builder: mozilla-inbound_ubuntu64_vm-debug_test-mochitest-devtools-chrome-8
slave: tst-linux64-spot-111
starttime: 1454440888.57
results: success (0)
buildid: 20160202102110
builduid: e50d7648750c46128db2d30913de6468
revision: 62d300c9c733163027e42d53ccd475671035a6d4
========= Started set props: master (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:28.567055) =========
master: http://buildbot-master114.bb.releng.use1.mozilla.com:8201/
========= Finished set props: master (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:28.567521) =========
========= Started set props: basedir (results: 0, elapsed: 1 secs) (at 2016-02-02 11:21:28.567829) =========
bash -c pwd
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['bash', '-c', 'pwd']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
/builds/slave/test
program finished with exit code 0
elapsedTime=0.023942
basedir: '/builds/slave/test'
========= master_lag: 1.12 =========
========= Finished set props: basedir (results: 0, elapsed: 1 secs) (at 2016-02-02 11:21:29.713807) =========
========= Started downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.714165) =========
========= Finished downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.759161) =========
========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.759452) =========
rm -rf properties
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['rm', '-rf', 'properties']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
program finished with exit code 0
elapsedTime=0.021209
========= master_lag: 0.04 =========
========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.824570) =========
========= Started set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.824891) =========
script_repo_url: https://hg.mozilla.org/build/mozharness
========= Finished set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.825286) =========
========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:29.825574) =========
bash -c 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py'
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['bash', '-c', 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
--2016-02-02 11:21:29-- https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py
Resolving hg.mozilla.org (hg.mozilla.org)... 63.245.215.25, 63.245.215.102
Connecting to hg.mozilla.org (hg.mozilla.org)|63.245.215.25|:443... connected.
HTTP request sent, awaiting response... 200 Script output follows
Length: 12141 (12K) [text/x-python]
Saving to: `archiver_client.py'
0K .......... . 100% 3.69M=0.003s
2016-02-02 11:21:30 (3.69 MB/s) - `archiver_client.py' saved [12141/12141]
program finished with exit code 0
elapsedTime=0.675368
========= master_lag: 0.04 =========
========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:30.537590) =========
========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:30.537929) =========
rm -rf scripts
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['rm', '-rf', 'scripts']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
program finished with exit code 0
elapsedTime=0.077477
========= master_lag: 0.04 =========
========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:30.650763) =========
========= Started 'bash -c ...' (results: 0, elapsed: 19 secs) (at 2016-02-02 11:21:30.651156) =========
bash -c 'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev 62d300c9c733163027e42d53ccd475671035a6d4 --destination scripts --debug'
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['bash', '-c', u'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev 62d300c9c733163027e42d53ccd475671035a6d4 --destination scripts --debug']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
2016-02-02 11:21:30,760 truncating revision to first 12 chars
2016-02-02 11:21:30,761 Setting DEBUG logging.
2016-02-02 11:21:30,761 attempt 1/10
2016-02-02 11:21:30,761 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/integration/mozilla-inbound/62d300c9c733?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness
2016-02-02 11:21:32,171 sleeping for 10.00s (attempt 1/10)
2016-02-02 11:21:42,182 attempt 2/10
2016-02-02 11:21:42,182 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/integration/mozilla-inbound/62d300c9c733?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness
2016-02-02 11:21:43,831 unpacking tar archive at: mozilla-inbound-62d300c9c733/testing/mozharness/
program finished with exit code 0
elapsedTime=13.622841
========= master_lag: 5.54 =========
========= Finished 'bash -c ...' (results: 0, elapsed: 19 secs) (at 2016-02-02 11:21:49.815271) =========
========= Started set props: script_repo_revision (results: 0, elapsed: 1 secs) (at 2016-02-02 11:21:49.815642) =========
echo 62d300c9c733163027e42d53ccd475671035a6d4
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['echo', u'62d300c9c733163027e42d53ccd475671035a6d4']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
62d300c9c733163027e42d53ccd475671035a6d4
program finished with exit code 0
elapsedTime=0.021595
script_repo_revision: '62d300c9c733163027e42d53ccd475671035a6d4'
========= master_lag: 1.58 =========
========= Finished set props: script_repo_revision (results: 0, elapsed: 1 secs) (at 2016-02-02 11:21:51.415590) =========
========= Started downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:51.415922) =========
========= Finished downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2016-02-02 11:21:51.799809) =========
========= Started '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 30 mins, 29 secs) (at 2016-02-02 11:21:51.800219) =========
/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 8 --blob-upload-branch mozilla-inbound --download-symbols true
in dir /builds/slave/test/. (timeout 1800 secs) (maxTime 4800 secs)
watching logfiles {}
argv: ['/tools/buildbot/bin/python', 'scripts/scripts/desktop_unittest.py', '--cfg', 'unittests/linux_unittest.py', '--mochitest-suite', 'mochitest-devtools-chrome-chunked', '--total-chunks', '8', '--this-chunk', '8', '--blob-upload-branch', 'mozilla-inbound', '--download-symbols', 'true']
environment:
CCACHE_DIR=/builds/ccache
CCACHE_UMASK=002
DISPLAY=:0
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
MOZ_HIDE_RESULTS_TABLE=1
MOZ_NODE_PATH=/usr/bin/node
MOZ_NO_REMOTE=1
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
NO_FAIL_ON_TEST_ERRORS=1
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PROPERTIES_FILE=/builds/slave/test/buildprops.json
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
11:21:52 INFO - MultiFileLogger online at 20160202 11:21:52 in /builds/slave/test
11:21:52 INFO - Run as scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 8 --blob-upload-branch mozilla-inbound --download-symbols true
11:21:52 INFO - Dumping config to /builds/slave/test/logs/localconfig.json.
11:21:52 INFO - {'all_cppunittest_suites': {'cppunittest': {'tests': ('tests/cppunittest',)}},
11:21:52 INFO - 'all_gtest_suites': {'gtest': ()},
11:21:52 INFO - 'all_jittest_suites': {'jittest': (),
11:21:52 INFO - 'jittest-chunked': (),
11:21:52 INFO - 'jittest1': ('--total-chunks=2', '--this-chunk=1'),
11:21:52 INFO - 'jittest2': ('--total-chunks=2', '--this-chunk=2')},
11:21:52 INFO - 'all_mochitest_suites': {'a11y': ('--a11y',),
11:21:52 INFO - 'browser-chrome': ('--browser-chrome',),
11:21:52 INFO - 'browser-chrome-addons': ('--browser-chrome',
11:21:52 INFO - '--chunk-by-runtime',
11:21:52 INFO - '--tag=addons'),
11:21:52 INFO - 'browser-chrome-chunked': ('--browser-chrome',
11:21:52 INFO - '--chunk-by-runtime'),
11:21:52 INFO - 'browser-chrome-coverage': ('--browser-chrome',
11:21:52 INFO - '--chunk-by-runtime',
11:21:52 INFO - '--timeout=1200'),
11:21:52 INFO - 'browser-chrome-screenshots': ('--browser-chrome',
11:21:52 INFO - '--subsuite=screenshots'),
11:21:52 INFO - 'chrome': ('--chrome',),
11:21:52 INFO - 'chrome-chunked': ('--chrome', '--chunk-by-dir=4'),
11:21:52 INFO - 'jetpack-addon': ('--jetpack-addon',),
11:21:52 INFO - 'jetpack-package': ('--jetpack-package',),
11:21:52 INFO - 'mochitest-devtools-chrome': ('--browser-chrome',
11:21:52 INFO - '--subsuite=devtools'),
11:21:52 INFO - 'mochitest-devtools-chrome-chunked': ('--browser-chrome',
11:21:52 INFO - '--subsuite=devtools',
11:21:52 INFO - '--chunk-by-runtime'),
11:21:52 INFO - 'mochitest-gl': ('--subsuite=webgl',),
11:21:52 INFO - 'mochitest-push': ('--subsuite=push',),
11:21:52 INFO - 'plain': (),
11:21:52 INFO - 'plain-chunked': ('--chunk-by-dir=4',)},
11:21:52 INFO - 'all_mozbase_suites': {'mozbase': ()},
11:21:52 INFO - 'all_reftest_suites': {'crashtest': {'options': ('--suite=crashtest',),
11:21:52 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)},
11:21:52 INFO - 'crashtest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1',
11:21:52 INFO - 'MOZ_OMTC_ENABLED': '1'},
11:21:52 INFO - 'options': ('--suite=crashtest',
11:21:52 INFO - '--setpref=browser.tabs.remote=true',
11:21:52 INFO - '--setpref=browser.tabs.remote.autostart=true',
11:21:52 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true',
11:21:52 INFO - '--setpref=layers.async-pan-zoom.enabled=true'),
11:21:52 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)},
11:21:52 INFO - 'jsreftest': {'options': ('--extra-profile-file=tests/jsreftest/tests/user.js',
11:21:52 INFO - '--suite=jstestbrowser'),
11:21:52 INFO - 'tests': ('tests/jsreftest/tests/jstests.list',)},
11:21:52 INFO - 'reftest': {'options': ('--suite=reftest',),
11:21:52 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)},
11:21:52 INFO - 'reftest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1',
11:21:52 INFO - 'MOZ_OMTC_ENABLED': '1'},
11:21:52 INFO - 'options': ('--suite=reftest',
11:21:52 INFO - '--setpref=browser.tabs.remote=true',
11:21:52 INFO - '--setpref=browser.tabs.remote.autostart=true',
11:21:52 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true',
11:21:52 INFO - '--setpref=layers.async-pan-zoom.enabled=true'),
11:21:52 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest-sanity/reftest.list',)},
11:21:52 INFO - 'reftest-no-accel': {'options': ('--suite=reftest',
11:21:52 INFO - '--setpref=layers.acceleration.force-enabled=disabled'),
11:21:52 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}},
11:21:52 INFO - 'all_webapprt_suites': {'chrome': ('--webapprt-chrome',
11:21:52 INFO - '--browser-arg=-test-mode'),
11:21:52 INFO - 'content': ('--webapprt-content',)},
11:21:52 INFO - 'all_xpcshell_suites': {'xpcshell': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell',
11:21:52 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'),
11:21:52 INFO - 'tests': ()},
11:21:52 INFO - 'xpcshell-addons': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell',
11:21:52 INFO - '--tag=addons',
11:21:52 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'),
11:21:52 INFO - 'tests': ()}},
11:21:52 INFO - 'append_to_log': False,
11:21:52 INFO - 'base_work_dir': '/builds/slave/test',
11:21:52 INFO - 'binary_path': '/builds/slave/test/build/firefox/firefox-bin',
11:21:52 INFO - 'blob_upload_branch': 'mozilla-inbound',
11:21:52 INFO - 'blob_uploader_auth_file': '/builds/slave/test/oauth.txt',
11:21:52 INFO - 'buildbot_json_path': 'buildprops.json',
11:21:52 INFO - 'buildbot_max_log_size': 52428800,
11:21:52 INFO - 'code_coverage': False,
11:21:52 INFO - 'config_files': ('unittests/linux_unittest.py',),
11:21:52 INFO - 'default_blob_upload_servers': ('https://blobupload.elasticbeanstalk.com',),
11:21:52 INFO - 'download_minidump_stackwalk': True,
11:21:52 INFO - 'download_symbols': 'true',
11:21:52 INFO - 'e10s': False,
11:21:52 INFO - 'exe_suffix': '',
11:21:52 INFO - 'exes': {'python': '/tools/buildbot/bin/python',
11:21:52 INFO - 'tooltool.py': '/tools/tooltool.py',
11:21:52 INFO - 'virtualenv': ('/tools/buildbot/bin/python',
11:21:52 INFO - '/tools/misc-python/virtualenv.py')},
11:21:52 INFO - 'find_links': ('http://pypi.pvt.build.mozilla.org/pub',
11:21:52 INFO - 'http://pypi.pub.build.mozilla.org/pub'),
11:21:52 INFO - 'installer_path': '/builds/slave/test/build/installer.tar.bz2',
11:21:52 INFO - 'log_level': 'info',
11:21:52 INFO - 'log_to_console': True,
11:21:52 INFO - 'minidump_save_path': '%(abs_work_dir)s/../minidumps',
11:21:52 INFO - 'minidump_stackwalk_path': 'linux64-minidump_stackwalk',
11:21:52 INFO - 'minidump_tooltool_manifest_path': 'config/tooltool-manifests/linux64/releng.manifest',
11:21:52 INFO - 'minimum_tests_zip_dirs': ('bin/*',
11:21:52 INFO - 'certs/*',
11:21:52 INFO - 'config/*',
11:21:52 INFO - 'marionette/*',
11:21:52 INFO - 'modules/*',
11:21:52 INFO - 'mozbase/*',
11:21:52 INFO - 'tools/*'),
11:21:52 INFO - 'no_random': False,
11:21:52 INFO - 'opt_config_files': (),
11:21:52 INFO - 'pip_index': False,
11:21:52 INFO - 'preflight_run_cmd_suites': ({'architectures': ('32bit', '64bit'),
11:21:52 INFO - 'cmd': ('xset', 's', 'off', 's', 'reset'),
11:21:52 INFO - 'enabled': True,
11:21:52 INFO - 'halt_on_failure': False,
11:21:52 INFO - 'name': 'disable_screen_saver'},
11:21:52 INFO - {'architectures': ('32bit',),
11:21:52 INFO - 'cmd': ('python',
11:21:52 INFO - '../scripts/external_tools/mouse_and_screen_resolution.py',
11:21:52 INFO - '--configuration-url',
11:21:52 INFO - 'https://hg.mozilla.org/%(branch)s/raw-file/%(revision)s/testing/machine-configuration.json'),
11:21:52 INFO - 'enabled': False,
11:21:52 INFO - 'halt_on_failure': True,
11:21:52 INFO - 'name': 'run mouse & screen adjustment script'}),
11:21:52 INFO - 'require_test_zip': True,
11:21:52 INFO - 'run_all_suites': False,
11:21:52 INFO - 'run_cmd_checks_enabled': True,
11:21:52 INFO - 'run_file_names': {'cppunittest': 'runcppunittests.py',
11:21:52 INFO - 'gtest': 'rungtests.py',
11:21:52 INFO - 'jittest': 'jit_test.py',
11:21:52 INFO - 'mochitest': 'runtests.py',
11:21:52 INFO - 'mozbase': 'test.py',
11:21:52 INFO - 'mozmill': 'runtestlist.py',
11:21:52 INFO - 'reftest': 'runreftest.py',
11:21:52 INFO - 'webapprt': 'runtests.py',
11:21:52 INFO - 'xpcshell': 'runxpcshelltests.py'},
11:21:52 INFO - 'specific_tests_zip_dirs': {'cppunittest': ('cppunittest/*',),
11:21:52 INFO - 'gtest': ('gtest/*',),
11:21:52 INFO - 'jittest': ('jit-test/*',),
11:21:52 INFO - 'mochitest': ('mochitest/*',),
11:21:52 INFO - 'mozbase': ('mozbase/*',),
11:21:52 INFO - 'mozmill': ('mozmill/*',),
11:21:52 INFO - 'reftest': ('reftest/*', 'jsreftest/*'),
11:21:52 INFO - 'webapprt': ('mochitest/*',),
11:21:52 INFO - 'xpcshell': ('xpcshell/*',)},
11:21:52 INFO - 'specified_mochitest_suites': ('mochitest-devtools-chrome-chunked',),
11:21:52 INFO - 'strict_content_sandbox': False,
11:21:52 INFO - 'suite_definitions': {'cppunittest': {'options': ('--symbols-path=%(symbols_path)s',
11:21:52 INFO - '--xre-path=%(abs_app_dir)s'),
11:21:52 INFO - 'run_filename': 'runcppunittests.py',
11:21:52 INFO - 'testsdir': 'cppunittest'},
11:21:52 INFO - 'gtest': {'options': ('--xre-path=%(abs_res_dir)s',
11:21:52 INFO - '--cwd=%(gtest_dir)s',
11:21:52 INFO - '--symbols-path=%(symbols_path)s',
11:21:52 INFO - '--utility-path=tests/bin',
11:21:52 INFO - '%(binary_path)s'),
11:21:52 INFO - 'run_filename': 'rungtests.py'},
11:21:52 INFO - 'jittest': {'options': ('tests/bin/js',
11:21:52 INFO - '--no-slow',
11:21:52 INFO - '--no-progress',
11:21:52 INFO - '--format=automation',
11:21:52 INFO - '--jitflags=all'),
11:21:52 INFO - 'run_filename': 'jit_test.py',
11:21:52 INFO - 'testsdir': 'jit-test/jit-test'},
11:21:52 INFO - 'luciddream-b2gdt': {'options': ('--startup-timeout=300',
11:21:52 INFO - '--log-raw=%(raw_log_file)s',
11:21:52 INFO - '--log-errorsummary=%(error_summary_file)s',
11:21:52 INFO - '--browser-path=%(browser_path)s',
11:21:52 INFO - '--b2g-desktop-path=%(fxos_desktop_path)s',
11:21:52 INFO - '--gaia-profile=%(gaia_profile)s',
11:21:52 INFO - '%(test_manifest)s')},
11:21:52 INFO - 'luciddream-emulator': {'options': ('--startup-timeout=300',
11:21:52 INFO - '--log-raw=%(raw_log_file)s',
11:21:52 INFO - '--log-errorsummary=%(error_summary_file)s',
11:21:52 INFO - '--browser-path=%(browser_path)s',
11:21:52 INFO - '--b2gpath=%(emulator_path)s',
11:21:52 INFO - '%(test_manifest)s')},
11:21:52 INFO - 'mochitest': {'options': ('--appname=%(binary_path)s',
11:21:52 INFO - '--utility-path=tests/bin',
11:21:52 INFO - '--extra-profile-file=tests/bin/plugins',
11:21:52 INFO - '--symbols-path=%(symbols_path)s',
11:21:52 INFO - '--certificate-path=tests/certs',
11:21:52 INFO - '--setpref=webgl.force-enabled=true',
11:21:52 INFO - '--quiet',
11:21:52 INFO - '--log-raw=%(raw_log_file)s',
11:21:52 INFO - '--log-errorsummary=%(error_summary_file)s',
11:21:52 INFO - '--use-test-media-devices',
11:21:52 INFO - '--screenshot-on-fail'),
11:21:52 INFO - 'run_filename': 'runtests.py',
11:21:52 INFO - 'testsdir': 'mochitest'},
11:21:52 INFO - 'mozbase': {'options': ('-b', '%(binary_path)s'),
11:21:52 INFO - 'run_filename': 'test.py',
11:21:52 INFO - 'testsdir': 'mozbase'},
11:21:52 INFO - 'mozmill': {'options': ('--binary=%(binary_path)s',
11:21:52 INFO - '--testing-modules-dir=test/modules',
11:21:52 INFO - '--symbols-path=%(symbols_path)s'),
11:21:52 INFO - 'run_filename': 'runtestlist.py',
11:21:52 INFO - 'testsdir': 'mozmill'},
11:21:52 INFO - 'reftest': {'options': ('--appname=%(binary_path)s',
11:21:52 INFO - '--utility-path=tests/bin',
11:21:52 INFO - '--extra-profile-file=tests/bin/plugins',
11:21:52 INFO - '--symbols-path=%(symbols_path)s'),
11:21:52 INFO - 'run_filename': 'runreftest.py',
11:21:52 INFO - 'testsdir': 'reftest'},
11:21:52 INFO - 'webapprt': {'options': ('--app=%(app_path)s',
11:21:52 INFO - '--utility-path=tests/bin',
11:21:52 INFO - '--extra-profile-file=tests/bin/plugins',
11:21:52 INFO - '--symbols-path=%(symbols_path)s',
11:21:52 INFO - '--certificate-path=tests/certs',
11:21:52 INFO - '--console-level=INFO',
11:21:52 INFO - '--testing-modules-dir=tests/modules',
11:21:52 INFO - '--quiet'),
11:21:52 INFO - 'run_filename': 'runtests.py',
11:21:52 INFO - 'testsdir': 'mochitest'},
11:21:52 INFO - 'xpcshell': {'options': ('--symbols-path=%(symbols_path)s',
11:21:52 INFO - '--test-plugin-path=%(test_plugin_path)s',
11:21:52 INFO - '--log-raw=%(raw_log_file)s',
11:21:52 INFO - '--log-errorsummary=%(error_summary_file)s',
11:21:52 INFO - '--utility-path=tests/bin'),
11:21:52 INFO - 'run_filename': 'runxpcshelltests.py',
11:21:52 INFO - 'testsdir': 'xpcshell'}},
11:21:52 INFO - 'this_chunk': '8',
11:21:52 INFO - 'tooltool_cache': '/builds/tooltool_cache',
11:21:52 INFO - 'total_chunks': '8',
11:21:52 INFO - 'vcs_output_timeout': 1000,
11:21:52 INFO - 'virtualenv_path': 'venv',
11:21:52 INFO - 'volatile_config': {'actions': None, 'add_actions': None, 'no_actions': None},
11:21:52 INFO - 'work_dir': 'build',
11:21:52 INFO - 'xpcshell_name': 'xpcshell'}
11:21:52 INFO - #####
11:21:52 INFO - ##### Running clobber step.
11:21:52 INFO - #####
11:21:52 INFO - Running pre-action listener: _resource_record_pre_action
11:21:52 INFO - Running main action method: clobber
11:21:52 INFO - rmtree: /builds/slave/test/build
11:21:52 INFO - retry: Calling rmtree with args: ('/builds/slave/test/build',), kwargs: {}, attempt #1
11:21:54 INFO - Running post-action listener: _resource_record_post_action
11:21:54 INFO - #####
11:21:54 INFO - ##### Running read-buildbot-config step.
11:21:54 INFO - #####
11:21:54 INFO - Running pre-action listener: _resource_record_pre_action
11:21:54 INFO - Running main action method: read_buildbot_config
11:21:54 INFO - Using buildbot properties:
11:21:54 INFO - {
11:21:54 INFO - "project": "",
11:21:54 INFO - "product": "firefox",
11:21:54 INFO - "script_repo_revision": "production",
11:21:54 INFO - "scheduler": "tests-mozilla-inbound-ubuntu64_vm-debug-unittest-7-3600",
11:21:54 INFO - "repository": "",
11:21:54 INFO - "buildername": "Ubuntu VM 12.04 x64 mozilla-inbound debug test mochitest-devtools-chrome-8",
11:21:54 INFO - "buildid": "20160202102110",
11:21:54 INFO - "pgo_build": "False",
11:21:54 INFO - "basedir": "/builds/slave/test",
11:21:54 INFO - "buildnumber": 64,
11:21:54 INFO - "slavename": "tst-linux64-spot-111",
11:21:54 INFO - "master": "http://buildbot-master114.bb.releng.use1.mozilla.com:8201/",
11:21:54 INFO - "platform": "linux64",
11:21:54 INFO - "branch": "mozilla-inbound",
11:21:54 INFO - "revision": "62d300c9c733163027e42d53ccd475671035a6d4",
11:21:54 INFO - "repo_path": "integration/mozilla-inbound",
11:21:54 INFO - "moz_repo_path": "",
11:21:54 INFO - "stage_platform": "linux64",
11:21:54 INFO - "builduid": "e50d7648750c46128db2d30913de6468",
11:21:54 INFO - "slavebuilddir": "test"
11:21:54 INFO - }
11:21:54 INFO - Found installer url https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2.
11:21:54 INFO - Found a test packages url https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json.
11:21:54 INFO - Running post-action listener: _resource_record_post_action
11:21:54 INFO - #####
11:21:54 INFO - ##### Running download-and-extract step.
11:21:54 INFO - #####
11:21:54 INFO - Running pre-action listener: _resource_record_pre_action
11:21:54 INFO - Running main action method: download_and_extract
11:21:54 INFO - mkdir: /builds/slave/test/build/tests
11:21:54 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:21:54 INFO - https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json matches https://queue.taskcluster.net
11:21:54 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json
11:21:54 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json
11:21:54 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json to /builds/slave/test/build/test_packages.json
11:21:54 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/test_packages.json', 'file_name': '/builds/slave/test/build/test_packages.json'}, attempt #1
11:21:56 INFO - Downloaded 1448 bytes.
11:21:56 INFO - Reading from file /builds/slave/test/build/test_packages.json
11:21:56 INFO - Using the following test package requirements:
11:21:56 INFO - {u'common': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip'],
11:21:56 INFO - u'cppunittest': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.cppunittest.tests.zip'],
11:21:56 INFO - u'gtest': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.gtest.tests.zip'],
11:21:56 INFO - u'jittest': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'jsshell-linux-x86_64.zip'],
11:21:56 INFO - u'mochitest': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip'],
11:21:56 INFO - u'mozbase': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip'],
11:21:56 INFO - u'reftest': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.reftest.tests.zip'],
11:21:56 INFO - u'talos': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.talos.tests.zip'],
11:21:56 INFO - u'web-platform': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.web-platform.tests.zip'],
11:21:56 INFO - u'webapprt': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip'],
11:21:56 INFO - u'xpcshell': [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip',
11:21:56 INFO - u'firefox-47.0a1.en-US.linux-x86_64.xpcshell.tests.zip']}
11:21:56 INFO - Downloading packages: [u'firefox-47.0a1.en-US.linux-x86_64.common.tests.zip', u'firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip'] for test suite category: mochitest
11:21:56 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:21:56 INFO - https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip matches https://queue.taskcluster.net
11:21:56 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip
11:21:56 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip
11:21:56 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip to /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip
11:21:56 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip'}, attempt #1
11:21:59 INFO - Downloaded 22151815 bytes.
11:21:59 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip', '-d', '/builds/slave/test/build/tests', 'bin/*', 'certs/*', 'config/*', 'marionette/*', 'modules/*', 'mozbase/*', 'tools/*', 'mochitest/*']
11:21:59 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.common.tests.zip -d /builds/slave/test/build/tests bin/* certs/* config/* marionette/* modules/* mozbase/* tools/* mochitest/*
11:22:00 INFO - caution: filename not matched: mochitest/*
11:22:00 INFO - Return code: 11
11:22:00 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:00 INFO - https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip matches https://queue.taskcluster.net
11:22:00 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip
11:22:00 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip
11:22:00 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip to /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip
11:22:00 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip'}, attempt #1
11:22:06 INFO - Downloaded 62750345 bytes.
11:22:06 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip', '-d', '/builds/slave/test/build/tests', 'bin/*', 'certs/*', 'config/*', 'marionette/*', 'modules/*', 'mozbase/*', 'tools/*', 'mochitest/*']
11:22:06 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.mochitest.tests.zip -d /builds/slave/test/build/tests bin/* certs/* config/* marionette/* modules/* mozbase/* tools/* mochitest/*
11:22:10 INFO - caution: filename not matched: bin/*
11:22:10 INFO - caution: filename not matched: certs/*
11:22:10 INFO - caution: filename not matched: config/*
11:22:10 INFO - caution: filename not matched: marionette/*
11:22:10 INFO - caution: filename not matched: modules/*
11:22:10 INFO - caution: filename not matched: mozbase/*
11:22:10 INFO - caution: filename not matched: tools/*
11:22:10 INFO - Return code: 11
11:22:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:10 INFO - https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2 matches https://queue.taskcluster.net
11:22:10 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2
11:22:10 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2
11:22:10 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2 to /builds/slave/test/build/installer.tar.bz2
11:22:10 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2', 'file_name': '/builds/slave/test/build/installer.tar.bz2'}, attempt #1
11:22:15 INFO - Downloaded 55862019 bytes.
11:22:15 INFO - Setting buildbot property build_url to https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2
11:22:15 INFO - mkdir: /builds/slave/test/properties
11:22:15 INFO - Writing buildbot properties ['build_url'] to /builds/slave/test/properties/build_url
11:22:15 INFO - Writing to file /builds/slave/test/properties/build_url
11:22:15 INFO - Contents:
11:22:15 INFO - build_url:https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2
11:22:17 INFO - Setting buildbot property symbols_url to https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
11:22:17 INFO - Writing buildbot properties ['symbols_url'] to /builds/slave/test/properties/symbols_url
11:22:17 INFO - Writing to file /builds/slave/test/properties/symbols_url
11:22:17 INFO - Contents:
11:22:17 INFO - symbols_url:https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
11:22:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:17 INFO - https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip matches https://queue.taskcluster.net
11:22:17 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
11:22:17 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
11:22:17 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip to /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
11:22:17 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip', 'file_name': '/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'}, attempt #1
11:22:20 INFO - Downloaded 91293322 bytes.
11:22:20 INFO - Running command: ['unzip', '-q', '-o', '/builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip', '-d', '/builds/slave/test/build/symbols']
11:22:20 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip -d /builds/slave/test/build/symbols
11:22:26 INFO - Return code: 0
11:22:26 INFO - Running post-action listener: _resource_record_post_action
11:22:26 INFO - Running post-action listener: set_extra_try_arguments
11:22:26 INFO - #####
11:22:26 INFO - ##### Running create-virtualenv step.
11:22:26 INFO - #####
11:22:26 INFO - Running pre-action listener: _install_mozbase
11:22:26 INFO - Running pre-action listener: _pre_create_virtualenv
11:22:26 INFO - Running pre-action listener: _resource_record_pre_action
11:22:26 INFO - Running main action method: create_virtualenv
11:22:26 INFO - Creating virtualenv /builds/slave/test/build/venv
11:22:26 INFO - Running command: ['/tools/buildbot/bin/python', '/tools/misc-python/virtualenv.py', '--no-site-packages', '--distribute', '/builds/slave/test/build/venv'] in /builds/slave/test/build
11:22:26 INFO - Copy/paste: /tools/buildbot/bin/python /tools/misc-python/virtualenv.py --no-site-packages --distribute /builds/slave/test/build/venv
11:22:26 INFO - The --no-site-packages flag is deprecated; it is now the default behavior.
11:22:26 INFO - Using real prefix '/usr'
11:22:26 INFO - New python executable in /builds/slave/test/build/venv/bin/python
11:22:30 INFO - Installing distribute.............................................................................................................................................................................................done.
11:22:34 INFO - Installing pip.................done.
11:22:34 INFO - Return code: 0
11:22:34 INFO - Installing psutil>=0.7.1 into virtualenv /builds/slave/test/build/venv
11:22:34 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:34 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:22:34 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:34 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:34 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:22:34 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:34 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:22:34 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1'] in /builds/slave/test/build
11:22:34 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil>=0.7.1
11:22:34 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:22:34 INFO - 'CCACHE_UMASK': '002',
11:22:34 INFO - 'DISPLAY': ':0',
11:22:34 INFO - 'HOME': '/home/cltbld',
11:22:34 INFO - 'LANG': 'en_US.UTF-8',
11:22:34 INFO - 'LOGNAME': 'cltbld',
11:22:34 INFO - 'MAIL': '/var/mail/cltbld',
11:22:34 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:22:34 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:22:34 INFO - 'MOZ_NO_REMOTE': '1',
11:22:34 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:22:34 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:22:34 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:22:34 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:22:34 INFO - 'PWD': '/builds/slave/test',
11:22:34 INFO - 'SHELL': '/bin/bash',
11:22:34 INFO - 'SHLVL': '1',
11:22:34 INFO - 'TERM': 'linux',
11:22:34 INFO - 'TMOUT': '86400',
11:22:34 INFO - 'USER': 'cltbld',
11:22:34 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:22:34 INFO - '_': '/tools/buildbot/bin/python'}
11:22:34 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:22:34 INFO - Downloading/unpacking psutil>=0.7.1
11:22:34 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:34 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:34 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:34 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:34 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:34 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:39 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/psutil/setup.py) egg_info for package psutil
11:22:39 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build'
11:22:39 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects
...
11:22:40 INFO - Installing collected packages: psutil
11:22:40 INFO - Running setup.py install for psutil
11:22:40 INFO - building 'psutil._psutil_linux' extension
11:22:40 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -DPSUTIL_VERSION=311 -I/usr/include/python2.7 -c psutil/_psutil_linux.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o
11:22:40 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_linux.so
11:22:40 INFO - building 'psutil._psutil_posix' extension
11:22:40 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c psutil/_psutil_posix.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o
11:22:41 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_posix.so
11:22:41 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build'
11:22:41 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ...
11:22:41 INFO - Successfully installed psutil
11:22:41 INFO - Cleaning up...
11:22:41 INFO - Return code: 0
11:22:41 INFO - Installing mozsystemmonitor==0.0.0 into virtualenv /builds/slave/test/build/venv
11:22:41 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:41 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:22:41 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:41 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:41 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:22:41 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:41 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:22:41 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0'] in /builds/slave/test/build
11:22:41 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mozsystemmonitor==0.0.0
11:22:41 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:22:41 INFO - 'CCACHE_UMASK': '002',
11:22:41 INFO - 'DISPLAY': ':0',
11:22:41 INFO - 'HOME': '/home/cltbld',
11:22:41 INFO - 'LANG': 'en_US.UTF-8',
11:22:41 INFO - 'LOGNAME': 'cltbld',
11:22:41 INFO - 'MAIL': '/var/mail/cltbld',
11:22:41 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:22:41 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:22:41 INFO - 'MOZ_NO_REMOTE': '1',
11:22:41 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:22:41 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:22:41 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:22:41 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:22:41 INFO - 'PWD': '/builds/slave/test',
11:22:41 INFO - 'SHELL': '/bin/bash',
11:22:41 INFO - 'SHLVL': '1',
11:22:41 INFO - 'TERM': 'linux',
11:22:41 INFO - 'TMOUT': '86400',
11:22:41 INFO - 'USER': 'cltbld',
11:22:41 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:22:41 INFO - '_': '/tools/buildbot/bin/python'}
11:22:41 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:22:41 INFO - Downloading/unpacking mozsystemmonitor==0.0.0
11:22:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:41 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:41 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:46 INFO - Downloading mozsystemmonitor-0.0.tar.gz
11:22:46 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mozsystemmonitor/setup.py) egg_info for package mozsystemmonitor
11:22:46 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil>=0.7.1 in ./venv/lib/python2.7/site-packages (from mozsystemmonitor==0.0.0)
11:22:46 INFO - Installing collected packages: mozsystemmonitor
11:22:46 INFO - Running setup.py install for mozsystemmonitor
11:22:46 INFO - Successfully installed mozsystemmonitor
11:22:46 INFO - Cleaning up...
11:22:47 INFO - Return code: 0
11:22:47 INFO - Installing blobuploader==1.2.4 into virtualenv /builds/slave/test/build/venv
11:22:47 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:47 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:22:47 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:47 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:47 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:22:47 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:47 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:22:47 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4'] in /builds/slave/test/build
11:22:47 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub blobuploader==1.2.4
11:22:47 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:22:47 INFO - 'CCACHE_UMASK': '002',
11:22:47 INFO - 'DISPLAY': ':0',
11:22:47 INFO - 'HOME': '/home/cltbld',
11:22:47 INFO - 'LANG': 'en_US.UTF-8',
11:22:47 INFO - 'LOGNAME': 'cltbld',
11:22:47 INFO - 'MAIL': '/var/mail/cltbld',
11:22:47 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:22:47 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:22:47 INFO - 'MOZ_NO_REMOTE': '1',
11:22:47 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:22:47 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:22:47 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:22:47 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:22:47 INFO - 'PWD': '/builds/slave/test',
11:22:47 INFO - 'SHELL': '/bin/bash',
11:22:47 INFO - 'SHLVL': '1',
11:22:47 INFO - 'TERM': 'linux',
11:22:47 INFO - 'TMOUT': '86400',
11:22:47 INFO - 'USER': 'cltbld',
11:22:47 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:22:47 INFO - '_': '/tools/buildbot/bin/python'}
11:22:47 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:22:47 INFO - Downloading/unpacking blobuploader==1.2.4
11:22:47 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:47 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:47 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:47 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:47 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:47 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:52 INFO - Downloading blobuploader-1.2.4.tar.gz
11:22:52 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blobuploader/setup.py) egg_info for package blobuploader
11:22:52 INFO - Downloading/unpacking requests==1.2.3. (from blobuploader==1.2.4)
11:22:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:52 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:52 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:53 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/requests/setup.py) egg_info for package requests
11:22:53 INFO - Downloading/unpacking docopt==0.6.1 (from blobuploader==1.2.4)
11:22:53 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:53 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:53 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:53 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:22:53 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:22:53 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:22:54 INFO - Downloading docopt-0.6.1.tar.gz
11:22:54 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/docopt/setup.py) egg_info for package docopt
11:22:54 INFO - Installing collected packages: blobuploader, requests, docopt
11:22:54 INFO - Running setup.py install for blobuploader
11:22:54 INFO - changing mode of build/scripts-2.7/blobberc.py from 664 to 775
11:22:54 INFO - changing mode of /builds/slave/test/build/venv/bin/blobberc.py to 775
11:22:54 INFO - Running setup.py install for requests
11:22:55 INFO - Running setup.py install for docopt
11:22:55 INFO - Successfully installed blobuploader requests docopt
11:22:55 INFO - Cleaning up...
11:22:55 INFO - Return code: 0
11:22:55 INFO - Installing None into virtualenv /builds/slave/test/build/venv
11:22:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:55 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:22:55 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:22:55 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:22:55 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:22:55 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:22:55 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config
11:22:55 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub
11:22:55 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:22:55 INFO - 'CCACHE_UMASK': '002',
11:22:55 INFO - 'DISPLAY': ':0',
11:22:55 INFO - 'HOME': '/home/cltbld',
11:22:55 INFO - 'LANG': 'en_US.UTF-8',
11:22:55 INFO - 'LOGNAME': 'cltbld',
11:22:55 INFO - 'MAIL': '/var/mail/cltbld',
11:22:55 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:22:55 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:22:55 INFO - 'MOZ_NO_REMOTE': '1',
11:22:55 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:22:55 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:22:55 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:22:55 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:22:55 INFO - 'PWD': '/builds/slave/test',
11:22:55 INFO - 'SHELL': '/bin/bash',
11:22:55 INFO - 'SHLVL': '1',
11:22:55 INFO - 'TERM': 'linux',
11:22:55 INFO - 'TMOUT': '86400',
11:22:55 INFO - 'USER': 'cltbld',
11:22:55 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:22:55 INFO - '_': '/tools/buildbot/bin/python'}
11:22:56 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser
11:22:56 INFO - Running setup.py (path:/tmp/pip-EymRsS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash
11:22:56 INFO - Running setup.py (path:/tmp/pip-vuUOFR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug
11:22:56 INFO - Running setup.py (path:/tmp/pip-grxgtl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice
11:22:56 INFO - Running setup.py (path:/tmp/pip-AFs4mu-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile
11:22:56 INFO - Running setup.py (path:/tmp/pip-qsYgBT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd
11:22:56 INFO - Running setup.py (path:/tmp/pip-RuPcmP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd
11:22:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo
11:22:56 INFO - Running setup.py (path:/tmp/pip-5qDAai-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall
11:22:57 INFO - Running setup.py (path:/tmp/pip-P99iJq-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak
11:22:57 INFO - Running setup.py (path:/tmp/pip-3pZc3y-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog
11:22:57 INFO - Running setup.py (path:/tmp/pip-NpdJOV-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork
11:22:57 INFO - Running setup.py (path:/tmp/pip-revHKw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess
11:22:57 INFO - Running setup.py (path:/tmp/pip-6xSDPW-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile
11:22:57 INFO - Running setup.py (path:/tmp/pip-yxk8Mo-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner
11:22:57 INFO - Running setup.py (path:/tmp/pip-rvpnvm-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner
11:22:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot
11:22:57 INFO - Running setup.py (path:/tmp/pip-LYYDf5-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot
11:22:58 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest
11:22:58 INFO - Running setup.py (path:/tmp/pip-qEpyjS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest
11:22:58 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion
11:22:58 INFO - Running setup.py (path:/tmp/pip-fK9fxy-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion
11:22:58 INFO - Installing collected packages: manifestparser, mozcrash, mozdebug, mozdevice, mozfile, mozhttpd, mozinfo, mozInstall, mozleak, mozlog, moznetwork, mozprocess, mozprofile, mozrunner, mozscreenshot, moztest, mozversion
11:22:58 INFO - Running setup.py install for manifestparser
11:22:58 INFO - Installing manifestparser script to /builds/slave/test/build/venv/bin
11:22:58 INFO - Running setup.py install for mozcrash
11:22:58 INFO - Running setup.py install for mozdebug
11:22:58 INFO - Running setup.py install for mozdevice
11:22:59 INFO - Installing sutini script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Installing dm script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Running setup.py install for mozfile
11:22:59 INFO - Running setup.py install for mozhttpd
11:22:59 INFO - Installing mozhttpd script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Running setup.py install for mozinfo
11:22:59 INFO - Installing mozinfo script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Running setup.py install for mozInstall
11:22:59 INFO - Installing moz_remove_from_system script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Installing mozuninstall script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Installing mozinstall script to /builds/slave/test/build/venv/bin
11:22:59 INFO - Installing moz_add_to_system script to /builds/slave/test/build/venv/bin
11:23:00 INFO - Running setup.py install for mozleak
11:23:00 INFO - Running setup.py install for mozlog
11:23:00 INFO - Installing structlog script to /builds/slave/test/build/venv/bin
11:23:00 INFO - Running setup.py install for moznetwork
11:23:00 INFO - Installing moznetwork script to /builds/slave/test/build/venv/bin
11:23:00 INFO - Running setup.py install for mozprocess
11:23:00 INFO - Running setup.py install for mozprofile
11:23:01 INFO - Installing mozprofile script to /builds/slave/test/build/venv/bin
11:23:01 INFO - Installing diff-profiles script to /builds/slave/test/build/venv/bin
11:23:01 INFO - Installing view-profile script to /builds/slave/test/build/venv/bin
11:23:01 INFO - Running setup.py install for mozrunner
11:23:01 INFO - Installing mozrunner script to /builds/slave/test/build/venv/bin
11:23:01 INFO - Running setup.py install for mozscreenshot
11:23:01 INFO - Running setup.py install for moztest
11:23:01 INFO - Running setup.py install for mozversion
11:23:01 INFO - Installing mozversion script to /builds/slave/test/build/venv/bin
11:23:01 INFO - Successfully installed manifestparser mozcrash mozdebug mozdevice mozfile mozhttpd mozinfo mozInstall mozleak mozlog moznetwork mozprocess mozprofile mozrunner mozscreenshot moztest mozversion
11:23:01 INFO - Cleaning up...
11:23:02 INFO - Return code: 0
11:23:02 INFO - Installing None into virtualenv /builds/slave/test/build/venv
11:23:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:02 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:02 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:02 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:02 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:02 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:02 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config
11:23:02 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub
11:23:02 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:02 INFO - 'CCACHE_UMASK': '002',
11:23:02 INFO - 'DISPLAY': ':0',
11:23:02 INFO - 'HOME': '/home/cltbld',
11:23:02 INFO - 'LANG': 'en_US.UTF-8',
11:23:02 INFO - 'LOGNAME': 'cltbld',
11:23:02 INFO - 'MAIL': '/var/mail/cltbld',
11:23:02 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:02 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:02 INFO - 'MOZ_NO_REMOTE': '1',
11:23:02 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:02 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:02 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:02 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:02 INFO - 'PWD': '/builds/slave/test',
11:23:02 INFO - 'SHELL': '/bin/bash',
11:23:02 INFO - 'SHLVL': '1',
11:23:02 INFO - 'TERM': 'linux',
11:23:02 INFO - 'TMOUT': '86400',
11:23:02 INFO - 'USER': 'cltbld',
11:23:02 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:02 INFO - '_': '/tools/buildbot/bin/python'}
11:23:02 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser
11:23:02 INFO - Running setup.py (path:/tmp/pip-JGqc0f-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser
11:23:02 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1))
11:23:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash
11:23:02 INFO - Running setup.py (path:/tmp/pip-2LlbuM-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash
11:23:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug
11:23:02 INFO - Running setup.py (path:/tmp/pip-GsLxM6-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug
11:23:02 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3))
11:23:02 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice
11:23:02 INFO - Running setup.py (path:/tmp/pip-gjndqx-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.48 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile
11:23:03 INFO - Running setup.py (path:/tmp/pip-XDvyUp-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd
11:23:03 INFO - Running setup.py (path:/tmp/pip-StDV9J-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo
11:23:03 INFO - Running setup.py (path:/tmp/pip-tDeFFE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall
11:23:03 INFO - Running setup.py (path:/tmp/pip-i9Kp5R-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak
11:23:03 INFO - Running setup.py (path:/tmp/pip-ajfxNi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog
11:23:03 INFO - Running setup.py (path:/tmp/pip-3ZKOsY-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog
11:23:03 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10))
11:23:03 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork
11:23:03 INFO - Running setup.py (path:/tmp/pip-ClCptH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess
11:23:04 INFO - Running setup.py (path:/tmp/pip-uQwaka-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile
11:23:04 INFO - Running setup.py (path:/tmp/pip-sC8tnM-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner
11:23:04 INFO - Running setup.py (path:/tmp/pip-mOtU3s-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:04 INFO - Running setup.py (path:/tmp/pip-Hgo4dE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest
11:23:04 INFO - Running setup.py (path:/tmp/pip-IInoqG-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16))
11:23:04 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion
11:23:04 INFO - Running setup.py (path:/tmp/pip-xQaxtS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17))
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3))
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.48->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:04 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.48->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:04 INFO - Downloading/unpacking blessings>=1.3 (from mozlog==3.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10))
11:23:04 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:04 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:04 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:04 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:04 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:04 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:09 INFO - Downloading blessings-1.6.tar.gz
11:23:09 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blessings/setup.py) egg_info for package blessings
11:23:10 INFO - Installing collected packages: blessings
11:23:10 INFO - Running setup.py install for blessings
11:23:10 INFO - Successfully installed blessings
11:23:10 INFO - Cleaning up...
11:23:10 INFO - Return code: 0
11:23:10 INFO - Installing pip>=1.5 into virtualenv /builds/slave/test/build/venv
11:23:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:10 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:10 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:10 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:10 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:10 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:10 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5'] in /builds/slave/test/build
11:23:10 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub pip>=1.5
11:23:10 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:10 INFO - 'CCACHE_UMASK': '002',
11:23:10 INFO - 'DISPLAY': ':0',
11:23:10 INFO - 'HOME': '/home/cltbld',
11:23:10 INFO - 'LANG': 'en_US.UTF-8',
11:23:10 INFO - 'LOGNAME': 'cltbld',
11:23:10 INFO - 'MAIL': '/var/mail/cltbld',
11:23:10 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:10 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:10 INFO - 'MOZ_NO_REMOTE': '1',
11:23:10 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:10 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:10 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:10 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:10 INFO - 'PWD': '/builds/slave/test',
11:23:10 INFO - 'SHELL': '/bin/bash',
11:23:10 INFO - 'SHLVL': '1',
11:23:10 INFO - 'TERM': 'linux',
11:23:10 INFO - 'TMOUT': '86400',
11:23:10 INFO - 'USER': 'cltbld',
11:23:10 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:10 INFO - '_': '/tools/buildbot/bin/python'}
11:23:10 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:10 INFO - Requirement already satisfied (use --upgrade to upgrade): pip>=1.5 in ./venv/lib/python2.7/site-packages/pip-1.5.5-py2.7.egg
11:23:10 INFO - Cleaning up...
11:23:10 INFO - Return code: 0
11:23:10 INFO - Installing psutil==3.1.1 into virtualenv /builds/slave/test/build/venv
11:23:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:10 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:10 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:10 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:10 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:10 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:10 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:10 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1'] in /builds/slave/test/build
11:23:10 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil==3.1.1
11:23:10 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:10 INFO - 'CCACHE_UMASK': '002',
11:23:10 INFO - 'DISPLAY': ':0',
11:23:10 INFO - 'HOME': '/home/cltbld',
11:23:10 INFO - 'LANG': 'en_US.UTF-8',
11:23:10 INFO - 'LOGNAME': 'cltbld',
11:23:10 INFO - 'MAIL': '/var/mail/cltbld',
11:23:10 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:10 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:10 INFO - 'MOZ_NO_REMOTE': '1',
11:23:10 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:10 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:10 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:10 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:10 INFO - 'PWD': '/builds/slave/test',
11:23:10 INFO - 'SHELL': '/bin/bash',
11:23:10 INFO - 'SHLVL': '1',
11:23:10 INFO - 'TERM': 'linux',
11:23:10 INFO - 'TMOUT': '86400',
11:23:10 INFO - 'USER': 'cltbld',
11:23:10 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:10 INFO - '_': '/tools/buildbot/bin/python'}
11:23:11 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:11 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil==3.1.1 in ./venv/lib/python2.7/site-packages
11:23:11 INFO - Cleaning up...
11:23:11 INFO - Return code: 0
11:23:11 INFO - Installing mock into virtualenv /builds/slave/test/build/venv
11:23:11 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:11 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:11 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:11 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:11 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:11 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:11 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:11 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock'] in /builds/slave/test/build
11:23:11 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mock
11:23:11 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:11 INFO - 'CCACHE_UMASK': '002',
11:23:11 INFO - 'DISPLAY': ':0',
11:23:11 INFO - 'HOME': '/home/cltbld',
11:23:11 INFO - 'LANG': 'en_US.UTF-8',
11:23:11 INFO - 'LOGNAME': 'cltbld',
11:23:11 INFO - 'MAIL': '/var/mail/cltbld',
11:23:11 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:11 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:11 INFO - 'MOZ_NO_REMOTE': '1',
11:23:11 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:11 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:11 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:11 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:11 INFO - 'PWD': '/builds/slave/test',
11:23:11 INFO - 'SHELL': '/bin/bash',
11:23:11 INFO - 'SHLVL': '1',
11:23:11 INFO - 'TERM': 'linux',
11:23:11 INFO - 'TMOUT': '86400',
11:23:11 INFO - 'USER': 'cltbld',
11:23:11 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:11 INFO - '_': '/tools/buildbot/bin/python'}
11:23:11 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:11 INFO - Downloading/unpacking mock
11:23:11 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:11 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:11 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:11 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:11 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:11 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:17 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mock/setup.py) egg_info for package mock
11:23:17 INFO - warning: no files found matching '*.png' under directory 'docs'
11:23:17 INFO - warning: no files found matching '*.css' under directory 'docs'
11:23:17 INFO - warning: no files found matching '*.html' under directory 'docs'
11:23:17 INFO - warning: no files found matching '*.js' under directory 'docs'
11:23:17 INFO - Installing collected packages: mock
11:23:17 INFO - Running setup.py install for mock
11:23:18 INFO - warning: no files found matching '*.png' under directory 'docs'
11:23:18 INFO - warning: no files found matching '*.css' under directory 'docs'
11:23:18 INFO - warning: no files found matching '*.html' under directory 'docs'
11:23:18 INFO - warning: no files found matching '*.js' under directory 'docs'
11:23:18 INFO - Successfully installed mock
11:23:18 INFO - Cleaning up...
11:23:18 INFO - Return code: 0
11:23:18 INFO - Installing simplejson into virtualenv /builds/slave/test/build/venv
11:23:18 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:18 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:18 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:18 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:18 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:18 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:18 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:18 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson'] in /builds/slave/test/build
11:23:18 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub simplejson
11:23:18 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:18 INFO - 'CCACHE_UMASK': '002',
11:23:18 INFO - 'DISPLAY': ':0',
11:23:18 INFO - 'HOME': '/home/cltbld',
11:23:18 INFO - 'LANG': 'en_US.UTF-8',
11:23:18 INFO - 'LOGNAME': 'cltbld',
11:23:18 INFO - 'MAIL': '/var/mail/cltbld',
11:23:18 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:18 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:18 INFO - 'MOZ_NO_REMOTE': '1',
11:23:18 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:18 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:18 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:18 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:18 INFO - 'PWD': '/builds/slave/test',
11:23:18 INFO - 'SHELL': '/bin/bash',
11:23:18 INFO - 'SHLVL': '1',
11:23:18 INFO - 'TERM': 'linux',
11:23:18 INFO - 'TMOUT': '86400',
11:23:18 INFO - 'USER': 'cltbld',
11:23:18 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:18 INFO - '_': '/tools/buildbot/bin/python'}
11:23:18 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:18 INFO - Downloading/unpacking simplejson
11:23:18 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:18 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:18 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:18 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available
11:23:18 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available
11:23:18 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available
11:23:23 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/simplejson/setup.py) egg_info for package simplejson
11:23:23 INFO - Installing collected packages: simplejson
11:23:23 INFO - Running setup.py install for simplejson
11:23:24 INFO - building 'simplejson._speedups' extension
11:23:24 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c simplejson/_speedups.c -o build/temp.linux-x86_64-2.7/simplejson/_speedups.o
11:23:25 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/simplejson/_speedups.o -o build/lib.linux-x86_64-2.7/simplejson/_speedups.so
11:23:25 INFO - Successfully installed simplejson
11:23:25 INFO - Cleaning up...
11:23:25 INFO - Return code: 0
11:23:25 INFO - Installing None into virtualenv /builds/slave/test/build/venv
11:23:25 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:25 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:25 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:25 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:25 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:25 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:25 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/marionette_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:25 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/marionette_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config
11:23:25 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --timeout 120 -r /builds/slave/test/build/tests/config/marionette_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub
11:23:25 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:25 INFO - 'CCACHE_UMASK': '002',
11:23:25 INFO - 'DISPLAY': ':0',
11:23:25 INFO - 'HOME': '/home/cltbld',
11:23:25 INFO - 'LANG': 'en_US.UTF-8',
11:23:25 INFO - 'LOGNAME': 'cltbld',
11:23:25 INFO - 'MAIL': '/var/mail/cltbld',
11:23:25 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:25 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:25 INFO - 'MOZ_NO_REMOTE': '1',
11:23:25 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:25 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:25 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:25 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:25 INFO - 'PWD': '/builds/slave/test',
11:23:25 INFO - 'SHELL': '/bin/bash',
11:23:25 INFO - 'SHLVL': '1',
11:23:25 INFO - 'TERM': 'linux',
11:23:25 INFO - 'TMOUT': '86400',
11:23:25 INFO - 'USER': 'cltbld',
11:23:25 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:25 INFO - '_': '/tools/buildbot/bin/python'}
11:23:26 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser
11:23:26 INFO - Running setup.py (path:/tmp/pip-E8K7_o-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser
11:23:26 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1))
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash
11:23:26 INFO - Running setup.py (path:/tmp/pip-RxDMvx-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash
11:23:26 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug
11:23:26 INFO - Running setup.py (path:/tmp/pip-qKJo2z-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug
11:23:26 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3))
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice
11:23:26 INFO - Running setup.py (path:/tmp/pip-Vln7pv-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice
11:23:26 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.48 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile
11:23:26 INFO - Running setup.py (path:/tmp/pip-zVCVEL-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile
11:23:26 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5))
11:23:26 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd
11:23:26 INFO - Running setup.py (path:/tmp/pip-OBuvln-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo
11:23:27 INFO - Running setup.py (path:/tmp/pip-o6XNux-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall
11:23:27 INFO - Running setup.py (path:/tmp/pip-pFvBxC-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak
11:23:27 INFO - Running setup.py (path:/tmp/pip-yTjVeh-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog
11:23:27 INFO - Running setup.py (path:/tmp/pip-BqCaOA-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork
11:23:27 INFO - Running setup.py (path:/tmp/pip-2jFiye-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess
11:23:27 INFO - Running setup.py (path:/tmp/pip-_l2l8x-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess
11:23:27 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12))
11:23:27 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile
11:23:28 INFO - Running setup.py (path:/tmp/pip-nReS9d-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile
11:23:28 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13))
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner
11:23:28 INFO - Running setup.py (path:/tmp/pip-Kgtb5M-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner
11:23:28 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14))
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:28 INFO - Running setup.py (path:/tmp/pip-fM18It-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:28 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15))
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest
11:23:28 INFO - Running setup.py (path:/tmp/pip-Mef4PT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest
11:23:28 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16))
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion
11:23:28 INFO - Running setup.py (path:/tmp/pip-N9F7AC-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion
11:23:28 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17))
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/tools/wptserve
11:23:28 INFO - Running setup.py (path:/tmp/pip-2DRZls-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/tools/wptserve
11:23:28 INFO - Unpacking /builds/slave/test/build/tests/marionette/driver
11:23:28 INFO - Running setup.py (path:/tmp/pip-s3jFRP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette/driver
11:23:29 INFO - Unpacking /builds/slave/test/build/tests/marionette/marionette/runner/mixins/browsermob-proxy-py
11:23:29 INFO - Running setup.py (path:/tmp/pip-ZQbk0E-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette/marionette/runner/mixins/browsermob-proxy-py
11:23:29 INFO - Unpacking /builds/slave/test/build/tests/marionette
11:23:29 INFO - Running setup.py (path:/tmp/pip-zFE7Aj-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette
11:23:29 INFO - warning: no files found matching '*.js' under directory 'marionette/touch'
11:23:29 INFO - Installing collected packages: wptserve, marionette-driver, browsermob-proxy, marionette-client
11:23:29 INFO - Running setup.py install for wptserve
11:23:29 INFO - Running setup.py install for marionette-driver
11:23:30 INFO - Running setup.py install for browsermob-proxy
11:23:30 INFO - Running setup.py install for marionette-client
11:23:30 INFO - warning: no files found matching '*.js' under directory 'marionette/touch'
11:23:30 INFO - Installing marionette script to /builds/slave/test/build/venv/bin
11:23:30 INFO - Successfully installed wptserve marionette-driver browsermob-proxy marionette-client
11:23:30 INFO - Cleaning up...
11:23:30 INFO - Return code: 0
11:23:30 INFO - Installing None into virtualenv /builds/slave/test/build/venv
11:23:30 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:30 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org
11:23:30 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:30 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:23:30 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org
11:23:30 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub
11:23:30 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/marionette_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xa631f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f047fa2ae40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0xb9e7d0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1
11:23:30 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/marionette_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config
11:23:30 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --timeout 120 -r /builds/slave/test/build/tests/config/marionette_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub
11:23:30 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:23:30 INFO - 'CCACHE_UMASK': '002',
11:23:30 INFO - 'DISPLAY': ':0',
11:23:30 INFO - 'HOME': '/home/cltbld',
11:23:30 INFO - 'LANG': 'en_US.UTF-8',
11:23:30 INFO - 'LOGNAME': 'cltbld',
11:23:30 INFO - 'MAIL': '/var/mail/cltbld',
11:23:30 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:23:30 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:23:30 INFO - 'MOZ_NO_REMOTE': '1',
11:23:30 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:23:30 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:23:30 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:23:30 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:23:30 INFO - 'PWD': '/builds/slave/test',
11:23:30 INFO - 'SHELL': '/bin/bash',
11:23:30 INFO - 'SHLVL': '1',
11:23:30 INFO - 'TERM': 'linux',
11:23:30 INFO - 'TMOUT': '86400',
11:23:30 INFO - 'USER': 'cltbld',
11:23:30 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:23:30 INFO - '_': '/tools/buildbot/bin/python'}
11:23:31 INFO - Ignoring indexes: https://pypi.python.org/simple/
11:23:31 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser
11:23:31 INFO - Running setup.py (path:/tmp/pip-8DzfWJ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser
11:23:31 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1))
11:23:31 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash
11:23:31 INFO - Running setup.py (path:/tmp/pip-sxNSFa-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash
11:23:31 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:31 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug
11:23:31 INFO - Running setup.py (path:/tmp/pip-_sB3zQ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug
11:23:31 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3))
11:23:31 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice
11:23:31 INFO - Running setup.py (path:/tmp/pip-iOdsca-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.48 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile
11:23:32 INFO - Running setup.py (path:/tmp/pip-zkuWN7-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd
11:23:32 INFO - Running setup.py (path:/tmp/pip-ZIJkfv-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo
11:23:32 INFO - Running setup.py (path:/tmp/pip-3_nEhI-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall
11:23:32 INFO - Running setup.py (path:/tmp/pip-m1fUVR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak
11:23:32 INFO - Running setup.py (path:/tmp/pip-3bxSAv-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog
11:23:32 INFO - Running setup.py (path:/tmp/pip-WavyFm-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog
11:23:32 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10))
11:23:32 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork
11:23:32 INFO - Running setup.py (path:/tmp/pip-qyBPHC-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess
11:23:33 INFO - Running setup.py (path:/tmp/pip-USVaE2-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile
11:23:33 INFO - Running setup.py (path:/tmp/pip-aupLec-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner
11:23:33 INFO - Running setup.py (path:/tmp/pip-lYo85K-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:33 INFO - Running setup.py (path:/tmp/pip-muXSEp-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest
11:23:33 INFO - Running setup.py (path:/tmp/pip-IA3mkK-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest
11:23:33 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16))
11:23:33 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion
11:23:33 INFO - Running setup.py (path:/tmp/pip-qAJHnW-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17))
11:23:34 INFO - Unpacking /builds/slave/test/build/tests/tools/wptserve
11:23:34 INFO - Running setup.py (path:/tmp/pip-smHF9Z-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/tools/wptserve
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): wptserve==1.3.0 from file:///builds/slave/test/build/tests/tools/wptserve in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/marionette_requirements.txt (line 2))
11:23:34 INFO - Unpacking /builds/slave/test/build/tests/marionette/driver
11:23:34 INFO - Running setup.py (path:/tmp/pip-j_qaqL-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette/driver
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): marionette-driver==1.3.0 from file:///builds/slave/test/build/tests/marionette/driver in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/marionette_requirements.txt (line 3))
11:23:34 INFO - Unpacking /builds/slave/test/build/tests/marionette/marionette/runner/mixins/browsermob-proxy-py
11:23:34 INFO - Running setup.py (path:/tmp/pip-i32Yrc-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette/marionette/runner/mixins/browsermob-proxy-py
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): browsermob-proxy==0.6.0 from file:///builds/slave/test/build/tests/marionette/marionette/runner/mixins/browsermob-proxy-py in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/marionette_requirements.txt (line 4))
11:23:34 INFO - Unpacking /builds/slave/test/build/tests/marionette
11:23:34 INFO - Running setup.py (path:/tmp/pip-xJyEft-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/marionette
11:23:34 INFO - warning: no files found matching '*.js' under directory 'marionette/touch'
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): marionette-client==2.2.0 from file:///builds/slave/test/build/tests/marionette in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/marionette_requirements.txt (line 5))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.48->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.48->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): blessings>=1.3 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozlog==3.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10))
11:23:34 INFO - Requirement already satisfied (use --upgrade to upgrade): requests>=1.1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from browsermob-proxy==0.6.0->-r /builds/slave/test/build/tests/config/marionette_requirements.txt (line 4))
11:23:34 INFO - Cleaning up...
11:23:35 INFO - Return code: 0
11:23:35 INFO - Done creating virtualenv /builds/slave/test/build/venv.
11:23:35 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze']
11:23:35 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze
11:23:35 INFO - Reading from file tmpfile_stdout
11:23:35 INFO - Current package versions:
11:23:35 INFO - argparse == 1.2.1
11:23:35 INFO - blessings == 1.6
11:23:35 INFO - blobuploader == 1.2.4
11:23:35 INFO - browsermob-proxy == 0.6.0
11:23:35 INFO - docopt == 0.6.1
11:23:35 INFO - manifestparser == 1.1
11:23:35 INFO - marionette-client == 2.2.0
11:23:35 INFO - marionette-driver == 1.3.0
11:23:35 INFO - mock == 1.0.1
11:23:35 INFO - mozInstall == 1.12
11:23:35 INFO - mozcrash == 0.16
11:23:35 INFO - mozdebug == 0.1
11:23:35 INFO - mozdevice == 0.48
11:23:35 INFO - mozfile == 1.2
11:23:35 INFO - mozhttpd == 0.7
11:23:35 INFO - mozinfo == 0.9
11:23:35 INFO - mozleak == 0.1
11:23:35 INFO - mozlog == 3.1
11:23:35 INFO - moznetwork == 0.27
11:23:35 INFO - mozprocess == 0.22
11:23:35 INFO - mozprofile == 0.28
11:23:35 INFO - mozrunner == 6.11
11:23:35 INFO - mozscreenshot == 0.1
11:23:35 INFO - mozsystemmonitor == 0.0
11:23:35 INFO - moztest == 0.7
11:23:35 INFO - mozversion == 1.4
11:23:35 INFO - psutil == 3.1.1
11:23:35 INFO - requests == 1.2.3
11:23:35 INFO - simplejson == 3.3.0
11:23:35 INFO - wptserve == 1.3.0
11:23:35 INFO - wsgiref == 0.1.2
11:23:35 INFO - Running post-action listener: _resource_record_post_action
11:23:35 INFO - Running post-action listener: _start_resource_monitoring
11:23:35 INFO - Starting resource monitoring.
11:23:35 INFO - #####
11:23:35 INFO - ##### Running install step.
11:23:35 INFO - #####
11:23:35 INFO - Running pre-action listener: _resource_record_pre_action
11:23:35 INFO - Running main action method: install
11:23:35 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze']
11:23:35 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze
11:23:36 INFO - Reading from file tmpfile_stdout
11:23:36 INFO - Detecting whether we're running mozinstall >=1.0...
11:23:36 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '-h']
11:23:36 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall -h
11:23:36 INFO - Reading from file tmpfile_stdout
11:23:36 INFO - Output received:
11:23:36 INFO - Usage: mozinstall [options] installer
11:23:36 INFO - Options:
11:23:36 INFO - -h, --help show this help message and exit
11:23:36 INFO - -d DEST, --destination=DEST
11:23:36 INFO - Directory to install application into. [default:
11:23:36 INFO - "/builds/slave/test"]
11:23:36 INFO - --app=APP Application being installed. [default: firefox]
11:23:36 INFO - mkdir: /builds/slave/test/build/application
11:23:36 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '/builds/slave/test/build/installer.tar.bz2', '--destination', '/builds/slave/test/build/application']
11:23:36 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall /builds/slave/test/build/installer.tar.bz2 --destination /builds/slave/test/build/application
11:24:02 INFO - Reading from file tmpfile_stdout
11:24:02 INFO - Output received:
11:24:02 INFO - /builds/slave/test/build/application/firefox/firefox
11:24:02 INFO - Running post-action listener: _resource_record_post_action
11:24:02 INFO - #####
11:24:02 INFO - ##### Running run-tests step.
11:24:02 INFO - #####
11:24:02 INFO - Running pre-action listener: _resource_record_pre_action
11:24:02 INFO - Running pre-action listener: _set_gcov_prefix
11:24:02 INFO - Running main action method: run_tests
11:24:02 INFO - Running pre test command disable_screen_saver with 'xset s off s reset'
11:24:02 INFO - Running command: ['xset', 's', 'off', 's', 'reset'] in /builds/slave/test/build
11:24:02 INFO - Copy/paste: xset s off s reset
11:24:02 INFO - Return code: 0
11:24:02 INFO - #### Running mochitest suites
11:24:02 INFO - grabbing minidump binary from tooltool
11:24:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]}
11:24:02 INFO - retry: Calling run_command with args: (['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'],), kwargs: {'error_list': [{'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9ae80>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0xb9c7e0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0xb9ca60>, 'level': 'critical'}, {'substr': 'ERROR - ', 'level': 'error'}], 'cwd': '/builds/slave/test/build', 'privileged': False}, attempt #1
11:24:02 INFO - Running command: ['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'] in /builds/slave/test/build
11:24:02 INFO - Copy/paste: /tools/tooltool.py --url https://api.pub.build.mozilla.org/tooltool/ --authentication-file /builds/relengapi.tok fetch -m /builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest -o -c /builds/tooltool_cache
11:24:03 INFO - INFO - File linux64-minidump_stackwalk retrieved from local cache /builds/tooltool_cache
11:24:03 INFO - Return code: 0
11:24:03 INFO - Chmoding /builds/slave/test/build/linux64-minidump_stackwalk to 0755
11:24:03 INFO - mkdir: /builds/slave/test/build/blobber_upload_dir
11:24:03 INFO - ENV: MOZ_UPLOAD_DIR is now /builds/slave/test/build/blobber_upload_dir
11:24:03 INFO - ENV: MINIDUMP_STACKWALK is now /builds/slave/test/build/linux64-minidump_stackwalk
11:24:03 INFO - ENV: MINIDUMP_SAVE_PATH is now /builds/slave/test/build/blobber_upload_dir
11:24:03 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '8', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] in /builds/slave/test/build
11:24:03 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python -u /builds/slave/test/build/tests/mochitest/runtests.py --total-chunks 8 --this-chunk 8 --appname=/builds/slave/test/build/application/firefox/firefox --utility-path=tests/bin --extra-profile-file=tests/bin/plugins --symbols-path=/builds/slave/test/build/symbols --certificate-path=tests/certs --setpref=webgl.force-enabled=true --quiet --log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log --log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log --use-test-media-devices --screenshot-on-fail --browser-chrome --subsuite=devtools --chunk-by-runtime
11:24:03 INFO - Using env: {'CCACHE_DIR': '/builds/ccache',
11:24:03 INFO - 'CCACHE_UMASK': '002',
11:24:03 INFO - 'DISPLAY': ':0',
11:24:03 INFO - 'HOME': '/home/cltbld',
11:24:03 INFO - 'LANG': 'en_US.UTF-8',
11:24:03 INFO - 'LOGNAME': 'cltbld',
11:24:03 INFO - 'MAIL': '/var/mail/cltbld',
11:24:03 INFO - 'MINIDUMP_SAVE_PATH': '/builds/slave/test/build/blobber_upload_dir',
11:24:03 INFO - 'MINIDUMP_STACKWALK': '/builds/slave/test/build/linux64-minidump_stackwalk',
11:24:03 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1',
11:24:03 INFO - 'MOZ_NODE_PATH': '/usr/bin/node',
11:24:03 INFO - 'MOZ_NO_REMOTE': '1',
11:24:03 INFO - 'MOZ_UPLOAD_DIR': '/builds/slave/test/build/blobber_upload_dir',
11:24:03 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript',
11:24:03 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1',
11:24:03 INFO - 'PATH': '/builds/slave/test/build/venv/bin:/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games',
11:24:03 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json',
11:24:03 INFO - 'PWD': '/builds/slave/test',
11:24:03 INFO - 'SHELL': '/bin/bash',
11:24:03 INFO - 'SHLVL': '1',
11:24:03 INFO - 'TERM': 'linux',
11:24:03 INFO - 'TMOUT': '86400',
11:24:03 INFO - 'USER': 'cltbld',
11:24:03 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851',
11:24:03 INFO - '_': '/tools/buildbot/bin/python'}
11:24:03 INFO - Calling ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '8', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] with output_timeout 1000
11:24:03 INFO - /builds/slave/test/build/venv/local/lib/python2.7/site-packages/mozrunner/utils.py:20: UserWarning: Module moznetwork was already imported from /builds/slave/test/build/tests/mochitest/moznetwork.py, but /builds/slave/test/build/venv/lib/python2.7/site-packages is being added to sys.path
11:24:03 INFO - import pkg_resources
11:24:03 INFO - Checking for orphan ssltunnel processes...
11:24:03 INFO - Checking for orphan xpcshell processes...
11:24:04 INFO - SUITE-START | Running 204 tests
11:24:04 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js
11:24:04 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js | took 1ms
11:24:04 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js
11:24:04 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js | took 1ms
11:24:04 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js
11:24:04 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js | took 0ms
11:24:04 INFO - dir: devtools/client/webconsole/test
11:24:04 INFO - Setting pipeline to PAUSED ...
11:24:04 INFO - libv4l2: error getting pixformat: Invalid argument
11:24:04 INFO - Pipeline is PREROLLING ...
11:24:04 INFO - Pipeline is PREROLLED ...
11:24:04 INFO - Setting pipeline to PLAYING ...
11:24:04 INFO - New clock: GstSystemClock
11:24:04 INFO - Got EOS from element "pipeline0".
11:24:04 INFO - Execution ended after 32425781 ns.
11:24:04 INFO - Setting pipeline to PAUSED ...
11:24:04 INFO - Setting pipeline to READY ...
11:24:04 INFO - Setting pipeline to NULL ...
11:24:04 INFO - Freeing pipeline ...
11:24:04 INFO - 23
11:24:04 INFO - mozprofile.addons WARNING | Could not install /builds/slave/test/build/tests/mochitest/extensions/mozscreenshots: [Errno 2] No such file or directory: '/builds/slave/test/build/tests/mochitest/extensions/mozscreenshots/install.rdf'
11:24:05 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL
11:24:05 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpYa7xtt.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js']
11:24:05 INFO - runtests.py | Server pid: 1923
11:24:05 INFO - runtests.py | Websocket server pid: 1926
11:24:05 INFO - runtests.py | SSL tunnel pid: 1929
11:24:06 INFO - runtests.py | Running tests: start.
11:24:06 INFO - runtests.py | Application pid: 1950
11:24:06 INFO - TEST-INFO | started process Main app process
11:24:06 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpYa7xtt.mozrunner/runtests_leaks.log
11:24:07 INFO - JavaScript warning: resource://gre/modules/AddonManager.jsm, line 692: Proxy.create and Proxy.createFunction are deprecated, use new Proxy instead
11:24:10 INFO - ++DOCSHELL 0x7f11a0d21800 == 1 [pid = 1950] [id = 1]
11:24:10 INFO - ++DOMWINDOW == 1 (0x7f11a0d62400) [pid = 1950] [serial = 1] [outer = (nil)]
11:24:10 INFO - ++DOMWINDOW == 2 (0x7f11a0d63000) [pid = 1950] [serial = 2] [outer = 0x7f11a0d62400]
11:24:11 INFO - ++DOCSHELL 0x7f119dd6d000 == 2 [pid = 1950] [id = 2]
11:24:11 INFO - ++DOMWINDOW == 3 (0x7f119dd5ec00) [pid = 1950] [serial = 3] [outer = (nil)]
11:24:11 INFO - ++DOMWINDOW == 4 (0x7f119dd5f800) [pid = 1950] [serial = 4] [outer = 0x7f119dd5ec00]
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnptestjava.so returned 7f11a11af490
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnpsecondtest.so returned 7f11a11af880
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnptest.so returned 7f11a11afbb0
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnpctrltest.so returned 7f11a11afca0
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnpswftest.so returned 7f11a11affd0
11:24:11 INFO - LoadPlugin() /tmp/tmpYa7xtt.mozrunner/plugins/libnpthirdtest.so returned 7f119c602340
11:24:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f119c6026a0
11:24:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f119c2069d0
11:24:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f119c20db20
11:24:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f119c20de20
11:24:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f119c214160
11:24:11 INFO - ++DOMWINDOW == 5 (0x7f119e244400) [pid = 1950] [serial = 5] [outer = 0x7f11a0d62400]
11:24:12 INFO - [1950] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2149
11:24:13 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:24:14 INFO - ++DOCSHELL 0x7f119142c800 == 3 [pid = 1950] [id = 3]
11:24:14 INFO - ++DOMWINDOW == 6 (0x7f119144c800) [pid = 1950] [serial = 6] [outer = (nil)]
11:24:14 INFO - ++DOCSHELL 0x7f1191430000 == 4 [pid = 1950] [id = 4]
11:24:14 INFO - ++DOMWINDOW == 7 (0x7f119144d000) [pid = 1950] [serial = 7] [outer = (nil)]
11:24:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272
11:24:15 INFO - ++DOCSHELL 0x7f118f63a000 == 5 [pid = 1950] [id = 5]
11:24:15 INFO - ++DOMWINDOW == 8 (0x7f118f617000) [pid = 1950] [serial = 8] [outer = (nil)]
11:24:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272
11:24:15 INFO - ++DOMWINDOW == 9 (0x7f118f595400) [pid = 1950] [serial = 9] [outer = 0x7f118f617000]
11:24:15 INFO - ++DOMWINDOW == 10 (0x7f118f1a3c00) [pid = 1950] [serial = 10] [outer = 0x7f119144c800]
11:24:15 INFO - ++DOMWINDOW == 11 (0x7f118f1a4400) [pid = 1950] [serial = 11] [outer = 0x7f119144d000]
11:24:16 INFO - ++DOMWINDOW == 12 (0x7f118f1a6000) [pid = 1950] [serial = 12] [outer = 0x7f118f617000]
11:24:17 INFO - ++DOMWINDOW == 13 (0x7f118d490000) [pid = 1950] [serial = 13] [outer = 0x7f118f617000]
11:24:17 INFO - ++DOCSHELL 0x7f118d36b800 == 6 [pid = 1950] [id = 6]
11:24:17 INFO - ++DOMWINDOW == 14 (0x7f118d34e000) [pid = 1950] [serial = 14] [outer = (nil)]
11:24:17 INFO - ++DOMWINDOW == 15 (0x7f118d34ec00) [pid = 1950] [serial = 15] [outer = 0x7f118d34e000]
11:24:19 INFO - 0 INFO *** Start BrowserChrome Test Results ***
11:24:19 INFO - ++DOCSHELL 0x7f1188183800 == 7 [pid = 1950] [id = 7]
11:24:19 INFO - ++DOMWINDOW == 16 (0x7f11881f3c00) [pid = 1950] [serial = 16] [outer = (nil)]
11:24:19 INFO - ++DOMWINDOW == 17 (0x7f11881f6400) [pid = 1950] [serial = 17] [outer = 0x7f11881f3c00]
11:24:20 INFO - 1 INFO checking window state
11:24:20 INFO - ++DOCSHELL 0x7f1187fc2800 == 8 [pid = 1950] [id = 8]
11:24:20 INFO - ++DOMWINDOW == 18 (0x7f1188146c00) [pid = 1950] [serial = 18] [outer = (nil)]
11:24:20 INFO - ++DOMWINDOW == 19 (0x7f118f594400) [pid = 1950] [serial = 19] [outer = 0x7f1188146c00]
11:24:20 INFO - 2 INFO TEST-INFO | (browser-test.js) | Console message: [JavaScript Error: "TelemetryStopwatch: requesting elapsed time for nonexisting stopwatch. Histogram: "FX_PAGE_LOAD_MS", key: "null"" {file: "resource://gre/modules/TelemetryStopwatch.jsm" line: 297}]
11:24:20 INFO - 3 INFO TEST-START | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js
11:24:20 INFO - ++DOCSHELL 0x7f1187d78800 == 9 [pid = 1950] [id = 9]
11:24:20 INFO - ++DOMWINDOW == 20 (0x7f118758d000) [pid = 1950] [serial = 20] [outer = (nil)]
11:24:20 INFO - ++DOMWINDOW == 21 (0x7f118758f800) [pid = 1950] [serial = 21] [outer = 0x7f118758d000]
11:24:20 INFO - ++DOMWINDOW == 22 (0x7f11872ad400) [pid = 1950] [serial = 22] [outer = 0x7f1188146c00]
11:24:21 INFO - ++DOCSHELL 0x7f118de30800 == 10 [pid = 1950] [id = 10]
11:24:21 INFO - ++DOMWINDOW == 23 (0x7f118f615c00) [pid = 1950] [serial = 23] [outer = (nil)]
11:24:21 INFO - ++DOMWINDOW == 24 (0x7f1190245800) [pid = 1950] [serial = 24] [outer = 0x7f118f615c00]
11:24:21 INFO - [1950] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101
11:24:21 INFO - ++DOMWINDOW == 25 (0x7f118f594c00) [pid = 1950] [serial = 25] [outer = 0x7f118f615c00]
11:24:22 INFO - ++DOCSHELL 0x7f1190ad0000 == 11 [pid = 1950] [id = 11]
11:24:22 INFO - ++DOMWINDOW == 26 (0x7f1185862800) [pid = 1950] [serial = 26] [outer = (nil)]
11:24:22 INFO - ++DOMWINDOW == 27 (0x7f1185865400) [pid = 1950] [serial = 27] [outer = 0x7f1185862800]
11:24:22 INFO - ++DOMWINDOW == 28 (0x7f11858f3c00) [pid = 1950] [serial = 28] [outer = 0x7f1185862800]
11:24:22 INFO - ++DOCSHELL 0x7f119163a800 == 12 [pid = 1950] [id = 12]
11:24:22 INFO - ++DOMWINDOW == 29 (0x7f1185865800) [pid = 1950] [serial = 29] [outer = (nil)]
11:24:22 INFO - ++DOMWINDOW == 30 (0x7f11858fc400) [pid = 1950] [serial = 30] [outer = 0x7f1185865800]
11:24:23 INFO - [1950] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 281
11:24:23 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/util/l10n.js, line 74: Proxy.create and Proxy.createFunction are deprecated, use new Proxy instead
11:24:24 INFO - ++DOCSHELL 0x7f1184009000 == 13 [pid = 1950] [id = 13]
11:24:24 INFO - ++DOMWINDOW == 31 (0x7f1184144c00) [pid = 1950] [serial = 31] [outer = (nil)]
11:24:24 INFO - ++DOMWINDOW == 32 (0x7f1184146400) [pid = 1950] [serial = 32] [outer = 0x7f1184144c00]
11:24:27 INFO - ++DOMWINDOW == 33 (0x7f1182848000) [pid = 1950] [serial = 33] [outer = 0x7f118758d000]
11:24:27 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:24:28 INFO - console.log: 11:24:27.479 GET http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html [HTTP/1.1 200 OK 62ms]
11:24:28 INFO - 11:24:27.645 Content Security Policy: Not supporting directive 'reflected-xss'. Directive and values will be ignored.1
11:24:28 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:24:28 INFO - [1950] WARNING: Image width or height is non-positive: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6500
11:24:29 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration.
11:24:29 INFO - MEMORY STAT | vsize 1048MB | residentFast 320MB | heapAllocated 127MB
11:24:29 INFO - 4 INFO TEST-OK | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js | took 9025ms
11:24:29 INFO - ++DOCSHELL 0x7f118a9a5000 == 14 [pid = 1950] [id = 14]
11:24:29 INFO - ++DOMWINDOW == 34 (0x7f11838ba400) [pid = 1950] [serial = 34] [outer = (nil)]
11:24:29 INFO - ++DOMWINDOW == 35 (0x7f11838bd400) [pid = 1950] [serial = 35] [outer = 0x7f11838ba400]
11:24:29 INFO - 5 INFO TEST-START | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js
11:24:29 INFO - ++DOCSHELL 0x7f11827de000 == 15 [pid = 1950] [id = 15]
11:24:29 INFO - ++DOMWINDOW == 36 (0x7f1185869400) [pid = 1950] [serial = 36] [outer = (nil)]
11:24:29 INFO - ++DOMWINDOW == 37 (0x7f1187583c00) [pid = 1950] [serial = 37] [outer = 0x7f1185869400]
11:24:30 INFO - ++DOMWINDOW == 38 (0x7f118242d800) [pid = 1950] [serial = 38] [outer = 0x7f1185869400]
11:24:30 INFO - ++DOCSHELL 0x7f1182493000 == 16 [pid = 1950] [id = 16]
11:24:30 INFO - ++DOMWINDOW == 39 (0x7f118242f000) [pid = 1950] [serial = 39] [outer = (nil)]
11:24:30 INFO - ++DOMWINDOW == 40 (0x7f1183fdd000) [pid = 1950] [serial = 40] [outer = 0x7f118242f000]
11:24:30 INFO - ++DOMWINDOW == 41 (0x7f118242a000) [pid = 1950] [serial = 41] [outer = 0x7f118242f000]
11:24:31 INFO - ++DOCSHELL 0x7f11824a2800 == 17 [pid = 1950] [id = 17]
11:24:31 INFO - ++DOMWINDOW == 42 (0x7f1196403000) [pid = 1950] [serial = 42] [outer = (nil)]
11:24:31 INFO - ++DOMWINDOW == 43 (0x7f119e239c00) [pid = 1950] [serial = 43] [outer = 0x7f1196403000]
11:24:35 INFO - --DOCSHELL 0x7f1184009000 == 16 [pid = 1950] [id = 13]
11:24:35 INFO - ++DOMWINDOW == 44 (0x7f11835a3400) [pid = 1950] [serial = 44] [outer = 0x7f1185869400]
11:24:35 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:24:36 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:24:36 INFO - --DOCSHELL 0x7f11824a2800 == 15 [pid = 1950] [id = 17]
11:24:37 INFO - MEMORY STAT | vsize 1062MB | residentFast 322MB | heapAllocated 114MB
11:24:37 INFO - 6 INFO TEST-OK | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js | took 7664ms
11:24:37 INFO - ++DOCSHELL 0x7f118249f800 == 16 [pid = 1950] [id = 18]
11:24:37 INFO - ++DOMWINDOW == 45 (0x7f1182750000) [pid = 1950] [serial = 45] [outer = (nil)]
11:24:37 INFO - ++DOMWINDOW == 46 (0x7f1184370000) [pid = 1950] [serial = 46] [outer = 0x7f1182750000]
11:24:37 INFO - 7 INFO TEST-START | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js
11:24:37 INFO - ++DOCSHELL 0x7f11872e3000 == 17 [pid = 1950] [id = 19]
11:24:37 INFO - ++DOMWINDOW == 47 (0x7f11858f1800) [pid = 1950] [serial = 47] [outer = (nil)]
11:24:37 INFO - ++DOMWINDOW == 48 (0x7f11858f8800) [pid = 1950] [serial = 48] [outer = 0x7f11858f1800]
11:24:38 INFO - ++DOMWINDOW == 49 (0x7f118758fc00) [pid = 1950] [serial = 49] [outer = 0x7f11858f1800]
11:24:38 INFO - ++DOCSHELL 0x7f11835f3800 == 18 [pid = 1950] [id = 20]
11:24:38 INFO - ++DOMWINDOW == 50 (0x7f11858fd800) [pid = 1950] [serial = 50] [outer = (nil)]
11:24:38 INFO - ++DOMWINDOW == 51 (0x7f118a02f000) [pid = 1950] [serial = 51] [outer = 0x7f11858fd800]
11:24:38 INFO - ++DOMWINDOW == 52 (0x7f1188151000) [pid = 1950] [serial = 52] [outer = 0x7f11858fd800]
11:24:38 INFO - ++DOCSHELL 0x7f118a9a0000 == 19 [pid = 1950] [id = 21]
11:24:38 INFO - ++DOMWINDOW == 53 (0x7f118d404c00) [pid = 1950] [serial = 53] [outer = (nil)]
11:24:38 INFO - ++DOMWINDOW == 54 (0x7f118d482400) [pid = 1950] [serial = 54] [outer = 0x7f118d404c00]
11:24:40 INFO - ++DOMWINDOW == 55 (0x7f119240d400) [pid = 1950] [serial = 55] [outer = 0x7f11858f1800]
11:24:40 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:24:42 INFO - MEMORY STAT | vsize 1159MB | residentFast 330MB | heapAllocated 121MB
11:24:42 INFO - 8 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js | took 4464ms
11:24:42 INFO - ++DOCSHELL 0x7f118a314800 == 20 [pid = 1950] [id = 22]
11:24:42 INFO - ++DOMWINDOW == 56 (0x7f118d409800) [pid = 1950] [serial = 56] [outer = (nil)]
11:24:42 INFO - ++DOMWINDOW == 57 (0x7f118da9a000) [pid = 1950] [serial = 57] [outer = 0x7f118d409800]
11:24:42 INFO - 9 INFO TEST-START | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js
11:24:42 INFO - ++DOCSHELL 0x7f118ddcc800 == 21 [pid = 1950] [id = 23]
11:24:42 INFO - ++DOMWINDOW == 58 (0x7f11910b0400) [pid = 1950] [serial = 58] [outer = (nil)]
11:24:42 INFO - ++DOMWINDOW == 59 (0x7f11916e4000) [pid = 1950] [serial = 59] [outer = 0x7f11910b0400]
11:24:42 INFO - ++DOCSHELL 0x7f1191646800 == 22 [pid = 1950] [id = 24]
11:24:42 INFO - ++DOMWINDOW == 60 (0x7f11918ea800) [pid = 1950] [serial = 60] [outer = (nil)]
11:24:42 INFO - ++DOMWINDOW == 61 (0x7f1196583000) [pid = 1950] [serial = 61] [outer = 0x7f11918ea800]
11:24:42 INFO - ++DOMWINDOW == 62 (0x7f119657d400) [pid = 1950] [serial = 62] [outer = 0x7f11918ea800]
11:24:43 INFO - ++DOCSHELL 0x7f1192e74800 == 23 [pid = 1950] [id = 25]
11:24:43 INFO - ++DOMWINDOW == 63 (0x7f119debac00) [pid = 1950] [serial = 63] [outer = (nil)]
11:24:43 INFO - ++DOMWINDOW == 64 (0x7f119e035400) [pid = 1950] [serial = 64] [outer = 0x7f119debac00]
11:24:45 INFO - --DOCSHELL 0x7f1188183800 == 22 [pid = 1950] [id = 7]
11:24:45 INFO - --DOCSHELL 0x7f118f63a000 == 21 [pid = 1950] [id = 5]
11:24:45 INFO - --DOCSHELL 0x7f118a9a0000 == 20 [pid = 1950] [id = 21]
11:24:45 INFO - --DOCSHELL 0x7f1187d78800 == 19 [pid = 1950] [id = 9]
11:24:45 INFO - --DOCSHELL 0x7f118de30800 == 18 [pid = 1950] [id = 10]
11:24:46 INFO - ++DOCSHELL 0x7f1182493800 == 19 [pid = 1950] [id = 26]
11:24:46 INFO - ++DOMWINDOW == 65 (0x7f1181f53000) [pid = 1950] [serial = 65] [outer = (nil)]
11:24:46 INFO - ++DOMWINDOW == 66 (0x7f1181f58800) [pid = 1950] [serial = 66] [outer = 0x7f1181f53000]
11:24:46 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 278
11:24:47 INFO - [1950] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 174
11:24:47 INFO - [1950] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 141
11:24:53 INFO - --DOMWINDOW == 65 (0x7f11858f1800) [pid = 1950] [serial = 47] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1454441077675]
11:24:53 INFO - --DOMWINDOW == 64 (0x7f1182750000) [pid = 1950] [serial = 45] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 63 (0x7f1185869400) [pid = 1950] [serial = 36] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:24:53 INFO - --DOMWINDOW == 62 (0x7f11838ba400) [pid = 1950] [serial = 34] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 61 (0x7f118758d000) [pid = 1950] [serial = 20] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html]
11:24:53 INFO - --DOMWINDOW == 60 (0x7f11881f3c00) [pid = 1950] [serial = 16] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 59 (0x7f118f617000) [pid = 1950] [serial = 8] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 58 (0x7f118f615c00) [pid = 1950] [serial = 23] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:24:53 INFO - --DOMWINDOW == 57 (0x7f1184144c00) [pid = 1950] [serial = 31] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:24:53 INFO - --DOMWINDOW == 56 (0x7f11858fd800) [pid = 1950] [serial = 50] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:24:53 INFO - --DOMWINDOW == 55 (0x7f118242f000) [pid = 1950] [serial = 39] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:24:53 INFO - --DOMWINDOW == 54 (0x7f118d404c00) [pid = 1950] [serial = 53] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:24:53 INFO - --DOMWINDOW == 53 (0x7f1190245800) [pid = 1950] [serial = 24] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 52 (0x7f11858f8800) [pid = 1950] [serial = 48] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 51 (0x7f1184370000) [pid = 1950] [serial = 46] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 50 (0x7f1187583c00) [pid = 1950] [serial = 37] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 49 (0x7f11838bd400) [pid = 1950] [serial = 35] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 48 (0x7f1196583000) [pid = 1950] [serial = 61] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 47 (0x7f118a02f000) [pid = 1950] [serial = 51] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 46 (0x7f11a0d63000) [pid = 1950] [serial = 2] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 45 (0x7f1196403000) [pid = 1950] [serial = 42] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:24:53 INFO - --DOMWINDOW == 44 (0x7f118d490000) [pid = 1950] [serial = 13] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 43 (0x7f118f1a6000) [pid = 1950] [serial = 12] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 42 (0x7f118f595400) [pid = 1950] [serial = 9] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 41 (0x7f1185865400) [pid = 1950] [serial = 27] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 40 (0x7f1183fdd000) [pid = 1950] [serial = 40] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 39 (0x7f118f594400) [pid = 1950] [serial = 19] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 38 (0x7f118758f800) [pid = 1950] [serial = 21] [outer = (nil)] [url = about:blank]
11:24:53 INFO - --DOMWINDOW == 37 (0x7f11881f6400) [pid = 1950] [serial = 17] [outer = (nil)] [url = about:blank]
11:24:55 INFO - --DOCSHELL 0x7f1182493800 == 18 [pid = 1950] [id = 26]
11:24:55 INFO - --DOCSHELL 0x7f1192e74800 == 17 [pid = 1950] [id = 25]
11:24:55 INFO - --DOMWINDOW == 36 (0x7f1182848000) [pid = 1950] [serial = 33] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html]
11:24:57 INFO - MEMORY STAT | vsize 1173MB | residentFast 344MB | heapAllocated 124MB
11:24:57 INFO - 10 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js | took 15352ms
11:24:57 INFO - ++DOCSHELL 0x7f1183b2b800 == 18 [pid = 1950] [id = 27]
11:24:57 INFO - ++DOMWINDOW == 37 (0x7f1183fe3000) [pid = 1950] [serial = 67] [outer = (nil)]
11:24:57 INFO - ++DOMWINDOW == 38 (0x7f1184616000) [pid = 1950] [serial = 68] [outer = 0x7f1183fe3000]
11:24:58 INFO - 11 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js
11:24:58 INFO - ++DOCSHELL 0x7f1183e2e000 == 19 [pid = 1950] [id = 28]
11:24:58 INFO - ++DOMWINDOW == 39 (0x7f11872af000) [pid = 1950] [serial = 69] [outer = (nil)]
11:24:58 INFO - ++DOMWINDOW == 40 (0x7f118758e000) [pid = 1950] [serial = 70] [outer = 0x7f11872af000]
11:24:58 INFO - ++DOMWINDOW == 41 (0x7f118d40c400) [pid = 1950] [serial = 71] [outer = 0x7f11872af000]
11:24:58 INFO - ++DOCSHELL 0x7f1187fd0800 == 20 [pid = 1950] [id = 29]
11:24:58 INFO - ++DOMWINDOW == 42 (0x7f11881f0c00) [pid = 1950] [serial = 72] [outer = (nil)]
11:24:58 INFO - ++DOMWINDOW == 43 (0x7f118a9bc400) [pid = 1950] [serial = 73] [outer = 0x7f11881f0c00]
11:24:59 INFO - ++DOMWINDOW == 44 (0x7f1182424800) [pid = 1950] [serial = 74] [outer = 0x7f11881f0c00]
11:24:59 INFO - ++DOCSHELL 0x7f118a992000 == 21 [pid = 1950] [id = 30]
11:24:59 INFO - ++DOMWINDOW == 45 (0x7f118d586400) [pid = 1950] [serial = 75] [outer = (nil)]
11:24:59 INFO - ++DOMWINDOW == 46 (0x7f118d743c00) [pid = 1950] [serial = 76] [outer = 0x7f118d586400]
11:25:02 INFO - --DOCSHELL 0x7f1191646800 == 20 [pid = 1950] [id = 24]
11:25:02 INFO - --DOCSHELL 0x7f11835f3800 == 19 [pid = 1950] [id = 20]
11:25:02 INFO - --DOCSHELL 0x7f118ddcc800 == 18 [pid = 1950] [id = 23]
11:25:02 INFO - --DOCSHELL 0x7f118249f800 == 17 [pid = 1950] [id = 18]
11:25:02 INFO - --DOCSHELL 0x7f118a9a5000 == 16 [pid = 1950] [id = 14]
11:25:02 INFO - --DOCSHELL 0x7f11827de000 == 15 [pid = 1950] [id = 15]
11:25:02 INFO - --DOCSHELL 0x7f11872e3000 == 14 [pid = 1950] [id = 19]
11:25:02 INFO - --DOCSHELL 0x7f1182493000 == 13 [pid = 1950] [id = 16]
11:25:02 INFO - --DOCSHELL 0x7f118a314800 == 12 [pid = 1950] [id = 22]
11:25:02 INFO - --DOMWINDOW == 45 (0x7f118f594c00) [pid = 1950] [serial = 25] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:02 INFO - --DOMWINDOW == 44 (0x7f11835a3400) [pid = 1950] [serial = 44] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-console.html]
11:25:02 INFO - --DOMWINDOW == 43 (0x7f119240d400) [pid = 1950] [serial = 55] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1454441077675]
11:25:02 INFO - --DOMWINDOW == 42 (0x7f118242d800) [pid = 1950] [serial = 38] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:25:02 INFO - --DOMWINDOW == 41 (0x7f118758fc00) [pid = 1950] [serial = 49] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1454441077675]
11:25:02 INFO - --DOMWINDOW == 40 (0x7f118242a000) [pid = 1950] [serial = 41] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:02 INFO - --DOMWINDOW == 39 (0x7f1184146400) [pid = 1950] [serial = 32] [outer = (nil)] [url = about:blank]
11:25:02 INFO - --DOMWINDOW == 38 (0x7f1188151000) [pid = 1950] [serial = 52] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:02 INFO - --DOMWINDOW == 37 (0x7f119e239c00) [pid = 1950] [serial = 43] [outer = (nil)] [url = about:blank]
11:25:02 INFO - --DOMWINDOW == 36 (0x7f118d482400) [pid = 1950] [serial = 54] [outer = (nil)] [url = about:blank]
11:25:02 INFO - ++DOCSHELL 0x7f11827df000 == 13 [pid = 1950] [id = 31]
11:25:02 INFO - ++DOMWINDOW == 37 (0x7f1182755c00) [pid = 1950] [serial = 77] [outer = (nil)]
11:25:02 INFO - ++DOMWINDOW == 38 (0x7f1182757c00) [pid = 1950] [serial = 78] [outer = 0x7f1182755c00]
11:25:03 INFO - --DOCSHELL 0x7f118a992000 == 12 [pid = 1950] [id = 30]
11:25:04 INFO - MEMORY STAT | vsize 1154MB | residentFast 319MB | heapAllocated 115MB
11:25:04 INFO - 12 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js | took 5980ms
11:25:04 INFO - ++DOCSHELL 0x7f1183e35000 == 13 [pid = 1950] [id = 32]
11:25:04 INFO - ++DOMWINDOW == 39 (0x7f11881f5c00) [pid = 1950] [serial = 79] [outer = (nil)]
11:25:04 INFO - ++DOMWINDOW == 40 (0x7f11881fd800) [pid = 1950] [serial = 80] [outer = 0x7f11881f5c00]
11:25:04 INFO - 13 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js
11:25:04 INFO - ++DOCSHELL 0x7f11853ed000 == 14 [pid = 1950] [id = 33]
11:25:04 INFO - ++DOMWINDOW == 41 (0x7f118a9b8c00) [pid = 1950] [serial = 81] [outer = (nil)]
11:25:04 INFO - ++DOMWINDOW == 42 (0x7f118a9c0800) [pid = 1950] [serial = 82] [outer = 0x7f118a9b8c00]
11:25:04 INFO - ++DOMWINDOW == 43 (0x7f118ce95000) [pid = 1950] [serial = 83] [outer = 0x7f118a9b8c00]
11:25:05 INFO - ++DOCSHELL 0x7f11827ed000 == 15 [pid = 1950] [id = 34]
11:25:05 INFO - ++DOMWINDOW == 44 (0x7f118a9c1c00) [pid = 1950] [serial = 84] [outer = (nil)]
11:25:05 INFO - ++DOMWINDOW == 45 (0x7f118d402c00) [pid = 1950] [serial = 85] [outer = 0x7f118a9c1c00]
11:25:05 INFO - ++DOMWINDOW == 46 (0x7f1184371800) [pid = 1950] [serial = 86] [outer = 0x7f118a9c1c00]
11:25:05 INFO - ++DOCSHELL 0x7f118a9a5000 == 16 [pid = 1950] [id = 35]
11:25:05 INFO - ++DOMWINDOW == 47 (0x7f118f369000) [pid = 1950] [serial = 87] [outer = (nil)]
11:25:05 INFO - ++DOMWINDOW == 48 (0x7f118f595000) [pid = 1950] [serial = 88] [outer = 0x7f118f369000]
11:25:07 INFO - --DOMWINDOW == 47 (0x7f11910b0400) [pid = 1950] [serial = 58] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20862916]
11:25:07 INFO - --DOMWINDOW == 46 (0x7f1181f53000) [pid = 1950] [serial = 65] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:07 INFO - --DOMWINDOW == 45 (0x7f118d409800) [pid = 1950] [serial = 56] [outer = (nil)] [url = about:blank]
11:25:07 INFO - --DOMWINDOW == 44 (0x7f118a9bc400) [pid = 1950] [serial = 73] [outer = (nil)] [url = about:blank]
11:25:07 INFO - --DOMWINDOW == 43 (0x7f118da9a000) [pid = 1950] [serial = 57] [outer = (nil)] [url = about:blank]
11:25:07 INFO - --DOMWINDOW == 42 (0x7f119debac00) [pid = 1950] [serial = 63] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:07 INFO - --DOMWINDOW == 41 (0x7f11918ea800) [pid = 1950] [serial = 60] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:07 INFO - ++DOCSHELL 0x7f1190482000 == 17 [pid = 1950] [id = 36]
11:25:07 INFO - ++DOMWINDOW == 42 (0x7f1192410800) [pid = 1950] [serial = 89] [outer = (nil)]
11:25:07 INFO - ++DOMWINDOW == 43 (0x7f11918e9400) [pid = 1950] [serial = 90] [outer = 0x7f1192410800]
11:25:08 INFO - ++DOCSHELL 0x7f1191050000 == 18 [pid = 1950] [id = 37]
11:25:08 INFO - ++DOMWINDOW == 44 (0x7f119657c400) [pid = 1950] [serial = 91] [outer = (nil)]
11:25:08 INFO - ++DOMWINDOW == 45 (0x7f119640b000) [pid = 1950] [serial = 92] [outer = 0x7f119657c400]
11:25:09 INFO - --DOCSHELL 0x7f11827df000 == 17 [pid = 1950] [id = 31]
11:25:09 INFO - --DOCSHELL 0x7f1187fd0800 == 16 [pid = 1950] [id = 29]
11:25:09 INFO - --DOCSHELL 0x7f118a9a5000 == 15 [pid = 1950] [id = 35]
11:25:09 INFO - --DOCSHELL 0x7f1190482000 == 14 [pid = 1950] [id = 36]
11:25:09 INFO - --DOCSHELL 0x7f1183b2b800 == 13 [pid = 1950] [id = 27]
11:25:09 INFO - --DOCSHELL 0x7f1191050000 == 12 [pid = 1950] [id = 37]
11:25:10 INFO - --DOMWINDOW == 44 (0x7f11916e4000) [pid = 1950] [serial = 59] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 43 (0x7f1181f58800) [pid = 1950] [serial = 66] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:10 INFO - --DOMWINDOW == 42 (0x7f119657d400) [pid = 1950] [serial = 62] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:10 INFO - --DOMWINDOW == 41 (0x7f119e035400) [pid = 1950] [serial = 64] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 40 (0x7f118a9c0800) [pid = 1950] [serial = 82] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 39 (0x7f118758e000) [pid = 1950] [serial = 70] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 38 (0x7f1184616000) [pid = 1950] [serial = 68] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 37 (0x7f118d402c00) [pid = 1950] [serial = 85] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 36 (0x7f11872af000) [pid = 1950] [serial = 69] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html]
11:25:10 INFO - --DOMWINDOW == 35 (0x7f1183fe3000) [pid = 1950] [serial = 67] [outer = (nil)] [url = about:blank]
11:25:10 INFO - --DOMWINDOW == 34 (0x7f118d40c400) [pid = 1950] [serial = 71] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html]
11:25:10 INFO - MEMORY STAT | vsize 1156MB | residentFast 312MB | heapAllocated 110MB
11:25:10 INFO - 14 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js | took 6286ms
11:25:10 INFO - ++DOCSHELL 0x7f11835f0000 == 13 [pid = 1950] [id = 38]
11:25:10 INFO - ++DOMWINDOW == 35 (0x7f11858fa800) [pid = 1950] [serial = 93] [outer = (nil)]
11:25:10 INFO - ++DOMWINDOW == 36 (0x7f118758c800) [pid = 1950] [serial = 94] [outer = 0x7f11858fa800]
11:25:10 INFO - 15 INFO TEST-START | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js
11:25:10 INFO - ++DOCSHELL 0x7f1187d66800 == 14 [pid = 1950] [id = 39]
11:25:10 INFO - ++DOMWINDOW == 37 (0x7f118a32a400) [pid = 1950] [serial = 95] [outer = (nil)]
11:25:11 INFO - ++DOMWINDOW == 38 (0x7f118a9b7400) [pid = 1950] [serial = 96] [outer = 0x7f118a32a400]
11:25:11 INFO - ++DOCSHELL 0x7f118249f000 == 15 [pid = 1950] [id = 40]
11:25:11 INFO - ++DOMWINDOW == 39 (0x7f11838c0c00) [pid = 1950] [serial = 97] [outer = (nil)]
11:25:11 INFO - ++DOMWINDOW == 40 (0x7f118d486800) [pid = 1950] [serial = 98] [outer = 0x7f11838c0c00]
11:25:11 INFO - ++DOMWINDOW == 41 (0x7f118ce92800) [pid = 1950] [serial = 99] [outer = 0x7f11838c0c00]
11:25:11 INFO - ++DOCSHELL 0x7f118d5e2800 == 16 [pid = 1950] [id = 41]
11:25:11 INFO - ++DOMWINDOW == 42 (0x7f118dba2000) [pid = 1950] [serial = 100] [outer = (nil)]
11:25:11 INFO - ++DOMWINDOW == 43 (0x7f118f596400) [pid = 1950] [serial = 101] [outer = 0x7f118dba2000]
11:25:13 INFO - ++DOMWINDOW == 44 (0x7f1196405c00) [pid = 1950] [serial = 102] [outer = 0x7f118a32a400]
11:25:13 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:25:13 INFO - ++DOCSHELL 0x7f11926d4800 == 17 [pid = 1950] [id = 42]
11:25:13 INFO - ++DOMWINDOW == 45 (0x7f119dd5cc00) [pid = 1950] [serial = 103] [outer = (nil)]
11:25:13 INFO - ++DOMWINDOW == 46 (0x7f1181fdf400) [pid = 1950] [serial = 104] [outer = 0x7f119dd5cc00]
11:25:13 INFO - ++DOMWINDOW == 47 (0x7f119deb7400) [pid = 1950] [serial = 105] [outer = 0x7f119dd5cc00]
11:25:13 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:25:14 INFO - ++DOCSHELL 0x7f11824a1000 == 18 [pid = 1950] [id = 43]
11:25:14 INFO - ++DOMWINDOW == 48 (0x7f1181f53000) [pid = 1950] [serial = 106] [outer = (nil)]
11:25:14 INFO - ++DOMWINDOW == 49 (0x7f1181fdf800) [pid = 1950] [serial = 107] [outer = 0x7f1181f53000]
11:25:15 INFO - --DOCSHELL 0x7f1183e2e000 == 17 [pid = 1950] [id = 28]
11:25:15 INFO - --DOCSHELL 0x7f11853ed000 == 16 [pid = 1950] [id = 33]
11:25:15 INFO - --DOCSHELL 0x7f11827ed000 == 15 [pid = 1950] [id = 34]
11:25:15 INFO - --DOCSHELL 0x7f1183e35000 == 14 [pid = 1950] [id = 32]
11:25:16 INFO - --DOCSHELL 0x7f118d5e2800 == 13 [pid = 1950] [id = 41]
11:25:16 INFO - MEMORY STAT | vsize 1149MB | residentFast 295MB | heapAllocated 106MB
11:25:16 INFO - 16 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js | took 5911ms
11:25:16 INFO - ++DOCSHELL 0x7f1182497800 == 14 [pid = 1950] [id = 44]
11:25:16 INFO - ++DOMWINDOW == 50 (0x7f1183673c00) [pid = 1950] [serial = 108] [outer = (nil)]
11:25:16 INFO - ++DOMWINDOW == 51 (0x7f1183a7b400) [pid = 1950] [serial = 109] [outer = 0x7f1183673c00]
11:25:17 INFO - 17 INFO TEST-START | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js
11:25:17 INFO - ++DOCSHELL 0x7f1183b0f000 == 15 [pid = 1950] [id = 45]
11:25:17 INFO - ++DOMWINDOW == 52 (0x7f1183fc4000) [pid = 1950] [serial = 110] [outer = (nil)]
11:25:17 INFO - ++DOMWINDOW == 53 (0x7f1183fc8400) [pid = 1950] [serial = 111] [outer = 0x7f1183fc4000]
11:25:17 INFO - ++DOCSHELL 0x7f1183e38800 == 16 [pid = 1950] [id = 46]
11:25:17 INFO - ++DOMWINDOW == 54 (0x7f1183fc9000) [pid = 1950] [serial = 112] [outer = (nil)]
11:25:17 INFO - ++DOMWINDOW == 55 (0x7f118758bc00) [pid = 1950] [serial = 113] [outer = 0x7f1183fc9000]
11:25:17 INFO - ++DOMWINDOW == 56 (0x7f118242ac00) [pid = 1950] [serial = 114] [outer = 0x7f1183fc9000]
11:25:18 INFO - ++DOCSHELL 0x7f118a317800 == 17 [pid = 1950] [id = 47]
11:25:18 INFO - ++DOMWINDOW == 57 (0x7f118a9b5c00) [pid = 1950] [serial = 115] [outer = (nil)]
11:25:18 INFO - ++DOMWINDOW == 58 (0x7f118a9b7000) [pid = 1950] [serial = 116] [outer = 0x7f118a9b5c00]
11:25:21 INFO - --DOCSHELL 0x7f11926d4800 == 16 [pid = 1950] [id = 42]
11:25:21 INFO - --DOCSHELL 0x7f11824a1000 == 15 [pid = 1950] [id = 43]
11:25:21 INFO - --DOCSHELL 0x7f118249f000 == 14 [pid = 1950] [id = 40]
11:25:21 INFO - --DOCSHELL 0x7f1187d66800 == 13 [pid = 1950] [id = 39]
11:25:21 INFO - --DOCSHELL 0x7f11835f0000 == 12 [pid = 1950] [id = 38]
11:25:21 INFO - --DOCSHELL 0x7f118a317800 == 11 [pid = 1950] [id = 47]
11:25:21 INFO - --DOMWINDOW == 57 (0x7f118d586400) [pid = 1950] [serial = 75] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:21 INFO - --DOMWINDOW == 56 (0x7f118a9c1c00) [pid = 1950] [serial = 84] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:21 INFO - --DOMWINDOW == 55 (0x7f119657c400) [pid = 1950] [serial = 91] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 54 (0x7f1192410800) [pid = 1950] [serial = 89] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 53 (0x7f1182755c00) [pid = 1950] [serial = 77] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 52 (0x7f11881f5c00) [pid = 1950] [serial = 79] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 51 (0x7f118a9b8c00) [pid = 1950] [serial = 81] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:25:21 INFO - --DOMWINDOW == 50 (0x7f118d743c00) [pid = 1950] [serial = 76] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 49 (0x7f1184371800) [pid = 1950] [serial = 86] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:21 INFO - --DOMWINDOW == 48 (0x7f118d486800) [pid = 1950] [serial = 98] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 47 (0x7f119640b000) [pid = 1950] [serial = 92] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 46 (0x7f11918e9400) [pid = 1950] [serial = 90] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 45 (0x7f1182757c00) [pid = 1950] [serial = 78] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 44 (0x7f11881fd800) [pid = 1950] [serial = 80] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 43 (0x7f11881f0c00) [pid = 1950] [serial = 72] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:21 INFO - --DOMWINDOW == 42 (0x7f118f369000) [pid = 1950] [serial = 87] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:21 INFO - --DOMWINDOW == 41 (0x7f118f595000) [pid = 1950] [serial = 88] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 40 (0x7f1182424800) [pid = 1950] [serial = 74] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:21 INFO - --DOMWINDOW == 39 (0x7f118ce95000) [pid = 1950] [serial = 83] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:25:21 INFO - --DOMWINDOW == 38 (0x7f1183fc4000) [pid = 1950] [serial = 110] [outer = (nil)] [url = data:text/html;charset=utf8,
bug871156hello%20world]
11:25:21 INFO - --DOMWINDOW == 37 (0x7f1183fc8400) [pid = 1950] [serial = 111] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 36 (0x7f118758c800) [pid = 1950] [serial = 94] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 35 (0x7f1181fdf400) [pid = 1950] [serial = 104] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 34 (0x7f11838c0c00) [pid = 1950] [serial = 97] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:21 INFO - --DOMWINDOW == 33 (0x7f118a9b7400) [pid = 1950] [serial = 96] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 32 (0x7f118758bc00) [pid = 1950] [serial = 113] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 31 (0x7f118dba2000) [pid = 1950] [serial = 100] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:21 INFO - --DOMWINDOW == 30 (0x7f1181f53000) [pid = 1950] [serial = 106] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:21 INFO - --DOMWINDOW == 29 (0x7f11858fa800) [pid = 1950] [serial = 93] [outer = (nil)] [url = about:blank]
11:25:21 INFO - --DOMWINDOW == 28 (0x7f118a32a400) [pid = 1950] [serial = 95] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html]
11:25:21 INFO - --DOMWINDOW == 27 (0x7f119dd5cc00) [pid = 1950] [serial = 103] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html]
11:25:21 INFO - --DOMWINDOW == 26 (0x7f1196405c00) [pid = 1950] [serial = 102] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html]
11:25:21 INFO - --DOMWINDOW == 25 (0x7f119deb7400) [pid = 1950] [serial = 105] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html]
11:25:21 INFO - ++DOCSHELL 0x7f11826bf800 == 12 [pid = 1950] [id = 48]
11:25:21 INFO - ++DOMWINDOW == 26 (0x7f1183670c00) [pid = 1950] [serial = 117] [outer = (nil)]
11:25:21 INFO - ++DOMWINDOW == 27 (0x7f11837e6000) [pid = 1950] [serial = 118] [outer = 0x7f1183670c00]
11:25:22 INFO - MEMORY STAT | vsize 1149MB | residentFast 297MB | heapAllocated 108MB
11:25:22 INFO - 18 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js | took 5543ms
11:25:22 INFO - ++DOCSHELL 0x7f11824a0800 == 13 [pid = 1950] [id = 49]
11:25:22 INFO - ++DOMWINDOW == 28 (0x7f1188144400) [pid = 1950] [serial = 119] [outer = (nil)]
11:25:22 INFO - ++DOMWINDOW == 29 (0x7f118dd4f400) [pid = 1950] [serial = 120] [outer = 0x7f1188144400]
11:25:22 INFO - 19 INFO TEST-START | devtools/client/webconsole/test/browser_cached_messages.js
11:25:22 INFO - ++DOCSHELL 0x7f118a016000 == 14 [pid = 1950] [id = 50]
11:25:22 INFO - ++DOMWINDOW == 30 (0x7f118f35f400) [pid = 1950] [serial = 121] [outer = (nil)]
11:25:23 INFO - ++DOMWINDOW == 31 (0x7f118f5a2400) [pid = 1950] [serial = 122] [outer = 0x7f118f35f400]
11:25:23 INFO - ++DOMWINDOW == 32 (0x7f1190abac00) [pid = 1950] [serial = 123] [outer = 0x7f118f35f400]
11:25:23 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html, line 15: TypeError: foo.bazBug611032 is not a function
11:25:23 INFO - ++DOCSHELL 0x7f11826c3800 == 15 [pid = 1950] [id = 51]
11:25:23 INFO - ++DOMWINDOW == 33 (0x7f1182611000) [pid = 1950] [serial = 124] [outer = (nil)]
11:25:23 INFO - ++DOMWINDOW == 34 (0x7f1182750800) [pid = 1950] [serial = 125] [outer = 0x7f1182611000]
11:25:23 INFO - ++DOMWINDOW == 35 (0x7f118274d400) [pid = 1950] [serial = 126] [outer = 0x7f1182611000]
11:25:24 INFO - ++DOCSHELL 0x7f118400b800 == 16 [pid = 1950] [id = 52]
11:25:24 INFO - ++DOMWINDOW == 36 (0x7f118758d400) [pid = 1950] [serial = 127] [outer = (nil)]
11:25:24 INFO - ++DOMWINDOW == 37 (0x7f1188151000) [pid = 1950] [serial = 128] [outer = 0x7f118758d400]
11:25:27 INFO - --DOCSHELL 0x7f11826bf800 == 15 [pid = 1950] [id = 48]
11:25:27 INFO - --DOCSHELL 0x7f118400b800 == 14 [pid = 1950] [id = 52]
11:25:27 INFO - --DOCSHELL 0x7f1182497800 == 13 [pid = 1950] [id = 44]
11:25:27 INFO - --DOCSHELL 0x7f1183b0f000 == 12 [pid = 1950] [id = 45]
11:25:27 INFO - --DOCSHELL 0x7f1183e38800 == 11 [pid = 1950] [id = 46]
11:25:27 INFO - --DOMWINDOW == 36 (0x7f118f596400) [pid = 1950] [serial = 101] [outer = (nil)] [url = about:blank]
11:25:27 INFO - --DOMWINDOW == 35 (0x7f1181fdf800) [pid = 1950] [serial = 107] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:25:27 INFO - --DOMWINDOW == 34 (0x7f118ce92800) [pid = 1950] [serial = 99] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:27 INFO - --DOMWINDOW == 33 (0x7f1182750800) [pid = 1950] [serial = 125] [outer = (nil)] [url = about:blank]
11:25:27 INFO - --DOMWINDOW == 32 (0x7f1183670c00) [pid = 1950] [serial = 117] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:27 INFO - --DOMWINDOW == 31 (0x7f1183a7b400) [pid = 1950] [serial = 109] [outer = (nil)] [url = about:blank]
11:25:27 INFO - --DOMWINDOW == 30 (0x7f118a9b5c00) [pid = 1950] [serial = 115] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:27 INFO - --DOMWINDOW == 29 (0x7f118f5a2400) [pid = 1950] [serial = 122] [outer = (nil)] [url = about:blank]
11:25:27 INFO - --DOMWINDOW == 28 (0x7f1183673c00) [pid = 1950] [serial = 108] [outer = (nil)] [url = about:blank]
11:25:27 INFO - --DOMWINDOW == 27 (0x7f1183fc9000) [pid = 1950] [serial = 112] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:27 INFO - ++DOCSHELL 0x7f11824a6800 == 12 [pid = 1950] [id = 53]
11:25:27 INFO - ++DOMWINDOW == 28 (0x7f1181fe3000) [pid = 1950] [serial = 129] [outer = (nil)]
11:25:27 INFO - ++DOMWINDOW == 29 (0x7f1182422400) [pid = 1950] [serial = 130] [outer = 0x7f1181fe3000]
11:25:27 INFO - ++DOMWINDOW == 30 (0x7f1182424000) [pid = 1950] [serial = 131] [outer = 0x7f1181fe3000]
11:25:28 INFO - ++DOCSHELL 0x7f11835ef000 == 13 [pid = 1950] [id = 54]
11:25:28 INFO - ++DOMWINDOW == 31 (0x7f1183fc3800) [pid = 1950] [serial = 132] [outer = (nil)]
11:25:28 INFO - ++DOMWINDOW == 32 (0x7f1183fc6800) [pid = 1950] [serial = 133] [outer = 0x7f1183fc3800]
11:25:30 INFO - --DOCSHELL 0x7f11835ef000 == 12 [pid = 1950] [id = 54]
11:25:30 INFO - --DOCSHELL 0x7f11826c3800 == 11 [pid = 1950] [id = 51]
11:25:31 INFO - --DOMWINDOW == 31 (0x7f11837e6000) [pid = 1950] [serial = 118] [outer = (nil)] [url = about:blank]
11:25:31 INFO - --DOMWINDOW == 30 (0x7f118a9b7000) [pid = 1950] [serial = 116] [outer = (nil)] [url = about:blank]
11:25:31 INFO - --DOMWINDOW == 29 (0x7f118242ac00) [pid = 1950] [serial = 114] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:31 INFO - --DOMWINDOW == 28 (0x7f1182422400) [pid = 1950] [serial = 130] [outer = (nil)] [url = about:blank]
11:25:31 INFO - --DOMWINDOW == 27 (0x7f1182611000) [pid = 1950] [serial = 124] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:31 INFO - --DOMWINDOW == 26 (0x7f118758d400) [pid = 1950] [serial = 127] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:31 INFO - MEMORY STAT | vsize 1149MB | residentFast 288MB | heapAllocated 101MB
11:25:31 INFO - 20 INFO TEST-OK | devtools/client/webconsole/test/browser_cached_messages.js | took 8503ms
11:25:31 INFO - ++DOCSHELL 0x7f118249f800 == 12 [pid = 1950] [id = 55]
11:25:31 INFO - ++DOMWINDOW == 27 (0x7f118260ec00) [pid = 1950] [serial = 134] [outer = (nil)]
11:25:31 INFO - ++DOMWINDOW == 28 (0x7f118283ec00) [pid = 1950] [serial = 135] [outer = 0x7f118260ec00]
11:25:31 INFO - 21 INFO TEST-START | devtools/client/webconsole/test/browser_console.js
11:25:31 INFO - ++DOCSHELL 0x7f11835e0000 == 13 [pid = 1950] [id = 56]
11:25:31 INFO - ++DOMWINDOW == 29 (0x7f11838bd400) [pid = 1950] [serial = 136] [outer = (nil)]
11:25:31 INFO - ++DOMWINDOW == 30 (0x7f11838e0400) [pid = 1950] [serial = 137] [outer = 0x7f11838bd400]
11:25:32 INFO - ++DOMWINDOW == 31 (0x7f1183fc2800) [pid = 1950] [serial = 138] [outer = 0x7f11838bd400]
11:25:32 INFO - ++DOCSHELL 0x7f11853ee800 == 14 [pid = 1950] [id = 57]
11:25:32 INFO - ++DOMWINDOW == 32 (0x7f11858fdc00) [pid = 1950] [serial = 139] [outer = (nil)]
11:25:32 INFO - ++DOMWINDOW == 33 (0x7f118758c800) [pid = 1950] [serial = 140] [outer = 0x7f11858fdc00]
11:25:33 INFO - JavaScript error: chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_console.js, line 41: ReferenceError: foobarExceptionBug587757 is not defined
11:25:33 INFO - console.log: xhr loaded, status is: 200
11:25:33 INFO - console.log: xhr error loaded, status is: 404
11:25:33 INFO - [1950] WARNING: 'NS_FAILED(rr->RetargetDeliveryTo(sts))', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/fetch/FetchDriver.cpp, line 599
11:25:33 INFO - console.log: fetch loaded
11:25:34 INFO - MEMORY STAT | vsize 1152MB | residentFast 297MB | heapAllocated 108MB
11:25:34 INFO - 22 INFO TEST-OK | devtools/client/webconsole/test/browser_console.js | took 2971ms
11:25:34 INFO - ++DOCSHELL 0x7f11846a2800 == 15 [pid = 1950] [id = 58]
11:25:34 INFO - ++DOMWINDOW == 34 (0x7f11858fb800) [pid = 1950] [serial = 141] [outer = (nil)]
11:25:34 INFO - ++DOMWINDOW == 35 (0x7f11881f6800) [pid = 1950] [serial = 142] [outer = 0x7f11858fb800]
11:25:35 INFO - 23 INFO TEST-START | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js
11:25:35 INFO - ++DOCSHELL 0x7f11826b9000 == 16 [pid = 1950] [id = 59]
11:25:35 INFO - ++DOMWINDOW == 36 (0x7f118242a400) [pid = 1950] [serial = 143] [outer = (nil)]
11:25:35 INFO - ++DOMWINDOW == 37 (0x7f1182611000) [pid = 1950] [serial = 144] [outer = 0x7f118242a400]
11:25:35 INFO - ++DOCSHELL 0x7f11853e6000 == 17 [pid = 1950] [id = 60]
11:25:35 INFO - ++DOMWINDOW == 38 (0x7f11838bb400) [pid = 1950] [serial = 145] [outer = (nil)]
11:25:35 INFO - ++DOMWINDOW == 39 (0x7f1183fcd400) [pid = 1950] [serial = 146] [outer = 0x7f11838bb400]
11:25:35 INFO - ++DOMWINDOW == 40 (0x7f1183e61c00) [pid = 1950] [serial = 147] [outer = 0x7f11838bb400]
11:25:36 INFO - ++DOCSHELL 0x7f118d5e3000 == 18 [pid = 1950] [id = 61]
11:25:36 INFO - ++DOMWINDOW == 41 (0x7f118ce9ec00) [pid = 1950] [serial = 148] [outer = (nil)]
11:25:36 INFO - ++DOMWINDOW == 42 (0x7f118d583400) [pid = 1950] [serial = 149] [outer = 0x7f118ce9ec00]
11:25:38 INFO - ++DOCSHELL 0x7f118f148800 == 19 [pid = 1950] [id = 62]
11:25:38 INFO - ++DOMWINDOW == 43 (0x7f11916d2000) [pid = 1950] [serial = 150] [outer = (nil)]
11:25:38 INFO - ++DOMWINDOW == 44 (0x7f1191939000) [pid = 1950] [serial = 151] [outer = 0x7f11916d2000]
11:25:38 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 205: TypeError: this._toolPanels is not iterable
11:25:40 INFO - --DOCSHELL 0x7f11824a6800 == 18 [pid = 1950] [id = 53]
11:25:40 INFO - --DOCSHELL 0x7f118a016000 == 17 [pid = 1950] [id = 50]
11:25:40 INFO - --DOCSHELL 0x7f118249f800 == 16 [pid = 1950] [id = 55]
11:25:40 INFO - --DOCSHELL 0x7f11835e0000 == 15 [pid = 1950] [id = 56]
11:25:40 INFO - --DOCSHELL 0x7f11824a0800 == 14 [pid = 1950] [id = 49]
11:25:40 INFO - --DOCSHELL 0x7f11853ee800 == 13 [pid = 1950] [id = 57]
11:25:40 INFO - --DOMWINDOW == 43 (0x7f1188151000) [pid = 1950] [serial = 128] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 42 (0x7f118274d400) [pid = 1950] [serial = 126] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:40 INFO - --DOMWINDOW == 41 (0x7f11858fdc00) [pid = 1950] [serial = 139] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:40 INFO - --DOMWINDOW == 40 (0x7f118283ec00) [pid = 1950] [serial = 135] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 39 (0x7f118260ec00) [pid = 1950] [serial = 134] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 38 (0x7f1183fcd400) [pid = 1950] [serial = 146] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 37 (0x7f118dd4f400) [pid = 1950] [serial = 120] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 36 (0x7f11838e0400) [pid = 1950] [serial = 137] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 35 (0x7f1181fe3000) [pid = 1950] [serial = 129] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:40 INFO - --DOMWINDOW == 34 (0x7f1183fc3800) [pid = 1950] [serial = 132] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:40 INFO - --DOMWINDOW == 33 (0x7f1188144400) [pid = 1950] [serial = 119] [outer = (nil)] [url = about:blank]
11:25:40 INFO - --DOMWINDOW == 32 (0x7f11838bd400) [pid = 1950] [serial = 136] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1454441131744]
11:25:40 INFO - --DOMWINDOW == 31 (0x7f118f35f400) [pid = 1950] [serial = 121] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html]
11:25:40 INFO - --DOMWINDOW == 30 (0x7f118ce9ec00) [pid = 1950] [serial = 148] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:25:41 INFO - --DOMWINDOW == 29 (0x7f1190abac00) [pid = 1950] [serial = 123] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html]
11:25:41 INFO - MEMORY STAT | vsize 1152MB | residentFast 297MB | heapAllocated 106MB
11:25:41 INFO - 24 INFO TEST-OK | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js | took 6145ms
11:25:41 INFO - ++DOCSHELL 0x7f11827e0800 == 14 [pid = 1950] [id = 63]
11:25:41 INFO - ++DOMWINDOW == 30 (0x7f11835a6c00) [pid = 1950] [serial = 152] [outer = (nil)]
11:25:41 INFO - ++DOMWINDOW == 31 (0x7f11838c0800) [pid = 1950] [serial = 153] [outer = 0x7f11835a6c00]
11:25:41 INFO - 25 INFO TEST-START | devtools/client/webconsole/test/browser_console_clear_on_reload.js
11:25:41 INFO - ++DOCSHELL 0x7f1183e38800 == 15 [pid = 1950] [id = 64]
11:25:41 INFO - ++DOMWINDOW == 32 (0x7f1181f54800) [pid = 1950] [serial = 154] [outer = (nil)]
11:25:41 INFO - ++DOMWINDOW == 33 (0x7f1183fca000) [pid = 1950] [serial = 155] [outer = 0x7f1181f54800]
11:25:41 INFO - ++DOMWINDOW == 34 (0x7f11858f1800) [pid = 1950] [serial = 156] [outer = 0x7f1181f54800]
11:25:41 INFO - ++DOCSHELL 0x7f11826c5000 == 16 [pid = 1950] [id = 65]
11:25:41 INFO - ++DOMWINDOW == 35 (0x7f1182611800) [pid = 1950] [serial = 157] [outer = (nil)]
11:25:41 INFO - ++DOMWINDOW == 36 (0x7f118586b400) [pid = 1950] [serial = 158] [outer = 0x7f1182611800]
11:25:42 INFO - ++DOMWINDOW == 37 (0x7f11858f8400) [pid = 1950] [serial = 159] [outer = 0x7f1182611800]
11:25:42 INFO - ++DOCSHELL 0x7f118a9a5000 == 17 [pid = 1950] [id = 66]
11:25:42 INFO - ++DOMWINDOW == 38 (0x7f118ce95400) [pid = 1950] [serial = 160] [outer = (nil)]
11:25:42 INFO - ++DOMWINDOW == 39 (0x7f118ce9ac00) [pid = 1950] [serial = 161] [outer = 0x7f118ce95400]
11:25:44 INFO - ++DOCSHELL 0x7f118f14c800 == 18 [pid = 1950] [id = 67]
11:25:44 INFO - ++DOMWINDOW == 40 (0x7f1192339800) [pid = 1950] [serial = 162] [outer = (nil)]
11:25:44 INFO - ++DOMWINDOW == 41 (0x7f119233b800) [pid = 1950] [serial = 163] [outer = 0x7f1192339800]
11:25:45 INFO - --DOCSHELL 0x7f118d5e3000 == 17 [pid = 1950] [id = 61]
11:25:45 INFO - --DOCSHELL 0x7f118f148800 == 16 [pid = 1950] [id = 62]
11:25:45 INFO - --DOCSHELL 0x7f11826b9000 == 15 [pid = 1950] [id = 59]
11:25:45 INFO - --DOCSHELL 0x7f11853e6000 == 14 [pid = 1950] [id = 60]
11:25:45 INFO - --DOCSHELL 0x7f11846a2800 == 13 [pid = 1950] [id = 58]
11:25:45 INFO - --DOCSHELL 0x7f118f14c800 == 12 [pid = 1950] [id = 67]
11:25:45 INFO - --DOMWINDOW == 40 (0x7f118758c800) [pid = 1950] [serial = 140] [outer = (nil)] [url = about:blank]
11:25:45 INFO - --DOMWINDOW == 39 (0x7f118d583400) [pid = 1950] [serial = 149] [outer = (nil)] [url = about:blank]
11:25:45 INFO - --DOMWINDOW == 38 (0x7f1183fc6800) [pid = 1950] [serial = 133] [outer = (nil)] [url = about:blank]
11:25:45 INFO - --DOMWINDOW == 37 (0x7f1182424000) [pid = 1950] [serial = 131] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:25:45 INFO - --DOMWINDOW == 36 (0x7f1183fc2800) [pid = 1950] [serial = 138] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1454441131744]
11:25:46 INFO - ++DOCSHELL 0x7f1182496800 == 13 [pid = 1950] [id = 68]
11:25:46 INFO - ++DOMWINDOW == 37 (0x7f1182755c00) [pid = 1950] [serial = 164] [outer = (nil)]
11:25:46 INFO - ++DOMWINDOW == 38 (0x7f118283d800) [pid = 1950] [serial = 165] [outer = 0x7f1182755c00]
11:25:46 INFO - ++DOMWINDOW == 39 (0x7f11838c5c00) [pid = 1950] [serial = 166] [outer = 0x7f1181f54800]
11:25:46 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:25:47 INFO - --DOCSHELL 0x7f118a9a5000 == 12 [pid = 1950] [id = 66]
11:25:47 INFO - MEMORY STAT | vsize 1186MB | residentFast 292MB | heapAllocated 106MB
11:25:47 INFO - 26 INFO TEST-OK | devtools/client/webconsole/test/browser_console_clear_on_reload.js | took 6378ms
11:25:47 INFO - ++DOCSHELL 0x7f11835da800 == 13 [pid = 1950] [id = 69]
11:25:47 INFO - ++DOMWINDOW == 40 (0x7f1185335800) [pid = 1950] [serial = 167] [outer = (nil)]
11:25:47 INFO - ++DOMWINDOW == 41 (0x7f11872b6c00) [pid = 1950] [serial = 168] [outer = 0x7f1185335800]
11:25:48 INFO - 27 INFO TEST-START | devtools/client/webconsole/test/browser_console_click_focus.js
11:25:48 INFO - ++DOCSHELL 0x7f118a014800 == 14 [pid = 1950] [id = 70]
11:25:48 INFO - ++DOMWINDOW == 42 (0x7f1188144c00) [pid = 1950] [serial = 169] [outer = (nil)]
11:25:48 INFO - ++DOMWINDOW == 43 (0x7f11881f3c00) [pid = 1950] [serial = 170] [outer = 0x7f1188144c00]
11:25:48 INFO - ++DOMWINDOW == 44 (0x7f118a335000) [pid = 1950] [serial = 171] [outer = 0x7f1188144c00]
11:25:48 INFO - ++DOCSHELL 0x7f11827df000 == 15 [pid = 1950] [id = 71]
11:25:48 INFO - ++DOMWINDOW == 45 (0x7f1182610000) [pid = 1950] [serial = 172] [outer = (nil)]
11:25:48 INFO - ++DOMWINDOW == 46 (0x7f11835a3000) [pid = 1950] [serial = 173] [outer = 0x7f1182610000]
11:25:48 INFO - ++DOMWINDOW == 47 (0x7f118260c800) [pid = 1950] [serial = 174] [outer = 0x7f1182610000]
11:25:49 INFO - ++DOCSHELL 0x7f118a992800 == 16 [pid = 1950] [id = 72]
11:25:49 INFO - ++DOMWINDOW == 48 (0x7f118a9bc400) [pid = 1950] [serial = 175] [outer = (nil)]
11:25:49 INFO - ++DOMWINDOW == 49 (0x7f118a9bf800) [pid = 1950] [serial = 176] [outer = 0x7f118a9bc400]
11:25:52 INFO - MEMORY STAT | vsize 1189MB | residentFast 299MB | heapAllocated 112MB
11:25:52 INFO - 28 INFO TEST-OK | devtools/client/webconsole/test/browser_console_click_focus.js | took 4146ms
11:25:52 INFO - ++DOCSHELL 0x7f118d380000 == 17 [pid = 1950] [id = 73]
11:25:52 INFO - ++DOMWINDOW == 50 (0x7f1183fd8400) [pid = 1950] [serial = 177] [outer = (nil)]
11:25:52 INFO - ++DOMWINDOW == 51 (0x7f118d345400) [pid = 1950] [serial = 178] [outer = 0x7f1183fd8400]
11:25:52 INFO - 29 INFO TEST-START | devtools/client/webconsole/test/browser_console_consolejsm_output.js
11:25:52 INFO - console.log: bug861338-log-cached
11:25:52 INFO - ++DOCSHELL 0x7f119104e000 == 18 [pid = 1950] [id = 74]
11:25:52 INFO - ++DOMWINDOW == 52 (0x7f11910ab000) [pid = 1950] [serial = 179] [outer = (nil)]
11:25:52 INFO - ++DOMWINDOW == 53 (0x7f11910b0800) [pid = 1950] [serial = 180] [outer = 0x7f11910ab000]
11:25:53 INFO - console.time: 'foobarTimer' @ Tue Feb 02 2016 11:25:53 GMT-0800 (PST)
11:25:53 INFO - console.log: bug851231-log
11:25:53 INFO - console.info: bug851231-info
11:25:53 INFO - console.warn: bug851231-warn
11:25:53 INFO - console.error:
11:25:53 INFO - bug851231-error
11:25:53 INFO - Object
11:25:53 INFO - - bug851231prop = bug851231value
11:25:53 INFO - console.debug:
11:25:53 INFO - bug851231-debug
11:25:53 INFO - console.dir:
11:25:53 INFO - XULDocument
11:25:53 INFO - - location = Location {"href":"chrome://browser/content/browser.xul","origin":"chrome://browser","protocol":"chrome:","host":"browser","hostname":"browser","port":"","pathname":"/content/browser.xul","search":"","hash":""}
11:25:53 INFO - console.trace:
11:25:53 INFO - _onsolejsm_output.js 42 testTrace
11:25:53 INFO - _onsolejsm_output.js 54
11:25:53 INFO - _re/modules/Task.jsm 319 TaskImpl_run
11:25:53 INFO - _/Promise-backend.js 937 Handler.prototype.process
11:25:53 INFO - _/Promise-backend.js 816 this.PromiseWalker.walkerLoop
11:25:53 INFO - console.timeEnd: 'foobarTimer' 77ms
11:25:53 INFO - ++DOCSHELL 0x7f1192559800 == 19 [pid = 1950] [id = 75]
11:25:53 INFO - ++DOMWINDOW == 54 (0x7f1196586000) [pid = 1950] [serial = 181] [outer = (nil)]
11:25:53 INFO - ++DOMWINDOW == 55 (0x7f1196583400) [pid = 1950] [serial = 182] [outer = 0x7f1196586000]
11:25:54 INFO - ++DOCSHELL 0x7f11926d8800 == 20 [pid = 1950] [id = 76]
11:25:54 INFO - ++DOMWINDOW == 56 (0x7f119e2b4c00) [pid = 1950] [serial = 183] [outer = (nil)]
11:25:54 INFO - ++DOMWINDOW == 57 (0x7f119e2b9000) [pid = 1950] [serial = 184] [outer = 0x7f119e2b4c00]
11:25:56 INFO - console.error: Log Prefix:
11:25:56 INFO - Testing a prefix
11:25:57 INFO - ++DOCSHELL 0x7f1183648800 == 21 [pid = 1950] [id = 77]
11:25:57 INFO - ++DOMWINDOW == 58 (0x7f119240d400) [pid = 1950] [serial = 185] [outer = (nil)]
11:25:57 INFO - ++DOMWINDOW == 59 (0x7f11925e0400) [pid = 1950] [serial = 186] [outer = 0x7f119240d400]
11:25:58 INFO - console.error:
11:25:58 INFO - Error should be shown
11:25:58 INFO - ++DOCSHELL 0x7f1192445000 == 22 [pid = 1950] [id = 78]
11:25:58 INFO - ++DOMWINDOW == 60 (0x7f119deb4000) [pid = 1950] [serial = 187] [outer = (nil)]
11:25:58 INFO - ++DOMWINDOW == 61 (0x7f119deba800) [pid = 1950] [serial = 188] [outer = 0x7f119deb4000]
11:25:59 INFO - console.error:
11:25:59 INFO - Error should be shown
11:25:59 INFO - console.warn: Warn should be shown due to the initial pref value
11:25:59 INFO - console.info: info should be shown due to the pref change being observed
11:25:59 INFO - console.error:
11:25:59 INFO - Should be shown due to defaulting to error
11:25:59 INFO - ++DOCSHELL 0x7f1183659000 == 23 [pid = 1950] [id = 79]
11:25:59 INFO - ++DOMWINDOW == 62 (0x7f1182844c00) [pid = 1950] [serial = 189] [outer = (nil)]
11:25:59 INFO - ++DOMWINDOW == 63 (0x7f11835a3400) [pid = 1950] [serial = 190] [outer = 0x7f1182844c00]
11:26:00 INFO - --DOCSHELL 0x7f1182496800 == 22 [pid = 1950] [id = 68]
11:26:00 INFO - --DOCSHELL 0x7f11826c5000 == 21 [pid = 1950] [id = 65]
11:26:00 INFO - MEMORY STAT | vsize 1192MB | residentFast 307MB | heapAllocated 117MB
11:26:00 INFO - 30 INFO TEST-OK | devtools/client/webconsole/test/browser_console_consolejsm_output.js | took 8232ms
11:26:00 INFO - ++DOCSHELL 0x7f11826c2000 == 22 [pid = 1950] [id = 80]
11:26:00 INFO - ++DOMWINDOW == 64 (0x7f1183672000) [pid = 1950] [serial = 191] [outer = (nil)]
11:26:00 INFO - ++DOMWINDOW == 65 (0x7f1183fce400) [pid = 1950] [serial = 192] [outer = 0x7f1183672000]
11:26:01 INFO - 31 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_command.js
11:26:01 INFO - ++DOCSHELL 0x7f11872d8800 == 23 [pid = 1950] [id = 81]
11:26:01 INFO - ++DOMWINDOW == 66 (0x7f118d407800) [pid = 1950] [serial = 193] [outer = (nil)]
11:26:01 INFO - ++DOMWINDOW == 67 (0x7f118da9a000) [pid = 1950] [serial = 194] [outer = 0x7f118d407800]
11:26:01 INFO - ++DOCSHELL 0x7f118d920000 == 24 [pid = 1950] [id = 82]
11:26:01 INFO - ++DOMWINDOW == 68 (0x7f118da9f000) [pid = 1950] [serial = 195] [outer = (nil)]
11:26:01 INFO - ++DOMWINDOW == 69 (0x7f1190aba800) [pid = 1950] [serial = 196] [outer = 0x7f118da9f000]
11:26:01 INFO - ++DOMWINDOW == 70 (0x7f118f594800) [pid = 1950] [serial = 197] [outer = 0x7f118da9f000]
11:26:02 INFO - ++DOCSHELL 0x7f1190adc000 == 25 [pid = 1950] [id = 83]
11:26:02 INFO - ++DOMWINDOW == 71 (0x7f1192e8c400) [pid = 1950] [serial = 198] [outer = (nil)]
11:26:02 INFO - ++DOMWINDOW == 72 (0x7f1192ef6400) [pid = 1950] [serial = 199] [outer = 0x7f1192e8c400]
11:26:03 INFO - --DOMWINDOW == 71 (0x7f11858fb800) [pid = 1950] [serial = 141] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 70 (0x7f118242a400) [pid = 1950] [serial = 143] [outer = (nil)] [url = data:text/html;charset=utf8,
hello%20world%20from%20bug%20866950]
11:26:03 INFO - --DOMWINDOW == 69 (0x7f118586b400) [pid = 1950] [serial = 158] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 68 (0x7f11881f6800) [pid = 1950] [serial = 142] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 67 (0x7f1182611000) [pid = 1950] [serial = 144] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 66 (0x7f11835a6c00) [pid = 1950] [serial = 152] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 65 (0x7f11838c0800) [pid = 1950] [serial = 153] [outer = (nil)] [url = about:blank]
11:26:03 INFO - --DOMWINDOW == 64 (0x7f1183fca000) [pid = 1950] [serial = 155] [outer = (nil)] [url = about:blank]
11:26:04 INFO - MEMORY STAT | vsize 1194MB | residentFast 317MB | heapAllocated 122MB
11:26:04 INFO - 32 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_command.js | took 3711ms
11:26:04 INFO - ++DOCSHELL 0x7f118281a000 == 26 [pid = 1950] [id = 84]
11:26:04 INFO - ++DOMWINDOW == 65 (0x7f118db05800) [pid = 1950] [serial = 200] [outer = (nil)]
11:26:04 INFO - ++DOMWINDOW == 66 (0x7f119193a800) [pid = 1950] [serial = 201] [outer = 0x7f118db05800]
11:26:05 INFO - 33 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js
11:26:05 INFO - ++DOCSHELL 0x7f11906b0800 == 27 [pid = 1950] [id = 85]
11:26:05 INFO - ++DOMWINDOW == 67 (0x7f119eedd000) [pid = 1950] [serial = 202] [outer = (nil)]
11:26:05 INFO - ++DOMWINDOW == 68 (0x7f11a11ebc00) [pid = 1950] [serial = 203] [outer = 0x7f119eedd000]
11:26:06 INFO - --DOCSHELL 0x7f1192559800 == 26 [pid = 1950] [id = 75]
11:26:06 INFO - --DOCSHELL 0x7f118a992800 == 25 [pid = 1950] [id = 72]
11:26:06 INFO - --DOCSHELL 0x7f1190adc000 == 24 [pid = 1950] [id = 83]
11:26:06 INFO - --DOCSHELL 0x7f11926d8800 == 23 [pid = 1950] [id = 76]
11:26:06 INFO - --DOCSHELL 0x7f119104e000 == 22 [pid = 1950] [id = 74]
11:26:06 INFO - --DOCSHELL 0x7f1183648800 == 21 [pid = 1950] [id = 77]
11:26:06 INFO - --DOCSHELL 0x7f1192445000 == 20 [pid = 1950] [id = 78]
11:26:07 INFO - --DOMWINDOW == 67 (0x7f1182755c00) [pid = 1950] [serial = 164] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:07 INFO - --DOMWINDOW == 66 (0x7f1192339800) [pid = 1950] [serial = 162] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:07 INFO - --DOMWINDOW == 65 (0x7f119e2b4c00) [pid = 1950] [serial = 183] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:07 INFO - --DOMWINDOW == 64 (0x7f1196586000) [pid = 1950] [serial = 181] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:07 INFO - --DOMWINDOW == 63 (0x7f1182610000) [pid = 1950] [serial = 172] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:07 INFO - --DOMWINDOW == 62 (0x7f1182611800) [pid = 1950] [serial = 157] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:07 INFO - --DOMWINDOW == 61 (0x7f11838bb400) [pid = 1950] [serial = 145] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:07 INFO - --DOMWINDOW == 60 (0x7f11916d2000) [pid = 1950] [serial = 150] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:07 INFO - --DOMWINDOW == 59 (0x7f118d407800) [pid = 1950] [serial = 193] [outer = (nil)] [url = data:text/html;charset=utf-8,
%20%20%20%20%20%20
Testing%20copy%20command
%20%20%20%20
This%20is%20some%20example%20text
%20%20%20%20
Lorem%20ipsum%20dolor%20sit%20amet,%20consectetur%20adipisicing%20elit,%20sed%20do%20eiusmod%20tempor%20incididunt%20ut%20labore%20et%20dolore%20magna%20aliqua.%20Ut%20enim%20ad%20minim%20veniam,%20quis%20nostrud%20exercitation%20ullamco%20laboris%20nisi%20ut%20aliquip%20ex%20ea%20commodo%20consequat.%20Duis%20aute%20irure%20dolor%20in%20reprehenderit%20in%20voluptate%20velit%20esse%20cillum%20dolore%20eu%20fugiat%20nulla%20pariatur.%20Excepteur%20sint%20occaecat%20cupidatat%20non%20proident,%20sunt%20in%20culpa%20qui%20officia%20deserunt%20mollit%20anim%20id%20est%20laborum.Tue%20Feb%2002%202016%2011:26:01%20GMT-0800%20(PST)
%20%20
%20%20]
11:26:07 INFO - --DOMWINDOW == 58 (0x7f1181f54800) [pid = 1950] [serial = 154] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:07 INFO - --DOMWINDOW == 57 (0x7f1185335800) [pid = 1950] [serial = 167] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 56 (0x7f1188144c00) [pid = 1950] [serial = 169] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:07 INFO - --DOMWINDOW == 55 (0x7f1183fd8400) [pid = 1950] [serial = 177] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 54 (0x7f1190aba800) [pid = 1950] [serial = 196] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 53 (0x7f11835a3000) [pid = 1950] [serial = 173] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 52 (0x7f11872b6c00) [pid = 1950] [serial = 168] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 51 (0x7f11881f3c00) [pid = 1950] [serial = 170] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 50 (0x7f118d345400) [pid = 1950] [serial = 178] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 49 (0x7f1192e8c400) [pid = 1950] [serial = 198] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:07 INFO - --DOMWINDOW == 48 (0x7f118a9bc400) [pid = 1950] [serial = 175] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:07 INFO - --DOMWINDOW == 47 (0x7f1183fce400) [pid = 1950] [serial = 192] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 46 (0x7f1183672000) [pid = 1950] [serial = 191] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 45 (0x7f118ce95400) [pid = 1950] [serial = 160] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:07 INFO - --DOMWINDOW == 44 (0x7f118da9a000) [pid = 1950] [serial = 194] [outer = (nil)] [url = about:blank]
11:26:07 INFO - --DOMWINDOW == 43 (0x7f11838c5c00) [pid = 1950] [serial = 166] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:07 INFO - --DOMWINDOW == 42 (0x7f11858f1800) [pid = 1950] [serial = 156] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:07 INFO - ++DOMWINDOW == 43 (0x7f1182610000) [pid = 1950] [serial = 204] [outer = 0x7f119eedd000]
11:26:07 INFO - ++DOCSHELL 0x7f11827e4000 == 21 [pid = 1950] [id = 86]
11:26:07 INFO - ++DOMWINDOW == 44 (0x7f1183671400) [pid = 1950] [serial = 205] [outer = (nil)]
11:26:07 INFO - ++DOMWINDOW == 45 (0x7f1183e67000) [pid = 1950] [serial = 206] [outer = 0x7f1183671400]
11:26:07 INFO - ++DOMWINDOW == 46 (0x7f118366e800) [pid = 1950] [serial = 207] [outer = 0x7f1183671400]
11:26:08 INFO - ++DOCSHELL 0x7f1188165000 == 22 [pid = 1950] [id = 87]
11:26:08 INFO - ++DOMWINDOW == 47 (0x7f118a3ec000) [pid = 1950] [serial = 208] [outer = (nil)]
11:26:08 INFO - ++DOMWINDOW == 48 (0x7f118a9b5800) [pid = 1950] [serial = 209] [outer = 0x7f118a3ec000]
11:26:10 INFO - --DOCSHELL 0x7f1188165000 == 21 [pid = 1950] [id = 87]
11:26:11 INFO - --DOMWINDOW == 47 (0x7f118ce9ac00) [pid = 1950] [serial = 161] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 46 (0x7f118260c800) [pid = 1950] [serial = 174] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:11 INFO - --DOMWINDOW == 45 (0x7f118283d800) [pid = 1950] [serial = 165] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:11 INFO - --DOMWINDOW == 44 (0x7f119233b800) [pid = 1950] [serial = 163] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:11 INFO - --DOMWINDOW == 43 (0x7f119e2b9000) [pid = 1950] [serial = 184] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 42 (0x7f1196583400) [pid = 1950] [serial = 182] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 41 (0x7f118a335000) [pid = 1950] [serial = 171] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:11 INFO - --DOMWINDOW == 40 (0x7f1183e61c00) [pid = 1950] [serial = 147] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:11 INFO - --DOMWINDOW == 39 (0x7f1192ef6400) [pid = 1950] [serial = 199] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 38 (0x7f1191939000) [pid = 1950] [serial = 151] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 37 (0x7f118a9bf800) [pid = 1950] [serial = 176] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 36 (0x7f11858f8400) [pid = 1950] [serial = 159] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:11 INFO - --DOMWINDOW == 35 (0x7f11a11ebc00) [pid = 1950] [serial = 203] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 34 (0x7f1183e67000) [pid = 1950] [serial = 206] [outer = (nil)] [url = about:blank]
11:26:11 INFO - --DOMWINDOW == 33 (0x7f118da9f000) [pid = 1950] [serial = 195] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:11 INFO - MEMORY STAT | vsize 1194MB | residentFast 309MB | heapAllocated 109MB
11:26:11 INFO - 34 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js | took 6365ms
11:26:11 INFO - ++DOCSHELL 0x7f11824a0000 == 22 [pid = 1950] [id = 88]
11:26:11 INFO - ++DOMWINDOW == 34 (0x7f118359f400) [pid = 1950] [serial = 210] [outer = (nil)]
11:26:11 INFO - ++DOMWINDOW == 35 (0x7f11838c5c00) [pid = 1950] [serial = 211] [outer = 0x7f118359f400]
11:26:11 INFO - 35 INFO TEST-START | devtools/client/webconsole/test/browser_console_dead_objects.js
11:26:12 INFO - ++DOCSHELL 0x7f1187d7c800 == 23 [pid = 1950] [id = 89]
11:26:12 INFO - ++DOMWINDOW == 36 (0x7f11858f6400) [pid = 1950] [serial = 212] [outer = (nil)]
11:26:12 INFO - ++DOMWINDOW == 37 (0x7f11872bac00) [pid = 1950] [serial = 213] [outer = 0x7f11858f6400]
11:26:12 INFO - ++DOCSHELL 0x7f11824a7000 == 24 [pid = 1950] [id = 90]
11:26:12 INFO - ++DOMWINDOW == 38 (0x7f118ce97000) [pid = 1950] [serial = 214] [outer = (nil)]
11:26:12 INFO - ++DOMWINDOW == 39 (0x7f118ce97c00) [pid = 1950] [serial = 215] [outer = 0x7f118ce97000]
11:26:13 INFO - ++DOCSHELL 0x7f1183b2a000 == 25 [pid = 1950] [id = 91]
11:26:13 INFO - ++DOMWINDOW == 40 (0x7f11916ce400) [pid = 1950] [serial = 216] [outer = (nil)]
11:26:13 INFO - ++DOMWINDOW == 41 (0x7f11916cec00) [pid = 1950] [serial = 217] [outer = 0x7f11916ce400]
11:26:14 INFO - MEMORY STAT | vsize 1196MB | residentFast 315MB | heapAllocated 115MB
11:26:14 INFO - 36 INFO TEST-OK | devtools/client/webconsole/test/browser_console_dead_objects.js | took 2979ms
11:26:14 INFO - ++DOCSHELL 0x7f11826c0800 == 26 [pid = 1950] [id = 92]
11:26:14 INFO - ++DOMWINDOW == 42 (0x7f1183e67000) [pid = 1950] [serial = 218] [outer = (nil)]
11:26:14 INFO - ++DOMWINDOW == 43 (0x7f118d407000) [pid = 1950] [serial = 219] [outer = 0x7f1183e67000]
11:26:15 INFO - 37 INFO TEST-START | devtools/client/webconsole/test/browser_console_error_source_click.js
11:26:15 INFO - ++DOCSHELL 0x7f118248d800 == 27 [pid = 1950] [id = 93]
11:26:15 INFO - ++DOMWINDOW == 44 (0x7f1181fe1c00) [pid = 1950] [serial = 220] [outer = (nil)]
11:26:15 INFO - ++DOMWINDOW == 45 (0x7f118260ec00) [pid = 1950] [serial = 221] [outer = 0x7f1181fe1c00]
11:26:15 INFO - ++DOCSHELL 0x7f118469e000 == 28 [pid = 1950] [id = 94]
11:26:15 INFO - ++DOMWINDOW == 46 (0x7f118814f000) [pid = 1950] [serial = 222] [outer = (nil)]
11:26:15 INFO - ++DOMWINDOW == 47 (0x7f11881f1000) [pid = 1950] [serial = 223] [outer = 0x7f118814f000]
11:26:16 INFO - JavaScript error: data:text/html;charset=utf8,hello%20world%20from%20bug%20877778%20, line 1: ReferenceError: foobar is not defined
11:26:17 INFO - MEMORY STAT | vsize 1197MB | residentFast 312MB | heapAllocated 112MB
11:26:17 INFO - 38 INFO TEST-OK | devtools/client/webconsole/test/browser_console_error_source_click.js | took 2338ms
11:26:17 INFO - ++DOCSHELL 0x7f11826c3000 == 29 [pid = 1950] [id = 95]
11:26:17 INFO - ++DOMWINDOW == 48 (0x7f118533e000) [pid = 1950] [serial = 224] [outer = (nil)]
11:26:17 INFO - ++DOMWINDOW == 49 (0x7f118a330c00) [pid = 1950] [serial = 225] [outer = 0x7f118533e000]
11:26:17 INFO - 39 INFO TEST-START | devtools/client/webconsole/test/browser_console_filters.js
11:26:17 INFO - ++DOCSHELL 0x7f1190483000 == 30 [pid = 1950] [id = 96]
11:26:17 INFO - ++DOMWINDOW == 50 (0x7f118ce99400) [pid = 1950] [serial = 226] [outer = (nil)]
11:26:17 INFO - ++DOMWINDOW == 51 (0x7f118d346000) [pid = 1950] [serial = 227] [outer = 0x7f118ce99400]
11:26:18 INFO - ++DOCSHELL 0x7f1191056800 == 31 [pid = 1950] [id = 97]
11:26:18 INFO - ++DOMWINDOW == 52 (0x7f119165dc00) [pid = 1950] [serial = 228] [outer = (nil)]
11:26:18 INFO - ++DOMWINDOW == 53 (0x7f11916c5c00) [pid = 1950] [serial = 229] [outer = 0x7f119165dc00]
11:26:18 INFO - ++DOMWINDOW == 54 (0x7f1190abb000) [pid = 1950] [serial = 230] [outer = 0x7f119165dc00]
11:26:18 INFO - ++DOCSHELL 0x7f1191992000 == 32 [pid = 1950] [id = 98]
11:26:18 INFO - ++DOMWINDOW == 55 (0x7f1192678800) [pid = 1950] [serial = 231] [outer = (nil)]
11:26:19 INFO - ++DOMWINDOW == 56 (0x7f119267f400) [pid = 1950] [serial = 232] [outer = 0x7f1192678800]
11:26:22 INFO - --DOCSHELL 0x7f1183659000 == 31 [pid = 1950] [id = 79]
11:26:22 INFO - --DOCSHELL 0x7f11827e0800 == 30 [pid = 1950] [id = 63]
11:26:22 INFO - --DOCSHELL 0x7f118281a000 == 29 [pid = 1950] [id = 84]
11:26:22 INFO - --DOCSHELL 0x7f11824a0000 == 28 [pid = 1950] [id = 88]
11:26:22 INFO - --DOCSHELL 0x7f11906b0800 == 27 [pid = 1950] [id = 85]
11:26:22 INFO - --DOCSHELL 0x7f11826c2000 == 26 [pid = 1950] [id = 80]
11:26:22 INFO - --DOCSHELL 0x7f11872d8800 == 25 [pid = 1950] [id = 81]
11:26:22 INFO - --DOCSHELL 0x7f118a014800 == 24 [pid = 1950] [id = 70]
11:26:22 INFO - --DOCSHELL 0x7f1187d7c800 == 23 [pid = 1950] [id = 89]
11:26:22 INFO - --DOCSHELL 0x7f11827df000 == 22 [pid = 1950] [id = 71]
11:26:22 INFO - --DOCSHELL 0x7f1183e38800 == 21 [pid = 1950] [id = 64]
11:26:22 INFO - --DOCSHELL 0x7f118d920000 == 20 [pid = 1950] [id = 82]
11:26:22 INFO - --DOCSHELL 0x7f11835da800 == 19 [pid = 1950] [id = 69]
11:26:22 INFO - --DOCSHELL 0x7f1191992000 == 18 [pid = 1950] [id = 98]
11:26:22 INFO - --DOCSHELL 0x7f118d380000 == 17 [pid = 1950] [id = 73]
11:26:22 INFO - --DOCSHELL 0x7f11827e4000 == 16 [pid = 1950] [id = 86]
11:26:22 INFO - --DOCSHELL 0x7f1183b2a000 == 15 [pid = 1950] [id = 91]
11:26:22 INFO - --DOCSHELL 0x7f11824a7000 == 14 [pid = 1950] [id = 90]
11:26:22 INFO - --DOMWINDOW == 55 (0x7f118f594800) [pid = 1950] [serial = 197] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:22 INFO - --DOMWINDOW == 54 (0x7f11916ce400) [pid = 1950] [serial = 216] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:22 INFO - --DOMWINDOW == 53 (0x7f118ce97000) [pid = 1950] [serial = 214] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 52 (0x7f118359f400) [pid = 1950] [serial = 210] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 51 (0x7f118db05800) [pid = 1950] [serial = 200] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 50 (0x7f119193a800) [pid = 1950] [serial = 201] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 49 (0x7f11838c5c00) [pid = 1950] [serial = 211] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 48 (0x7f119deb4000) [pid = 1950] [serial = 187] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 47 (0x7f118a3ec000) [pid = 1950] [serial = 208] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 46 (0x7f11910ab000) [pid = 1950] [serial = 179] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 45 (0x7f1182844c00) [pid = 1950] [serial = 189] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 44 (0x7f1183671400) [pid = 1950] [serial = 205] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:22 INFO - --DOMWINDOW == 43 (0x7f119240d400) [pid = 1950] [serial = 185] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 42 (0x7f119eedd000) [pid = 1950] [serial = 202] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:22 INFO - --DOMWINDOW == 41 (0x7f11916c5c00) [pid = 1950] [serial = 229] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 40 (0x7f118814f000) [pid = 1950] [serial = 222] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:22 INFO - --DOMWINDOW == 39 (0x7f1181fe1c00) [pid = 1950] [serial = 220] [outer = (nil)] [url = data:text/html;charset=utf8,
hello%20world%20from%20bug%20877778%20]
11:26:22 INFO - --DOMWINDOW == 38 (0x7f118d407000) [pid = 1950] [serial = 219] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 37 (0x7f1183e67000) [pid = 1950] [serial = 218] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 36 (0x7f11872bac00) [pid = 1950] [serial = 213] [outer = (nil)] [url = about:blank]
11:26:22 INFO - --DOMWINDOW == 35 (0x7f11858f6400) [pid = 1950] [serial = 212] [outer = (nil)] [url = data:text/html;charset=utf8,
dead%20objects!]
11:26:22 INFO - --DOMWINDOW == 34 (0x7f1182610000) [pid = 1950] [serial = 204] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:26:22 INFO - ++DOCSHELL 0x7f1182494800 == 15 [pid = 1950] [id = 99]
11:26:22 INFO - ++DOMWINDOW == 35 (0x7f1182755c00) [pid = 1950] [serial = 233] [outer = (nil)]
11:26:22 INFO - ++DOMWINDOW == 36 (0x7f1182844c00) [pid = 1950] [serial = 234] [outer = 0x7f1182755c00]
11:26:23 INFO - MEMORY STAT | vsize 1194MB | residentFast 310MB | heapAllocated 111MB
11:26:23 INFO - 40 INFO TEST-OK | devtools/client/webconsole/test/browser_console_filters.js | took 5906ms
11:26:23 INFO - ++DOCSHELL 0x7f11826b9000 == 16 [pid = 1950] [id = 100]
11:26:23 INFO - ++DOMWINDOW == 37 (0x7f1183fc9000) [pid = 1950] [serial = 235] [outer = (nil)]
11:26:23 INFO - ++DOMWINDOW == 38 (0x7f11858fa800) [pid = 1950] [serial = 236] [outer = 0x7f1183fc9000]
11:26:24 INFO - must wait for focus
11:26:24 INFO - 41 INFO TEST-START | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js
11:26:24 INFO - ++DOCSHELL 0x7f118a98b000 == 17 [pid = 1950] [id = 101]
11:26:24 INFO - ++DOMWINDOW == 39 (0x7f118d48f800) [pid = 1950] [serial = 237] [outer = (nil)]
11:26:24 INFO - ++DOMWINDOW == 40 (0x7f118d583400) [pid = 1950] [serial = 238] [outer = 0x7f118d48f800]
11:26:25 INFO - ++DOCSHELL 0x7f118d925000 == 18 [pid = 1950] [id = 102]
11:26:25 INFO - ++DOMWINDOW == 41 (0x7f1190eb5400) [pid = 1950] [serial = 239] [outer = (nil)]
11:26:25 INFO - ++DOMWINDOW == 42 (0x7f11910a9c00) [pid = 1950] [serial = 240] [outer = 0x7f1190eb5400]
11:26:25 INFO - ++DOCSHELL 0x7f11826c2000 == 19 [pid = 1950] [id = 103]
11:26:25 INFO - ++DOMWINDOW == 43 (0x7f1183e5d400) [pid = 1950] [serial = 241] [outer = (nil)]
11:26:25 INFO - ++DOMWINDOW == 44 (0x7f1183fe3000) [pid = 1950] [serial = 242] [outer = 0x7f1183e5d400]
11:26:25 INFO - ++DOCSHELL 0x7f11907b1000 == 20 [pid = 1950] [id = 104]
11:26:25 INFO - ++DOMWINDOW == 45 (0x7f1183671400) [pid = 1950] [serial = 243] [outer = (nil)]
11:26:25 INFO - ++DOMWINDOW == 46 (0x7f11916db000) [pid = 1950] [serial = 244] [outer = 0x7f1183671400]
11:26:26 INFO - ++DOMWINDOW == 47 (0x7f118260dc00) [pid = 1950] [serial = 245] [outer = 0x7f1183671400]
11:26:27 INFO - ++DOCSHELL 0x7f1188184000 == 21 [pid = 1950] [id = 105]
11:26:27 INFO - ++DOMWINDOW == 48 (0x7f118ce95400) [pid = 1950] [serial = 246] [outer = (nil)]
11:26:27 INFO - ++DOMWINDOW == 49 (0x7f118ce98400) [pid = 1950] [serial = 247] [outer = 0x7f118ce95400]
11:26:29 INFO - --DOCSHELL 0x7f118469e000 == 20 [pid = 1950] [id = 94]
11:26:29 INFO - --DOCSHELL 0x7f11826c0800 == 19 [pid = 1950] [id = 92]
11:26:29 INFO - --DOCSHELL 0x7f11826c3000 == 18 [pid = 1950] [id = 95]
11:26:29 INFO - --DOCSHELL 0x7f1190483000 == 17 [pid = 1950] [id = 96]
11:26:29 INFO - --DOCSHELL 0x7f1191056800 == 16 [pid = 1950] [id = 97]
11:26:29 INFO - --DOCSHELL 0x7f118248d800 == 15 [pid = 1950] [id = 93]
11:26:29 INFO - --DOCSHELL 0x7f1182494800 == 14 [pid = 1950] [id = 99]
11:26:30 INFO - --DOMWINDOW == 48 (0x7f11916cec00) [pid = 1950] [serial = 217] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 47 (0x7f119deba800) [pid = 1950] [serial = 188] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 46 (0x7f118ce97c00) [pid = 1950] [serial = 215] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 45 (0x7f11925e0400) [pid = 1950] [serial = 186] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 44 (0x7f11835a3400) [pid = 1950] [serial = 190] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 43 (0x7f11910b0800) [pid = 1950] [serial = 180] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 42 (0x7f11881f1000) [pid = 1950] [serial = 223] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 41 (0x7f118a9b5800) [pid = 1950] [serial = 209] [outer = (nil)] [url = about:blank]
11:26:30 INFO - --DOMWINDOW == 40 (0x7f118366e800) [pid = 1950] [serial = 207] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:30 INFO - --DOMWINDOW == 39 (0x7f118260ec00) [pid = 1950] [serial = 221] [outer = (nil)] [url = about:blank]
11:26:30 INFO - ++DOCSHELL 0x7f11826c1800 == 15 [pid = 1950] [id = 106]
11:26:30 INFO - ++DOMWINDOW == 40 (0x7f118260c800) [pid = 1950] [serial = 248] [outer = (nil)]
11:26:30 INFO - ++DOMWINDOW == 41 (0x7f118260d400) [pid = 1950] [serial = 249] [outer = 0x7f118260c800]
11:26:31 INFO - --DOCSHELL 0x7f1188184000 == 14 [pid = 1950] [id = 105]
11:26:31 INFO - --DOCSHELL 0x7f11826c1800 == 13 [pid = 1950] [id = 106]
11:26:31 INFO - --DOCSHELL 0x7f11907b1000 == 12 [pid = 1950] [id = 104]
11:26:32 INFO - --DOMWINDOW == 40 (0x7f11916db000) [pid = 1950] [serial = 244] [outer = (nil)] [url = about:blank]
11:26:32 INFO - --DOMWINDOW == 39 (0x7f118a330c00) [pid = 1950] [serial = 225] [outer = (nil)] [url = about:blank]
11:26:32 INFO - --DOMWINDOW == 38 (0x7f118d346000) [pid = 1950] [serial = 227] [outer = (nil)] [url = about:blank]
11:26:32 INFO - --DOMWINDOW == 37 (0x7f1182755c00) [pid = 1950] [serial = 233] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:32 INFO - --DOMWINDOW == 36 (0x7f119165dc00) [pid = 1950] [serial = 228] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:32 INFO - --DOMWINDOW == 35 (0x7f1192678800) [pid = 1950] [serial = 231] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:32 INFO - --DOMWINDOW == 34 (0x7f118533e000) [pid = 1950] [serial = 224] [outer = (nil)] [url = about:blank]
11:26:32 INFO - --DOMWINDOW == 33 (0x7f118ce99400) [pid = 1950] [serial = 226] [outer = (nil)] [url = data:text/html;charset=utf8,
browser%20console%20filters]
11:26:32 INFO - ++DOCSHELL 0x7f11827ea000 == 13 [pid = 1950] [id = 107]
11:26:32 INFO - ++DOMWINDOW == 34 (0x7f1183673c00) [pid = 1950] [serial = 250] [outer = (nil)]
11:26:32 INFO - ++DOMWINDOW == 35 (0x7f1183677800) [pid = 1950] [serial = 251] [outer = 0x7f1183673c00]
11:26:33 INFO - ++DOCSHELL 0x7f1183e2d000 == 14 [pid = 1950] [id = 108]
11:26:33 INFO - ++DOMWINDOW == 36 (0x7f118461ac00) [pid = 1950] [serial = 252] [outer = (nil)]
11:26:33 INFO - ++DOMWINDOW == 37 (0x7f11858f2400) [pid = 1950] [serial = 253] [outer = 0x7f118461ac00]
11:26:33 INFO - ++DOCSHELL 0x7f11872e2800 == 15 [pid = 1950] [id = 109]
11:26:33 INFO - ++DOMWINDOW == 38 (0x7f1188148000) [pid = 1950] [serial = 254] [outer = (nil)]
11:26:33 INFO - ++DOMWINDOW == 39 (0x7f11881f7800) [pid = 1950] [serial = 255] [outer = 0x7f1188148000]
11:26:33 INFO - ++DOMWINDOW == 40 (0x7f118758e000) [pid = 1950] [serial = 256] [outer = 0x7f1188148000]
11:26:34 INFO - ++DOCSHELL 0x7f118a011000 == 16 [pid = 1950] [id = 110]
11:26:34 INFO - ++DOMWINDOW == 41 (0x7f118a9be800) [pid = 1950] [serial = 257] [outer = (nil)]
11:26:34 INFO - ++DOMWINDOW == 42 (0x7f118a9c0000) [pid = 1950] [serial = 258] [outer = 0x7f118a9be800]
11:26:36 INFO - --DOCSHELL 0x7f118d925000 == 15 [pid = 1950] [id = 102]
11:26:36 INFO - --DOCSHELL 0x7f118a98b000 == 14 [pid = 1950] [id = 101]
11:26:36 INFO - --DOMWINDOW == 41 (0x7f1182844c00) [pid = 1950] [serial = 234] [outer = (nil)] [url = about:blank]
11:26:36 INFO - --DOMWINDOW == 40 (0x7f119267f400) [pid = 1950] [serial = 232] [outer = (nil)] [url = about:blank]
11:26:36 INFO - --DOMWINDOW == 39 (0x7f1190abb000) [pid = 1950] [serial = 230] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:36 INFO - ++DOCSHELL 0x7f11826d5800 == 15 [pid = 1950] [id = 111]
11:26:36 INFO - ++DOMWINDOW == 40 (0x7f1182605400) [pid = 1950] [serial = 259] [outer = (nil)]
11:26:36 INFO - ++DOMWINDOW == 41 (0x7f118260c400) [pid = 1950] [serial = 260] [outer = 0x7f1182605400]
11:26:38 INFO - --DOCSHELL 0x7f118a011000 == 14 [pid = 1950] [id = 110]
11:26:38 INFO - --DOCSHELL 0x7f11826d5800 == 13 [pid = 1950] [id = 111]
11:26:38 INFO - --DOCSHELL 0x7f11872e2800 == 12 [pid = 1950] [id = 109]
11:26:38 INFO - --DOMWINDOW == 40 (0x7f11881f7800) [pid = 1950] [serial = 255] [outer = (nil)] [url = about:blank]
11:26:38 INFO - --DOMWINDOW == 39 (0x7f1190eb5400) [pid = 1950] [serial = 239] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:38 INFO - --DOMWINDOW == 38 (0x7f118260c800) [pid = 1950] [serial = 248] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:39 INFO - MEMORY STAT | vsize 1184MB | residentFast 288MB | heapAllocated 103MB
11:26:39 INFO - 42 INFO TEST-OK | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js | took 14913ms
11:26:39 INFO - ++DOCSHELL 0x7f118249c800 == 13 [pid = 1950] [id = 112]
11:26:39 INFO - ++DOMWINDOW == 39 (0x7f11838c0800) [pid = 1950] [serial = 261] [outer = (nil)]
11:26:39 INFO - ++DOMWINDOW == 40 (0x7f1183e5d800) [pid = 1950] [serial = 262] [outer = 0x7f11838c0800]
11:26:39 INFO - 43 INFO TEST-START | devtools/client/webconsole/test/browser_console_history_persist.js
11:26:39 INFO - ++DOCSHELL 0x7f1183b2d000 == 14 [pid = 1950] [id = 113]
11:26:39 INFO - ++DOMWINDOW == 41 (0x7f1183fcb800) [pid = 1950] [serial = 263] [outer = (nil)]
11:26:39 INFO - ++DOMWINDOW == 42 (0x7f1183fda000) [pid = 1950] [serial = 264] [outer = 0x7f1183fcb800]
11:26:39 INFO - ++DOCSHELL 0x7f118400b800 == 15 [pid = 1950] [id = 114]
11:26:39 INFO - ++DOMWINDOW == 43 (0x7f1183fe0800) [pid = 1950] [serial = 265] [outer = (nil)]
11:26:39 INFO - ++DOMWINDOW == 44 (0x7f118758ec00) [pid = 1950] [serial = 266] [outer = 0x7f1183fe0800]
11:26:39 INFO - ++DOMWINDOW == 45 (0x7f1187592400) [pid = 1950] [serial = 267] [outer = 0x7f1183fe0800]
11:26:40 INFO - ++DOCSHELL 0x7f118a01d800 == 16 [pid = 1950] [id = 115]
11:26:40 INFO - ++DOMWINDOW == 46 (0x7f118a9b4800) [pid = 1950] [serial = 268] [outer = (nil)]
11:26:40 INFO - ++DOMWINDOW == 47 (0x7f118a9b5c00) [pid = 1950] [serial = 269] [outer = 0x7f118a9b4800]
11:26:42 INFO - ++DOCSHELL 0x7f11826c2800 == 17 [pid = 1950] [id = 116]
11:26:42 INFO - ++DOMWINDOW == 48 (0x7f118f1a4000) [pid = 1950] [serial = 270] [outer = (nil)]
11:26:42 INFO - ++DOMWINDOW == 49 (0x7f118f366800) [pid = 1950] [serial = 271] [outer = 0x7f118f1a4000]
11:26:43 INFO - --DOCSHELL 0x7f11826c2000 == 16 [pid = 1950] [id = 103]
11:26:43 INFO - --DOCSHELL 0x7f11826b9000 == 15 [pid = 1950] [id = 100]
11:26:43 INFO - --DOCSHELL 0x7f1183e2d000 == 14 [pid = 1950] [id = 108]
11:26:43 INFO - --DOCSHELL 0x7f11827ea000 == 13 [pid = 1950] [id = 107]
11:26:43 INFO - --DOMWINDOW == 48 (0x7f118260d400) [pid = 1950] [serial = 249] [outer = (nil)] [url = about:blank]
11:26:43 INFO - --DOMWINDOW == 47 (0x7f11910a9c00) [pid = 1950] [serial = 240] [outer = (nil)] [url = about:blank]
11:26:43 INFO - ++DOCSHELL 0x7f11826c6000 == 14 [pid = 1950] [id = 117]
11:26:43 INFO - ++DOMWINDOW == 48 (0x7f1182752400) [pid = 1950] [serial = 272] [outer = (nil)]
11:26:43 INFO - ++DOMWINDOW == 49 (0x7f1182754c00) [pid = 1950] [serial = 273] [outer = 0x7f1182752400]
11:26:43 INFO - ++DOMWINDOW == 50 (0x7f118260c000) [pid = 1950] [serial = 274] [outer = 0x7f1182752400]
11:26:44 INFO - ++DOCSHELL 0x7f1187d81000 == 15 [pid = 1950] [id = 118]
11:26:44 INFO - ++DOMWINDOW == 51 (0x7f11881f8000) [pid = 1950] [serial = 275] [outer = (nil)]
11:26:44 INFO - ++DOMWINDOW == 52 (0x7f11881fb400) [pid = 1950] [serial = 276] [outer = 0x7f11881f8000]
11:26:46 INFO - ++DOCSHELL 0x7f118d781800 == 16 [pid = 1950] [id = 119]
11:26:46 INFO - ++DOMWINDOW == 53 (0x7f11918eac00) [pid = 1950] [serial = 277] [outer = (nil)]
11:26:46 INFO - ++DOMWINDOW == 54 (0x7f119193b400) [pid = 1950] [serial = 278] [outer = 0x7f11918eac00]
11:26:46 INFO - ++DOCSHELL 0x7f11827d6000 == 17 [pid = 1950] [id = 120]
11:26:46 INFO - ++DOMWINDOW == 55 (0x7f1182755400) [pid = 1950] [serial = 279] [outer = (nil)]
11:26:46 INFO - ++DOMWINDOW == 56 (0x7f1183670400) [pid = 1950] [serial = 280] [outer = 0x7f1182755400]
11:26:47 INFO - ++DOMWINDOW == 57 (0x7f1183a71800) [pid = 1950] [serial = 281] [outer = 0x7f1182755400]
11:26:47 INFO - ++DOCSHELL 0x7f118d4b0800 == 18 [pid = 1950] [id = 121]
11:26:47 INFO - ++DOMWINDOW == 58 (0x7f1190abac00) [pid = 1950] [serial = 282] [outer = (nil)]
11:26:47 INFO - ++DOMWINDOW == 59 (0x7f1190eb5400) [pid = 1950] [serial = 283] [outer = 0x7f1190abac00]
11:26:49 INFO - ++DOCSHELL 0x7f1191635000 == 19 [pid = 1950] [id = 122]
11:26:49 INFO - ++DOMWINDOW == 60 (0x7f1196585c00) [pid = 1950] [serial = 284] [outer = (nil)]
11:26:49 INFO - ++DOMWINDOW == 61 (0x7f119dd63800) [pid = 1950] [serial = 285] [outer = 0x7f1196585c00]
11:26:50 INFO - ++DOCSHELL 0x7f11827da000 == 20 [pid = 1950] [id = 123]
11:26:50 INFO - ++DOMWINDOW == 62 (0x7f11881f7800) [pid = 1950] [serial = 286] [outer = (nil)]
11:26:50 INFO - ++DOMWINDOW == 63 (0x7f118a32ac00) [pid = 1950] [serial = 287] [outer = 0x7f11881f7800]
11:26:50 INFO - ++DOMWINDOW == 64 (0x7f118d9ee800) [pid = 1950] [serial = 288] [outer = 0x7f11881f7800]
11:26:51 INFO - ++DOCSHELL 0x7f11907b9000 == 21 [pid = 1950] [id = 124]
11:26:51 INFO - ++DOMWINDOW == 65 (0x7f11925e3c00) [pid = 1950] [serial = 289] [outer = (nil)]
11:26:51 INFO - ++DOMWINDOW == 66 (0x7f11926df800) [pid = 1950] [serial = 290] [outer = 0x7f11925e3c00]
11:26:52 INFO - ++DOCSHELL 0x7f11827e9800 == 22 [pid = 1950] [id = 125]
11:26:52 INFO - ++DOMWINDOW == 67 (0x7f119f0c7000) [pid = 1950] [serial = 291] [outer = (nil)]
11:26:52 INFO - ++DOMWINDOW == 68 (0x7f11a11f1800) [pid = 1950] [serial = 292] [outer = 0x7f119f0c7000]
11:26:53 INFO - ++DOCSHELL 0x7f11926d7000 == 23 [pid = 1950] [id = 126]
11:26:53 INFO - ++DOMWINDOW == 69 (0x7f11a11ecc00) [pid = 1950] [serial = 293] [outer = (nil)]
11:26:53 INFO - ++DOMWINDOW == 70 (0x7f11a13bb000) [pid = 1950] [serial = 294] [outer = 0x7f11a11ecc00]
11:26:53 INFO - ++DOMWINDOW == 71 (0x7f1182750800) [pid = 1950] [serial = 295] [outer = 0x7f11a11ecc00]
11:26:53 INFO - ++DOCSHELL 0x7f1196599800 == 24 [pid = 1950] [id = 127]
11:26:53 INFO - ++DOMWINDOW == 72 (0x7f11a617d800) [pid = 1950] [serial = 296] [outer = (nil)]
11:26:53 INFO - ++DOMWINDOW == 73 (0x7f11a6182c00) [pid = 1950] [serial = 297] [outer = 0x7f11a617d800]
11:26:55 INFO - --DOCSHELL 0x7f118d4b0800 == 23 [pid = 1950] [id = 121]
11:26:55 INFO - --DOCSHELL 0x7f1187d81000 == 22 [pid = 1950] [id = 118]
11:26:56 INFO - --DOCSHELL 0x7f118a01d800 == 21 [pid = 1950] [id = 115]
11:26:56 INFO - --DOMWINDOW == 72 (0x7f1182605400) [pid = 1950] [serial = 259] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:56 INFO - --DOMWINDOW == 71 (0x7f11858fa800) [pid = 1950] [serial = 236] [outer = (nil)] [url = about:blank]
11:26:56 INFO - --DOMWINDOW == 70 (0x7f1183fe3000) [pid = 1950] [serial = 242] [outer = (nil)] [url = about:blank]
11:26:56 INFO - --DOMWINDOW == 69 (0x7f118d48f800) [pid = 1950] [serial = 237] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:56 INFO - --DOMWINDOW == 68 (0x7f1183671400) [pid = 1950] [serial = 243] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:56 INFO - --DOMWINDOW == 67 (0x7f1183673c00) [pid = 1950] [serial = 250] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:56 INFO - --DOMWINDOW == 66 (0x7f1188148000) [pid = 1950] [serial = 254] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:56 INFO - --DOMWINDOW == 65 (0x7f118ce95400) [pid = 1950] [serial = 246] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:56 INFO - --DOMWINDOW == 64 (0x7f118a9be800) [pid = 1950] [serial = 257] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:26:56 INFO - --DOMWINDOW == 63 (0x7f118461ac00) [pid = 1950] [serial = 252] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:26:56 INFO - --DOMWINDOW == 62 (0x7f1183fc9000) [pid = 1950] [serial = 235] [outer = (nil)] [url = about:blank]
11:26:56 INFO - --DOMWINDOW == 61 (0x7f1183e5d400) [pid = 1950] [serial = 241] [outer = (nil)] [url = data:text/html;charset=utf8,hello%20world]
11:26:57 INFO - MEMORY STAT | vsize 1193MB | residentFast 312MB | heapAllocated 119MB
11:26:57 INFO - 44 INFO TEST-OK | devtools/client/webconsole/test/browser_console_history_persist.js | took 17694ms
11:26:57 INFO - ++DOCSHELL 0x7f11853f0000 == 22 [pid = 1950] [id = 128]
11:26:57 INFO - ++DOMWINDOW == 62 (0x7f1183fcbc00) [pid = 1950] [serial = 298] [outer = (nil)]
11:26:57 INFO - ++DOMWINDOW == 63 (0x7f11858f9000) [pid = 1950] [serial = 299] [outer = 0x7f1183fcbc00]
11:26:57 INFO - 45 INFO TEST-START | devtools/client/webconsole/test/browser_console_iframe_messages.js
11:26:57 INFO - ++DOCSHELL 0x7f118d5f0000 == 23 [pid = 1950] [id = 129]
11:26:57 INFO - ++DOMWINDOW == 64 (0x7f118a9b5000) [pid = 1950] [serial = 300] [outer = (nil)]
11:26:57 INFO - ++DOMWINDOW == 65 (0x7f118ce8f800) [pid = 1950] [serial = 301] [outer = 0x7f118a9b5000]
11:26:58 INFO - --DOCSHELL 0x7f11907b9000 == 22 [pid = 1950] [id = 124]
11:26:58 INFO - --DOCSHELL 0x7f1196599800 == 21 [pid = 1950] [id = 127]
11:26:58 INFO - --DOMWINDOW == 64 (0x7f11858f2400) [pid = 1950] [serial = 253] [outer = (nil)] [url = about:blank]
11:26:58 INFO - --DOMWINDOW == 63 (0x7f118260c400) [pid = 1950] [serial = 260] [outer = (nil)] [url = about:blank]
11:26:58 INFO - --DOMWINDOW == 62 (0x7f118ce98400) [pid = 1950] [serial = 247] [outer = (nil)] [url = about:blank]
11:26:58 INFO - --DOMWINDOW == 61 (0x7f118a9c0000) [pid = 1950] [serial = 258] [outer = (nil)] [url = about:blank]
11:26:58 INFO - --DOMWINDOW == 60 (0x7f118758e000) [pid = 1950] [serial = 256] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:58 INFO - --DOMWINDOW == 59 (0x7f1183677800) [pid = 1950] [serial = 251] [outer = (nil)] [url = about:blank]
11:26:58 INFO - --DOMWINDOW == 58 (0x7f118260dc00) [pid = 1950] [serial = 245] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:26:58 INFO - --DOMWINDOW == 57 (0x7f118d583400) [pid = 1950] [serial = 238] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 56 (0x7f11926df800) [pid = 1950] [serial = 290] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 55 (0x7f11a617d800) [pid = 1950] [serial = 296] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:00 INFO - --DOMWINDOW == 54 (0x7f11925e3c00) [pid = 1950] [serial = 289] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:00 INFO - --DOMWINDOW == 53 (0x7f119f0c7000) [pid = 1950] [serial = 291] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306]
11:27:00 INFO - --DOMWINDOW == 52 (0x7f1196585c00) [pid = 1950] [serial = 284] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306]
11:27:00 INFO - --DOMWINDOW == 51 (0x7f11918eac00) [pid = 1950] [serial = 277] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306]
11:27:00 INFO - --DOMWINDOW == 50 (0x7f118f1a4000) [pid = 1950] [serial = 270] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306]
11:27:00 INFO - --DOMWINDOW == 49 (0x7f1183fcb800) [pid = 1950] [serial = 263] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306]
11:27:00 INFO - --DOMWINDOW == 48 (0x7f11838c0800) [pid = 1950] [serial = 261] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 47 (0x7f118758ec00) [pid = 1950] [serial = 266] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 46 (0x7f1182754c00) [pid = 1950] [serial = 273] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 45 (0x7f1183670400) [pid = 1950] [serial = 280] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 44 (0x7f11a6182c00) [pid = 1950] [serial = 297] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 43 (0x7f11a11f1800) [pid = 1950] [serial = 292] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 42 (0x7f119dd63800) [pid = 1950] [serial = 285] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 41 (0x7f119193b400) [pid = 1950] [serial = 278] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 40 (0x7f118f366800) [pid = 1950] [serial = 271] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 39 (0x7f1183fda000) [pid = 1950] [serial = 264] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 38 (0x7f1183e5d800) [pid = 1950] [serial = 262] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 37 (0x7f11a13bb000) [pid = 1950] [serial = 294] [outer = (nil)] [url = about:blank]
11:27:00 INFO - --DOMWINDOW == 36 (0x7f118a32ac00) [pid = 1950] [serial = 287] [outer = (nil)] [url = about:blank]
11:27:01 INFO - --DOCSHELL 0x7f11827da000 == 20 [pid = 1950] [id = 123]
11:27:01 INFO - --DOCSHELL 0x7f118400b800 == 19 [pid = 1950] [id = 114]
11:27:01 INFO - --DOCSHELL 0x7f11826c6000 == 18 [pid = 1950] [id = 117]
11:27:01 INFO - --DOCSHELL 0x7f11827d6000 == 17 [pid = 1950] [id = 120]
11:27:01 INFO - --DOCSHELL 0x7f11926d7000 == 16 [pid = 1950] [id = 126]
11:27:01 INFO - --DOCSHELL 0x7f118249c800 == 15 [pid = 1950] [id = 112]
11:27:01 INFO - --DOMWINDOW == 35 (0x7f118d9ee800) [pid = 1950] [serial = 288] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:01 INFO - --DOMWINDOW == 34 (0x7f1190eb5400) [pid = 1950] [serial = 283] [outer = (nil)] [url = about:blank]
11:27:01 INFO - --DOMWINDOW == 33 (0x7f11881f7800) [pid = 1950] [serial = 286] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:01 INFO - --DOMWINDOW == 32 (0x7f1190abac00) [pid = 1950] [serial = 282] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:02 INFO - --DOMWINDOW == 31 (0x7f11881fb400) [pid = 1950] [serial = 276] [outer = (nil)] [url = about:blank]
11:27:02 INFO - --DOMWINDOW == 30 (0x7f1183a71800) [pid = 1950] [serial = 281] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:02 INFO - --DOMWINDOW == 29 (0x7f11881f8000) [pid = 1950] [serial = 275] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:02 INFO - --DOMWINDOW == 28 (0x7f1182755400) [pid = 1950] [serial = 279] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:02 INFO - ++DOMWINDOW == 29 (0x7f118242a400) [pid = 1950] [serial = 302] [outer = 0x7f118a9b5000]
11:27:02 INFO - --DOMWINDOW == 28 (0x7f118a9b4800) [pid = 1950] [serial = 268] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:02 INFO - ++DOCSHELL 0x7f11824ad800 == 16 [pid = 1950] [id = 130]
11:27:02 INFO - ++DOMWINDOW == 29 (0x7f118274f400) [pid = 1950] [serial = 303] [outer = (nil)]
11:27:02 INFO - ++DOCSHELL 0x7f11826c1800 == 17 [pid = 1950] [id = 131]
11:27:02 INFO - ++DOMWINDOW == 30 (0x7f1182845800) [pid = 1950] [serial = 304] [outer = (nil)]
11:27:02 INFO - ++DOCSHELL 0x7f11826c5800 == 18 [pid = 1950] [id = 132]
11:27:02 INFO - ++DOMWINDOW == 31 (0x7f1182848000) [pid = 1950] [serial = 305] [outer = (nil)]
11:27:02 INFO - ++DOMWINDOW == 32 (0x7f1182888c00) [pid = 1950] [serial = 306] [outer = 0x7f118274f400]
11:27:02 INFO - ++DOMWINDOW == 33 (0x7f118288dc00) [pid = 1950] [serial = 307] [outer = 0x7f1182845800]
11:27:02 INFO - ++DOMWINDOW == 34 (0x7f1183678800) [pid = 1950] [serial = 308] [outer = 0x7f1182848000]
11:27:03 INFO - ++DOCSHELL 0x7f11835e7800 == 19 [pid = 1950] [id = 133]
11:27:03 INFO - ++DOMWINDOW == 35 (0x7f11838c5c00) [pid = 1950] [serial = 309] [outer = (nil)]
11:27:03 INFO - ++DOMWINDOW == 36 (0x7f11838e6c00) [pid = 1950] [serial = 310] [outer = 0x7f11838c5c00]
11:27:03 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html, line 5: ReferenceError: blah is not defined
11:27:03 INFO - ++DOCSHELL 0x7f11835f0000 == 20 [pid = 1950] [id = 134]
11:27:03 INFO - ++DOMWINDOW == 37 (0x7f1183670400) [pid = 1950] [serial = 311] [outer = (nil)]
11:27:03 INFO - ++DOMWINDOW == 38 (0x7f1183ca6400) [pid = 1950] [serial = 312] [outer = 0x7f1183670400]
11:27:03 INFO - ++DOMWINDOW == 39 (0x7f1183fc7800) [pid = 1950] [serial = 313] [outer = 0x7f11838c5c00]
11:27:03 INFO - ++DOCSHELL 0x7f118531b000 == 21 [pid = 1950] [id = 135]
11:27:03 INFO - ++DOMWINDOW == 40 (0x7f118585e800) [pid = 1950] [serial = 314] [outer = (nil)]
11:27:03 INFO - ++DOMWINDOW == 41 (0x7f11872b8000) [pid = 1950] [serial = 315] [outer = 0x7f118585e800]
11:27:06 INFO - --DOCSHELL 0x7f118531b000 == 20 [pid = 1950] [id = 135]
11:27:06 INFO - --DOMWINDOW == 40 (0x7f118a9b5c00) [pid = 1950] [serial = 269] [outer = (nil)] [url = about:blank]
11:27:06 INFO - --DOMWINDOW == 39 (0x7f118ce8f800) [pid = 1950] [serial = 301] [outer = (nil)] [url = about:blank]
11:27:06 INFO - --DOMWINDOW == 38 (0x7f11838e6c00) [pid = 1950] [serial = 310] [outer = (nil)] [url = about:blank]
11:27:06 INFO - --DOMWINDOW == 37 (0x7f11a11ecc00) [pid = 1950] [serial = 293] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:06 INFO - ++DOCSHELL 0x7f118249b000 == 21 [pid = 1950] [id = 136]
11:27:06 INFO - ++DOMWINDOW == 38 (0x7f118366ec00) [pid = 1950] [serial = 316] [outer = (nil)]
11:27:06 INFO - ++DOMWINDOW == 39 (0x7f1183675400) [pid = 1950] [serial = 317] [outer = 0x7f118366ec00]
11:27:07 INFO - MEMORY STAT | vsize 1192MB | residentFast 300MB | heapAllocated 110MB
11:27:07 INFO - 46 INFO TEST-OK | devtools/client/webconsole/test/browser_console_iframe_messages.js | took 10443ms
11:27:07 INFO - ++DOCSHELL 0x7f11826d3800 == 22 [pid = 1950] [id = 137]
11:27:07 INFO - ++DOMWINDOW == 40 (0x7f11838c2400) [pid = 1950] [serial = 318] [outer = (nil)]
11:27:07 INFO - ++DOMWINDOW == 41 (0x7f1183fca000) [pid = 1950] [serial = 319] [outer = 0x7f11838c2400]
11:27:08 INFO - 47 INFO TEST-START | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js
11:27:08 INFO - ++DOCSHELL 0x7f118d782800 == 23 [pid = 1950] [id = 138]
11:27:08 INFO - ++DOMWINDOW == 42 (0x7f11872af000) [pid = 1950] [serial = 320] [outer = (nil)]
11:27:08 INFO - ++DOMWINDOW == 43 (0x7f11881f5000) [pid = 1950] [serial = 321] [outer = 0x7f11872af000]
11:27:08 INFO - ++DOMWINDOW == 44 (0x7f118dda2000) [pid = 1950] [serial = 322] [outer = 0x7f11872af000]
11:27:08 INFO - ++DOCSHELL 0x7f11835e5800 == 24 [pid = 1950] [id = 139]
11:27:08 INFO - ++DOMWINDOW == 45 (0x7f11881f7000) [pid = 1950] [serial = 323] [outer = (nil)]
11:27:08 INFO - ++DOMWINDOW == 46 (0x7f118f1a5800) [pid = 1950] [serial = 324] [outer = 0x7f11881f7000]
11:27:08 INFO - ++DOMWINDOW == 47 (0x7f118dd9bc00) [pid = 1950] [serial = 325] [outer = 0x7f11881f7000]
11:27:09 INFO - ++DOCSHELL 0x7f11907c0000 == 25 [pid = 1950] [id = 140]
11:27:09 INFO - ++DOMWINDOW == 48 (0x7f11910a9c00) [pid = 1950] [serial = 326] [outer = (nil)]
11:27:09 INFO - ++DOMWINDOW == 49 (0x7f11910abc00) [pid = 1950] [serial = 327] [outer = 0x7f11910a9c00]
11:27:11 INFO - --DOCSHELL 0x7f1191635000 == 24 [pid = 1950] [id = 122]
11:27:11 INFO - --DOCSHELL 0x7f11835f0000 == 23 [pid = 1950] [id = 134]
11:27:11 INFO - --DOCSHELL 0x7f11826c1800 == 22 [pid = 1950] [id = 131]
11:27:11 INFO - --DOCSHELL 0x7f11826c5800 == 21 [pid = 1950] [id = 132]
11:27:11 INFO - --DOCSHELL 0x7f1183b2d000 == 20 [pid = 1950] [id = 113]
11:27:11 INFO - --DOCSHELL 0x7f118d781800 == 19 [pid = 1950] [id = 119]
11:27:11 INFO - --DOCSHELL 0x7f11824ad800 == 18 [pid = 1950] [id = 130]
11:27:11 INFO - --DOCSHELL 0x7f11826c2800 == 17 [pid = 1950] [id = 116]
11:27:11 INFO - --DOCSHELL 0x7f11827e9800 == 16 [pid = 1950] [id = 125]
11:27:11 INFO - --DOCSHELL 0x7f11835e7800 == 15 [pid = 1950] [id = 133]
11:27:11 INFO - --DOCSHELL 0x7f11853f0000 == 14 [pid = 1950] [id = 128]
11:27:11 INFO - --DOCSHELL 0x7f118d5f0000 == 13 [pid = 1950] [id = 129]
11:27:11 INFO - --DOCSHELL 0x7f118249b000 == 12 [pid = 1950] [id = 136]
11:27:11 INFO - --DOMWINDOW == 48 (0x7f1182750800) [pid = 1950] [serial = 295] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:13 INFO - --DOCSHELL 0x7f11907c0000 == 11 [pid = 1950] [id = 140]
11:27:13 INFO - MEMORY STAT | vsize 1187MB | residentFast 293MB | heapAllocated 108MB
11:27:13 INFO - 48 INFO TEST-OK | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js | took 5650ms
11:27:13 INFO - ++DOCSHELL 0x7f11835f0000 == 12 [pid = 1950] [id = 141]
11:27:13 INFO - ++DOMWINDOW == 49 (0x7f118f596c00) [pid = 1950] [serial = 328] [outer = (nil)]
11:27:13 INFO - ++DOMWINDOW == 50 (0x7f11910aa000) [pid = 1950] [serial = 329] [outer = 0x7f118f596c00]
11:27:14 INFO - 49 INFO TEST-START | devtools/client/webconsole/test/browser_console_log_inspectable_object.js
11:27:14 INFO - ++DOCSHELL 0x7f1183e45000 == 13 [pid = 1950] [id = 142]
11:27:14 INFO - ++DOMWINDOW == 51 (0x7f119165ec00) [pid = 1950] [serial = 330] [outer = (nil)]
11:27:14 INFO - ++DOMWINDOW == 52 (0x7f11916cf000) [pid = 1950] [serial = 331] [outer = 0x7f119165ec00]
11:27:14 INFO - ++DOCSHELL 0x7f1183664000 == 14 [pid = 1950] [id = 143]
11:27:14 INFO - ++DOMWINDOW == 53 (0x7f11916d0400) [pid = 1950] [serial = 332] [outer = (nil)]
11:27:14 INFO - ++DOMWINDOW == 54 (0x7f119193d800) [pid = 1950] [serial = 333] [outer = 0x7f11916d0400]
11:27:14 INFO - ++DOMWINDOW == 55 (0x7f118db0ec00) [pid = 1950] [serial = 334] [outer = 0x7f11916d0400]
11:27:15 INFO - ++DOCSHELL 0x7f11906c8000 == 15 [pid = 1950] [id = 144]
11:27:15 INFO - ++DOMWINDOW == 56 (0x7f1196585400) [pid = 1950] [serial = 335] [outer = (nil)]
11:27:15 INFO - ++DOMWINDOW == 57 (0x7f1196586800) [pid = 1950] [serial = 336] [outer = 0x7f1196585400]
11:27:16 INFO - --DOMWINDOW == 56 (0x7f118242a400) [pid = 1950] [serial = 302] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html]
11:27:16 INFO - --DOMWINDOW == 55 (0x7f1182888c00) [pid = 1950] [serial = 306] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html]
11:27:16 INFO - --DOMWINDOW == 54 (0x7f11881f5000) [pid = 1950] [serial = 321] [outer = (nil)] [url = about:blank]
11:27:16 INFO - --DOMWINDOW == 53 (0x7f11858f9000) [pid = 1950] [serial = 299] [outer = (nil)] [url = about:blank]
11:27:16 INFO - --DOMWINDOW == 52 (0x7f1183678800) [pid = 1950] [serial = 308] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html]
11:27:16 INFO - --DOMWINDOW == 51 (0x7f118f1a5800) [pid = 1950] [serial = 324] [outer = (nil)] [url = about:blank]
11:27:16 INFO - --DOMWINDOW == 50 (0x7f1183ca6400) [pid = 1950] [serial = 312] [outer = (nil)] [url = about:blank]
11:27:16 INFO - --DOMWINDOW == 49 (0x7f1183670400) [pid = 1950] [serial = 311] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html]
11:27:16 INFO - --DOMWINDOW == 48 (0x7f1182848000) [pid = 1950] [serial = 305] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html]
11:27:16 INFO - --DOMWINDOW == 47 (0x7f1183fcbc00) [pid = 1950] [serial = 298] [outer = (nil)] [url = about:blank]
11:27:16 INFO - --DOMWINDOW == 46 (0x7f118274f400) [pid = 1950] [serial = 303] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html]
11:27:16 INFO - --DOMWINDOW == 45 (0x7f118a9b5000) [pid = 1950] [serial = 300] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html]
11:27:17 INFO - ++DOCSHELL 0x7f118a30a000 == 16 [pid = 1950] [id = 145]
11:27:17 INFO - ++DOMWINDOW == 46 (0x7f11a11f4000) [pid = 1950] [serial = 337] [outer = (nil)]
11:27:17 INFO - ++DOMWINDOW == 47 (0x7f11a1352000) [pid = 1950] [serial = 338] [outer = 0x7f11a11f4000]
11:27:18 INFO - MEMORY STAT | vsize 1206MB | residentFast 303MB | heapAllocated 116MB
11:27:18 INFO - 50 INFO TEST-OK | devtools/client/webconsole/test/browser_console_log_inspectable_object.js | took 4292ms
11:27:18 INFO - ++DOCSHELL 0x7f118a022800 == 17 [pid = 1950] [id = 146]
11:27:18 INFO - ++DOMWINDOW == 48 (0x7f1192409c00) [pid = 1950] [serial = 339] [outer = (nil)]
11:27:18 INFO - ++DOMWINDOW == 49 (0x7f11926e3400) [pid = 1950] [serial = 340] [outer = 0x7f1192409c00]
11:27:18 INFO - 51 INFO TEST-START | devtools/client/webconsole/test/browser_console_native_getters.js
11:27:18 INFO - ++DOCSHELL 0x7f1192459000 == 18 [pid = 1950] [id = 147]
11:27:18 INFO - ++DOMWINDOW == 50 (0x7f1181f51c00) [pid = 1950] [serial = 341] [outer = (nil)]
11:27:18 INFO - ++DOMWINDOW == 51 (0x7f119ef1c400) [pid = 1950] [serial = 342] [outer = 0x7f1181f51c00]
11:27:19 INFO - ++DOCSHELL 0x7f119256a000 == 19 [pid = 1950] [id = 148]
11:27:19 INFO - ++DOMWINDOW == 52 (0x7f119f0c7000) [pid = 1950] [serial = 343] [outer = (nil)]
11:27:19 INFO - ++DOMWINDOW == 53 (0x7f11a1fee400) [pid = 1950] [serial = 344] [outer = 0x7f119f0c7000]
11:27:19 INFO - ++DOMWINDOW == 54 (0x7f119e239c00) [pid = 1950] [serial = 345] [outer = 0x7f119f0c7000]
11:27:19 INFO - ++DOCSHELL 0x7f1196431800 == 20 [pid = 1950] [id = 149]
11:27:19 INFO - ++DOMWINDOW == 55 (0x7f11a6182c00) [pid = 1950] [serial = 346] [outer = (nil)]
11:27:19 INFO - ++DOMWINDOW == 56 (0x7f11a6726800) [pid = 1950] [serial = 347] [outer = 0x7f11a6182c00]
11:27:22 INFO - --DOCSHELL 0x7f118d782800 == 19 [pid = 1950] [id = 138]
11:27:22 INFO - --DOCSHELL 0x7f11835e5800 == 18 [pid = 1950] [id = 139]
11:27:22 INFO - --DOCSHELL 0x7f11826d3800 == 17 [pid = 1950] [id = 137]
11:27:22 INFO - --DOCSHELL 0x7f11906c8000 == 16 [pid = 1950] [id = 144]
11:27:22 INFO - --DOCSHELL 0x7f118a30a000 == 15 [pid = 1950] [id = 145]
11:27:22 INFO - ++DOCSHELL 0x7f1182496800 == 16 [pid = 1950] [id = 150]
11:27:22 INFO - ++DOMWINDOW == 57 (0x7f118283ec00) [pid = 1950] [serial = 348] [outer = (nil)]
11:27:22 INFO - ++DOMWINDOW == 58 (0x7f1182847c00) [pid = 1950] [serial = 349] [outer = 0x7f118283ec00]
11:27:28 INFO - ++DOCSHELL 0x7f118f643800 == 17 [pid = 1950] [id = 151]
11:27:28 INFO - ++DOMWINDOW == 59 (0x7f1184370000) [pid = 1950] [serial = 350] [outer = (nil)]
11:27:28 INFO - ++DOMWINDOW == 60 (0x7f118ab89c00) [pid = 1950] [serial = 351] [outer = 0x7f1184370000]
11:27:31 INFO - --DOMWINDOW == 59 (0x7f1182845800) [pid = 1950] [serial = 304] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html]
11:27:31 INFO - --DOMWINDOW == 58 (0x7f11838c2400) [pid = 1950] [serial = 318] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 57 (0x7f11872af000) [pid = 1950] [serial = 320] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:27:31 INFO - --DOMWINDOW == 56 (0x7f118f596c00) [pid = 1950] [serial = 328] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 55 (0x7f119165ec00) [pid = 1950] [serial = 330] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20676722%20-%20inspectable%20objects%20for%20window.console]
11:27:31 INFO - --DOMWINDOW == 54 (0x7f11a11f4000) [pid = 1950] [serial = 337] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:31 INFO - --DOMWINDOW == 53 (0x7f11a1fee400) [pid = 1950] [serial = 344] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 52 (0x7f11916d0400) [pid = 1950] [serial = 332] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:31 INFO - --DOMWINDOW == 51 (0x7f1183fe0800) [pid = 1950] [serial = 265] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:31 INFO - --DOMWINDOW == 50 (0x7f118585e800) [pid = 1950] [serial = 314] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:31 INFO - --DOMWINDOW == 49 (0x7f118366ec00) [pid = 1950] [serial = 316] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:31 INFO - --DOMWINDOW == 48 (0x7f1196585400) [pid = 1950] [serial = 335] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:31 INFO - --DOMWINDOW == 47 (0x7f1182752400) [pid = 1950] [serial = 272] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:31 INFO - --DOMWINDOW == 46 (0x7f11838c5c00) [pid = 1950] [serial = 309] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:31 INFO - --DOMWINDOW == 45 (0x7f119193d800) [pid = 1950] [serial = 333] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 44 (0x7f118288dc00) [pid = 1950] [serial = 307] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html]
11:27:31 INFO - --DOMWINDOW == 43 (0x7f1183fca000) [pid = 1950] [serial = 319] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 42 (0x7f11910aa000) [pid = 1950] [serial = 329] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 41 (0x7f11916cf000) [pid = 1950] [serial = 331] [outer = (nil)] [url = about:blank]
11:27:31 INFO - --DOMWINDOW == 40 (0x7f118dda2000) [pid = 1950] [serial = 322] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:27:33 INFO - --DOCSHELL 0x7f1196431800 == 16 [pid = 1950] [id = 149]
11:27:35 INFO - MEMORY STAT | vsize 1210MB | residentFast 321MB | heapAllocated 124MB
11:27:35 INFO - 52 INFO TEST-OK | devtools/client/webconsole/test/browser_console_native_getters.js | took 16653ms
11:27:35 INFO - ++DOCSHELL 0x7f1183654000 == 17 [pid = 1950] [id = 152]
11:27:35 INFO - ++DOMWINDOW == 41 (0x7f11838c4400) [pid = 1950] [serial = 352] [outer = (nil)]
11:27:35 INFO - ++DOMWINDOW == 42 (0x7f1188149000) [pid = 1950] [serial = 353] [outer = 0x7f11838c4400]
11:27:35 INFO - 53 INFO TEST-START | devtools/client/webconsole/test/browser_console_navigation_marker.js
11:27:35 INFO - ++DOCSHELL 0x7f118a996800 == 18 [pid = 1950] [id = 153]
11:27:35 INFO - ++DOMWINDOW == 43 (0x7f118a9b9800) [pid = 1950] [serial = 354] [outer = (nil)]
11:27:35 INFO - ++DOMWINDOW == 44 (0x7f118a9c0800) [pid = 1950] [serial = 355] [outer = 0x7f118a9b9800]
11:27:36 INFO - ++DOMWINDOW == 45 (0x7f118dd56400) [pid = 1950] [serial = 356] [outer = 0x7f118a9b9800]
11:27:36 INFO - ++DOCSHELL 0x7f119164a800 == 19 [pid = 1950] [id = 154]
11:27:36 INFO - ++DOMWINDOW == 46 (0x7f118ce95400) [pid = 1950] [serial = 357] [outer = (nil)]
11:27:36 INFO - ++DOMWINDOW == 47 (0x7f11916c8000) [pid = 1950] [serial = 358] [outer = 0x7f118ce95400]
11:27:36 INFO - ++DOMWINDOW == 48 (0x7f118758b400) [pid = 1950] [serial = 359] [outer = 0x7f118ce95400]
11:27:37 INFO - ++DOCSHELL 0x7f11926d7000 == 20 [pid = 1950] [id = 155]
11:27:37 INFO - ++DOMWINDOW == 49 (0x7f119e246400) [pid = 1950] [serial = 360] [outer = (nil)]
11:27:37 INFO - ++DOMWINDOW == 50 (0x7f119e2b0800) [pid = 1950] [serial = 361] [outer = 0x7f119e246400]
11:27:39 INFO - ++DOMWINDOW == 51 (0x7f11a738ec00) [pid = 1950] [serial = 362] [outer = 0x7f118a9b9800]
11:27:39 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:27:40 INFO - --DOCSHELL 0x7f1182496800 == 19 [pid = 1950] [id = 150]
11:27:40 INFO - --DOCSHELL 0x7f119256a000 == 18 [pid = 1950] [id = 148]
11:27:40 INFO - --DOCSHELL 0x7f11835f0000 == 17 [pid = 1950] [id = 141]
11:27:40 INFO - --DOCSHELL 0x7f1183e45000 == 16 [pid = 1950] [id = 142]
11:27:40 INFO - --DOCSHELL 0x7f1192459000 == 15 [pid = 1950] [id = 147]
11:27:40 INFO - --DOCSHELL 0x7f1183664000 == 14 [pid = 1950] [id = 143]
11:27:40 INFO - --DOCSHELL 0x7f118f643800 == 13 [pid = 1950] [id = 151]
11:27:40 INFO - --DOCSHELL 0x7f118a022800 == 12 [pid = 1950] [id = 146]
11:27:40 INFO - --DOMWINDOW == 50 (0x7f11a1352000) [pid = 1950] [serial = 338] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:40 INFO - --DOMWINDOW == 49 (0x7f118260c000) [pid = 1950] [serial = 274] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:40 INFO - --DOMWINDOW == 48 (0x7f1183fc7800) [pid = 1950] [serial = 313] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:40 INFO - --DOMWINDOW == 47 (0x7f1183675400) [pid = 1950] [serial = 317] [outer = (nil)] [url = about:blank]
11:27:40 INFO - --DOMWINDOW == 46 (0x7f1196586800) [pid = 1950] [serial = 336] [outer = (nil)] [url = about:blank]
11:27:40 INFO - --DOMWINDOW == 45 (0x7f1187592400) [pid = 1950] [serial = 267] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:40 INFO - --DOMWINDOW == 44 (0x7f11872b8000) [pid = 1950] [serial = 315] [outer = (nil)] [url = about:blank]
11:27:40 INFO - --DOMWINDOW == 43 (0x7f118db0ec00) [pid = 1950] [serial = 334] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:41 INFO - --DOCSHELL 0x7f11926d7000 == 11 [pid = 1950] [id = 155]
11:27:41 INFO - MEMORY STAT | vsize 1208MB | residentFast 322MB | heapAllocated 120MB
11:27:41 INFO - 54 INFO TEST-OK | devtools/client/webconsole/test/browser_console_navigation_marker.js | took 5794ms
11:27:41 INFO - ++DOCSHELL 0x7f1183e47800 == 12 [pid = 1950] [id = 156]
11:27:41 INFO - ++DOMWINDOW == 44 (0x7f1183fc2800) [pid = 1950] [serial = 363] [outer = (nil)]
11:27:41 INFO - ++DOMWINDOW == 45 (0x7f1183fc9400) [pid = 1950] [serial = 364] [outer = 0x7f1183fc2800]
11:27:41 INFO - 55 INFO TEST-START | devtools/client/webconsole/test/browser_console_netlogging.js
11:27:41 INFO - ++DOCSHELL 0x7f118817d800 == 13 [pid = 1950] [id = 157]
11:27:41 INFO - ++DOMWINDOW == 46 (0x7f1183fe1000) [pid = 1950] [serial = 365] [outer = (nil)]
11:27:41 INFO - ++DOMWINDOW == 47 (0x7f1184370c00) [pid = 1950] [serial = 366] [outer = 0x7f1183fe1000]
11:27:42 INFO - ++DOCSHELL 0x7f118a014800 == 14 [pid = 1950] [id = 158]
11:27:42 INFO - ++DOMWINDOW == 48 (0x7f1188145c00) [pid = 1950] [serial = 367] [outer = (nil)]
11:27:42 INFO - ++DOMWINDOW == 49 (0x7f118814f000) [pid = 1950] [serial = 368] [outer = 0x7f1188145c00]
11:27:43 INFO - ++DOMWINDOW == 50 (0x7f118ce9ec00) [pid = 1950] [serial = 369] [outer = 0x7f1183fe1000]
11:27:43 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:27:44 INFO - MEMORY STAT | vsize 1214MB | residentFast 328MB | heapAllocated 127MB
11:27:44 INFO - 56 INFO TEST-OK | devtools/client/webconsole/test/browser_console_netlogging.js | took 2627ms
11:27:44 INFO - ++DOCSHELL 0x7f118a9a5000 == 15 [pid = 1950] [id = 159]
11:27:44 INFO - ++DOMWINDOW == 51 (0x7f11881efc00) [pid = 1950] [serial = 370] [outer = (nil)]
11:27:44 INFO - ++DOMWINDOW == 52 (0x7f118a3e0400) [pid = 1950] [serial = 371] [outer = 0x7f11881efc00]
11:27:44 INFO - 57 INFO TEST-START | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js
11:27:44 INFO - ++DOCSHELL 0x7f1191646000 == 16 [pid = 1950] [id = 160]
11:27:44 INFO - ++DOMWINDOW == 53 (0x7f118ab7bc00) [pid = 1950] [serial = 372] [outer = (nil)]
11:27:44 INFO - ++DOMWINDOW == 54 (0x7f118ce9ac00) [pid = 1950] [serial = 373] [outer = 0x7f118ab7bc00]
11:27:45 INFO - ++DOCSHELL 0x7f119199a000 == 17 [pid = 1950] [id = 161]
11:27:45 INFO - ++DOMWINDOW == 55 (0x7f11910b0000) [pid = 1950] [serial = 374] [outer = (nil)]
11:27:45 INFO - ++DOMWINDOW == 56 (0x7f11916d2400) [pid = 1950] [serial = 375] [outer = 0x7f11910b0000]
11:27:46 INFO - --DOMWINDOW == 55 (0x7f1181f51c00) [pid = 1950] [serial = 341] [outer = (nil)] [url = data:text/html;charset=utf8,
bug870220hello%20world
native%20getters!]
11:27:46 INFO - --DOMWINDOW == 54 (0x7f1184370000) [pid = 1950] [serial = 350] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:46 INFO - --DOMWINDOW == 53 (0x7f1192409c00) [pid = 1950] [serial = 339] [outer = (nil)] [url = about:blank]
11:27:46 INFO - --DOMWINDOW == 52 (0x7f11910a9c00) [pid = 1950] [serial = 326] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:46 INFO - --DOMWINDOW == 51 (0x7f118283ec00) [pid = 1950] [serial = 348] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:46 INFO - --DOMWINDOW == 50 (0x7f11881f7000) [pid = 1950] [serial = 323] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:46 INFO - --DOMWINDOW == 49 (0x7f119f0c7000) [pid = 1950] [serial = 343] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:46 INFO - --DOMWINDOW == 48 (0x7f11a6182c00) [pid = 1950] [serial = 346] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:46 INFO - --DOMWINDOW == 47 (0x7f11926e3400) [pid = 1950] [serial = 340] [outer = (nil)] [url = about:blank]
11:27:46 INFO - --DOMWINDOW == 46 (0x7f11916c8000) [pid = 1950] [serial = 358] [outer = (nil)] [url = about:blank]
11:27:46 INFO - ++DOMWINDOW == 47 (0x7f1181f51c00) [pid = 1950] [serial = 376] [outer = 0x7f11910b0000]
11:27:46 INFO - ++DOCSHELL 0x7f1192458800 == 18 [pid = 1950] [id = 162]
11:27:46 INFO - ++DOMWINDOW == 48 (0x7f119240c800) [pid = 1950] [serial = 377] [outer = (nil)]
11:27:46 INFO - ++DOMWINDOW == 49 (0x7f11925e0c00) [pid = 1950] [serial = 378] [outer = 0x7f119240c800]
11:27:50 INFO - --DOCSHELL 0x7f1183e47800 == 17 [pid = 1950] [id = 156]
11:27:50 INFO - --DOCSHELL 0x7f118817d800 == 16 [pid = 1950] [id = 157]
11:27:50 INFO - --DOCSHELL 0x7f119199a000 == 15 [pid = 1950] [id = 161]
11:27:50 INFO - --DOCSHELL 0x7f1192458800 == 14 [pid = 1950] [id = 162]
11:27:50 INFO - --DOCSHELL 0x7f118a996800 == 13 [pid = 1950] [id = 153]
11:27:50 INFO - --DOCSHELL 0x7f119164a800 == 12 [pid = 1950] [id = 154]
11:27:50 INFO - --DOCSHELL 0x7f1183654000 == 11 [pid = 1950] [id = 152]
11:27:50 INFO - --DOCSHELL 0x7f118a014800 == 10 [pid = 1950] [id = 158]
11:27:50 INFO - --DOMWINDOW == 48 (0x7f119ef1c400) [pid = 1950] [serial = 342] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 47 (0x7f118ab89c00) [pid = 1950] [serial = 351] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:50 INFO - --DOMWINDOW == 46 (0x7f119e239c00) [pid = 1950] [serial = 345] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:50 INFO - --DOMWINDOW == 45 (0x7f1182847c00) [pid = 1950] [serial = 349] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:27:50 INFO - --DOMWINDOW == 44 (0x7f118dd9bc00) [pid = 1950] [serial = 325] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:50 INFO - --DOMWINDOW == 43 (0x7f11a6726800) [pid = 1950] [serial = 347] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 42 (0x7f11910abc00) [pid = 1950] [serial = 327] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 41 (0x7f1188145c00) [pid = 1950] [serial = 367] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:50 INFO - --DOMWINDOW == 40 (0x7f118ce95400) [pid = 1950] [serial = 357] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:27:50 INFO - --DOMWINDOW == 39 (0x7f119e246400) [pid = 1950] [serial = 360] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:27:50 INFO - --DOMWINDOW == 38 (0x7f1183fe1000) [pid = 1950] [serial = 365] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:27:50 INFO - --DOMWINDOW == 37 (0x7f1183fc2800) [pid = 1950] [serial = 363] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 36 (0x7f118a9b9800) [pid = 1950] [serial = 354] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:27:50 INFO - --DOMWINDOW == 35 (0x7f11838c4400) [pid = 1950] [serial = 352] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 34 (0x7f11916d2400) [pid = 1950] [serial = 375] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 33 (0x7f1184370c00) [pid = 1950] [serial = 366] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 32 (0x7f1183fc9400) [pid = 1950] [serial = 364] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 31 (0x7f118a9c0800) [pid = 1950] [serial = 355] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 30 (0x7f1188149000) [pid = 1950] [serial = 353] [outer = (nil)] [url = about:blank]
11:27:50 INFO - --DOMWINDOW == 29 (0x7f118ce9ec00) [pid = 1950] [serial = 369] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:27:50 INFO - --DOMWINDOW == 28 (0x7f118dd56400) [pid = 1950] [serial = 356] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:27:50 INFO - ++DOCSHELL 0x7f11827e4000 == 11 [pid = 1950] [id = 163]
11:27:50 INFO - ++DOMWINDOW == 29 (0x7f118274c800) [pid = 1950] [serial = 379] [outer = (nil)]
11:27:50 INFO - ++DOMWINDOW == 30 (0x7f1182750800) [pid = 1950] [serial = 380] [outer = 0x7f118274c800]
11:27:51 INFO - MEMORY STAT | vsize 1209MB | residentFast 308MB | heapAllocated 109MB
11:27:51 INFO - 58 INFO TEST-OK | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js | took 6956ms
11:27:51 INFO - ++DOCSHELL 0x7f1183654000 == 12 [pid = 1950] [id = 164]
11:27:51 INFO - ++DOMWINDOW == 31 (0x7f1183fca800) [pid = 1950] [serial = 381] [outer = (nil)]
11:27:51 INFO - ++DOMWINDOW == 32 (0x7f1183fde800) [pid = 1950] [serial = 382] [outer = 0x7f1183fca800]
11:27:52 INFO - 59 INFO TEST-START | devtools/client/webconsole/test/browser_console_open_or_focus.js
11:27:52 INFO - ++DOCSHELL 0x7f1187fbd000 == 13 [pid = 1950] [id = 165]
11:27:52 INFO - ++DOMWINDOW == 33 (0x7f11872b9c00) [pid = 1950] [serial = 383] [outer = (nil)]
11:27:52 INFO - ++DOMWINDOW == 34 (0x7f1187583c00) [pid = 1950] [serial = 384] [outer = 0x7f11872b9c00]
11:27:52 INFO - console.log: testmessage
11:27:53 INFO - MEMORY STAT | vsize 1210MB | residentFast 311MB | heapAllocated 111MB
11:27:53 INFO - 60 INFO TEST-OK | devtools/client/webconsole/test/browser_console_open_or_focus.js | took 1384ms
11:27:53 INFO - ++DOCSHELL 0x7f11824a5000 == 14 [pid = 1950] [id = 166]
11:27:53 INFO - ++DOMWINDOW == 35 (0x7f1182887400) [pid = 1950] [serial = 385] [outer = (nil)]
11:27:53 INFO - ++DOMWINDOW == 36 (0x7f1183672400) [pid = 1950] [serial = 386] [outer = 0x7f1182887400]
11:27:53 INFO - 61 INFO TEST-START | devtools/client/webconsole/test/browser_console_optimized_out_vars.js
11:27:53 INFO - ++DOCSHELL 0x7f118a317800 == 15 [pid = 1950] [id = 167]
11:27:53 INFO - ++DOMWINDOW == 37 (0x7f1187590c00) [pid = 1950] [serial = 387] [outer = (nil)]
11:27:53 INFO - ++DOMWINDOW == 38 (0x7f11881f2c00) [pid = 1950] [serial = 388] [outer = 0x7f1187590c00]
11:27:54 INFO - ++DOMWINDOW == 39 (0x7f118a335c00) [pid = 1950] [serial = 389] [outer = 0x7f1187590c00]
11:27:54 INFO - ++DOCSHELL 0x7f11827dc800 == 16 [pid = 1950] [id = 168]
11:27:54 INFO - ++DOMWINDOW == 40 (0x7f1182611000) [pid = 1950] [serial = 390] [outer = (nil)]
11:27:54 INFO - ++DOMWINDOW == 41 (0x7f1182845000) [pid = 1950] [serial = 391] [outer = 0x7f1182611000]
11:27:54 INFO - ++DOMWINDOW == 42 (0x7f1182750000) [pid = 1950] [serial = 392] [outer = 0x7f1182611000]
11:27:55 INFO - ++DOCSHELL 0x7f118d5eb000 == 17 [pid = 1950] [id = 169]
11:27:55 INFO - ++DOMWINDOW == 43 (0x7f1182422400) [pid = 1950] [serial = 393] [outer = (nil)]
11:27:55 INFO - ++DOMWINDOW == 44 (0x7f118ab87400) [pid = 1950] [serial = 394] [outer = 0x7f1182422400]
11:27:57 INFO - ++DOCSHELL 0x7f119142c000 == 18 [pid = 1950] [id = 170]
11:27:57 INFO - ++DOMWINDOW == 45 (0x7f118288dc00) [pid = 1950] [serial = 395] [outer = (nil)]
11:27:57 INFO - ++DOMWINDOW == 46 (0x7f119193ac00) [pid = 1950] [serial = 396] [outer = 0x7f118288dc00]
11:27:57 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:27:58 INFO - ++DOCSHELL 0x7f11a61a9800 == 19 [pid = 1950] [id = 171]
11:27:58 INFO - ++DOMWINDOW == 47 (0x7f1196589c00) [pid = 1950] [serial = 397] [outer = (nil)]
11:27:58 INFO - ++DOMWINDOW == 48 (0x7f118a922800) [pid = 1950] [serial = 398] [outer = 0x7f1196589c00]
11:28:00 INFO - --DOCSHELL 0x7f11827e4000 == 18 [pid = 1950] [id = 163]
11:28:00 INFO - --DOCSHELL 0x7f1187fbd000 == 17 [pid = 1950] [id = 165]
11:28:01 INFO - --DOCSHELL 0x7f1191646000 == 16 [pid = 1950] [id = 160]
11:28:01 INFO - --DOCSHELL 0x7f118a9a5000 == 15 [pid = 1950] [id = 159]
11:28:01 INFO - --DOMWINDOW == 47 (0x7f11a738ec00) [pid = 1950] [serial = 362] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:28:01 INFO - --DOMWINDOW == 46 (0x7f118814f000) [pid = 1950] [serial = 368] [outer = (nil)] [url = about:blank]
11:28:01 INFO - --DOMWINDOW == 45 (0x7f119e2b0800) [pid = 1950] [serial = 361] [outer = (nil)] [url = about:blank]
11:28:01 INFO - --DOMWINDOW == 44 (0x7f118758b400) [pid = 1950] [serial = 359] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:04 INFO - --DOCSHELL 0x7f11a61a9800 == 14 [pid = 1950] [id = 171]
11:28:04 INFO - --DOCSHELL 0x7f119142c000 == 13 [pid = 1950] [id = 170]
11:28:04 INFO - --DOCSHELL 0x7f118d5eb000 == 12 [pid = 1950] [id = 169]
11:28:05 INFO - --DOCSHELL 0x7f1183654000 == 11 [pid = 1950] [id = 164]
11:28:05 INFO - --DOMWINDOW == 43 (0x7f1196589c00) [pid = 1950] [serial = 397] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:28:05 INFO - --DOMWINDOW == 42 (0x7f1182845000) [pid = 1950] [serial = 391] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 41 (0x7f118274c800) [pid = 1950] [serial = 379] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:05 INFO - --DOMWINDOW == 40 (0x7f11872b9c00) [pid = 1950] [serial = 383] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:05 INFO - --DOMWINDOW == 39 (0x7f1183fde800) [pid = 1950] [serial = 382] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 38 (0x7f1183fca800) [pid = 1950] [serial = 381] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 37 (0x7f11881f2c00) [pid = 1950] [serial = 388] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 36 (0x7f118ce9ac00) [pid = 1950] [serial = 373] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 35 (0x7f118a3e0400) [pid = 1950] [serial = 371] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 34 (0x7f119240c800) [pid = 1950] [serial = 377] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:05 INFO - --DOMWINDOW == 33 (0x7f118ab7bc00) [pid = 1950] [serial = 372] [outer = (nil)] [url = data:text/html;charset=utf8,bug859756hello%20world
nsIConsoleMessages%20ftw!]
11:28:05 INFO - --DOMWINDOW == 32 (0x7f11881efc00) [pid = 1950] [serial = 370] [outer = (nil)] [url = about:blank]
11:28:05 INFO - --DOMWINDOW == 31 (0x7f11910b0000) [pid = 1950] [serial = 374] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:06 INFO - MEMORY STAT | vsize 1209MB | residentFast 313MB | heapAllocated 120MB
11:28:06 INFO - 62 INFO TEST-OK | devtools/client/webconsole/test/browser_console_optimized_out_vars.js | took 12429ms
11:28:06 INFO - ++DOCSHELL 0x7f1181169800 == 12 [pid = 1950] [id = 172]
11:28:06 INFO - ++DOMWINDOW == 32 (0x7f1181d1b000) [pid = 1950] [serial = 399] [outer = (nil)]
11:28:06 INFO - ++DOMWINDOW == 33 (0x7f1182604400) [pid = 1950] [serial = 400] [outer = 0x7f1181d1b000]
11:28:06 INFO - 63 INFO TEST-START | devtools/client/webconsole/test/browser_console_private_browsing.js
11:28:06 INFO - ++DOCSHELL 0x7f11835e0800 == 13 [pid = 1950] [id = 173]
11:28:06 INFO - ++DOMWINDOW == 34 (0x7f1182755c00) [pid = 1950] [serial = 401] [outer = (nil)]
11:28:06 INFO - ++DOMWINDOW == 35 (0x7f1182881400) [pid = 1950] [serial = 402] [outer = 0x7f1182755c00]
11:28:06 INFO - ++DOCSHELL 0x7f1183e2d800 == 14 [pid = 1950] [id = 174]
11:28:06 INFO - ++DOMWINDOW == 36 (0x7f11838ed000) [pid = 1950] [serial = 403] [outer = (nil)]
11:28:06 INFO - ++DOMWINDOW == 37 (0x7f1183a7c400) [pid = 1950] [serial = 404] [outer = 0x7f11838ed000]
11:28:07 INFO - ++DOCSHELL 0x7f1187d82800 == 15 [pid = 1950] [id = 175]
11:28:07 INFO - ++DOMWINDOW == 38 (0x7f1183fca000) [pid = 1950] [serial = 405] [outer = (nil)]
11:28:07 INFO - ++DOCSHELL 0x7f1187d83000 == 16 [pid = 1950] [id = 176]
11:28:07 INFO - ++DOMWINDOW == 39 (0x7f1183fcb000) [pid = 1950] [serial = 406] [outer = (nil)]
11:28:07 INFO - ++DOMWINDOW == 40 (0x7f1183fcc800) [pid = 1950] [serial = 407] [outer = 0x7f1183fcb000]
11:28:07 INFO - ++DOCSHELL 0x7f118a9a4800 == 17 [pid = 1950] [id = 177]
11:28:07 INFO - ++DOMWINDOW == 41 (0x7f1183fc9c00) [pid = 1950] [serial = 408] [outer = (nil)]
11:28:07 INFO - ++DOMWINDOW == 42 (0x7f118a32a800) [pid = 1950] [serial = 409] [outer = 0x7f1183fc9c00]
11:28:07 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:07 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:07 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:07 INFO - ++DOMWINDOW == 43 (0x7f118a3e6000) [pid = 1950] [serial = 410] [outer = 0x7f1183fca000]
11:28:07 INFO - ++DOMWINDOW == 44 (0x7f118a92b000) [pid = 1950] [serial = 411] [outer = 0x7f1183fcb000]
11:28:07 INFO - ++DOMWINDOW == 45 (0x7f118a936c00) [pid = 1950] [serial = 412] [outer = 0x7f1183fc9c00]
11:28:08 INFO - ++DOMWINDOW == 46 (0x7f118ce90000) [pid = 1950] [serial = 413] [outer = 0x7f1183fc9c00]
11:28:08 INFO - ++DOCSHELL 0x7f118a9a5000 == 18 [pid = 1950] [id = 178]
11:28:08 INFO - ++DOMWINDOW == 47 (0x7f118260d000) [pid = 1950] [serial = 414] [outer = (nil)]
11:28:08 INFO - ++DOMWINDOW == 48 (0x7f118d404800) [pid = 1950] [serial = 415] [outer = 0x7f118260d000]
11:28:09 INFO - ++DOCSHELL 0x7f119dee6000 == 19 [pid = 1950] [id = 179]
11:28:09 INFO - ++DOMWINDOW == 49 (0x7f118dda8c00) [pid = 1950] [serial = 416] [outer = (nil)]
11:28:09 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:09 INFO - ++DOMWINDOW == 50 (0x7f118f19b000) [pid = 1950] [serial = 417] [outer = 0x7f118dda8c00]
11:28:09 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:09 INFO - ++DOCSHELL 0x7f119de16000 == 20 [pid = 1950] [id = 180]
11:28:09 INFO - ++DOMWINDOW == 51 (0x7f118f594800) [pid = 1950] [serial = 418] [outer = (nil)]
11:28:09 INFO - ++DOMWINDOW == 52 (0x7f11903e0c00) [pid = 1950] [serial = 419] [outer = 0x7f118f594800]
11:28:09 INFO - ++DOMWINDOW == 53 (0x7f118db97c00) [pid = 1950] [serial = 420] [outer = 0x7f118f594800]
11:28:09 INFO - [1950] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1308
11:28:09 INFO - ++DOMWINDOW == 54 (0x7f1182430400) [pid = 1950] [serial = 421] [outer = 0x7f118dda8c00]
11:28:10 INFO - [1950] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1308
11:28:10 INFO - ++DOCSHELL 0x7f11926d3000 == 21 [pid = 1950] [id = 181]
11:28:10 INFO - ++DOMWINDOW == 55 (0x7f11916d8800) [pid = 1950] [serial = 422] [outer = (nil)]
11:28:10 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:10 INFO - ++DOMWINDOW == 56 (0x7f11916e0000) [pid = 1950] [serial = 423] [outer = 0x7f11916d8800]
11:28:13 INFO - --DOCSHELL 0x7f11824a5000 == 20 [pid = 1950] [id = 166]
11:28:13 INFO - --DOCSHELL 0x7f11827dc800 == 19 [pid = 1950] [id = 168]
11:28:13 INFO - --DOCSHELL 0x7f118a317800 == 18 [pid = 1950] [id = 167]
11:28:13 INFO - JavaScript error: data:text/html;charset=utf8,
hello%20world!%20bug%20874061, line 1: ReferenceError: fooBazBaz is not defined
11:28:13 INFO - --DOMWINDOW == 55 (0x7f1181f51c00) [pid = 1950] [serial = 376] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:13 INFO - --DOMWINDOW == 54 (0x7f11925e0c00) [pid = 1950] [serial = 378] [outer = (nil)] [url = about:blank]
11:28:13 INFO - --DOMWINDOW == 53 (0x7f118a922800) [pid = 1950] [serial = 398] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:28:13 INFO - --DOMWINDOW == 52 (0x7f1182750800) [pid = 1950] [serial = 380] [outer = (nil)] [url = about:blank]
11:28:13 INFO - --DOMWINDOW == 51 (0x7f1187583c00) [pid = 1950] [serial = 384] [outer = (nil)] [url = about:blank]
11:28:13 INFO - --DOMWINDOW == 50 (0x7f1183fcc800) [pid = 1950] [serial = 407] [outer = 0x7f1183fcb000] [url = about:blank]
11:28:13 INFO - --DOCSHELL 0x7f11926d3000 == 17 [pid = 1950] [id = 181]
11:28:14 INFO - --DOCSHELL 0x7f119dee6000 == 16 [pid = 1950] [id = 179]
11:28:15 INFO - ++DOCSHELL 0x7f118115b000 == 17 [pid = 1950] [id = 182]
11:28:15 INFO - ++DOMWINDOW == 51 (0x7f118113f400) [pid = 1950] [serial = 424] [outer = (nil)]
11:28:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:15 INFO - ++DOMWINDOW == 52 (0x7f1181146000) [pid = 1950] [serial = 425] [outer = 0x7f118113f400]
11:28:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:15 INFO - --DOMWINDOW == 51 (0x7f1183672400) [pid = 1950] [serial = 386] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 50 (0x7f118a32a800) [pid = 1950] [serial = 409] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 49 (0x7f118a936c00) [pid = 1950] [serial = 412] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 48 (0x7f1187590c00) [pid = 1950] [serial = 387] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html]
11:28:15 INFO - --DOMWINDOW == 47 (0x7f11903e0c00) [pid = 1950] [serial = 419] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 46 (0x7f118f19b000) [pid = 1950] [serial = 417] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 45 (0x7f118288dc00) [pid = 1950] [serial = 395] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:28:15 INFO - --DOMWINDOW == 44 (0x7f1182422400) [pid = 1950] [serial = 393] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:15 INFO - --DOMWINDOW == 43 (0x7f1182611000) [pid = 1950] [serial = 390] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:15 INFO - --DOMWINDOW == 42 (0x7f1182887400) [pid = 1950] [serial = 385] [outer = (nil)] [url = about:blank]
11:28:15 INFO - --DOMWINDOW == 41 (0x7f118a335c00) [pid = 1950] [serial = 389] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html]
11:28:15 INFO - ++DOMWINDOW == 42 (0x7f1182884800) [pid = 1950] [serial = 426] [outer = 0x7f118113f400]
11:28:15 INFO - ++DOCSHELL 0x7f118a317800 == 18 [pid = 1950] [id = 183]
11:28:15 INFO - ++DOMWINDOW == 43 (0x7f1183fe3c00) [pid = 1950] [serial = 427] [outer = (nil)]
11:28:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:28:15 INFO - ++DOMWINDOW == 44 (0x7f1184369800) [pid = 1950] [serial = 428] [outer = 0x7f1183fe3c00]
11:28:18 INFO - --DOCSHELL 0x7f118a317800 == 17 [pid = 1950] [id = 183]
11:28:18 INFO - --DOMWINDOW == 43 (0x7f119193ac00) [pid = 1950] [serial = 396] [outer = (nil)] [url = about:blank]
11:28:18 INFO - --DOMWINDOW == 42 (0x7f118ab87400) [pid = 1950] [serial = 394] [outer = (nil)] [url = about:blank]
11:28:18 INFO - --DOMWINDOW == 41 (0x7f1182750000) [pid = 1950] [serial = 392] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:18 INFO - --DOMWINDOW == 40 (0x7f1181146000) [pid = 1950] [serial = 425] [outer = (nil)] [url = about:blank]
11:28:18 INFO - ++DOCSHELL 0x7f11824a0800 == 18 [pid = 1950] [id = 184]
11:28:18 INFO - ++DOMWINDOW == 41 (0x7f1182750800) [pid = 1950] [serial = 429] [outer = (nil)]
11:28:18 INFO - ++DOMWINDOW == 42 (0x7f1182845000) [pid = 1950] [serial = 430] [outer = 0x7f1182750800]
11:28:19 INFO - JavaScript error: data:text/html;charset=utf8,hello%20world!%20bug%20874061, line 1: ReferenceError: fooBazBaz is not defined
11:28:20 INFO - ++DOCSHELL 0x7f118115d000 == 19 [pid = 1950] [id = 185]
11:28:20 INFO - ++DOMWINDOW == 43 (0x7f11838bec00) [pid = 1950] [serial = 431] [outer = (nil)]
11:28:20 INFO - ++DOMWINDOW == 44 (0x7f11838c0c00) [pid = 1950] [serial = 432] [outer = 0x7f11838bec00]
11:28:22 INFO - MEMORY STAT | vsize 1216MB | residentFast 319MB | heapAllocated 123MB
11:28:22 INFO - 64 INFO TEST-OK | devtools/client/webconsole/test/browser_console_private_browsing.js | took 15696ms
11:28:22 INFO - ++DOCSHELL 0x7f11826bf000 == 20 [pid = 1950] [id = 186]
11:28:22 INFO - ++DOMWINDOW == 45 (0x7f1183caa400) [pid = 1950] [serial = 433] [outer = (nil)]
11:28:22 INFO - ++DOMWINDOW == 46 (0x7f1183fdd000) [pid = 1950] [serial = 434] [outer = 0x7f1183caa400]
11:28:22 INFO - 65 INFO TEST-START | devtools/client/webconsole/test/browser_console_server_logging.js
11:28:22 INFO - ++DOCSHELL 0x7f11923b5800 == 21 [pid = 1950] [id = 187]
11:28:22 INFO - ++DOMWINDOW == 47 (0x7f118a90fc00) [pid = 1950] [serial = 435] [outer = (nil)]
11:28:22 INFO - ++DOMWINDOW == 48 (0x7f118a92b400) [pid = 1950] [serial = 436] [outer = 0x7f118a90fc00]
11:28:22 INFO - ++DOMWINDOW == 49 (0x7f1181d13000) [pid = 1950] [serial = 437] [outer = 0x7f118a90fc00]
11:28:22 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:28:23 INFO - ++DOCSHELL 0x7f11827e9800 == 22 [pid = 1950] [id = 188]
11:28:23 INFO - ++DOMWINDOW == 50 (0x7f1182750000) [pid = 1950] [serial = 438] [outer = (nil)]
11:28:23 INFO - ++DOMWINDOW == 51 (0x7f118288a000) [pid = 1950] [serial = 439] [outer = 0x7f1182750000]
11:28:23 INFO - ++DOMWINDOW == 52 (0x7f1181143400) [pid = 1950] [serial = 440] [outer = 0x7f1182750000]
11:28:23 INFO - ++DOCSHELL 0x7f118f643000 == 23 [pid = 1950] [id = 189]
11:28:23 INFO - ++DOMWINDOW == 53 (0x7f118a9b4c00) [pid = 1950] [serial = 441] [outer = (nil)]
11:28:23 INFO - ++DOMWINDOW == 54 (0x7f118a9b6c00) [pid = 1950] [serial = 442] [outer = 0x7f118a9b4c00]
11:28:25 INFO - ++DOMWINDOW == 55 (0x7f1196585c00) [pid = 1950] [serial = 443] [outer = 0x7f118a90fc00]
11:28:25 INFO - [1950] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4692
11:28:26 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:28:26 INFO - ++DOCSHELL 0x7f11a1478800 == 24 [pid = 1950] [id = 190]
11:28:26 INFO - ++DOMWINDOW == 56 (0x7f1181f5c000) [pid = 1950] [serial = 444] [outer = (nil)]
11:28:26 INFO - ++DOMWINDOW == 57 (0x7f119ddd8c00) [pid = 1950] [serial = 445] [outer = 0x7f1181f5c000]
11:28:26 INFO - ++DOMWINDOW == 58 (0x7f1184375000) [pid = 1950] [serial = 446] [outer = 0x7f1181f5c000]
11:28:26 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:28:27 INFO - ++DOCSHELL 0x7f11a67cc000 == 25 [pid = 1950] [id = 191]
11:28:27 INFO - ++DOMWINDOW == 59 (0x7f119c6b9c00) [pid = 1950] [serial = 447] [outer = (nil)]
11:28:27 INFO - ++DOMWINDOW == 60 (0x7f119dd59800) [pid = 1950] [serial = 448] [outer = 0x7f119c6b9c00]
11:28:27 INFO - ++DOMWINDOW == 61 (0x7f1181d19800) [pid = 1950] [serial = 449] [outer = 0x7f119c6b9c00]
11:28:27 INFO - ++DOCSHELL 0x7f11a83c7000 == 26 [pid = 1950] [id = 192]
11:28:27 INFO - ++DOMWINDOW == 62 (0x7f119e4f4000) [pid = 1950] [serial = 450] [outer = (nil)]
11:28:27 INFO - ++DOMWINDOW == 63 (0x7f119eecec00) [pid = 1950] [serial = 451] [outer = 0x7f119e4f4000]
11:28:29 INFO - ++DOMWINDOW == 64 (0x7f11a1ff0c00) [pid = 1950] [serial = 452] [outer = 0x7f1181f5c000]
11:28:29 INFO - [1950] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4692
11:28:29 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:28:30 INFO - MEMORY STAT | vsize 1220MB | residentFast 332MB | heapAllocated 133MB
11:28:30 INFO - 66 INFO TEST-OK | devtools/client/webconsole/test/browser_console_server_logging.js | took 8540ms
11:28:31 INFO - ++DOCSHELL 0x7f11824ad800 == 27 [pid = 1950] [id = 193]
11:28:31 INFO - ++DOMWINDOW == 65 (0x7f11837e7c00) [pid = 1950] [serial = 453] [outer = (nil)]
11:28:31 INFO - ++DOMWINDOW == 66 (0x7f1184377400) [pid = 1950] [serial = 454] [outer = 0x7f11837e7c00]
11:28:31 INFO - 67 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view.js
11:28:31 INFO - ++DOCSHELL 0x7f11a83dd000 == 28 [pid = 1950] [id = 194]
11:28:31 INFO - ++DOMWINDOW == 67 (0x7f119e040400) [pid = 1950] [serial = 455] [outer = (nil)]
11:28:31 INFO - ++DOMWINDOW == 68 (0x7f11a0d5a000) [pid = 1950] [serial = 456] [outer = 0x7f119e040400]
11:28:33 INFO - --DOCSHELL 0x7f11835e0800 == 27 [pid = 1950] [id = 173]
11:28:33 INFO - --DOCSHELL 0x7f118f643000 == 26 [pid = 1950] [id = 189]
11:28:33 INFO - --DOCSHELL 0x7f1181169800 == 25 [pid = 1950] [id = 172]
11:28:33 INFO - --DOCSHELL 0x7f11a83c7000 == 24 [pid = 1950] [id = 192]
11:28:33 INFO - --DOCSHELL 0x7f1183e2d800 == 23 [pid = 1950] [id = 174]
11:28:33 INFO - --DOCSHELL 0x7f118a9a4800 == 22 [pid = 1950] [id = 177]
11:28:33 INFO - --DOCSHELL 0x7f1187d82800 == 21 [pid = 1950] [id = 175]
11:28:33 INFO - --DOCSHELL 0x7f1187d83000 == 20 [pid = 1950] [id = 176]
11:28:33 INFO - --DOCSHELL 0x7f118a9a5000 == 19 [pid = 1950] [id = 178]
11:28:33 INFO - --DOCSHELL 0x7f118115b000 == 18 [pid = 1950] [id = 182]
11:28:33 INFO - --DOCSHELL 0x7f119de16000 == 17 [pid = 1950] [id = 180]
11:28:33 INFO - --DOCSHELL 0x7f11824a0800 == 16 [pid = 1950] [id = 184]
11:28:33 INFO - --DOCSHELL 0x7f118115d000 == 15 [pid = 1950] [id = 185]
11:28:33 INFO - --DOMWINDOW == 67 (0x7f118a3e6000) [pid = 1950] [serial = 410] [outer = 0x7f1183fca000] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 66 (0x7f118a92b000) [pid = 1950] [serial = 411] [outer = 0x7f1183fcb000] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 65 (0x7f1183fcb000) [pid = 1950] [serial = 406] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 64 (0x7f1183fca000) [pid = 1950] [serial = 405] [outer = (nil)] [url = about:blank]
11:28:33 INFO - ++DOMWINDOW == 65 (0x7f1181d0d800) [pid = 1950] [serial = 457] [outer = 0x7f119e040400]
11:28:33 INFO - --DOMWINDOW == 64 (0x7f118f594800) [pid = 1950] [serial = 418] [outer = (nil)] [url = about:privatebrowsing]
11:28:33 INFO - --DOMWINDOW == 63 (0x7f1183fc9c00) [pid = 1950] [serial = 408] [outer = (nil)] [url = about:privatebrowsing]
11:28:33 INFO - --DOMWINDOW == 62 (0x7f1183fe3c00) [pid = 1950] [serial = 427] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:33 INFO - --DOMWINDOW == 61 (0x7f11916d8800) [pid = 1950] [serial = 422] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:33 INFO - --DOMWINDOW == 60 (0x7f118113f400) [pid = 1950] [serial = 424] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:33 INFO - --DOMWINDOW == 59 (0x7f11838ed000) [pid = 1950] [serial = 403] [outer = (nil)] [url = chrome://browser/content/browser.xul]
11:28:33 INFO - --DOMWINDOW == 58 (0x7f118dda8c00) [pid = 1950] [serial = 416] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:33 INFO - --DOMWINDOW == 57 (0x7f1182755c00) [pid = 1950] [serial = 401] [outer = (nil)] [url = data:text/html;charset=utf8,
hello%20world!%20I%20am%20not%20private!]
11:28:33 INFO - --DOMWINDOW == 56 (0x7f1181f5c000) [pid = 1950] [serial = 444] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging-array.sjs]
11:28:33 INFO - --DOMWINDOW == 55 (0x7f119ddd8c00) [pid = 1950] [serial = 445] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 54 (0x7f118a9b4c00) [pid = 1950] [serial = 441] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:33 INFO - --DOMWINDOW == 53 (0x7f118288a000) [pid = 1950] [serial = 439] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 52 (0x7f1182750800) [pid = 1950] [serial = 429] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:33 INFO - --DOMWINDOW == 51 (0x7f11838bec00) [pid = 1950] [serial = 431] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:33 INFO - --DOMWINDOW == 50 (0x7f118260d000) [pid = 1950] [serial = 414] [outer = (nil)] [url = data:text/html;charset=utf8,
hello%20world!%20bug%20874061]
11:28:33 INFO - --DOMWINDOW == 49 (0x7f1182604400) [pid = 1950] [serial = 400] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 48 (0x7f1181d1b000) [pid = 1950] [serial = 399] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 47 (0x7f118a90fc00) [pid = 1950] [serial = 435] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs]
11:28:33 INFO - --DOMWINDOW == 46 (0x7f118a92b400) [pid = 1950] [serial = 436] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 45 (0x7f1183caa400) [pid = 1950] [serial = 433] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 44 (0x7f1183fdd000) [pid = 1950] [serial = 434] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 43 (0x7f1182881400) [pid = 1950] [serial = 402] [outer = (nil)] [url = about:blank]
11:28:33 INFO - --DOMWINDOW == 42 (0x7f119dd59800) [pid = 1950] [serial = 448] [outer = (nil)] [url = about:blank]
11:28:34 INFO - --DOMWINDOW == 41 (0x7f1184375000) [pid = 1950] [serial = 446] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging-array.sjs]
11:28:34 INFO - --DOMWINDOW == 40 (0x7f1181d13000) [pid = 1950] [serial = 437] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs]
11:28:34 INFO - --DOMWINDOW == 39 (0x7f1196585c00) [pid = 1950] [serial = 443] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs]
11:28:34 INFO - --DOMWINDOW == 38 (0x7f11a1ff0c00) [pid = 1950] [serial = 452] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging-array.sjs]
11:28:34 INFO - ++DOCSHELL 0x7f11824aa000 == 16 [pid = 1950] [id = 195]
11:28:34 INFO - ++DOMWINDOW == 39 (0x7f1182422400) [pid = 1950] [serial = 458] [outer = (nil)]
11:28:34 INFO - ++DOMWINDOW == 40 (0x7f118260bc00) [pid = 1950] [serial = 459] [outer = 0x7f1182422400]
11:28:34 INFO - ++DOMWINDOW == 41 (0x7f1181fe5800) [pid = 1950] [serial = 460] [outer = 0x7f1182422400]
11:28:34 INFO - ++DOCSHELL 0x7f1182819000 == 17 [pid = 1950] [id = 196]
11:28:34 INFO - ++DOMWINDOW == 42 (0x7f11838c4000) [pid = 1950] [serial = 461] [outer = (nil)]
11:28:34 INFO - ++DOMWINDOW == 43 (0x7f1183fcec00) [pid = 1950] [serial = 462] [outer = 0x7f11838c4000]
11:28:36 INFO - ++DOCSHELL 0x7f118ddae800 == 18 [pid = 1950] [id = 197]
11:28:36 INFO - ++DOMWINDOW == 44 (0x7f118dba3c00) [pid = 1950] [serial = 463] [outer = (nil)]
11:28:36 INFO - ++DOMWINDOW == 45 (0x7f118dd57800) [pid = 1950] [serial = 464] [outer = 0x7f118dba3c00]
11:28:38 INFO - --DOCSHELL 0x7f11826bf000 == 17 [pid = 1950] [id = 186]
11:28:38 INFO - --DOCSHELL 0x7f11923b5800 == 16 [pid = 1950] [id = 187]
11:28:38 INFO - --DOCSHELL 0x7f11827e9800 == 15 [pid = 1950] [id = 188]
11:28:38 INFO - --DOCSHELL 0x7f11a1478800 == 14 [pid = 1950] [id = 190]
11:28:38 INFO - --DOCSHELL 0x7f11a67cc000 == 13 [pid = 1950] [id = 191]
11:28:38 INFO - --DOMWINDOW == 44 (0x7f1183a7c400) [pid = 1950] [serial = 404] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 43 (0x7f118db97c00) [pid = 1950] [serial = 420] [outer = (nil)] [url = about:privatebrowsing]
11:28:38 INFO - --DOMWINDOW == 42 (0x7f118ce90000) [pid = 1950] [serial = 413] [outer = (nil)] [url = about:privatebrowsing]
11:28:38 INFO - --DOMWINDOW == 41 (0x7f1182845000) [pid = 1950] [serial = 430] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 40 (0x7f11838c0c00) [pid = 1950] [serial = 432] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 39 (0x7f118a9b6c00) [pid = 1950] [serial = 442] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 38 (0x7f1184369800) [pid = 1950] [serial = 428] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 37 (0x7f1182884800) [pid = 1950] [serial = 426] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:38 INFO - --DOMWINDOW == 36 (0x7f11916e0000) [pid = 1950] [serial = 423] [outer = (nil)] [url = about:blank]
11:28:38 INFO - --DOMWINDOW == 35 (0x7f1182430400) [pid = 1950] [serial = 421] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:38 INFO - --DOMWINDOW == 34 (0x7f118d404800) [pid = 1950] [serial = 415] [outer = (nil)] [url = about:blank]
11:28:39 INFO - --DOCSHELL 0x7f1182819000 == 12 [pid = 1950] [id = 196]
11:28:40 INFO - MEMORY STAT | vsize 1212MB | residentFast 316MB | heapAllocated 118MB
11:28:40 INFO - 68 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view.js | took 8762ms
11:28:40 INFO - ++DOCSHELL 0x7f11826b9000 == 13 [pid = 1950] [id = 198]
11:28:40 INFO - ++DOMWINDOW == 35 (0x7f1182886800) [pid = 1950] [serial = 465] [outer = (nil)]
11:28:40 INFO - ++DOMWINDOW == 36 (0x7f118288e400) [pid = 1950] [serial = 466] [outer = 0x7f1182886800]
11:28:40 INFO - 69 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js
11:28:40 INFO - ++DOCSHELL 0x7f11835e7800 == 14 [pid = 1950] [id = 199]
11:28:40 INFO - ++DOMWINDOW == 37 (0x7f11838c4400) [pid = 1950] [serial = 467] [outer = (nil)]
11:28:40 INFO - ++DOMWINDOW == 38 (0x7f1183a7d400) [pid = 1950] [serial = 468] [outer = 0x7f11838c4400]
11:28:40 INFO - ++DOCSHELL 0x7f1184017000 == 15 [pid = 1950] [id = 200]
11:28:40 INFO - ++DOMWINDOW == 39 (0x7f1183e58800) [pid = 1950] [serial = 469] [outer = (nil)]
11:28:40 INFO - ++DOMWINDOW == 40 (0x7f1183fe3800) [pid = 1950] [serial = 470] [outer = 0x7f1183e58800]
11:28:41 INFO - ++DOMWINDOW == 41 (0x7f11835a3400) [pid = 1950] [serial = 471] [outer = 0x7f1183e58800]
11:28:41 INFO - ++DOCSHELL 0x7f11824a0000 == 16 [pid = 1950] [id = 201]
11:28:41 INFO - ++DOMWINDOW == 42 (0x7f1182611c00) [pid = 1950] [serial = 472] [outer = (nil)]
11:28:41 INFO - ++DOMWINDOW == 43 (0x7f1182883800) [pid = 1950] [serial = 473] [outer = 0x7f1182611c00]
11:28:44 INFO - --DOCSHELL 0x7f118ddae800 == 15 [pid = 1950] [id = 197]
11:28:44 INFO - --DOCSHELL 0x7f11824aa000 == 14 [pid = 1950] [id = 195]
11:28:44 INFO - --DOCSHELL 0x7f11824ad800 == 13 [pid = 1950] [id = 193]
11:28:44 INFO - --DOCSHELL 0x7f11a83dd000 == 12 [pid = 1950] [id = 194]
11:28:44 INFO - ++DOCSHELL 0x7f1181150000 == 13 [pid = 1950] [id = 202]
11:28:44 INFO - ++DOMWINDOW == 44 (0x7f118114bc00) [pid = 1950] [serial = 474] [outer = (nil)]
11:28:44 INFO - ++DOMWINDOW == 45 (0x7f1181d0f000) [pid = 1950] [serial = 475] [outer = 0x7f118114bc00]
11:28:45 INFO - --DOCSHELL 0x7f11824a0000 == 12 [pid = 1950] [id = 201]
11:28:46 INFO - --DOCSHELL 0x7f1181150000 == 11 [pid = 1950] [id = 202]
11:28:46 INFO - --DOCSHELL 0x7f1184017000 == 10 [pid = 1950] [id = 200]
11:28:46 INFO - --DOMWINDOW == 44 (0x7f1182422400) [pid = 1950] [serial = 458] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:46 INFO - --DOMWINDOW == 43 (0x7f11a0d5a000) [pid = 1950] [serial = 456] [outer = (nil)] [url = about:blank]
11:28:46 INFO - --DOMWINDOW == 42 (0x7f119e4f4000) [pid = 1950] [serial = 450] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:46 INFO - --DOMWINDOW == 41 (0x7f118dba3c00) [pid = 1950] [serial = 463] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:28:46 INFO - --DOMWINDOW == 40 (0x7f119e040400) [pid = 1950] [serial = 455] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:28:46 INFO - --DOMWINDOW == 39 (0x7f119c6b9c00) [pid = 1950] [serial = 447] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:46 INFO - --DOMWINDOW == 38 (0x7f11837e7c00) [pid = 1950] [serial = 453] [outer = (nil)] [url = about:blank]
11:28:46 INFO - --DOMWINDOW == 37 (0x7f1182750000) [pid = 1950] [serial = 438] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:46 INFO - --DOMWINDOW == 36 (0x7f1184377400) [pid = 1950] [serial = 454] [outer = (nil)] [url = about:blank]
11:28:46 INFO - --DOMWINDOW == 35 (0x7f118260bc00) [pid = 1950] [serial = 459] [outer = (nil)] [url = about:blank]
11:28:46 INFO - --DOMWINDOW == 34 (0x7f1183fe3800) [pid = 1950] [serial = 470] [outer = (nil)] [url = about:blank]
11:28:46 INFO - --DOMWINDOW == 33 (0x7f11838c4000) [pid = 1950] [serial = 461] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:46 INFO - --DOMWINDOW == 32 (0x7f1181d0d800) [pid = 1950] [serial = 457] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:28:47 INFO - MEMORY STAT | vsize 1213MB | residentFast 309MB | heapAllocated 117MB
11:28:47 INFO - 70 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js | took 6589ms
11:28:47 INFO - ++DOCSHELL 0x7f118116d000 == 11 [pid = 1950] [id = 203]
11:28:47 INFO - ++DOMWINDOW == 33 (0x7f1181fe1c00) [pid = 1950] [serial = 476] [outer = (nil)]
11:28:47 INFO - ++DOMWINDOW == 34 (0x7f118242f000) [pid = 1950] [serial = 477] [outer = 0x7f1181fe1c00]
11:28:47 INFO - 71 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js
11:28:47 INFO - ++DOCSHELL 0x7f1182792000 == 12 [pid = 1950] [id = 204]
11:28:47 INFO - ++DOMWINDOW == 35 (0x7f1182846800) [pid = 1950] [serial = 478] [outer = (nil)]
11:28:47 INFO - ++DOMWINDOW == 36 (0x7f118288b400) [pid = 1950] [serial = 479] [outer = 0x7f1182846800]
11:28:47 INFO - ++DOCSHELL 0x7f118278e800 == 13 [pid = 1950] [id = 205]
11:28:47 INFO - ++DOMWINDOW == 37 (0x7f118288c400) [pid = 1950] [serial = 480] [outer = (nil)]
11:28:47 INFO - ++DOMWINDOW == 38 (0x7f1183e64c00) [pid = 1950] [serial = 481] [outer = 0x7f118288c400]
11:28:47 INFO - ++DOMWINDOW == 39 (0x7f1182422800) [pid = 1950] [serial = 482] [outer = 0x7f118288c400]
11:28:48 INFO - ++DOCSHELL 0x7f118a020800 == 14 [pid = 1950] [id = 206]
11:28:48 INFO - ++DOMWINDOW == 40 (0x7f11872b9400) [pid = 1950] [serial = 483] [outer = (nil)]
11:28:48 INFO - ++DOMWINDOW == 41 (0x7f1187583c00) [pid = 1950] [serial = 484] [outer = 0x7f11872b9400]
11:28:50 INFO - ++DOCSHELL 0x7f1182820800 == 15 [pid = 1950] [id = 207]
11:28:50 INFO - ++DOMWINDOW == 42 (0x7f118a9b9000) [pid = 1950] [serial = 485] [outer = (nil)]
11:28:50 INFO - ++DOMWINDOW == 43 (0x7f118a9bc400) [pid = 1950] [serial = 486] [outer = 0x7f118a9b9000]
11:28:51 INFO - --DOCSHELL 0x7f11826b9000 == 14 [pid = 1950] [id = 198]
11:28:51 INFO - --DOCSHELL 0x7f11835e7800 == 13 [pid = 1950] [id = 199]
11:28:51 INFO - --DOMWINDOW == 42 (0x7f118dd57800) [pid = 1950] [serial = 464] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:28:51 INFO - --DOMWINDOW == 41 (0x7f1183fcec00) [pid = 1950] [serial = 462] [outer = (nil)] [url = about:blank]
11:28:51 INFO - --DOMWINDOW == 40 (0x7f1181fe5800) [pid = 1950] [serial = 460] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:51 INFO - --DOMWINDOW == 39 (0x7f119eecec00) [pid = 1950] [serial = 451] [outer = (nil)] [url = about:blank]
11:28:51 INFO - --DOMWINDOW == 38 (0x7f1181d19800) [pid = 1950] [serial = 449] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:51 INFO - --DOMWINDOW == 37 (0x7f1181143400) [pid = 1950] [serial = 440] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:58 INFO - --DOMWINDOW == 36 (0x7f118114bc00) [pid = 1950] [serial = 474] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:28:58 INFO - --DOMWINDOW == 35 (0x7f1183e64c00) [pid = 1950] [serial = 481] [outer = (nil)] [url = about:blank]
11:28:58 INFO - --DOMWINDOW == 34 (0x7f118288e400) [pid = 1950] [serial = 466] [outer = (nil)] [url = about:blank]
11:28:58 INFO - --DOMWINDOW == 33 (0x7f1183a7d400) [pid = 1950] [serial = 468] [outer = (nil)] [url = about:blank]
11:28:58 INFO - --DOMWINDOW == 32 (0x7f1182611c00) [pid = 1950] [serial = 472] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:28:58 INFO - --DOMWINDOW == 31 (0x7f1183e58800) [pid = 1950] [serial = 469] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:28:58 INFO - --DOMWINDOW == 30 (0x7f1182886800) [pid = 1950] [serial = 465] [outer = (nil)] [url = about:blank]
11:28:58 INFO - --DOMWINDOW == 29 (0x7f11838c4400) [pid = 1950] [serial = 467] [outer = (nil)] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20for%20DOM%20nodes%20in%20variables%20view%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%]
11:29:01 INFO - --DOCSHELL 0x7f118a020800 == 12 [pid = 1950] [id = 206]
11:29:02 INFO - --DOCSHELL 0x7f1182820800 == 11 [pid = 1950] [id = 207]
11:29:02 INFO - --DOCSHELL 0x7f118278e800 == 10 [pid = 1950] [id = 205]
11:29:03 INFO - --DOMWINDOW == 28 (0x7f1181d0f000) [pid = 1950] [serial = 475] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:03 INFO - --DOMWINDOW == 27 (0x7f1182883800) [pid = 1950] [serial = 473] [outer = (nil)] [url = about:blank]
11:29:03 INFO - --DOMWINDOW == 26 (0x7f11835a3400) [pid = 1950] [serial = 471] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:03 INFO - --DOMWINDOW == 25 (0x7f118a9b9000) [pid = 1950] [serial = 485] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:03 INFO - --DOMWINDOW == 24 (0x7f11872b9400) [pid = 1950] [serial = 483] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:29:03 INFO - MEMORY STAT | vsize 1214MB | residentFast 309MB | heapAllocated 117MB
11:29:03 INFO - 72 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js | took 16327ms
11:29:03 INFO - ++DOCSHELL 0x7f1181164800 == 11 [pid = 1950] [id = 208]
11:29:03 INFO - ++DOMWINDOW == 25 (0x7f1181d17800) [pid = 1950] [serial = 487] [outer = (nil)]
11:29:03 INFO - ++DOMWINDOW == 26 (0x7f1181fdfc00) [pid = 1950] [serial = 488] [outer = 0x7f1181d17800]
11:29:03 INFO - 73 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_filter.js
11:29:04 INFO - ++DOCSHELL 0x7f1182794800 == 12 [pid = 1950] [id = 209]
11:29:04 INFO - ++DOMWINDOW == 27 (0x7f1182611000) [pid = 1950] [serial = 489] [outer = (nil)]
11:29:04 INFO - ++DOMWINDOW == 28 (0x7f1182755400) [pid = 1950] [serial = 490] [outer = 0x7f1182611000]
11:29:04 INFO - ++DOCSHELL 0x7f1182791800 == 13 [pid = 1950] [id = 210]
11:29:04 INFO - ++DOMWINDOW == 29 (0x7f1183677000) [pid = 1950] [serial = 491] [outer = (nil)]
11:29:04 INFO - ++DOMWINDOW == 30 (0x7f11838bec00) [pid = 1950] [serial = 492] [outer = 0x7f1183677000]
11:29:04 INFO - ++DOMWINDOW == 31 (0x7f1183672000) [pid = 1950] [serial = 493] [outer = 0x7f1183677000]
11:29:04 INFO - ++DOCSHELL 0x7f11853ed800 == 14 [pid = 1950] [id = 211]
11:29:04 INFO - ++DOMWINDOW == 32 (0x7f1184369800) [pid = 1950] [serial = 494] [outer = (nil)]
11:29:04 INFO - ++DOMWINDOW == 33 (0x7f1184370000) [pid = 1950] [serial = 495] [outer = 0x7f1184369800]
11:29:06 INFO - ++DOCSHELL 0x7f118a022800 == 15 [pid = 1950] [id = 212]
11:29:06 INFO - ++DOMWINDOW == 34 (0x7f1183fc6c00) [pid = 1950] [serial = 496] [outer = (nil)]
11:29:06 INFO - ++DOMWINDOW == 35 (0x7f118a91e800) [pid = 1950] [serial = 497] [outer = 0x7f1183fc6c00]
11:29:08 INFO - MEMORY STAT | vsize 1217MB | residentFast 316MB | heapAllocated 123MB
11:29:08 INFO - 74 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_filter.js | took 4965ms
11:29:08 INFO - ++DOCSHELL 0x7f118115f000 == 16 [pid = 1950] [id = 213]
11:29:08 INFO - ++DOMWINDOW == 36 (0x7f1183a76800) [pid = 1950] [serial = 498] [outer = (nil)]
11:29:08 INFO - ++DOMWINDOW == 37 (0x7f1183fe4800) [pid = 1950] [serial = 499] [outer = 0x7f1183a76800]
11:29:09 INFO - 75 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js
11:29:09 INFO - ++DOCSHELL 0x7f1187fd0800 == 17 [pid = 1950] [id = 214]
11:29:09 INFO - ++DOMWINDOW == 38 (0x7f118113f400) [pid = 1950] [serial = 500] [outer = (nil)]
11:29:09 INFO - ++DOMWINDOW == 39 (0x7f11881f9000) [pid = 1950] [serial = 501] [outer = 0x7f118113f400]
11:29:09 INFO - ++DOMWINDOW == 40 (0x7f118a910400) [pid = 1950] [serial = 502] [outer = 0x7f118113f400]
11:29:10 INFO - ++DOCSHELL 0x7f11907c0000 == 18 [pid = 1950] [id = 215]
11:29:10 INFO - ++DOMWINDOW == 41 (0x7f118a335000) [pid = 1950] [serial = 503] [outer = (nil)]
11:29:10 INFO - ++DOMWINDOW == 42 (0x7f118a917c00) [pid = 1950] [serial = 504] [outer = 0x7f118a335000]
11:29:10 INFO - ++DOMWINDOW == 43 (0x7f1183fd9400) [pid = 1950] [serial = 505] [outer = 0x7f118a335000]
11:29:10 INFO - ++DOCSHELL 0x7f1191436800 == 19 [pid = 1950] [id = 216]
11:29:10 INFO - ++DOMWINDOW == 44 (0x7f118114a400) [pid = 1950] [serial = 506] [outer = (nil)]
11:29:10 INFO - ++DOMWINDOW == 45 (0x7f118a9bdc00) [pid = 1950] [serial = 507] [outer = 0x7f118114a400]
11:29:13 INFO - --DOCSHELL 0x7f1181164800 == 18 [pid = 1950] [id = 208]
11:29:13 INFO - --DOCSHELL 0x7f1182794800 == 17 [pid = 1950] [id = 209]
11:29:13 INFO - --DOCSHELL 0x7f1182791800 == 16 [pid = 1950] [id = 210]
11:29:13 INFO - --DOCSHELL 0x7f118116d000 == 15 [pid = 1950] [id = 203]
11:29:13 INFO - --DOCSHELL 0x7f11853ed800 == 14 [pid = 1950] [id = 211]
11:29:13 INFO - --DOCSHELL 0x7f1182792000 == 13 [pid = 1950] [id = 204]
11:29:13 INFO - --DOCSHELL 0x7f118a022800 == 12 [pid = 1950] [id = 212]
11:29:13 INFO - --DOMWINDOW == 44 (0x7f118a9bc400) [pid = 1950] [serial = 486] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:13 INFO - --DOMWINDOW == 43 (0x7f1187583c00) [pid = 1950] [serial = 484] [outer = (nil)] [url = about:blank]
11:29:13 INFO - ++DOCSHELL 0x7f1181160800 == 13 [pid = 1950] [id = 217]
11:29:13 INFO - ++DOMWINDOW == 44 (0x7f1181fed800) [pid = 1950] [serial = 508] [outer = (nil)]
11:29:13 INFO - ++DOMWINDOW == 45 (0x7f118242b400) [pid = 1950] [serial = 509] [outer = 0x7f1181fed800]
11:29:14 INFO - ++DOCSHELL 0x7f1183e47800 == 14 [pid = 1950] [id = 218]
11:29:14 INFO - ++DOMWINDOW == 46 (0x7f11916ccc00) [pid = 1950] [serial = 510] [outer = (nil)]
11:29:14 INFO - ++DOMWINDOW == 47 (0x7f11916d0c00) [pid = 1950] [serial = 511] [outer = 0x7f11916ccc00]
11:29:15 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:15 INFO - ++DOCSHELL 0x7f119141f000 == 15 [pid = 1950] [id = 219]
11:29:15 INFO - ++DOMWINDOW == 48 (0x7f119657a400) [pid = 1950] [serial = 512] [outer = (nil)]
11:29:15 INFO - ++DOMWINDOW == 49 (0x7f119657e000) [pid = 1950] [serial = 513] [outer = 0x7f119657a400]
11:29:15 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:15 INFO - ++DOCSHELL 0x7f119047c000 == 16 [pid = 1950] [id = 220]
11:29:15 INFO - ++DOMWINDOW == 50 (0x7f119e035400) [pid = 1950] [serial = 514] [outer = (nil)]
11:29:15 INFO - ++DOCSHELL 0x7f119e00b800 == 17 [pid = 1950] [id = 221]
11:29:15 INFO - ++DOMWINDOW == 51 (0x7f119e0c0400) [pid = 1950] [serial = 515] [outer = (nil)]
11:29:15 INFO - ++DOCSHELL 0x7f119e00c800 == 18 [pid = 1950] [id = 222]
11:29:15 INFO - ++DOMWINDOW == 52 (0x7f119e0cb000) [pid = 1950] [serial = 516] [outer = (nil)]
11:29:15 INFO - ++DOCSHELL 0x7f119e00e000 == 19 [pid = 1950] [id = 223]
11:29:15 INFO - ++DOMWINDOW == 53 (0x7f119e238800) [pid = 1950] [serial = 517] [outer = (nil)]
11:29:15 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:15 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:15 INFO - ++DOCSHELL 0x7f1183e2d800 == 20 [pid = 1950] [id = 224]
11:29:15 INFO - ++DOMWINDOW == 54 (0x7f119e2b1000) [pid = 1950] [serial = 518] [outer = (nil)]
11:29:15 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:15 INFO - ++DOCSHELL 0x7f119e274800 == 21 [pid = 1950] [id = 225]
11:29:15 INFO - ++DOMWINDOW == 55 (0x7f119e4e9800) [pid = 1950] [serial = 519] [outer = (nil)]
11:29:15 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:29:15 INFO - ++DOMWINDOW == 56 (0x7f119eecec00) [pid = 1950] [serial = 520] [outer = 0x7f119e035400]
11:29:15 INFO - ++DOMWINDOW == 57 (0x7f119eed5c00) [pid = 1950] [serial = 521] [outer = 0x7f119e0c0400]
11:29:15 INFO - ++DOMWINDOW == 58 (0x7f119eedcc00) [pid = 1950] [serial = 522] [outer = 0x7f119e0cb000]
11:29:15 INFO - ++DOMWINDOW == 59 (0x7f119ef15400) [pid = 1950] [serial = 523] [outer = 0x7f119e238800]
11:29:15 INFO - ++DOMWINDOW == 60 (0x7f119f0c7000) [pid = 1950] [serial = 524] [outer = 0x7f119e2b1000]
11:29:15 INFO - ++DOMWINDOW == 61 (0x7f11a0d5b800) [pid = 1950] [serial = 525] [outer = 0x7f119e4e9800]
11:29:16 INFO - ++DOCSHELL 0x7f11a37e1800 == 22 [pid = 1950] [id = 226]
11:29:16 INFO - ++DOMWINDOW == 62 (0x7f11a1fefc00) [pid = 1950] [serial = 526] [outer = (nil)]
11:29:16 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:16 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:16 INFO - ++DOCSHELL 0x7f11a399a800 == 23 [pid = 1950] [id = 227]
11:29:16 INFO - ++DOMWINDOW == 63 (0x7f11a1ff5000) [pid = 1950] [serial = 527] [outer = (nil)]
11:29:16 INFO - ++DOMWINDOW == 64 (0x7f11a1ff8c00) [pid = 1950] [serial = 528] [outer = 0x7f11a1ff5000]
11:29:16 INFO - ++DOMWINDOW == 65 (0x7f119c611c00) [pid = 1950] [serial = 529] [outer = 0x7f11a1fefc00]
11:29:16 INFO - ++DOMWINDOW == 66 (0x7f119eeda400) [pid = 1950] [serial = 530] [outer = 0x7f11a1ff5000]
11:29:17 INFO - console.warn: Asynchronous operation was aborted as selection changed.
11:29:18 INFO - --DOMWINDOW == 65 (0x7f1181fdfc00) [pid = 1950] [serial = 488] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 64 (0x7f1182755400) [pid = 1950] [serial = 490] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 63 (0x7f118242f000) [pid = 1950] [serial = 477] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 62 (0x7f118288b400) [pid = 1950] [serial = 479] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 61 (0x7f118a917c00) [pid = 1950] [serial = 504] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 60 (0x7f11838bec00) [pid = 1950] [serial = 492] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 59 (0x7f118288c400) [pid = 1950] [serial = 480] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:18 INFO - --DOMWINDOW == 58 (0x7f1181d17800) [pid = 1950] [serial = 487] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 57 (0x7f1182611000) [pid = 1950] [serial = 489] [outer = (nil)] [url = data:text/html;charset=utf-8,webconsole-filter]
11:29:18 INFO - --DOMWINDOW == 56 (0x7f1181fe1c00) [pid = 1950] [serial = 476] [outer = (nil)] [url = about:blank]
11:29:18 INFO - --DOMWINDOW == 55 (0x7f1182846800) [pid = 1950] [serial = 478] [outer = (nil)] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20document%20for%20bug%20977500%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%]
11:29:23 INFO - --DOCSHELL 0x7f119e00b800 == 22 [pid = 1950] [id = 221]
11:29:23 INFO - --DOCSHELL 0x7f119e00c800 == 21 [pid = 1950] [id = 222]
11:29:23 INFO - --DOCSHELL 0x7f119047c000 == 20 [pid = 1950] [id = 220]
11:29:23 INFO - --DOCSHELL 0x7f119e00e000 == 19 [pid = 1950] [id = 223]
11:29:23 INFO - --DOCSHELL 0x7f1183e2d800 == 18 [pid = 1950] [id = 224]
11:29:23 INFO - --DOCSHELL 0x7f11a37e1800 == 17 [pid = 1950] [id = 226]
11:29:24 INFO - --DOCSHELL 0x7f1191436800 == 16 [pid = 1950] [id = 216]
11:29:25 INFO - --DOCSHELL 0x7f11a399a800 == 15 [pid = 1950] [id = 227]
11:29:25 INFO - --DOCSHELL 0x7f1181160800 == 14 [pid = 1950] [id = 217]
11:29:25 INFO - --DOCSHELL 0x7f1183e47800 == 13 [pid = 1950] [id = 218]
11:29:25 INFO - --DOCSHELL 0x7f119141f000 == 12 [pid = 1950] [id = 219]
11:29:25 INFO - --DOCSHELL 0x7f119e274800 == 11 [pid = 1950] [id = 225]
11:29:25 INFO - --DOMWINDOW == 54 (0x7f1182422800) [pid = 1950] [serial = 482] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:26 INFO - --DOMWINDOW == 53 (0x7f1184369800) [pid = 1950] [serial = 494] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:29:26 INFO - --DOMWINDOW == 52 (0x7f1183677000) [pid = 1950] [serial = 491] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:26 INFO - --DOMWINDOW == 51 (0x7f11a1ff5000) [pid = 1950] [serial = 527] [outer = (nil)] [url = data:text/html,]
11:29:26 INFO - --DOMWINDOW == 50 (0x7f1183fc6c00) [pid = 1950] [serial = 496] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:26 INFO - --DOMWINDOW == 49 (0x7f11881f9000) [pid = 1950] [serial = 501] [outer = (nil)] [url = about:blank]
11:29:26 INFO - --DOMWINDOW == 48 (0x7f11a1fefc00) [pid = 1950] [serial = 526] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:29:26 INFO - --DOMWINDOW == 47 (0x7f119eeda400) [pid = 1950] [serial = 530] [outer = (nil)] [url = data:text/html,]
11:29:26 INFO - --DOMWINDOW == 46 (0x7f11a1ff8c00) [pid = 1950] [serial = 528] [outer = (nil)] [url = about:blank]
11:29:26 INFO - MEMORY STAT | vsize 1222MB | residentFast 328MB | heapAllocated 127MB
11:29:26 INFO - 76 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js | took 17168ms
11:29:26 INFO - ++DOCSHELL 0x7f118116b800 == 12 [pid = 1950] [id = 228]
11:29:26 INFO - ++DOMWINDOW == 47 (0x7f1176dc6400) [pid = 1950] [serial = 531] [outer = (nil)]
11:29:26 INFO - ++DOMWINDOW == 48 (0x7f1176dc9400) [pid = 1950] [serial = 532] [outer = 0x7f1176dc6400]
11:29:26 INFO - 77 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_special_names.js
11:29:26 INFO - ++DOCSHELL 0x7f118278f800 == 13 [pid = 1950] [id = 229]
11:29:26 INFO - ++DOMWINDOW == 49 (0x7f1182610800) [pid = 1950] [serial = 533] [outer = (nil)]
11:29:26 INFO - ++DOMWINDOW == 50 (0x7f1182755c00) [pid = 1950] [serial = 534] [outer = 0x7f1182610800]
11:29:27 INFO - ++DOCSHELL 0x7f118278f000 == 14 [pid = 1950] [id = 230]
11:29:27 INFO - ++DOMWINDOW == 51 (0x7f1182845000) [pid = 1950] [serial = 535] [outer = (nil)]
11:29:27 INFO - ++DOMWINDOW == 52 (0x7f11838bec00) [pid = 1950] [serial = 536] [outer = 0x7f1182845000]
11:29:27 INFO - ++DOMWINDOW == 53 (0x7f118366e800) [pid = 1950] [serial = 537] [outer = 0x7f1182845000]
11:29:27 INFO - ++DOCSHELL 0x7f11853ed000 == 15 [pid = 1950] [id = 231]
11:29:27 INFO - ++DOMWINDOW == 54 (0x7f11881f1000) [pid = 1950] [serial = 538] [outer = (nil)]
11:29:27 INFO - ++DOMWINDOW == 55 (0x7f11881f4c00) [pid = 1950] [serial = 539] [outer = 0x7f11881f1000]
11:29:29 INFO - ++DOCSHELL 0x7f118a152800 == 16 [pid = 1950] [id = 232]
11:29:29 INFO - ++DOMWINDOW == 56 (0x7f118288b400) [pid = 1950] [serial = 540] [outer = (nil)]
11:29:29 INFO - ++DOMWINDOW == 57 (0x7f1183fcfc00) [pid = 1950] [serial = 541] [outer = 0x7f118288b400]
11:29:30 INFO - MEMORY STAT | vsize 1225MB | residentFast 334MB | heapAllocated 132MB
11:29:30 INFO - 78 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_special_names.js | took 4225ms
11:29:30 INFO - ++DOCSHELL 0x7f118279e800 == 17 [pid = 1950] [id = 233]
11:29:30 INFO - ++DOMWINDOW == 58 (0x7f118461ac00) [pid = 1950] [serial = 542] [outer = (nil)]
11:29:30 INFO - ++DOMWINDOW == 59 (0x7f11872ae000) [pid = 1950] [serial = 543] [outer = 0x7f118461ac00]
11:29:31 INFO - 79 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js
11:29:31 INFO - ++DOCSHELL 0x7f1187d82000 == 18 [pid = 1950] [id = 234]
11:29:31 INFO - ++DOMWINDOW == 60 (0x7f1187592c00) [pid = 1950] [serial = 544] [outer = (nil)]
11:29:31 INFO - ++DOMWINDOW == 61 (0x7f11881f1800) [pid = 1950] [serial = 545] [outer = 0x7f1187592c00]
11:29:31 INFO - ++DOMWINDOW == 62 (0x7f118a93cc00) [pid = 1950] [serial = 546] [outer = 0x7f1187592c00]
11:29:31 INFO - ++DOCSHELL 0x7f118f638000 == 19 [pid = 1950] [id = 235]
11:29:31 INFO - ++DOMWINDOW == 63 (0x7f11881f5000) [pid = 1950] [serial = 547] [outer = (nil)]
11:29:31 INFO - ++DOMWINDOW == 64 (0x7f118ab7cc00) [pid = 1950] [serial = 548] [outer = 0x7f11881f5000]
11:29:32 INFO - ++DOMWINDOW == 65 (0x7f11858f8400) [pid = 1950] [serial = 549] [outer = 0x7f11881f5000]
11:29:32 INFO - ++DOCSHELL 0x7f118d5de000 == 20 [pid = 1950] [id = 236]
11:29:32 INFO - ++DOMWINDOW == 66 (0x7f118d747400) [pid = 1950] [serial = 550] [outer = (nil)]
11:29:32 INFO - ++DOMWINDOW == 67 (0x7f118da55400) [pid = 1950] [serial = 551] [outer = 0x7f118d747400]
11:29:34 INFO - ++DOCSHELL 0x7f119243e800 == 21 [pid = 1950] [id = 237]
11:29:34 INFO - ++DOMWINDOW == 68 (0x7f118a9b8000) [pid = 1950] [serial = 552] [outer = (nil)]
11:29:34 INFO - ++DOMWINDOW == 69 (0x7f1196582800) [pid = 1950] [serial = 553] [outer = 0x7f118a9b8000]
11:29:34 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:29:35 INFO - ++DOCSHELL 0x7f1180e40000 == 22 [pid = 1950] [id = 238]
11:29:35 INFO - ++DOMWINDOW == 70 (0x7f11a62eec00) [pid = 1950] [serial = 554] [outer = (nil)]
11:29:35 INFO - ++DOMWINDOW == 71 (0x7f11914f7000) [pid = 1950] [serial = 555] [outer = 0x7f11a62eec00]
11:29:37 INFO - --DOCSHELL 0x7f118115f000 == 21 [pid = 1950] [id = 213]
11:29:37 INFO - --DOCSHELL 0x7f11853ed000 == 20 [pid = 1950] [id = 231]
11:29:37 INFO - --DOCSHELL 0x7f1187fd0800 == 19 [pid = 1950] [id = 214]
11:29:37 INFO - --DOCSHELL 0x7f11907c0000 == 18 [pid = 1950] [id = 215]
11:29:37 INFO - --DOCSHELL 0x7f118116b800 == 17 [pid = 1950] [id = 228]
11:29:37 INFO - --DOCSHELL 0x7f118a152800 == 16 [pid = 1950] [id = 232]
11:29:37 INFO - --DOCSHELL 0x7f118278f000 == 15 [pid = 1950] [id = 230]
11:29:37 INFO - --DOCSHELL 0x7f118278f800 == 14 [pid = 1950] [id = 229]
11:29:38 INFO - --DOMWINDOW == 70 (0x7f118a91e800) [pid = 1950] [serial = 497] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:38 INFO - --DOMWINDOW == 69 (0x7f1184370000) [pid = 1950] [serial = 495] [outer = (nil)] [url = about:blank]
11:29:38 INFO - --DOMWINDOW == 68 (0x7f1183672000) [pid = 1950] [serial = 493] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:38 INFO - --DOMWINDOW == 67 (0x7f119c611c00) [pid = 1950] [serial = 529] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:29:42 INFO - ++DOCSHELL 0x7f1182793000 == 15 [pid = 1950] [id = 239]
11:29:42 INFO - ++DOMWINDOW == 68 (0x7f1182887800) [pid = 1950] [serial = 556] [outer = (nil)]
11:29:43 INFO - ++DOMWINDOW == 69 (0x7f1182888000) [pid = 1950] [serial = 557] [outer = 0x7f1182887800]
11:29:44 INFO - --DOCSHELL 0x7f1180e40000 == 14 [pid = 1950] [id = 238]
11:29:44 INFO - --DOCSHELL 0x7f119243e800 == 13 [pid = 1950] [id = 237]
11:29:44 INFO - --DOCSHELL 0x7f118d5de000 == 12 [pid = 1950] [id = 236]
11:29:45 INFO - --DOCSHELL 0x7f1182793000 == 11 [pid = 1950] [id = 239]
11:29:45 INFO - --DOCSHELL 0x7f118f638000 == 10 [pid = 1950] [id = 235]
11:29:46 INFO - --DOMWINDOW == 68 (0x7f1181fed800) [pid = 1950] [serial = 508] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:46 INFO - --DOMWINDOW == 67 (0x7f119e2b1000) [pid = 1950] [serial = 518] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 66 (0x7f119e238800) [pid = 1950] [serial = 517] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 65 (0x7f119e0cb000) [pid = 1950] [serial = 516] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 64 (0x7f119e0c0400) [pid = 1950] [serial = 515] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 63 (0x7f119e035400) [pid = 1950] [serial = 514] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 62 (0x7f11838bec00) [pid = 1950] [serial = 536] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 61 (0x7f118114a400) [pid = 1950] [serial = 506] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:29:46 INFO - --DOMWINDOW == 60 (0x7f1182845000) [pid = 1950] [serial = 535] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:46 INFO - --DOMWINDOW == 59 (0x7f118a335000) [pid = 1950] [serial = 503] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:46 INFO - --DOMWINDOW == 58 (0x7f118242b400) [pid = 1950] [serial = 509] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:46 INFO - --DOMWINDOW == 57 (0x7f11881f1000) [pid = 1950] [serial = 538] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:29:46 INFO - --DOMWINDOW == 56 (0x7f11916ccc00) [pid = 1950] [serial = 510] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:29:46 INFO - --DOMWINDOW == 55 (0x7f1182610800) [pid = 1950] [serial = 533] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%201084430]
11:29:46 INFO - --DOMWINDOW == 54 (0x7f118288b400) [pid = 1950] [serial = 540] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:46 INFO - --DOMWINDOW == 53 (0x7f1176dc6400) [pid = 1950] [serial = 531] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 52 (0x7f1183a76800) [pid = 1950] [serial = 498] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 51 (0x7f118113f400) [pid = 1950] [serial = 500] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html]
11:29:46 INFO - --DOMWINDOW == 50 (0x7f119657a400) [pid = 1950] [serial = 512] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:29:46 INFO - --DOMWINDOW == 49 (0x7f119e4e9800) [pid = 1950] [serial = 519] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:29:46 INFO - --DOMWINDOW == 48 (0x7f11881f1800) [pid = 1950] [serial = 545] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 47 (0x7f11916d0c00) [pid = 1950] [serial = 511] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 46 (0x7f1182755c00) [pid = 1950] [serial = 534] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 45 (0x7f1183fcfc00) [pid = 1950] [serial = 541] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:29:46 INFO - --DOMWINDOW == 44 (0x7f1176dc9400) [pid = 1950] [serial = 532] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 43 (0x7f1183fe4800) [pid = 1950] [serial = 499] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 42 (0x7f1183fd9400) [pid = 1950] [serial = 505] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:46 INFO - --DOMWINDOW == 41 (0x7f118366e800) [pid = 1950] [serial = 537] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:29:46 INFO - --DOMWINDOW == 40 (0x7f11881f4c00) [pid = 1950] [serial = 539] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 39 (0x7f118a9bdc00) [pid = 1950] [serial = 507] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 38 (0x7f119f0c7000) [pid = 1950] [serial = 524] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 37 (0x7f119ef15400) [pid = 1950] [serial = 523] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 36 (0x7f119eedcc00) [pid = 1950] [serial = 522] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 35 (0x7f119eed5c00) [pid = 1950] [serial = 521] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 34 (0x7f119eecec00) [pid = 1950] [serial = 520] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:29:46 INFO - --DOMWINDOW == 33 (0x7f118a910400) [pid = 1950] [serial = 502] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html]
11:29:46 INFO - --DOMWINDOW == 32 (0x7f119657e000) [pid = 1950] [serial = 513] [outer = (nil)] [url = about:blank]
11:29:46 INFO - --DOMWINDOW == 31 (0x7f11a0d5b800) [pid = 1950] [serial = 525] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:29:46 INFO - --DOMWINDOW == 30 (0x7f118ab7cc00) [pid = 1950] [serial = 548] [outer = (nil)] [url = about:blank]
11:29:46 INFO - MEMORY STAT | vsize 1217MB | residentFast 321MB | heapAllocated 127MB
11:29:46 INFO - 80 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js | took 15321ms
11:29:46 INFO - ++DOCSHELL 0x7f1181159800 == 11 [pid = 1950] [id = 240]
11:29:46 INFO - ++DOMWINDOW == 31 (0x7f1176dc5400) [pid = 1950] [serial = 558] [outer = (nil)]
11:29:46 INFO - ++DOMWINDOW == 32 (0x7f1176dcd000) [pid = 1950] [serial = 559] [outer = 0x7f1176dc5400]
11:29:46 INFO - 81 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js
11:29:46 INFO - ++DOCSHELL 0x7f118126e000 == 12 [pid = 1950] [id = 241]
11:29:46 INFO - ++DOMWINDOW == 33 (0x7f11776f0800) [pid = 1950] [serial = 560] [outer = (nil)]
11:29:46 INFO - ++DOMWINDOW == 34 (0x7f11776f8400) [pid = 1950] [serial = 561] [outer = 0x7f11776f0800]
11:29:47 INFO - ++DOMWINDOW == 35 (0x7f11812d5400) [pid = 1950] [serial = 562] [outer = 0x7f11776f0800]
11:29:47 INFO - ++DOCSHELL 0x7f11824ad800 == 13 [pid = 1950] [id = 242]
11:29:47 INFO - ++DOMWINDOW == 36 (0x7f1181141c00) [pid = 1950] [serial = 563] [outer = (nil)]
11:29:47 INFO - ++DOMWINDOW == 37 (0x7f1181d1b000) [pid = 1950] [serial = 564] [outer = 0x7f1181141c00]
11:29:47 INFO - ++DOMWINDOW == 38 (0x7f11812d7800) [pid = 1950] [serial = 565] [outer = 0x7f1181141c00]
11:29:47 INFO - ++DOCSHELL 0x7f11827e7000 == 14 [pid = 1950] [id = 243]
11:29:47 INFO - ++DOMWINDOW == 39 (0x7f1183672400) [pid = 1950] [serial = 566] [outer = (nil)]
11:29:47 INFO - ++DOMWINDOW == 40 (0x7f11838b8c00) [pid = 1950] [serial = 567] [outer = 0x7f1183672400]
11:29:50 INFO - ++DOCSHELL 0x7f118469f000 == 15 [pid = 1950] [id = 244]
11:29:50 INFO - ++DOMWINDOW == 41 (0x7f11881f7c00) [pid = 1950] [serial = 568] [outer = (nil)]
11:29:50 INFO - ++DOMWINDOW == 42 (0x7f118a3e4400) [pid = 1950] [serial = 569] [outer = 0x7f11881f7c00]
11:29:50 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:29:51 INFO - ++DOCSHELL 0x7f119de26800 == 16 [pid = 1950] [id = 245]
11:29:51 INFO - ++DOMWINDOW == 43 (0x7f118dba3c00) [pid = 1950] [serial = 570] [outer = (nil)]
11:29:51 INFO - ++DOMWINDOW == 44 (0x7f118a3e5c00) [pid = 1950] [serial = 571] [outer = 0x7f118dba3c00]
11:29:53 INFO - --DOCSHELL 0x7f118279e800 == 15 [pid = 1950] [id = 233]
11:29:53 INFO - --DOCSHELL 0x7f1187d82000 == 14 [pid = 1950] [id = 234]
11:29:54 INFO - ++DOCSHELL 0x7f1181274000 == 15 [pid = 1950] [id = 246]
11:29:54 INFO - ++DOMWINDOW == 45 (0x7f11838bd400) [pid = 1950] [serial = 572] [outer = (nil)]
11:29:54 INFO - ++DOMWINDOW == 46 (0x7f11838bf000) [pid = 1950] [serial = 573] [outer = 0x7f11838bd400]
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - ++DOCSHELL 0x7f118d36f800 == 16 [pid = 1950] [id = 247]
11:29:55 INFO - ++DOMWINDOW == 47 (0x7f1183caa400) [pid = 1950] [serial = 574] [outer = (nil)]
11:29:55 INFO - ++DOMWINDOW == 48 (0x7f118d56e000) [pid = 1950] [serial = 575] [outer = 0x7f1183caa400]
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - ++DOCSHELL 0x7f1182786800 == 17 [pid = 1950] [id = 248]
11:29:55 INFO - ++DOMWINDOW == 49 (0x7f118d9e1000) [pid = 1950] [serial = 576] [outer = (nil)]
11:29:55 INFO - ++DOCSHELL 0x7f1180e33000 == 18 [pid = 1950] [id = 249]
11:29:55 INFO - ++DOMWINDOW == 50 (0x7f118d9eb400) [pid = 1950] [serial = 577] [outer = (nil)]
11:29:55 INFO - ++DOCSHELL 0x7f1182790800 == 19 [pid = 1950] [id = 250]
11:29:55 INFO - ++DOMWINDOW == 51 (0x7f118da56800) [pid = 1950] [serial = 578] [outer = (nil)]
11:29:55 INFO - ++DOCSHELL 0x7f118d4a6000 == 20 [pid = 1950] [id = 251]
11:29:55 INFO - ++DOMWINDOW == 52 (0x7f118da57000) [pid = 1950] [serial = 579] [outer = (nil)]
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - ++DOCSHELL 0x7f118d4a7000 == 21 [pid = 1950] [id = 252]
11:29:55 INFO - ++DOMWINDOW == 53 (0x7f118da60000) [pid = 1950] [serial = 580] [outer = (nil)]
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - ++DOCSHELL 0x7f118d527000 == 22 [pid = 1950] [id = 253]
11:29:55 INFO - ++DOMWINDOW == 54 (0x7f118dd57800) [pid = 1950] [serial = 581] [outer = (nil)]
11:29:55 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:29:55 INFO - ++DOMWINDOW == 55 (0x7f1190abe800) [pid = 1950] [serial = 582] [outer = 0x7f118d9e1000]
11:29:55 INFO - ++DOMWINDOW == 56 (0x7f11910ab000) [pid = 1950] [serial = 583] [outer = 0x7f118d9eb400]
11:29:55 INFO - ++DOMWINDOW == 57 (0x7f11910b0000) [pid = 1950] [serial = 584] [outer = 0x7f118da56800]
11:29:55 INFO - ++DOMWINDOW == 58 (0x7f11914f8400) [pid = 1950] [serial = 585] [outer = 0x7f118da57000]
11:29:55 INFO - ++DOMWINDOW == 59 (0x7f11916ccc00) [pid = 1950] [serial = 586] [outer = 0x7f118da60000]
11:29:55 INFO - ++DOMWINDOW == 60 (0x7f11916d0c00) [pid = 1950] [serial = 587] [outer = 0x7f118dd57800]
11:29:55 INFO - ++DOCSHELL 0x7f1191638000 == 23 [pid = 1950] [id = 254]
11:29:55 INFO - ++DOMWINDOW == 61 (0x7f119c2d2800) [pid = 1950] [serial = 588] [outer = (nil)]
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:29:55 INFO - ++DOCSHELL 0x7f1191646800 == 24 [pid = 1950] [id = 255]
11:29:55 INFO - ++DOMWINDOW == 62 (0x7f1183fc8c00) [pid = 1950] [serial = 589] [outer = (nil)]
11:29:55 INFO - ++DOMWINDOW == 63 (0x7f119e03bc00) [pid = 1950] [serial = 590] [outer = 0x7f1183fc8c00]
11:29:56 INFO - ++DOMWINDOW == 64 (0x7f11a63ce400) [pid = 1950] [serial = 591] [outer = 0x7f119c2d2800]
11:29:56 INFO - ++DOMWINDOW == 65 (0x7f11a63d0c00) [pid = 1950] [serial = 592] [outer = 0x7f1183fc8c00]
11:29:56 INFO - [1950] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175
11:29:58 INFO - ++DOCSHELL 0x7f1176f0f800 == 25 [pid = 1950] [id = 256]
11:29:58 INFO - ++DOMWINDOW == 66 (0x7f1185aa9c00) [pid = 1950] [serial = 593] [outer = (nil)]
11:29:58 INFO - ++DOMWINDOW == 67 (0x7f1185aaa400) [pid = 1950] [serial = 594] [outer = 0x7f1185aa9c00]
11:30:00 INFO - --DOCSHELL 0x7f119de26800 == 24 [pid = 1950] [id = 245]
11:30:00 INFO - --DOCSHELL 0x7f1180e33000 == 23 [pid = 1950] [id = 249]
11:30:00 INFO - --DOCSHELL 0x7f1182790800 == 22 [pid = 1950] [id = 250]
11:30:00 INFO - --DOCSHELL 0x7f1182786800 == 21 [pid = 1950] [id = 248]
11:30:00 INFO - --DOCSHELL 0x7f118d4a6000 == 20 [pid = 1950] [id = 251]
11:30:00 INFO - --DOCSHELL 0x7f118d4a7000 == 19 [pid = 1950] [id = 252]
11:30:00 INFO - --DOCSHELL 0x7f1191638000 == 18 [pid = 1950] [id = 254]
11:30:00 INFO - --DOCSHELL 0x7f118469f000 == 17 [pid = 1950] [id = 244]
11:30:00 INFO - --DOCSHELL 0x7f11827e7000 == 16 [pid = 1950] [id = 243]
11:30:02 INFO - --DOCSHELL 0x7f1191646800 == 15 [pid = 1950] [id = 255]
11:30:02 INFO - --DOCSHELL 0x7f1181274000 == 14 [pid = 1950] [id = 246]
11:30:02 INFO - --DOCSHELL 0x7f118d36f800 == 13 [pid = 1950] [id = 247]
11:30:02 INFO - --DOCSHELL 0x7f1176f0f800 == 12 [pid = 1950] [id = 256]
11:30:02 INFO - --DOCSHELL 0x7f118d527000 == 11 [pid = 1950] [id = 253]
11:30:02 INFO - --DOMWINDOW == 66 (0x7f118da55400) [pid = 1950] [serial = 551] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 65 (0x7f11914f7000) [pid = 1950] [serial = 555] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:30:02 INFO - --DOMWINDOW == 64 (0x7f11776f8400) [pid = 1950] [serial = 561] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 63 (0x7f1182887800) [pid = 1950] [serial = 556] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:30:02 INFO - --DOMWINDOW == 62 (0x7f118a9b8000) [pid = 1950] [serial = 552] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:30:02 INFO - --DOMWINDOW == 61 (0x7f118d747400) [pid = 1950] [serial = 550] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:30:02 INFO - --DOMWINDOW == 60 (0x7f11881f5000) [pid = 1950] [serial = 547] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:30:02 INFO - --DOMWINDOW == 59 (0x7f118461ac00) [pid = 1950] [serial = 542] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 58 (0x7f1187592c00) [pid = 1950] [serial = 544] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:02 INFO - --DOMWINDOW == 57 (0x7f11a62eec00) [pid = 1950] [serial = 554] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:30:02 INFO - --DOMWINDOW == 56 (0x7f11858f8400) [pid = 1950] [serial = 549] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:30:02 INFO - --DOMWINDOW == 55 (0x7f11872ae000) [pid = 1950] [serial = 543] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 54 (0x7f1196582800) [pid = 1950] [serial = 553] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 53 (0x7f1182888000) [pid = 1950] [serial = 557] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:30:02 INFO - --DOMWINDOW == 52 (0x7f118a93cc00) [pid = 1950] [serial = 546] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:02 INFO - --DOMWINDOW == 51 (0x7f1181d1b000) [pid = 1950] [serial = 564] [outer = (nil)] [url = about:blank]
11:30:02 INFO - --DOMWINDOW == 50 (0x7f119c2d2800) [pid = 1950] [serial = 588] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:30:03 INFO - MEMORY STAT | vsize 1225MB | residentFast 337MB | heapAllocated 135MB
11:30:03 INFO - 82 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js | took 16161ms
11:30:03 INFO - ++DOCSHELL 0x7f1176f18000 == 12 [pid = 1950] [id = 257]
11:30:03 INFO - ++DOMWINDOW == 51 (0x7f1176ccec00) [pid = 1950] [serial = 595] [outer = (nil)]
11:30:03 INFO - ++DOMWINDOW == 52 (0x7f1176db8400) [pid = 1950] [serial = 596] [outer = 0x7f1176ccec00]
11:30:03 INFO - 83 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js
11:30:03 INFO - ++DOCSHELL 0x7f11773b2000 == 13 [pid = 1950] [id = 258]
11:30:03 INFO - ++DOMWINDOW == 53 (0x7f1176dc9800) [pid = 1950] [serial = 597] [outer = (nil)]
11:30:03 INFO - ++DOMWINDOW == 54 (0x7f1176dcfc00) [pid = 1950] [serial = 598] [outer = 0x7f1176dc9800]
11:30:03 INFO - ++DOMWINDOW == 55 (0x7f1176edb800) [pid = 1950] [serial = 599] [outer = 0x7f1176dc9800]
11:30:03 INFO - ++DOCSHELL 0x7f1180e35800 == 14 [pid = 1950] [id = 259]
11:30:03 INFO - ++DOMWINDOW == 56 (0x7f1176dd1400) [pid = 1950] [serial = 600] [outer = (nil)]
11:30:03 INFO - ++DOMWINDOW == 57 (0x7f117738a800) [pid = 1950] [serial = 601] [outer = 0x7f1176dd1400]
11:30:03 INFO - ++DOMWINDOW == 58 (0x7f1176edd400) [pid = 1950] [serial = 602] [outer = 0x7f1176dd1400]
11:30:04 INFO - ++DOCSHELL 0x7f1181158000 == 15 [pid = 1950] [id = 260]
11:30:04 INFO - ++DOMWINDOW == 59 (0x7f118114b000) [pid = 1950] [serial = 603] [outer = (nil)]
11:30:04 INFO - ++DOMWINDOW == 60 (0x7f11812cb800) [pid = 1950] [serial = 604] [outer = 0x7f118114b000]
11:30:07 INFO - --DOCSHELL 0x7f11824ad800 == 14 [pid = 1950] [id = 242]
11:30:07 INFO - --DOCSHELL 0x7f118126e000 == 13 [pid = 1950] [id = 241]
11:30:07 INFO - --DOCSHELL 0x7f1181159800 == 12 [pid = 1950] [id = 240]
11:30:07 INFO - --DOMWINDOW == 59 (0x7f11a63ce400) [pid = 1950] [serial = 591] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:30:07 INFO - ++DOCSHELL 0x7f1176f2c800 == 13 [pid = 1950] [id = 261]
11:30:07 INFO - ++DOMWINDOW == 60 (0x7f1176db3000) [pid = 1950] [serial = 605] [outer = (nil)]
11:30:07 INFO - ++DOMWINDOW == 61 (0x7f1176db7000) [pid = 1950] [serial = 606] [outer = 0x7f1176db3000]
11:30:08 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:30:08 INFO - ++DOCSHELL 0x7f118aa35000 == 14 [pid = 1950] [id = 262]
11:30:08 INFO - ++DOMWINDOW == 62 (0x7f1182754400) [pid = 1950] [serial = 607] [outer = (nil)]
11:30:08 INFO - ++DOMWINDOW == 63 (0x7f1176dd1800) [pid = 1950] [serial = 608] [outer = 0x7f1182754400]
11:30:13 INFO - --DOCSHELL 0x7f1181158000 == 13 [pid = 1950] [id = 260]
11:30:14 INFO - --DOCSHELL 0x7f1176f2c800 == 12 [pid = 1950] [id = 261]
11:30:14 INFO - --DOCSHELL 0x7f118aa35000 == 11 [pid = 1950] [id = 262]
11:30:14 INFO - --DOMWINDOW == 62 (0x7f11838bf000) [pid = 1950] [serial = 573] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 61 (0x7f1183fc8c00) [pid = 1950] [serial = 589] [outer = (nil)] [url = data:text/html,]
11:30:14 INFO - --DOMWINDOW == 60 (0x7f118dd57800) [pid = 1950] [serial = 581] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:30:14 INFO - --DOMWINDOW == 59 (0x7f118dba3c00) [pid = 1950] [serial = 570] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:30:14 INFO - --DOMWINDOW == 58 (0x7f1176dc5400) [pid = 1950] [serial = 558] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 57 (0x7f11776f0800) [pid = 1950] [serial = 560] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:14 INFO - --DOMWINDOW == 56 (0x7f11a63d0c00) [pid = 1950] [serial = 592] [outer = (nil)] [url = data:text/html,]
11:30:14 INFO - --DOMWINDOW == 55 (0x7f119e03bc00) [pid = 1950] [serial = 590] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 54 (0x7f118a3e5c00) [pid = 1950] [serial = 571] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:30:14 INFO - --DOMWINDOW == 53 (0x7f1176dcfc00) [pid = 1950] [serial = 598] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 52 (0x7f1176dcd000) [pid = 1950] [serial = 559] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 51 (0x7f11838bd400) [pid = 1950] [serial = 572] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:30:14 INFO - --DOMWINDOW == 50 (0x7f1183672400) [pid = 1950] [serial = 566] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:30:14 INFO - --DOMWINDOW == 49 (0x7f1185aa9c00) [pid = 1950] [serial = 593] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:30:14 INFO - --DOMWINDOW == 48 (0x7f118da56800) [pid = 1950] [serial = 578] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 47 (0x7f118da57000) [pid = 1950] [serial = 579] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 46 (0x7f118d9e1000) [pid = 1950] [serial = 576] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 45 (0x7f1183caa400) [pid = 1950] [serial = 574] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:30:14 INFO - --DOMWINDOW == 44 (0x7f118da60000) [pid = 1950] [serial = 580] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 43 (0x7f118d9eb400) [pid = 1950] [serial = 577] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 42 (0x7f11838b8c00) [pid = 1950] [serial = 567] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 41 (0x7f1185aaa400) [pid = 1950] [serial = 594] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:30:14 INFO - --DOMWINDOW == 40 (0x7f11910b0000) [pid = 1950] [serial = 584] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 39 (0x7f11914f8400) [pid = 1950] [serial = 585] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 38 (0x7f1190abe800) [pid = 1950] [serial = 582] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 37 (0x7f118d56e000) [pid = 1950] [serial = 575] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 36 (0x7f11916ccc00) [pid = 1950] [serial = 586] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 35 (0x7f11910ab000) [pid = 1950] [serial = 583] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:30:14 INFO - --DOMWINDOW == 34 (0x7f11916d0c00) [pid = 1950] [serial = 587] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:30:14 INFO - --DOMWINDOW == 33 (0x7f11812d5400) [pid = 1950] [serial = 562] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:14 INFO - --DOMWINDOW == 32 (0x7f118114b000) [pid = 1950] [serial = 603] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:30:14 INFO - --DOMWINDOW == 31 (0x7f117738a800) [pid = 1950] [serial = 601] [outer = (nil)] [url = about:blank]
11:30:14 INFO - --DOMWINDOW == 30 (0x7f1181141c00) [pid = 1950] [serial = 563] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:30:14 INFO - --DOMWINDOW == 29 (0x7f11881f7c00) [pid = 1950] [serial = 568] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:30:15 INFO - MEMORY STAT | vsize 1231MB | residentFast 330MB | heapAllocated 132MB
11:30:15 INFO - 84 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js | took 11928ms
11:30:15 INFO - ++DOCSHELL 0x7f1176f2a800 == 12 [pid = 1950] [id = 263]
11:30:15 INFO - ++DOMWINDOW == 30 (0x7f1176db2c00) [pid = 1950] [serial = 609] [outer = (nil)]
11:30:15 INFO - ++DOMWINDOW == 31 (0x7f1176dc8800) [pid = 1950] [serial = 610] [outer = 0x7f1176db2c00]
11:30:15 INFO - 85 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js
11:30:15 INFO - ++DOCSHELL 0x7f1181154800 == 13 [pid = 1950] [id = 264]
11:30:15 INFO - ++DOMWINDOW == 32 (0x7f1176ed6c00) [pid = 1950] [serial = 611] [outer = (nil)]
11:30:15 INFO - ++DOMWINDOW == 33 (0x7f1176edb000) [pid = 1950] [serial = 612] [outer = 0x7f1176ed6c00]
11:30:15 INFO - ++DOMWINDOW == 34 (0x7f1176dac400) [pid = 1950] [serial = 613] [outer = 0x7f1176ed6c00]
11:30:16 INFO - ++DOCSHELL 0x7f1180e42000 == 14 [pid = 1950] [id = 265]
11:30:16 INFO - ++DOMWINDOW == 35 (0x7f1176ee0000) [pid = 1950] [serial = 614] [outer = (nil)]
11:30:16 INFO - ++DOMWINDOW == 36 (0x7f117738b400) [pid = 1950] [serial = 615] [outer = 0x7f1176ee0000]
11:30:16 INFO - ++DOMWINDOW == 37 (0x7f1176cc9c00) [pid = 1950] [serial = 616] [outer = 0x7f1176ee0000]
11:30:16 INFO - ++DOCSHELL 0x7f11835f6800 == 15 [pid = 1950] [id = 266]
11:30:16 INFO - ++DOMWINDOW == 38 (0x7f1181498400) [pid = 1950] [serial = 617] [outer = (nil)]
11:30:16 INFO - ++DOMWINDOW == 39 (0x7f1181499800) [pid = 1950] [serial = 618] [outer = 0x7f1181498400]
11:30:18 INFO - ++DOCSHELL 0x7f118aa3b800 == 16 [pid = 1950] [id = 267]
11:30:18 INFO - ++DOMWINDOW == 40 (0x7f1176ccb000) [pid = 1950] [serial = 619] [outer = (nil)]
11:30:18 INFO - ++DOMWINDOW == 41 (0x7f1185aa7c00) [pid = 1950] [serial = 620] [outer = 0x7f1176ccb000]
11:30:19 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:30:19 INFO - ++DOCSHELL 0x7f118aa41800 == 17 [pid = 1950] [id = 268]
11:30:19 INFO - ++DOMWINDOW == 42 (0x7f118f35f400) [pid = 1950] [serial = 621] [outer = (nil)]
11:30:19 INFO - ++DOMWINDOW == 43 (0x7f118260d800) [pid = 1950] [serial = 622] [outer = 0x7f118f35f400]
11:30:21 INFO - --DOCSHELL 0x7f1180e35800 == 16 [pid = 1950] [id = 259]
11:30:22 INFO - --DOCSHELL 0x7f1176f18000 == 15 [pid = 1950] [id = 257]
11:30:22 INFO - --DOCSHELL 0x7f11773b2000 == 14 [pid = 1950] [id = 258]
11:30:22 INFO - --DOMWINDOW == 42 (0x7f11812d7800) [pid = 1950] [serial = 565] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:30:22 INFO - --DOMWINDOW == 41 (0x7f11812cb800) [pid = 1950] [serial = 604] [outer = (nil)] [url = about:blank]
11:30:22 INFO - --DOMWINDOW == 40 (0x7f118a3e4400) [pid = 1950] [serial = 569] [outer = (nil)] [url = about:blank]
11:30:25 INFO - --DOCSHELL 0x7f118aa41800 == 13 [pid = 1950] [id = 268]
11:30:25 INFO - --DOCSHELL 0x7f118aa3b800 == 12 [pid = 1950] [id = 267]
11:30:25 INFO - --DOCSHELL 0x7f11835f6800 == 11 [pid = 1950] [id = 266]
11:30:26 INFO - MEMORY STAT | vsize 1238MB | residentFast 337MB | heapAllocated 139MB
11:30:26 INFO - 86 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js | took 10912ms
11:30:26 INFO - ++DOCSHELL 0x7f1176f0c800 == 12 [pid = 1950] [id = 269]
11:30:26 INFO - ++DOMWINDOW == 41 (0x7f118114a000) [pid = 1950] [serial = 623] [outer = (nil)]
11:30:26 INFO - ++DOMWINDOW == 42 (0x7f1181491000) [pid = 1950] [serial = 624] [outer = 0x7f118114a000]
11:30:26 INFO - 87 INFO TEST-START | devtools/client/webconsole/test/browser_jsterm_inspect.js
11:30:26 INFO - ++DOCSHELL 0x7f1181280800 == 13 [pid = 1950] [id = 270]
11:30:26 INFO - ++DOMWINDOW == 43 (0x7f1181edcc00) [pid = 1950] [serial = 625] [outer = (nil)]
11:30:26 INFO - ++DOMWINDOW == 44 (0x7f1181ee4800) [pid = 1950] [serial = 626] [outer = 0x7f1181edcc00]
11:30:27 INFO - ++DOCSHELL 0x7f1182797800 == 14 [pid = 1950] [id = 271]
11:30:27 INFO - ++DOMWINDOW == 45 (0x7f1182889400) [pid = 1950] [serial = 627] [outer = (nil)]
11:30:27 INFO - ++DOMWINDOW == 46 (0x7f118288c400) [pid = 1950] [serial = 628] [outer = 0x7f1182889400]
11:30:27 INFO - ++DOMWINDOW == 47 (0x7f1176dc5400) [pid = 1950] [serial = 629] [outer = 0x7f1182889400]
11:30:27 INFO - ++DOCSHELL 0x7f118365d800 == 15 [pid = 1950] [id = 272]
11:30:27 INFO - ++DOMWINDOW == 48 (0x7f1176ccf400) [pid = 1950] [serial = 630] [outer = (nil)]
11:30:28 INFO - ++DOMWINDOW == 49 (0x7f1185aa6800) [pid = 1950] [serial = 631] [outer = 0x7f1176ccf400]
11:30:31 INFO - --DOCSHELL 0x7f1180e42000 == 14 [pid = 1950] [id = 265]
11:30:31 INFO - --DOCSHELL 0x7f1181154800 == 13 [pid = 1950] [id = 264]
11:30:31 INFO - --DOCSHELL 0x7f1176f2a800 == 12 [pid = 1950] [id = 263]
11:30:32 INFO - ++DOCSHELL 0x7f11773c4800 == 13 [pid = 1950] [id = 273]
11:30:32 INFO - ++DOMWINDOW == 50 (0x7f1176dc4000) [pid = 1950] [serial = 632] [outer = (nil)]
11:30:32 INFO - ++DOMWINDOW == 51 (0x7f1176dc5800) [pid = 1950] [serial = 633] [outer = 0x7f1176dc4000]
11:30:33 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 278
11:30:34 INFO - [1950] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 174
11:30:34 INFO - [1950] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 141
11:30:45 INFO - --DOCSHELL 0x7f118365d800 == 12 [pid = 1950] [id = 272]
11:30:50 INFO - --DOMWINDOW == 50 (0x7f117738b400) [pid = 1950] [serial = 615] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 49 (0x7f1176edb000) [pid = 1950] [serial = 612] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 48 (0x7f1176ccec00) [pid = 1950] [serial = 595] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 47 (0x7f1176db2c00) [pid = 1950] [serial = 609] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 46 (0x7f1176dc9800) [pid = 1950] [serial = 597] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:50 INFO - --DOMWINDOW == 45 (0x7f1176db8400) [pid = 1950] [serial = 596] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 44 (0x7f1176dc8800) [pid = 1950] [serial = 610] [outer = (nil)] [url = about:blank]
11:30:50 INFO - --DOMWINDOW == 43 (0x7f1176ed6c00) [pid = 1950] [serial = 611] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:50 INFO - --DOMWINDOW == 42 (0x7f1176edb800) [pid = 1950] [serial = 599] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:50 INFO - --DOMWINDOW == 41 (0x7f1176dac400) [pid = 1950] [serial = 613] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html]
11:30:51 INFO - MEMORY STAT | vsize 1239MB | residentFast 361MB | heapAllocated 155MB
11:30:51 INFO - 88 INFO TEST-OK | devtools/client/webconsole/test/browser_jsterm_inspect.js | took 24297ms
11:30:51 INFO - ++DOCSHELL 0x7f1180e34000 == 13 [pid = 1950] [id = 274]
11:30:51 INFO - ++DOMWINDOW == 42 (0x7f1181edd400) [pid = 1950] [serial = 634] [outer = (nil)]
11:30:51 INFO - ++DOMWINDOW == 43 (0x7f1181fee800) [pid = 1950] [serial = 635] [outer = 0x7f1181edd400]
11:30:51 INFO - 89 INFO TEST-START | devtools/client/webconsole/test/browser_longstring_hang.js
11:30:51 INFO - ++DOCSHELL 0x7f11773aa800 == 14 [pid = 1950] [id = 275]
11:30:51 INFO - ++DOMWINDOW == 44 (0x7f1182748400) [pid = 1950] [serial = 636] [outer = (nil)]
11:30:51 INFO - ++DOMWINDOW == 45 (0x7f118283dc00) [pid = 1950] [serial = 637] [outer = 0x7f1182748400]
11:30:51 INFO - ++DOMWINDOW == 46 (0x7f118288fc00) [pid = 1950] [serial = 638] [outer = 0x7f1182748400]
11:30:52 INFO - ++DOCSHELL 0x7f1187d83000 == 15 [pid = 1950] [id = 276]
11:30:52 INFO - ++DOMWINDOW == 47 (0x7f1176dc4400) [pid = 1950] [serial = 639] [outer = (nil)]
11:30:52 INFO - ++DOMWINDOW == 48 (0x7f118260e400) [pid = 1950] [serial = 640] [outer = 0x7f1176dc4400]
11:30:52 INFO - ++DOMWINDOW == 49 (0x7f1183670000) [pid = 1950] [serial = 641] [outer = 0x7f1176dc4400]
11:30:52 INFO - ++DOCSHELL 0x7f11773c0000 == 16 [pid = 1950] [id = 277]
11:30:52 INFO - ++DOMWINDOW == 50 (0x7f117738dc00) [pid = 1950] [serial = 642] [outer = (nil)]
11:30:52 INFO - ++DOMWINDOW == 51 (0x7f11776eb800) [pid = 1950] [serial = 643] [outer = 0x7f117738dc00]
11:30:55 INFO - Block(span)(3)@7f1181fa0208: Init: bad caller: width WAS 84007040(0x501d880)
11:30:55 INFO - Block(span)(0)@7f11820367b0: Init: bad caller: width WAS 84000000(0x501bd00)
11:30:55 INFO - nsLineLayout: Text(0)"foobaraaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa"@7f1182036c30 metrics=84000000,840!
11:30:55 INFO - nsLineLayout: Inline(span)(0)@7f1182036bb8 metrics=84000000,840!
11:30:55 INFO - nsBlockReflowContext: FlexContainer(span)(0)@7f1181fa05a0 metrics=84007040,840!
11:30:55 INFO - nsBlockReflowContext: Block(span)(0)@7f1182038c40 metrics=84007040,840!
11:30:55 INFO - Block(span)(3)@7f1181fa0208: Init: bad caller: width WAS 84007040(0x501d880)
11:30:56 INFO - MEMORY STAT | vsize 1251MB | residentFast 377MB | heapAllocated 164MB
11:30:56 INFO - 90 INFO TEST-OK | devtools/client/webconsole/test/browser_longstring_hang.js | took 4721ms
11:30:56 INFO - ++DOCSHELL 0x7f1182795800 == 17 [pid = 1950] [id = 278]
11:30:56 INFO - ++DOMWINDOW == 52 (0x7f1183fd9400) [pid = 1950] [serial = 644] [outer = (nil)]
11:30:56 INFO - ++DOMWINDOW == 53 (0x7f1185aa0000) [pid = 1950] [serial = 645] [outer = 0x7f1183fd9400]
11:30:56 INFO - 91 INFO TEST-START | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js
11:30:56 INFO - ++DOCSHELL 0x7f118d52e800 == 18 [pid = 1950] [id = 279]
11:30:56 INFO - ++DOMWINDOW == 54 (0x7f11881f4c00) [pid = 1950] [serial = 646] [outer = (nil)]
11:30:56 INFO - ++DOMWINDOW == 55 (0x7f118a92dc00) [pid = 1950] [serial = 647] [outer = 0x7f11881f4c00]
11:30:57 INFO - ++DOCSHELL 0x7f118d918800 == 19 [pid = 1950] [id = 280]
11:30:57 INFO - ++DOMWINDOW == 56 (0x7f1176dbb400) [pid = 1950] [serial = 648] [outer = (nil)]
11:30:57 INFO - ++DOMWINDOW == 57 (0x7f118ce9cc00) [pid = 1950] [serial = 649] [outer = 0x7f1176dbb400]
11:30:57 INFO - ++DOMWINDOW == 58 (0x7f1183671c00) [pid = 1950] [serial = 650] [outer = 0x7f1176dbb400]
11:30:57 INFO - ++DOCSHELL 0x7f11907c0000 == 20 [pid = 1950] [id = 281]
11:30:57 INFO - ++DOMWINDOW == 59 (0x7f118da57000) [pid = 1950] [serial = 651] [outer = (nil)]
11:30:57 INFO - ++DOMWINDOW == 60 (0x7f118da5a800) [pid = 1950] [serial = 652] [outer = 0x7f118da57000]
11:30:59 INFO - ++DOMWINDOW == 61 (0x7f119c2d0400) [pid = 1950] [serial = 653] [outer = 0x7f11881f4c00]
11:30:59 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:31:00 INFO - --DOCSHELL 0x7f1181280800 == 19 [pid = 1950] [id = 270]
11:31:00 INFO - --DOCSHELL 0x7f1176f0c800 == 18 [pid = 1950] [id = 269]
11:31:00 INFO - --DOCSHELL 0x7f11773c0000 == 17 [pid = 1950] [id = 277]
11:31:00 INFO - --DOCSHELL 0x7f11773c4800 == 16 [pid = 1950] [id = 273]
11:31:00 INFO - --DOCSHELL 0x7f1182797800 == 15 [pid = 1950] [id = 271]
11:31:01 INFO - ++DOCSHELL 0x7f1176f0d000 == 16 [pid = 1950] [id = 282]
11:31:01 INFO - ++DOMWINDOW == 62 (0x7f11812d6c00) [pid = 1950] [serial = 654] [outer = (nil)]
11:31:01 INFO - ++DOMWINDOW == 63 (0x7f1181490000) [pid = 1950] [serial = 655] [outer = 0x7f11812d6c00]
11:31:01 INFO - ++DOCSHELL 0x7f1176f23800 == 17 [pid = 1950] [id = 283]
11:31:01 INFO - ++DOMWINDOW == 64 (0x7f1185a9f400) [pid = 1950] [serial = 656] [outer = (nil)]
11:31:01 INFO - ++DOMWINDOW == 65 (0x7f118274f400) [pid = 1950] [serial = 657] [outer = 0x7f1185a9f400]
11:31:02 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:31:02 INFO - --DOCSHELL 0x7f1176f23800 == 16 [pid = 1950] [id = 283]
11:31:02 INFO - --DOCSHELL 0x7f11907c0000 == 15 [pid = 1950] [id = 281]
11:31:03 INFO - MEMORY STAT | vsize 1255MB | residentFast 371MB | heapAllocated 161MB
11:31:03 INFO - 92 INFO TEST-OK | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js | took 6691ms
11:31:03 INFO - ++DOCSHELL 0x7f11906b7000 == 16 [pid = 1950] [id = 284]
11:31:03 INFO - ++DOMWINDOW == 66 (0x7f1185aa2800) [pid = 1950] [serial = 658] [outer = (nil)]
11:31:03 INFO - ++DOMWINDOW == 67 (0x7f118a914c00) [pid = 1950] [serial = 659] [outer = 0x7f1185aa2800]
11:31:03 INFO - 93 INFO TEST-START | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js
11:31:03 INFO - ++DOCSHELL 0x7f119c253000 == 17 [pid = 1950] [id = 285]
11:31:03 INFO - ++DOMWINDOW == 68 (0x7f118d571000) [pid = 1950] [serial = 660] [outer = (nil)]
11:31:03 INFO - ++DOMWINDOW == 69 (0x7f118f36a800) [pid = 1950] [serial = 661] [outer = 0x7f118d571000]
11:31:04 INFO - ++DOCSHELL 0x7f1180e50800 == 18 [pid = 1950] [id = 286]
11:31:04 INFO - ++DOMWINDOW == 70 (0x7f119e4f4800) [pid = 1950] [serial = 662] [outer = (nil)]
11:31:04 INFO - ++DOMWINDOW == 71 (0x7f11a3852800) [pid = 1950] [serial = 663] [outer = 0x7f119e4f4800]
11:31:04 INFO - ++DOMWINDOW == 72 (0x7f118a927400) [pid = 1950] [serial = 664] [outer = 0x7f119e4f4800]
11:31:04 INFO - ++DOCSHELL 0x7f11a67cf800 == 19 [pid = 1950] [id = 287]
11:31:04 INFO - ++DOMWINDOW == 73 (0x7f11a62f1000) [pid = 1950] [serial = 665] [outer = (nil)]
11:31:04 INFO - ++DOMWINDOW == 74 (0x7f11a62f4800) [pid = 1950] [serial = 666] [outer = 0x7f11a62f1000]
11:31:07 INFO - --DOMWINDOW == 73 (0x7f1182748400) [pid = 1950] [serial = 636] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html]
11:31:07 INFO - --DOMWINDOW == 72 (0x7f1182754400) [pid = 1950] [serial = 607] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:31:07 INFO - --DOMWINDOW == 71 (0x7f1181edd400) [pid = 1950] [serial = 634] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 70 (0x7f118f35f400) [pid = 1950] [serial = 621] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:31:07 INFO - --DOMWINDOW == 69 (0x7f1176dc4000) [pid = 1950] [serial = 632] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:31:07 INFO - --DOMWINDOW == 68 (0x7f1181edcc00) [pid = 1950] [serial = 625] [outer = (nil)] [url = data:text/html;charset=utf8,hello%20bug%20869981]
11:31:07 INFO - --DOMWINDOW == 67 (0x7f118114a000) [pid = 1950] [serial = 623] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 66 (0x7f1176ccb000) [pid = 1950] [serial = 619] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:31:07 INFO - --DOMWINDOW == 65 (0x7f117738dc00) [pid = 1950] [serial = 642] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:07 INFO - --DOMWINDOW == 64 (0x7f1176ccf400) [pid = 1950] [serial = 630] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:07 INFO - --DOMWINDOW == 63 (0x7f1181fee800) [pid = 1950] [serial = 635] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 62 (0x7f118260e400) [pid = 1950] [serial = 640] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 61 (0x7f1176db3000) [pid = 1950] [serial = 605] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:31:07 INFO - --DOMWINDOW == 60 (0x7f1181498400) [pid = 1950] [serial = 617] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:07 INFO - --DOMWINDOW == 59 (0x7f1176dd1400) [pid = 1950] [serial = 600] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:07 INFO - --DOMWINDOW == 58 (0x7f1176dc4400) [pid = 1950] [serial = 639] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:07 INFO - --DOMWINDOW == 57 (0x7f1176ee0000) [pid = 1950] [serial = 614] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:07 INFO - --DOMWINDOW == 56 (0x7f1182889400) [pid = 1950] [serial = 627] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:07 INFO - --DOMWINDOW == 55 (0x7f118ce9cc00) [pid = 1950] [serial = 649] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 54 (0x7f118283dc00) [pid = 1950] [serial = 637] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 53 (0x7f118288c400) [pid = 1950] [serial = 628] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 52 (0x7f1181491000) [pid = 1950] [serial = 624] [outer = (nil)] [url = about:blank]
11:31:07 INFO - --DOMWINDOW == 51 (0x7f118288fc00) [pid = 1950] [serial = 638] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html]
11:31:07 INFO - ++DOCSHELL 0x7f117a61d800 == 20 [pid = 1950] [id = 288]
11:31:07 INFO - ++DOMWINDOW == 52 (0x7f118260c400) [pid = 1950] [serial = 667] [outer = (nil)]
11:31:07 INFO - ++DOMWINDOW == 53 (0x7f1182754400) [pid = 1950] [serial = 668] [outer = 0x7f118260c400]
11:31:07 INFO - --DOCSHELL 0x7f117a61d800 == 19 [pid = 1950] [id = 288]
11:31:08 INFO - MEMORY STAT | vsize 1267MB | residentFast 379MB | heapAllocated 162MB
11:31:08 INFO - 94 INFO TEST-OK | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js | took 5019ms
11:31:08 INFO - ++DOCSHELL 0x7f117a608000 == 20 [pid = 1950] [id = 289]
11:31:08 INFO - ++DOMWINDOW == 54 (0x7f11881f6c00) [pid = 1950] [serial = 669] [outer = (nil)]
11:31:08 INFO - ++DOMWINDOW == 55 (0x7f118d566400) [pid = 1950] [serial = 670] [outer = 0x7f11881f6c00]
11:31:08 INFO - 95 INFO TEST-START | devtools/client/webconsole/test/browser_output_longstring_expand.js
11:31:08 INFO - ++DOCSHELL 0x7f11872d0000 == 21 [pid = 1950] [id = 290]
11:31:08 INFO - ++DOMWINDOW == 56 (0x7f11a62ef800) [pid = 1950] [serial = 671] [outer = (nil)]
11:31:09 INFO - ++DOMWINDOW == 57 (0x7f11a63d0c00) [pid = 1950] [serial = 672] [outer = 0x7f11a62ef800]
11:31:09 INFO - ++DOCSHELL 0x7f11773ad800 == 22 [pid = 1950] [id = 291]
11:31:09 INFO - ++DOMWINDOW == 58 (0x7f1176cd0800) [pid = 1950] [serial = 673] [outer = (nil)]
11:31:09 INFO - ++DOMWINDOW == 59 (0x7f1176dc4000) [pid = 1950] [serial = 674] [outer = 0x7f1176cd0800]
11:31:10 INFO - ++DOMWINDOW == 60 (0x7f1176db6c00) [pid = 1950] [serial = 675] [outer = 0x7f1176cd0800]
11:31:10 INFO - ++DOCSHELL 0x7f118116e800 == 23 [pid = 1950] [id = 292]
11:31:10 INFO - ++DOMWINDOW == 61 (0x7f11838bf800) [pid = 1950] [serial = 676] [outer = (nil)]
11:31:10 INFO - ++DOMWINDOW == 62 (0x7f1185aab800) [pid = 1950] [serial = 677] [outer = 0x7f11838bf800]
11:31:14 INFO - --DOCSHELL 0x7f1176f0d000 == 22 [pid = 1950] [id = 282]
11:31:14 INFO - --DOCSHELL 0x7f11773aa800 == 21 [pid = 1950] [id = 275]
11:31:14 INFO - --DOCSHELL 0x7f1187d83000 == 20 [pid = 1950] [id = 276]
11:31:14 INFO - --DOCSHELL 0x7f1180e34000 == 19 [pid = 1950] [id = 274]
11:31:14 INFO - --DOCSHELL 0x7f11a67cf800 == 18 [pid = 1950] [id = 287]
11:31:14 INFO - --DOMWINDOW == 61 (0x7f1176dd1800) [pid = 1950] [serial = 608] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:31:14 INFO - --DOMWINDOW == 60 (0x7f118260d800) [pid = 1950] [serial = 622] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:31:14 INFO - --DOMWINDOW == 59 (0x7f1176dc5800) [pid = 1950] [serial = 633] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:31:14 INFO - --DOMWINDOW == 58 (0x7f1181ee4800) [pid = 1950] [serial = 626] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 57 (0x7f1185aa6800) [pid = 1950] [serial = 631] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 56 (0x7f11776eb800) [pid = 1950] [serial = 643] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 55 (0x7f1185aa7c00) [pid = 1950] [serial = 620] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 54 (0x7f1176cc9c00) [pid = 1950] [serial = 616] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:14 INFO - --DOMWINDOW == 53 (0x7f1176dc5400) [pid = 1950] [serial = 629] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:14 INFO - --DOMWINDOW == 52 (0x7f1183670000) [pid = 1950] [serial = 641] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:14 INFO - --DOMWINDOW == 51 (0x7f1176db7000) [pid = 1950] [serial = 606] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 50 (0x7f1181499800) [pid = 1950] [serial = 618] [outer = (nil)] [url = about:blank]
11:31:14 INFO - --DOMWINDOW == 49 (0x7f1176edd400) [pid = 1950] [serial = 602] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:15 INFO - --DOCSHELL 0x7f118116e800 == 17 [pid = 1950] [id = 292]
11:31:16 INFO - MEMORY STAT | vsize 1268MB | residentFast 362MB | heapAllocated 134MB
11:31:16 INFO - 96 INFO TEST-OK | devtools/client/webconsole/test/browser_output_longstring_expand.js | took 7146ms
11:31:16 INFO - ++DOCSHELL 0x7f11773bf000 == 18 [pid = 1950] [id = 293]
11:31:16 INFO - ++DOMWINDOW == 50 (0x7f1176edac00) [pid = 1950] [serial = 678] [outer = (nil)]
11:31:16 INFO - ++DOMWINDOW == 51 (0x7f1176ee1000) [pid = 1950] [serial = 679] [outer = 0x7f1176edac00]
11:31:16 INFO - 97 INFO TEST-START | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js
11:31:16 INFO - ++DOCSHELL 0x7f117a61b800 == 19 [pid = 1950] [id = 294]
11:31:16 INFO - ++DOMWINDOW == 52 (0x7f1177390000) [pid = 1950] [serial = 680] [outer = (nil)]
11:31:16 INFO - ++DOMWINDOW == 53 (0x7f1177393c00) [pid = 1950] [serial = 681] [outer = 0x7f1177390000]
11:31:16 INFO - ++DOMWINDOW == 54 (0x7f11776f3400) [pid = 1950] [serial = 682] [outer = 0x7f1177390000]
11:31:16 INFO - ++DOCSHELL 0x7f1180e42000 == 20 [pid = 1950] [id = 295]
11:31:16 INFO - ++DOMWINDOW == 55 (0x7f1177394c00) [pid = 1950] [serial = 683] [outer = (nil)]
11:31:16 INFO - ++DOMWINDOW == 56 (0x7f118114ec00) [pid = 1950] [serial = 684] [outer = 0x7f1177394c00]
11:31:17 INFO - ++DOMWINDOW == 57 (0x7f1176dac400) [pid = 1950] [serial = 685] [outer = 0x7f1177394c00]
11:31:17 INFO - ++DOCSHELL 0x7f118116b800 == 21 [pid = 1950] [id = 296]
11:31:17 INFO - ++DOMWINDOW == 58 (0x7f118148fc00) [pid = 1950] [serial = 686] [outer = (nil)]
11:31:17 INFO - ++DOMWINDOW == 59 (0x7f1181493400) [pid = 1950] [serial = 687] [outer = 0x7f118148fc00]
11:31:19 INFO - --DOMWINDOW == 58 (0x7f11812d6c00) [pid = 1950] [serial = 654] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul]
11:31:19 INFO - --DOMWINDOW == 57 (0x7f118260c400) [pid = 1950] [serial = 667] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:31:19 INFO - --DOMWINDOW == 56 (0x7f1185aa2800) [pid = 1950] [serial = 658] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 55 (0x7f118da57000) [pid = 1950] [serial = 651] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:19 INFO - --DOMWINDOW == 54 (0x7f1176dbb400) [pid = 1950] [serial = 648] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:19 INFO - --DOMWINDOW == 53 (0x7f118d571000) [pid = 1950] [serial = 660] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20773466]
11:31:19 INFO - --DOMWINDOW == 52 (0x7f11881f4c00) [pid = 1950] [serial = 646] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:31:19 INFO - --DOMWINDOW == 51 (0x7f1183fd9400) [pid = 1950] [serial = 644] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 50 (0x7f1185a9f400) [pid = 1950] [serial = 656] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 49 (0x7f118f36a800) [pid = 1950] [serial = 661] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 48 (0x7f118a92dc00) [pid = 1950] [serial = 647] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 47 (0x7f1185aa0000) [pid = 1950] [serial = 645] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 46 (0x7f11a3852800) [pid = 1950] [serial = 663] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 45 (0x7f118274f400) [pid = 1950] [serial = 657] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 44 (0x7f1176dc4000) [pid = 1950] [serial = 674] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 43 (0x7f118a914c00) [pid = 1950] [serial = 659] [outer = (nil)] [url = about:blank]
11:31:19 INFO - --DOMWINDOW == 42 (0x7f119c2d0400) [pid = 1950] [serial = 653] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:31:19 INFO - ++DOMWINDOW == 43 (0x7f1183e61c00) [pid = 1950] [serial = 688] [outer = 0x7f1177390000]
11:31:20 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:31:21 INFO - MEMORY STAT | vsize 1271MB | residentFast 356MB | heapAllocated 140MB
11:31:21 INFO - 98 INFO TEST-OK | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js | took 5155ms
11:31:21 INFO - ++DOCSHELL 0x7f11835e0800 == 22 [pid = 1950] [id = 297]
11:31:21 INFO - ++DOMWINDOW == 44 (0x7f118113f800) [pid = 1950] [serial = 689] [outer = (nil)]
11:31:21 INFO - ++DOMWINDOW == 45 (0x7f1182604400) [pid = 1950] [serial = 690] [outer = 0x7f118113f800]
11:31:21 INFO - 99 INFO TEST-START | devtools/client/webconsole/test/browser_result_format_as_string.js
11:31:21 INFO - ++DOCSHELL 0x7f1176f1d800 == 23 [pid = 1950] [id = 298]
11:31:21 INFO - ++DOMWINDOW == 46 (0x7f1176ccd800) [pid = 1950] [serial = 691] [outer = (nil)]
11:31:21 INFO - ++DOMWINDOW == 47 (0x7f1176dba400) [pid = 1950] [serial = 692] [outer = 0x7f1176ccd800]
11:31:22 INFO - ++DOMWINDOW == 48 (0x7f1176dd0000) [pid = 1950] [serial = 693] [outer = 0x7f1176ccd800]
11:31:22 INFO - ++DOCSHELL 0x7f1180e4f000 == 24 [pid = 1950] [id = 299]
11:31:22 INFO - ++DOMWINDOW == 49 (0x7f1176dc5400) [pid = 1950] [serial = 694] [outer = (nil)]
11:31:22 INFO - ++DOMWINDOW == 50 (0x7f11776eb800) [pid = 1950] [serial = 695] [outer = 0x7f1176dc5400]
11:31:22 INFO - ++DOMWINDOW == 51 (0x7f1176dbb400) [pid = 1950] [serial = 696] [outer = 0x7f1176dc5400]
11:31:23 INFO - ++DOCSHELL 0x7f1181269000 == 25 [pid = 1950] [id = 300]
11:31:23 INFO - ++DOMWINDOW == 52 (0x7f1181fe1400) [pid = 1950] [serial = 697] [outer = (nil)]
11:31:23 INFO - ++DOMWINDOW == 53 (0x7f1182883400) [pid = 1950] [serial = 698] [outer = 0x7f1181fe1400]
11:31:26 INFO - --DOCSHELL 0x7f1182795800 == 24 [pid = 1950] [id = 278]
11:31:26 INFO - --DOCSHELL 0x7f11773bf000 == 23 [pid = 1950] [id = 293]
11:31:26 INFO - --DOCSHELL 0x7f1180e50800 == 22 [pid = 1950] [id = 286]
11:31:26 INFO - --DOCSHELL 0x7f117a61b800 == 21 [pid = 1950] [id = 294]
11:31:26 INFO - --DOCSHELL 0x7f1180e42000 == 20 [pid = 1950] [id = 295]
11:31:26 INFO - --DOCSHELL 0x7f11773ad800 == 19 [pid = 1950] [id = 291]
11:31:26 INFO - --DOCSHELL 0x7f118116b800 == 18 [pid = 1950] [id = 296]
11:31:26 INFO - --DOCSHELL 0x7f117a608000 == 17 [pid = 1950] [id = 289]
11:31:26 INFO - --DOCSHELL 0x7f11872d0000 == 16 [pid = 1950] [id = 290]
11:31:26 INFO - --DOCSHELL 0x7f118d52e800 == 15 [pid = 1950] [id = 279]
11:31:26 INFO - --DOCSHELL 0x7f118d918800 == 14 [pid = 1950] [id = 280]
11:31:26 INFO - --DOCSHELL 0x7f119c253000 == 13 [pid = 1950] [id = 285]
11:31:26 INFO - --DOCSHELL 0x7f11906b7000 == 12 [pid = 1950] [id = 284]
11:31:26 INFO - --DOMWINDOW == 52 (0x7f1181490000) [pid = 1950] [serial = 655] [outer = (nil)] [url = about:blank]
11:31:26 INFO - --DOMWINDOW == 51 (0x7f1182754400) [pid = 1950] [serial = 668] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:31:26 INFO - --DOMWINDOW == 50 (0x7f1183671c00) [pid = 1950] [serial = 650] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:26 INFO - --DOMWINDOW == 49 (0x7f118da5a800) [pid = 1950] [serial = 652] [outer = (nil)] [url = about:blank]
11:31:26 INFO - --DOCSHELL 0x7f1181269000 == 11 [pid = 1950] [id = 300]
11:31:27 INFO - MEMORY STAT | vsize 1266MB | residentFast 345MB | heapAllocated 131MB
11:31:27 INFO - 100 INFO TEST-OK | devtools/client/webconsole/test/browser_result_format_as_string.js | took 5906ms
11:31:27 INFO - ++DOCSHELL 0x7f1176f2a800 == 12 [pid = 1950] [id = 301]
11:31:27 INFO - ++DOMWINDOW == 50 (0x7f118114a000) [pid = 1950] [serial = 699] [outer = (nil)]
11:31:27 INFO - ++DOMWINDOW == 51 (0x7f11812d1000) [pid = 1950] [serial = 700] [outer = 0x7f118114a000]
11:31:28 INFO - 101 INFO TEST-START | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js
11:31:28 INFO - ++DOCSHELL 0x7f1180e43800 == 13 [pid = 1950] [id = 302]
11:31:28 INFO - ++DOMWINDOW == 52 (0x7f11812da800) [pid = 1950] [serial = 701] [outer = (nil)]
11:31:28 INFO - ++DOMWINDOW == 53 (0x7f118148f400) [pid = 1950] [serial = 702] [outer = 0x7f11812da800]
11:31:28 INFO - ++DOMWINDOW == 54 (0x7f1181edec00) [pid = 1950] [serial = 703] [outer = 0x7f11812da800]
11:31:29 INFO - ++DOCSHELL 0x7f118115a800 == 14 [pid = 1950] [id = 303]
11:31:29 INFO - ++DOMWINDOW == 55 (0x7f1181490400) [pid = 1950] [serial = 704] [outer = (nil)]
11:31:29 INFO - ++DOMWINDOW == 56 (0x7f118242dc00) [pid = 1950] [serial = 705] [outer = 0x7f1181490400]
11:31:29 INFO - ++DOMWINDOW == 57 (0x7f1181ee1400) [pid = 1950] [serial = 706] [outer = 0x7f1181490400]
11:31:29 INFO - ++DOCSHELL 0x7f1182794800 == 15 [pid = 1950] [id = 304]
11:31:29 INFO - ++DOMWINDOW == 58 (0x7f1183671c00) [pid = 1950] [serial = 707] [outer = (nil)]
11:31:29 INFO - ++DOMWINDOW == 59 (0x7f11838de400) [pid = 1950] [serial = 708] [outer = 0x7f1183671c00]
11:31:31 INFO - --DOMWINDOW == 58 (0x7f1176edac00) [pid = 1950] [serial = 678] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 57 (0x7f11838bf800) [pid = 1950] [serial = 676] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:31 INFO - --DOMWINDOW == 56 (0x7f119e4f4800) [pid = 1950] [serial = 662] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:31 INFO - --DOMWINDOW == 55 (0x7f11a62f1000) [pid = 1950] [serial = 665] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:31 INFO - --DOMWINDOW == 54 (0x7f1177394c00) [pid = 1950] [serial = 683] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:31 INFO - --DOMWINDOW == 53 (0x7f1176cd0800) [pid = 1950] [serial = 673] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:31 INFO - --DOMWINDOW == 52 (0x7f118148fc00) [pid = 1950] [serial = 686] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:31 INFO - --DOMWINDOW == 51 (0x7f11881f6c00) [pid = 1950] [serial = 669] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 50 (0x7f11a62ef800) [pid = 1950] [serial = 671] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20787981%20-%20check%20that%20long%20strings%20can%20be%20expanded%20in%20the%20output.]
11:31:31 INFO - --DOMWINDOW == 49 (0x7f1177390000) [pid = 1950] [serial = 680] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html]
11:31:31 INFO - --DOMWINDOW == 48 (0x7f118114ec00) [pid = 1950] [serial = 684] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 47 (0x7f118d566400) [pid = 1950] [serial = 670] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 46 (0x7f11a63d0c00) [pid = 1950] [serial = 672] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 45 (0x7f1177393c00) [pid = 1950] [serial = 681] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 44 (0x7f11776eb800) [pid = 1950] [serial = 695] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 43 (0x7f1176ee1000) [pid = 1950] [serial = 679] [outer = (nil)] [url = about:blank]
11:31:31 INFO - --DOMWINDOW == 42 (0x7f11776f3400) [pid = 1950] [serial = 682] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html]
11:31:32 INFO - ++DOMWINDOW == 43 (0x7f1183ca8c00) [pid = 1950] [serial = 709] [outer = 0x7f11812da800]
11:31:32 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:31:33 INFO - --DOCSHELL 0x7f1182794800 == 14 [pid = 1950] [id = 304]
11:31:33 INFO - --DOCSHELL 0x7f1180e4f000 == 13 [pid = 1950] [id = 299]
11:31:33 INFO - --DOCSHELL 0x7f11835e0800 == 12 [pid = 1950] [id = 297]
11:31:33 INFO - --DOMWINDOW == 42 (0x7f1183e61c00) [pid = 1950] [serial = 688] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html]
11:31:33 INFO - --DOMWINDOW == 41 (0x7f118a927400) [pid = 1950] [serial = 664] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:33 INFO - --DOMWINDOW == 40 (0x7f11a62f4800) [pid = 1950] [serial = 666] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 39 (0x7f1176dac400) [pid = 1950] [serial = 685] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:33 INFO - --DOMWINDOW == 38 (0x7f1176db6c00) [pid = 1950] [serial = 675] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:33 INFO - --DOMWINDOW == 37 (0x7f1181493400) [pid = 1950] [serial = 687] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 36 (0x7f1185aab800) [pid = 1950] [serial = 677] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 35 (0x7f118148f400) [pid = 1950] [serial = 702] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 34 (0x7f1176dba400) [pid = 1950] [serial = 692] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 33 (0x7f1182604400) [pid = 1950] [serial = 690] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 32 (0x7f118242dc00) [pid = 1950] [serial = 705] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 31 (0x7f1181edec00) [pid = 1950] [serial = 703] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js]
11:31:33 INFO - --DOMWINDOW == 30 (0x7f1176ccd800) [pid = 1950] [serial = 691] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html]
11:31:33 INFO - --DOMWINDOW == 29 (0x7f118113f800) [pid = 1950] [serial = 689] [outer = (nil)] [url = about:blank]
11:31:33 INFO - --DOMWINDOW == 28 (0x7f1176dd0000) [pid = 1950] [serial = 693] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html]
11:31:33 INFO - ++DOMWINDOW == 29 (0x7f1176db3400) [pid = 1950] [serial = 710] [outer = 0x7f11812da800]
11:31:34 INFO - ++DOCSHELL 0x7f11773ba800 == 13 [pid = 1950] [id = 305]
11:31:34 INFO - ++DOMWINDOW == 30 (0x7f1176db5000) [pid = 1950] [serial = 711] [outer = (nil)]
11:31:34 INFO - ++DOMWINDOW == 31 (0x7f1176dc2800) [pid = 1950] [serial = 712] [outer = 0x7f1176db5000]
11:31:34 INFO - ++DOMWINDOW == 32 (0x7f1176dc5c00) [pid = 1950] [serial = 713] [outer = 0x7f1176db5000]
11:31:34 INFO - ++DOCSHELL 0x7f1180e3e800 == 14 [pid = 1950] [id = 306]
11:31:34 INFO - ++DOMWINDOW == 33 (0x7f11776ec000) [pid = 1950] [serial = 714] [outer = (nil)]
11:31:34 INFO - ++DOMWINDOW == 34 (0x7f11776f2400) [pid = 1950] [serial = 715] [outer = 0x7f11776ec000]
11:31:36 INFO - ++DOMWINDOW == 35 (0x7f118274d400) [pid = 1950] [serial = 716] [outer = 0x7f11812da800]
11:31:36 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:31:37 INFO - MEMORY STAT | vsize 1268MB | residentFast 339MB | heapAllocated 132MB
11:31:37 INFO - 102 INFO TEST-OK | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js | took 9242ms
11:31:37 INFO - ++DOCSHELL 0x7f11773b3800 == 15 [pid = 1950] [id = 307]
11:31:37 INFO - ++DOMWINDOW == 36 (0x7f11776f1800) [pid = 1950] [serial = 717] [outer = (nil)]
11:31:37 INFO - ++DOMWINDOW == 37 (0x7f1181490000) [pid = 1950] [serial = 718] [outer = 0x7f11776f1800]
11:31:37 INFO - 103 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js
11:31:38 INFO - MEMORY STAT | vsize 1268MB | residentFast 332MB | heapAllocated 128MB
11:31:38 INFO - 104 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js | took 399ms
11:31:38 INFO - ++DOCSHELL 0x7f11773af000 == 16 [pid = 1950] [id = 308]
11:31:38 INFO - ++DOMWINDOW == 38 (0x7f1176dbb000) [pid = 1950] [serial = 719] [outer = (nil)]
11:31:38 INFO - ++DOMWINDOW == 39 (0x7f1176dcbc00) [pid = 1950] [serial = 720] [outer = 0x7f1176dbb000]
11:31:38 INFO - 105 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js
11:31:38 INFO - ++DOCSHELL 0x7f118115d800 == 17 [pid = 1950] [id = 309]
11:31:38 INFO - ++DOMWINDOW == 40 (0x7f11776ec800) [pid = 1950] [serial = 721] [outer = (nil)]
11:31:38 INFO - ++DOMWINDOW == 41 (0x7f11812cdc00) [pid = 1950] [serial = 722] [outer = 0x7f11776ec800]
11:31:39 INFO - ++DOMWINDOW == 42 (0x7f1181f51000) [pid = 1950] [serial = 723] [outer = 0x7f11776ec800]
11:31:40 INFO - ++DOCSHELL 0x7f1187d86000 == 18 [pid = 1950] [id = 310]
11:31:40 INFO - ++DOMWINDOW == 43 (0x7f1176dcb400) [pid = 1950] [serial = 724] [outer = (nil)]
11:31:40 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:31:40 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:31:40 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:31:40 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:31:40 INFO - ++DOMWINDOW == 44 (0x7f1181f50400) [pid = 1950] [serial = 725] [outer = 0x7f1176dcb400]
11:31:40 INFO - ++DOCSHELL 0x7f118a152800 == 19 [pid = 1950] [id = 311]
11:31:40 INFO - ++DOMWINDOW == 45 (0x7f118288dc00) [pid = 1950] [serial = 726] [outer = (nil)]
11:31:40 INFO - ++DOMWINDOW == 46 (0x7f11835a0800) [pid = 1950] [serial = 727] [outer = 0x7f118288dc00]
11:31:41 INFO - ++DOMWINDOW == 47 (0x7f1181eea800) [pid = 1950] [serial = 728] [outer = 0x7f118288dc00]
11:31:41 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:31:41 INFO - ++DOCSHELL 0x7f118aa32000 == 20 [pid = 1950] [id = 312]
11:31:41 INFO - ++DOMWINDOW == 48 (0x7f1185aa4000) [pid = 1950] [serial = 729] [outer = (nil)]
11:31:41 INFO - ++DOMWINDOW == 49 (0x7f1185aa7c00) [pid = 1950] [serial = 730] [outer = 0x7f1185aa4000]
11:31:44 INFO - MEMORY STAT | vsize 1271MB | residentFast 342MB | heapAllocated 137MB
11:31:44 INFO - 106 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js | took 6014ms
11:31:44 INFO - ++DOCSHELL 0x7f1176f29000 == 21 [pid = 1950] [id = 313]
11:31:44 INFO - ++DOMWINDOW == 50 (0x7f1181493000) [pid = 1950] [serial = 731] [outer = (nil)]
11:31:44 INFO - ++DOMWINDOW == 51 (0x7f118288fc00) [pid = 1950] [serial = 732] [outer = 0x7f1181493000]
11:31:44 INFO - 107 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_assert.js
11:31:44 INFO - ++DOCSHELL 0x7f118de43800 == 22 [pid = 1950] [id = 314]
11:31:44 INFO - ++DOMWINDOW == 52 (0x7f118758fc00) [pid = 1950] [serial = 733] [outer = (nil)]
11:31:44 INFO - ++DOMWINDOW == 53 (0x7f11881f9800) [pid = 1950] [serial = 734] [outer = 0x7f118758fc00]
11:31:45 INFO - ++DOMWINDOW == 54 (0x7f118ab86c00) [pid = 1950] [serial = 735] [outer = 0x7f118758fc00]
11:31:45 INFO - ++DOCSHELL 0x7f1190978000 == 23 [pid = 1950] [id = 315]
11:31:45 INFO - ++DOMWINDOW == 55 (0x7f118a93ec00) [pid = 1950] [serial = 736] [outer = (nil)]
11:31:45 INFO - ++DOMWINDOW == 56 (0x7f118a940000) [pid = 1950] [serial = 737] [outer = 0x7f118a93ec00]
11:31:45 INFO - ++DOMWINDOW == 57 (0x7f1176ee2c00) [pid = 1950] [serial = 738] [outer = 0x7f118a93ec00]
11:31:46 INFO - ++DOCSHELL 0x7f1191638800 == 24 [pid = 1950] [id = 316]
11:31:46 INFO - ++DOMWINDOW == 58 (0x7f118a9ba400) [pid = 1950] [serial = 739] [outer = (nil)]
11:31:46 INFO - ++DOMWINDOW == 59 (0x7f118ce9a800) [pid = 1950] [serial = 740] [outer = 0x7f118a9ba400]
11:31:48 INFO - --DOCSHELL 0x7f1176f1d800 == 23 [pid = 1950] [id = 298]
11:31:48 INFO - --DOCSHELL 0x7f11773ba800 == 22 [pid = 1950] [id = 305]
11:31:48 INFO - --DOCSHELL 0x7f1180e43800 == 21 [pid = 1950] [id = 302]
11:31:48 INFO - --DOCSHELL 0x7f1180e3e800 == 20 [pid = 1950] [id = 306]
11:31:48 INFO - --DOCSHELL 0x7f1176f2a800 == 19 [pid = 1950] [id = 301]
11:31:48 INFO - --DOCSHELL 0x7f11773b3800 == 18 [pid = 1950] [id = 307]
11:31:48 INFO - --DOCSHELL 0x7f118aa32000 == 17 [pid = 1950] [id = 312]
11:31:48 INFO - --DOCSHELL 0x7f118115a800 == 16 [pid = 1950] [id = 303]
11:31:49 INFO - --DOCSHELL 0x7f1191638800 == 15 [pid = 1950] [id = 316]
11:31:49 INFO - MEMORY STAT | vsize 1271MB | residentFast 345MB | heapAllocated 136MB
11:31:49 INFO - 108 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_assert.js | took 4746ms
11:31:49 INFO - ++DOCSHELL 0x7f11773ba000 == 16 [pid = 1950] [id = 317]
11:31:49 INFO - ++DOMWINDOW == 60 (0x7f11776ef800) [pid = 1950] [serial = 741] [outer = (nil)]
11:31:49 INFO - ++DOMWINDOW == 61 (0x7f1181146400) [pid = 1950] [serial = 742] [outer = 0x7f11776ef800]
11:31:50 INFO - 109 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js
11:31:50 INFO - ++DOCSHELL 0x7f1180e50800 == 17 [pid = 1950] [id = 318]
11:31:50 INFO - ++DOMWINDOW == 62 (0x7f1181494000) [pid = 1950] [serial = 743] [outer = (nil)]
11:31:50 INFO - ++DOMWINDOW == 63 (0x7f1181eddc00) [pid = 1950] [serial = 744] [outer = 0x7f1181494000]
11:31:50 INFO - ++DOCSHELL 0x7f118127d000 == 18 [pid = 1950] [id = 319]
11:31:50 INFO - ++DOMWINDOW == 64 (0x7f11776f1400) [pid = 1950] [serial = 745] [outer = (nil)]
11:31:50 INFO - ++DOMWINDOW == 65 (0x7f118274f400) [pid = 1950] [serial = 746] [outer = 0x7f11776f1400]
11:31:50 INFO - ++DOMWINDOW == 66 (0x7f1176db5c00) [pid = 1950] [serial = 747] [outer = 0x7f11776f1400]
11:31:50 INFO - ++DOCSHELL 0x7f118a98a800 == 19 [pid = 1950] [id = 320]
11:31:50 INFO - ++DOMWINDOW == 67 (0x7f11881f7c00) [pid = 1950] [serial = 748] [outer = (nil)]
11:31:50 INFO - ++DOMWINDOW == 68 (0x7f118a90d000) [pid = 1950] [serial = 749] [outer = 0x7f11881f7c00]
11:31:54 INFO - --DOCSHELL 0x7f1187d86000 == 18 [pid = 1950] [id = 310]
11:31:54 INFO - --DOCSHELL 0x7f1190978000 == 17 [pid = 1950] [id = 315]
11:31:54 INFO - --DOCSHELL 0x7f11773af000 == 16 [pid = 1950] [id = 308]
11:31:54 INFO - --DOCSHELL 0x7f118de43800 == 15 [pid = 1950] [id = 314]
11:31:54 INFO - --DOCSHELL 0x7f118115d800 == 14 [pid = 1950] [id = 309]
11:31:54 INFO - --DOCSHELL 0x7f1176f29000 == 13 [pid = 1950] [id = 313]
11:31:54 INFO - --DOCSHELL 0x7f118a152800 == 12 [pid = 1950] [id = 311]
11:31:56 INFO - --DOCSHELL 0x7f118a98a800 == 11 [pid = 1950] [id = 320]
11:31:56 INFO - MEMORY STAT | vsize 1259MB | residentFast 331MB | heapAllocated 138MB
11:31:56 INFO - 110 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js | took 6893ms
11:31:56 INFO - ++DOCSHELL 0x7f1176f22800 == 12 [pid = 1950] [id = 321]
11:31:56 INFO - ++DOMWINDOW == 69 (0x7f1177393400) [pid = 1950] [serial = 750] [outer = (nil)]
11:31:56 INFO - ++DOMWINDOW == 70 (0x7f11776ea000) [pid = 1950] [serial = 751] [outer = 0x7f1177393400]
11:31:57 INFO - 111 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js
11:31:57 INFO - ++DOCSHELL 0x7f118126b800 == 13 [pid = 1950] [id = 322]
11:31:57 INFO - ++DOMWINDOW == 71 (0x7f11776f4c00) [pid = 1950] [serial = 752] [outer = (nil)]
11:31:57 INFO - ++DOMWINDOW == 72 (0x7f1181140000) [pid = 1950] [serial = 753] [outer = 0x7f11776f4c00]
11:31:57 INFO - --DOMWINDOW == 71 (0x7f11812da800) [pid = 1950] [serial = 701] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html]
11:31:57 INFO - --DOMWINDOW == 70 (0x7f118114a000) [pid = 1950] [serial = 699] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 69 (0x7f1181493000) [pid = 1950] [serial = 731] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 68 (0x7f1176dcb400) [pid = 1950] [serial = 724] [outer = (nil)] [url = http://example.com/]
11:31:57 INFO - --DOMWINDOW == 67 (0x7f11776ec800) [pid = 1950] [serial = 721] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html]
11:31:57 INFO - --DOMWINDOW == 66 (0x7f11776f1800) [pid = 1950] [serial = 717] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 65 (0x7f1176dbb000) [pid = 1950] [serial = 719] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 64 (0x7f118758fc00) [pid = 1950] [serial = 733] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html]
11:31:57 INFO - --DOMWINDOW == 63 (0x7f11812d1000) [pid = 1950] [serial = 700] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 62 (0x7f1183671c00) [pid = 1950] [serial = 707] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:57 INFO - --DOMWINDOW == 61 (0x7f1181490400) [pid = 1950] [serial = 704] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:57 INFO - --DOMWINDOW == 60 (0x7f118288dc00) [pid = 1950] [serial = 726] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:57 INFO - --DOMWINDOW == 59 (0x7f11776ec000) [pid = 1950] [serial = 714] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:57 INFO - --DOMWINDOW == 58 (0x7f1185aa4000) [pid = 1950] [serial = 729] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:57 INFO - --DOMWINDOW == 57 (0x7f1181fe1400) [pid = 1950] [serial = 697] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:57 INFO - --DOMWINDOW == 56 (0x7f1176dc5400) [pid = 1950] [serial = 694] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:57 INFO - --DOMWINDOW == 55 (0x7f1176db5000) [pid = 1950] [serial = 711] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:57 INFO - --DOMWINDOW == 54 (0x7f118a93ec00) [pid = 1950] [serial = 736] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:31:57 INFO - --DOMWINDOW == 53 (0x7f11881f9800) [pid = 1950] [serial = 734] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 52 (0x7f118288fc00) [pid = 1950] [serial = 732] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 51 (0x7f1181f50400) [pid = 1950] [serial = 725] [outer = (nil)] [url = http://example.com/]
11:31:57 INFO - --DOMWINDOW == 50 (0x7f11812cdc00) [pid = 1950] [serial = 722] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 49 (0x7f1181490000) [pid = 1950] [serial = 718] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 48 (0x7f1176dcbc00) [pid = 1950] [serial = 720] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 47 (0x7f11835a0800) [pid = 1950] [serial = 727] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 46 (0x7f118a9ba400) [pid = 1950] [serial = 739] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:31:57 INFO - --DOMWINDOW == 45 (0x7f118a940000) [pid = 1950] [serial = 737] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 44 (0x7f1176dc2800) [pid = 1950] [serial = 712] [outer = (nil)] [url = about:blank]
11:31:57 INFO - --DOMWINDOW == 43 (0x7f1183ca8c00) [pid = 1950] [serial = 709] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js]
11:31:57 INFO - --DOMWINDOW == 42 (0x7f1176db3400) [pid = 1950] [serial = 710] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html]
11:31:57 INFO - --DOMWINDOW == 41 (0x7f118274d400) [pid = 1950] [serial = 716] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html]
11:31:57 INFO - --DOMWINDOW == 40 (0x7f1181f51000) [pid = 1950] [serial = 723] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html]
11:31:57 INFO - ++DOCSHELL 0x7f11773ae800 == 14 [pid = 1950] [id = 323]
11:31:57 INFO - ++DOMWINDOW == 41 (0x7f1181141c00) [pid = 1950] [serial = 754] [outer = (nil)]
11:31:57 INFO - ++DOMWINDOW == 42 (0x7f11812cec00) [pid = 1950] [serial = 755] [outer = 0x7f1181141c00]
11:31:58 INFO - ++DOMWINDOW == 43 (0x7f1177398400) [pid = 1950] [serial = 756] [outer = 0x7f1181141c00]
11:31:58 INFO - ++DOCSHELL 0x7f118279b800 == 15 [pid = 1950] [id = 324]
11:31:58 INFO - ++DOMWINDOW == 44 (0x7f1181d1c800) [pid = 1950] [serial = 757] [outer = (nil)]
11:31:58 INFO - ++DOMWINDOW == 45 (0x7f1181edf400) [pid = 1950] [serial = 758] [outer = 0x7f1181d1c800]
11:32:00 INFO - [1950] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175
11:32:01 INFO - --DOCSHELL 0x7f1180e50800 == 14 [pid = 1950] [id = 318]
11:32:01 INFO - --DOCSHELL 0x7f118127d000 == 13 [pid = 1950] [id = 319]
11:32:01 INFO - --DOCSHELL 0x7f11773ba000 == 12 [pid = 1950] [id = 317]
11:32:01 INFO - --DOMWINDOW == 44 (0x7f118ab86c00) [pid = 1950] [serial = 735] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html]
11:32:01 INFO - --DOMWINDOW == 43 (0x7f1176dc5c00) [pid = 1950] [serial = 713] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:01 INFO - --DOMWINDOW == 42 (0x7f1176ee2c00) [pid = 1950] [serial = 738] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:01 INFO - --DOMWINDOW == 41 (0x7f11776f2400) [pid = 1950] [serial = 715] [outer = (nil)] [url = about:blank]
11:32:01 INFO - --DOMWINDOW == 40 (0x7f1185aa7c00) [pid = 1950] [serial = 730] [outer = (nil)] [url = about:blank]
11:32:01 INFO - --DOMWINDOW == 39 (0x7f1182883400) [pid = 1950] [serial = 698] [outer = (nil)] [url = about:blank]
11:32:01 INFO - --DOMWINDOW == 38 (0x7f118ce9a800) [pid = 1950] [serial = 740] [outer = (nil)] [url = about:blank]
11:32:01 INFO - --DOMWINDOW == 37 (0x7f1176dbb400) [pid = 1950] [serial = 696] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:01 INFO - --DOMWINDOW == 36 (0x7f1181ee1400) [pid = 1950] [serial = 706] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:01 INFO - --DOMWINDOW == 35 (0x7f1181eea800) [pid = 1950] [serial = 728] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:01 INFO - --DOMWINDOW == 34 (0x7f11838de400) [pid = 1950] [serial = 708] [outer = (nil)] [url = about:blank]
11:32:01 INFO - --DOCSHELL 0x7f118279b800 == 11 [pid = 1950] [id = 324]
11:32:02 INFO - MEMORY STAT | vsize 1261MB | residentFast 329MB | heapAllocated 127MB
11:32:02 INFO - 112 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js | took 5135ms
11:32:02 INFO - ++DOCSHELL 0x7f1176f19000 == 12 [pid = 1950] [id = 325]
11:32:02 INFO - ++DOMWINDOW == 35 (0x7f1176dc9400) [pid = 1950] [serial = 759] [outer = (nil)]
11:32:02 INFO - ++DOMWINDOW == 36 (0x7f1176dd0c00) [pid = 1950] [serial = 760] [outer = 0x7f1176dc9400]
11:32:02 INFO - 113 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js
11:32:02 INFO - ++DOCSHELL 0x7f117a613800 == 13 [pid = 1950] [id = 326]
11:32:02 INFO - ++DOMWINDOW == 37 (0x7f1176edf800) [pid = 1950] [serial = 761] [outer = (nil)]
11:32:02 INFO - ++DOMWINDOW == 38 (0x7f1176ee2c00) [pid = 1950] [serial = 762] [outer = 0x7f1176edf800]
11:32:03 INFO - ++DOMWINDOW == 39 (0x7f117738e400) [pid = 1950] [serial = 763] [outer = 0x7f1176edf800]
11:32:03 INFO - ++DOCSHELL 0x7f1176f12000 == 14 [pid = 1950] [id = 327]
11:32:03 INFO - ++DOMWINDOW == 40 (0x7f1176dcb400) [pid = 1950] [serial = 764] [outer = (nil)]
11:32:03 INFO - ++DOMWINDOW == 41 (0x7f11776f0400) [pid = 1950] [serial = 765] [outer = 0x7f1176dcb400]
11:32:03 INFO - ++DOCSHELL 0x7f1176f2c800 == 15 [pid = 1950] [id = 328]
11:32:03 INFO - ++DOMWINDOW == 42 (0x7f1176ee3800) [pid = 1950] [serial = 766] [outer = (nil)]
11:32:03 INFO - ++DOMWINDOW == 43 (0x7f1181142000) [pid = 1950] [serial = 767] [outer = 0x7f1176ee3800]
11:32:03 INFO - ++DOMWINDOW == 44 (0x7f1177392800) [pid = 1950] [serial = 768] [outer = 0x7f1176ee3800]
11:32:04 INFO - ++DOCSHELL 0x7f118126b000 == 16 [pid = 1950] [id = 329]
11:32:04 INFO - ++DOMWINDOW == 45 (0x7f11812d8c00) [pid = 1950] [serial = 769] [outer = (nil)]
11:32:04 INFO - ++DOMWINDOW == 46 (0x7f118148b400) [pid = 1950] [serial = 770] [outer = 0x7f11812d8c00]
11:32:05 INFO - --DOMWINDOW == 45 (0x7f1181494000) [pid = 1950] [serial = 743] [outer = (nil)] [url = data:text/html;charset=utf8,test%20autocompletion%20with%20$%20or%20_]
11:32:05 INFO - --DOMWINDOW == 44 (0x7f11776ef800) [pid = 1950] [serial = 741] [outer = (nil)] [url = about:blank]
11:32:05 INFO - --DOMWINDOW == 43 (0x7f1181eddc00) [pid = 1950] [serial = 744] [outer = (nil)] [url = about:blank]
11:32:05 INFO - --DOMWINDOW == 42 (0x7f1181146400) [pid = 1950] [serial = 742] [outer = (nil)] [url = about:blank]
11:32:05 INFO - --DOMWINDOW == 41 (0x7f11812cec00) [pid = 1950] [serial = 755] [outer = (nil)] [url = about:blank]
11:32:05 INFO - --DOMWINDOW == 40 (0x7f118274f400) [pid = 1950] [serial = 746] [outer = (nil)] [url = about:blank]
11:32:05 INFO - --DOMWINDOW == 39 (0x7f11776f1400) [pid = 1950] [serial = 745] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:05 INFO - --DOMWINDOW == 38 (0x7f11881f7c00) [pid = 1950] [serial = 748] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:06 INFO - getProperty threw an exception: Error: Permission denied to access property "document"
11:32:06 INFO - Stack: getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:167:20
11:32:06 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:270:13
11:32:06 INFO - exports.makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/ThreadSafeDevToolsUtils.js:101:14
11:32:06 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:948:18
11:32:06 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1643:15
11:32:06 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11
11:32:06 INFO - exports.makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/ThreadSafeDevToolsUtils.js:101:14
11:32:06 INFO - DevToolsUtils.executeSoon*executeSoon@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:34:11
11:32:06 INFO - LocalDebuggerTransport.prototype.send@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:562:7
11:32:06 INFO - _sendRequest@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:873:7
11:32:06 INFO - _sendOrQueueRequest@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:857:7
11:32:06 INFO - DebuggerClient.prototype.request@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:727:5
11:32:06 INFO - WCC_autocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/client.js:341:5
11:32:06 INFO - JSTerm.prototype._updateCompletionResult@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:4256:5
11:32:06 INFO - JSTerm.prototype.complete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:4162:7
11:32:06 INFO - JSTerm.prototype._inputEventHandler@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:3765:7
11:32:06 INFO - synthesizeKey@chrome://mochikit/content/tests/SimpleTest/EventUtils.js:730:7
11:32:06 INFO - test/<@chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js:35:7
11:32:06 INFO - testScope/test_executeSoon/<.run@chrome://mochikit/content/browser-test.js:1005:9
11:32:06 INFO - Line: 0, column: 0
11:32:06 INFO - console.error:
11:32:06 INFO - getProperty threw an exception: Error: Permission denied to access property "document"
11:32:06 INFO - Stack: getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:167:20
11:32:06 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:270:13
11:32:06 INFO - exports.makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/ThreadSafeDevToolsUtils.js:101:14
11:32:06 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:948:18
11:32:06 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1643:15
11:32:06 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11
11:32:06 INFO - exports.makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/ThreadSafeDevToolsUtils.js:101:14
11:32:06 INFO - DevToolsUtils.executeSoon*executeSoon@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:34:11
11:32:06 INFO - LocalDebuggerTransport.prototype.send@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:562:7
11:32:06 INFO - _sendRequest@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:873:7
11:32:06 INFO - _sendOrQueueRequest@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:857:7
11:32:06 INFO - DebuggerClient.prototype.request@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:727:5
11:32:06 INFO - WCC_autocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/client.js:341:5
11:32:06 INFO - JSTerm.prototype._updateCompletionResult@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:4256:5
11:32:06 INFO - JSTerm.prototype.complete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:4162:7
11:32:06 INFO - JSTerm.prototype._inputEventHandler@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/webconsole/webconsole.js:3765:7
11:32:06 INFO - synthesizeKey@chrome://mochikit/content/tests/SimpleTest/EventUtils.js:730:7
11:32:06 INFO - test/<@chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js:35:7
11:32:06 INFO - testScope/test_executeSoon/<.run@chrome://mochikit/content/browser-test.js:1005:9
11:32:06 INFO - Line: 0, column: 0
11:32:07 INFO - --DOCSHELL 0x7f11773ae800 == 15 [pid = 1950] [id = 323]
11:32:07 INFO - --DOCSHELL 0x7f118126b000 == 14 [pid = 1950] [id = 329]
11:32:07 INFO - --DOCSHELL 0x7f1176f22800 == 13 [pid = 1950] [id = 321]
11:32:07 INFO - --DOMWINDOW == 37 (0x7f1176db5c00) [pid = 1950] [serial = 747] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:07 INFO - --DOMWINDOW == 36 (0x7f118a90d000) [pid = 1950] [serial = 749] [outer = (nil)] [url = about:blank]
11:32:07 INFO - --DOMWINDOW == 35 (0x7f1176ee2c00) [pid = 1950] [serial = 762] [outer = (nil)] [url = about:blank]
11:32:07 INFO - --DOMWINDOW == 34 (0x7f1181140000) [pid = 1950] [serial = 753] [outer = (nil)] [url = about:blank]
11:32:07 INFO - --DOMWINDOW == 33 (0x7f11776ea000) [pid = 1950] [serial = 751] [outer = (nil)] [url = about:blank]
11:32:07 INFO - --DOMWINDOW == 32 (0x7f1181142000) [pid = 1950] [serial = 767] [outer = (nil)] [url = about:blank]
11:32:07 INFO - --DOMWINDOW == 31 (0x7f1181d1c800) [pid = 1950] [serial = 757] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:07 INFO - --DOMWINDOW == 30 (0x7f1181141c00) [pid = 1950] [serial = 754] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:07 INFO - --DOMWINDOW == 29 (0x7f11776f4c00) [pid = 1950] [serial = 752] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20bug%20642615]
11:32:07 INFO - --DOMWINDOW == 28 (0x7f1177393400) [pid = 1950] [serial = 750] [outer = (nil)] [url = about:blank]
11:32:08 INFO - MEMORY STAT | vsize 1264MB | residentFast 329MB | heapAllocated 128MB
11:32:08 INFO - 114 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js | took 5429ms
11:32:08 INFO - ++DOCSHELL 0x7f1176f15800 == 14 [pid = 1950] [id = 330]
11:32:08 INFO - ++DOMWINDOW == 29 (0x7f1176edc000) [pid = 1950] [serial = 771] [outer = (nil)]
11:32:08 INFO - ++DOMWINDOW == 30 (0x7f1176ee0400) [pid = 1950] [serial = 772] [outer = 0x7f1176edc000]
11:32:08 INFO - 115 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js
11:32:08 INFO - ++DOCSHELL 0x7f1181156800 == 15 [pid = 1950] [id = 331]
11:32:08 INFO - ++DOMWINDOW == 31 (0x7f11776f6000) [pid = 1950] [serial = 773] [outer = (nil)]
11:32:08 INFO - ++DOMWINDOW == 32 (0x7f1181142c00) [pid = 1950] [serial = 774] [outer = 0x7f11776f6000]
11:32:08 INFO - ++DOMWINDOW == 33 (0x7f11812cd800) [pid = 1950] [serial = 775] [outer = 0x7f11776f6000]
11:32:09 INFO - ++DOCSHELL 0x7f11773b7000 == 16 [pid = 1950] [id = 332]
11:32:09 INFO - ++DOMWINDOW == 34 (0x7f1181146000) [pid = 1950] [serial = 776] [outer = (nil)]
11:32:09 INFO - ++DOMWINDOW == 35 (0x7f118148f800) [pid = 1950] [serial = 777] [outer = 0x7f1181146000]
11:32:09 INFO - ++DOMWINDOW == 36 (0x7f11812cf800) [pid = 1950] [serial = 778] [outer = 0x7f1181146000]
11:32:09 INFO - ++DOCSHELL 0x7f1188169000 == 17 [pid = 1950] [id = 333]
11:32:09 INFO - ++DOMWINDOW == 37 (0x7f118260ec00) [pid = 1950] [serial = 779] [outer = (nil)]
11:32:09 INFO - ++DOMWINDOW == 38 (0x7f1182847c00) [pid = 1950] [serial = 780] [outer = 0x7f118260ec00]
11:32:12 INFO - ++DOCSHELL 0x7f1176f0d000 == 18 [pid = 1950] [id = 334]
11:32:12 INFO - ++DOMWINDOW == 39 (0x7f1176daf000) [pid = 1950] [serial = 781] [outer = (nil)]
11:32:12 INFO - ++DOMWINDOW == 40 (0x7f1176db2800) [pid = 1950] [serial = 782] [outer = 0x7f1176daf000]
11:32:12 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:32:13 INFO - ++DOCSHELL 0x7f1190491800 == 19 [pid = 1950] [id = 335]
11:32:13 INFO - ++DOMWINDOW == 41 (0x7f118a92dc00) [pid = 1950] [serial = 783] [outer = (nil)]
11:32:13 INFO - ++DOMWINDOW == 42 (0x7f1181ee8000) [pid = 1950] [serial = 784] [outer = 0x7f118a92dc00]
11:32:15 INFO - --DOCSHELL 0x7f1176f12000 == 18 [pid = 1950] [id = 327]
11:32:15 INFO - --DOCSHELL 0x7f1176f19000 == 17 [pid = 1950] [id = 325]
11:32:15 INFO - --DOCSHELL 0x7f1176f2c800 == 16 [pid = 1950] [id = 328]
11:32:16 INFO - --DOCSHELL 0x7f118126b800 == 15 [pid = 1950] [id = 322]
11:32:16 INFO - --DOCSHELL 0x7f117a613800 == 14 [pid = 1950] [id = 326]
11:32:16 INFO - --DOMWINDOW == 41 (0x7f1181edf400) [pid = 1950] [serial = 758] [outer = (nil)] [url = about:blank]
11:32:16 INFO - --DOMWINDOW == 40 (0x7f1177398400) [pid = 1950] [serial = 756] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:19 INFO - --DOCSHELL 0x7f1190491800 == 13 [pid = 1950] [id = 335]
11:32:19 INFO - --DOCSHELL 0x7f1176f0d000 == 12 [pid = 1950] [id = 334]
11:32:19 INFO - --DOCSHELL 0x7f1188169000 == 11 [pid = 1950] [id = 333]
11:32:21 INFO - --DOMWINDOW == 39 (0x7f118148b400) [pid = 1950] [serial = 770] [outer = (nil)] [url = about:blank]
11:32:21 INFO - --DOMWINDOW == 38 (0x7f1177392800) [pid = 1950] [serial = 768] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:21 INFO - --DOMWINDOW == 37 (0x7f1176dd0c00) [pid = 1950] [serial = 760] [outer = (nil)] [url = about:blank]
11:32:21 INFO - --DOMWINDOW == 36 (0x7f1181142c00) [pid = 1950] [serial = 774] [outer = (nil)] [url = about:blank]
11:32:21 INFO - --DOMWINDOW == 35 (0x7f11812d8c00) [pid = 1950] [serial = 769] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:21 INFO - --DOMWINDOW == 34 (0x7f1176ee3800) [pid = 1950] [serial = 766] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:21 INFO - --DOMWINDOW == 33 (0x7f1176dc9400) [pid = 1950] [serial = 759] [outer = (nil)] [url = about:blank]
11:32:21 INFO - --DOMWINDOW == 32 (0x7f1176edf800) [pid = 1950] [serial = 761] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html]
11:32:21 INFO - --DOMWINDOW == 31 (0x7f1176dcb400) [pid = 1950] [serial = 764] [outer = (nil)] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html]
11:32:21 INFO - --DOMWINDOW == 30 (0x7f117738e400) [pid = 1950] [serial = 763] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html]
11:32:21 INFO - --DOMWINDOW == 29 (0x7f11776f0400) [pid = 1950] [serial = 765] [outer = (nil)] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html]
11:32:21 INFO - --DOMWINDOW == 28 (0x7f118260ec00) [pid = 1950] [serial = 779] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:21 INFO - --DOMWINDOW == 27 (0x7f118148f800) [pid = 1950] [serial = 777] [outer = (nil)] [url = about:blank]
11:32:21 INFO - --DOMWINDOW == 26 (0x7f118a92dc00) [pid = 1950] [serial = 783] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:32:21 INFO - MEMORY STAT | vsize 1261MB | residentFast 328MB | heapAllocated 130MB
11:32:21 INFO - 116 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js | took 13206ms
11:32:21 INFO - ++DOCSHELL 0x7f1176f19000 == 12 [pid = 1950] [id = 336]
11:32:21 INFO - ++DOMWINDOW == 27 (0x7f1176dba000) [pid = 1950] [serial = 785] [outer = (nil)]
11:32:21 INFO - ++DOMWINDOW == 28 (0x7f1176dc7800) [pid = 1950] [serial = 786] [outer = 0x7f1176dba000]
11:32:22 INFO - 117 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js
11:32:22 INFO - ++DOCSHELL 0x7f117a610000 == 13 [pid = 1950] [id = 337]
11:32:22 INFO - ++DOMWINDOW == 29 (0x7f1177395000) [pid = 1950] [serial = 787] [outer = (nil)]
11:32:22 INFO - ++DOMWINDOW == 30 (0x7f11776ee800) [pid = 1950] [serial = 788] [outer = 0x7f1177395000]
11:32:22 INFO - ++DOCSHELL 0x7f1176f20800 == 14 [pid = 1950] [id = 338]
11:32:22 INFO - ++DOMWINDOW == 31 (0x7f11812d8c00) [pid = 1950] [serial = 789] [outer = (nil)]
11:32:22 INFO - ++DOMWINDOW == 32 (0x7f118148bc00) [pid = 1950] [serial = 790] [outer = 0x7f11812d8c00]
11:32:22 INFO - ++DOMWINDOW == 33 (0x7f11812ce800) [pid = 1950] [serial = 791] [outer = 0x7f11812d8c00]
11:32:22 INFO - ++DOCSHELL 0x7f11824a5000 == 15 [pid = 1950] [id = 339]
11:32:22 INFO - ++DOMWINDOW == 34 (0x7f118242f400) [pid = 1950] [serial = 792] [outer = (nil)]
11:32:22 INFO - ++DOMWINDOW == 35 (0x7f1182610000) [pid = 1950] [serial = 793] [outer = 0x7f118242f400]
11:32:25 INFO - ++DOCSHELL 0x7f1182499800 == 16 [pid = 1950] [id = 340]
11:32:25 INFO - ++DOMWINDOW == 36 (0x7f1181eeb400) [pid = 1950] [serial = 794] [outer = (nil)]
11:32:25 INFO - ++DOMWINDOW == 37 (0x7f118260fc00) [pid = 1950] [serial = 795] [outer = 0x7f1181eeb400]
11:32:26 INFO - MEMORY STAT | vsize 1264MB | residentFast 337MB | heapAllocated 137MB
11:32:26 INFO - 118 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js | took 4537ms
11:32:26 INFO - ++DOCSHELL 0x7f1176f21800 == 17 [pid = 1950] [id = 341]
11:32:26 INFO - ++DOMWINDOW == 38 (0x7f1181496c00) [pid = 1950] [serial = 796] [outer = (nil)]
11:32:26 INFO - ++DOMWINDOW == 39 (0x7f1185aa1800) [pid = 1950] [serial = 797] [outer = 0x7f1181496c00]
11:32:26 INFO - 119 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js
11:32:28 INFO - --DOCSHELL 0x7f11773b7000 == 16 [pid = 1950] [id = 332]
11:32:28 INFO - --DOCSHELL 0x7f1176f20800 == 15 [pid = 1950] [id = 338]
11:32:28 INFO - --DOCSHELL 0x7f11824a5000 == 14 [pid = 1950] [id = 339]
11:32:28 INFO - --DOCSHELL 0x7f1181156800 == 13 [pid = 1950] [id = 331]
11:32:28 INFO - --DOCSHELL 0x7f1176f15800 == 12 [pid = 1950] [id = 330]
11:32:28 INFO - --DOMWINDOW == 38 (0x7f1182847c00) [pid = 1950] [serial = 780] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 37 (0x7f1181ee8000) [pid = 1950] [serial = 784] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:32:28 INFO - --DOMWINDOW == 36 (0x7f118260fc00) [pid = 1950] [serial = 795] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 35 (0x7f1181eeb400) [pid = 1950] [serial = 794] [outer = (nil)] [url = data:text/html;charset=utf-8,testing%20autocomplete%20closes]
11:32:28 INFO - --DOMWINDOW == 34 (0x7f118242f400) [pid = 1950] [serial = 792] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:28 INFO - --DOMWINDOW == 33 (0x7f118148bc00) [pid = 1950] [serial = 790] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 32 (0x7f1176edc000) [pid = 1950] [serial = 771] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 31 (0x7f1176ee0400) [pid = 1950] [serial = 772] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 30 (0x7f1176dba000) [pid = 1950] [serial = 785] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 29 (0x7f1177395000) [pid = 1950] [serial = 787] [outer = (nil)] [url = data:text/html;charset=utf-8,
bug%20900448%20-%20autocomplete%20popup%20closes%20on%20tab%20switch]
11:32:28 INFO - --DOMWINDOW == 28 (0x7f1176dc7800) [pid = 1950] [serial = 786] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 27 (0x7f11776ee800) [pid = 1950] [serial = 788] [outer = (nil)] [url = about:blank]
11:32:28 INFO - --DOMWINDOW == 26 (0x7f1176daf000) [pid = 1950] [serial = 781] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:32:28 INFO - --DOMWINDOW == 25 (0x7f1181146000) [pid = 1950] [serial = 776] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:28 INFO - --DOMWINDOW == 24 (0x7f11776f6000) [pid = 1950] [serial = 773] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html]
11:32:28 INFO - ++DOCSHELL 0x7f1176f15800 == 13 [pid = 1950] [id = 342]
11:32:28 INFO - ++DOMWINDOW == 25 (0x7f1176cc3800) [pid = 1950] [serial = 798] [outer = (nil)]
11:32:28 INFO - ++DOMWINDOW == 26 (0x7f1176db0000) [pid = 1950] [serial = 799] [outer = 0x7f1176cc3800]
11:32:28 INFO - --DOMWINDOW == 25 (0x7f11812cd800) [pid = 1950] [serial = 775] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html]
11:32:28 INFO - ++DOMWINDOW == 26 (0x7f1176dc8800) [pid = 1950] [serial = 800] [outer = 0x7f1176cc3800]
11:32:29 INFO - ++DOCSHELL 0x7f117a60e800 == 14 [pid = 1950] [id = 343]
11:32:29 INFO - ++DOMWINDOW == 27 (0x7f117738dc00) [pid = 1950] [serial = 801] [outer = (nil)]
11:32:29 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 437
11:32:29 INFO - ++DOMWINDOW == 28 (0x7f1177396c00) [pid = 1950] [serial = 802] [outer = 0x7f117738dc00]
11:32:29 INFO - ++DOCSHELL 0x7f117a612000 == 15 [pid = 1950] [id = 344]
11:32:29 INFO - ++DOMWINDOW == 29 (0x7f1176db1800) [pid = 1950] [serial = 803] [outer = (nil)]
11:32:29 INFO - ++DOMWINDOW == 30 (0x7f11776e9800) [pid = 1950] [serial = 804] [outer = 0x7f1176db1800]
11:32:29 INFO - ++DOMWINDOW == 31 (0x7f1176edc000) [pid = 1950] [serial = 805] [outer = 0x7f1176db1800]
11:32:29 INFO - ++DOCSHELL 0x7f1182788800 == 16 [pid = 1950] [id = 345]
11:32:29 INFO - ++DOMWINDOW == 32 (0x7f1181ee1800) [pid = 1950] [serial = 806] [outer = (nil)]
11:32:29 INFO - ++DOMWINDOW == 33 (0x7f1181ee6000) [pid = 1950] [serial = 807] [outer = 0x7f1181ee1800]
11:32:31 INFO - ++DOMWINDOW == 34 (0x7f118a93b000) [pid = 1950] [serial = 808] [outer = 0x7f1176cc3800]
11:32:31 INFO - [1950] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4692
11:32:31 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:32:32 INFO - ++DOCSHELL 0x7f11773ac000 == 17 [pid = 1950] [id = 346]
11:32:32 INFO - ++DOMWINDOW == 35 (0x7f1176dba400) [pid = 1950] [serial = 809] [outer = (nil)]
11:32:32 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:32:32 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:32:32 INFO - ++DOMWINDOW == 36 (0x7f1176dbb800) [pid = 1950] [serial = 810] [outer = 0x7f1176dba400]
11:32:32 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:32:32 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:32:33 INFO - ++DOMWINDOW == 37 (0x7f1177394800) [pid = 1950] [serial = 811] [outer = 0x7f1176dba400]
11:32:33 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:32:34 INFO - MEMORY STAT | vsize 1266MB | residentFast 334MB | heapAllocated 135MB
11:32:34 INFO - 120 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js | took 7590ms
11:32:34 INFO - ++DOCSHELL 0x7f1182827800 == 18 [pid = 1950] [id = 347]
11:32:34 INFO - ++DOMWINDOW == 38 (0x7f1181ee5400) [pid = 1950] [serial = 812] [outer = (nil)]
11:32:34 INFO - ++DOMWINDOW == 39 (0x7f11838bf800) [pid = 1950] [serial = 813] [outer = 0x7f1181ee5400]
11:32:34 INFO - 121 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js
11:32:34 INFO - ++DOCSHELL 0x7f118aa33000 == 19 [pid = 1950] [id = 348]
11:32:34 INFO - ++DOMWINDOW == 40 (0x7f1185866000) [pid = 1950] [serial = 814] [outer = (nil)]
11:32:34 INFO - ++DOMWINDOW == 41 (0x7f118586bc00) [pid = 1950] [serial = 815] [outer = 0x7f1185866000]
11:32:35 INFO - ++DOCSHELL 0x7f118d37e800 == 20 [pid = 1950] [id = 349]
11:32:35 INFO - ++DOMWINDOW == 42 (0x7f11858f3800) [pid = 1950] [serial = 816] [outer = (nil)]
11:32:35 INFO - ++DOMWINDOW == 43 (0x7f118758f000) [pid = 1950] [serial = 817] [outer = 0x7f11858f3800]
11:32:35 INFO - ++DOMWINDOW == 44 (0x7f1181ee8000) [pid = 1950] [serial = 818] [outer = 0x7f11858f3800]
11:32:36 INFO - ++DOCSHELL 0x7f118d5df800 == 21 [pid = 1950] [id = 350]
11:32:36 INFO - ++DOMWINDOW == 45 (0x7f118ab88000) [pid = 1950] [serial = 819] [outer = (nil)]
11:32:36 INFO - ++DOMWINDOW == 46 (0x7f118ce98c00) [pid = 1950] [serial = 820] [outer = 0x7f118ab88000]
11:32:38 INFO - --DOCSHELL 0x7f117a60e800 == 20 [pid = 1950] [id = 343]
11:32:38 INFO - --DOCSHELL 0x7f1176f19000 == 19 [pid = 1950] [id = 336]
11:32:38 INFO - --DOCSHELL 0x7f117a612000 == 18 [pid = 1950] [id = 344]
11:32:38 INFO - --DOCSHELL 0x7f1182788800 == 17 [pid = 1950] [id = 345]
11:32:38 INFO - --DOCSHELL 0x7f1182499800 == 16 [pid = 1950] [id = 340]
11:32:38 INFO - --DOCSHELL 0x7f117a610000 == 15 [pid = 1950] [id = 337]
11:32:38 INFO - --DOMWINDOW == 45 (0x7f1176db2800) [pid = 1950] [serial = 782] [outer = (nil)] [url = about:blank]
11:32:38 INFO - --DOMWINDOW == 44 (0x7f1182610000) [pid = 1950] [serial = 793] [outer = (nil)] [url = about:blank]
11:32:38 INFO - --DOMWINDOW == 43 (0x7f11812cf800) [pid = 1950] [serial = 778] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:39 INFO - --DOCSHELL 0x7f118d5df800 == 14 [pid = 1950] [id = 350]
11:32:39 INFO - --DOCSHELL 0x7f1176f21800 == 13 [pid = 1950] [id = 341]
11:32:39 INFO - --DOCSHELL 0x7f118d37e800 == 12 [pid = 1950] [id = 349]
11:32:40 INFO - --DOMWINDOW == 42 (0x7f1176dba400) [pid = 1950] [serial = 809] [outer = (nil)] [url = http://example.com/]
11:32:40 INFO - --DOMWINDOW == 41 (0x7f1176dbb800) [pid = 1950] [serial = 810] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 40 (0x7f1177394800) [pid = 1950] [serial = 811] [outer = (nil)] [url = http://example.com/]
11:32:40 INFO - --DOMWINDOW == 39 (0x7f1176db1800) [pid = 1950] [serial = 803] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:40 INFO - --DOMWINDOW == 38 (0x7f1181ee1800) [pid = 1950] [serial = 806] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:40 INFO - --DOMWINDOW == 37 (0x7f118758f000) [pid = 1950] [serial = 817] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 36 (0x7f1176cc3800) [pid = 1950] [serial = 798] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html]
11:32:40 INFO - --DOMWINDOW == 35 (0x7f1185aa1800) [pid = 1950] [serial = 797] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 34 (0x7f1177396c00) [pid = 1950] [serial = 802] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 33 (0x7f1176db0000) [pid = 1950] [serial = 799] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 32 (0x7f11776e9800) [pid = 1950] [serial = 804] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 31 (0x7f1181496c00) [pid = 1950] [serial = 796] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 30 (0x7f11812d8c00) [pid = 1950] [serial = 789] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:40 INFO - --DOMWINDOW == 29 (0x7f117738dc00) [pid = 1950] [serial = 801] [outer = (nil)] [url = about:blank]
11:32:40 INFO - --DOMWINDOW == 28 (0x7f118a93b000) [pid = 1950] [serial = 808] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html]
11:32:40 INFO - --DOMWINDOW == 27 (0x7f1176dc8800) [pid = 1950] [serial = 800] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html]
11:32:40 INFO - MEMORY STAT | vsize 1267MB | residentFast 331MB | heapAllocated 128MB
11:32:40 INFO - 122 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js | took 5750ms
11:32:40 INFO - ++DOCSHELL 0x7f1176f26800 == 13 [pid = 1950] [id = 351]
11:32:40 INFO - ++DOMWINDOW == 28 (0x7f1176dcec00) [pid = 1950] [serial = 821] [outer = (nil)]
11:32:40 INFO - ++DOMWINDOW == 29 (0x7f1177392400) [pid = 1950] [serial = 822] [outer = 0x7f1176dcec00]
11:32:40 INFO - 123 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js
11:32:40 INFO - ++DOCSHELL 0x7f117a614000 == 14 [pid = 1950] [id = 352]
11:32:40 INFO - ++DOMWINDOW == 30 (0x7f11776ef800) [pid = 1950] [serial = 823] [outer = (nil)]
11:32:40 INFO - ++DOMWINDOW == 31 (0x7f11776f5c00) [pid = 1950] [serial = 824] [outer = 0x7f11776ef800]
11:32:41 INFO - ++DOCSHELL 0x7f117a612800 == 15 [pid = 1950] [id = 353]
11:32:41 INFO - ++DOMWINDOW == 32 (0x7f11776f6c00) [pid = 1950] [serial = 825] [outer = (nil)]
11:32:41 INFO - ++DOMWINDOW == 33 (0x7f11812cbc00) [pid = 1950] [serial = 826] [outer = 0x7f11776f6c00]
11:32:41 INFO - ++DOMWINDOW == 34 (0x7f11812cb400) [pid = 1950] [serial = 827] [outer = 0x7f11776f6c00]
11:32:41 INFO - ++DOCSHELL 0x7f1181161800 == 16 [pid = 1950] [id = 354]
11:32:41 INFO - ++DOMWINDOW == 35 (0x7f1181497400) [pid = 1950] [serial = 828] [outer = (nil)]
11:32:41 INFO - ++DOMWINDOW == 36 (0x7f1181d0ec00) [pid = 1950] [serial = 829] [outer = 0x7f1181497400]
11:32:43 INFO - ++DOMWINDOW == 37 (0x7f11858f7400) [pid = 1950] [serial = 830] [outer = 0x7f11776ef800]
11:32:43 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:32:44 INFO - console.log: 11:32:43.184 GET http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html [HTTP/1.1 200 OK 61ms]
11:32:44 INFO - 11:32:43.528 GET http://some.example.com/test_bug_1010953_cspro.js [167ms]
11:32:44 INFO - 11:32:43.536 Content Security Policy: The page's settings observed the loading of a resource at http://some.example.com/test_bug_1010953_cspro.js ("script-src http://example.com"). A CSP report is being sent.1
11:32:44 INFO - 11:32:43.595 POST https://example.com/ignored/ [HTTP/1.1 200 Connected 208ms]
11:32:44 INFO - console.log: 11:32:43.184 GET http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html [HTTP/1.1 200 OK 61ms]
11:32:44 INFO - 11:32:43.528 GET http://some.example.com/test_bug_1010953_cspro.js [167ms]
11:32:44 INFO - 11:32:43.536 Content Security Policy: The page's settings observed the loading of a resource at http://some.example.com/test_bug_1010953_cspro.js ("script-src http://example.com"). A CSP report is being sent.1
11:32:44 INFO - 11:32:43.595 POST https://example.com/ignored/ [HTTP/1.1 200 Connected 208ms]
11:32:44 INFO - 11:32:43.960 Content Security Policy: The page's settings blocked the loading of a resource at http://some.example.com/test.png ("img-src http://example.com").1
11:32:45 INFO - MEMORY STAT | vsize 1269MB | residentFast 333MB | heapAllocated 129MB
11:32:45 INFO - 124 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js | took 4345ms
11:32:45 INFO - ++DOCSHELL 0x7f1176f2b000 == 17 [pid = 1950] [id = 355]
11:32:45 INFO - ++DOMWINDOW == 38 (0x7f11776f4000) [pid = 1950] [serial = 831] [outer = (nil)]
11:32:45 INFO - ++DOMWINDOW == 39 (0x7f11812cd800) [pid = 1950] [serial = 832] [outer = 0x7f11776f4000]
11:32:45 INFO - 125 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js
11:32:45 INFO - ++DOCSHELL 0x7f1182787800 == 18 [pid = 1950] [id = 356]
11:32:45 INFO - ++DOMWINDOW == 40 (0x7f11812d9000) [pid = 1950] [serial = 833] [outer = (nil)]
11:32:45 INFO - ++DOMWINDOW == 41 (0x7f1181490c00) [pid = 1950] [serial = 834] [outer = 0x7f11812d9000]
11:32:46 INFO - ++DOMWINDOW == 42 (0x7f1181ee4800) [pid = 1950] [serial = 835] [outer = 0x7f11812d9000]
11:32:46 INFO - ++DOCSHELL 0x7f1187fc0800 == 19 [pid = 1950] [id = 357]
11:32:46 INFO - ++DOMWINDOW == 43 (0x7f1181d11000) [pid = 1950] [serial = 836] [outer = (nil)]
11:32:46 INFO - ++DOMWINDOW == 44 (0x7f1182844c00) [pid = 1950] [serial = 837] [outer = 0x7f1181d11000]
11:32:46 INFO - ++DOMWINDOW == 45 (0x7f118114a800) [pid = 1950] [serial = 838] [outer = 0x7f1181d11000]
11:32:47 INFO - ++DOCSHELL 0x7f118aa38000 == 20 [pid = 1950] [id = 358]
11:32:47 INFO - ++DOMWINDOW == 46 (0x7f118260d800) [pid = 1950] [serial = 839] [outer = (nil)]
11:32:47 INFO - ++DOMWINDOW == 47 (0x7f1185862c00) [pid = 1950] [serial = 840] [outer = 0x7f118260d800]
11:32:48 INFO - ++DOCSHELL 0x7f118d52c000 == 21 [pid = 1950] [id = 359]
11:32:48 INFO - ++DOMWINDOW == 48 (0x7f1181ee4400) [pid = 1950] [serial = 841] [outer = (nil)]
11:32:48 INFO - ++DOMWINDOW == 49 (0x7f1185aa1800) [pid = 1950] [serial = 842] [outer = 0x7f1181ee4400]
11:32:49 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:32:49 INFO - ++DOCSHELL 0x7f118d52f800 == 22 [pid = 1950] [id = 360]
11:32:49 INFO - ++DOMWINDOW == 50 (0x7f1192333800) [pid = 1950] [serial = 843] [outer = (nil)]
11:32:49 INFO - ++DOMWINDOW == 51 (0x7f11858f8000) [pid = 1950] [serial = 844] [outer = 0x7f1192333800]
11:32:51 INFO - --DOCSHELL 0x7f1181161800 == 21 [pid = 1950] [id = 354]
11:32:52 INFO - --DOCSHELL 0x7f11773ac000 == 20 [pid = 1950] [id = 346]
11:32:52 INFO - --DOCSHELL 0x7f1176f15800 == 19 [pid = 1950] [id = 342]
11:32:52 INFO - --DOCSHELL 0x7f1182827800 == 18 [pid = 1950] [id = 347]
11:32:52 INFO - --DOCSHELL 0x7f118aa33000 == 17 [pid = 1950] [id = 348]
11:32:52 INFO - --DOCSHELL 0x7f1176f26800 == 16 [pid = 1950] [id = 351]
11:32:52 INFO - --DOCSHELL 0x7f117a612800 == 15 [pid = 1950] [id = 353]
11:32:52 INFO - --DOCSHELL 0x7f117a614000 == 14 [pid = 1950] [id = 352]
11:32:52 INFO - --DOMWINDOW == 50 (0x7f1181ee6000) [pid = 1950] [serial = 807] [outer = (nil)] [url = about:blank]
11:32:52 INFO - --DOMWINDOW == 49 (0x7f1176edc000) [pid = 1950] [serial = 805] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:52 INFO - --DOMWINDOW == 48 (0x7f11812ce800) [pid = 1950] [serial = 791] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:53 INFO - --DOCSHELL 0x7f118d52f800 == 13 [pid = 1950] [id = 360]
11:32:53 INFO - --DOCSHELL 0x7f118d52c000 == 12 [pid = 1950] [id = 359]
11:32:53 INFO - --DOCSHELL 0x7f118aa38000 == 11 [pid = 1950] [id = 358]
11:32:53 INFO - MEMORY STAT | vsize 1261MB | residentFast 335MB | heapAllocated 137MB
11:32:53 INFO - 126 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js | took 8383ms
11:32:53 INFO - ++DOCSHELL 0x7f118116a800 == 12 [pid = 1950] [id = 361]
11:32:53 INFO - ++DOMWINDOW == 49 (0x7f11812d2c00) [pid = 1950] [serial = 845] [outer = (nil)]
11:32:54 INFO - ++DOMWINDOW == 50 (0x7f118148a800) [pid = 1950] [serial = 846] [outer = 0x7f11812d2c00]
11:32:54 INFO - 127 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js
11:32:54 INFO - ++DOCSHELL 0x7f11827a0000 == 13 [pid = 1950] [id = 362]
11:32:54 INFO - ++DOMWINDOW == 51 (0x7f1181edf400) [pid = 1950] [serial = 847] [outer = (nil)]
11:32:54 INFO - ++DOMWINDOW == 52 (0x7f1181ee3400) [pid = 1950] [serial = 848] [outer = 0x7f1181edf400]
11:32:54 INFO - ++DOMWINDOW == 53 (0x7f1181f5c000) [pid = 1950] [serial = 849] [outer = 0x7f1181edf400]
11:32:54 INFO - ++DOCSHELL 0x7f11773b4000 == 14 [pid = 1950] [id = 363]
11:32:54 INFO - ++DOMWINDOW == 54 (0x7f1181ee4c00) [pid = 1950] [serial = 850] [outer = (nil)]
11:32:54 INFO - ++DOMWINDOW == 55 (0x7f1182755c00) [pid = 1950] [serial = 851] [outer = 0x7f1181ee4c00]
11:32:55 INFO - ++DOMWINDOW == 56 (0x7f1176db7800) [pid = 1950] [serial = 852] [outer = 0x7f1181ee4c00]
11:32:55 INFO - ++DOCSHELL 0x7f118aa3b800 == 15 [pid = 1950] [id = 364]
11:32:55 INFO - ++DOMWINDOW == 57 (0x7f118436e400) [pid = 1950] [serial = 853] [outer = (nil)]
11:32:55 INFO - ++DOMWINDOW == 58 (0x7f118461b000) [pid = 1950] [serial = 854] [outer = 0x7f118436e400]
11:32:57 INFO - --DOMWINDOW == 57 (0x7f1181ee5400) [pid = 1950] [serial = 812] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 56 (0x7f1185866000) [pid = 1950] [serial = 814] [outer = (nil)] [url = data:text/html;charset=utf8,Test%20for%20Bug%201006027]
11:32:57 INFO - --DOMWINDOW == 55 (0x7f1176dcec00) [pid = 1950] [serial = 821] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 54 (0x7f11838bf800) [pid = 1950] [serial = 813] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 53 (0x7f118586bc00) [pid = 1950] [serial = 815] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 52 (0x7f1182844c00) [pid = 1950] [serial = 837] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 51 (0x7f11812cbc00) [pid = 1950] [serial = 826] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 50 (0x7f1177392400) [pid = 1950] [serial = 822] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 49 (0x7f11776f5c00) [pid = 1950] [serial = 824] [outer = (nil)] [url = about:blank]
11:32:57 INFO - --DOMWINDOW == 48 (0x7f1181497400) [pid = 1950] [serial = 828] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:57 INFO - --DOMWINDOW == 47 (0x7f11858f3800) [pid = 1950] [serial = 816] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:57 INFO - --DOMWINDOW == 46 (0x7f11776f6c00) [pid = 1950] [serial = 825] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:32:57 INFO - --DOMWINDOW == 45 (0x7f118ab88000) [pid = 1950] [serial = 819] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:32:57 INFO - --DOMWINDOW == 44 (0x7f11776ef800) [pid = 1950] [serial = 823] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html]
11:32:57 INFO - --DOMWINDOW == 43 (0x7f11858f7400) [pid = 1950] [serial = 830] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html]
11:32:58 INFO - MEMORY STAT | vsize 1263MB | residentFast 341MB | heapAllocated 142MB
11:32:58 INFO - 128 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js | took 3769ms
11:32:58 INFO - ++DOCSHELL 0x7f118127e800 == 16 [pid = 1950] [id = 365]
11:32:58 INFO - ++DOMWINDOW == 44 (0x7f11838c5c00) [pid = 1950] [serial = 855] [outer = (nil)]
11:32:58 INFO - ++DOMWINDOW == 45 (0x7f1187583c00) [pid = 1950] [serial = 856] [outer = 0x7f11838c5c00]
11:32:58 INFO - 129 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js
11:32:58 INFO - ++DOCSHELL 0x7f118aa46000 == 17 [pid = 1950] [id = 366]
11:32:58 INFO - ++DOMWINDOW == 46 (0x7f118a915c00) [pid = 1950] [serial = 857] [outer = (nil)]
11:32:58 INFO - ++DOMWINDOW == 47 (0x7f118a941400) [pid = 1950] [serial = 858] [outer = 0x7f118a915c00]
11:32:58 INFO - ++DOMWINDOW == 48 (0x7f118d572c00) [pid = 1950] [serial = 859] [outer = 0x7f118a915c00]
11:32:58 INFO - ++DOCSHELL 0x7f11923b0800 == 18 [pid = 1950] [id = 367]
11:32:58 INFO - ++DOMWINDOW == 49 (0x7f118ab88000) [pid = 1950] [serial = 860] [outer = (nil)]
11:32:58 INFO - ++DOMWINDOW == 50 (0x7f118dd4cc00) [pid = 1950] [serial = 861] [outer = 0x7f118ab88000]
11:32:59 INFO - ++DOMWINDOW == 51 (0x7f1176cc7000) [pid = 1950] [serial = 862] [outer = 0x7f118ab88000]
11:32:59 INFO - ++DOCSHELL 0x7f1180e47800 == 19 [pid = 1950] [id = 368]
11:32:59 INFO - ++DOMWINDOW == 52 (0x7f118242a800) [pid = 1950] [serial = 863] [outer = (nil)]
11:32:59 INFO - ++DOMWINDOW == 53 (0x7f1182750800) [pid = 1950] [serial = 864] [outer = 0x7f118242a800]
11:33:02 INFO - --DOCSHELL 0x7f118aa3b800 == 18 [pid = 1950] [id = 364]
11:33:02 INFO - --DOCSHELL 0x7f1182787800 == 17 [pid = 1950] [id = 356]
11:33:02 INFO - --DOCSHELL 0x7f1180e47800 == 16 [pid = 1950] [id = 368]
11:33:03 INFO - --DOMWINDOW == 52 (0x7f11812cb400) [pid = 1950] [serial = 827] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:03 INFO - --DOMWINDOW == 51 (0x7f118ce98c00) [pid = 1950] [serial = 820] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 50 (0x7f1181ee8000) [pid = 1950] [serial = 818] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:03 INFO - --DOMWINDOW == 49 (0x7f1181d0ec00) [pid = 1950] [serial = 829] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 48 (0x7f11776f4000) [pid = 1950] [serial = 831] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 47 (0x7f11812d9000) [pid = 1950] [serial = 833] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html]
11:33:03 INFO - --DOMWINDOW == 46 (0x7f11812d2c00) [pid = 1950] [serial = 845] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 45 (0x7f1181edf400) [pid = 1950] [serial = 847] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:03 INFO - --DOMWINDOW == 44 (0x7f1192333800) [pid = 1950] [serial = 843] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:33:03 INFO - --DOMWINDOW == 43 (0x7f118dd4cc00) [pid = 1950] [serial = 861] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 42 (0x7f118436e400) [pid = 1950] [serial = 853] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:03 INFO - --DOMWINDOW == 41 (0x7f1181ee4400) [pid = 1950] [serial = 841] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:33:03 INFO - --DOMWINDOW == 40 (0x7f118260d800) [pid = 1950] [serial = 839] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:03 INFO - --DOMWINDOW == 39 (0x7f118a941400) [pid = 1950] [serial = 858] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 38 (0x7f1181d11000) [pid = 1950] [serial = 836] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:03 INFO - --DOMWINDOW == 37 (0x7f1181ee4c00) [pid = 1950] [serial = 850] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:03 INFO - --DOMWINDOW == 36 (0x7f1182755c00) [pid = 1950] [serial = 851] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 35 (0x7f11812cd800) [pid = 1950] [serial = 832] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 34 (0x7f1181490c00) [pid = 1950] [serial = 834] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 33 (0x7f118148a800) [pid = 1950] [serial = 846] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 32 (0x7f1181ee3400) [pid = 1950] [serial = 848] [outer = (nil)] [url = about:blank]
11:33:03 INFO - --DOMWINDOW == 31 (0x7f1181ee4800) [pid = 1950] [serial = 835] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html]
11:33:03 INFO - MEMORY STAT | vsize 1264MB | residentFast 339MB | heapAllocated 133MB
11:33:03 INFO - 130 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js | took 5611ms
11:33:03 INFO - ++DOCSHELL 0x7f1176f28800 == 17 [pid = 1950] [id = 369]
11:33:03 INFO - ++DOMWINDOW == 32 (0x7f1176dc9400) [pid = 1950] [serial = 865] [outer = (nil)]
11:33:03 INFO - ++DOMWINDOW == 33 (0x7f1176dd0400) [pid = 1950] [serial = 866] [outer = 0x7f1176dc9400]
11:33:04 INFO - 131 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js
11:33:04 INFO - ++DOCSHELL 0x7f117a617800 == 18 [pid = 1950] [id = 370]
11:33:04 INFO - ++DOMWINDOW == 34 (0x7f117738f000) [pid = 1950] [serial = 867] [outer = (nil)]
11:33:04 INFO - ++DOMWINDOW == 35 (0x7f1177396c00) [pid = 1950] [serial = 868] [outer = 0x7f117738f000]
11:33:04 INFO - ++DOMWINDOW == 36 (0x7f1181ee2400) [pid = 1950] [serial = 869] [outer = 0x7f117738f000]
11:33:04 INFO - ++DOCSHELL 0x7f117a614000 == 19 [pid = 1950] [id = 371]
11:33:04 INFO - ++DOMWINDOW == 37 (0x7f1177398800) [pid = 1950] [serial = 870] [outer = (nil)]
11:33:04 INFO - ++DOMWINDOW == 38 (0x7f118114e000) [pid = 1950] [serial = 871] [outer = 0x7f1177398800]
11:33:04 INFO - ++DOMWINDOW == 39 (0x7f1181148c00) [pid = 1950] [serial = 872] [outer = 0x7f1177398800]
11:33:05 INFO - ++DOCSHELL 0x7f11824ad800 == 20 [pid = 1950] [id = 372]
11:33:05 INFO - ++DOMWINDOW == 40 (0x7f1181d19800) [pid = 1950] [serial = 873] [outer = (nil)]
11:33:05 INFO - ++DOMWINDOW == 41 (0x7f1181ede000) [pid = 1950] [serial = 874] [outer = 0x7f1181d19800]
11:33:07 INFO - ++DOMWINDOW == 42 (0x7f1176dc7c00) [pid = 1950] [serial = 875] [outer = 0x7f117738f000]
11:33:07 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:33:08 INFO - --DOCSHELL 0x7f1187fc0800 == 19 [pid = 1950] [id = 357]
11:33:08 INFO - --DOCSHELL 0x7f1176f2b000 == 18 [pid = 1950] [id = 355]
11:33:08 INFO - --DOCSHELL 0x7f118127e800 == 17 [pid = 1950] [id = 365]
11:33:08 INFO - --DOCSHELL 0x7f118aa46000 == 16 [pid = 1950] [id = 366]
11:33:08 INFO - --DOCSHELL 0x7f118116a800 == 15 [pid = 1950] [id = 361]
11:33:08 INFO - --DOCSHELL 0x7f11827a0000 == 14 [pid = 1950] [id = 362]
11:33:08 INFO - --DOCSHELL 0x7f11773b4000 == 13 [pid = 1950] [id = 363]
11:33:08 INFO - --DOCSHELL 0x7f11923b0800 == 12 [pid = 1950] [id = 367]
11:33:08 INFO - --DOMWINDOW == 41 (0x7f1181f5c000) [pid = 1950] [serial = 849] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:08 INFO - --DOMWINDOW == 40 (0x7f118461b000) [pid = 1950] [serial = 854] [outer = (nil)] [url = about:blank]
11:33:08 INFO - --DOMWINDOW == 39 (0x7f1176db7800) [pid = 1950] [serial = 852] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:08 INFO - --DOMWINDOW == 38 (0x7f11858f8000) [pid = 1950] [serial = 844] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:33:08 INFO - --DOMWINDOW == 37 (0x7f1185aa1800) [pid = 1950] [serial = 842] [outer = (nil)] [url = about:blank]
11:33:08 INFO - --DOMWINDOW == 36 (0x7f1185862c00) [pid = 1950] [serial = 840] [outer = (nil)] [url = about:blank]
11:33:08 INFO - --DOMWINDOW == 35 (0x7f118114a800) [pid = 1950] [serial = 838] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:08 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined
11:33:08 INFO - --DOCSHELL 0x7f11824ad800 == 11 [pid = 1950] [id = 372]
11:33:09 INFO - --DOCSHELL 0x7f117a614000 == 10 [pid = 1950] [id = 371]
11:33:10 INFO - --DOMWINDOW == 34 (0x7f1177396c00) [pid = 1950] [serial = 868] [outer = (nil)] [url = about:blank]
11:33:10 INFO - --DOMWINDOW == 33 (0x7f1187583c00) [pid = 1950] [serial = 856] [outer = (nil)] [url = about:blank]
11:33:10 INFO - --DOMWINDOW == 32 (0x7f118114e000) [pid = 1950] [serial = 871] [outer = (nil)] [url = about:blank]
11:33:10 INFO - --DOMWINDOW == 31 (0x7f118242a800) [pid = 1950] [serial = 863] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:10 INFO - --DOMWINDOW == 30 (0x7f118ab88000) [pid = 1950] [serial = 860] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:10 INFO - --DOMWINDOW == 29 (0x7f118a915c00) [pid = 1950] [serial = 857] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:10 INFO - --DOMWINDOW == 28 (0x7f11838c5c00) [pid = 1950] [serial = 855] [outer = (nil)] [url = about:blank]
11:33:10 INFO - --DOMWINDOW == 27 (0x7f118d572c00) [pid = 1950] [serial = 859] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:10 INFO - MEMORY STAT | vsize 1260MB | residentFast 319MB | heapAllocated 124MB
11:33:10 INFO - 132 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js | took 6475ms
11:33:10 INFO - ++DOCSHELL 0x7f11773b9800 == 11 [pid = 1950] [id = 373]
11:33:10 INFO - ++DOMWINDOW == 28 (0x7f1176dc4c00) [pid = 1950] [serial = 876] [outer = (nil)]
11:33:10 INFO - ++DOMWINDOW == 29 (0x7f1176dcc800) [pid = 1950] [serial = 877] [outer = 0x7f1176dc4c00]
11:33:11 INFO - 133 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js
11:33:11 INFO - ++DOCSHELL 0x7f1180e43800 == 12 [pid = 1950] [id = 374]
11:33:11 INFO - ++DOMWINDOW == 30 (0x7f1177396000) [pid = 1950] [serial = 878] [outer = (nil)]
11:33:11 INFO - ++DOMWINDOW == 31 (0x7f11776eb000) [pid = 1950] [serial = 879] [outer = 0x7f1177396000]
11:33:11 INFO - ++DOMWINDOW == 32 (0x7f11776f6c00) [pid = 1950] [serial = 880] [outer = 0x7f1177396000]
11:33:12 INFO - MEMORY STAT | vsize 1261MB | residentFast 322MB | heapAllocated 126MB
11:33:12 INFO - 134 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js | took 1459ms
11:33:12 INFO - ++DOCSHELL 0x7f1181268800 == 13 [pid = 1950] [id = 375]
11:33:12 INFO - ++DOMWINDOW == 33 (0x7f11812ce000) [pid = 1950] [serial = 881] [outer = (nil)]
11:33:12 INFO - ++DOMWINDOW == 34 (0x7f11812d4c00) [pid = 1950] [serial = 882] [outer = 0x7f11812ce000]
11:33:12 INFO - 135 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js
11:33:12 INFO - ++DOCSHELL 0x7f118249e800 == 14 [pid = 1950] [id = 376]
11:33:12 INFO - ++DOMWINDOW == 35 (0x7f1181491000) [pid = 1950] [serial = 883] [outer = (nil)]
11:33:13 INFO - ++DOMWINDOW == 36 (0x7f1181494000) [pid = 1950] [serial = 884] [outer = 0x7f1181491000]
11:33:13 INFO - ++DOCSHELL 0x7f1180e3b000 == 15 [pid = 1950] [id = 377]
11:33:13 INFO - ++DOMWINDOW == 37 (0x7f1176db8800) [pid = 1950] [serial = 885] [outer = (nil)]
11:33:13 INFO - ++DOMWINDOW == 38 (0x7f11812d1c00) [pid = 1950] [serial = 886] [outer = 0x7f1176db8800]
11:33:13 INFO - ++DOMWINDOW == 39 (0x7f11812d3c00) [pid = 1950] [serial = 887] [outer = 0x7f1176db8800]
11:33:13 INFO - ++DOCSHELL 0x7f118aa27800 == 16 [pid = 1950] [id = 378]
11:33:13 INFO - ++DOMWINDOW == 40 (0x7f1182844800) [pid = 1950] [serial = 888] [outer = (nil)]
11:33:13 INFO - ++DOMWINDOW == 41 (0x7f1182885800) [pid = 1950] [serial = 889] [outer = 0x7f1182844800]
11:33:16 INFO - ++DOMWINDOW == 42 (0x7f118533e000) [pid = 1950] [serial = 890] [outer = 0x7f1181491000]
11:33:16 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:33:17 INFO - --DOCSHELL 0x7f1176f28800 == 15 [pid = 1950] [id = 369]
11:33:17 INFO - --DOCSHELL 0x7f11773b9800 == 14 [pid = 1950] [id = 373]
11:33:17 INFO - --DOCSHELL 0x7f1180e43800 == 13 [pid = 1950] [id = 374]
11:33:17 INFO - --DOCSHELL 0x7f117a617800 == 12 [pid = 1950] [id = 370]
11:33:17 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html, line 17: ReferenceError: fooDuplicateError1 is not defined
11:33:17 INFO - --DOMWINDOW == 41 (0x7f1181ee2400) [pid = 1950] [serial = 869] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:33:17 INFO - --DOMWINDOW == 40 (0x7f1176cc7000) [pid = 1950] [serial = 862] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:17 INFO - --DOMWINDOW == 39 (0x7f1182750800) [pid = 1950] [serial = 864] [outer = (nil)] [url = about:blank]
11:33:17 INFO - --DOCSHELL 0x7f118aa27800 == 11 [pid = 1950] [id = 378]
11:33:18 INFO - MEMORY STAT | vsize 1263MB | residentFast 326MB | heapAllocated 127MB
11:33:18 INFO - 136 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js | took 5251ms
11:33:18 INFO - ++DOCSHELL 0x7f1176f0c800 == 12 [pid = 1950] [id = 379]
11:33:18 INFO - ++DOMWINDOW == 40 (0x7f11812d0800) [pid = 1950] [serial = 891] [outer = (nil)]
11:33:18 INFO - ++DOMWINDOW == 41 (0x7f118148a800) [pid = 1950] [serial = 892] [outer = 0x7f11812d0800]
11:33:18 INFO - 137 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js
11:33:18 INFO - ++DOCSHELL 0x7f1182827800 == 13 [pid = 1950] [id = 380]
11:33:18 INFO - ++DOMWINDOW == 42 (0x7f1181496c00) [pid = 1950] [serial = 893] [outer = (nil)]
11:33:18 INFO - ++DOMWINDOW == 43 (0x7f1181d0dc00) [pid = 1950] [serial = 894] [outer = 0x7f1181496c00]
11:33:18 INFO - ++DOMWINDOW == 44 (0x7f1181edf800) [pid = 1950] [serial = 895] [outer = 0x7f1181496c00]
11:33:19 INFO - ++DOCSHELL 0x7f117a60e800 == 14 [pid = 1950] [id = 381]
11:33:19 INFO - ++DOMWINDOW == 45 (0x7f1181ee6400) [pid = 1950] [serial = 896] [outer = (nil)]
11:33:19 INFO - ++DOMWINDOW == 46 (0x7f1181ee8400) [pid = 1950] [serial = 897] [outer = 0x7f1181ee6400]
11:33:19 INFO - ++DOMWINDOW == 47 (0x7f11776f2400) [pid = 1950] [serial = 898] [outer = 0x7f1181ee6400]
11:33:19 INFO - ++DOCSHELL 0x7f118aa3c000 == 15 [pid = 1950] [id = 382]
11:33:19 INFO - ++DOMWINDOW == 48 (0x7f1183fca000) [pid = 1950] [serial = 899] [outer = (nil)]
11:33:19 INFO - ++DOMWINDOW == 49 (0x7f1184619c00) [pid = 1950] [serial = 900] [outer = 0x7f1183fca000]
11:33:21 INFO - --DOMWINDOW == 48 (0x7f1177398800) [pid = 1950] [serial = 870] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:21 INFO - --DOMWINDOW == 47 (0x7f1181d19800) [pid = 1950] [serial = 873] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:21 INFO - --DOMWINDOW == 46 (0x7f1176dc9400) [pid = 1950] [serial = 865] [outer = (nil)] [url = about:blank]
11:33:21 INFO - --DOMWINDOW == 45 (0x7f1176dc4c00) [pid = 1950] [serial = 876] [outer = (nil)] [url = about:blank]
11:33:21 INFO - --DOMWINDOW == 44 (0x7f1177396000) [pid = 1950] [serial = 878] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:21 INFO - --DOMWINDOW == 43 (0x7f117738f000) [pid = 1950] [serial = 867] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:33:21 INFO - --DOMWINDOW == 42 (0x7f11812d1c00) [pid = 1950] [serial = 886] [outer = (nil)] [url = about:blank]
11:33:21 INFO - --DOMWINDOW == 41 (0x7f1176dd0400) [pid = 1950] [serial = 866] [outer = (nil)] [url = about:blank]
11:33:21 INFO - --DOMWINDOW == 40 (0x7f1176dcc800) [pid = 1950] [serial = 877] [outer = (nil)] [url = about:blank]
11:33:21 INFO - --DOMWINDOW == 39 (0x7f11776eb000) [pid = 1950] [serial = 879] [outer = (nil)] [url = about:blank]
11:33:22 INFO - MEMORY STAT | vsize 1266MB | residentFast 333MB | heapAllocated 133MB
11:33:22 INFO - 138 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js | took 3693ms
11:33:22 INFO - ++DOCSHELL 0x7f118364d800 == 16 [pid = 1950] [id = 383]
11:33:22 INFO - ++DOMWINDOW == 40 (0x7f1182750800) [pid = 1950] [serial = 901] [outer = (nil)]
11:33:22 INFO - ++DOMWINDOW == 41 (0x7f1183fd9800) [pid = 1950] [serial = 902] [outer = 0x7f1182750800]
11:33:22 INFO - 139 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js
11:33:22 INFO - ++DOCSHELL 0x7f118d5df800 == 17 [pid = 1950] [id = 384]
11:33:22 INFO - ++DOMWINDOW == 42 (0x7f1185aab000) [pid = 1950] [serial = 903] [outer = (nil)]
11:33:22 INFO - ++DOMWINDOW == 43 (0x7f1188144400) [pid = 1950] [serial = 904] [outer = 0x7f1185aab000]
11:33:22 INFO - ++DOCSHELL 0x7f11906b3800 == 18 [pid = 1950] [id = 385]
11:33:22 INFO - ++DOMWINDOW == 44 (0x7f1188145000) [pid = 1950] [serial = 905] [outer = (nil)]
11:33:22 INFO - ++DOMWINDOW == 45 (0x7f11881fe400) [pid = 1950] [serial = 906] [outer = 0x7f1188145000]
11:33:23 INFO - ++DOMWINDOW == 46 (0x7f11881f5400) [pid = 1950] [serial = 907] [outer = 0x7f1188145000]
11:33:23 INFO - ++DOCSHELL 0x7f119141e800 == 19 [pid = 1950] [id = 386]
11:33:23 INFO - ++DOMWINDOW == 47 (0x7f118a91ec00) [pid = 1950] [serial = 908] [outer = (nil)]
11:33:23 INFO - ++DOMWINDOW == 48 (0x7f118a923400) [pid = 1950] [serial = 909] [outer = 0x7f118a91ec00]
11:33:29 INFO - MEMORY STAT | vsize 1269MB | residentFast 341MB | heapAllocated 138MB
11:33:29 INFO - 140 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js | took 6866ms
11:33:29 INFO - ++DOCSHELL 0x7f11906b1000 == 20 [pid = 1950] [id = 387]
11:33:29 INFO - ++DOMWINDOW == 49 (0x7f1181edc400) [pid = 1950] [serial = 910] [outer = (nil)]
11:33:29 INFO - ++DOMWINDOW == 50 (0x7f11881fe000) [pid = 1950] [serial = 911] [outer = 0x7f1181edc400]
11:33:29 INFO - 141 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js
11:33:29 INFO - ++DOCSHELL 0x7f11923b0800 == 21 [pid = 1950] [id = 388]
11:33:29 INFO - ++DOMWINDOW == 51 (0x7f118a93c800) [pid = 1950] [serial = 912] [outer = (nil)]
11:33:29 INFO - ++DOMWINDOW == 52 (0x7f118a941c00) [pid = 1950] [serial = 913] [outer = 0x7f118a93c800]
11:33:30 INFO - ++DOCSHELL 0x7f119de19000 == 22 [pid = 1950] [id = 389]
11:33:30 INFO - ++DOMWINDOW == 53 (0x7f118a942800) [pid = 1950] [serial = 914] [outer = (nil)]
11:33:30 INFO - ++DOMWINDOW == 54 (0x7f118d40c400) [pid = 1950] [serial = 915] [outer = 0x7f118a942800]
11:33:30 INFO - ++DOMWINDOW == 55 (0x7f11881fb400) [pid = 1950] [serial = 916] [outer = 0x7f118a942800]
11:33:30 INFO - ++DOCSHELL 0x7f119e434000 == 23 [pid = 1950] [id = 390]
11:33:30 INFO - ++DOMWINDOW == 56 (0x7f118f35f000) [pid = 1950] [serial = 917] [outer = (nil)]
11:33:30 INFO - ++DOMWINDOW == 57 (0x7f118f5a2400) [pid = 1950] [serial = 918] [outer = 0x7f118f35f000]
11:33:32 INFO - ++DOMWINDOW == 58 (0x7f119240a800) [pid = 1950] [serial = 919] [outer = 0x7f118a93c800]
11:33:32 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:33:33 INFO - --DOCSHELL 0x7f1176f0c800 == 22 [pid = 1950] [id = 379]
11:33:33 INFO - --DOCSHELL 0x7f1182827800 == 21 [pid = 1950] [id = 380]
11:33:33 INFO - --DOCSHELL 0x7f117a60e800 == 20 [pid = 1950] [id = 381]
11:33:33 INFO - --DOCSHELL 0x7f118249e800 == 19 [pid = 1950] [id = 376]
11:33:33 INFO - --DOCSHELL 0x7f1181268800 == 18 [pid = 1950] [id = 375]
11:33:33 INFO - --DOCSHELL 0x7f118aa3c000 == 17 [pid = 1950] [id = 382]
11:33:33 INFO - --DOCSHELL 0x7f1180e3b000 == 16 [pid = 1950] [id = 377]
11:33:33 INFO - --DOCSHELL 0x7f119141e800 == 15 [pid = 1950] [id = 386]
11:33:33 INFO - --DOMWINDOW == 57 (0x7f1181148c00) [pid = 1950] [serial = 872] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:33 INFO - --DOMWINDOW == 56 (0x7f1181ede000) [pid = 1950] [serial = 874] [outer = (nil)] [url = about:blank]
11:33:33 INFO - --DOMWINDOW == 55 (0x7f11776f6c00) [pid = 1950] [serial = 880] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:33:33 INFO - --DOMWINDOW == 54 (0x7f1176dc7c00) [pid = 1950] [serial = 875] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:33:34 INFO - --DOCSHELL 0x7f119e434000 == 14 [pid = 1950] [id = 390]
11:33:35 INFO - --DOCSHELL 0x7f118364d800 == 13 [pid = 1950] [id = 383]
11:33:35 INFO - --DOCSHELL 0x7f119de19000 == 12 [pid = 1950] [id = 389]
11:33:35 INFO - --DOCSHELL 0x7f11906b3800 == 11 [pid = 1950] [id = 385]
11:33:35 INFO - --DOMWINDOW == 53 (0x7f11812ce000) [pid = 1950] [serial = 881] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 52 (0x7f1181491000) [pid = 1950] [serial = 883] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html]
11:33:35 INFO - --DOMWINDOW == 51 (0x7f11812d0800) [pid = 1950] [serial = 891] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 50 (0x7f1188144400) [pid = 1950] [serial = 904] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 49 (0x7f1183fca000) [pid = 1950] [serial = 899] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:35 INFO - --DOMWINDOW == 48 (0x7f1181496c00) [pid = 1950] [serial = 893] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html]
11:33:35 INFO - --DOMWINDOW == 47 (0x7f1188145000) [pid = 1950] [serial = 905] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:35 INFO - --DOMWINDOW == 46 (0x7f118a91ec00) [pid = 1950] [serial = 908] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:35 INFO - --DOMWINDOW == 45 (0x7f1181ee6400) [pid = 1950] [serial = 896] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:35 INFO - --DOMWINDOW == 44 (0x7f1176db8800) [pid = 1950] [serial = 885] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:35 INFO - --DOMWINDOW == 43 (0x7f1182844800) [pid = 1950] [serial = 888] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:35 INFO - --DOMWINDOW == 42 (0x7f1182750800) [pid = 1950] [serial = 901] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 41 (0x7f1183fd9800) [pid = 1950] [serial = 902] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 40 (0x7f1185aab000) [pid = 1950] [serial = 903] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20585237]
11:33:35 INFO - --DOMWINDOW == 39 (0x7f1181ee8400) [pid = 1950] [serial = 897] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 38 (0x7f11812d4c00) [pid = 1950] [serial = 882] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 37 (0x7f1181494000) [pid = 1950] [serial = 884] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 36 (0x7f118148a800) [pid = 1950] [serial = 892] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 35 (0x7f1181d0dc00) [pid = 1950] [serial = 894] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 34 (0x7f1181edf800) [pid = 1950] [serial = 895] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html]
11:33:35 INFO - --DOMWINDOW == 33 (0x7f11881fe400) [pid = 1950] [serial = 906] [outer = (nil)] [url = about:blank]
11:33:35 INFO - --DOMWINDOW == 32 (0x7f118d40c400) [pid = 1950] [serial = 915] [outer = (nil)] [url = about:blank]
11:33:36 INFO - --DOMWINDOW == 31 (0x7f118533e000) [pid = 1950] [serial = 890] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html]
11:33:36 INFO - MEMORY STAT | vsize 1268MB | residentFast 338MB | heapAllocated 131MB
11:33:36 INFO - 142 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js | took 6634ms
11:33:36 INFO - ++DOCSHELL 0x7f1176f11800 == 12 [pid = 1950] [id = 391]
11:33:36 INFO - ++DOMWINDOW == 32 (0x7f11776ef800) [pid = 1950] [serial = 920] [outer = (nil)]
11:33:36 INFO - ++DOMWINDOW == 33 (0x7f11776f6c00) [pid = 1950] [serial = 921] [outer = 0x7f11776ef800]
11:33:36 INFO - 143 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js
11:33:36 INFO - ++DOCSHELL 0x7f1180e4f000 == 13 [pid = 1950] [id = 392]
11:33:36 INFO - ++DOMWINDOW == 34 (0x7f118114c400) [pid = 1950] [serial = 922] [outer = (nil)]
11:33:36 INFO - ++DOMWINDOW == 35 (0x7f11812d0c00) [pid = 1950] [serial = 923] [outer = 0x7f118114c400]
11:33:37 INFO - ++DOCSHELL 0x7f1180e4d000 == 14 [pid = 1950] [id = 393]
11:33:37 INFO - ++DOMWINDOW == 36 (0x7f1181497800) [pid = 1950] [serial = 924] [outer = (nil)]
11:33:37 INFO - ++DOMWINDOW == 37 (0x7f1181498400) [pid = 1950] [serial = 925] [outer = 0x7f1181497800]
11:33:37 INFO - ++DOMWINDOW == 38 (0x7f1181493400) [pid = 1950] [serial = 926] [outer = 0x7f1181497800]
11:33:37 INFO - ++DOCSHELL 0x7f1183648800 == 15 [pid = 1950] [id = 394]
11:33:37 INFO - ++DOMWINDOW == 39 (0x7f1182431800) [pid = 1950] [serial = 927] [outer = (nil)]
11:33:37 INFO - ++DOMWINDOW == 40 (0x7f118260e800) [pid = 1950] [serial = 928] [outer = 0x7f1182431800]
11:33:42 INFO - --DOCSHELL 0x7f118d5df800 == 14 [pid = 1950] [id = 384]
11:33:42 INFO - --DOCSHELL 0x7f11906b1000 == 13 [pid = 1950] [id = 387]
11:33:42 INFO - --DOCSHELL 0x7f11923b0800 == 12 [pid = 1950] [id = 388]
11:33:42 INFO - --DOMWINDOW == 39 (0x7f118a923400) [pid = 1950] [serial = 909] [outer = (nil)] [url = about:blank]
11:33:42 INFO - --DOMWINDOW == 38 (0x7f11881f5400) [pid = 1950] [serial = 907] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:42 INFO - --DOMWINDOW == 37 (0x7f1184619c00) [pid = 1950] [serial = 900] [outer = (nil)] [url = about:blank]
11:33:42 INFO - --DOMWINDOW == 36 (0x7f11776f2400) [pid = 1950] [serial = 898] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:42 INFO - --DOMWINDOW == 35 (0x7f1182885800) [pid = 1950] [serial = 889] [outer = (nil)] [url = about:blank]
11:33:42 INFO - --DOMWINDOW == 34 (0x7f11812d3c00) [pid = 1950] [serial = 887] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:42 INFO - --DOCSHELL 0x7f1183648800 == 11 [pid = 1950] [id = 394]
11:33:43 INFO - MEMORY STAT | vsize 1263MB | residentFast 331MB | heapAllocated 127MB
11:33:43 INFO - 144 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js | took 6679ms
11:33:43 INFO - ++DOCSHELL 0x7f1176f17800 == 12 [pid = 1950] [id = 395]
11:33:43 INFO - ++DOMWINDOW == 35 (0x7f1176ed9c00) [pid = 1950] [serial = 929] [outer = (nil)]
11:33:43 INFO - ++DOMWINDOW == 36 (0x7f1177393400) [pid = 1950] [serial = 930] [outer = 0x7f1176ed9c00]
11:33:43 INFO - 145 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js
11:33:43 INFO - ++DOCSHELL 0x7f1180e48800 == 13 [pid = 1950] [id = 396]
11:33:43 INFO - ++DOMWINDOW == 37 (0x7f11776ee400) [pid = 1950] [serial = 931] [outer = (nil)]
11:33:43 INFO - ++DOMWINDOW == 38 (0x7f11776f3800) [pid = 1950] [serial = 932] [outer = 0x7f11776ee400]
11:33:44 INFO - ++DOCSHELL 0x7f11773b3000 == 14 [pid = 1950] [id = 397]
11:33:44 INFO - ++DOMWINDOW == 39 (0x7f11776f4400) [pid = 1950] [serial = 933] [outer = (nil)]
11:33:44 INFO - ++DOMWINDOW == 40 (0x7f11812d2000) [pid = 1950] [serial = 934] [outer = 0x7f11776f4400]
11:33:44 INFO - ++DOMWINDOW == 41 (0x7f1176ee0800) [pid = 1950] [serial = 935] [outer = 0x7f11776f4400]
11:33:44 INFO - ++DOCSHELL 0x7f1182787800 == 15 [pid = 1950] [id = 398]
11:33:44 INFO - ++DOMWINDOW == 42 (0x7f1181497000) [pid = 1950] [serial = 936] [outer = (nil)]
11:33:44 INFO - ++DOMWINDOW == 43 (0x7f1181d12800) [pid = 1950] [serial = 937] [outer = 0x7f1181497000]
11:33:46 INFO - [1950] WARNING: Must complete empty transaction when compositing!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsPresShell.cpp, line 5934
11:33:47 INFO - MEMORY STAT | vsize 1265MB | residentFast 334MB | heapAllocated 135MB
11:33:47 INFO - 146 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js | took 3433ms
11:33:47 INFO - ++DOCSHELL 0x7f1183e38800 == 16 [pid = 1950] [id = 399]
11:33:47 INFO - ++DOMWINDOW == 44 (0x7f118148f800) [pid = 1950] [serial = 938] [outer = (nil)]
11:33:47 INFO - ++DOMWINDOW == 45 (0x7f1182749000) [pid = 1950] [serial = 939] [outer = 0x7f118148f800]
11:33:47 INFO - 147 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js
11:33:47 INFO - ++DOCSHELL 0x7f118d49f800 == 17 [pid = 1950] [id = 400]
11:33:47 INFO - ++DOMWINDOW == 46 (0x7f1185866400) [pid = 1950] [serial = 940] [outer = (nil)]
11:33:47 INFO - ++DOMWINDOW == 47 (0x7f118758c800) [pid = 1950] [serial = 941] [outer = 0x7f1185866400]
11:33:47 INFO - ++DOMWINDOW == 48 (0x7f11881f5400) [pid = 1950] [serial = 942] [outer = 0x7f1185866400]
11:33:48 INFO - --DOMWINDOW == 47 (0x7f1181498400) [pid = 1950] [serial = 925] [outer = (nil)] [url = about:blank]
11:33:48 INFO - --DOMWINDOW == 46 (0x7f11881fe000) [pid = 1950] [serial = 911] [outer = (nil)] [url = about:blank]
11:33:48 INFO - --DOMWINDOW == 45 (0x7f118a941c00) [pid = 1950] [serial = 913] [outer = (nil)] [url = about:blank]
11:33:48 INFO - --DOMWINDOW == 44 (0x7f118a942800) [pid = 1950] [serial = 914] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:48 INFO - --DOMWINDOW == 43 (0x7f118f35f000) [pid = 1950] [serial = 917] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:48 INFO - --DOMWINDOW == 42 (0x7f1181edc400) [pid = 1950] [serial = 910] [outer = (nil)] [url = about:blank]
11:33:48 INFO - --DOMWINDOW == 41 (0x7f118a93c800) [pid = 1950] [serial = 912] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html]
11:33:48 INFO - --DOMWINDOW == 40 (0x7f119240a800) [pid = 1950] [serial = 919] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html]
11:33:48 INFO - ++DOCSHELL 0x7f11853e7800 == 18 [pid = 1950] [id = 401]
11:33:48 INFO - ++DOMWINDOW == 41 (0x7f1183fc9800) [pid = 1950] [serial = 943] [outer = (nil)]
11:33:48 INFO - ++DOMWINDOW == 42 (0x7f1183fde400) [pid = 1950] [serial = 944] [outer = 0x7f1183fc9800]
11:33:48 INFO - ++DOMWINDOW == 43 (0x7f1182881800) [pid = 1950] [serial = 945] [outer = 0x7f1183fc9800]
11:33:48 INFO - ++DOCSHELL 0x7f118d5e2800 == 19 [pid = 1950] [id = 402]
11:33:48 INFO - ++DOMWINDOW == 44 (0x7f118a915000) [pid = 1950] [serial = 946] [outer = (nil)]
11:33:48 INFO - ++DOMWINDOW == 45 (0x7f118a91b000) [pid = 1950] [serial = 947] [outer = 0x7f118a915000]
11:33:51 INFO - --DOCSHELL 0x7f1180e4d000 == 18 [pid = 1950] [id = 393]
11:33:51 INFO - --DOCSHELL 0x7f1176f17800 == 17 [pid = 1950] [id = 395]
11:33:51 INFO - --DOCSHELL 0x7f1180e4f000 == 16 [pid = 1950] [id = 392]
11:33:51 INFO - --DOCSHELL 0x7f1180e48800 == 15 [pid = 1950] [id = 396]
11:33:51 INFO - --DOCSHELL 0x7f11773b3000 == 14 [pid = 1950] [id = 397]
11:33:51 INFO - --DOCSHELL 0x7f1182787800 == 13 [pid = 1950] [id = 398]
11:33:51 INFO - --DOCSHELL 0x7f1176f11800 == 12 [pid = 1950] [id = 391]
11:33:51 INFO - --DOMWINDOW == 44 (0x7f118f5a2400) [pid = 1950] [serial = 918] [outer = (nil)] [url = about:blank]
11:33:51 INFO - --DOMWINDOW == 43 (0x7f11881fb400) [pid = 1950] [serial = 916] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:51 INFO - --DOCSHELL 0x7f118d5e2800 == 11 [pid = 1950] [id = 402]
11:33:52 INFO - MEMORY STAT | vsize 1261MB | residentFast 327MB | heapAllocated 129MB
11:33:52 INFO - 148 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js | took 5099ms
11:33:52 INFO - ++DOCSHELL 0x7f11773ac800 == 12 [pid = 1950] [id = 403]
11:33:52 INFO - ++DOMWINDOW == 44 (0x7f1176edc800) [pid = 1950] [serial = 948] [outer = (nil)]
11:33:52 INFO - ++DOMWINDOW == 45 (0x7f1177397800) [pid = 1950] [serial = 949] [outer = 0x7f1176edc800]
11:33:52 INFO - 149 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js
11:33:52 INFO - ++DOCSHELL 0x7f1181166000 == 13 [pid = 1950] [id = 404]
11:33:52 INFO - ++DOMWINDOW == 46 (0x7f11776f4000) [pid = 1950] [serial = 950] [outer = (nil)]
11:33:52 INFO - ++DOMWINDOW == 47 (0x7f1181143800) [pid = 1950] [serial = 951] [outer = 0x7f11776f4000]
11:33:53 INFO - ++DOMWINDOW == 48 (0x7f11812d6c00) [pid = 1950] [serial = 952] [outer = 0x7f11776f4000]
11:33:53 INFO - ++DOCSHELL 0x7f117a60a800 == 14 [pid = 1950] [id = 405]
11:33:53 INFO - ++DOMWINDOW == 49 (0x7f1181147c00) [pid = 1950] [serial = 953] [outer = (nil)]
11:33:53 INFO - ++DOMWINDOW == 50 (0x7f1181491800) [pid = 1950] [serial = 954] [outer = 0x7f1181147c00]
11:33:53 INFO - ++DOMWINDOW == 51 (0x7f1177396800) [pid = 1950] [serial = 955] [outer = 0x7f1181147c00]
11:33:53 INFO - ++DOCSHELL 0x7f1183656000 == 15 [pid = 1950] [id = 406]
11:33:53 INFO - ++DOMWINDOW == 52 (0x7f1181ee5000) [pid = 1950] [serial = 956] [outer = (nil)]
11:33:53 INFO - ++DOMWINDOW == 53 (0x7f1181ee8400) [pid = 1950] [serial = 957] [outer = 0x7f1181ee5000]
11:33:55 INFO - --DOMWINDOW == 52 (0x7f11776f4400) [pid = 1950] [serial = 933] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:55 INFO - --DOMWINDOW == 51 (0x7f1181497000) [pid = 1950] [serial = 936] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:55 INFO - --DOMWINDOW == 50 (0x7f1181497800) [pid = 1950] [serial = 924] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:33:55 INFO - --DOMWINDOW == 49 (0x7f1182431800) [pid = 1950] [serial = 927] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:33:55 INFO - --DOMWINDOW == 48 (0x7f11776ef800) [pid = 1950] [serial = 920] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 47 (0x7f118114c400) [pid = 1950] [serial = 922] [outer = (nil)] [url = data:text/html;charset=utf-8,bug%20585991%20-%20autocomplete%20popup%20keyboard%20usage%20test]
11:33:55 INFO - --DOMWINDOW == 46 (0x7f1176ed9c00) [pid = 1950] [serial = 929] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 45 (0x7f11776ee400) [pid = 1950] [serial = 931] [outer = (nil)] [url = data:text/html;charset=utf-8,
bug%20585991%20-%20autocomplete%20popup%20test]
11:33:55 INFO - --DOMWINDOW == 44 (0x7f11812d2000) [pid = 1950] [serial = 934] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 43 (0x7f1183fde400) [pid = 1950] [serial = 944] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 42 (0x7f11776f6c00) [pid = 1950] [serial = 921] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 41 (0x7f11812d0c00) [pid = 1950] [serial = 923] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 40 (0x7f1177393400) [pid = 1950] [serial = 930] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 39 (0x7f11776f3800) [pid = 1950] [serial = 932] [outer = (nil)] [url = about:blank]
11:33:55 INFO - --DOMWINDOW == 38 (0x7f118758c800) [pid = 1950] [serial = 941] [outer = (nil)] [url = about:blank]
11:33:56 INFO - MEMORY STAT | vsize 1264MB | residentFast 332MB | heapAllocated 135MB
11:33:56 INFO - 150 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js | took 3983ms
11:33:56 INFO - ++DOCSHELL 0x7f11826bd800 == 16 [pid = 1950] [id = 407]
11:33:56 INFO - ++DOMWINDOW == 39 (0x7f1181d15c00) [pid = 1950] [serial = 958] [outer = (nil)]
11:33:56 INFO - ++DOMWINDOW == 40 (0x7f1183671400) [pid = 1950] [serial = 959] [outer = 0x7f1181d15c00]
11:33:57 INFO - 151 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js
11:33:57 INFO - ++DOCSHELL 0x7f118d546000 == 17 [pid = 1950] [id = 408]
11:33:57 INFO - ++DOMWINDOW == 41 (0x7f118533e000) [pid = 1950] [serial = 960] [outer = (nil)]
11:33:57 INFO - ++DOMWINDOW == 42 (0x7f1185aa5400) [pid = 1950] [serial = 961] [outer = 0x7f118533e000]
11:33:57 INFO - ++DOCSHELL 0x7f1191424000 == 18 [pid = 1950] [id = 409]
11:33:57 INFO - ++DOMWINDOW == 43 (0x7f1181d1bc00) [pid = 1950] [serial = 962] [outer = (nil)]
11:33:57 INFO - ++DOMWINDOW == 44 (0x7f11872b6800) [pid = 1950] [serial = 963] [outer = 0x7f1181d1bc00]
11:33:57 INFO - ++DOMWINDOW == 45 (0x7f1183cab400) [pid = 1950] [serial = 964] [outer = 0x7f1181d1bc00]
11:33:57 INFO - ++DOCSHELL 0x7f1191994000 == 19 [pid = 1950] [id = 410]
11:33:57 INFO - ++DOMWINDOW == 46 (0x7f118a927400) [pid = 1950] [serial = 965] [outer = (nil)]
11:33:57 INFO - ++DOMWINDOW == 47 (0x7f118a93c000) [pid = 1950] [serial = 966] [outer = 0x7f118a927400]
11:34:01 INFO - --DOCSHELL 0x7f11853e7800 == 18 [pid = 1950] [id = 401]
11:34:01 INFO - --DOCSHELL 0x7f1183656000 == 17 [pid = 1950] [id = 406]
11:34:01 INFO - --DOCSHELL 0x7f1183e38800 == 16 [pid = 1950] [id = 399]
11:34:01 INFO - --DOCSHELL 0x7f118d49f800 == 15 [pid = 1950] [id = 400]
11:34:01 INFO - --DOCSHELL 0x7f1191994000 == 14 [pid = 1950] [id = 410]
11:34:01 INFO - --DOMWINDOW == 46 (0x7f1181493400) [pid = 1950] [serial = 926] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:01 INFO - --DOMWINDOW == 45 (0x7f118260e800) [pid = 1950] [serial = 928] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 44 (0x7f1176ee0800) [pid = 1950] [serial = 935] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:01 INFO - --DOMWINDOW == 43 (0x7f1181d12800) [pid = 1950] [serial = 937] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 42 (0x7f1181147c00) [pid = 1950] [serial = 953] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:01 INFO - --DOMWINDOW == 41 (0x7f1183fc9800) [pid = 1950] [serial = 943] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:01 INFO - --DOMWINDOW == 40 (0x7f118148f800) [pid = 1950] [serial = 938] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 39 (0x7f1185866400) [pid = 1950] [serial = 940] [outer = (nil)] [url = http://example.com/]
11:34:01 INFO - --DOMWINDOW == 38 (0x7f1176edc800) [pid = 1950] [serial = 948] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 37 (0x7f11776f4000) [pid = 1950] [serial = 950] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:01 INFO - --DOMWINDOW == 36 (0x7f1181491800) [pid = 1950] [serial = 954] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 35 (0x7f1182749000) [pid = 1950] [serial = 939] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 34 (0x7f11881f5400) [pid = 1950] [serial = 942] [outer = (nil)] [url = http://example.com/]
11:34:01 INFO - --DOMWINDOW == 33 (0x7f1177397800) [pid = 1950] [serial = 949] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 32 (0x7f1181143800) [pid = 1950] [serial = 951] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 31 (0x7f11872b6800) [pid = 1950] [serial = 963] [outer = (nil)] [url = about:blank]
11:34:01 INFO - --DOMWINDOW == 30 (0x7f1181ee5000) [pid = 1950] [serial = 956] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:01 INFO - --DOMWINDOW == 29 (0x7f118a915000) [pid = 1950] [serial = 946] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:01 INFO - MEMORY STAT | vsize 1265MB | residentFast 330MB | heapAllocated 127MB
11:34:01 INFO - 152 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js | took 4903ms
11:34:01 INFO - ++DOCSHELL 0x7f1176f29800 == 15 [pid = 1950] [id = 411]
11:34:01 INFO - ++DOMWINDOW == 30 (0x7f1176dbb400) [pid = 1950] [serial = 967] [outer = (nil)]
11:34:02 INFO - ++DOMWINDOW == 31 (0x7f1176dcdc00) [pid = 1950] [serial = 968] [outer = 0x7f1176dbb400]
11:34:02 INFO - 153 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js
11:34:02 INFO - ++DOCSHELL 0x7f117a612800 == 16 [pid = 1950] [id = 412]
11:34:02 INFO - ++DOMWINDOW == 32 (0x7f1176ee0800) [pid = 1950] [serial = 969] [outer = (nil)]
11:34:02 INFO - ++DOMWINDOW == 33 (0x7f117738e000) [pid = 1950] [serial = 970] [outer = 0x7f1176ee0800]
11:34:02 INFO - ++DOMWINDOW == 34 (0x7f11776f2800) [pid = 1950] [serial = 971] [outer = 0x7f1176ee0800]
11:34:02 INFO - ++DOCSHELL 0x7f117a611800 == 17 [pid = 1950] [id = 413]
11:34:02 INFO - ++DOMWINDOW == 35 (0x7f1177391800) [pid = 1950] [serial = 972] [outer = (nil)]
11:34:02 INFO - ++DOMWINDOW == 36 (0x7f1181144800) [pid = 1950] [serial = 973] [outer = 0x7f1177391800]
11:34:02 INFO - ++DOMWINDOW == 37 (0x7f11776f3800) [pid = 1950] [serial = 974] [outer = 0x7f1177391800]
11:34:03 INFO - ++DOCSHELL 0x7f118278d800 == 18 [pid = 1950] [id = 414]
11:34:03 INFO - ++DOMWINDOW == 38 (0x7f1181d19800) [pid = 1950] [serial = 975] [outer = (nil)]
11:34:03 INFO - ++DOMWINDOW == 39 (0x7f1181eddc00) [pid = 1950] [serial = 976] [outer = 0x7f1181d19800]
11:34:06 INFO - MEMORY STAT | vsize 1268MB | residentFast 337MB | heapAllocated 132MB
11:34:06 INFO - 154 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js | took 3871ms
11:34:06 INFO - ++DOCSHELL 0x7f1176f20800 == 19 [pid = 1950] [id = 415]
11:34:06 INFO - ++DOMWINDOW == 40 (0x7f11812cd400) [pid = 1950] [serial = 977] [outer = (nil)]
11:34:06 INFO - ++DOMWINDOW == 41 (0x7f1181494000) [pid = 1950] [serial = 978] [outer = 0x7f11812cd400]
11:34:06 INFO - 155 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js
11:34:06 INFO - ++DOCSHELL 0x7f1183e38800 == 20 [pid = 1950] [id = 416]
11:34:06 INFO - ++DOMWINDOW == 42 (0x7f1181ee0400) [pid = 1950] [serial = 979] [outer = (nil)]
11:34:06 INFO - ++DOMWINDOW == 43 (0x7f118260b800) [pid = 1950] [serial = 980] [outer = 0x7f1181ee0400]
11:34:06 INFO - ++DOMWINDOW == 44 (0x7f11838e3800) [pid = 1950] [serial = 981] [outer = 0x7f1181ee0400]
11:34:07 INFO - ++DOCSHELL 0x7f118d52a000 == 21 [pid = 1950] [id = 417]
11:34:07 INFO - ++DOMWINDOW == 45 (0x7f1182847c00) [pid = 1950] [serial = 982] [outer = (nil)]
11:34:07 INFO - ++DOMWINDOW == 46 (0x7f1184374c00) [pid = 1950] [serial = 983] [outer = 0x7f1182847c00]
11:34:07 INFO - ++DOMWINDOW == 47 (0x7f11776ed000) [pid = 1950] [serial = 984] [outer = 0x7f1182847c00]
11:34:07 INFO - ++DOCSHELL 0x7f118dd05800 == 22 [pid = 1950] [id = 418]
11:34:07 INFO - ++DOMWINDOW == 48 (0x7f11872afc00) [pid = 1950] [serial = 985] [outer = (nil)]
11:34:07 INFO - ++DOMWINDOW == 49 (0x7f118758c800) [pid = 1950] [serial = 986] [outer = 0x7f11872afc00]
11:34:10 INFO - MEMORY STAT | vsize 1270MB | residentFast 345MB | heapAllocated 139MB
11:34:10 INFO - 156 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js | took 4044ms
11:34:10 INFO - ++DOCSHELL 0x7f118127f800 == 23 [pid = 1950] [id = 419]
11:34:10 INFO - ++DOMWINDOW == 50 (0x7f1187583c00) [pid = 1950] [serial = 987] [outer = (nil)]
11:34:10 INFO - ++DOMWINDOW == 51 (0x7f11881fc400) [pid = 1950] [serial = 988] [outer = 0x7f1187583c00]
11:34:10 INFO - 157 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js
11:34:10 INFO - ++DOCSHELL 0x7f119f0be800 == 24 [pid = 1950] [id = 420]
11:34:10 INFO - ++DOMWINDOW == 52 (0x7f118a942800) [pid = 1950] [serial = 989] [outer = (nil)]
11:34:10 INFO - ++DOMWINDOW == 53 (0x7f118ce9a000) [pid = 1950] [serial = 990] [outer = 0x7f118a942800]
11:34:11 INFO - ++DOCSHELL 0x7f11a140f800 == 25 [pid = 1950] [id = 421]
11:34:11 INFO - ++DOMWINDOW == 54 (0x7f118148b800) [pid = 1950] [serial = 991] [outer = (nil)]
11:34:11 INFO - ++DOMWINDOW == 55 (0x7f118d566400) [pid = 1950] [serial = 992] [outer = 0x7f118148b800]
11:34:11 INFO - ++DOMWINDOW == 56 (0x7f118a3e0400) [pid = 1950] [serial = 993] [outer = 0x7f118148b800]
11:34:11 INFO - ++DOCSHELL 0x7f11a61b2800 == 26 [pid = 1950] [id = 422]
11:34:11 INFO - ++DOMWINDOW == 57 (0x7f118da5a800) [pid = 1950] [serial = 994] [outer = (nil)]
11:34:11 INFO - ++DOMWINDOW == 58 (0x7f118daa5400) [pid = 1950] [serial = 995] [outer = 0x7f118da5a800]
11:34:12 INFO - ++DOMWINDOW == 59 (0x7f1191657400) [pid = 1950] [serial = 996] [outer = 0x7f118a942800]
11:34:14 INFO - --DOCSHELL 0x7f117a611800 == 25 [pid = 1950] [id = 413]
11:34:14 INFO - --DOCSHELL 0x7f118278d800 == 24 [pid = 1950] [id = 414]
11:34:14 INFO - --DOCSHELL 0x7f1191424000 == 23 [pid = 1950] [id = 409]
11:34:14 INFO - --DOCSHELL 0x7f11826bd800 == 22 [pid = 1950] [id = 407]
11:34:14 INFO - --DOCSHELL 0x7f118d546000 == 21 [pid = 1950] [id = 408]
11:34:14 INFO - --DOCSHELL 0x7f1181166000 == 20 [pid = 1950] [id = 404]
11:34:14 INFO - --DOCSHELL 0x7f118dd05800 == 19 [pid = 1950] [id = 418]
11:34:14 INFO - --DOCSHELL 0x7f11773ac800 == 18 [pid = 1950] [id = 403]
11:34:14 INFO - --DOCSHELL 0x7f117a60a800 == 17 [pid = 1950] [id = 405]
11:34:14 INFO - --DOCSHELL 0x7f11a61b2800 == 16 [pid = 1950] [id = 422]
11:34:14 INFO - --DOMWINDOW == 58 (0x7f1177396800) [pid = 1950] [serial = 955] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:14 INFO - --DOMWINDOW == 57 (0x7f1182881800) [pid = 1950] [serial = 945] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:14 INFO - --DOMWINDOW == 56 (0x7f118a91b000) [pid = 1950] [serial = 947] [outer = (nil)] [url = about:blank]
11:34:14 INFO - --DOMWINDOW == 55 (0x7f1181ee8400) [pid = 1950] [serial = 957] [outer = (nil)] [url = about:blank]
11:34:14 INFO - --DOMWINDOW == 54 (0x7f11812d6c00) [pid = 1950] [serial = 952] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:15 INFO - --DOMWINDOW == 53 (0x7f118260b800) [pid = 1950] [serial = 980] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 52 (0x7f118ce9a000) [pid = 1950] [serial = 990] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 51 (0x7f1181d19800) [pid = 1950] [serial = 975] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:15 INFO - --DOMWINDOW == 50 (0x7f11872afc00) [pid = 1950] [serial = 985] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:15 INFO - --DOMWINDOW == 49 (0x7f1182847c00) [pid = 1950] [serial = 982] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:15 INFO - --DOMWINDOW == 48 (0x7f118a927400) [pid = 1950] [serial = 965] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:15 INFO - --DOMWINDOW == 47 (0x7f1181d1bc00) [pid = 1950] [serial = 962] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:15 INFO - --DOMWINDOW == 46 (0x7f1177391800) [pid = 1950] [serial = 972] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:15 INFO - --DOMWINDOW == 45 (0x7f1181d15c00) [pid = 1950] [serial = 958] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 44 (0x7f118533e000) [pid = 1950] [serial = 960] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20588342]
11:34:15 INFO - --DOMWINDOW == 43 (0x7f1176dbb400) [pid = 1950] [serial = 967] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 42 (0x7f1176ee0800) [pid = 1950] [serial = 969] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:15 INFO - --DOMWINDOW == 41 (0x7f11812cd400) [pid = 1950] [serial = 977] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 40 (0x7f1181ee0400) [pid = 1950] [serial = 979] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:15 INFO - --DOMWINDOW == 39 (0x7f118d566400) [pid = 1950] [serial = 992] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 38 (0x7f1181144800) [pid = 1950] [serial = 973] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 37 (0x7f1184374c00) [pid = 1950] [serial = 983] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 36 (0x7f1183671400) [pid = 1950] [serial = 959] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 35 (0x7f1185aa5400) [pid = 1950] [serial = 961] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 34 (0x7f1176dcdc00) [pid = 1950] [serial = 968] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 33 (0x7f117738e000) [pid = 1950] [serial = 970] [outer = (nil)] [url = about:blank]
11:34:15 INFO - --DOMWINDOW == 32 (0x7f1181494000) [pid = 1950] [serial = 978] [outer = (nil)] [url = about:blank]
11:34:15 INFO - MEMORY STAT | vsize 1270MB | residentFast 346MB | heapAllocated 134MB
11:34:15 INFO - 158 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js | took 4666ms
11:34:15 INFO - ++DOCSHELL 0x7f11773ab000 == 17 [pid = 1950] [id = 423]
11:34:15 INFO - ++DOMWINDOW == 33 (0x7f1176dcc800) [pid = 1950] [serial = 997] [outer = (nil)]
11:34:15 INFO - ++DOMWINDOW == 34 (0x7f1176edac00) [pid = 1950] [serial = 998] [outer = 0x7f1176dcc800]
11:34:15 INFO - 159 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js
11:34:15 INFO - ++DOCSHELL 0x7f1180e4f800 == 18 [pid = 1950] [id = 424]
11:34:15 INFO - ++DOMWINDOW == 35 (0x7f11776f7000) [pid = 1950] [serial = 999] [outer = (nil)]
11:34:15 INFO - ++DOMWINDOW == 36 (0x7f118114b400) [pid = 1950] [serial = 1000] [outer = 0x7f11776f7000]
11:34:16 INFO - ++DOCSHELL 0x7f1180e45800 == 19 [pid = 1950] [id = 425]
11:34:16 INFO - ++DOMWINDOW == 37 (0x7f1176ed8400) [pid = 1950] [serial = 1001] [outer = (nil)]
11:34:16 INFO - ++DOMWINDOW == 38 (0x7f11812cf400) [pid = 1950] [serial = 1002] [outer = 0x7f1176ed8400]
11:34:16 INFO - ++DOMWINDOW == 39 (0x7f1176ee1c00) [pid = 1950] [serial = 1003] [outer = 0x7f1176ed8400]
11:34:16 INFO - ++DOCSHELL 0x7f118364d000 == 20 [pid = 1950] [id = 426]
11:34:16 INFO - ++DOMWINDOW == 40 (0x7f1181ee9400) [pid = 1950] [serial = 1004] [outer = (nil)]
11:34:16 INFO - ++DOMWINDOW == 41 (0x7f1182885800) [pid = 1950] [serial = 1005] [outer = 0x7f1181ee9400]
11:34:18 INFO - MEMORY STAT | vsize 1271MB | residentFast 346MB | heapAllocated 134MB
11:34:18 INFO - 160 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js | took 3173ms
11:34:18 INFO - ++DOCSHELL 0x7f1176f1d800 == 21 [pid = 1950] [id = 427]
11:34:18 INFO - ++DOMWINDOW == 42 (0x7f11776f1400) [pid = 1950] [serial = 1006] [outer = (nil)]
11:34:19 INFO - ++DOMWINDOW == 43 (0x7f11812d2400) [pid = 1950] [serial = 1007] [outer = 0x7f11776f1400]
11:34:19 INFO - 161 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js
11:34:19 INFO - ++DOCSHELL 0x7f1180e3f800 == 22 [pid = 1950] [id = 428]
11:34:19 INFO - ++DOMWINDOW == 44 (0x7f1181490400) [pid = 1950] [serial = 1008] [outer = (nil)]
11:34:19 INFO - ++DOMWINDOW == 45 (0x7f1181496800) [pid = 1950] [serial = 1009] [outer = 0x7f1181490400]
11:34:19 INFO - ++DOMWINDOW == 46 (0x7f1181ee6800) [pid = 1950] [serial = 1010] [outer = 0x7f1181490400]
11:34:19 INFO - ++DOCSHELL 0x7f118d380000 == 23 [pid = 1950] [id = 429]
11:34:19 INFO - ++DOMWINDOW == 47 (0x7f1181ee6c00) [pid = 1950] [serial = 1011] [outer = (nil)]
11:34:20 INFO - ++DOMWINDOW == 48 (0x7f1181ee5c00) [pid = 1950] [serial = 1012] [outer = 0x7f1181ee6c00]
11:34:20 INFO - ++DOCSHELL 0x7f118d534800 == 24 [pid = 1950] [id = 430]
11:34:20 INFO - ++DOMWINDOW == 49 (0x7f1181eea400) [pid = 1950] [serial = 1013] [outer = (nil)]
11:34:20 INFO - ++DOMWINDOW == 50 (0x7f1183a7d800) [pid = 1950] [serial = 1014] [outer = 0x7f1181eea400]
11:34:20 INFO - ++DOMWINDOW == 51 (0x7f11776eb000) [pid = 1950] [serial = 1015] [outer = 0x7f1181eea400]
11:34:20 INFO - ++DOCSHELL 0x7f118dd06800 == 25 [pid = 1950] [id = 431]
11:34:20 INFO - ++DOMWINDOW == 52 (0x7f1185aa5800) [pid = 1950] [serial = 1016] [outer = (nil)]
11:34:20 INFO - ++DOMWINDOW == 53 (0x7f1185aaac00) [pid = 1950] [serial = 1017] [outer = 0x7f1185aa5800]
11:34:22 INFO - ++DOCSHELL 0x7f1191436800 == 26 [pid = 1950] [id = 432]
11:34:22 INFO - ++DOMWINDOW == 54 (0x7f118a91e800) [pid = 1950] [serial = 1018] [outer = (nil)]
11:34:22 INFO - ++DOMWINDOW == 55 (0x7f118a937000) [pid = 1950] [serial = 1019] [outer = 0x7f118a91e800]
11:34:22 INFO - ++DOMWINDOW == 56 (0x7f1185866c00) [pid = 1950] [serial = 1020] [outer = 0x7f118a91e800]
11:34:23 INFO - ++DOCSHELL 0x7f118d5df800 == 27 [pid = 1950] [id = 433]
11:34:23 INFO - ++DOMWINDOW == 57 (0x7f118a927400) [pid = 1950] [serial = 1021] [outer = (nil)]
11:34:23 INFO - ++DOMWINDOW == 58 (0x7f118a92d000) [pid = 1950] [serial = 1022] [outer = 0x7f118a927400]
11:34:23 INFO - ++DOMWINDOW == 59 (0x7f1185aa3800) [pid = 1950] [serial = 1023] [outer = 0x7f118a927400]
11:34:23 INFO - ++DOCSHELL 0x7f11a147f000 == 28 [pid = 1950] [id = 434]
11:34:23 INFO - ++DOMWINDOW == 60 (0x7f118d405800) [pid = 1950] [serial = 1024] [outer = (nil)]
11:34:23 INFO - ++DOMWINDOW == 61 (0x7f118d566400) [pid = 1950] [serial = 1025] [outer = 0x7f118d405800]
11:34:25 INFO - ++DOMWINDOW == 62 (0x7f1192f33400) [pid = 1950] [serial = 1026] [outer = 0x7f1181490400]
11:34:25 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:34:25 INFO - ++DOCSHELL 0x7f11a1486800 == 29 [pid = 1950] [id = 435]
11:34:25 INFO - ++DOMWINDOW == 63 (0x7f1176cc8800) [pid = 1950] [serial = 1027] [outer = (nil)]
11:34:25 INFO - ++DOMWINDOW == 64 (0x7f1196406000) [pid = 1950] [serial = 1028] [outer = 0x7f1176cc8800]
11:34:26 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:34:27 INFO - --DOCSHELL 0x7f117a612800 == 28 [pid = 1950] [id = 412]
11:34:27 INFO - --DOCSHELL 0x7f1180e45800 == 27 [pid = 1950] [id = 425]
11:34:27 INFO - --DOCSHELL 0x7f118364d000 == 26 [pid = 1950] [id = 426]
11:34:27 INFO - --DOCSHELL 0x7f119f0be800 == 25 [pid = 1950] [id = 420]
11:34:27 INFO - --DOCSHELL 0x7f11a140f800 == 24 [pid = 1950] [id = 421]
11:34:27 INFO - --DOCSHELL 0x7f118d52a000 == 23 [pid = 1950] [id = 417]
11:34:27 INFO - --DOCSHELL 0x7f1176f20800 == 22 [pid = 1950] [id = 415]
11:34:27 INFO - --DOCSHELL 0x7f118127f800 == 21 [pid = 1950] [id = 419]
11:34:27 INFO - --DOCSHELL 0x7f1176f29800 == 20 [pid = 1950] [id = 411]
11:34:27 INFO - --DOCSHELL 0x7f11a147f000 == 19 [pid = 1950] [id = 434]
11:34:27 INFO - --DOCSHELL 0x7f1183e38800 == 18 [pid = 1950] [id = 416]
11:34:27 INFO - --DOMWINDOW == 63 (0x7f11776ed000) [pid = 1950] [serial = 984] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:27 INFO - --DOMWINDOW == 62 (0x7f118758c800) [pid = 1950] [serial = 986] [outer = (nil)] [url = about:blank]
11:34:27 INFO - --DOMWINDOW == 61 (0x7f1181eddc00) [pid = 1950] [serial = 976] [outer = (nil)] [url = about:blank]
11:34:27 INFO - --DOMWINDOW == 60 (0x7f11838e3800) [pid = 1950] [serial = 981] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:27 INFO - --DOMWINDOW == 59 (0x7f11776f2800) [pid = 1950] [serial = 971] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:27 INFO - --DOMWINDOW == 58 (0x7f118a93c000) [pid = 1950] [serial = 966] [outer = (nil)] [url = about:blank]
11:34:27 INFO - --DOMWINDOW == 57 (0x7f1183cab400) [pid = 1950] [serial = 964] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:27 INFO - --DOMWINDOW == 56 (0x7f11776f3800) [pid = 1950] [serial = 974] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:28 INFO - --DOMWINDOW == 55 (0x7f118148b800) [pid = 1950] [serial = 991] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:28 INFO - --DOMWINDOW == 54 (0x7f118da5a800) [pid = 1950] [serial = 994] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:28 INFO - --DOMWINDOW == 53 (0x7f118a942800) [pid = 1950] [serial = 989] [outer = (nil)] [url = data:text/html;charset=utf-8,
test%20CSS%20parser%20filter
]
11:34:28 INFO - --DOMWINDOW == 52 (0x7f118a937000) [pid = 1950] [serial = 1019] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 51 (0x7f1181496800) [pid = 1950] [serial = 1009] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 50 (0x7f1183a7d800) [pid = 1950] [serial = 1014] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 49 (0x7f1181ee6c00) [pid = 1950] [serial = 1011] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html]
11:34:28 INFO - --DOMWINDOW == 48 (0x7f1176ed8400) [pid = 1950] [serial = 1001] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:28 INFO - --DOMWINDOW == 47 (0x7f1181ee9400) [pid = 1950] [serial = 1004] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:28 INFO - --DOMWINDOW == 46 (0x7f1176dcc800) [pid = 1950] [serial = 997] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 45 (0x7f1187583c00) [pid = 1950] [serial = 987] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 44 (0x7f11776f7000) [pid = 1950] [serial = 999] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20bug%20592442]
11:34:28 INFO - --DOMWINDOW == 43 (0x7f1176edac00) [pid = 1950] [serial = 998] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 42 (0x7f11812cf400) [pid = 1950] [serial = 1002] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 41 (0x7f11881fc400) [pid = 1950] [serial = 988] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 40 (0x7f118114b400) [pid = 1950] [serial = 1000] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOMWINDOW == 39 (0x7f118d405800) [pid = 1950] [serial = 1024] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:28 INFO - --DOMWINDOW == 38 (0x7f1191657400) [pid = 1950] [serial = 996] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20CSS%20parser%20filter
]
11:34:28 INFO - --DOMWINDOW == 37 (0x7f118a92d000) [pid = 1950] [serial = 1022] [outer = (nil)] [url = about:blank]
11:34:28 INFO - --DOCSHELL 0x7f118dd06800 == 17 [pid = 1950] [id = 431]
11:34:28 INFO - --DOMWINDOW == 36 (0x7f1181ee5c00) [pid = 1950] [serial = 1012] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html]
11:34:28 INFO - --DOMWINDOW == 35 (0x7f1181ee6800) [pid = 1950] [serial = 1010] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html]
11:34:29 INFO - --DOCSHELL 0x7f118d534800 == 16 [pid = 1950] [id = 430]
11:34:29 INFO - --DOCSHELL 0x7f11773ab000 == 15 [pid = 1950] [id = 423]
11:34:29 INFO - --DOCSHELL 0x7f118d5df800 == 14 [pid = 1950] [id = 433]
11:34:29 INFO - --DOMWINDOW == 34 (0x7f1176ee1c00) [pid = 1950] [serial = 1003] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:29 INFO - --DOMWINDOW == 33 (0x7f118d566400) [pid = 1950] [serial = 1025] [outer = (nil)] [url = about:blank]
11:34:29 INFO - --DOMWINDOW == 32 (0x7f1182885800) [pid = 1950] [serial = 1005] [outer = (nil)] [url = about:blank]
11:34:29 INFO - --DOMWINDOW == 31 (0x7f118daa5400) [pid = 1950] [serial = 995] [outer = (nil)] [url = about:blank]
11:34:29 INFO - --DOMWINDOW == 30 (0x7f118a3e0400) [pid = 1950] [serial = 993] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:29 INFO - --DOMWINDOW == 29 (0x7f118a91e800) [pid = 1950] [serial = 1018] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:29 INFO - --DOMWINDOW == 28 (0x7f1185aa5800) [pid = 1950] [serial = 1016] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:29 INFO - --DOMWINDOW == 27 (0x7f1185866c00) [pid = 1950] [serial = 1020] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:34:30 INFO - MEMORY STAT | vsize 1271MB | residentFast 340MB | heapAllocated 129MB
11:34:30 INFO - 162 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js | took 10909ms
11:34:30 INFO - ++DOCSHELL 0x7f11773b1800 == 15 [pid = 1950] [id = 436]
11:34:30 INFO - ++DOMWINDOW == 28 (0x7f1176dd0400) [pid = 1950] [serial = 1029] [outer = (nil)]
11:34:30 INFO - ++DOMWINDOW == 29 (0x7f117738b000) [pid = 1950] [serial = 1030] [outer = 0x7f1176dd0400]
11:34:30 INFO - 163 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js
11:34:30 INFO - ++DOCSHELL 0x7f1180e38800 == 16 [pid = 1950] [id = 437]
11:34:30 INFO - ++DOMWINDOW == 30 (0x7f11776ef000) [pid = 1950] [serial = 1031] [outer = (nil)]
11:34:30 INFO - ++DOMWINDOW == 31 (0x7f11776f3800) [pid = 1950] [serial = 1032] [outer = 0x7f11776ef000]
11:34:30 INFO - ++DOCSHELL 0x7f1180e35800 == 17 [pid = 1950] [id = 438]
11:34:30 INFO - ++DOMWINDOW == 32 (0x7f11776f6800) [pid = 1950] [serial = 1033] [outer = (nil)]
11:34:30 INFO - ++DOMWINDOW == 33 (0x7f11812cc000) [pid = 1950] [serial = 1034] [outer = 0x7f11776f6800]
11:34:30 INFO - ++DOMWINDOW == 34 (0x7f1176ee2800) [pid = 1950] [serial = 1035] [outer = 0x7f11776f6800]
11:34:31 INFO - ++DOCSHELL 0x7f11827a2800 == 18 [pid = 1950] [id = 439]
11:34:31 INFO - ++DOMWINDOW == 35 (0x7f1181d18000) [pid = 1950] [serial = 1036] [outer = (nil)]
11:34:31 INFO - ++DOMWINDOW == 36 (0x7f1181edec00) [pid = 1950] [serial = 1037] [outer = 0x7f1181d18000]
11:34:33 INFO - MEMORY STAT | vsize 1272MB | residentFast 336MB | heapAllocated 129MB
11:34:33 INFO - 164 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js | took 3476ms
11:34:33 INFO - ++DOCSHELL 0x7f1176f1f000 == 19 [pid = 1950] [id = 440]
11:34:33 INFO - ++DOMWINDOW == 37 (0x7f1176cc6800) [pid = 1950] [serial = 1038] [outer = (nil)]
11:34:33 INFO - ++DOMWINDOW == 38 (0x7f1176cd0400) [pid = 1950] [serial = 1039] [outer = 0x7f1176cc6800]
11:34:34 INFO - 165 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js
11:34:34 INFO - ++DOCSHELL 0x7f11773ba000 == 20 [pid = 1950] [id = 441]
11:34:34 INFO - ++DOMWINDOW == 39 (0x7f1176dc5400) [pid = 1950] [serial = 1040] [outer = (nil)]
11:34:34 INFO - ++DOMWINDOW == 40 (0x7f1176dd0000) [pid = 1950] [serial = 1041] [outer = 0x7f1176dc5400]
11:34:34 INFO - ++DOCSHELL 0x7f118127e000 == 21 [pid = 1950] [id = 442]
11:34:34 INFO - ++DOMWINDOW == 41 (0x7f1176ee0800) [pid = 1950] [serial = 1042] [outer = (nil)]
11:34:34 INFO - ++DOMWINDOW == 42 (0x7f118114b400) [pid = 1950] [serial = 1043] [outer = 0x7f1176ee0800]
11:34:35 INFO - ++DOMWINDOW == 43 (0x7f11776f6c00) [pid = 1950] [serial = 1044] [outer = 0x7f1176ee0800]
11:34:35 INFO - ++DOCSHELL 0x7f1185a2b800 == 22 [pid = 1950] [id = 443]
11:34:35 INFO - ++DOMWINDOW == 44 (0x7f118288e000) [pid = 1950] [serial = 1045] [outer = (nil)]
11:34:35 INFO - ++DOMWINDOW == 45 (0x7f1183670000) [pid = 1950] [serial = 1046] [outer = 0x7f118288e000]
11:34:37 INFO - ++DOMWINDOW == 46 (0x7f1188149400) [pid = 1950] [serial = 1047] [outer = 0x7f1176dc5400]
11:34:38 INFO - --DOCSHELL 0x7f1180e4f800 == 21 [pid = 1950] [id = 424]
11:34:38 INFO - --DOCSHELL 0x7f118d380000 == 20 [pid = 1950] [id = 429]
11:34:38 INFO - --DOCSHELL 0x7f11a1486800 == 19 [pid = 1950] [id = 435]
11:34:38 INFO - --DOCSHELL 0x7f1191436800 == 18 [pid = 1950] [id = 432]
11:34:38 INFO - --DOCSHELL 0x7f11773b1800 == 17 [pid = 1950] [id = 436]
11:34:38 INFO - --DOCSHELL 0x7f1180e38800 == 16 [pid = 1950] [id = 437]
11:34:38 INFO - --DOCSHELL 0x7f1180e35800 == 15 [pid = 1950] [id = 438]
11:34:38 INFO - --DOCSHELL 0x7f11827a2800 == 14 [pid = 1950] [id = 439]
11:34:38 INFO - --DOCSHELL 0x7f1180e3f800 == 13 [pid = 1950] [id = 428]
11:34:38 INFO - --DOCSHELL 0x7f1176f1d800 == 12 [pid = 1950] [id = 427]
11:34:38 INFO - --DOMWINDOW == 45 (0x7f1185aaac00) [pid = 1950] [serial = 1017] [outer = (nil)] [url = about:blank]
11:34:39 INFO - --DOCSHELL 0x7f1185a2b800 == 11 [pid = 1950] [id = 443]
11:34:39 INFO - MEMORY STAT | vsize 1268MB | residentFast 336MB | heapAllocated 130MB
11:34:39 INFO - 166 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js | took 5419ms
11:34:39 INFO - ++DOCSHELL 0x7f1180e4e000 == 12 [pid = 1950] [id = 444]
11:34:39 INFO - ++DOMWINDOW == 46 (0x7f11812d0c00) [pid = 1950] [serial = 1048] [outer = (nil)]
11:34:39 INFO - ++DOMWINDOW == 47 (0x7f118148d400) [pid = 1950] [serial = 1049] [outer = 0x7f11812d0c00]
11:34:40 INFO - 167 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js
11:34:40 INFO - ++DOCSHELL 0x7f11827e9800 == 13 [pid = 1950] [id = 445]
11:34:40 INFO - ++DOMWINDOW == 48 (0x7f1181497400) [pid = 1950] [serial = 1050] [outer = (nil)]
11:34:40 INFO - ++DOMWINDOW == 49 (0x7f1181d15c00) [pid = 1950] [serial = 1051] [outer = 0x7f1181497400]
11:34:40 INFO - ++DOCSHELL 0x7f118282b800 == 14 [pid = 1950] [id = 446]
11:34:40 INFO - ++DOMWINDOW == 50 (0x7f1181ee2400) [pid = 1950] [serial = 1052] [outer = (nil)]
11:34:40 INFO - ++DOMWINDOW == 51 (0x7f1181ee8000) [pid = 1950] [serial = 1053] [outer = 0x7f1181ee2400]
11:34:40 INFO - ++DOCSHELL 0x7f1185a35000 == 15 [pid = 1950] [id = 447]
11:34:40 INFO - ++DOMWINDOW == 52 (0x7f1182888800) [pid = 1950] [serial = 1054] [outer = (nil)]
11:34:40 INFO - ++DOMWINDOW == 53 (0x7f1182889800) [pid = 1950] [serial = 1055] [outer = 0x7f1182888800]
11:34:40 INFO - ++DOCSHELL 0x7f118a15c000 == 16 [pid = 1950] [id = 448]
11:34:40 INFO - ++DOMWINDOW == 54 (0x7f11858f4400) [pid = 1950] [serial = 1056] [outer = (nil)]
11:34:40 INFO - ++DOCSHELL 0x7f118a15f800 == 17 [pid = 1950] [id = 449]
11:34:40 INFO - ++DOMWINDOW == 55 (0x7f11858f7400) [pid = 1950] [serial = 1057] [outer = (nil)]
11:34:40 INFO - ++DOMWINDOW == 56 (0x7f11858fdc00) [pid = 1950] [serial = 1058] [outer = 0x7f11858f7400]
11:34:40 INFO - ++DOCSHELL 0x7f118d544800 == 18 [pid = 1950] [id = 450]
11:34:40 INFO - ++DOMWINDOW == 57 (0x7f11858f3800) [pid = 1950] [serial = 1059] [outer = (nil)]
11:34:40 INFO - ++DOMWINDOW == 58 (0x7f11881fd800) [pid = 1950] [serial = 1060] [outer = 0x7f11858f3800]
11:34:41 INFO - ++DOMWINDOW == 59 (0x7f118a916800) [pid = 1950] [serial = 1061] [outer = 0x7f11858f4400]
11:34:41 INFO - ++DOMWINDOW == 60 (0x7f118a91a400) [pid = 1950] [serial = 1062] [outer = 0x7f11858f7400]
11:34:41 INFO - ++DOMWINDOW == 61 (0x7f118a91e400) [pid = 1950] [serial = 1063] [outer = 0x7f11858f3800]
11:34:41 INFO - ++DOCSHELL 0x7f1181270000 == 19 [pid = 1950] [id = 451]
11:34:41 INFO - ++DOMWINDOW == 62 (0x7f118a93c400) [pid = 1950] [serial = 1064] [outer = (nil)]
11:34:41 INFO - ++DOMWINDOW == 63 (0x7f118a93ec00) [pid = 1950] [serial = 1065] [outer = 0x7f118a93c400]
11:34:41 INFO - ++DOCSHELL 0x7f119198c000 == 20 [pid = 1950] [id = 452]
11:34:41 INFO - ++DOMWINDOW == 64 (0x7f118a944800) [pid = 1950] [serial = 1066] [outer = (nil)]
11:34:41 INFO - ++DOMWINDOW == 65 (0x7f118a9b9c00) [pid = 1950] [serial = 1067] [outer = 0x7f118a944800]
11:34:42 INFO - ++DOCSHELL 0x7f118115b000 == 21 [pid = 1950] [id = 453]
11:34:42 INFO - ++DOMWINDOW == 66 (0x7f118d565800) [pid = 1950] [serial = 1068] [outer = (nil)]
11:34:42 INFO - ++DOMWINDOW == 67 (0x7f118da9c800) [pid = 1950] [serial = 1069] [outer = 0x7f118d565800]
11:34:42 INFO - ++DOMWINDOW == 68 (0x7f118d586400) [pid = 1950] [serial = 1070] [outer = 0x7f118d565800]
11:34:42 INFO - ++DOCSHELL 0x7f11a147f000 == 22 [pid = 1950] [id = 454]
11:34:42 INFO - ++DOMWINDOW == 69 (0x7f118d570000) [pid = 1950] [serial = 1071] [outer = (nil)]
11:34:42 INFO - ++DOMWINDOW == 70 (0x7f118d590c00) [pid = 1950] [serial = 1072] [outer = 0x7f118d570000]
11:34:43 INFO - ++DOMWINDOW == 71 (0x7f118dd4f400) [pid = 1950] [serial = 1073] [outer = 0x7f118d570000]
11:34:43 INFO - --DOMWINDOW == 70 (0x7f118a927400) [pid = 1950] [serial = 1021] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:43 INFO - --DOMWINDOW == 69 (0x7f1181eea400) [pid = 1950] [serial = 1013] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:43 INFO - --DOMWINDOW == 68 (0x7f1181d18000) [pid = 1950] [serial = 1036] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:34:43 INFO - --DOMWINDOW == 67 (0x7f11776f6800) [pid = 1950] [serial = 1033] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:34:43 INFO - --DOMWINDOW == 66 (0x7f11776ef000) [pid = 1950] [serial = 1031] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20594497%20and%20bug%20619598]
11:34:43 INFO - --DOMWINDOW == 65 (0x7f1176dd0400) [pid = 1950] [serial = 1029] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 64 (0x7f11776f1400) [pid = 1950] [serial = 1006] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 63 (0x7f1181490400) [pid = 1950] [serial = 1008] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html]
11:34:43 INFO - --DOMWINDOW == 62 (0x7f1176cc8800) [pid = 1950] [serial = 1027] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html]
11:34:43 INFO - --DOMWINDOW == 61 (0x7f11776f3800) [pid = 1950] [serial = 1032] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 60 (0x7f117738b000) [pid = 1950] [serial = 1030] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 59 (0x7f11812cc000) [pid = 1950] [serial = 1034] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 58 (0x7f11812d2400) [pid = 1950] [serial = 1007] [outer = (nil)] [url = about:blank]
11:34:43 INFO - --DOMWINDOW == 57 (0x7f118114b400) [pid = 1950] [serial = 1043] [outer = (nil)] [url = about:blank]
11:34:44 INFO - --DOMWINDOW == 56 (0x7f1192f33400) [pid = 1950] [serial = 1026] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html]
11:34:44 INFO - --DOMWINDOW == 55 (0x7f1196406000) [pid = 1950] [serial = 1028] [outer = (nil)] [url = about:blank]
11:34:44 INFO - ++DOCSHELL 0x7f1183653000 == 23 [pid = 1950] [id = 455]
11:34:44 INFO - ++DOMWINDOW == 56 (0x7f11812cc000) [pid = 1950] [serial = 1074] [outer = (nil)]
11:34:44 INFO - ++DOMWINDOW == 57 (0x7f11835a0800) [pid = 1950] [serial = 1075] [outer = 0x7f11812cc000]
11:34:45 INFO - ++DOCSHELL 0x7f11a1329000 == 24 [pid = 1950] [id = 456]
11:34:45 INFO - ++DOMWINDOW == 58 (0x7f119c611c00) [pid = 1950] [serial = 1076] [outer = (nil)]
11:34:45 INFO - ++DOMWINDOW == 59 (0x7f119c6ac800) [pid = 1950] [serial = 1077] [outer = 0x7f119c611c00]
11:34:45 INFO - ++DOMWINDOW == 60 (0x7f11812d7800) [pid = 1950] [serial = 1078] [outer = 0x7f119c611c00]
11:34:46 INFO - ++DOCSHELL 0x7f11a83e0800 == 25 [pid = 1950] [id = 457]
11:34:46 INFO - ++DOMWINDOW == 61 (0x7f1191da9000) [pid = 1950] [serial = 1079] [outer = (nil)]
11:34:46 INFO - ++DOMWINDOW == 62 (0x7f11a0d5d400) [pid = 1950] [serial = 1080] [outer = 0x7f1191da9000]
11:34:48 INFO - ++DOCSHELL 0x7f11770b5800 == 26 [pid = 1950] [id = 458]
11:34:48 INFO - ++DOMWINDOW == 63 (0x7f118a916400) [pid = 1950] [serial = 1081] [outer = (nil)]
11:34:48 INFO - ++DOMWINDOW == 64 (0x7f118a920c00) [pid = 1950] [serial = 1082] [outer = 0x7f118a916400]
11:34:48 INFO - ++DOMWINDOW == 65 (0x7f118a92b400) [pid = 1950] [serial = 1083] [outer = 0x7f118a916400]
11:34:49 INFO - ++DOCSHELL 0x7f119e00a000 == 27 [pid = 1950] [id = 459]
11:34:49 INFO - ++DOMWINDOW == 66 (0x7f1192681800) [pid = 1950] [serial = 1084] [outer = (nil)]
11:34:49 INFO - ++DOMWINDOW == 67 (0x7f119c6ae400) [pid = 1950] [serial = 1085] [outer = 0x7f1192681800]
11:34:51 INFO - ++DOCSHELL 0x7f1180e22800 == 28 [pid = 1950] [id = 460]
11:34:51 INFO - ++DOMWINDOW == 68 (0x7f11a63ce400) [pid = 1950] [serial = 1086] [outer = (nil)]
11:34:51 INFO - ++DOMWINDOW == 69 (0x7f11a63cec00) [pid = 1950] [serial = 1087] [outer = 0x7f11a63ce400]
11:34:51 INFO - ++DOMWINDOW == 70 (0x7f118d564800) [pid = 1950] [serial = 1088] [outer = 0x7f11a63ce400]
11:34:51 INFO - ++DOCSHELL 0x7f1176f6c800 == 29 [pid = 1950] [id = 461]
11:34:51 INFO - ++DOMWINDOW == 71 (0x7f11a646a800) [pid = 1950] [serial = 1089] [outer = (nil)]
11:34:51 INFO - ++DOMWINDOW == 72 (0x7f11a646e400) [pid = 1950] [serial = 1090] [outer = 0x7f11a646a800]
11:34:56 INFO - MEMORY STAT | vsize 1275MB | residentFast 365MB | heapAllocated 150MB
11:34:56 INFO - 168 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js | took 16125ms
11:34:56 INFO - ++DOCSHELL 0x7f11770c9000 == 30 [pid = 1950] [id = 462]
11:34:56 INFO - ++DOMWINDOW == 73 (0x7f1183e5c000) [pid = 1950] [serial = 1091] [outer = (nil)]
11:34:56 INFO - ++DOMWINDOW == 74 (0x7f1185a99400) [pid = 1950] [serial = 1092] [outer = 0x7f1183e5c000]
11:34:56 INFO - 169 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js
11:34:56 INFO - ++DOCSHELL 0x7f11810c3000 == 31 [pid = 1950] [id = 463]
11:34:56 INFO - ++DOMWINDOW == 75 (0x7f11872b3400) [pid = 1950] [serial = 1093] [outer = (nil)]
11:34:56 INFO - ++DOMWINDOW == 76 (0x7f11872b7400) [pid = 1950] [serial = 1094] [outer = 0x7f11872b3400]
11:34:57 INFO - ++DOCSHELL 0x7f118d53d800 == 32 [pid = 1950] [id = 464]
11:34:57 INFO - ++DOMWINDOW == 77 (0x7f118a32a800) [pid = 1950] [serial = 1095] [outer = (nil)]
11:34:57 INFO - ++DOMWINDOW == 78 (0x7f118a32fc00) [pid = 1950] [serial = 1096] [outer = 0x7f118a32a800]
11:34:57 INFO - ++DOMWINDOW == 79 (0x7f1185a98800) [pid = 1950] [serial = 1097] [outer = 0x7f118a32a800]
11:34:57 INFO - ++DOCSHELL 0x7f119e21b800 == 33 [pid = 1950] [id = 465]
11:34:57 INFO - ++DOMWINDOW == 80 (0x7f118d409800) [pid = 1950] [serial = 1098] [outer = (nil)]
11:34:57 INFO - ++DOMWINDOW == 81 (0x7f118d565000) [pid = 1950] [serial = 1099] [outer = 0x7f118d409800]
11:34:59 INFO - ++DOMWINDOW == 82 (0x7f119f0cc400) [pid = 1950] [serial = 1100] [outer = 0x7f11872b3400]
11:34:59 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:00 INFO - ++DOMWINDOW == 83 (0x7f11a62ee000) [pid = 1950] [serial = 1101] [outer = 0x7f11872b3400]
11:35:00 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:01 INFO - ++DOMWINDOW == 84 (0x7f11a63db400) [pid = 1950] [serial = 1102] [outer = 0x7f11872b3400]
11:35:01 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:01 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 77: TypeError: this._recipeManager is null
11:35:01 INFO - ++DOMWINDOW == 85 (0x7f11a6496800) [pid = 1950] [serial = 1103] [outer = 0x7f11872b3400]
11:35:02 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:02 INFO - ++DOMWINDOW == 86 (0x7f1180f2f000) [pid = 1950] [serial = 1104] [outer = 0x7f11872b3400]
11:35:02 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:03 INFO - --DOCSHELL 0x7f118127e000 == 32 [pid = 1950] [id = 442]
11:35:03 INFO - --DOCSHELL 0x7f11a147f000 == 31 [pid = 1950] [id = 454]
11:35:03 INFO - --DOCSHELL 0x7f1176f1f000 == 30 [pid = 1950] [id = 440]
11:35:03 INFO - --DOCSHELL 0x7f11773ba000 == 29 [pid = 1950] [id = 441]
11:35:03 INFO - --DOCSHELL 0x7f1183653000 == 28 [pid = 1950] [id = 455]
11:35:03 INFO - --DOCSHELL 0x7f11a83e0800 == 27 [pid = 1950] [id = 457]
11:35:03 INFO - --DOCSHELL 0x7f118d544800 == 26 [pid = 1950] [id = 450]
11:35:03 INFO - --DOCSHELL 0x7f118a15c000 == 25 [pid = 1950] [id = 448]
11:35:03 INFO - --DOCSHELL 0x7f118a15f800 == 24 [pid = 1950] [id = 449]
11:35:03 INFO - --DOCSHELL 0x7f119e00a000 == 23 [pid = 1950] [id = 459]
11:35:03 INFO - --DOCSHELL 0x7f1176f6c800 == 22 [pid = 1950] [id = 461]
11:35:03 INFO - --DOCSHELL 0x7f118115b000 == 21 [pid = 1950] [id = 453]
11:35:03 INFO - --DOMWINDOW == 85 (0x7f1176ee2800) [pid = 1950] [serial = 1035] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:03 INFO - --DOMWINDOW == 84 (0x7f1185aa3800) [pid = 1950] [serial = 1023] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:03 INFO - --DOMWINDOW == 83 (0x7f11776eb000) [pid = 1950] [serial = 1015] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:03 INFO - --DOMWINDOW == 82 (0x7f1181edec00) [pid = 1950] [serial = 1037] [outer = (nil)] [url = about:blank]
11:35:04 INFO - --DOMWINDOW == 81 (0x7f118a916800) [pid = 1950] [serial = 1061] [outer = 0x7f11858f4400] [url = about:blank]
11:35:04 INFO - --DOMWINDOW == 80 (0x7f118a91a400) [pid = 1950] [serial = 1062] [outer = 0x7f11858f7400] [url = about:blank]
11:35:04 INFO - --DOMWINDOW == 79 (0x7f11858fdc00) [pid = 1950] [serial = 1058] [outer = 0x7f11858f7400] [url = about:blank]
11:35:04 INFO - --DOMWINDOW == 78 (0x7f11858f7400) [pid = 1950] [serial = 1057] [outer = (nil)] [url = about:blank]
11:35:04 INFO - --DOMWINDOW == 77 (0x7f11858f4400) [pid = 1950] [serial = 1056] [outer = (nil)] [url = about:blank]
11:35:04 INFO - ++DOMWINDOW == 78 (0x7f1180f33800) [pid = 1950] [serial = 1105] [outer = 0x7f11872b3400]
11:35:05 INFO - ++DOMWINDOW == 79 (0x7f11812d3c00) [pid = 1950] [serial = 1106] [outer = 0x7f11872b3400]
11:35:05 INFO - ++DOMWINDOW == 80 (0x7f11835a2000) [pid = 1950] [serial = 1107] [outer = 0x7f11872b3400]
11:35:06 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:06 INFO - ++DOMWINDOW == 81 (0x7f118a937000) [pid = 1950] [serial = 1108] [outer = 0x7f11872b3400]
11:35:06 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:07 INFO - ++DOMWINDOW == 82 (0x7f118a938c00) [pid = 1950] [serial = 1109] [outer = 0x7f11872b3400]
11:35:07 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:09 INFO - --DOMWINDOW == 81 (0x7f118d565800) [pid = 1950] [serial = 1068] [outer = (nil)] [url = about:newtab]
11:35:09 INFO - --DOMWINDOW == 80 (0x7f1176dc5400) [pid = 1950] [serial = 1040] [outer = (nil)] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html]
11:35:09 INFO - --DOMWINDOW == 79 (0x7f1176cc6800) [pid = 1950] [serial = 1038] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 78 (0x7f118a93c400) [pid = 1950] [serial = 1064] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350]
11:35:09 INFO - --DOMWINDOW == 77 (0x7f11812d0c00) [pid = 1950] [serial = 1048] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 76 (0x7f1181497400) [pid = 1950] [serial = 1050] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350]
11:35:09 INFO - --DOMWINDOW == 75 (0x7f1181ee2400) [pid = 1950] [serial = 1052] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350]
11:35:09 INFO - --DOMWINDOW == 74 (0x7f11858f3800) [pid = 1950] [serial = 1059] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 73 (0x7f118a944800) [pid = 1950] [serial = 1066] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350]
11:35:09 INFO - --DOMWINDOW == 72 (0x7f118148d400) [pid = 1950] [serial = 1049] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 71 (0x7f1181d15c00) [pid = 1950] [serial = 1051] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 70 (0x7f1181ee8000) [pid = 1950] [serial = 1053] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 69 (0x7f119c6ac800) [pid = 1950] [serial = 1077] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 68 (0x7f11812cc000) [pid = 1950] [serial = 1074] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:09 INFO - --DOMWINDOW == 67 (0x7f118d570000) [pid = 1950] [serial = 1071] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:09 INFO - --DOMWINDOW == 66 (0x7f1176ee0800) [pid = 1950] [serial = 1042] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:09 INFO - --DOMWINDOW == 65 (0x7f1192681800) [pid = 1950] [serial = 1084] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:09 INFO - --DOMWINDOW == 64 (0x7f1191da9000) [pid = 1950] [serial = 1079] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:09 INFO - --DOMWINDOW == 63 (0x7f11a646a800) [pid = 1950] [serial = 1089] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:09 INFO - --DOMWINDOW == 62 (0x7f118288e000) [pid = 1950] [serial = 1045] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:09 INFO - --DOMWINDOW == 61 (0x7f118a91e400) [pid = 1950] [serial = 1063] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 60 (0x7f118a9b9c00) [pid = 1950] [serial = 1067] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 59 (0x7f11881fd800) [pid = 1950] [serial = 1060] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 58 (0x7f118da9c800) [pid = 1950] [serial = 1069] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 57 (0x7f118d590c00) [pid = 1950] [serial = 1072] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 56 (0x7f1176dd0000) [pid = 1950] [serial = 1041] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 55 (0x7f1176cd0400) [pid = 1950] [serial = 1039] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 54 (0x7f118a32fc00) [pid = 1950] [serial = 1096] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 53 (0x7f118a93ec00) [pid = 1950] [serial = 1065] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 52 (0x7f11a63cec00) [pid = 1950] [serial = 1087] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 51 (0x7f118a920c00) [pid = 1950] [serial = 1082] [outer = (nil)] [url = about:blank]
11:35:09 INFO - --DOMWINDOW == 50 (0x7f1188149400) [pid = 1950] [serial = 1047] [outer = (nil)] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html]
11:35:09 INFO - ++DOMWINDOW == 51 (0x7f1181495c00) [pid = 1950] [serial = 1110] [outer = 0x7f11872b3400]
11:35:09 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:10 INFO - ++DOMWINDOW == 52 (0x7f1188144c00) [pid = 1950] [serial = 1111] [outer = 0x7f11872b3400]
11:35:10 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:10 INFO - --DOCSHELL 0x7f119e21b800 == 20 [pid = 1950] [id = 465]
11:35:12 INFO - --DOCSHELL 0x7f11a1329000 == 19 [pid = 1950] [id = 456]
11:35:12 INFO - --DOCSHELL 0x7f1180e4e000 == 18 [pid = 1950] [id = 444]
11:35:12 INFO - --DOCSHELL 0x7f11770b5800 == 17 [pid = 1950] [id = 458]
11:35:12 INFO - --DOCSHELL 0x7f1180e22800 == 16 [pid = 1950] [id = 460]
11:35:12 INFO - --DOMWINDOW == 51 (0x7f118d586400) [pid = 1950] [serial = 1070] [outer = (nil)] [url = about:newtab]
11:35:12 INFO - --DOMWINDOW == 50 (0x7f1183670000) [pid = 1950] [serial = 1046] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 49 (0x7f11a0d5d400) [pid = 1950] [serial = 1080] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 48 (0x7f11a646e400) [pid = 1950] [serial = 1090] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 47 (0x7f11776f6c00) [pid = 1950] [serial = 1044] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:12 INFO - --DOMWINDOW == 46 (0x7f119c6ae400) [pid = 1950] [serial = 1085] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 45 (0x7f11835a0800) [pid = 1950] [serial = 1075] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 44 (0x7f118dd4f400) [pid = 1950] [serial = 1073] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:12 INFO - --DOMWINDOW == 43 (0x7f11812d3c00) [pid = 1950] [serial = 1106] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-svg.xhtml]
11:35:12 INFO - --DOMWINDOW == 42 (0x7f1180f33800) [pid = 1950] [serial = 1105] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml.xhtml]
11:35:12 INFO - --DOMWINDOW == 41 (0x7f11a6496800) [pid = 1950] [serial = 1103] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html]
11:35:12 INFO - --DOMWINDOW == 40 (0x7f11872b7400) [pid = 1950] [serial = 1094] [outer = (nil)] [url = about:blank]
11:35:12 INFO - --DOMWINDOW == 39 (0x7f1182888800) [pid = 1950] [serial = 1054] [outer = (nil)] [url = chrome://browser/content/browser.xul]
11:35:12 INFO - --DOMWINDOW == 38 (0x7f11835a2000) [pid = 1950] [serial = 1107] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-parser.html]
11:35:12 INFO - --DOMWINDOW == 37 (0x7f11a63db400) [pid = 1950] [serial = 1102] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html]
11:35:12 INFO - --DOMWINDOW == 36 (0x7f11a62ee000) [pid = 1950] [serial = 1101] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-imagemap.html]
11:35:12 INFO - --DOMWINDOW == 35 (0x7f119f0cc400) [pid = 1950] [serial = 1100] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-loader.html]
11:35:13 INFO - MEMORY STAT | vsize 1294MB | residentFast 367MB | heapAllocated 138MB
11:35:13 INFO - 170 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js | took 16191ms
11:35:13 INFO - ++DOCSHELL 0x7f11770ad800 == 17 [pid = 1950] [id = 466]
11:35:13 INFO - ++DOMWINDOW == 36 (0x7f11776ec000) [pid = 1950] [serial = 1112] [outer = (nil)]
11:35:13 INFO - ++DOMWINDOW == 37 (0x7f11776f1c00) [pid = 1950] [serial = 1113] [outer = 0x7f11776ec000]
11:35:13 INFO - 171 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js
11:35:13 INFO - ++DOCSHELL 0x7f1177254800 == 18 [pid = 1950] [id = 467]
11:35:13 INFO - ++DOMWINDOW == 38 (0x7f1176cc7000) [pid = 1950] [serial = 1114] [outer = (nil)]
11:35:13 INFO - ++DOMWINDOW == 39 (0x7f1180f37800) [pid = 1950] [serial = 1115] [outer = 0x7f1176cc7000]
11:35:13 INFO - ++DOMWINDOW == 40 (0x7f11812d9400) [pid = 1950] [serial = 1116] [outer = 0x7f1176cc7000]
11:35:13 INFO - ++DOCSHELL 0x7f1180e02800 == 19 [pid = 1950] [id = 468]
11:35:13 INFO - ++DOMWINDOW == 41 (0x7f1181498400) [pid = 1950] [serial = 1117] [outer = (nil)]
11:35:13 INFO - ++DOMWINDOW == 42 (0x7f1181499000) [pid = 1950] [serial = 1118] [outer = 0x7f1181498400]
11:35:13 INFO - ++DOCSHELL 0x7f1180e0e000 == 20 [pid = 1950] [id = 469]
11:35:13 INFO - ++DOMWINDOW == 43 (0x7f1181ee5400) [pid = 1950] [serial = 1119] [outer = (nil)]
11:35:13 INFO - ++DOCSHELL 0x7f1180e0e800 == 21 [pid = 1950] [id = 470]
11:35:13 INFO - ++DOMWINDOW == 44 (0x7f1181ee6800) [pid = 1950] [serial = 1120] [outer = (nil)]
11:35:14 INFO - ++DOMWINDOW == 45 (0x7f118242fc00) [pid = 1950] [serial = 1121] [outer = 0x7f1181ee6800]
11:35:14 INFO - ++DOCSHELL 0x7f1180f6e800 == 22 [pid = 1950] [id = 471]
11:35:14 INFO - ++DOMWINDOW == 46 (0x7f1181ee4000) [pid = 1950] [serial = 1122] [outer = (nil)]
11:35:14 INFO - ++DOMWINDOW == 47 (0x7f1185aa1800) [pid = 1950] [serial = 1123] [outer = 0x7f1181ee4000]
11:35:14 INFO - ++DOMWINDOW == 48 (0x7f1187583c00) [pid = 1950] [serial = 1124] [outer = 0x7f1181ee5400]
11:35:14 INFO - ++DOMWINDOW == 49 (0x7f1188149000) [pid = 1950] [serial = 1125] [outer = 0x7f1181ee6800]
11:35:14 INFO - ++DOMWINDOW == 50 (0x7f11881f6000) [pid = 1950] [serial = 1126] [outer = 0x7f1181ee4000]
11:35:15 INFO - ++DOCSHELL 0x7f11824ad800 == 23 [pid = 1950] [id = 472]
11:35:15 INFO - ++DOMWINDOW == 51 (0x7f1182749800) [pid = 1950] [serial = 1127] [outer = (nil)]
11:35:15 INFO - ++DOMWINDOW == 52 (0x7f118ce95400) [pid = 1950] [serial = 1128] [outer = 0x7f1182749800]
11:35:15 INFO - ++DOMWINDOW == 53 (0x7f118a9bc400) [pid = 1950] [serial = 1129] [outer = 0x7f1182749800]
11:35:15 INFO - ++DOCSHELL 0x7f1180f6f800 == 24 [pid = 1950] [id = 473]
11:35:15 INFO - ++DOMWINDOW == 54 (0x7f118ce97000) [pid = 1950] [serial = 1130] [outer = (nil)]
11:35:15 INFO - ++DOMWINDOW == 55 (0x7f118d56dc00) [pid = 1950] [serial = 1131] [outer = 0x7f118ce97000]
11:35:16 INFO - ++DOCSHELL 0x7f118364b800 == 25 [pid = 1950] [id = 474]
11:35:16 INFO - ++DOMWINDOW == 56 (0x7f118a9c0000) [pid = 1950] [serial = 1132] [outer = (nil)]
11:35:16 INFO - ++DOMWINDOW == 57 (0x7f118d56b400) [pid = 1950] [serial = 1133] [outer = 0x7f118a9c0000]
11:35:16 INFO - ++DOCSHELL 0x7f1185a25000 == 26 [pid = 1950] [id = 475]
11:35:16 INFO - ++DOMWINDOW == 58 (0x7f118d586400) [pid = 1950] [serial = 1134] [outer = (nil)]
11:35:16 INFO - ++DOMWINDOW == 59 (0x7f118d746400) [pid = 1950] [serial = 1135] [outer = 0x7f118d586400]
11:35:16 INFO - ++DOMWINDOW == 60 (0x7f118db04000) [pid = 1950] [serial = 1136] [outer = 0x7f118ce97000]
11:35:17 INFO - ++DOMWINDOW == 61 (0x7f1176cca000) [pid = 1950] [serial = 1137] [outer = 0x7f118a9c0000]
11:35:17 INFO - ++DOMWINDOW == 62 (0x7f1177397400) [pid = 1950] [serial = 1138] [outer = 0x7f118d586400]
11:35:17 INFO - [1950] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175
11:35:18 INFO - ++DOCSHELL 0x7f1180e4d000 == 27 [pid = 1950] [id = 476]
11:35:18 INFO - ++DOMWINDOW == 63 (0x7f1182847c00) [pid = 1950] [serial = 1139] [outer = (nil)]
11:35:18 INFO - ++DOMWINDOW == 64 (0x7f1183671400) [pid = 1950] [serial = 1140] [outer = 0x7f1182847c00]
11:35:18 INFO - ++DOCSHELL 0x7f11810b1800 == 28 [pid = 1950] [id = 477]
11:35:18 INFO - ++DOMWINDOW == 65 (0x7f1183a7d800) [pid = 1950] [serial = 1141] [outer = (nil)]
11:35:18 INFO - ++DOMWINDOW == 66 (0x7f118461f800) [pid = 1950] [serial = 1142] [outer = 0x7f1183a7d800]
11:35:23 INFO - --DOCSHELL 0x7f119198c000 == 27 [pid = 1950] [id = 452]
11:35:23 INFO - --DOCSHELL 0x7f118282b800 == 26 [pid = 1950] [id = 446]
11:35:23 INFO - --DOCSHELL 0x7f1181270000 == 25 [pid = 1950] [id = 451]
11:35:23 INFO - --DOCSHELL 0x7f11827e9800 == 24 [pid = 1950] [id = 445]
11:35:23 INFO - --DOCSHELL 0x7f1185a35000 == 23 [pid = 1950] [id = 447]
11:35:23 INFO - --DOCSHELL 0x7f118d53d800 == 22 [pid = 1950] [id = 464]
11:35:23 INFO - --DOCSHELL 0x7f1180e4d000 == 21 [pid = 1950] [id = 476]
11:35:23 INFO - --DOCSHELL 0x7f11810c3000 == 20 [pid = 1950] [id = 463]
11:35:23 INFO - --DOCSHELL 0x7f11770c9000 == 19 [pid = 1950] [id = 462]
11:35:23 INFO - --DOMWINDOW == 65 (0x7f1182889800) [pid = 1950] [serial = 1055] [outer = (nil)] [url = about:blank]
11:35:23 INFO - --DOMWINDOW == 64 (0x7f118242fc00) [pid = 1950] [serial = 1121] [outer = 0x7f1181ee6800] [url = about:blank]
11:35:23 INFO - --DOCSHELL 0x7f11810b1800 == 18 [pid = 1950] [id = 477]
11:35:24 INFO - --DOMWINDOW == 63 (0x7f1182847c00) [pid = 1950] [serial = 1139] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:24 INFO - --DOMWINDOW == 62 (0x7f118d56dc00) [pid = 1950] [serial = 1131] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 61 (0x7f118d56b400) [pid = 1950] [serial = 1133] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 60 (0x7f118d746400) [pid = 1950] [serial = 1135] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 59 (0x7f118ce95400) [pid = 1950] [serial = 1128] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 58 (0x7f1185aa1800) [pid = 1950] [serial = 1123] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 57 (0x7f11872b3400) [pid = 1950] [serial = 1093] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html]
11:35:24 INFO - --DOMWINDOW == 56 (0x7f1180f37800) [pid = 1950] [serial = 1115] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 55 (0x7f1185a99400) [pid = 1950] [serial = 1092] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 54 (0x7f1183e5c000) [pid = 1950] [serial = 1091] [outer = (nil)] [url = about:blank]
11:35:24 INFO - --DOMWINDOW == 53 (0x7f118a916400) [pid = 1950] [serial = 1081] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:24 INFO - --DOMWINDOW == 52 (0x7f11a63ce400) [pid = 1950] [serial = 1086] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:24 INFO - --DOMWINDOW == 51 (0x7f118a32a800) [pid = 1950] [serial = 1095] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:24 INFO - --DOMWINDOW == 50 (0x7f118d409800) [pid = 1950] [serial = 1098] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:24 INFO - --DOMWINDOW == 49 (0x7f119c611c00) [pid = 1950] [serial = 1076] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:24 INFO - --DOMWINDOW == 48 (0x7f1188144c00) [pid = 1950] [serial = 1111] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html]
11:35:24 INFO - --DOMWINDOW == 47 (0x7f1180f2f000) [pid = 1950] [serial = 1104] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-workers.html]
11:35:24 INFO - --DOMWINDOW == 46 (0x7f118a937000) [pid = 1950] [serial = 1108] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml-external.html]
11:35:24 INFO - --DOMWINDOW == 45 (0x7f118a938c00) [pid = 1950] [serial = 1109] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-empty-getelementbyid.html]
11:35:24 INFO - --DOMWINDOW == 44 (0x7f1181495c00) [pid = 1950] [serial = 1110] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-canvas-css.html]
11:35:25 INFO - --DOCSHELL 0x7f118364b800 == 17 [pid = 1950] [id = 474]
11:35:25 INFO - --DOCSHELL 0x7f1185a25000 == 16 [pid = 1950] [id = 475]
11:35:25 INFO - --DOMWINDOW == 43 (0x7f118a92b400) [pid = 1950] [serial = 1083] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:25 INFO - --DOMWINDOW == 42 (0x7f118d564800) [pid = 1950] [serial = 1088] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:25 INFO - --DOMWINDOW == 41 (0x7f1185a98800) [pid = 1950] [serial = 1097] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:25 INFO - --DOMWINDOW == 40 (0x7f118d565000) [pid = 1950] [serial = 1099] [outer = (nil)] [url = about:blank]
11:35:25 INFO - --DOMWINDOW == 39 (0x7f1183671400) [pid = 1950] [serial = 1140] [outer = (nil)] [url = about:blank]
11:35:25 INFO - --DOMWINDOW == 38 (0x7f11812d7800) [pid = 1950] [serial = 1078] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:25 INFO - --DOMWINDOW == 37 (0x7f1183a7d800) [pid = 1950] [serial = 1141] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:26 INFO - MEMORY STAT | vsize 1288MB | residentFast 348MB | heapAllocated 134MB
11:35:26 INFO - 172 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js | took 13097ms
11:35:26 INFO - ++DOCSHELL 0x7f11770b0000 == 17 [pid = 1950] [id = 478]
11:35:26 INFO - ++DOMWINDOW == 38 (0x7f1180f2fc00) [pid = 1950] [serial = 1143] [outer = (nil)]
11:35:26 INFO - ++DOMWINDOW == 39 (0x7f1180f34c00) [pid = 1950] [serial = 1144] [outer = 0x7f1180f2fc00]
11:35:26 INFO - 173 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js
11:35:26 INFO - ++DOCSHELL 0x7f1177253000 == 18 [pid = 1950] [id = 479]
11:35:26 INFO - ++DOMWINDOW == 40 (0x7f118114dc00) [pid = 1950] [serial = 1145] [outer = (nil)]
11:35:26 INFO - ++DOMWINDOW == 41 (0x7f11812d2400) [pid = 1950] [serial = 1146] [outer = 0x7f118114dc00]
11:35:27 INFO - ++DOMWINDOW == 42 (0x7f1185a9e400) [pid = 1950] [serial = 1147] [outer = 0x7f118114dc00]
11:35:27 INFO - ++DOCSHELL 0x7f117724f800 == 19 [pid = 1950] [id = 480]
11:35:27 INFO - ++DOMWINDOW == 43 (0x7f11812d5000) [pid = 1950] [serial = 1148] [outer = (nil)]
11:35:27 INFO - ++DOMWINDOW == 44 (0x7f1181edd400) [pid = 1950] [serial = 1149] [outer = 0x7f11812d5000]
11:35:27 INFO - ++DOMWINDOW == 45 (0x7f118148e400) [pid = 1950] [serial = 1150] [outer = 0x7f11812d5000]
11:35:28 INFO - ++DOCSHELL 0x7f1180e35800 == 20 [pid = 1950] [id = 481]
11:35:28 INFO - ++DOMWINDOW == 46 (0x7f11838c3000) [pid = 1950] [serial = 1151] [outer = (nil)]
11:35:28 INFO - ++DOMWINDOW == 47 (0x7f1183ca8c00) [pid = 1950] [serial = 1152] [outer = 0x7f11838c3000]
11:35:30 INFO - --DOCSHELL 0x7f11770ad800 == 19 [pid = 1950] [id = 466]
11:35:30 INFO - --DOCSHELL 0x7f1177254800 == 18 [pid = 1950] [id = 467]
11:35:30 INFO - --DOCSHELL 0x7f1180e02800 == 17 [pid = 1950] [id = 468]
11:35:30 INFO - --DOCSHELL 0x7f1180f6e800 == 16 [pid = 1950] [id = 471]
11:35:30 INFO - --DOCSHELL 0x7f11824ad800 == 15 [pid = 1950] [id = 472]
11:35:30 INFO - --DOCSHELL 0x7f1180e0e000 == 14 [pid = 1950] [id = 469]
11:35:30 INFO - --DOCSHELL 0x7f1180e0e800 == 13 [pid = 1950] [id = 470]
11:35:30 INFO - --DOCSHELL 0x7f1180f6f800 == 12 [pid = 1950] [id = 473]
11:35:30 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.js, line 7: ReferenceError: bogus is not defined
11:35:30 INFO - --DOMWINDOW == 46 (0x7f118461f800) [pid = 1950] [serial = 1142] [outer = (nil)] [url = about:blank]
11:35:30 INFO - --DOMWINDOW == 45 (0x7f1187583c00) [pid = 1950] [serial = 1124] [outer = 0x7f1181ee5400] [url = about:blank]
11:35:30 INFO - --DOMWINDOW == 44 (0x7f1188149000) [pid = 1950] [serial = 1125] [outer = 0x7f1181ee6800] [url = about:blank]
11:35:30 INFO - --DOMWINDOW == 43 (0x7f1181ee5400) [pid = 1950] [serial = 1119] [outer = (nil)] [url = about:blank]
11:35:30 INFO - --DOMWINDOW == 42 (0x7f1181ee6800) [pid = 1950] [serial = 1120] [outer = (nil)] [url = about:blank]
11:35:30 INFO - --DOCSHELL 0x7f1180e35800 == 11 [pid = 1950] [id = 481]
11:35:31 INFO - --DOCSHELL 0x7f117724f800 == 10 [pid = 1950] [id = 480]
11:35:32 INFO - --DOMWINDOW == 41 (0x7f118a9c0000) [pid = 1950] [serial = 1132] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:32 INFO - --DOMWINDOW == 40 (0x7f1182749800) [pid = 1950] [serial = 1127] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:35:32 INFO - --DOMWINDOW == 39 (0x7f1181ee4000) [pid = 1950] [serial = 1122] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 38 (0x7f1176cc7000) [pid = 1950] [serial = 1114] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:35:32 INFO - --DOMWINDOW == 37 (0x7f11776ec000) [pid = 1950] [serial = 1112] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 36 (0x7f118ce97000) [pid = 1950] [serial = 1130] [outer = (nil)] [url = about:newtab]
11:35:32 INFO - --DOMWINDOW == 35 (0x7f11812d2400) [pid = 1950] [serial = 1146] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 34 (0x7f11881f6000) [pid = 1950] [serial = 1126] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 33 (0x7f11776f1c00) [pid = 1950] [serial = 1113] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 32 (0x7f1181edd400) [pid = 1950] [serial = 1149] [outer = (nil)] [url = about:blank]
11:35:32 INFO - --DOMWINDOW == 31 (0x7f1181498400) [pid = 1950] [serial = 1117] [outer = (nil)] [url = chrome://browser/content/browser.xul]
11:35:32 INFO - --DOMWINDOW == 30 (0x7f118d586400) [pid = 1950] [serial = 1134] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:32 INFO - --DOMWINDOW == 29 (0x7f118a9bc400) [pid = 1950] [serial = 1129] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:35:32 INFO - --DOMWINDOW == 28 (0x7f11812d9400) [pid = 1950] [serial = 1116] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:35:32 INFO - MEMORY STAT | vsize 1277MB | residentFast 328MB | heapAllocated 128MB
11:35:32 INFO - 174 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js | took 5805ms
11:35:32 INFO - ++DOCSHELL 0x7f1176f14000 == 11 [pid = 1950] [id = 482]
11:35:32 INFO - ++DOMWINDOW == 29 (0x7f1176dce800) [pid = 1950] [serial = 1153] [outer = (nil)]
11:35:32 INFO - ++DOMWINDOW == 30 (0x7f117738a400) [pid = 1950] [serial = 1154] [outer = 0x7f1176dce800]
11:35:32 INFO - 175 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js
11:35:33 INFO - MEMORY STAT | vsize 1278MB | residentFast 329MB | heapAllocated 129MB
11:35:33 INFO - 176 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js | took 536ms
11:35:33 INFO - ++DOCSHELL 0x7f11770c8000 == 12 [pid = 1950] [id = 483]
11:35:33 INFO - ++DOMWINDOW == 31 (0x7f11776f1400) [pid = 1950] [serial = 1155] [outer = (nil)]
11:35:33 INFO - ++DOMWINDOW == 32 (0x7f11776f5000) [pid = 1950] [serial = 1156] [outer = 0x7f11776f1400]
11:35:33 INFO - 177 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js
11:35:33 INFO - ++DOCSHELL 0x7f1177260000 == 13 [pid = 1950] [id = 484]
11:35:33 INFO - ++DOMWINDOW == 33 (0x7f1180f33400) [pid = 1950] [serial = 1157] [outer = (nil)]
11:35:33 INFO - ++DOMWINDOW == 34 (0x7f1180f37800) [pid = 1950] [serial = 1158] [outer = 0x7f1180f33400]
11:35:34 INFO - ++DOMWINDOW == 35 (0x7f11812d0000) [pid = 1950] [serial = 1159] [outer = 0x7f1180f33400]
11:35:34 INFO - ++DOCSHELL 0x7f11770bd000 == 14 [pid = 1950] [id = 485]
11:35:34 INFO - ++DOMWINDOW == 36 (0x7f118113f800) [pid = 1950] [serial = 1160] [outer = (nil)]
11:35:34 INFO - ++DOMWINDOW == 37 (0x7f118148c000) [pid = 1950] [serial = 1161] [outer = 0x7f118113f800]
11:35:34 INFO - ++DOMWINDOW == 38 (0x7f11812ce400) [pid = 1950] [serial = 1162] [outer = 0x7f118113f800]
11:35:34 INFO - ++DOCSHELL 0x7f1180f65000 == 15 [pid = 1950] [id = 486]
11:35:34 INFO - ++DOMWINDOW == 39 (0x7f1181f55400) [pid = 1950] [serial = 1163] [outer = (nil)]
11:35:34 INFO - ++DOMWINDOW == 40 (0x7f1182424000) [pid = 1950] [serial = 1164] [outer = 0x7f1181f55400]
11:35:40 INFO - ++DOMWINDOW == 41 (0x7f119e0cc800) [pid = 1950] [serial = 1165] [outer = 0x7f1180f33400]
11:35:40 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:42 INFO - MEMORY STAT | vsize 1281MB | residentFast 341MB | heapAllocated 141MB
11:35:42 INFO - 178 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js | took 8393ms
11:35:42 INFO - ++DOCSHELL 0x7f1176f12000 == 16 [pid = 1950] [id = 487]
11:35:42 INFO - ++DOMWINDOW == 42 (0x7f1181490800) [pid = 1950] [serial = 1166] [outer = (nil)]
11:35:42 INFO - ++DOMWINDOW == 43 (0x7f1181ee1400) [pid = 1950] [serial = 1167] [outer = 0x7f1181490800]
11:35:42 INFO - 179 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js
11:35:42 INFO - ++DOCSHELL 0x7f1180e14000 == 17 [pid = 1950] [id = 488]
11:35:42 INFO - ++DOMWINDOW == 44 (0x7f1181493c00) [pid = 1950] [serial = 1168] [outer = (nil)]
11:35:42 INFO - ++DOMWINDOW == 45 (0x7f118533e000) [pid = 1950] [serial = 1169] [outer = 0x7f1181493c00]
11:35:42 INFO - ++DOMWINDOW == 46 (0x7f119eed1c00) [pid = 1950] [serial = 1170] [outer = 0x7f1181493c00]
11:35:42 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined
11:35:43 INFO - ++DOCSHELL 0x7f1181512000 == 18 [pid = 1950] [id = 489]
11:35:43 INFO - ++DOMWINDOW == 47 (0x7f119f0cc400) [pid = 1950] [serial = 1171] [outer = (nil)]
11:35:43 INFO - ++DOMWINDOW == 48 (0x7f119f0ccc00) [pid = 1950] [serial = 1172] [outer = 0x7f119f0cc400]
11:35:43 INFO - ++DOMWINDOW == 49 (0x7f119c6ae400) [pid = 1950] [serial = 1173] [outer = 0x7f119f0cc400]
11:35:43 INFO - ++DOCSHELL 0x7f118249e800 == 19 [pid = 1950] [id = 490]
11:35:43 INFO - ++DOMWINDOW == 50 (0x7f11a14c7800) [pid = 1950] [serial = 1174] [outer = (nil)]
11:35:43 INFO - ++DOMWINDOW == 51 (0x7f11872bac00) [pid = 1950] [serial = 1175] [outer = 0x7f11a14c7800]
11:35:45 INFO - ++DOMWINDOW == 52 (0x7f11a63dc800) [pid = 1950] [serial = 1176] [outer = 0x7f1181493c00]
11:35:45 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:46 INFO - --DOCSHELL 0x7f1176f14000 == 18 [pid = 1950] [id = 482]
11:35:46 INFO - --DOCSHELL 0x7f11770b0000 == 17 [pid = 1950] [id = 478]
11:35:46 INFO - --DOCSHELL 0x7f1177253000 == 16 [pid = 1950] [id = 479]
11:35:46 INFO - --DOCSHELL 0x7f11770bd000 == 15 [pid = 1950] [id = 485]
11:35:46 INFO - --DOCSHELL 0x7f1180f65000 == 14 [pid = 1950] [id = 486]
11:35:46 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined
11:35:47 INFO - --DOMWINDOW == 51 (0x7f1181499000) [pid = 1950] [serial = 1118] [outer = (nil)] [url = about:blank]
11:35:47 INFO - --DOMWINDOW == 50 (0x7f118db04000) [pid = 1950] [serial = 1136] [outer = (nil)] [url = about:newtab]
11:35:47 INFO - --DOMWINDOW == 49 (0x7f1176cca000) [pid = 1950] [serial = 1137] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:47 INFO - --DOMWINDOW == 48 (0x7f1177397400) [pid = 1950] [serial = 1138] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:47 INFO - --DOCSHELL 0x7f118249e800 == 13 [pid = 1950] [id = 490]
11:35:48 INFO - --DOCSHELL 0x7f11770c8000 == 12 [pid = 1950] [id = 483]
11:35:48 INFO - --DOCSHELL 0x7f1181512000 == 11 [pid = 1950] [id = 489]
11:35:49 INFO - ++DOCSHELL 0x7f1176f77000 == 12 [pid = 1950] [id = 491]
11:35:49 INFO - ++DOMWINDOW == 49 (0x7f1176dce000) [pid = 1950] [serial = 1177] [outer = (nil)]
11:35:49 INFO - ++DOMWINDOW == 50 (0x7f1176ed8000) [pid = 1950] [serial = 1178] [outer = 0x7f1176dce000]
11:35:49 INFO - --DOMWINDOW == 49 (0x7f11812d5000) [pid = 1950] [serial = 1148] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:49 INFO - --DOMWINDOW == 48 (0x7f11838c3000) [pid = 1950] [serial = 1151] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:49 INFO - --DOMWINDOW == 47 (0x7f1181f55400) [pid = 1950] [serial = 1163] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:35:49 INFO - --DOMWINDOW == 46 (0x7f118113f800) [pid = 1950] [serial = 1160] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:35:49 INFO - --DOMWINDOW == 45 (0x7f1180f2fc00) [pid = 1950] [serial = 1143] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 44 (0x7f1176dce800) [pid = 1950] [serial = 1153] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 43 (0x7f118114dc00) [pid = 1950] [serial = 1145] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html]
11:35:49 INFO - --DOMWINDOW == 42 (0x7f1180f37800) [pid = 1950] [serial = 1158] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 41 (0x7f11776f5000) [pid = 1950] [serial = 1156] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 40 (0x7f1180f33400) [pid = 1950] [serial = 1157] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html]
11:35:49 INFO - --DOMWINDOW == 39 (0x7f11776f1400) [pid = 1950] [serial = 1155] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 38 (0x7f1180f34c00) [pid = 1950] [serial = 1144] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 37 (0x7f117738a400) [pid = 1950] [serial = 1154] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 36 (0x7f118533e000) [pid = 1950] [serial = 1169] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 35 (0x7f119f0ccc00) [pid = 1950] [serial = 1172] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 34 (0x7f118148c000) [pid = 1950] [serial = 1161] [outer = (nil)] [url = about:blank]
11:35:49 INFO - --DOMWINDOW == 33 (0x7f11812d0000) [pid = 1950] [serial = 1159] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html]
11:35:49 INFO - --DOMWINDOW == 32 (0x7f119eed1c00) [pid = 1950] [serial = 1170] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:35:49 INFO - --DOMWINDOW == 31 (0x7f119e0cc800) [pid = 1950] [serial = 1165] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html]
11:35:49 INFO - ++DOMWINDOW == 32 (0x7f11776ed400) [pid = 1950] [serial = 1179] [outer = 0x7f1176dce000]
11:35:49 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined
11:35:49 INFO - ++DOCSHELL 0x7f1177253800 == 13 [pid = 1950] [id = 492]
11:35:49 INFO - ++DOMWINDOW == 33 (0x7f1180f34c00) [pid = 1950] [serial = 1180] [outer = (nil)]
11:35:49 INFO - ++DOMWINDOW == 34 (0x7f1180f35c00) [pid = 1950] [serial = 1181] [outer = 0x7f1180f34c00]
11:35:49 INFO - ++DOMWINDOW == 35 (0x7f1180f2b400) [pid = 1950] [serial = 1182] [outer = 0x7f1180f34c00]
11:35:50 INFO - ++DOCSHELL 0x7f1180e06000 == 14 [pid = 1950] [id = 493]
11:35:50 INFO - ++DOMWINDOW == 36 (0x7f1181d13000) [pid = 1950] [serial = 1183] [outer = (nil)]
11:35:50 INFO - ++DOMWINDOW == 37 (0x7f1181edd000) [pid = 1950] [serial = 1184] [outer = 0x7f1181d13000]
11:35:51 INFO - ++DOMWINDOW == 38 (0x7f118283d800) [pid = 1950] [serial = 1185] [outer = 0x7f1176dce000]
11:35:51 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:51 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined
11:35:52 INFO - MEMORY STAT | vsize 1284MB | residentFast 337MB | heapAllocated 132MB
11:35:52 INFO - 180 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js | took 10541ms
11:35:52 INFO - ++DOCSHELL 0x7f1176f1d800 == 15 [pid = 1950] [id = 494]
11:35:52 INFO - ++DOMWINDOW == 39 (0x7f1176cca000) [pid = 1950] [serial = 1186] [outer = (nil)]
11:35:53 INFO - ++DOMWINDOW == 40 (0x7f1176db2400) [pid = 1950] [serial = 1187] [outer = 0x7f1176cca000]
11:35:53 INFO - 181 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js
11:35:53 INFO - ++DOCSHELL 0x7f11770b0800 == 16 [pid = 1950] [id = 495]
11:35:53 INFO - ++DOMWINDOW == 41 (0x7f117738dc00) [pid = 1950] [serial = 1188] [outer = (nil)]
11:35:53 INFO - ++DOMWINDOW == 42 (0x7f11776eb000) [pid = 1950] [serial = 1189] [outer = 0x7f117738dc00]
11:35:53 INFO - ++DOCSHELL 0x7f1180e02800 == 17 [pid = 1950] [id = 496]
11:35:53 INFO - ++DOMWINDOW == 43 (0x7f11812cdc00) [pid = 1950] [serial = 1190] [outer = (nil)]
11:35:53 INFO - ++DOMWINDOW == 44 (0x7f11812cf000) [pid = 1950] [serial = 1191] [outer = 0x7f11812cdc00]
11:35:54 INFO - ++DOMWINDOW == 45 (0x7f1180f33800) [pid = 1950] [serial = 1192] [outer = 0x7f11812cdc00]
11:35:54 INFO - ++DOCSHELL 0x7f1180f6b800 == 18 [pid = 1950] [id = 497]
11:35:54 INFO - ++DOMWINDOW == 46 (0x7f1176cd1000) [pid = 1950] [serial = 1193] [outer = (nil)]
11:35:54 INFO - ++DOMWINDOW == 47 (0x7f11838c0400) [pid = 1950] [serial = 1194] [outer = 0x7f1176cd1000]
11:35:56 INFO - ++DOMWINDOW == 48 (0x7f1188144400) [pid = 1950] [serial = 1195] [outer = 0x7f117738dc00]
11:35:56 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:57 INFO - ++DOMWINDOW == 49 (0x7f11881f4c00) [pid = 1950] [serial = 1196] [outer = 0x7f117738dc00]
11:35:57 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:35:58 INFO - MEMORY STAT | vsize 1287MB | residentFast 348MB | heapAllocated 140MB
11:35:58 INFO - 182 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js | took 5185ms
11:35:58 INFO - ++DOCSHELL 0x7f1180e33800 == 19 [pid = 1950] [id = 498]
11:35:58 INFO - ++DOMWINDOW == 50 (0x7f1185a93c00) [pid = 1950] [serial = 1197] [outer = (nil)]
11:35:58 INFO - ++DOMWINDOW == 51 (0x7f1185aa8c00) [pid = 1950] [serial = 1198] [outer = 0x7f1185a93c00]
11:35:58 INFO - 183 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js
11:35:58 INFO - ++DOCSHELL 0x7f1182827800 == 20 [pid = 1950] [id = 499]
11:35:58 INFO - ++DOMWINDOW == 52 (0x7f118a914c00) [pid = 1950] [serial = 1199] [outer = (nil)]
11:35:58 INFO - ++DOMWINDOW == 53 (0x7f118a91bc00) [pid = 1950] [serial = 1200] [outer = 0x7f118a914c00]
11:35:59 INFO - ++DOCSHELL 0x7f1183e47000 == 21 [pid = 1950] [id = 500]
11:35:59 INFO - ++DOMWINDOW == 54 (0x7f118a9b8400) [pid = 1950] [serial = 1201] [outer = (nil)]
11:35:59 INFO - ++DOMWINDOW == 55 (0x7f118a9ba800) [pid = 1950] [serial = 1202] [outer = 0x7f118a9b8400]
11:35:59 INFO - ++DOMWINDOW == 56 (0x7f1185a9b000) [pid = 1950] [serial = 1203] [outer = 0x7f118a9b8400]
11:36:00 INFO - ++DOCSHELL 0x7f1185a2a800 == 22 [pid = 1950] [id = 501]
11:36:00 INFO - ++DOMWINDOW == 57 (0x7f118d40e400) [pid = 1950] [serial = 1204] [outer = (nil)]
11:36:00 INFO - ++DOMWINDOW == 58 (0x7f118d567000) [pid = 1950] [serial = 1205] [outer = 0x7f118d40e400]
11:36:01 INFO - ++DOMWINDOW == 59 (0x7f1190abdc00) [pid = 1950] [serial = 1206] [outer = 0x7f118a914c00]
11:36:01 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:36:03 INFO - MEMORY STAT | vsize 1305MB | residentFast 357MB | heapAllocated 147MB
11:36:03 INFO - 184 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js | took 4256ms
11:36:03 INFO - ++DOCSHELL 0x7f1180f75000 == 23 [pid = 1950] [id = 502]
11:36:03 INFO - ++DOMWINDOW == 60 (0x7f118a915000) [pid = 1950] [serial = 1207] [outer = (nil)]
11:36:03 INFO - ++DOMWINDOW == 61 (0x7f118db09000) [pid = 1950] [serial = 1208] [outer = 0x7f118a915000]
11:36:03 INFO - 185 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js
11:36:03 INFO - ++DOCSHELL 0x7f118d52c000 == 24 [pid = 1950] [id = 503]
11:36:03 INFO - ++DOMWINDOW == 62 (0x7f1192680c00) [pid = 1950] [serial = 1209] [outer = (nil)]
11:36:03 INFO - ++DOMWINDOW == 63 (0x7f1196403800) [pid = 1950] [serial = 1210] [outer = 0x7f1192680c00]
11:36:03 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/tilt/tilt.js, line 263: ReferenceError: reference to undefined property this.visualizers[this.currentWindowId]
11:36:04 INFO - ++DOCSHELL 0x7f118d545800 == 25 [pid = 1950] [id = 504]
11:36:04 INFO - ++DOMWINDOW == 64 (0x7f118dd4d800) [pid = 1950] [serial = 1211] [outer = (nil)]
11:36:04 INFO - ++DOMWINDOW == 65 (0x7f119c6acc00) [pid = 1950] [serial = 1212] [outer = 0x7f118dd4d800]
11:36:04 INFO - ++DOMWINDOW == 66 (0x7f118dd4f400) [pid = 1950] [serial = 1213] [outer = 0x7f118dd4d800]
11:36:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js, line 989: ReferenceError: reference to undefined property aPacket.type
11:36:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/attach-thread.js, line 65: ReferenceError: reference to undefined property res.error
11:36:04 INFO - ++DOCSHELL 0x7f118de28000 == 26 [pid = 1950] [id = 505]
11:36:04 INFO - ++DOMWINDOW == 67 (0x7f119f0cec00) [pid = 1950] [serial = 1214] [outer = (nil)]
11:36:04 INFO - ++DOMWINDOW == 68 (0x7f11a0d5d400) [pid = 1950] [serial = 1215] [outer = 0x7f119f0cec00]
11:36:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/commands/commands.js, line 293: ReferenceError: reference to undefined property this.paramSpec.manual
11:36:05 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/system.js, line 366: ReferenceError: reference to undefined property command.front
11:36:05 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 339: ReferenceError: reference to undefined property this._splitConsole
11:36:06 INFO - ++DOMWINDOW == 69 (0x7f11a3b45800) [pid = 1950] [serial = 1216] [outer = 0x7f1192680c00]
11:36:06 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:36:07 INFO - --DOCSHELL 0x7f1177260000 == 25 [pid = 1950] [id = 484]
11:36:07 INFO - --DOCSHELL 0x7f1176f77000 == 24 [pid = 1950] [id = 491]
11:36:07 INFO - --DOCSHELL 0x7f1177253800 == 23 [pid = 1950] [id = 492]
11:36:07 INFO - --DOCSHELL 0x7f1180e06000 == 22 [pid = 1950] [id = 493]
11:36:07 INFO - --DOCSHELL 0x7f1180f6b800 == 21 [pid = 1950] [id = 497]
11:36:07 INFO - --DOCSHELL 0x7f1185a2a800 == 20 [pid = 1950] [id = 501]
11:36:07 INFO - --DOCSHELL 0x7f1176f12000 == 19 [pid = 1950] [id = 487]
11:36:07 INFO - --DOCSHELL 0x7f1180e14000 == 18 [pid = 1950] [id = 488]
11:36:07 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 6: ReferenceError: assignment to undeclared variable foobarBug601177strictError
11:36:07 INFO - JavaScript strict warning: chrome://mochikit/content/tests/SimpleTest/TestRunner.js, line 237: ReferenceError: reference to undefined property message.level
11:36:07 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 8: TypeError: window.foobarBug601177exception is not a function
11:36:07 INFO - --DOMWINDOW == 68 (0x7f1182424000) [pid = 1950] [serial = 1164] [outer = (nil)] [url = about:blank]
11:36:07 INFO - --DOMWINDOW == 67 (0x7f11812ce400) [pid = 1950] [serial = 1162] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:07 INFO - --DOMWINDOW == 66 (0x7f1183ca8c00) [pid = 1950] [serial = 1152] [outer = (nil)] [url = about:blank]
11:36:07 INFO - --DOMWINDOW == 65 (0x7f118148e400) [pid = 1950] [serial = 1150] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:07 INFO - --DOMWINDOW == 64 (0x7f1185a9e400) [pid = 1950] [serial = 1147] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html]
11:36:07 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:36:07 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html, line 8: ReferenceError: reference to undefined property window.undefinedPropertyBug601177
11:36:08 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:36:08 INFO - --DOCSHELL 0x7f118de28000 == 17 [pid = 1950] [id = 505]
11:36:09 INFO - MEMORY STAT | vsize 1304MB | residentFast 360MB | heapAllocated 142MB
11:36:09 INFO - 186 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js | took 5712ms
11:36:09 INFO - ++DOCSHELL 0x7f1176f1f800 == 18 [pid = 1950] [id = 506]
11:36:09 INFO - ++DOMWINDOW == 65 (0x7f11812d9000) [pid = 1950] [serial = 1217] [outer = (nil)]
11:36:09 INFO - ++DOMWINDOW == 66 (0x7f1181491400) [pid = 1950] [serial = 1218] [outer = 0x7f11812d9000]
11:36:09 INFO - 187 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js
11:36:09 INFO - ++DOCSHELL 0x7f117725d000 == 19 [pid = 1950] [id = 507]
11:36:09 INFO - ++DOMWINDOW == 67 (0x7f1181edd800) [pid = 1950] [serial = 1219] [outer = (nil)]
11:36:09 INFO - ++DOMWINDOW == 68 (0x7f1181ee4400) [pid = 1950] [serial = 1220] [outer = 0x7f1181edd800]
11:36:09 INFO - ++DOCSHELL 0x7f11773b5000 == 20 [pid = 1950] [id = 508]
11:36:09 INFO - ++DOMWINDOW == 69 (0x7f1181ee6800) [pid = 1950] [serial = 1221] [outer = (nil)]
11:36:09 INFO - ++DOMWINDOW == 70 (0x7f1183674400) [pid = 1950] [serial = 1222] [outer = 0x7f1181ee6800]
11:36:10 INFO - ++DOMWINDOW == 71 (0x7f1182844800) [pid = 1950] [serial = 1223] [outer = 0x7f1181ee6800]
11:36:10 INFO - ++DOCSHELL 0x7f1180e3a000 == 21 [pid = 1950] [id = 509]
11:36:10 INFO - ++DOMWINDOW == 72 (0x7f1176ccc000) [pid = 1950] [serial = 1224] [outer = (nil)]
11:36:10 INFO - ++DOMWINDOW == 73 (0x7f1185aa8000) [pid = 1950] [serial = 1225] [outer = 0x7f1176ccc000]
11:36:13 INFO - --DOMWINDOW == 72 (0x7f1180f34c00) [pid = 1950] [serial = 1180] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:13 INFO - --DOMWINDOW == 71 (0x7f1176cd1000) [pid = 1950] [serial = 1193] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:13 INFO - --DOMWINDOW == 70 (0x7f11812cdc00) [pid = 1950] [serial = 1190] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:13 INFO - --DOMWINDOW == 69 (0x7f11a14c7800) [pid = 1950] [serial = 1174] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:13 INFO - --DOMWINDOW == 68 (0x7f118d40e400) [pid = 1950] [serial = 1204] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:13 INFO - --DOMWINDOW == 67 (0x7f119f0cc400) [pid = 1950] [serial = 1171] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:13 INFO - --DOMWINDOW == 66 (0x7f118a9b8400) [pid = 1950] [serial = 1201] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:13 INFO - --DOMWINDOW == 65 (0x7f1181d13000) [pid = 1950] [serial = 1183] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:13 INFO - --DOMWINDOW == 64 (0x7f1181490800) [pid = 1950] [serial = 1166] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 63 (0x7f1176dce000) [pid = 1950] [serial = 1177] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:36:13 INFO - --DOMWINDOW == 62 (0x7f1181493c00) [pid = 1950] [serial = 1168] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:36:13 INFO - --DOMWINDOW == 61 (0x7f118a9ba800) [pid = 1950] [serial = 1202] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 60 (0x7f1181ee1400) [pid = 1950] [serial = 1167] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 59 (0x7f1176ed8000) [pid = 1950] [serial = 1178] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 58 (0x7f11812cf000) [pid = 1950] [serial = 1191] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 57 (0x7f1180f35c00) [pid = 1950] [serial = 1181] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 56 (0x7f119c6acc00) [pid = 1950] [serial = 1212] [outer = (nil)] [url = about:blank]
11:36:13 INFO - --DOMWINDOW == 55 (0x7f11a63dc800) [pid = 1950] [serial = 1176] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:36:13 INFO - console.debug:
11:36:13 INFO - rectNode
11:36:13 INFO - DOMRect
11:36:13 INFO - - prototype DOMRect
11:36:13 INFO - - height = 20
11:36:13 INFO - - width = 1273
11:36:13 INFO - - x = 0
11:36:13 INFO - - y = 173
11:36:13 INFO - - prototype DOMRectReadOnly
11:36:13 INFO - - bottom = 193
11:36:13 INFO - - left = 0
11:36:13 INFO - - right = 1273
11:36:13 INFO - - top = 173
11:36:13 INFO - - prototype Object
11:36:13 INFO - rectOutput
11:36:13 INFO - DOMRect
11:36:13 INFO - - prototype DOMRect
11:36:13 INFO - - height = 182
11:36:13 INFO - - width = 1280
11:36:13 INFO - - x = 0
11:36:13 INFO - - y = 24
11:36:13 INFO - - prototype DOMRectReadOnly
11:36:13 INFO - - bottom = 206
11:36:13 INFO - - left = 0
11:36:13 INFO - - right = 1280
11:36:13 INFO - - top = 24
11:36:13 INFO - - prototype Object
11:36:13 INFO - console.log: scrollNode scrollHeight 2060 scrollTop 1891 clientHeight 169
11:36:15 INFO - --DOCSHELL 0x7f118d545800 == 20 [pid = 1950] [id = 504]
11:36:15 INFO - --DOCSHELL 0x7f1176f1d800 == 19 [pid = 1950] [id = 494]
11:36:15 INFO - --DOCSHELL 0x7f1180e02800 == 18 [pid = 1950] [id = 496]
11:36:15 INFO - --DOCSHELL 0x7f1183e47000 == 17 [pid = 1950] [id = 500]
11:36:15 INFO - --DOMWINDOW == 54 (0x7f118283d800) [pid = 1950] [serial = 1185] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:36:15 INFO - --DOMWINDOW == 53 (0x7f11776ed400) [pid = 1950] [serial = 1179] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html]
11:36:15 INFO - --DOMWINDOW == 52 (0x7f119c6ae400) [pid = 1950] [serial = 1173] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:15 INFO - --DOMWINDOW == 51 (0x7f1185a9b000) [pid = 1950] [serial = 1203] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:15 INFO - --DOMWINDOW == 50 (0x7f1181edd000) [pid = 1950] [serial = 1184] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 49 (0x7f11838c0400) [pid = 1950] [serial = 1194] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 48 (0x7f1180f33800) [pid = 1950] [serial = 1192] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:15 INFO - --DOMWINDOW == 47 (0x7f11872bac00) [pid = 1950] [serial = 1175] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 46 (0x7f118d567000) [pid = 1950] [serial = 1205] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 45 (0x7f1180f2b400) [pid = 1950] [serial = 1182] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:15 INFO - --DOMWINDOW == 44 (0x7f1192680c00) [pid = 1950] [serial = 1209] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html]
11:36:15 INFO - --DOMWINDOW == 43 (0x7f118a915000) [pid = 1950] [serial = 1207] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 42 (0x7f1185a93c00) [pid = 1950] [serial = 1197] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 41 (0x7f1176cca000) [pid = 1950] [serial = 1186] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 40 (0x7f117738dc00) [pid = 1950] [serial = 1188] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs]
11:36:15 INFO - --DOMWINDOW == 39 (0x7f118a914c00) [pid = 1950] [serial = 1199] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html]
11:36:15 INFO - --DOMWINDOW == 38 (0x7f1196403800) [pid = 1950] [serial = 1210] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 37 (0x7f118db09000) [pid = 1950] [serial = 1208] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 36 (0x7f118a91bc00) [pid = 1950] [serial = 1200] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 35 (0x7f1185aa8c00) [pid = 1950] [serial = 1198] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 34 (0x7f11881f4c00) [pid = 1950] [serial = 1196] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs]
11:36:15 INFO - --DOMWINDOW == 33 (0x7f1188144400) [pid = 1950] [serial = 1195] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs]
11:36:15 INFO - --DOMWINDOW == 32 (0x7f11776eb000) [pid = 1950] [serial = 1189] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 31 (0x7f1176db2400) [pid = 1950] [serial = 1187] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 30 (0x7f1183674400) [pid = 1950] [serial = 1222] [outer = (nil)] [url = about:blank]
11:36:15 INFO - --DOMWINDOW == 29 (0x7f1190abdc00) [pid = 1950] [serial = 1206] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html]
11:36:15 INFO - MEMORY STAT | vsize 1306MB | residentFast 357MB | heapAllocated 138MB
11:36:15 INFO - 188 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js | took 6340ms
11:36:15 INFO - ++DOCSHELL 0x7f11770b6800 == 18 [pid = 1950] [id = 510]
11:36:15 INFO - ++DOMWINDOW == 30 (0x7f1176ed5c00) [pid = 1950] [serial = 1226] [outer = (nil)]
11:36:15 INFO - ++DOMWINDOW == 31 (0x7f1176ee1c00) [pid = 1950] [serial = 1227] [outer = 0x7f1176ed5c00]
11:36:16 INFO - 189 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js
11:36:16 INFO - ++DOCSHELL 0x7f11773c9000 == 19 [pid = 1950] [id = 511]
11:36:16 INFO - ++DOMWINDOW == 32 (0x7f11776ec800) [pid = 1950] [serial = 1228] [outer = (nil)]
11:36:16 INFO - ++DOMWINDOW == 33 (0x7f11776f4800) [pid = 1950] [serial = 1229] [outer = 0x7f11776ec800]
11:36:16 INFO - ++DOMWINDOW == 34 (0x7f1180f38400) [pid = 1950] [serial = 1230] [outer = 0x7f11776ec800]
11:36:16 INFO - ++DOCSHELL 0x7f11770c6000 == 20 [pid = 1950] [id = 512]
11:36:16 INFO - ++DOMWINDOW == 35 (0x7f11776f7800) [pid = 1950] [serial = 1231] [outer = (nil)]
11:36:16 INFO - ++DOMWINDOW == 36 (0x7f1181149000) [pid = 1950] [serial = 1232] [outer = 0x7f11776f7800]
11:36:17 INFO - ++DOMWINDOW == 37 (0x7f1180f35c00) [pid = 1950] [serial = 1233] [outer = 0x7f11776f7800]
11:36:17 INFO - ++DOCSHELL 0x7f11810ae000 == 21 [pid = 1950] [id = 513]
11:36:17 INFO - ++DOMWINDOW == 38 (0x7f1181498c00) [pid = 1950] [serial = 1234] [outer = (nil)]
11:36:17 INFO - ++DOMWINDOW == 39 (0x7f118242cc00) [pid = 1950] [serial = 1235] [outer = 0x7f1181498c00]
11:36:21 INFO - MEMORY STAT | vsize 1308MB | residentFast 348MB | heapAllocated 137MB
11:36:21 INFO - 190 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js | took 5847ms
11:36:21 INFO - ++DOCSHELL 0x7f117724c800 == 22 [pid = 1950] [id = 514]
11:36:21 INFO - ++DOMWINDOW == 40 (0x7f1176ee2400) [pid = 1950] [serial = 1236] [outer = (nil)]
11:36:21 INFO - ++DOMWINDOW == 41 (0x7f11776ecc00) [pid = 1950] [serial = 1237] [outer = 0x7f1176ee2400]
11:36:22 INFO - 191 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js
11:36:22 INFO - ++DOCSHELL 0x7f1180e0c800 == 23 [pid = 1950] [id = 515]
11:36:22 INFO - ++DOMWINDOW == 42 (0x7f1181140c00) [pid = 1950] [serial = 1238] [outer = (nil)]
11:36:22 INFO - ++DOMWINDOW == 43 (0x7f118114a000) [pid = 1950] [serial = 1239] [outer = 0x7f1181140c00]
11:36:22 INFO - ++DOCSHELL 0x7f1180f71800 == 24 [pid = 1950] [id = 516]
11:36:22 INFO - ++DOMWINDOW == 44 (0x7f11812cb400) [pid = 1950] [serial = 1240] [outer = (nil)]
11:36:22 INFO - ++DOMWINDOW == 45 (0x7f118148ec00) [pid = 1950] [serial = 1241] [outer = 0x7f11812cb400]
11:36:23 INFO - ++DOMWINDOW == 46 (0x7f1180f2f400) [pid = 1950] [serial = 1242] [outer = 0x7f11812cb400]
11:36:23 INFO - ++DOCSHELL 0x7f11810bd800 == 25 [pid = 1950] [id = 517]
11:36:23 INFO - ++DOMWINDOW == 47 (0x7f1181f56800) [pid = 1950] [serial = 1243] [outer = (nil)]
11:36:23 INFO - ++DOMWINDOW == 48 (0x7f1182424000) [pid = 1950] [serial = 1244] [outer = 0x7f1181f56800]
11:36:25 INFO - ++DOMWINDOW == 49 (0x7f1185aa3400) [pid = 1950] [serial = 1245] [outer = 0x7f1181140c00]
11:36:25 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:36:25 INFO - ++DOCSHELL 0x7f1185a29000 == 26 [pid = 1950] [id = 518]
11:36:25 INFO - ++DOMWINDOW == 50 (0x7f1185aa4800) [pid = 1950] [serial = 1246] [outer = (nil)]
11:36:25 INFO - ++DOMWINDOW == 51 (0x7f1185aa5800) [pid = 1950] [serial = 1247] [outer = 0x7f1185aa4800]
11:36:26 INFO - --DOCSHELL 0x7f1180e3a000 == 25 [pid = 1950] [id = 509]
11:36:26 INFO - --DOCSHELL 0x7f1180e33800 == 24 [pid = 1950] [id = 498]
11:36:26 INFO - --DOCSHELL 0x7f118d52c000 == 23 [pid = 1950] [id = 503]
11:36:26 INFO - --DOCSHELL 0x7f1182827800 == 22 [pid = 1950] [id = 499]
11:36:26 INFO - --DOCSHELL 0x7f11770b0800 == 21 [pid = 1950] [id = 495]
11:36:26 INFO - --DOCSHELL 0x7f11770b6800 == 20 [pid = 1950] [id = 510]
11:36:26 INFO - --DOCSHELL 0x7f11773c9000 == 19 [pid = 1950] [id = 511]
11:36:26 INFO - --DOCSHELL 0x7f117725d000 == 18 [pid = 1950] [id = 507]
11:36:26 INFO - --DOCSHELL 0x7f11770c6000 == 17 [pid = 1950] [id = 512]
11:36:26 INFO - --DOCSHELL 0x7f11773b5000 == 16 [pid = 1950] [id = 508]
11:36:26 INFO - --DOCSHELL 0x7f11810ae000 == 15 [pid = 1950] [id = 513]
11:36:26 INFO - --DOCSHELL 0x7f1180f75000 == 14 [pid = 1950] [id = 502]
11:36:26 INFO - --DOCSHELL 0x7f1176f1f800 == 13 [pid = 1950] [id = 506]
11:36:26 INFO - --DOMWINDOW == 50 (0x7f11a3b45800) [pid = 1950] [serial = 1216] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html]
11:36:27 INFO - --DOCSHELL 0x7f11810bd800 == 12 [pid = 1950] [id = 517]
11:36:28 INFO - MEMORY STAT | vsize 1296MB | residentFast 344MB | heapAllocated 136MB
11:36:28 INFO - 192 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js | took 6009ms
11:36:28 INFO - ++DOCSHELL 0x7f11770b1800 == 13 [pid = 1950] [id = 519]
11:36:28 INFO - ++DOMWINDOW == 51 (0x7f11776efc00) [pid = 1950] [serial = 1248] [outer = (nil)]
11:36:28 INFO - ++DOMWINDOW == 52 (0x7f1180f2f000) [pid = 1950] [serial = 1249] [outer = 0x7f11776efc00]
11:36:28 INFO - 193 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_611795.js
11:36:28 INFO - ++DOCSHELL 0x7f1180e3a000 == 14 [pid = 1950] [id = 520]
11:36:28 INFO - ++DOMWINDOW == 53 (0x7f11812cdc00) [pid = 1950] [serial = 1250] [outer = (nil)]
11:36:28 INFO - ++DOMWINDOW == 54 (0x7f11812d2c00) [pid = 1950] [serial = 1251] [outer = 0x7f11812cdc00]
11:36:29 INFO - ++DOCSHELL 0x7f11773ad000 == 15 [pid = 1950] [id = 521]
11:36:29 INFO - ++DOMWINDOW == 55 (0x7f11812d4c00) [pid = 1950] [serial = 1252] [outer = (nil)]
11:36:29 INFO - ++DOMWINDOW == 56 (0x7f1181ee2000) [pid = 1950] [serial = 1253] [outer = 0x7f11812d4c00]
11:36:29 INFO - ++DOMWINDOW == 57 (0x7f1181496800) [pid = 1950] [serial = 1254] [outer = 0x7f11812d4c00]
11:36:29 INFO - ++DOCSHELL 0x7f118115b800 == 16 [pid = 1950] [id = 522]
11:36:29 INFO - ++DOMWINDOW == 58 (0x7f11858f2400) [pid = 1950] [serial = 1255] [outer = (nil)]
11:36:29 INFO - ++DOMWINDOW == 59 (0x7f1185a8c800) [pid = 1950] [serial = 1256] [outer = 0x7f11858f2400]
11:36:31 INFO - ++DOMWINDOW == 60 (0x7f1187fa0400) [pid = 1950] [serial = 1257] [outer = 0x7f11812cdc00]
11:36:32 INFO - --DOMWINDOW == 59 (0x7f11776ec800) [pid = 1950] [serial = 1228] [outer = (nil)] [url = http://example.com/]
11:36:32 INFO - --DOMWINDOW == 58 (0x7f11812d9000) [pid = 1950] [serial = 1217] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 57 (0x7f1181edd800) [pid = 1950] [serial = 1219] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20601352]
11:36:32 INFO - --DOMWINDOW == 56 (0x7f1176ed5c00) [pid = 1950] [serial = 1226] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 55 (0x7f1176ee1c00) [pid = 1950] [serial = 1227] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 54 (0x7f1180f38400) [pid = 1950] [serial = 1230] [outer = (nil)] [url = http://example.com/]
11:36:32 INFO - --DOMWINDOW == 53 (0x7f1181498c00) [pid = 1950] [serial = 1234] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:32 INFO - --DOMWINDOW == 52 (0x7f118dd4d800) [pid = 1950] [serial = 1211] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:32 INFO - --DOMWINDOW == 51 (0x7f119f0cec00) [pid = 1950] [serial = 1214] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:32 INFO - --DOMWINDOW == 50 (0x7f11776f7800) [pid = 1950] [serial = 1231] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:32 INFO - --DOMWINDOW == 49 (0x7f1181149000) [pid = 1950] [serial = 1232] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 48 (0x7f11776f4800) [pid = 1950] [serial = 1229] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 47 (0x7f1181491400) [pid = 1950] [serial = 1218] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 46 (0x7f1181ee4400) [pid = 1950] [serial = 1220] [outer = (nil)] [url = about:blank]
11:36:32 INFO - --DOMWINDOW == 45 (0x7f118148ec00) [pid = 1950] [serial = 1241] [outer = (nil)] [url = about:blank]
11:36:32 INFO - MEMORY STAT | vsize 1293MB | residentFast 348MB | heapAllocated 140MB
11:36:32 INFO - 194 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_611795.js | took 3934ms
11:36:32 INFO - ++DOCSHELL 0x7f1180e51000 == 17 [pid = 1950] [id = 523]
11:36:32 INFO - ++DOMWINDOW == 46 (0x7f1181495000) [pid = 1950] [serial = 1258] [outer = (nil)]
11:36:32 INFO - ++DOMWINDOW == 47 (0x7f118288f000) [pid = 1950] [serial = 1259] [outer = 0x7f1181495000]
11:36:32 INFO - 195 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js
11:36:32 INFO - ++DOCSHELL 0x7f11810ab000 == 18 [pid = 1950] [id = 524]
11:36:32 INFO - ++DOMWINDOW == 48 (0x7f1185a99800) [pid = 1950] [serial = 1260] [outer = (nil)]
11:36:32 INFO - ++DOMWINDOW == 49 (0x7f1185aa3000) [pid = 1950] [serial = 1261] [outer = 0x7f1185a99800]
11:36:33 INFO - ++DOMWINDOW == 50 (0x7f11872b3400) [pid = 1950] [serial = 1262] [outer = 0x7f1185a99800]
11:36:33 INFO - ++DOCSHELL 0x7f1183b25800 == 19 [pid = 1950] [id = 525]
11:36:33 INFO - ++DOMWINDOW == 51 (0x7f1187fa7000) [pid = 1950] [serial = 1263] [outer = (nil)]
11:36:33 INFO - ++DOMWINDOW == 52 (0x7f1181d1bc00) [pid = 1950] [serial = 1264] [outer = 0x7f1187fa7000]
11:36:33 INFO - ++DOCSHELL 0x7f1176f75000 == 20 [pid = 1950] [id = 526]
11:36:33 INFO - ++DOMWINDOW == 53 (0x7f1185aa4000) [pid = 1950] [serial = 1265] [outer = (nil)]
11:36:33 INFO - ++DOMWINDOW == 54 (0x7f118a036800) [pid = 1950] [serial = 1266] [outer = 0x7f1185aa4000]
11:36:33 INFO - ++DOMWINDOW == 55 (0x7f1187590c00) [pid = 1950] [serial = 1267] [outer = 0x7f1185aa4000]
11:36:34 INFO - ++DOCSHELL 0x7f118a9a5000 == 21 [pid = 1950] [id = 527]
11:36:34 INFO - ++DOMWINDOW == 56 (0x7f1181fe1400) [pid = 1950] [serial = 1268] [outer = (nil)]
11:36:34 INFO - ++DOMWINDOW == 57 (0x7f118a93dc00) [pid = 1950] [serial = 1269] [outer = 0x7f1181fe1400]
11:36:36 INFO - ++DOMWINDOW == 58 (0x7f1176db9000) [pid = 1950] [serial = 1270] [outer = 0x7f1185a99800]
11:36:36 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:36:36 INFO - ++DOCSHELL 0x7f1176f17000 == 22 [pid = 1950] [id = 528]
11:36:36 INFO - ++DOMWINDOW == 59 (0x7f11812d8800) [pid = 1950] [serial = 1271] [outer = (nil)]
11:36:36 INFO - ++DOMWINDOW == 60 (0x7f11812da800) [pid = 1950] [serial = 1272] [outer = 0x7f11812d8800]
11:36:37 INFO - MEMORY STAT | vsize 1295MB | residentFast 351MB | heapAllocated 141MB
11:36:37 INFO - 196 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js | took 4519ms
11:36:37 INFO - ++DOCSHELL 0x7f11770bb800 == 23 [pid = 1950] [id = 529]
11:36:37 INFO - ++DOMWINDOW == 61 (0x7f1181ee4400) [pid = 1950] [serial = 1273] [outer = (nil)]
11:36:37 INFO - ++DOMWINDOW == 62 (0x7f11835a3800) [pid = 1950] [serial = 1274] [outer = 0x7f1181ee4400]
11:36:37 INFO - 197 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js
11:36:37 INFO - ++DOCSHELL 0x7f1185a25000 == 24 [pid = 1950] [id = 530]
11:36:37 INFO - ++DOMWINDOW == 63 (0x7f1185866000) [pid = 1950] [serial = 1275] [outer = (nil)]
11:36:37 INFO - ++DOMWINDOW == 64 (0x7f1185a8dc00) [pid = 1950] [serial = 1276] [outer = 0x7f1185866000]
11:36:38 INFO - ++DOCSHELL 0x7f118aa26800 == 25 [pid = 1950] [id = 531]
11:36:38 INFO - ++DOMWINDOW == 65 (0x7f1185a90400) [pid = 1950] [serial = 1277] [outer = (nil)]
11:36:38 INFO - ++DOMWINDOW == 66 (0x7f1185aa4400) [pid = 1950] [serial = 1278] [outer = 0x7f1185a90400]
11:36:38 INFO - ++DOMWINDOW == 67 (0x7f1185aa1800) [pid = 1950] [serial = 1279] [outer = 0x7f1185a90400]
11:36:38 INFO - ++DOCSHELL 0x7f1177245800 == 26 [pid = 1950] [id = 532]
11:36:38 INFO - ++DOMWINDOW == 68 (0x7f11881fb400) [pid = 1950] [serial = 1280] [outer = (nil)]
11:36:38 INFO - ++DOMWINDOW == 69 (0x7f118a90d800) [pid = 1950] [serial = 1281] [outer = 0x7f11881fb400]
11:36:42 INFO - --DOCSHELL 0x7f1185a29000 == 25 [pid = 1950] [id = 518]
11:36:42 INFO - --DOCSHELL 0x7f1180f71800 == 24 [pid = 1950] [id = 516]
11:36:42 INFO - --DOCSHELL 0x7f11770b1800 == 23 [pid = 1950] [id = 519]
11:36:42 INFO - --DOCSHELL 0x7f1180e3a000 == 22 [pid = 1950] [id = 520]
11:36:42 INFO - --DOCSHELL 0x7f11773ad000 == 21 [pid = 1950] [id = 521]
11:36:42 INFO - --DOCSHELL 0x7f118115b800 == 20 [pid = 1950] [id = 522]
11:36:42 INFO - --DOCSHELL 0x7f117724c800 == 19 [pid = 1950] [id = 514]
11:36:42 INFO - --DOCSHELL 0x7f1180e0c800 == 18 [pid = 1950] [id = 515]
11:36:42 INFO - --DOCSHELL 0x7f1183b25800 == 17 [pid = 1950] [id = 525]
11:36:42 INFO - --DOCSHELL 0x7f118a9a5000 == 16 [pid = 1950] [id = 527]
11:36:42 INFO - --DOCSHELL 0x7f1176f17000 == 15 [pid = 1950] [id = 528]
11:36:42 INFO - --DOCSHELL 0x7f1177245800 == 14 [pid = 1950] [id = 532]
11:36:42 INFO - --DOMWINDOW == 68 (0x7f11a0d5d400) [pid = 1950] [serial = 1215] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 67 (0x7f1180f35c00) [pid = 1950] [serial = 1233] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:42 INFO - --DOMWINDOW == 66 (0x7f118dd4f400) [pid = 1950] [serial = 1213] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:42 INFO - --DOMWINDOW == 65 (0x7f118242cc00) [pid = 1950] [serial = 1235] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 64 (0x7f1176ee2400) [pid = 1950] [serial = 1236] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 63 (0x7f1185aa4800) [pid = 1950] [serial = 1246] [outer = (nil)] [url = data:text/html;charset=utf-8,hello%20world!]
11:36:42 INFO - --DOMWINDOW == 62 (0x7f11776efc00) [pid = 1950] [serial = 1248] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 61 (0x7f11812cdc00) [pid = 1950] [serial = 1250] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20repeated%20css%20warnings
hi
]
11:36:42 INFO - --DOMWINDOW == 60 (0x7f1181fe1400) [pid = 1950] [serial = 1268] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:42 INFO - --DOMWINDOW == 59 (0x7f11812da800) [pid = 1950] [serial = 1272] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 58 (0x7f11812d8800) [pid = 1950] [serial = 1271] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe]
11:36:42 INFO - --DOMWINDOW == 57 (0x7f1187fa7000) [pid = 1950] [serial = 1263] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe]
11:36:42 INFO - --DOMWINDOW == 56 (0x7f1185aa4000) [pid = 1950] [serial = 1265] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:42 INFO - --DOMWINDOW == 55 (0x7f1181495000) [pid = 1950] [serial = 1258] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 54 (0x7f118288f000) [pid = 1950] [serial = 1259] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 53 (0x7f11858f2400) [pid = 1950] [serial = 1255] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:42 INFO - --DOMWINDOW == 52 (0x7f1185a99800) [pid = 1950] [serial = 1260] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html]
11:36:42 INFO - --DOMWINDOW == 51 (0x7f1181d1bc00) [pid = 1950] [serial = 1264] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe]
11:36:42 INFO - --DOMWINDOW == 50 (0x7f118a036800) [pid = 1950] [serial = 1266] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 49 (0x7f1181140c00) [pid = 1950] [serial = 1238] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html]
11:36:42 INFO - --DOMWINDOW == 48 (0x7f11812cb400) [pid = 1950] [serial = 1240] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:42 INFO - --DOMWINDOW == 47 (0x7f11812d4c00) [pid = 1950] [serial = 1252] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:36:42 INFO - --DOMWINDOW == 46 (0x7f1181f56800) [pid = 1950] [serial = 1243] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:36:42 INFO - --DOMWINDOW == 45 (0x7f1185aa4400) [pid = 1950] [serial = 1278] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 44 (0x7f1185aa3000) [pid = 1950] [serial = 1261] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 43 (0x7f1181ee2000) [pid = 1950] [serial = 1253] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 42 (0x7f11776ecc00) [pid = 1950] [serial = 1237] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 41 (0x7f118114a000) [pid = 1950] [serial = 1239] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 40 (0x7f1185aa5800) [pid = 1950] [serial = 1247] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 39 (0x7f1180f2f000) [pid = 1950] [serial = 1249] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 38 (0x7f11812d2c00) [pid = 1950] [serial = 1251] [outer = (nil)] [url = about:blank]
11:36:42 INFO - --DOMWINDOW == 37 (0x7f1187fa0400) [pid = 1950] [serial = 1257] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20repeated%20css%20warnings
hi
]
11:36:42 INFO - --DOMWINDOW == 36 (0x7f1176db9000) [pid = 1950] [serial = 1270] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html]
11:36:42 INFO - --DOMWINDOW == 35 (0x7f11872b3400) [pid = 1950] [serial = 1262] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html]
11:36:42 INFO - --DOMWINDOW == 34 (0x7f1185aa3400) [pid = 1950] [serial = 1245] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html]
11:36:43 INFO - MEMORY STAT | vsize 1293MB | residentFast 348MB | heapAllocated 135MB
11:36:43 INFO - 198 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js | took 5311ms
11:36:43 INFO - ++DOCSHELL 0x7f1176f22800 == 15 [pid = 1950] [id = 533]
11:36:43 INFO - ++DOMWINDOW == 35 (0x7f1176ddc400) [pid = 1950] [serial = 1282] [outer = (nil)]
11:36:43 INFO - ++DOMWINDOW == 36 (0x7f1176ed8000) [pid = 1950] [serial = 1283] [outer = 0x7f1176ddc400]
11:36:43 INFO - 199 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js
11:36:43 INFO - ++DOCSHELL 0x7f117724b800 == 16 [pid = 1950] [id = 534]
11:36:43 INFO - ++DOMWINDOW == 37 (0x7f11776ee400) [pid = 1950] [serial = 1284] [outer = (nil)]
11:36:43 INFO - ++DOMWINDOW == 38 (0x7f11776f2000) [pid = 1950] [serial = 1285] [outer = 0x7f11776ee400]
11:36:43 INFO - ++DOCSHELL 0x7f1177249000 == 17 [pid = 1950] [id = 535]
11:36:43 INFO - ++DOMWINDOW == 39 (0x7f11776f2c00) [pid = 1950] [serial = 1286] [outer = (nil)]
11:36:43 INFO - ++DOMWINDOW == 40 (0x7f1181143800) [pid = 1950] [serial = 1287] [outer = 0x7f11776f2c00]
11:36:43 INFO - ++DOMWINDOW == 41 (0x7f1180f34000) [pid = 1950] [serial = 1288] [outer = 0x7f11776f2c00]
11:36:44 INFO - ++DOCSHELL 0x7f1180e45800 == 18 [pid = 1950] [id = 536]
11:36:44 INFO - ++DOMWINDOW == 42 (0x7f1181d19800) [pid = 1950] [serial = 1289] [outer = (nil)]
11:36:44 INFO - ++DOMWINDOW == 43 (0x7f1181edf400) [pid = 1950] [serial = 1290] [outer = 0x7f1181d19800]
11:36:50 INFO - MEMORY STAT | vsize 1291MB | residentFast 348MB | heapAllocated 139MB
11:36:50 INFO - 200 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js | took 6718ms
11:36:50 INFO - ++DOCSHELL 0x7f1176f17000 == 19 [pid = 1950] [id = 537]
11:36:50 INFO - ++DOMWINDOW == 44 (0x7f11812d8c00) [pid = 1950] [serial = 1291] [outer = (nil)]
11:36:50 INFO - ++DOMWINDOW == 45 (0x7f1182887400) [pid = 1950] [serial = 1292] [outer = 0x7f11812d8c00]
11:36:50 INFO - 201 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js
11:36:50 INFO - ++DOCSHELL 0x7f1180f6a800 == 20 [pid = 1950] [id = 538]
11:36:50 INFO - ++DOMWINDOW == 46 (0x7f1185a8cc00) [pid = 1950] [serial = 1293] [outer = (nil)]
11:36:50 INFO - ++DOMWINDOW == 47 (0x7f1185a9f000) [pid = 1950] [serial = 1294] [outer = 0x7f1185a8cc00]
11:36:50 INFO - ++DOCSHELL 0x7f11810c1000 == 21 [pid = 1950] [id = 539]
11:36:50 INFO - ++DOMWINDOW == 48 (0x7f1181eeac00) [pid = 1950] [serial = 1295] [outer = (nil)]
11:36:50 INFO - ++DOMWINDOW == 49 (0x7f118d409800) [pid = 1950] [serial = 1296] [outer = 0x7f1181eeac00]
11:36:51 INFO - ++DOMWINDOW == 50 (0x7f1183674400) [pid = 1950] [serial = 1297] [outer = 0x7f1181eeac00]
11:36:51 INFO - ++DOCSHELL 0x7f1181506800 == 22 [pid = 1950] [id = 540]
11:36:51 INFO - ++DOMWINDOW == 51 (0x7f118d749800) [pid = 1950] [serial = 1298] [outer = (nil)]
11:36:51 INFO - ++DOMWINDOW == 52 (0x7f118da57000) [pid = 1950] [serial = 1299] [outer = 0x7f118d749800]
11:36:56 INFO - MEMORY STAT | vsize 1293MB | residentFast 358MB | heapAllocated 149MB
11:36:56 INFO - 202 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js | took 6530ms
11:36:56 INFO - ++DOCSHELL 0x7f1180f7b800 == 23 [pid = 1950] [id = 541]
11:36:56 INFO - ++DOMWINDOW == 53 (0x7f1176fb6800) [pid = 1950] [serial = 1300] [outer = (nil)]
11:36:57 INFO - ++DOMWINDOW == 54 (0x7f1176fba400) [pid = 1950] [serial = 1301] [outer = 0x7f1176fb6800]
11:36:57 INFO - 203 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js
11:36:57 INFO - ++DOCSHELL 0x7f1187fbd000 == 24 [pid = 1950] [id = 542]
11:36:57 INFO - ++DOMWINDOW == 55 (0x7f118d408c00) [pid = 1950] [serial = 1302] [outer = (nil)]
11:36:57 INFO - ++DOMWINDOW == 56 (0x7f118d566400) [pid = 1950] [serial = 1303] [outer = 0x7f118d408c00]
11:36:57 INFO - ++DOCSHELL 0x7f118aa2e000 == 25 [pid = 1950] [id = 543]
11:36:57 INFO - ++DOMWINDOW == 57 (0x7f1176fb8000) [pid = 1950] [serial = 1304] [outer = (nil)]
11:36:57 INFO - ++DOMWINDOW == 58 (0x7f11910a8400) [pid = 1950] [serial = 1305] [outer = 0x7f1176fb8000]
11:36:58 INFO - ++DOMWINDOW == 59 (0x7f118d567800) [pid = 1950] [serial = 1306] [outer = 0x7f1176fb8000]
11:36:58 INFO - ++DOCSHELL 0x7f118d497800 == 26 [pid = 1950] [id = 544]
11:36:58 INFO - ++DOMWINDOW == 60 (0x7f118aa56800) [pid = 1950] [serial = 1307] [outer = (nil)]
11:36:58 INFO - ++DOMWINDOW == 61 (0x7f118aa59400) [pid = 1950] [serial = 1308] [outer = 0x7f118aa56800]
11:37:07 INFO - --DOCSHELL 0x7f1180e45800 == 25 [pid = 1950] [id = 536]
11:37:10 INFO - MEMORY STAT | vsize 1292MB | residentFast 364MB | heapAllocated 150MB
11:37:10 INFO - 204 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js | took 12728ms
11:37:10 INFO - ++DOCSHELL 0x7f1177255800 == 26 [pid = 1950] [id = 545]
11:37:10 INFO - ++DOMWINDOW == 62 (0x7f11776f0000) [pid = 1950] [serial = 1309] [outer = (nil)]
11:37:10 INFO - ++DOMWINDOW == 63 (0x7f118aa52400) [pid = 1950] [serial = 1310] [outer = 0x7f11776f0000]
11:37:10 INFO - 205 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js
11:37:10 INFO - ++DOCSHELL 0x7f117a603000 == 27 [pid = 1950] [id = 546]
11:37:10 INFO - ++DOMWINDOW == 64 (0x7f118aa6fc00) [pid = 1950] [serial = 1311] [outer = (nil)]
11:37:10 INFO - ++DOMWINDOW == 65 (0x7f118ab7e800) [pid = 1950] [serial = 1312] [outer = 0x7f118aa6fc00]
11:37:10 INFO - --DOMWINDOW == 64 (0x7f1181ee4400) [pid = 1950] [serial = 1273] [outer = (nil)] [url = about:blank]
11:37:10 INFO - --DOMWINDOW == 63 (0x7f1185866000) [pid = 1950] [serial = 1275] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613280]
11:37:10 INFO - --DOMWINDOW == 62 (0x7f11835a3800) [pid = 1950] [serial = 1274] [outer = (nil)] [url = about:blank]
11:37:10 INFO - --DOMWINDOW == 61 (0x7f1185a8dc00) [pid = 1950] [serial = 1276] [outer = (nil)] [url = about:blank]
11:37:10 INFO - --DOMWINDOW == 60 (0x7f1181143800) [pid = 1950] [serial = 1287] [outer = (nil)] [url = about:blank]
11:37:10 INFO - ++DOCSHELL 0x7f11770b1000 == 28 [pid = 1950] [id = 547]
11:37:10 INFO - ++DOMWINDOW == 61 (0x7f118242dc00) [pid = 1950] [serial = 1313] [outer = (nil)]
11:37:10 INFO - ++DOMWINDOW == 62 (0x7f1184377400) [pid = 1950] [serial = 1314] [outer = 0x7f118242dc00]
11:37:10 INFO - ++DOMWINDOW == 63 (0x7f1184620800) [pid = 1950] [serial = 1315] [outer = 0x7f118242dc00]
11:37:11 INFO - ++DOCSHELL 0x7f1180e34000 == 29 [pid = 1950] [id = 548]
11:37:11 INFO - ++DOMWINDOW == 64 (0x7f118f617000) [pid = 1950] [serial = 1316] [outer = (nil)]
11:37:11 INFO - ++DOMWINDOW == 65 (0x7f1191657000) [pid = 1950] [serial = 1317] [outer = 0x7f118f617000]
11:37:12 INFO - ++DOMWINDOW == 66 (0x7f1181d8e800) [pid = 1950] [serial = 1318] [outer = 0x7f118aa6fc00]
11:37:13 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:37:13 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html, line 14: ReferenceError: bug618078exception is not defined
11:37:14 INFO - MEMORY STAT | vsize 1295MB | residentFast 371MB | heapAllocated 153MB
11:37:14 INFO - 206 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js | took 4518ms
11:37:14 INFO - ++DOCSHELL 0x7f11773b0000 == 30 [pid = 1950] [id = 549]
11:37:14 INFO - ++DOMWINDOW == 67 (0x7f117767ac00) [pid = 1950] [serial = 1319] [outer = (nil)]
11:37:14 INFO - ++DOMWINDOW == 68 (0x7f1180f36400) [pid = 1950] [serial = 1320] [outer = 0x7f117767ac00]
11:37:15 INFO - 207 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js
11:37:15 INFO - ++DOCSHELL 0x7f1180e1f000 == 31 [pid = 1950] [id = 550]
11:37:15 INFO - ++DOMWINDOW == 69 (0x7f1181d98800) [pid = 1950] [serial = 1321] [outer = (nil)]
11:37:15 INFO - ++DOMWINDOW == 70 (0x7f1182430400) [pid = 1950] [serial = 1322] [outer = 0x7f1181d98800]
11:37:15 INFO - ++DOMWINDOW == 71 (0x7f11910ae800) [pid = 1950] [serial = 1323] [outer = 0x7f1181d98800]
11:37:16 INFO - ++DOCSHELL 0x7f118126e800 == 32 [pid = 1950] [id = 551]
11:37:16 INFO - ++DOMWINDOW == 72 (0x7f1180f2b800) [pid = 1950] [serial = 1324] [outer = (nil)]
11:37:16 INFO - ++DOMWINDOW == 73 (0x7f1187d44000) [pid = 1950] [serial = 1325] [outer = 0x7f1180f2b800]
11:37:16 INFO - ++DOMWINDOW == 74 (0x7f11776ee800) [pid = 1950] [serial = 1326] [outer = 0x7f1180f2b800]
11:37:16 INFO - ++DOCSHELL 0x7f1181167800 == 33 [pid = 1950] [id = 552]
11:37:16 INFO - ++DOMWINDOW == 75 (0x7f1177128c00) [pid = 1950] [serial = 1327] [outer = (nil)]
11:37:16 INFO - ++DOMWINDOW == 76 (0x7f118da56800) [pid = 1950] [serial = 1328] [outer = 0x7f1177128c00]
11:37:19 INFO - --DOCSHELL 0x7f1180e51000 == 32 [pid = 1950] [id = 523]
11:37:19 INFO - --DOCSHELL 0x7f11810ab000 == 31 [pid = 1950] [id = 524]
11:37:19 INFO - --DOCSHELL 0x7f11770bb800 == 30 [pid = 1950] [id = 529]
11:37:19 INFO - --DOCSHELL 0x7f1185a25000 == 29 [pid = 1950] [id = 530]
11:37:19 INFO - --DOCSHELL 0x7f118aa26800 == 28 [pid = 1950] [id = 531]
11:37:19 INFO - --DOCSHELL 0x7f1176f75000 == 27 [pid = 1950] [id = 526]
11:37:19 INFO - --DOCSHELL 0x7f1176f17000 == 26 [pid = 1950] [id = 537]
11:37:19 INFO - --DOCSHELL 0x7f1180f6a800 == 25 [pid = 1950] [id = 538]
11:37:19 INFO - --DOCSHELL 0x7f11810c1000 == 24 [pid = 1950] [id = 539]
11:37:19 INFO - --DOCSHELL 0x7f1181506800 == 23 [pid = 1950] [id = 540]
11:37:19 INFO - --DOCSHELL 0x7f1180f7b800 == 22 [pid = 1950] [id = 541]
11:37:19 INFO - --DOCSHELL 0x7f1187fbd000 == 21 [pid = 1950] [id = 542]
11:37:19 INFO - --DOCSHELL 0x7f118aa2e000 == 20 [pid = 1950] [id = 543]
11:37:19 INFO - --DOCSHELL 0x7f118d497800 == 19 [pid = 1950] [id = 544]
11:37:19 INFO - --DOCSHELL 0x7f1176f22800 == 18 [pid = 1950] [id = 533]
11:37:19 INFO - --DOCSHELL 0x7f1177249000 == 17 [pid = 1950] [id = 535]
11:37:19 INFO - --DOCSHELL 0x7f117724b800 == 16 [pid = 1950] [id = 534]
11:37:19 INFO - --DOCSHELL 0x7f117a603000 == 15 [pid = 1950] [id = 546]
11:37:19 INFO - --DOCSHELL 0x7f11770b1000 == 14 [pid = 1950] [id = 547]
11:37:19 INFO - --DOCSHELL 0x7f1180e34000 == 13 [pid = 1950] [id = 548]
11:37:19 INFO - --DOMWINDOW == 75 (0x7f1181496800) [pid = 1950] [serial = 1254] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:19 INFO - --DOMWINDOW == 74 (0x7f1185a8c800) [pid = 1950] [serial = 1256] [outer = (nil)] [url = about:blank]
11:37:19 INFO - --DOMWINDOW == 73 (0x7f1187590c00) [pid = 1950] [serial = 1267] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:19 INFO - --DOMWINDOW == 72 (0x7f118a93dc00) [pid = 1950] [serial = 1269] [outer = (nil)] [url = about:blank]
11:37:19 INFO - --DOMWINDOW == 71 (0x7f1180f2f400) [pid = 1950] [serial = 1242] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:19 INFO - --DOMWINDOW == 70 (0x7f1182424000) [pid = 1950] [serial = 1244] [outer = (nil)] [url = about:blank]
11:37:20 INFO - --DOCSHELL 0x7f1181167800 == 12 [pid = 1950] [id = 552]
11:37:20 INFO - MEMORY STAT | vsize 1288MB | residentFast 368MB | heapAllocated 142MB
11:37:20 INFO - 208 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js | took 5531ms
11:37:20 INFO - ++DOCSHELL 0x7f1176f1f800 == 13 [pid = 1950] [id = 553]
11:37:20 INFO - ++DOMWINDOW == 71 (0x7f1176daf400) [pid = 1950] [serial = 1329] [outer = (nil)]
11:37:20 INFO - ++DOMWINDOW == 72 (0x7f1176dc6c00) [pid = 1950] [serial = 1330] [outer = 0x7f1176daf400]
11:37:21 INFO - 209 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js
11:37:21 INFO - ++DOCSHELL 0x7f11773ab800 == 14 [pid = 1950] [id = 554]
11:37:21 INFO - ++DOMWINDOW == 73 (0x7f1176dd7c00) [pid = 1950] [serial = 1331] [outer = (nil)]
11:37:21 INFO - ++DOMWINDOW == 74 (0x7f1176dde400) [pid = 1950] [serial = 1332] [outer = 0x7f1176dd7c00]
11:37:21 INFO - ++DOMWINDOW == 75 (0x7f1176fae400) [pid = 1950] [serial = 1333] [outer = 0x7f1176dd7c00]
11:37:21 INFO - ++DOCSHELL 0x7f11770c1800 == 15 [pid = 1950] [id = 555]
11:37:21 INFO - ++DOMWINDOW == 76 (0x7f1176fb1000) [pid = 1950] [serial = 1334] [outer = (nil)]
11:37:21 INFO - ++DOMWINDOW == 77 (0x7f1176fb2400) [pid = 1950] [serial = 1335] [outer = 0x7f1176fb1000]
11:37:21 INFO - ++DOMWINDOW == 78 (0x7f1176fb4000) [pid = 1950] [serial = 1336] [outer = 0x7f1176fb1000]
11:37:21 INFO - ++DOCSHELL 0x7f1180e3a000 == 16 [pid = 1950] [id = 556]
11:37:21 INFO - ++DOMWINDOW == 79 (0x7f117738a400) [pid = 1950] [serial = 1337] [outer = (nil)]
11:37:21 INFO - ++DOMWINDOW == 80 (0x7f1177394c00) [pid = 1950] [serial = 1338] [outer = 0x7f117738a400]
11:37:25 INFO - --DOCSHELL 0x7f1180e3a000 == 15 [pid = 1950] [id = 556]
11:37:25 INFO - --DOCSHELL 0x7f118126e800 == 14 [pid = 1950] [id = 551]
11:37:25 INFO - --DOCSHELL 0x7f1177255800 == 13 [pid = 1950] [id = 545]
11:37:25 INFO - --DOCSHELL 0x7f11773b0000 == 12 [pid = 1950] [id = 549]
11:37:25 INFO - --DOMWINDOW == 79 (0x7f11776f0000) [pid = 1950] [serial = 1309] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 78 (0x7f118aa6fc00) [pid = 1950] [serial = 1311] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html]
11:37:25 INFO - --DOMWINDOW == 77 (0x7f1181eeac00) [pid = 1950] [serial = 1295] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 76 (0x7f1181d19800) [pid = 1950] [serial = 1289] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 75 (0x7f11776f2c00) [pid = 1950] [serial = 1286] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 74 (0x7f118aa56800) [pid = 1950] [serial = 1307] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 73 (0x7f1176fb8000) [pid = 1950] [serial = 1304] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 72 (0x7f1176ddc400) [pid = 1950] [serial = 1282] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 71 (0x7f11776ee400) [pid = 1950] [serial = 1284] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20remember%20scroll%20location]
11:37:25 INFO - --DOMWINDOW == 70 (0x7f11812d8c00) [pid = 1950] [serial = 1291] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 69 (0x7f1185a8cc00) [pid = 1950] [serial = 1293] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20maintain%20scroll%20with%20pruning%20of%20old%20messages]
11:37:25 INFO - --DOMWINDOW == 68 (0x7f1176fb6800) [pid = 1950] [serial = 1300] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 67 (0x7f118d408c00) [pid = 1950] [serial = 1302] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20614793:%20jsterm%20result%20scroll]
11:37:25 INFO - --DOMWINDOW == 66 (0x7f118aa52400) [pid = 1950] [serial = 1310] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 65 (0x7f118ab7e800) [pid = 1950] [serial = 1312] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 64 (0x7f118d749800) [pid = 1950] [serial = 1298] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 63 (0x7f11881fb400) [pid = 1950] [serial = 1280] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 62 (0x7f118f617000) [pid = 1950] [serial = 1316] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 61 (0x7f1185a90400) [pid = 1950] [serial = 1277] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 60 (0x7f118242dc00) [pid = 1950] [serial = 1313] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 59 (0x7f1187d44000) [pid = 1950] [serial = 1325] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 58 (0x7f1184377400) [pid = 1950] [serial = 1314] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 57 (0x7f118d409800) [pid = 1950] [serial = 1296] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 56 (0x7f11910a8400) [pid = 1950] [serial = 1305] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 55 (0x7f1176ed8000) [pid = 1950] [serial = 1283] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 54 (0x7f11776f2000) [pid = 1950] [serial = 1285] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 53 (0x7f1182887400) [pid = 1950] [serial = 1292] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 52 (0x7f1185a9f000) [pid = 1950] [serial = 1294] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 51 (0x7f1176fba400) [pid = 1950] [serial = 1301] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 50 (0x7f118d566400) [pid = 1950] [serial = 1303] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 49 (0x7f118d567800) [pid = 1950] [serial = 1306] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 48 (0x7f1181edf400) [pid = 1950] [serial = 1290] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 47 (0x7f1180f34000) [pid = 1950] [serial = 1288] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 46 (0x7f118aa59400) [pid = 1950] [serial = 1308] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 45 (0x7f1183674400) [pid = 1950] [serial = 1297] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 44 (0x7f1184620800) [pid = 1950] [serial = 1315] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 43 (0x7f118da57000) [pid = 1950] [serial = 1299] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 42 (0x7f118a90d800) [pid = 1950] [serial = 1281] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 41 (0x7f1191657000) [pid = 1950] [serial = 1317] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 40 (0x7f1185aa1800) [pid = 1950] [serial = 1279] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 39 (0x7f1181d8e800) [pid = 1950] [serial = 1318] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html]
11:37:25 INFO - ++DOCSHELL 0x7f1176f16800 == 13 [pid = 1950] [id = 557]
11:37:25 INFO - ++DOMWINDOW == 40 (0x7f1176cc4000) [pid = 1950] [serial = 1339] [outer = (nil)]
11:37:25 INFO - ++DOMWINDOW == 41 (0x7f1176cc8800) [pid = 1950] [serial = 1340] [outer = 0x7f1176cc4000]
11:37:25 INFO - --DOMWINDOW == 40 (0x7f1180f36400) [pid = 1950] [serial = 1320] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 39 (0x7f1182430400) [pid = 1950] [serial = 1322] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 38 (0x7f1176dde400) [pid = 1950] [serial = 1332] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 37 (0x7f1180f2b800) [pid = 1950] [serial = 1324] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:25 INFO - --DOMWINDOW == 36 (0x7f1176fb2400) [pid = 1950] [serial = 1335] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 35 (0x7f1181d98800) [pid = 1950] [serial = 1321] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html]
11:37:25 INFO - --DOMWINDOW == 34 (0x7f1177128c00) [pid = 1950] [serial = 1327] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:25 INFO - --DOMWINDOW == 33 (0x7f117767ac00) [pid = 1950] [serial = 1319] [outer = (nil)] [url = about:blank]
11:37:25 INFO - --DOMWINDOW == 32 (0x7f11910ae800) [pid = 1950] [serial = 1323] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html]
11:37:25 INFO - ++DOMWINDOW == 33 (0x7f1176cc9400) [pid = 1950] [serial = 1341] [outer = 0x7f1176cc4000]
11:37:26 INFO - ++DOCSHELL 0x7f11770c9800 == 14 [pid = 1950] [id = 558]
11:37:26 INFO - ++DOMWINDOW == 34 (0x7f1176dc5000) [pid = 1950] [serial = 1342] [outer = (nil)]
11:37:26 INFO - ++DOMWINDOW == 35 (0x7f1176dcec00) [pid = 1950] [serial = 1343] [outer = 0x7f1176dc5000]
11:37:28 INFO - --DOCSHELL 0x7f1180e1f000 == 13 [pid = 1950] [id = 550]
11:37:28 INFO - --DOCSHELL 0x7f1176f16800 == 12 [pid = 1950] [id = 557]
11:37:28 INFO - --DOCSHELL 0x7f11770c9800 == 11 [pid = 1950] [id = 558]
11:37:28 INFO - --DOCSHELL 0x7f11770c1800 == 10 [pid = 1950] [id = 555]
11:37:28 INFO - --DOMWINDOW == 34 (0x7f118da56800) [pid = 1950] [serial = 1328] [outer = (nil)] [url = about:blank]
11:37:28 INFO - --DOMWINDOW == 33 (0x7f11776ee800) [pid = 1950] [serial = 1326] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:28 INFO - ++DOCSHELL 0x7f1176f0f000 == 11 [pid = 1950] [id = 559]
11:37:28 INFO - ++DOMWINDOW == 34 (0x7f1176cc6800) [pid = 1950] [serial = 1344] [outer = (nil)]
11:37:28 INFO - ++DOMWINDOW == 35 (0x7f1176ccf000) [pid = 1950] [serial = 1345] [outer = 0x7f1176cc6800]
11:37:28 INFO - --DOMWINDOW == 34 (0x7f1176cc8800) [pid = 1950] [serial = 1340] [outer = (nil)] [url = about:blank]
11:37:28 INFO - ++DOMWINDOW == 35 (0x7f1176cc8800) [pid = 1950] [serial = 1346] [outer = 0x7f1176cc6800]
11:37:29 INFO - ++DOCSHELL 0x7f11770b0800 == 12 [pid = 1950] [id = 560]
11:37:29 INFO - ++DOMWINDOW == 36 (0x7f1176dc8c00) [pid = 1950] [serial = 1347] [outer = (nil)]
11:37:29 INFO - ++DOMWINDOW == 37 (0x7f1176dd1400) [pid = 1950] [serial = 1348] [outer = 0x7f1176dc8c00]
11:37:31 INFO - MEMORY STAT | vsize 1284MB | residentFast 339MB | heapAllocated 129MB
11:37:31 INFO - 210 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js | took 10276ms
11:37:31 INFO - ++DOCSHELL 0x7f1176f22800 == 13 [pid = 1950] [id = 561]
11:37:31 INFO - ++DOMWINDOW == 38 (0x7f1176dcc000) [pid = 1950] [serial = 1349] [outer = (nil)]
11:37:31 INFO - ++DOMWINDOW == 39 (0x7f1176fba000) [pid = 1950] [serial = 1350] [outer = 0x7f1176dcc000]
11:37:31 INFO - 211 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js
11:37:31 INFO - ++DOCSHELL 0x7f117a612000 == 14 [pid = 1950] [id = 562]
11:37:31 INFO - ++DOMWINDOW == 40 (0x7f1177203000) [pid = 1950] [serial = 1351] [outer = (nil)]
11:37:31 INFO - ++DOMWINDOW == 41 (0x7f1177210000) [pid = 1950] [serial = 1352] [outer = 0x7f1177203000]
11:37:32 INFO - ++DOCSHELL 0x7f1176f82800 == 15 [pid = 1950] [id = 563]
11:37:32 INFO - ++DOMWINDOW == 42 (0x7f1177393000) [pid = 1950] [serial = 1353] [outer = (nil)]
11:37:32 INFO - ++DOMWINDOW == 43 (0x7f11773f0800) [pid = 1950] [serial = 1354] [outer = 0x7f1177393000]
11:37:32 INFO - ++DOMWINDOW == 44 (0x7f117712e000) [pid = 1950] [serial = 1355] [outer = 0x7f1177393000]
11:37:32 INFO - ++DOCSHELL 0x7f1180e4e800 == 16 [pid = 1950] [id = 564]
11:37:32 INFO - ++DOMWINDOW == 45 (0x7f1177681c00) [pid = 1950] [serial = 1356] [outer = (nil)]
11:37:32 INFO - ++DOMWINDOW == 46 (0x7f11776eb000) [pid = 1950] [serial = 1357] [outer = 0x7f1177681c00]
11:37:34 INFO - ++DOMWINDOW == 47 (0x7f11776f0c00) [pid = 1950] [serial = 1358] [outer = 0x7f1177203000]
11:37:34 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:37:36 INFO - MEMORY STAT | vsize 1287MB | residentFast 343MB | heapAllocated 134MB
11:37:36 INFO - 212 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js | took 4480ms
11:37:36 INFO - ++DOCSHELL 0x7f1180f70000 == 17 [pid = 1950] [id = 565]
11:37:36 INFO - ++DOMWINDOW == 48 (0x7f11776ebc00) [pid = 1950] [serial = 1359] [outer = (nil)]
11:37:36 INFO - ++DOMWINDOW == 49 (0x7f11776f6c00) [pid = 1950] [serial = 1360] [outer = 0x7f11776ebc00]
11:37:36 INFO - 213 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js
11:37:36 INFO - ++DOCSHELL 0x7f117725c800 == 18 [pid = 1950] [id = 566]
11:37:36 INFO - ++DOMWINDOW == 50 (0x7f1181142400) [pid = 1950] [serial = 1361] [outer = (nil)]
11:37:36 INFO - ++DOMWINDOW == 51 (0x7f1181148000) [pid = 1950] [serial = 1362] [outer = 0x7f1181142400]
11:37:36 INFO - ++DOMWINDOW == 52 (0x7f11812cec00) [pid = 1950] [serial = 1363] [outer = 0x7f1181142400]
11:37:37 INFO - ++DOCSHELL 0x7f1181152800 == 19 [pid = 1950] [id = 567]
11:37:37 INFO - ++DOMWINDOW == 53 (0x7f1181149000) [pid = 1950] [serial = 1364] [outer = (nil)]
11:37:37 INFO - ++DOMWINDOW == 54 (0x7f11812d4c00) [pid = 1950] [serial = 1365] [outer = 0x7f1181149000]
11:37:37 INFO - ++DOMWINDOW == 55 (0x7f117767e400) [pid = 1950] [serial = 1366] [outer = 0x7f1181149000]
11:37:37 INFO - ++DOCSHELL 0x7f118116d000 == 20 [pid = 1950] [id = 568]
11:37:37 INFO - ++DOMWINDOW == 56 (0x7f1176cd1800) [pid = 1950] [serial = 1367] [outer = (nil)]
11:37:37 INFO - ++DOMWINDOW == 57 (0x7f1181495800) [pid = 1950] [serial = 1368] [outer = 0x7f1176cd1800]
11:37:40 INFO - --DOCSHELL 0x7f1176f0f000 == 19 [pid = 1950] [id = 559]
11:37:40 INFO - --DOCSHELL 0x7f11773ab800 == 18 [pid = 1950] [id = 554]
11:37:40 INFO - --DOCSHELL 0x7f11770b0800 == 17 [pid = 1950] [id = 560]
11:37:40 INFO - --DOCSHELL 0x7f1176f1f800 == 16 [pid = 1950] [id = 553]
11:37:40 INFO - --DOCSHELL 0x7f1180e4e800 == 15 [pid = 1950] [id = 564]
11:37:40 INFO - ++DOCSHELL 0x7f1176f0c800 == 16 [pid = 1950] [id = 569]
11:37:40 INFO - ++DOMWINDOW == 58 (0x7f1176cc8000) [pid = 1950] [serial = 1369] [outer = (nil)]
11:37:40 INFO - ++DOMWINDOW == 59 (0x7f1176d7fc00) [pid = 1950] [serial = 1370] [outer = 0x7f1176cc8000]
11:37:43 INFO - --DOCSHELL 0x7f1176f0c800 == 15 [pid = 1950] [id = 569]
11:37:43 INFO - --DOCSHELL 0x7f118116d000 == 14 [pid = 1950] [id = 568]
11:37:44 INFO - --DOCSHELL 0x7f1181152800 == 13 [pid = 1950] [id = 567]
11:37:44 INFO - --DOCSHELL 0x7f1176f82800 == 12 [pid = 1950] [id = 563]
11:37:44 INFO - --DOCSHELL 0x7f1176f22800 == 11 [pid = 1950] [id = 561]
11:37:45 INFO - --DOMWINDOW == 58 (0x7f1176dc8c00) [pid = 1950] [serial = 1347] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:45 INFO - --DOMWINDOW == 57 (0x7f1176fb1000) [pid = 1950] [serial = 1334] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:45 INFO - --DOMWINDOW == 56 (0x7f1176cc4000) [pid = 1950] [serial = 1339] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:45 INFO - --DOMWINDOW == 55 (0x7f1176cc6800) [pid = 1950] [serial = 1344] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:45 INFO - --DOMWINDOW == 54 (0x7f1176dc5000) [pid = 1950] [serial = 1342] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:45 INFO - --DOMWINDOW == 53 (0x7f117738a400) [pid = 1950] [serial = 1337] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:45 INFO - --DOMWINDOW == 52 (0x7f1176daf400) [pid = 1950] [serial = 1329] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 51 (0x7f1176dd7c00) [pid = 1950] [serial = 1331] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 50 (0x7f1177681c00) [pid = 1950] [serial = 1356] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:45 INFO - --DOMWINDOW == 49 (0x7f1177393000) [pid = 1950] [serial = 1353] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:45 INFO - --DOMWINDOW == 48 (0x7f1176ccf000) [pid = 1950] [serial = 1345] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 47 (0x7f1176dc6c00) [pid = 1950] [serial = 1330] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 46 (0x7f1176fae400) [pid = 1950] [serial = 1333] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 45 (0x7f11812d4c00) [pid = 1950] [serial = 1365] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 44 (0x7f11773f0800) [pid = 1950] [serial = 1354] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 43 (0x7f1181148000) [pid = 1950] [serial = 1362] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 42 (0x7f1176dcc000) [pid = 1950] [serial = 1349] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 41 (0x7f11776f0c00) [pid = 1950] [serial = 1358] [outer = (nil)] [url = http://example.com/redirect-from-bug-630733]
11:37:45 INFO - --DOMWINDOW == 40 (0x7f1176fba000) [pid = 1950] [serial = 1350] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 39 (0x7f1177210000) [pid = 1950] [serial = 1352] [outer = (nil)] [url = about:blank]
11:37:45 INFO - --DOMWINDOW == 38 (0x7f1177203000) [pid = 1950] [serial = 1351] [outer = (nil)] [url = http://example.com/redirect-from-bug-630733]
11:37:45 INFO - MEMORY STAT | vsize 1288MB | residentFast 347MB | heapAllocated 135MB
11:37:45 INFO - 214 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js | took 9337ms
11:37:45 INFO - ++DOCSHELL 0x7f1176f2b000 == 12 [pid = 1950] [id = 570]
11:37:45 INFO - ++DOMWINDOW == 39 (0x7f1176dd8400) [pid = 1950] [serial = 1371] [outer = (nil)]
11:37:45 INFO - ++DOMWINDOW == 40 (0x7f1176fb5400) [pid = 1950] [serial = 1372] [outer = 0x7f1176dd8400]
11:37:46 INFO - 215 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js
11:37:46 INFO - ++DOCSHELL 0x7f117a606800 == 13 [pid = 1950] [id = 571]
11:37:46 INFO - ++DOMWINDOW == 41 (0x7f1176cc7000) [pid = 1950] [serial = 1373] [outer = (nil)]
11:37:46 INFO - ++DOMWINDOW == 42 (0x7f1177131c00) [pid = 1950] [serial = 1374] [outer = 0x7f1176cc7000]
11:37:46 INFO - ++DOMWINDOW == 43 (0x7f11773f2000) [pid = 1950] [serial = 1375] [outer = 0x7f1176cc7000]
11:37:46 INFO - ++DOCSHELL 0x7f11770ac000 == 14 [pid = 1950] [id = 572]
11:37:46 INFO - ++DOMWINDOW == 44 (0x7f1177203000) [pid = 1950] [serial = 1376] [outer = (nil)]
11:37:46 INFO - ++DOMWINDOW == 45 (0x7f1177679c00) [pid = 1950] [serial = 1377] [outer = 0x7f1177203000]
11:37:46 INFO - ++DOMWINDOW == 46 (0x7f11773e3c00) [pid = 1950] [serial = 1378] [outer = 0x7f1177203000]
11:37:47 INFO - ++DOCSHELL 0x7f11810b6800 == 15 [pid = 1950] [id = 573]
11:37:47 INFO - ++DOMWINDOW == 47 (0x7f1180f31800) [pid = 1950] [serial = 1379] [outer = (nil)]
11:37:47 INFO - ++DOMWINDOW == 48 (0x7f1180f36400) [pid = 1950] [serial = 1380] [outer = 0x7f1180f31800]
11:37:48 INFO - ++DOCSHELL 0x7f1176f73800 == 16 [pid = 1950] [id = 574]
11:37:48 INFO - ++DOMWINDOW == 49 (0x7f1181eeac00) [pid = 1950] [serial = 1381] [outer = (nil)]
11:37:48 INFO - ++DOMWINDOW == 50 (0x7f1181eeb800) [pid = 1950] [serial = 1382] [outer = 0x7f1181eeac00]
11:37:51 INFO - --DOCSHELL 0x7f117a612000 == 15 [pid = 1950] [id = 562]
11:37:51 INFO - --DOCSHELL 0x7f1180f70000 == 14 [pid = 1950] [id = 565]
11:37:51 INFO - --DOCSHELL 0x7f117725c800 == 13 [pid = 1950] [id = 566]
11:37:51 INFO - --DOCSHELL 0x7f11770ac000 == 12 [pid = 1950] [id = 572]
11:37:51 INFO - --DOCSHELL 0x7f11810b6800 == 11 [pid = 1950] [id = 573]
11:37:51 INFO - --DOCSHELL 0x7f1176f73800 == 10 [pid = 1950] [id = 574]
11:37:51 INFO - --DOMWINDOW == 49 (0x7f11776eb000) [pid = 1950] [serial = 1357] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 48 (0x7f117712e000) [pid = 1950] [serial = 1355] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:51 INFO - --DOMWINDOW == 47 (0x7f1176dd1400) [pid = 1950] [serial = 1348] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 46 (0x7f1176cc8800) [pid = 1950] [serial = 1346] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:51 INFO - --DOMWINDOW == 45 (0x7f1176dcec00) [pid = 1950] [serial = 1343] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 44 (0x7f1176cc9400) [pid = 1950] [serial = 1341] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:51 INFO - --DOMWINDOW == 43 (0x7f1177394c00) [pid = 1950] [serial = 1338] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 42 (0x7f1176fb4000) [pid = 1950] [serial = 1336] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:51 INFO - --DOMWINDOW == 41 (0x7f11776ebc00) [pid = 1950] [serial = 1359] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 40 (0x7f1181142400) [pid = 1950] [serial = 1361] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html]
11:37:51 INFO - --DOMWINDOW == 39 (0x7f1176cc8000) [pid = 1950] [serial = 1369] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:37:51 INFO - --DOMWINDOW == 38 (0x7f11776f6c00) [pid = 1950] [serial = 1360] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 37 (0x7f1177131c00) [pid = 1950] [serial = 1374] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 36 (0x7f1177679c00) [pid = 1950] [serial = 1377] [outer = (nil)] [url = about:blank]
11:37:51 INFO - --DOMWINDOW == 35 (0x7f1181149000) [pid = 1950] [serial = 1364] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:51 INFO - --DOMWINDOW == 34 (0x7f1176cd1800) [pid = 1950] [serial = 1367] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:37:52 INFO - MEMORY STAT | vsize 1284MB | residentFast 339MB | heapAllocated 128MB
11:37:52 INFO - 216 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js | took 6041ms
11:37:52 INFO - ++DOCSHELL 0x7f1176f0c800 == 11 [pid = 1950] [id = 575]
11:37:52 INFO - ++DOMWINDOW == 35 (0x7f1176d7c800) [pid = 1950] [serial = 1383] [outer = (nil)]
11:37:52 INFO - ++DOMWINDOW == 36 (0x7f1176d84400) [pid = 1950] [serial = 1384] [outer = 0x7f1176d7c800]
11:37:52 INFO - 217 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632817.js
11:37:52 INFO - ++DOCSHELL 0x7f11770c8000 == 12 [pid = 1950] [id = 576]
11:37:52 INFO - ++DOMWINDOW == 37 (0x7f1176dc6400) [pid = 1950] [serial = 1385] [outer = (nil)]
11:37:52 INFO - ++DOMWINDOW == 38 (0x7f1176dcb000) [pid = 1950] [serial = 1386] [outer = 0x7f1176dc6400]
11:37:53 INFO - ++DOCSHELL 0x7f117724c000 == 13 [pid = 1950] [id = 577]
11:37:53 INFO - ++DOMWINDOW == 39 (0x7f1176ddf800) [pid = 1950] [serial = 1387] [outer = (nil)]
11:37:53 INFO - ++DOMWINDOW == 40 (0x7f1176de0800) [pid = 1950] [serial = 1388] [outer = 0x7f1176ddf800]
11:37:53 INFO - ++DOMWINDOW == 41 (0x7f1176de0c00) [pid = 1950] [serial = 1389] [outer = 0x7f1176ddf800]
11:37:53 INFO - ++DOCSHELL 0x7f117a621800 == 14 [pid = 1950] [id = 578]
11:37:53 INFO - ++DOMWINDOW == 42 (0x7f117712a800) [pid = 1950] [serial = 1390] [outer = (nil)]
11:37:53 INFO - ++DOMWINDOW == 43 (0x7f117712cc00) [pid = 1950] [serial = 1391] [outer = 0x7f117712a800]
11:37:55 INFO - ++DOMWINDOW == 44 (0x7f1181d8e000) [pid = 1950] [serial = 1392] [outer = 0x7f1176dc6400]
11:37:55 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:37:56 INFO - --DOCSHELL 0x7f117a606800 == 13 [pid = 1950] [id = 571]
11:37:56 INFO - --DOCSHELL 0x7f1176f2b000 == 12 [pid = 1950] [id = 570]
11:37:56 INFO - --DOMWINDOW == 43 (0x7f1176d7fc00) [pid = 1950] [serial = 1370] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:37:56 INFO - --DOMWINDOW == 42 (0x7f1181495800) [pid = 1950] [serial = 1368] [outer = (nil)] [url = about:blank]
11:37:56 INFO - --DOMWINDOW == 41 (0x7f117767e400) [pid = 1950] [serial = 1366] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:37:56 INFO - --DOMWINDOW == 40 (0x7f11812cec00) [pid = 1950] [serial = 1363] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html]
11:37:57 INFO - ++DOMWINDOW == 41 (0x7f1176dd3400) [pid = 1950] [serial = 1393] [outer = 0x7f1176dc6400]
11:37:57 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:37:58 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:37:58 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:37:58 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:37:58 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:37:58 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 77: TypeError: this._recipeManager is null
11:37:59 INFO - ++DOMWINDOW == 42 (0x7f1176fb1400) [pid = 1950] [serial = 1394] [outer = 0x7f1176dc6400]
11:37:59 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:37:59 INFO - --DOCSHELL 0x7f117a621800 == 11 [pid = 1950] [id = 578]
11:38:01 INFO - --DOMWINDOW == 41 (0x7f1176de0800) [pid = 1950] [serial = 1388] [outer = (nil)] [url = about:blank]
11:38:01 INFO - --DOMWINDOW == 40 (0x7f1176fb5400) [pid = 1950] [serial = 1372] [outer = (nil)] [url = about:blank]
11:38:01 INFO - --DOMWINDOW == 39 (0x7f1177203000) [pid = 1950] [serial = 1376] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:01 INFO - --DOMWINDOW == 38 (0x7f1180f31800) [pid = 1950] [serial = 1379] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:01 INFO - --DOMWINDOW == 37 (0x7f1176dd8400) [pid = 1950] [serial = 1371] [outer = (nil)] [url = about:blank]
11:38:01 INFO - --DOMWINDOW == 36 (0x7f1176cc7000) [pid = 1950] [serial = 1373] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html]
11:38:01 INFO - --DOMWINDOW == 35 (0x7f1181eeac00) [pid = 1950] [serial = 1381] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:38:01 INFO - --DOMWINDOW == 34 (0x7f11773f2000) [pid = 1950] [serial = 1375] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html]
11:38:01 INFO - --DOMWINDOW == 33 (0x7f1181d8e000) [pid = 1950] [serial = 1392] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:38:01 INFO - MEMORY STAT | vsize 1282MB | residentFast 330MB | heapAllocated 126MB
11:38:01 INFO - 218 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632817.js | took 9179ms
11:38:01 INFO - ++DOCSHELL 0x7f11770b0000 == 12 [pid = 1950] [id = 579]
11:38:01 INFO - ++DOMWINDOW == 34 (0x7f1176db3c00) [pid = 1950] [serial = 1395] [outer = (nil)]
11:38:01 INFO - ++DOMWINDOW == 35 (0x7f1176dc6c00) [pid = 1950] [serial = 1396] [outer = 0x7f1176db3c00]
11:38:01 INFO - 219 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js
11:38:01 INFO - ++DOCSHELL 0x7f11773af000 == 13 [pid = 1950] [id = 580]
11:38:01 INFO - ++DOMWINDOW == 36 (0x7f1176dd5800) [pid = 1950] [serial = 1397] [outer = (nil)]
11:38:01 INFO - ++DOMWINDOW == 37 (0x7f1176dd8400) [pid = 1950] [serial = 1398] [outer = 0x7f1176dd5800]
11:38:02 INFO - ++DOCSHELL 0x7f1176f6f000 == 14 [pid = 1950] [id = 581]
11:38:02 INFO - ++DOMWINDOW == 38 (0x7f1176dd9c00) [pid = 1950] [serial = 1399] [outer = (nil)]
11:38:02 INFO - ++DOMWINDOW == 39 (0x7f1176ee1c00) [pid = 1950] [serial = 1400] [outer = 0x7f1176dd9c00]
11:38:02 INFO - ++DOMWINDOW == 40 (0x7f1176edb400) [pid = 1950] [serial = 1401] [outer = 0x7f1176dd9c00]
11:38:02 INFO - ++DOCSHELL 0x7f1180e0e800 == 15 [pid = 1950] [id = 582]
11:38:02 INFO - ++DOMWINDOW == 41 (0x7f1177132000) [pid = 1950] [serial = 1402] [outer = (nil)]
11:38:02 INFO - ++DOMWINDOW == 42 (0x7f1177134c00) [pid = 1950] [serial = 1403] [outer = 0x7f1177132000]
11:38:05 INFO - --DOCSHELL 0x7f117724c000 == 14 [pid = 1950] [id = 577]
11:38:05 INFO - --DOCSHELL 0x7f1176f0c800 == 13 [pid = 1950] [id = 575]
11:38:05 INFO - --DOCSHELL 0x7f1176f6f000 == 12 [pid = 1950] [id = 581]
11:38:05 INFO - --DOCSHELL 0x7f1180e0e800 == 11 [pid = 1950] [id = 582]
11:38:05 INFO - --DOCSHELL 0x7f11770c8000 == 10 [pid = 1950] [id = 576]
11:38:05 INFO - --DOMWINDOW == 41 (0x7f11773e3c00) [pid = 1950] [serial = 1378] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:05 INFO - --DOMWINDOW == 40 (0x7f1180f36400) [pid = 1950] [serial = 1380] [outer = (nil)] [url = about:blank]
11:38:05 INFO - --DOMWINDOW == 39 (0x7f1181eeb800) [pid = 1950] [serial = 1382] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:38:06 INFO - --DOMWINDOW == 38 (0x7f1176dcb000) [pid = 1950] [serial = 1386] [outer = (nil)] [url = about:blank]
11:38:06 INFO - --DOMWINDOW == 37 (0x7f1176d84400) [pid = 1950] [serial = 1384] [outer = (nil)] [url = about:blank]
11:38:06 INFO - --DOMWINDOW == 36 (0x7f1176ee1c00) [pid = 1950] [serial = 1400] [outer = (nil)] [url = about:blank]
11:38:06 INFO - --DOMWINDOW == 35 (0x7f1176ddf800) [pid = 1950] [serial = 1387] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:06 INFO - --DOMWINDOW == 34 (0x7f117712a800) [pid = 1950] [serial = 1390] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:06 INFO - --DOMWINDOW == 33 (0x7f1176dc6400) [pid = 1950] [serial = 1385] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:38:06 INFO - --DOMWINDOW == 32 (0x7f1176d7c800) [pid = 1950] [serial = 1383] [outer = (nil)] [url = about:blank]
11:38:06 INFO - MEMORY STAT | vsize 1279MB | residentFast 327MB | heapAllocated 125MB
11:38:06 INFO - 220 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js | took 4672ms
11:38:06 INFO - ++DOCSHELL 0x7f1176f29800 == 11 [pid = 1950] [id = 583]
11:38:06 INFO - ++DOMWINDOW == 33 (0x7f1176d83000) [pid = 1950] [serial = 1404] [outer = (nil)]
11:38:06 INFO - ++DOMWINDOW == 34 (0x7f1176db0800) [pid = 1950] [serial = 1405] [outer = 0x7f1176d83000]
11:38:06 INFO - 221 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js
11:38:06 INFO - ++DOCSHELL 0x7f1177243000 == 12 [pid = 1950] [id = 584]
11:38:06 INFO - ++DOMWINDOW == 35 (0x7f1176dcc800) [pid = 1950] [serial = 1406] [outer = (nil)]
11:38:06 INFO - ++DOMWINDOW == 36 (0x7f1176dd5000) [pid = 1950] [serial = 1407] [outer = 0x7f1176dcc800]
11:38:07 INFO - ++DOCSHELL 0x7f1176f17800 == 13 [pid = 1950] [id = 585]
11:38:07 INFO - ++DOMWINDOW == 37 (0x7f1176dd6000) [pid = 1950] [serial = 1408] [outer = (nil)]
11:38:07 INFO - ++DOMWINDOW == 38 (0x7f1176edc000) [pid = 1950] [serial = 1409] [outer = 0x7f1176dd6000]
11:38:07 INFO - ++DOMWINDOW == 39 (0x7f1176ed5400) [pid = 1950] [serial = 1410] [outer = 0x7f1176dd6000]
11:38:07 INFO - ++DOCSHELL 0x7f117a621800 == 14 [pid = 1950] [id = 586]
11:38:07 INFO - ++DOMWINDOW == 40 (0x7f117712ec00) [pid = 1950] [serial = 1411] [outer = (nil)]
11:38:07 INFO - ++DOMWINDOW == 41 (0x7f1177131000) [pid = 1950] [serial = 1412] [outer = 0x7f117712ec00]
11:38:09 INFO - ++DOMWINDOW == 42 (0x7f1180f38800) [pid = 1950] [serial = 1413] [outer = 0x7f1176dcc800]
11:38:09 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:38:09 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 15: ReferenceError: bar is not defined
11:38:11 INFO - --DOCSHELL 0x7f11770b0000 == 13 [pid = 1950] [id = 579]
11:38:11 INFO - --DOCSHELL 0x7f11773af000 == 12 [pid = 1950] [id = 580]
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar0 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar1 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar2 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar3 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar4 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar5 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar6 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar7 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar8 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar9 is not defined
11:38:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar10 is not defined
11:38:11 INFO - --DOMWINDOW == 41 (0x7f1176de0c00) [pid = 1950] [serial = 1389] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:11 INFO - --DOMWINDOW == 40 (0x7f117712cc00) [pid = 1950] [serial = 1391] [outer = (nil)] [url = about:blank]
11:38:11 INFO - --DOMWINDOW == 39 (0x7f1176fb1400) [pid = 1950] [serial = 1394] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:38:11 INFO - --DOMWINDOW == 38 (0x7f1176dd3400) [pid = 1950] [serial = 1393] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:38:12 INFO - --DOCSHELL 0x7f117a621800 == 11 [pid = 1950] [id = 586]
11:38:13 INFO - MEMORY STAT | vsize 1283MB | residentFast 333MB | heapAllocated 130MB
11:38:13 INFO - 222 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js | took 6910ms
11:38:13 INFO - ++DOCSHELL 0x7f1180e08800 == 12 [pid = 1950] [id = 587]
11:38:13 INFO - ++DOMWINDOW == 39 (0x7f11773eb000) [pid = 1950] [serial = 1414] [outer = (nil)]
11:38:13 INFO - ++DOMWINDOW == 40 (0x7f1177676000) [pid = 1950] [serial = 1415] [outer = 0x7f11773eb000]
11:38:14 INFO - 223 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js
11:38:14 INFO - ++DOCSHELL 0x7f1180e51000 == 13 [pid = 1950] [id = 588]
11:38:14 INFO - ++DOMWINDOW == 41 (0x7f11776f4400) [pid = 1950] [serial = 1416] [outer = (nil)]
11:38:14 INFO - ++DOMWINDOW == 42 (0x7f1180f37c00) [pid = 1950] [serial = 1417] [outer = 0x7f11776f4400]
11:38:14 INFO - ++DOCSHELL 0x7f1176f8a800 == 14 [pid = 1950] [id = 589]
11:38:14 INFO - ++DOMWINDOW == 43 (0x7f1176dd3000) [pid = 1950] [serial = 1418] [outer = (nil)]
11:38:14 INFO - ++DOMWINDOW == 44 (0x7f1176dd5c00) [pid = 1950] [serial = 1419] [outer = 0x7f1176dd3000]
11:38:15 INFO - ++DOMWINDOW == 45 (0x7f1176ddd400) [pid = 1950] [serial = 1420] [outer = 0x7f1176dd3000]
11:38:15 INFO - ++DOCSHELL 0x7f1176f1a000 == 15 [pid = 1950] [id = 590]
11:38:15 INFO - ++DOMWINDOW == 46 (0x7f1177395000) [pid = 1950] [serial = 1421] [outer = (nil)]
11:38:15 INFO - ++DOMWINDOW == 47 (0x7f1181144c00) [pid = 1950] [serial = 1422] [outer = 0x7f1177395000]
11:38:17 INFO - ++DOMWINDOW == 48 (0x7f1181ee2000) [pid = 1950] [serial = 1423] [outer = 0x7f11776f4400]
11:38:17 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:38:19 INFO - --DOCSHELL 0x7f1177243000 == 14 [pid = 1950] [id = 584]
11:38:19 INFO - --DOCSHELL 0x7f1176f17800 == 13 [pid = 1950] [id = 585]
11:38:19 INFO - --DOCSHELL 0x7f1176f29800 == 12 [pid = 1950] [id = 583]
11:38:21 INFO - --DOCSHELL 0x7f1176f1a000 == 11 [pid = 1950] [id = 590]
11:38:21 INFO - MEMORY STAT | vsize 1279MB | residentFast 327MB | heapAllocated 132MB
11:38:21 INFO - 224 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js | took 7708ms
11:38:21 INFO - ++DOCSHELL 0x7f1176f15000 == 12 [pid = 1950] [id = 591]
11:38:21 INFO - ++DOMWINDOW == 49 (0x7f1176fb6000) [pid = 1950] [serial = 1424] [outer = (nil)]
11:38:21 INFO - ++DOMWINDOW == 50 (0x7f1176fbb800) [pid = 1950] [serial = 1425] [outer = 0x7f1176fb6000]
11:38:22 INFO - 225 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js
11:38:22 INFO - ++DOCSHELL 0x7f11773c4000 == 13 [pid = 1950] [id = 592]
11:38:22 INFO - ++DOMWINDOW == 51 (0x7f117712f000) [pid = 1950] [serial = 1426] [outer = (nil)]
11:38:22 INFO - ++DOMWINDOW == 52 (0x7f1177134400) [pid = 1950] [serial = 1427] [outer = 0x7f117712f000]
11:38:22 INFO - ++DOCSHELL 0x7f1177258000 == 14 [pid = 1950] [id = 593]
11:38:22 INFO - ++DOMWINDOW == 53 (0x7f1177210000) [pid = 1950] [serial = 1428] [outer = (nil)]
11:38:22 INFO - ++DOMWINDOW == 54 (0x7f1177393c00) [pid = 1950] [serial = 1429] [outer = 0x7f1177210000]
11:38:22 INFO - ++DOMWINDOW == 55 (0x7f117720b400) [pid = 1950] [serial = 1430] [outer = 0x7f1177210000]
11:38:23 INFO - ++DOCSHELL 0x7f11810b2800 == 15 [pid = 1950] [id = 594]
11:38:23 INFO - ++DOMWINDOW == 56 (0x7f1177682400) [pid = 1950] [serial = 1431] [outer = (nil)]
11:38:23 INFO - ++DOMWINDOW == 57 (0x7f11776eec00) [pid = 1950] [serial = 1432] [outer = 0x7f1177682400]
11:38:23 INFO - --DOMWINDOW == 56 (0x7f1176d83000) [pid = 1950] [serial = 1404] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 55 (0x7f1176db0800) [pid = 1950] [serial = 1405] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 54 (0x7f1177132000) [pid = 1950] [serial = 1402] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:23 INFO - --DOMWINDOW == 53 (0x7f1176dd6000) [pid = 1950] [serial = 1408] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:23 INFO - --DOMWINDOW == 52 (0x7f1176dd9c00) [pid = 1950] [serial = 1399] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:23 INFO - --DOMWINDOW == 51 (0x7f117712ec00) [pid = 1950] [serial = 1411] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:23 INFO - --DOMWINDOW == 50 (0x7f1176dcc800) [pid = 1950] [serial = 1406] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html]
11:38:23 INFO - --DOMWINDOW == 49 (0x7f1176db3c00) [pid = 1950] [serial = 1395] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 48 (0x7f1176dd5800) [pid = 1950] [serial = 1397] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20bug%20642108.]
11:38:23 INFO - --DOMWINDOW == 47 (0x7f1176edc000) [pid = 1950] [serial = 1409] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 46 (0x7f1176dc6c00) [pid = 1950] [serial = 1396] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 45 (0x7f1176dd8400) [pid = 1950] [serial = 1398] [outer = (nil)] [url = about:blank]
11:38:23 INFO - --DOMWINDOW == 44 (0x7f1176dd5000) [pid = 1950] [serial = 1407] [outer = (nil)] [url = about:blank]
11:38:26 INFO - --DOCSHELL 0x7f1180e51000 == 14 [pid = 1950] [id = 588]
11:38:26 INFO - --DOCSHELL 0x7f1176f8a800 == 13 [pid = 1950] [id = 589]
11:38:26 INFO - --DOCSHELL 0x7f1180e08800 == 12 [pid = 1950] [id = 587]
11:38:27 INFO - --DOMWINDOW == 43 (0x7f1180f38800) [pid = 1950] [serial = 1413] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html]
11:38:27 INFO - --DOMWINDOW == 42 (0x7f1176edb400) [pid = 1950] [serial = 1401] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:27 INFO - --DOMWINDOW == 41 (0x7f1177131000) [pid = 1950] [serial = 1412] [outer = (nil)] [url = about:blank]
11:38:27 INFO - --DOMWINDOW == 40 (0x7f1176ed5400) [pid = 1950] [serial = 1410] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:27 INFO - --DOMWINDOW == 39 (0x7f1177134c00) [pid = 1950] [serial = 1403] [outer = (nil)] [url = about:blank]
11:38:27 INFO - ++DOCSHELL 0x7f1176f29800 == 13 [pid = 1950] [id = 595]
11:38:27 INFO - ++DOMWINDOW == 40 (0x7f1176d7bc00) [pid = 1950] [serial = 1433] [outer = (nil)]
11:38:27 INFO - ++DOMWINDOW == 41 (0x7f1176d7d000) [pid = 1950] [serial = 1434] [outer = 0x7f1176d7bc00]
11:38:29 INFO - --DOCSHELL 0x7f11810b2800 == 12 [pid = 1950] [id = 594]
11:38:30 INFO - MEMORY STAT | vsize 1280MB | residentFast 333MB | heapAllocated 134MB
11:38:30 INFO - 226 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js | took 8590ms
11:38:30 INFO - ++DOCSHELL 0x7f117a61a000 == 13 [pid = 1950] [id = 596]
11:38:30 INFO - ++DOMWINDOW == 42 (0x7f1176ee2400) [pid = 1950] [serial = 1435] [outer = (nil)]
11:38:30 INFO - ++DOMWINDOW == 43 (0x7f1176fb0000) [pid = 1950] [serial = 1436] [outer = 0x7f1176ee2400]
11:38:30 INFO - 227 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js
11:38:31 INFO - ++DOCSHELL 0x7f1180e3b000 == 14 [pid = 1950] [id = 597]
11:38:31 INFO - ++DOMWINDOW == 44 (0x7f1176fb7000) [pid = 1950] [serial = 1437] [outer = (nil)]
11:38:31 INFO - ++DOMWINDOW == 45 (0x7f1177125c00) [pid = 1950] [serial = 1438] [outer = 0x7f1176fb7000]
11:38:31 INFO - ++DOCSHELL 0x7f1180f6c000 == 15 [pid = 1950] [id = 598]
11:38:31 INFO - ++DOMWINDOW == 46 (0x7f1176faf400) [pid = 1950] [serial = 1439] [outer = (nil)]
11:38:31 INFO - ++DOMWINDOW == 47 (0x7f1176cd1c00) [pid = 1950] [serial = 1440] [outer = 0x7f1176faf400]
11:38:31 INFO - ++DOMWINDOW == 48 (0x7f1177127800) [pid = 1950] [serial = 1441] [outer = 0x7f1176faf400]
11:38:33 INFO - ++DOCSHELL 0x7f1176f19800 == 16 [pid = 1950] [id = 599]
11:38:33 INFO - ++DOMWINDOW == 49 (0x7f11812cf400) [pid = 1950] [serial = 1442] [outer = (nil)]
11:38:33 INFO - ++DOMWINDOW == 50 (0x7f1181493c00) [pid = 1950] [serial = 1443] [outer = 0x7f11812cf400]
11:38:33 INFO - --DOMWINDOW == 49 (0x7f1177395000) [pid = 1950] [serial = 1421] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:33 INFO - --DOMWINDOW == 48 (0x7f1176dd3000) [pid = 1950] [serial = 1418] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:33 INFO - --DOMWINDOW == 47 (0x7f11776f4400) [pid = 1950] [serial = 1416] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html]
11:38:33 INFO - --DOMWINDOW == 46 (0x7f11773eb000) [pid = 1950] [serial = 1414] [outer = (nil)] [url = about:blank]
11:38:33 INFO - --DOMWINDOW == 45 (0x7f1176dd5c00) [pid = 1950] [serial = 1419] [outer = (nil)] [url = about:blank]
11:38:33 INFO - --DOMWINDOW == 44 (0x7f1180f37c00) [pid = 1950] [serial = 1417] [outer = (nil)] [url = about:blank]
11:38:33 INFO - --DOMWINDOW == 43 (0x7f1177676000) [pid = 1950] [serial = 1415] [outer = (nil)] [url = about:blank]
11:38:33 INFO - --DOMWINDOW == 42 (0x7f1177393c00) [pid = 1950] [serial = 1429] [outer = (nil)] [url = about:blank]
11:38:33 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:33 INFO - ++DOCSHELL 0x7f11810c6800 == 17 [pid = 1950] [id = 600]
11:38:33 INFO - ++DOMWINDOW == 43 (0x7f1180f29400) [pid = 1950] [serial = 1444] [outer = (nil)]
11:38:33 INFO - ++DOMWINDOW == 44 (0x7f118114a000) [pid = 1950] [serial = 1445] [outer = 0x7f1180f29400]
11:38:33 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:33 INFO - ++DOCSHELL 0x7f117725c800 == 18 [pid = 1950] [id = 601]
11:38:33 INFO - ++DOMWINDOW == 45 (0x7f1181d17c00) [pid = 1950] [serial = 1446] [outer = (nil)]
11:38:33 INFO - ++DOCSHELL 0x7f11810bd000 == 19 [pid = 1950] [id = 602]
11:38:33 INFO - ++DOMWINDOW == 46 (0x7f1181d19800) [pid = 1950] [serial = 1447] [outer = (nil)]
11:38:33 INFO - ++DOCSHELL 0x7f1181275800 == 20 [pid = 1950] [id = 603]
11:38:33 INFO - ++DOMWINDOW == 47 (0x7f1181d1a400) [pid = 1950] [serial = 1448] [outer = (nil)]
11:38:33 INFO - ++DOCSHELL 0x7f1181283800 == 21 [pid = 1950] [id = 604]
11:38:33 INFO - ++DOMWINDOW == 48 (0x7f1181d1b400) [pid = 1950] [serial = 1449] [outer = (nil)]
11:38:33 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:33 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:33 INFO - ++DOCSHELL 0x7f1176f79000 == 22 [pid = 1950] [id = 605]
11:38:33 INFO - ++DOMWINDOW == 49 (0x7f1181d8e800) [pid = 1950] [serial = 1450] [outer = (nil)]
11:38:33 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:33 INFO - ++DOCSHELL 0x7f1181502800 == 23 [pid = 1950] [id = 606]
11:38:33 INFO - ++DOMWINDOW == 50 (0x7f1181d91800) [pid = 1950] [serial = 1451] [outer = (nil)]
11:38:34 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:38:34 INFO - ++DOMWINDOW == 51 (0x7f1181d93800) [pid = 1950] [serial = 1452] [outer = 0x7f1181d17c00]
11:38:34 INFO - ++DOMWINDOW == 52 (0x7f1181d99800) [pid = 1950] [serial = 1453] [outer = 0x7f1181d19800]
11:38:34 INFO - ++DOMWINDOW == 53 (0x7f1181d9a000) [pid = 1950] [serial = 1454] [outer = 0x7f1181d1a400]
11:38:34 INFO - ++DOMWINDOW == 54 (0x7f1181edd400) [pid = 1950] [serial = 1455] [outer = 0x7f1181d1b400]
11:38:34 INFO - ++DOMWINDOW == 55 (0x7f1181ee0000) [pid = 1950] [serial = 1456] [outer = 0x7f1181d8e800]
11:38:34 INFO - ++DOMWINDOW == 56 (0x7f1181ee1000) [pid = 1950] [serial = 1457] [outer = 0x7f1181d91800]
11:38:34 INFO - ++DOCSHELL 0x7f11826c8800 == 24 [pid = 1950] [id = 607]
11:38:34 INFO - ++DOMWINDOW == 57 (0x7f118242bc00) [pid = 1950] [serial = 1458] [outer = (nil)]
11:38:34 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:34 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:38:34 INFO - ++DOCSHELL 0x7f1182784000 == 25 [pid = 1950] [id = 608]
11:38:34 INFO - ++DOMWINDOW == 58 (0x7f1182603400) [pid = 1950] [serial = 1459] [outer = (nil)]
11:38:34 INFO - ++DOMWINDOW == 59 (0x7f1176cca400) [pid = 1950] [serial = 1460] [outer = 0x7f1182603400]
11:38:34 INFO - ++DOMWINDOW == 60 (0x7f1183675400) [pid = 1950] [serial = 1461] [outer = 0x7f118242bc00]
11:38:34 INFO - ++DOMWINDOW == 61 (0x7f11838be400) [pid = 1950] [serial = 1462] [outer = 0x7f1182603400]
11:38:36 INFO - ++DOCSHELL 0x7f1180f63800 == 26 [pid = 1950] [id = 609]
11:38:36 INFO - ++DOMWINDOW == 62 (0x7f117712cc00) [pid = 1950] [serial = 1463] [outer = (nil)]
11:38:36 INFO - ++DOMWINDOW == 63 (0x7f117712f400) [pid = 1950] [serial = 1464] [outer = 0x7f117712cc00]
11:38:38 INFO - --DOCSHELL 0x7f1182784000 == 25 [pid = 1950] [id = 608]
11:38:38 INFO - --DOCSHELL 0x7f1176f29800 == 24 [pid = 1950] [id = 595]
11:38:38 INFO - --DOCSHELL 0x7f11773c4000 == 23 [pid = 1950] [id = 592]
11:38:38 INFO - --DOCSHELL 0x7f1177258000 == 22 [pid = 1950] [id = 593]
11:38:38 INFO - --DOCSHELL 0x7f1176f15000 == 21 [pid = 1950] [id = 591]
11:38:38 INFO - --DOMWINDOW == 62 (0x7f1181ee2000) [pid = 1950] [serial = 1423] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html]
11:38:38 INFO - --DOMWINDOW == 61 (0x7f1181144c00) [pid = 1950] [serial = 1422] [outer = (nil)] [url = about:blank]
11:38:38 INFO - --DOMWINDOW == 60 (0x7f1176ddd400) [pid = 1950] [serial = 1420] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:38 INFO - --DOCSHELL 0x7f11810bd000 == 20 [pid = 1950] [id = 602]
11:38:38 INFO - --DOCSHELL 0x7f1181275800 == 19 [pid = 1950] [id = 603]
11:38:38 INFO - --DOCSHELL 0x7f117725c800 == 18 [pid = 1950] [id = 601]
11:38:38 INFO - --DOCSHELL 0x7f1181283800 == 17 [pid = 1950] [id = 604]
11:38:38 INFO - --DOCSHELL 0x7f1176f79000 == 16 [pid = 1950] [id = 605]
11:38:39 INFO - --DOCSHELL 0x7f11826c8800 == 15 [pid = 1950] [id = 607]
11:38:39 INFO - --DOCSHELL 0x7f11810c6800 == 14 [pid = 1950] [id = 600]
11:38:39 INFO - --DOCSHELL 0x7f1176f19800 == 13 [pid = 1950] [id = 599]
11:38:39 INFO - --DOCSHELL 0x7f1180f63800 == 12 [pid = 1950] [id = 609]
11:38:39 INFO - console.error:
11:38:39 INFO - Protocol error (noSuchActor): No such actor for ID: server1.conn138.animationsActor23
11:38:39 INFO - MEMORY STAT | vsize 1283MB | residentFast 346MB | heapAllocated 139MB
11:38:39 INFO - 228 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js | took 8765ms
11:38:39 INFO - ++DOCSHELL 0x7f1176f28000 == 13 [pid = 1950] [id = 610]
11:38:39 INFO - ++DOMWINDOW == 61 (0x7f1176db8000) [pid = 1950] [serial = 1465] [outer = (nil)]
11:38:39 INFO - ++DOMWINDOW == 62 (0x7f1176dd4000) [pid = 1950] [serial = 1466] [outer = 0x7f1176db8000]
11:38:40 INFO - 229 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js
11:38:40 INFO - ++DOCSHELL 0x7f11773b3800 == 14 [pid = 1950] [id = 611]
11:38:40 INFO - ++DOMWINDOW == 63 (0x7f1176ddd800) [pid = 1950] [serial = 1467] [outer = (nil)]
11:38:40 INFO - ++DOMWINDOW == 64 (0x7f1176de0400) [pid = 1950] [serial = 1468] [outer = 0x7f1176ddd800]
11:38:42 INFO - --DOCSHELL 0x7f1181502800 == 13 [pid = 1950] [id = 606]
11:38:42 INFO - --DOCSHELL 0x7f117a61a000 == 12 [pid = 1950] [id = 596]
11:38:42 INFO - --DOCSHELL 0x7f1180f6c000 == 11 [pid = 1950] [id = 598]
11:38:42 INFO - --DOMWINDOW == 63 (0x7f118242bc00) [pid = 1950] [serial = 1458] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:38:42 INFO - --DOMWINDOW == 62 (0x7f1176fb7000) [pid = 1950] [serial = 1437] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20highlighter%20helper%20in%20web%20console]
11:38:42 INFO - --DOMWINDOW == 61 (0x7f1176ee2400) [pid = 1950] [serial = 1435] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 60 (0x7f1181d19800) [pid = 1950] [serial = 1447] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:38:42 INFO - --DOMWINDOW == 59 (0x7f1181d1a400) [pid = 1950] [serial = 1448] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:38:42 INFO - --DOMWINDOW == 58 (0x7f1181d17c00) [pid = 1950] [serial = 1446] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:38:42 INFO - --DOMWINDOW == 57 (0x7f1181d1b400) [pid = 1950] [serial = 1449] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:38:42 INFO - --DOMWINDOW == 56 (0x7f1182603400) [pid = 1950] [serial = 1459] [outer = (nil)] [url = data:text/html,]
11:38:42 INFO - --DOMWINDOW == 55 (0x7f11838be400) [pid = 1950] [serial = 1462] [outer = (nil)] [url = data:text/html,]
11:38:42 INFO - --DOMWINDOW == 54 (0x7f117712cc00) [pid = 1950] [serial = 1463] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:42 INFO - --DOMWINDOW == 53 (0x7f1177125c00) [pid = 1950] [serial = 1438] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 52 (0x7f1176fb0000) [pid = 1950] [serial = 1436] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 51 (0x7f1176cca400) [pid = 1950] [serial = 1460] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 50 (0x7f1177682400) [pid = 1950] [serial = 1431] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:42 INFO - --DOMWINDOW == 49 (0x7f1176fb6000) [pid = 1950] [serial = 1424] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 48 (0x7f1176d7bc00) [pid = 1950] [serial = 1433] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:38:42 INFO - --DOMWINDOW == 47 (0x7f117712f000) [pid = 1950] [serial = 1426] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20autocompletion%20bug%20in%20document.body]
11:38:42 INFO - --DOMWINDOW == 46 (0x7f1177210000) [pid = 1950] [serial = 1428] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:42 INFO - --DOMWINDOW == 45 (0x7f1176fbb800) [pid = 1950] [serial = 1425] [outer = (nil)] [url = about:blank]
11:38:42 INFO - --DOMWINDOW == 44 (0x7f1176cd1c00) [pid = 1950] [serial = 1440] [outer = (nil)] [url = about:blank]
11:38:42 INFO - ++DOMWINDOW == 45 (0x7f11773f2400) [pid = 1950] [serial = 1469] [outer = 0x7f1176ddd800]
11:38:43 INFO - ++DOCSHELL 0x7f1176f6d000 == 12 [pid = 1950] [id = 612]
11:38:43 INFO - ++DOMWINDOW == 46 (0x7f1176d81c00) [pid = 1950] [serial = 1470] [outer = (nil)]
11:38:43 INFO - ++DOMWINDOW == 47 (0x7f1176db9000) [pid = 1950] [serial = 1471] [outer = 0x7f1176d81c00]
11:38:43 INFO - ++DOMWINDOW == 48 (0x7f1176cc8400) [pid = 1950] [serial = 1472] [outer = 0x7f1176d81c00]
11:38:43 INFO - ++DOCSHELL 0x7f117a608000 == 13 [pid = 1950] [id = 613]
11:38:43 INFO - ++DOMWINDOW == 49 (0x7f1176fb3c00) [pid = 1950] [serial = 1473] [outer = (nil)]
11:38:43 INFO - ++DOMWINDOW == 50 (0x7f1176fb7800) [pid = 1950] [serial = 1474] [outer = 0x7f1176fb3c00]
11:38:45 INFO - ++DOCSHELL 0x7f1180f7a800 == 14 [pid = 1950] [id = 614]
11:38:45 INFO - ++DOMWINDOW == 51 (0x7f117767e400) [pid = 1950] [serial = 1475] [outer = (nil)]
11:38:45 INFO - ++DOMWINDOW == 52 (0x7f11776f2c00) [pid = 1950] [serial = 1476] [outer = 0x7f117767e400]
11:38:46 INFO - ++DOCSHELL 0x7f1176f26800 == 15 [pid = 1950] [id = 615]
11:38:46 INFO - ++DOMWINDOW == 53 (0x7f1176ccb800) [pid = 1950] [serial = 1477] [outer = (nil)]
11:38:46 INFO - ++DOMWINDOW == 54 (0x7f1176ccf800) [pid = 1950] [serial = 1478] [outer = 0x7f1176ccb800]
11:38:46 INFO - ++DOMWINDOW == 55 (0x7f1176ccfc00) [pid = 1950] [serial = 1479] [outer = 0x7f1176ccb800]
11:38:47 INFO - ++DOCSHELL 0x7f1180e39000 == 16 [pid = 1950] [id = 616]
11:38:47 INFO - ++DOMWINDOW == 56 (0x7f11773ee000) [pid = 1950] [serial = 1480] [outer = (nil)]
11:38:47 INFO - ++DOMWINDOW == 57 (0x7f11773f1c00) [pid = 1950] [serial = 1481] [outer = 0x7f11773ee000]
11:38:49 INFO - ++DOMWINDOW == 58 (0x7f1181d9c000) [pid = 1950] [serial = 1482] [outer = 0x7f117767e400]
11:38:50 INFO - --DOCSHELL 0x7f1180e3b000 == 15 [pid = 1950] [id = 597]
11:38:50 INFO - --DOMWINDOW == 57 (0x7f1181d93800) [pid = 1950] [serial = 1452] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:38:50 INFO - --DOMWINDOW == 56 (0x7f1181d99800) [pid = 1950] [serial = 1453] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:38:50 INFO - --DOMWINDOW == 55 (0x7f1181d9a000) [pid = 1950] [serial = 1454] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:38:50 INFO - --DOMWINDOW == 54 (0x7f1181edd400) [pid = 1950] [serial = 1455] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:38:50 INFO - --DOMWINDOW == 53 (0x7f1176d7d000) [pid = 1950] [serial = 1434] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:38:50 INFO - --DOMWINDOW == 52 (0x7f117712f400) [pid = 1950] [serial = 1464] [outer = (nil)] [url = about:blank]
11:38:50 INFO - --DOMWINDOW == 51 (0x7f11776eec00) [pid = 1950] [serial = 1432] [outer = (nil)] [url = about:blank]
11:38:50 INFO - --DOMWINDOW == 50 (0x7f117720b400) [pid = 1950] [serial = 1430] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:50 INFO - --DOMWINDOW == 49 (0x7f1177134400) [pid = 1950] [serial = 1427] [outer = (nil)] [url = about:blank]
11:38:50 INFO - --DOMWINDOW == 48 (0x7f1183675400) [pid = 1950] [serial = 1461] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:38:50 INFO - ++DOMWINDOW == 49 (0x7f1176dc2400) [pid = 1950] [serial = 1483] [outer = 0x7f117767e400]
11:38:50 INFO - --DOCSHELL 0x7f1180e39000 == 14 [pid = 1950] [id = 616]
11:38:51 INFO - --DOCSHELL 0x7f117a608000 == 13 [pid = 1950] [id = 613]
11:38:51 INFO - MEMORY STAT | vsize 1286MB | residentFast 343MB | heapAllocated 132MB
11:38:51 INFO - 230 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js | took 11650ms
11:38:51 INFO - ++DOCSHELL 0x7f1176f19800 == 14 [pid = 1950] [id = 617]
11:38:51 INFO - ++DOMWINDOW == 50 (0x7f1176dc4c00) [pid = 1950] [serial = 1484] [outer = (nil)]
11:38:51 INFO - ++DOMWINDOW == 51 (0x7f1176fb0c00) [pid = 1950] [serial = 1485] [outer = 0x7f1176dc4c00]
11:38:51 INFO - 231 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js
11:38:52 INFO - ++DOCSHELL 0x7f11773ca000 == 15 [pid = 1950] [id = 618]
11:38:52 INFO - ++DOMWINDOW == 52 (0x7f1177132c00) [pid = 1950] [serial = 1486] [outer = (nil)]
11:38:52 INFO - ++DOMWINDOW == 53 (0x7f1177206000) [pid = 1950] [serial = 1487] [outer = 0x7f1177132c00]
11:38:53 INFO - --DOCSHELL 0x7f1176f6d000 == 14 [pid = 1950] [id = 612]
11:38:53 INFO - --DOCSHELL 0x7f1176f26800 == 13 [pid = 1950] [id = 615]
11:38:53 INFO - --DOMWINDOW == 52 (0x7f117767e400) [pid = 1950] [serial = 1475] [outer = (nil)] [url = data:text/html;charset=utf-8,]
11:38:53 INFO - --DOMWINDOW == 51 (0x7f1176db8000) [pid = 1950] [serial = 1465] [outer = (nil)] [url = about:blank]
11:38:53 INFO - --DOMWINDOW == 50 (0x7f1181d91800) [pid = 1950] [serial = 1451] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:38:53 INFO - --DOMWINDOW == 49 (0x7f1181d8e800) [pid = 1950] [serial = 1450] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:38:53 INFO - --DOMWINDOW == 48 (0x7f1180f29400) [pid = 1950] [serial = 1444] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:38:53 INFO - --DOMWINDOW == 47 (0x7f1176dd4000) [pid = 1950] [serial = 1466] [outer = (nil)] [url = about:blank]
11:38:53 INFO - --DOMWINDOW == 46 (0x7f1176ccf800) [pid = 1950] [serial = 1478] [outer = (nil)] [url = about:blank]
11:38:53 INFO - --DOMWINDOW == 45 (0x7f11773ee000) [pid = 1950] [serial = 1480] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:53 INFO - --DOMWINDOW == 44 (0x7f11812cf400) [pid = 1950] [serial = 1442] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:38:53 INFO - --DOMWINDOW == 43 (0x7f1176faf400) [pid = 1950] [serial = 1439] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:53 INFO - --DOMWINDOW == 42 (0x7f1176fb3c00) [pid = 1950] [serial = 1473] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:38:53 INFO - --DOMWINDOW == 41 (0x7f1176ccb800) [pid = 1950] [serial = 1477] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:38:53 INFO - --DOMWINDOW == 40 (0x7f1176ddd800) [pid = 1950] [serial = 1467] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html]
11:38:53 INFO - --DOMWINDOW == 39 (0x7f1176db9000) [pid = 1950] [serial = 1471] [outer = (nil)] [url = about:blank]
11:38:53 INFO - --DOMWINDOW == 38 (0x7f1176de0400) [pid = 1950] [serial = 1468] [outer = (nil)] [url = about:blank]
11:38:53 INFO - --DOMWINDOW == 37 (0x7f1181d9c000) [pid = 1950] [serial = 1482] [outer = (nil)] [url = data:text/html;charset=utf-8,]
11:38:53 INFO - --DOMWINDOW == 36 (0x7f1176dc2400) [pid = 1950] [serial = 1483] [outer = (nil)] [url = data:text/html;charset=utf-8,]
11:38:53 INFO - --DOMWINDOW == 35 (0x7f11776f2c00) [pid = 1950] [serial = 1476] [outer = (nil)] [url = about:blank]
11:38:53 INFO - ++DOCSHELL 0x7f1176f2c000 == 14 [pid = 1950] [id = 619]
11:38:53 INFO - ++DOMWINDOW == 36 (0x7f1176d84400) [pid = 1950] [serial = 1488] [outer = (nil)]
11:38:53 INFO - ++DOMWINDOW == 37 (0x7f1176d85400) [pid = 1950] [serial = 1489] [outer = 0x7f1176d84400]
11:38:53 INFO - --DOMWINDOW == 36 (0x7f11773f2400) [pid = 1950] [serial = 1469] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html]
11:38:54 INFO - ++DOMWINDOW == 37 (0x7f1176cc2800) [pid = 1950] [serial = 1490] [outer = 0x7f1176d84400]
11:38:54 INFO - ++DOCSHELL 0x7f117725c800 == 15 [pid = 1950] [id = 620]
11:38:54 INFO - ++DOMWINDOW == 38 (0x7f1176eda800) [pid = 1950] [serial = 1491] [outer = (nil)]
11:38:54 INFO - ++DOMWINDOW == 39 (0x7f1176fad000) [pid = 1950] [serial = 1492] [outer = 0x7f1176eda800]
11:38:56 INFO - ++DOCSHELL 0x7f1180e46800 == 16 [pid = 1950] [id = 621]
11:38:56 INFO - ++DOMWINDOW == 40 (0x7f1177674800) [pid = 1950] [serial = 1493] [outer = (nil)]
11:38:56 INFO - ++DOMWINDOW == 41 (0x7f1177675800) [pid = 1950] [serial = 1494] [outer = 0x7f1177674800]
11:39:04 INFO - --DOCSHELL 0x7f1180e46800 == 15 [pid = 1950] [id = 621]
11:39:06 INFO - MEMORY STAT | vsize 1288MB | residentFast 355MB | heapAllocated 145MB
11:39:06 INFO - 232 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js | took 15004ms
11:39:07 INFO - ++DOCSHELL 0x7f1176f17800 == 16 [pid = 1950] [id = 622]
11:39:07 INFO - ++DOMWINDOW == 42 (0x7f1177132000) [pid = 1950] [serial = 1495] [outer = (nil)]
11:39:07 INFO - ++DOMWINDOW == 43 (0x7f117720fc00) [pid = 1950] [serial = 1496] [outer = 0x7f1177132000]
11:39:07 INFO - 233 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js
11:39:07 INFO - ++DOCSHELL 0x7f1180f7c800 == 17 [pid = 1950] [id = 623]
11:39:07 INFO - ++DOMWINDOW == 44 (0x7f11773e5c00) [pid = 1950] [serial = 1497] [outer = (nil)]
11:39:07 INFO - ++DOMWINDOW == 45 (0x7f11773e9c00) [pid = 1950] [serial = 1498] [outer = 0x7f11773e5c00]
11:39:07 INFO - ++DOCSHELL 0x7f1181270000 == 18 [pid = 1950] [id = 624]
11:39:07 INFO - ++DOMWINDOW == 46 (0x7f11773eb000) [pid = 1950] [serial = 1499] [outer = (nil)]
11:39:07 INFO - ++DOMWINDOW == 47 (0x7f1177683000) [pid = 1950] [serial = 1500] [outer = 0x7f11773eb000]
11:39:08 INFO - ++DOMWINDOW == 48 (0x7f1177679400) [pid = 1950] [serial = 1501] [outer = 0x7f11773eb000]
11:39:08 INFO - ++DOCSHELL 0x7f118150f800 == 19 [pid = 1950] [id = 625]
11:39:08 INFO - ++DOMWINDOW == 49 (0x7f1181142000) [pid = 1950] [serial = 1502] [outer = (nil)]
11:39:08 INFO - ++DOMWINDOW == 50 (0x7f1181148c00) [pid = 1950] [serial = 1503] [outer = 0x7f1181142000]
11:39:11 INFO - MEMORY STAT | vsize 1290MB | residentFast 363MB | heapAllocated 150MB
11:39:11 INFO - 234 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js | took 3805ms
11:39:11 INFO - ++DOCSHELL 0x7f1180e32800 == 20 [pid = 1950] [id = 626]
11:39:11 INFO - ++DOMWINDOW == 51 (0x7f11776f0000) [pid = 1950] [serial = 1504] [outer = (nil)]
11:39:11 INFO - ++DOMWINDOW == 52 (0x7f1181147c00) [pid = 1950] [serial = 1505] [outer = 0x7f11776f0000]
11:39:11 INFO - 235 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js
11:39:11 INFO - ++DOCSHELL 0x7f11827e2000 == 21 [pid = 1950] [id = 627]
11:39:11 INFO - ++DOMWINDOW == 53 (0x7f1181ee2000) [pid = 1950] [serial = 1506] [outer = (nil)]
11:39:11 INFO - ++DOMWINDOW == 54 (0x7f1181ee9400) [pid = 1950] [serial = 1507] [outer = 0x7f1181ee2000]
11:39:11 INFO - ++DOCSHELL 0x7f11835da800 == 22 [pid = 1950] [id = 628]
11:39:11 INFO - ++DOMWINDOW == 55 (0x7f1181eeac00) [pid = 1950] [serial = 1508] [outer = (nil)]
11:39:11 INFO - ++DOMWINDOW == 56 (0x7f118260d000) [pid = 1950] [serial = 1509] [outer = 0x7f1181eeac00]
11:39:12 INFO - ++DOMWINDOW == 57 (0x7f1181497000) [pid = 1950] [serial = 1510] [outer = 0x7f1181eeac00]
11:39:12 INFO - ++DOCSHELL 0x7f1183e2f000 == 23 [pid = 1950] [id = 629]
11:39:12 INFO - ++DOMWINDOW == 58 (0x7f118288f000) [pid = 1950] [serial = 1511] [outer = (nil)]
11:39:12 INFO - ++DOMWINDOW == 59 (0x7f118366e800) [pid = 1950] [serial = 1512] [outer = 0x7f118288f000]
11:39:15 INFO - MEMORY STAT | vsize 1292MB | residentFast 371MB | heapAllocated 154MB
11:39:15 INFO - 236 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js | took 3909ms
11:39:15 INFO - ++DOCSHELL 0x7f1180e11800 == 24 [pid = 1950] [id = 630]
11:39:15 INFO - ++DOMWINDOW == 60 (0x7f118274a800) [pid = 1950] [serial = 1513] [outer = (nil)]
11:39:15 INFO - ++DOMWINDOW == 61 (0x7f1182888000) [pid = 1950] [serial = 1514] [outer = 0x7f118274a800]
11:39:15 INFO - 237 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js
11:39:15 INFO - ++DOCSHELL 0x7f11810c2800 == 25 [pid = 1950] [id = 631]
11:39:15 INFO - ++DOMWINDOW == 62 (0x7f118585ec00) [pid = 1950] [serial = 1515] [outer = (nil)]
11:39:15 INFO - ++DOMWINDOW == 63 (0x7f1185866000) [pid = 1950] [serial = 1516] [outer = 0x7f118585ec00]
11:39:16 INFO - ++DOCSHELL 0x7f118249f800 == 26 [pid = 1950] [id = 632]
11:39:16 INFO - ++DOMWINDOW == 64 (0x7f1185a96800) [pid = 1950] [serial = 1517] [outer = (nil)]
11:39:16 INFO - ++DOMWINDOW == 65 (0x7f1185a97000) [pid = 1950] [serial = 1518] [outer = 0x7f1185a96800]
11:39:16 INFO - ++DOMWINDOW == 66 (0x7f118260c400) [pid = 1950] [serial = 1519] [outer = 0x7f1185a96800]
11:39:16 INFO - ++DOCSHELL 0x7f1185a27800 == 27 [pid = 1950] [id = 633]
11:39:16 INFO - ++DOMWINDOW == 67 (0x7f1180f38000) [pid = 1950] [serial = 1520] [outer = (nil)]
11:39:16 INFO - ++DOMWINDOW == 68 (0x7f1185aac400) [pid = 1950] [serial = 1521] [outer = 0x7f1180f38000]
11:39:22 INFO - MEMORY STAT | vsize 1293MB | residentFast 380MB | heapAllocated 156MB
11:39:22 INFO - 238 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js | took 7098ms
11:39:22 INFO - ++DOCSHELL 0x7f1180e0d800 == 28 [pid = 1950] [id = 634]
11:39:22 INFO - ++DOMWINDOW == 69 (0x7f1177396800) [pid = 1950] [serial = 1522] [outer = (nil)]
11:39:23 INFO - ++DOMWINDOW == 70 (0x7f11773f0800) [pid = 1950] [serial = 1523] [outer = 0x7f1177396800]
11:39:23 INFO - 239 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_704295.js
11:39:23 INFO - ++DOCSHELL 0x7f1180f72000 == 29 [pid = 1950] [id = 635]
11:39:23 INFO - ++DOMWINDOW == 71 (0x7f1177682c00) [pid = 1950] [serial = 1524] [outer = (nil)]
11:39:23 INFO - ++DOMWINDOW == 72 (0x7f1180f2c000) [pid = 1950] [serial = 1525] [outer = 0x7f1177682c00]
11:39:23 INFO - ++DOMWINDOW == 73 (0x7f11812d1800) [pid = 1950] [serial = 1526] [outer = 0x7f1177682c00]
11:39:24 INFO - ++DOCSHELL 0x7f1181522000 == 30 [pid = 1950] [id = 636]
11:39:24 INFO - ++DOMWINDOW == 74 (0x7f1181142800) [pid = 1950] [serial = 1527] [outer = (nil)]
11:39:24 INFO - ++DOMWINDOW == 75 (0x7f1181d94800) [pid = 1950] [serial = 1528] [outer = 0x7f1181142800]
11:39:24 INFO - ++DOMWINDOW == 76 (0x7f1176edb800) [pid = 1950] [serial = 1529] [outer = 0x7f1181142800]
11:39:24 INFO - ++DOCSHELL 0x7f11827a1000 == 31 [pid = 1950] [id = 637]
11:39:24 INFO - ++DOMWINDOW == 77 (0x7f118260fc00) [pid = 1950] [serial = 1530] [outer = (nil)]
11:39:24 INFO - ++DOMWINDOW == 78 (0x7f1182847400) [pid = 1950] [serial = 1531] [outer = 0x7f118260fc00]
11:39:27 INFO - MEMORY STAT | vsize 1301MB | residentFast 393MB | heapAllocated 163MB
11:39:27 INFO - 240 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_704295.js | took 4378ms
11:39:27 INFO - ++DOCSHELL 0x7f118279e000 == 32 [pid = 1950] [id = 638]
11:39:27 INFO - ++DOMWINDOW == 79 (0x7f1181d96800) [pid = 1950] [serial = 1532] [outer = (nil)]
11:39:27 INFO - ++DOMWINDOW == 80 (0x7f1182750000) [pid = 1950] [serial = 1533] [outer = 0x7f1181d96800]
11:39:28 INFO - 241 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js
11:39:28 INFO - ++DOCSHELL 0x7f118aa28800 == 33 [pid = 1950] [id = 639]
11:39:28 INFO - ++DOMWINDOW == 81 (0x7f1187d3c000) [pid = 1950] [serial = 1534] [outer = (nil)]
11:39:28 INFO - ++DOMWINDOW == 82 (0x7f1187d46000) [pid = 1950] [serial = 1535] [outer = 0x7f1187d3c000]
11:39:28 INFO - ++DOMWINDOW == 83 (0x7f1187fab800) [pid = 1950] [serial = 1536] [outer = 0x7f1187d3c000]
11:39:28 INFO - ++DOCSHELL 0x7f118d365000 == 34 [pid = 1950] [id = 640]
11:39:28 INFO - ++DOMWINDOW == 84 (0x7f1180f30c00) [pid = 1950] [serial = 1537] [outer = (nil)]
11:39:28 INFO - ++DOMWINDOW == 85 (0x7f1188145c00) [pid = 1950] [serial = 1538] [outer = 0x7f1180f30c00]
11:39:28 INFO - ++DOMWINDOW == 86 (0x7f1187d47000) [pid = 1950] [serial = 1539] [outer = 0x7f1180f30c00]
11:39:29 INFO - ++DOCSHELL 0x7f118d52c800 == 35 [pid = 1950] [id = 641]
11:39:29 INFO - ++DOMWINDOW == 87 (0x7f118a3e2000) [pid = 1950] [serial = 1540] [outer = (nil)]
11:39:29 INFO - ++DOMWINDOW == 88 (0x7f118a90d000) [pid = 1950] [serial = 1541] [outer = 0x7f118a3e2000]
11:39:31 INFO - MEMORY STAT | vsize 1307MB | residentFast 403MB | heapAllocated 169MB
11:39:31 INFO - 242 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js | took 3798ms
11:39:31 INFO - ++DOCSHELL 0x7f118a01c000 == 36 [pid = 1950] [id = 642]
11:39:31 INFO - ++DOMWINDOW == 89 (0x7f11881f4c00) [pid = 1950] [serial = 1542] [outer = (nil)]
11:39:31 INFO - ++DOMWINDOW == 90 (0x7f118a3e7800) [pid = 1950] [serial = 1543] [outer = 0x7f11881f4c00]
11:39:32 INFO - 243 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js
11:39:32 INFO - ++DOCSHELL 0x7f118dd07000 == 37 [pid = 1950] [id = 643]
11:39:32 INFO - ++DOMWINDOW == 91 (0x7f11881f3c00) [pid = 1950] [serial = 1544] [outer = (nil)]
11:39:32 INFO - ++DOMWINDOW == 92 (0x7f118a945000) [pid = 1950] [serial = 1545] [outer = 0x7f11881f3c00]
11:39:32 INFO - ++DOCSHELL 0x7f118f149800 == 38 [pid = 1950] [id = 644]
11:39:32 INFO - ++DOMWINDOW == 93 (0x7f118a9b4c00) [pid = 1950] [serial = 1546] [outer = (nil)]
11:39:32 INFO - ++DOMWINDOW == 94 (0x7f118aa66c00) [pid = 1950] [serial = 1547] [outer = 0x7f118a9b4c00]
11:39:33 INFO - ++DOMWINDOW == 95 (0x7f118a914c00) [pid = 1950] [serial = 1548] [outer = 0x7f118a9b4c00]
11:39:33 INFO - ++DOCSHELL 0x7f1176f7f000 == 39 [pid = 1950] [id = 645]
11:39:33 INFO - ++DOMWINDOW == 96 (0x7f1176dd3c00) [pid = 1950] [serial = 1549] [outer = (nil)]
11:39:33 INFO - ++DOMWINDOW == 97 (0x7f117712ac00) [pid = 1950] [serial = 1550] [outer = 0x7f1176dd3c00]
11:39:35 INFO - ++DOMWINDOW == 98 (0x7f1187fa8000) [pid = 1950] [serial = 1551] [outer = 0x7f11881f3c00]
11:39:35 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:39:37 INFO - --DOCSHELL 0x7f11773ca000 == 38 [pid = 1950] [id = 618]
11:39:37 INFO - --DOCSHELL 0x7f1176f2c000 == 37 [pid = 1950] [id = 619]
11:39:37 INFO - --DOCSHELL 0x7f117725c800 == 36 [pid = 1950] [id = 620]
11:39:37 INFO - --DOCSHELL 0x7f1180f7a800 == 35 [pid = 1950] [id = 614]
11:39:37 INFO - --DOCSHELL 0x7f11773b3800 == 34 [pid = 1950] [id = 611]
11:39:37 INFO - --DOCSHELL 0x7f1176f28000 == 33 [pid = 1950] [id = 610]
11:39:37 INFO - --DOCSHELL 0x7f1176f19800 == 32 [pid = 1950] [id = 617]
11:39:37 INFO - --DOCSHELL 0x7f1176f17800 == 31 [pid = 1950] [id = 622]
11:39:37 INFO - --DOCSHELL 0x7f1180f7c800 == 30 [pid = 1950] [id = 623]
11:39:37 INFO - --DOCSHELL 0x7f1181270000 == 29 [pid = 1950] [id = 624]
11:39:37 INFO - --DOCSHELL 0x7f118150f800 == 28 [pid = 1950] [id = 625]
11:39:37 INFO - --DOCSHELL 0x7f1180e32800 == 27 [pid = 1950] [id = 626]
11:39:37 INFO - --DOCSHELL 0x7f11827e2000 == 26 [pid = 1950] [id = 627]
11:39:37 INFO - --DOCSHELL 0x7f11835da800 == 25 [pid = 1950] [id = 628]
11:39:37 INFO - --DOCSHELL 0x7f1183e2f000 == 24 [pid = 1950] [id = 629]
11:39:37 INFO - --DOCSHELL 0x7f11810c2800 == 23 [pid = 1950] [id = 631]
11:39:37 INFO - --DOCSHELL 0x7f118249f800 == 22 [pid = 1950] [id = 632]
11:39:37 INFO - --DOCSHELL 0x7f1185a27800 == 21 [pid = 1950] [id = 633]
11:39:37 INFO - --DOCSHELL 0x7f11827a1000 == 20 [pid = 1950] [id = 637]
11:39:37 INFO - --DOCSHELL 0x7f118d52c800 == 19 [pid = 1950] [id = 641]
11:39:37 INFO - --DOMWINDOW == 97 (0x7f1176fb7800) [pid = 1950] [serial = 1474] [outer = (nil)] [url = about:blank]
11:39:37 INFO - --DOMWINDOW == 96 (0x7f1181ee1000) [pid = 1950] [serial = 1457] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:39:37 INFO - --DOMWINDOW == 95 (0x7f1181ee0000) [pid = 1950] [serial = 1456] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:39:37 INFO - --DOMWINDOW == 94 (0x7f1177127800) [pid = 1950] [serial = 1441] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:37 INFO - --DOMWINDOW == 93 (0x7f1181493c00) [pid = 1950] [serial = 1443] [outer = (nil)] [url = about:blank]
11:39:37 INFO - --DOMWINDOW == 92 (0x7f11773f1c00) [pid = 1950] [serial = 1481] [outer = (nil)] [url = about:blank]
11:39:37 INFO - --DOMWINDOW == 91 (0x7f1176ccfc00) [pid = 1950] [serial = 1479] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:37 INFO - --DOMWINDOW == 90 (0x7f118114a000) [pid = 1950] [serial = 1445] [outer = (nil)] [url = about:blank]
11:39:37 INFO - ++DOCSHELL 0x7f1176f17800 == 20 [pid = 1950] [id = 646]
11:39:37 INFO - ++DOMWINDOW == 91 (0x7f1176d7bc00) [pid = 1950] [serial = 1552] [outer = (nil)]
11:39:37 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:39:37 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:39:37 INFO - ++DOMWINDOW == 92 (0x7f1176d82c00) [pid = 1950] [serial = 1553] [outer = 0x7f1176d7bc00]
11:39:38 INFO - [1950] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5473
11:39:38 INFO - [1950] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 356
11:39:38 INFO - ++DOMWINDOW == 93 (0x7f1176ddb800) [pid = 1950] [serial = 1554] [outer = 0x7f1176d7bc00]
11:39:38 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:39:38 INFO - --DOCSHELL 0x7f1176f7f000 == 19 [pid = 1950] [id = 645]
11:39:39 INFO - MEMORY STAT | vsize 1307MB | residentFast 397MB | heapAllocated 152MB
11:39:39 INFO - 244 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js | took 7526ms
11:39:39 INFO - ++DOCSHELL 0x7f11770b9800 == 20 [pid = 1950] [id = 647]
11:39:39 INFO - ++DOMWINDOW == 94 (0x7f1177202800) [pid = 1950] [serial = 1555] [outer = (nil)]
11:39:39 INFO - ++DOMWINDOW == 95 (0x7f1177208800) [pid = 1950] [serial = 1556] [outer = 0x7f1177202800]
11:39:40 INFO - 245 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js
11:39:40 INFO - ++DOCSHELL 0x7f1180e06000 == 21 [pid = 1950] [id = 648]
11:39:40 INFO - ++DOMWINDOW == 96 (0x7f1177395800) [pid = 1950] [serial = 1557] [outer = (nil)]
11:39:40 INFO - ++DOMWINDOW == 97 (0x7f11773e4800) [pid = 1950] [serial = 1558] [outer = 0x7f1177395800]
11:39:40 INFO - ++DOMWINDOW == 98 (0x7f11773f1c00) [pid = 1950] [serial = 1559] [outer = 0x7f1177395800]
11:39:40 INFO - ++DOCSHELL 0x7f1180f68000 == 22 [pid = 1950] [id = 649]
11:39:40 INFO - ++DOMWINDOW == 99 (0x7f117767fc00) [pid = 1950] [serial = 1560] [outer = (nil)]
11:39:40 INFO - ++DOMWINDOW == 100 (0x7f117767c400) [pid = 1950] [serial = 1561] [outer = 0x7f117767fc00]
11:39:40 INFO - ++DOCSHELL 0x7f1176f76800 == 23 [pid = 1950] [id = 650]
11:39:40 INFO - ++DOMWINDOW == 101 (0x7f11776f2000) [pid = 1950] [serial = 1562] [outer = (nil)]
11:39:40 INFO - ++DOMWINDOW == 102 (0x7f11776f7000) [pid = 1950] [serial = 1563] [outer = 0x7f11776f2000]
11:39:41 INFO - ++DOMWINDOW == 103 (0x7f1177674c00) [pid = 1950] [serial = 1564] [outer = 0x7f11776f2000]
11:39:41 INFO - ++DOCSHELL 0x7f11810c7800 == 24 [pid = 1950] [id = 651]
11:39:41 INFO - ++DOMWINDOW == 104 (0x7f1176db0c00) [pid = 1950] [serial = 1565] [outer = (nil)]
11:39:41 INFO - ++DOMWINDOW == 105 (0x7f1181146000) [pid = 1950] [serial = 1566] [outer = 0x7f1176db0c00]
11:39:43 INFO - --DOMWINDOW == 104 (0x7f1181ee2000) [pid = 1950] [serial = 1506] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20664131:%20Expand%20console%20object%20with%20group%20methods]
11:39:43 INFO - --DOMWINDOW == 103 (0x7f1177132c00) [pid = 1950] [serial = 1486] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20659907:%20Expand%20console%20object%20with%20a%20dir%20method]
11:39:43 INFO - --DOMWINDOW == 102 (0x7f1176dc4c00) [pid = 1950] [serial = 1484] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 101 (0x7f118585ec00) [pid = 1950] [serial = 1515] [outer = (nil)] [url = data:text/html;charset=utf8,test%20JSTerm%20Helpers%20autocomplete]
11:39:43 INFO - --DOMWINDOW == 100 (0x7f11773e5c00) [pid = 1950] [serial = 1497] [outer = (nil)] [url = data:text/html;charset=utf-8,
bug%20660806%20-%20history%20navigation%20must%20not%20show%20the%20autocomplete%20popup]
11:39:43 INFO - --DOMWINDOW == 99 (0x7f1177132000) [pid = 1950] [serial = 1495] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 98 (0x7f11776f0000) [pid = 1950] [serial = 1504] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 97 (0x7f1177674800) [pid = 1950] [serial = 1493] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:39:43 INFO - --DOMWINDOW == 96 (0x7f118260fc00) [pid = 1950] [serial = 1530] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 95 (0x7f1176d81c00) [pid = 1950] [serial = 1470] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 94 (0x7f1176d84400) [pid = 1950] [serial = 1488] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 93 (0x7f1176eda800) [pid = 1950] [serial = 1491] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 92 (0x7f1181142000) [pid = 1950] [serial = 1502] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 91 (0x7f1180f38000) [pid = 1950] [serial = 1520] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 90 (0x7f118288f000) [pid = 1950] [serial = 1511] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 89 (0x7f1181142800) [pid = 1950] [serial = 1527] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 88 (0x7f11773eb000) [pid = 1950] [serial = 1499] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 87 (0x7f1180f30c00) [pid = 1950] [serial = 1537] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 86 (0x7f1185866000) [pid = 1950] [serial = 1516] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 85 (0x7f11773e9c00) [pid = 1950] [serial = 1498] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 84 (0x7f117720fc00) [pid = 1950] [serial = 1496] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 83 (0x7f1176d85400) [pid = 1950] [serial = 1489] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 82 (0x7f118260d000) [pid = 1950] [serial = 1509] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 81 (0x7f1181147c00) [pid = 1950] [serial = 1505] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 80 (0x7f1177683000) [pid = 1950] [serial = 1500] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 79 (0x7f1181ee9400) [pid = 1950] [serial = 1507] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 78 (0x7f1176fb0c00) [pid = 1950] [serial = 1485] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 77 (0x7f1185a96800) [pid = 1950] [serial = 1517] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 76 (0x7f118a3e2000) [pid = 1950] [serial = 1540] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:39:43 INFO - --DOMWINDOW == 75 (0x7f1181eeac00) [pid = 1950] [serial = 1508] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:39:43 INFO - --DOMWINDOW == 74 (0x7f1181d94800) [pid = 1950] [serial = 1528] [outer = (nil)] [url = about:blank]
11:39:43 INFO - --DOMWINDOW == 73 (0x7f1185a97000) [pid = 1950] [serial = 1518] [outer = (nil)] [url = about:blank]
11:39:44 INFO - --DOMWINDOW == 72 (0x7f118aa66c00) [pid = 1950] [serial = 1547] [outer = (nil)] [url = about:blank]
11:39:44 INFO - --DOMWINDOW == 71 (0x7f1188145c00) [pid = 1950] [serial = 1538] [outer = (nil)] [url = about:blank]
11:39:44 INFO - ++DOCSHELL 0x7f118126f800 == 25 [pid = 1950] [id = 652]
11:39:44 INFO - ++DOMWINDOW == 72 (0x7f1180f30c00) [pid = 1950] [serial = 1567] [outer = (nil)]
11:39:44 INFO - ++DOMWINDOW == 73 (0x7f11812d6800) [pid = 1950] [serial = 1568] [outer = 0x7f1180f30c00]
11:39:44 INFO - ++DOMWINDOW == 74 (0x7f11776efc00) [pid = 1950] [serial = 1569] [outer = 0x7f1180f30c00]
11:39:44 INFO - ++DOCSHELL 0x7f11824aa000 == 26 [pid = 1950] [id = 653]
11:39:44 INFO - ++DOMWINDOW == 75 (0x7f11812d7c00) [pid = 1950] [serial = 1570] [outer = (nil)]
11:39:45 INFO - ++DOMWINDOW == 76 (0x7f1177678c00) [pid = 1950] [serial = 1571] [outer = 0x7f11812d7c00]
11:39:45 INFO - ++DOMWINDOW == 77 (0x7f118242f400) [pid = 1950] [serial = 1572] [outer = 0x7f11812d7c00]
11:39:45 INFO - ++DOCSHELL 0x7f118278e800 == 27 [pid = 1950] [id = 654]
11:39:45 INFO - ++DOMWINDOW == 78 (0x7f11837e6000) [pid = 1950] [serial = 1573] [outer = (nil)]
11:39:45 INFO - ++DOMWINDOW == 79 (0x7f11838bd800) [pid = 1950] [serial = 1574] [outer = 0x7f11837e6000]
11:39:45 INFO - ++DOMWINDOW == 80 (0x7f1176d83c00) [pid = 1950] [serial = 1575] [outer = 0x7f11837e6000]
11:39:45 INFO - ++DOCSHELL 0x7f11827e7800 == 28 [pid = 1950] [id = 655]
11:39:45 INFO - ++DOMWINDOW == 81 (0x7f118585ec00) [pid = 1950] [serial = 1576] [outer = (nil)]
11:39:45 INFO - ++DOMWINDOW == 82 (0x7f1185867000) [pid = 1950] [serial = 1577] [outer = 0x7f118585ec00]
11:39:47 INFO - ++DOCSHELL 0x7f118115d000 == 29 [pid = 1950] [id = 656]
11:39:47 INFO - ++DOMWINDOW == 83 (0x7f1180f33400) [pid = 1950] [serial = 1578] [outer = (nil)]
11:39:48 INFO - ++DOMWINDOW == 84 (0x7f11812d4400) [pid = 1950] [serial = 1579] [outer = 0x7f1180f33400]
11:39:48 INFO - ++DOMWINDOW == 85 (0x7f11812d0000) [pid = 1950] [serial = 1580] [outer = 0x7f1180f33400]
11:39:48 INFO - ++DOCSHELL 0x7f11835df800 == 30 [pid = 1950] [id = 657]
11:39:48 INFO - ++DOMWINDOW == 86 (0x7f118242c400) [pid = 1950] [serial = 1581] [outer = (nil)]
11:39:48 INFO - ++DOMWINDOW == 87 (0x7f1176ccd800) [pid = 1950] [serial = 1582] [outer = 0x7f118242c400]
11:39:48 INFO - ++DOCSHELL 0x7f1176f72800 == 31 [pid = 1950] [id = 658]
11:39:48 INFO - ++DOMWINDOW == 88 (0x7f1185aad800) [pid = 1950] [serial = 1583] [outer = (nil)]
11:39:48 INFO - ++DOMWINDOW == 89 (0x7f11872adc00) [pid = 1950] [serial = 1584] [outer = 0x7f1185aad800]
11:39:49 INFO - ++DOMWINDOW == 90 (0x7f118113f800) [pid = 1950] [serial = 1585] [outer = 0x7f1185aad800]
11:39:49 INFO - ++DOCSHELL 0x7f1185a20000 == 32 [pid = 1950] [id = 659]
11:39:49 INFO - ++DOMWINDOW == 91 (0x7f1176cc9400) [pid = 1950] [serial = 1586] [outer = (nil)]
11:39:49 INFO - ++DOMWINDOW == 92 (0x7f1187d4a000) [pid = 1950] [serial = 1587] [outer = 0x7f1176cc9400]
11:39:51 INFO - ++DOCSHELL 0x7f11810af800 == 33 [pid = 1950] [id = 660]
11:39:51 INFO - ++DOMWINDOW == 93 (0x7f118a921c00) [pid = 1950] [serial = 1588] [outer = (nil)]
11:39:51 INFO - ++DOMWINDOW == 94 (0x7f118a93d400) [pid = 1950] [serial = 1589] [outer = 0x7f118a921c00]
11:39:51 INFO - ++DOMWINDOW == 95 (0x7f118758f000) [pid = 1950] [serial = 1590] [outer = 0x7f118a921c00]
11:39:52 INFO - ++DOCSHELL 0x7f1176f13800 == 34 [pid = 1950] [id = 661]
11:39:52 INFO - ++DOMWINDOW == 96 (0x7f118758b400) [pid = 1950] [serial = 1591] [outer = (nil)]
11:39:52 INFO - ++DOMWINDOW == 97 (0x7f118a92c000) [pid = 1950] [serial = 1592] [outer = 0x7f118758b400]
11:39:52 INFO - ++DOMWINDOW == 98 (0x7f1187fad400) [pid = 1950] [serial = 1593] [outer = 0x7f118758b400]
11:39:52 INFO - ++DOCSHELL 0x7f11770c0000 == 35 [pid = 1950] [id = 662]
11:39:52 INFO - ++DOMWINDOW == 99 (0x7f118a9bfc00) [pid = 1950] [serial = 1594] [outer = (nil)]
11:39:52 INFO - ++DOMWINDOW == 100 (0x7f118a9c0800) [pid = 1950] [serial = 1595] [outer = 0x7f118a9bfc00]
11:39:52 INFO - ++DOMWINDOW == 101 (0x7f1187fa9800) [pid = 1950] [serial = 1596] [outer = 0x7f118a9bfc00]
11:39:53 INFO - ++DOCSHELL 0x7f118a318800 == 36 [pid = 1950] [id = 663]
11:39:53 INFO - ++DOMWINDOW == 102 (0x7f1187d47400) [pid = 1950] [serial = 1597] [outer = (nil)]
11:39:53 INFO - ++DOMWINDOW == 103 (0x7f118ab89800) [pid = 1950] [serial = 1598] [outer = 0x7f1187d47400]
11:39:54 INFO - ++DOCSHELL 0x7f118d4ab000 == 37 [pid = 1950] [id = 664]
11:39:54 INFO - ++DOMWINDOW == 104 (0x7f118d745400) [pid = 1950] [serial = 1599] [outer = (nil)]
11:39:54 INFO - ++DOMWINDOW == 105 (0x7f118da55400) [pid = 1950] [serial = 1600] [outer = 0x7f118d745400]
11:39:55 INFO - ++DOMWINDOW == 106 (0x7f118aa70c00) [pid = 1950] [serial = 1601] [outer = 0x7f118d745400]
11:39:55 INFO - ++DOCSHELL 0x7f1176f28800 == 38 [pid = 1950] [id = 665]
11:39:55 INFO - ++DOMWINDOW == 107 (0x7f118d490000) [pid = 1950] [serial = 1602] [outer = (nil)]
11:39:55 INFO - ++DOMWINDOW == 108 (0x7f118db06800) [pid = 1950] [serial = 1603] [outer = 0x7f118d490000]
11:39:55 INFO - ++DOMWINDOW == 109 (0x7f118db0e800) [pid = 1950] [serial = 1604] [outer = 0x7f118d490000]
11:39:55 INFO - ++DOCSHELL 0x7f119104f800 == 39 [pid = 1950] [id = 666]
11:39:55 INFO - ++DOMWINDOW == 110 (0x7f118da57800) [pid = 1950] [serial = 1605] [outer = (nil)]
11:39:55 INFO - ++DOMWINDOW == 111 (0x7f118a9ba000) [pid = 1950] [serial = 1606] [outer = 0x7f118da57800]
11:39:55 INFO - ++DOCSHELL 0x7f1190978000 == 40 [pid = 1950] [id = 667]
11:39:55 INFO - ++DOMWINDOW == 112 (0x7f11910ae800) [pid = 1950] [serial = 1607] [outer = (nil)]
11:39:55 INFO - ++DOMWINDOW == 113 (0x7f11914f8400) [pid = 1950] [serial = 1608] [outer = 0x7f11910ae800]
11:39:56 INFO - ++DOMWINDOW == 114 (0x7f1184369800) [pid = 1950] [serial = 1609] [outer = 0x7f11910ae800]
11:39:56 INFO - ++DOCSHELL 0x7f1191052800 == 41 [pid = 1950] [id = 668]
11:39:56 INFO - ++DOMWINDOW == 115 (0x7f1191940000) [pid = 1950] [serial = 1610] [outer = (nil)]
11:39:56 INFO - ++DOMWINDOW == 116 (0x7f11925e7800) [pid = 1950] [serial = 1611] [outer = 0x7f1191940000]
11:39:58 INFO - ++DOCSHELL 0x7f119c260000 == 42 [pid = 1950] [id = 669]
11:39:58 INFO - ++DOMWINDOW == 117 (0x7f118585e400) [pid = 1950] [serial = 1612] [outer = (nil)]
11:39:58 INFO - ++DOMWINDOW == 118 (0x7f119ef17c00) [pid = 1950] [serial = 1613] [outer = 0x7f118585e400]
11:39:58 INFO - ++DOMWINDOW == 119 (0x7f11a62ec800) [pid = 1950] [serial = 1614] [outer = 0x7f118585e400]
11:39:58 INFO - ++DOCSHELL 0x7f1176f73800 == 43 [pid = 1950] [id = 670]
11:39:58 INFO - ++DOMWINDOW == 120 (0x7f119193e800) [pid = 1950] [serial = 1615] [outer = (nil)]
11:39:58 INFO - ++DOMWINDOW == 121 (0x7f119ef1c400) [pid = 1950] [serial = 1616] [outer = 0x7f119193e800]
11:39:59 INFO - ++DOMWINDOW == 122 (0x7f119f0ca800) [pid = 1950] [serial = 1617] [outer = 0x7f119193e800]
11:39:59 INFO - ++DOCSHELL 0x7f1176f6e800 == 44 [pid = 1950] [id = 671]
11:39:59 INFO - ++DOMWINDOW == 123 (0x7f118db0f800) [pid = 1950] [serial = 1618] [outer = (nil)]
11:39:59 INFO - ++DOMWINDOW == 124 (0x7f119f0c7400) [pid = 1950] [serial = 1619] [outer = 0x7f118db0f800]
11:39:59 INFO - ++DOCSHELL 0x7f11a1329800 == 45 [pid = 1950] [id = 672]
11:39:59 INFO - ++DOMWINDOW == 125 (0x7f11776ed800) [pid = 1950] [serial = 1620] [outer = (nil)]
11:39:59 INFO - ++DOMWINDOW == 126 (0x7f11a14bd000) [pid = 1950] [serial = 1621] [outer = 0x7f11776ed800]
11:39:59 INFO - ++DOMWINDOW == 127 (0x7f118758c800) [pid = 1950] [serial = 1622] [outer = 0x7f11776ed800]
11:40:00 INFO - ++DOCSHELL 0x7f119e43c000 == 46 [pid = 1950] [id = 673]
11:40:00 INFO - ++DOMWINDOW == 128 (0x7f11a384d800) [pid = 1950] [serial = 1623] [outer = (nil)]
11:40:00 INFO - ++DOMWINDOW == 129 (0x7f11a60b1400) [pid = 1950] [serial = 1624] [outer = 0x7f11a384d800]
11:40:03 INFO - --DOCSHELL 0x7f1176f17800 == 45 [pid = 1950] [id = 646]
11:40:03 INFO - --DOCSHELL 0x7f118d365000 == 44 [pid = 1950] [id = 640]
11:40:03 INFO - --DOCSHELL 0x7f118a01c000 == 43 [pid = 1950] [id = 642]
11:40:03 INFO - --DOCSHELL 0x7f118dd07000 == 42 [pid = 1950] [id = 643]
11:40:03 INFO - --DOCSHELL 0x7f118279e000 == 41 [pid = 1950] [id = 638]
11:40:03 INFO - --DOCSHELL 0x7f118f149800 == 40 [pid = 1950] [id = 644]
11:40:03 INFO - --DOCSHELL 0x7f1180e0d800 == 39 [pid = 1950] [id = 634]
11:40:03 INFO - --DOCSHELL 0x7f1180f72000 == 38 [pid = 1950] [id = 635]
11:40:03 INFO - --DOCSHELL 0x7f1180e11800 == 37 [pid = 1950] [id = 630]
11:40:03 INFO - --DOCSHELL 0x7f118aa28800 == 36 [pid = 1950] [id = 639]
11:40:03 INFO - --DOCSHELL 0x7f1181522000 == 35 [pid = 1950] [id = 636]
11:40:03 INFO - --DOMWINDOW == 128 (0x7f1177675800) [pid = 1950] [serial = 1494] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:40:03 INFO - --DOMWINDOW == 127 (0x7f1177206000) [pid = 1950] [serial = 1487] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 126 (0x7f1182847400) [pid = 1950] [serial = 1531] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 125 (0x7f1177679400) [pid = 1950] [serial = 1501] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 124 (0x7f1187d47000) [pid = 1950] [serial = 1539] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 123 (0x7f1176edb800) [pid = 1950] [serial = 1529] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 122 (0x7f1185aac400) [pid = 1950] [serial = 1521] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 121 (0x7f118366e800) [pid = 1950] [serial = 1512] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 120 (0x7f1181148c00) [pid = 1950] [serial = 1503] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 119 (0x7f1176fad000) [pid = 1950] [serial = 1492] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 118 (0x7f1176cc8400) [pid = 1950] [serial = 1472] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 117 (0x7f1176cc2800) [pid = 1950] [serial = 1490] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 116 (0x7f118a90d000) [pid = 1950] [serial = 1541] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 115 (0x7f1181497000) [pid = 1950] [serial = 1510] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 114 (0x7f118260c400) [pid = 1950] [serial = 1519] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:03 INFO - --DOMWINDOW == 113 (0x7f118db06800) [pid = 1950] [serial = 1603] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 112 (0x7f118da55400) [pid = 1950] [serial = 1600] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 111 (0x7f118a9c0800) [pid = 1950] [serial = 1595] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 110 (0x7f118a92c000) [pid = 1950] [serial = 1592] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 109 (0x7f118a93d400) [pid = 1950] [serial = 1589] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 108 (0x7f11872adc00) [pid = 1950] [serial = 1584] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 107 (0x7f11812d4400) [pid = 1950] [serial = 1579] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 106 (0x7f11838bd800) [pid = 1950] [serial = 1574] [outer = (nil)] [url = about:blank]
11:40:03 INFO - --DOMWINDOW == 105 (0x7f1187d3c000) [pid = 1950] [serial = 1534] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html]
11:40:03 INFO - --DOMWINDOW == 104 (0x7f1176dd3c00) [pid = 1950] [serial = 1549] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:03 INFO - --DOMWINDOW == 103 (0x7f118a9b4c00) [pid = 1950] [serial = 1546] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:04 INFO - --DOMWINDOW == 102 (0x7f118274a800) [pid = 1950] [serial = 1513] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 101 (0x7f1177396800) [pid = 1950] [serial = 1522] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 100 (0x7f1177682c00) [pid = 1950] [serial = 1524] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:04 INFO - --DOMWINDOW == 99 (0x7f1181d96800) [pid = 1950] [serial = 1532] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 98 (0x7f11881f4c00) [pid = 1950] [serial = 1542] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 97 (0x7f11881f3c00) [pid = 1950] [serial = 1544] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html]
11:40:04 INFO - --DOMWINDOW == 96 (0x7f1176d7bc00) [pid = 1950] [serial = 1552] [outer = (nil)] [url = http://example.com/]
11:40:04 INFO - --DOMWINDOW == 95 (0x7f1182888000) [pid = 1950] [serial = 1514] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 94 (0x7f11773f0800) [pid = 1950] [serial = 1523] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 93 (0x7f1180f2c000) [pid = 1950] [serial = 1525] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 92 (0x7f1182750000) [pid = 1950] [serial = 1533] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 91 (0x7f1187d46000) [pid = 1950] [serial = 1535] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 90 (0x7f1187fab800) [pid = 1950] [serial = 1536] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html]
11:40:04 INFO - --DOMWINDOW == 89 (0x7f118a3e7800) [pid = 1950] [serial = 1543] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 88 (0x7f118a945000) [pid = 1950] [serial = 1545] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 87 (0x7f1176d82c00) [pid = 1950] [serial = 1553] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 86 (0x7f1176ddb800) [pid = 1950] [serial = 1554] [outer = (nil)] [url = http://example.com/]
11:40:04 INFO - --DOMWINDOW == 85 (0x7f11773e4800) [pid = 1950] [serial = 1558] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 84 (0x7f11812d6800) [pid = 1950] [serial = 1568] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 83 (0x7f1177678c00) [pid = 1950] [serial = 1571] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 82 (0x7f11776f7000) [pid = 1950] [serial = 1563] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 81 (0x7f119ef17c00) [pid = 1950] [serial = 1613] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 80 (0x7f119ef1c400) [pid = 1950] [serial = 1616] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 79 (0x7f11a14bd000) [pid = 1950] [serial = 1621] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOMWINDOW == 78 (0x7f11914f8400) [pid = 1950] [serial = 1608] [outer = (nil)] [url = about:blank]
11:40:04 INFO - --DOCSHELL 0x7f1191052800 == 34 [pid = 1950] [id = 668]
11:40:04 INFO - --DOCSHELL 0x7f118a318800 == 33 [pid = 1950] [id = 663]
11:40:04 INFO - --DOCSHELL 0x7f1185a20000 == 32 [pid = 1950] [id = 659]
11:40:04 INFO - --DOCSHELL 0x7f11827e7800 == 31 [pid = 1950] [id = 655]
11:40:05 INFO - --DOCSHELL 0x7f11810c7800 == 30 [pid = 1950] [id = 651]
11:40:05 INFO - --DOCSHELL 0x7f1176f76800 == 29 [pid = 1950] [id = 650]
11:40:05 INFO - --DOMWINDOW == 77 (0x7f11812d1800) [pid = 1950] [serial = 1526] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:05 INFO - --DOMWINDOW == 76 (0x7f1187fa8000) [pid = 1950] [serial = 1551] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html]
11:40:06 INFO - MEMORY STAT | vsize 1311MB | residentFast 404MB | heapAllocated 147MB
11:40:06 INFO - 246 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js | took 25957ms
11:40:06 INFO - ++DOCSHELL 0x7f1176f1f000 == 30 [pid = 1950] [id = 674]
11:40:06 INFO - ++DOMWINDOW == 77 (0x7f1176fb5400) [pid = 1950] [serial = 1625] [outer = (nil)]
11:40:06 INFO - ++DOMWINDOW == 78 (0x7f1177126c00) [pid = 1950] [serial = 1626] [outer = 0x7f1176fb5400]
11:40:06 INFO - 247 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js
11:40:06 INFO - ++DOCSHELL 0x7f1177262800 == 31 [pid = 1950] [id = 675]
11:40:06 INFO - ++DOMWINDOW == 79 (0x7f117720a800) [pid = 1950] [serial = 1627] [outer = (nil)]
11:40:06 INFO - ++DOMWINDOW == 80 (0x7f117720fc00) [pid = 1950] [serial = 1628] [outer = 0x7f117720a800]
11:40:07 INFO - --DOCSHELL 0x7f11770c0000 == 30 [pid = 1950] [id = 662]
11:40:07 INFO - --DOCSHELL 0x7f118278e800 == 29 [pid = 1950] [id = 654]
11:40:07 INFO - --DOCSHELL 0x7f1190978000 == 28 [pid = 1950] [id = 667]
11:40:07 INFO - --DOCSHELL 0x7f1176f72800 == 27 [pid = 1950] [id = 658]
11:40:07 INFO - --DOMWINDOW == 79 (0x7f117712ac00) [pid = 1950] [serial = 1550] [outer = (nil)] [url = about:blank]
11:40:08 INFO - --DOMWINDOW == 78 (0x7f118a914c00) [pid = 1950] [serial = 1548] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:09 INFO - --DOMWINDOW == 77 (0x7f11925e7800) [pid = 1950] [serial = 1611] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 76 (0x7f11a60b1400) [pid = 1950] [serial = 1624] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 75 (0x7f1177208800) [pid = 1950] [serial = 1556] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 74 (0x7f1191940000) [pid = 1950] [serial = 1610] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:09 INFO - --DOMWINDOW == 73 (0x7f118da57800) [pid = 1950] [serial = 1605] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 72 (0x7f118db0f800) [pid = 1950] [serial = 1618] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 71 (0x7f11a384d800) [pid = 1950] [serial = 1623] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:09 INFO - --DOMWINDOW == 70 (0x7f117767fc00) [pid = 1950] [serial = 1560] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 69 (0x7f1177202800) [pid = 1950] [serial = 1555] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 68 (0x7f118242c400) [pid = 1950] [serial = 1581] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 67 (0x7f1177395800) [pid = 1950] [serial = 1557] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html]
11:40:09 INFO - --DOMWINDOW == 66 (0x7f1180f30c00) [pid = 1950] [serial = 1567] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html]
11:40:09 INFO - --DOMWINDOW == 65 (0x7f11812d7c00) [pid = 1950] [serial = 1570] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 64 (0x7f118585e400) [pid = 1950] [serial = 1612] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html]
11:40:09 INFO - --DOMWINDOW == 63 (0x7f119193e800) [pid = 1950] [serial = 1615] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html]
11:40:09 INFO - --DOMWINDOW == 62 (0x7f118d490000) [pid = 1950] [serial = 1602] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html]
11:40:09 INFO - --DOMWINDOW == 61 (0x7f118d745400) [pid = 1950] [serial = 1599] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html]
11:40:09 INFO - --DOMWINDOW == 60 (0x7f118758b400) [pid = 1950] [serial = 1591] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 59 (0x7f118a921c00) [pid = 1950] [serial = 1588] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html]
11:40:09 INFO - --DOMWINDOW == 58 (0x7f1180f33400) [pid = 1950] [serial = 1578] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html]
11:40:09 INFO - --DOMWINDOW == 57 (0x7f118758f000) [pid = 1950] [serial = 1590] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html]
11:40:09 INFO - --DOMWINDOW == 56 (0x7f1187fad400) [pid = 1950] [serial = 1593] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 55 (0x7f118aa70c00) [pid = 1950] [serial = 1601] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html]
11:40:09 INFO - --DOMWINDOW == 54 (0x7f118db0e800) [pid = 1950] [serial = 1604] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html]
11:40:09 INFO - --DOMWINDOW == 53 (0x7f119f0ca800) [pid = 1950] [serial = 1617] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html]
11:40:09 INFO - --DOMWINDOW == 52 (0x7f11a62ec800) [pid = 1950] [serial = 1614] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html]
11:40:09 INFO - --DOMWINDOW == 51 (0x7f117767c400) [pid = 1950] [serial = 1561] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 50 (0x7f11773f1c00) [pid = 1950] [serial = 1559] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html]
11:40:09 INFO - --DOMWINDOW == 49 (0x7f118242f400) [pid = 1950] [serial = 1572] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html]
11:40:09 INFO - --DOMWINDOW == 48 (0x7f11776efc00) [pid = 1950] [serial = 1569] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html]
11:40:09 INFO - --DOMWINDOW == 47 (0x7f119f0c7400) [pid = 1950] [serial = 1619] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 46 (0x7f118a9ba000) [pid = 1950] [serial = 1606] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 45 (0x7f1176ccd800) [pid = 1950] [serial = 1582] [outer = (nil)] [url = about:blank]
11:40:09 INFO - --DOMWINDOW == 44 (0x7f11812d0000) [pid = 1950] [serial = 1580] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html]
11:40:10 INFO - --DOCSHELL 0x7f11770b9800 == 26 [pid = 1950] [id = 647]
11:40:10 INFO - --DOMWINDOW == 43 (0x7f118ab89800) [pid = 1950] [serial = 1598] [outer = (nil)] [url = about:blank]
11:40:10 INFO - --DOMWINDOW == 42 (0x7f1187d47400) [pid = 1950] [serial = 1597] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:11 INFO - --DOMWINDOW == 41 (0x7f1187d4a000) [pid = 1950] [serial = 1587] [outer = (nil)] [url = about:blank]
11:40:11 INFO - --DOMWINDOW == 40 (0x7f1187fa9800) [pid = 1950] [serial = 1596] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:11 INFO - --DOMWINDOW == 39 (0x7f1176cc9400) [pid = 1950] [serial = 1586] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:11 INFO - --DOMWINDOW == 38 (0x7f118a9bfc00) [pid = 1950] [serial = 1594] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:12 INFO - --DOMWINDOW == 37 (0x7f1185867000) [pid = 1950] [serial = 1577] [outer = (nil)] [url = about:blank]
11:40:12 INFO - --DOMWINDOW == 36 (0x7f118585ec00) [pid = 1950] [serial = 1576] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:13 INFO - ++DOMWINDOW == 37 (0x7f11776f1400) [pid = 1950] [serial = 1629] [outer = 0x7f117720a800]
11:40:13 INFO - --DOMWINDOW == 36 (0x7f1176db0c00) [pid = 1950] [serial = 1565] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:13 INFO - ++DOCSHELL 0x7f1176f8c000 == 27 [pid = 1950] [id = 676]
11:40:13 INFO - ++DOMWINDOW == 37 (0x7f1176d7e400) [pid = 1950] [serial = 1630] [outer = (nil)]
11:40:13 INFO - ++DOMWINDOW == 38 (0x7f1176d86000) [pid = 1950] [serial = 1631] [outer = 0x7f1176d7e400]
11:40:13 INFO - ++DOCSHELL 0x7f11770c3000 == 28 [pid = 1950] [id = 677]
11:40:13 INFO - ++DOMWINDOW == 39 (0x7f1176d87800) [pid = 1950] [serial = 1632] [outer = (nil)]
11:40:13 INFO - ++DOMWINDOW == 40 (0x7f1176dd0c00) [pid = 1950] [serial = 1633] [outer = 0x7f1176d87800]
11:40:13 INFO - ++DOMWINDOW == 41 (0x7f1176dd4800) [pid = 1950] [serial = 1634] [outer = 0x7f1176d87800]
11:40:13 INFO - ++DOCSHELL 0x7f11770c4000 == 29 [pid = 1950] [id = 678]
11:40:13 INFO - ++DOMWINDOW == 42 (0x7f117712dc00) [pid = 1950] [serial = 1635] [outer = (nil)]
11:40:13 INFO - ++DOMWINDOW == 43 (0x7f1177131800) [pid = 1950] [serial = 1636] [outer = 0x7f117712dc00]
11:40:15 INFO - MEMORY STAT | vsize 1310MB | residentFast 365MB | heapAllocated 137MB
11:40:15 INFO - 248 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js | took 9629ms
11:40:16 INFO - ++DOCSHELL 0x7f117a603000 == 30 [pid = 1950] [id = 679]
11:40:16 INFO - ++DOMWINDOW == 44 (0x7f1176eda800) [pid = 1950] [serial = 1637] [outer = (nil)]
11:40:16 INFO - ++DOMWINDOW == 45 (0x7f1176fadc00) [pid = 1950] [serial = 1638] [outer = 0x7f1176eda800]
11:40:16 INFO - 249 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js
11:40:16 INFO - ++DOCSHELL 0x7f1180e46800 == 31 [pid = 1950] [id = 680]
11:40:16 INFO - ++DOMWINDOW == 46 (0x7f1177397c00) [pid = 1950] [serial = 1639] [outer = (nil)]
11:40:16 INFO - ++DOMWINDOW == 47 (0x7f11773ef000) [pid = 1950] [serial = 1640] [outer = 0x7f1177397c00]
11:40:16 INFO - ++DOMWINDOW == 48 (0x7f11776f3400) [pid = 1950] [serial = 1641] [outer = 0x7f1177397c00]
11:40:16 INFO - ++DOCSHELL 0x7f1180f6b800 == 32 [pid = 1950] [id = 681]
11:40:16 INFO - ++DOMWINDOW == 49 (0x7f1176ddb800) [pid = 1950] [serial = 1642] [outer = (nil)]
11:40:16 INFO - ++DOMWINDOW == 50 (0x7f11776f3c00) [pid = 1950] [serial = 1643] [outer = 0x7f1176ddb800]
11:40:17 INFO - ++DOMWINDOW == 51 (0x7f1176cc4c00) [pid = 1950] [serial = 1644] [outer = 0x7f1176ddb800]
11:40:17 INFO - ++DOCSHELL 0x7f11770ae800 == 33 [pid = 1950] [id = 682]
11:40:17 INFO - ++DOMWINDOW == 52 (0x7f1176ddc000) [pid = 1950] [serial = 1645] [outer = (nil)]
11:40:17 INFO - ++DOMWINDOW == 53 (0x7f1176de1000) [pid = 1950] [serial = 1646] [outer = 0x7f1176ddc000]
11:40:20 INFO - ++DOMWINDOW == 54 (0x7f1181499400) [pid = 1950] [serial = 1647] [outer = 0x7f1177397c00]
11:40:20 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:40:20 INFO - ++DOCSHELL 0x7f11770c8800 == 34 [pid = 1950] [id = 683]
11:40:20 INFO - ++DOMWINDOW == 55 (0x7f1181d93400) [pid = 1950] [serial = 1648] [outer = (nil)]
11:40:20 INFO - ++DOMWINDOW == 56 (0x7f1181d9bc00) [pid = 1950] [serial = 1649] [outer = 0x7f1181d93400]
11:40:21 INFO - --DOCSHELL 0x7f11824aa000 == 33 [pid = 1950] [id = 653]
11:40:21 INFO - --DOCSHELL 0x7f1180e06000 == 32 [pid = 1950] [id = 648]
11:40:21 INFO - --DOCSHELL 0x7f1176f6e800 == 31 [pid = 1950] [id = 671]
11:40:21 INFO - --DOCSHELL 0x7f11a1329800 == 30 [pid = 1950] [id = 672]
11:40:21 INFO - --DOCSHELL 0x7f119c260000 == 29 [pid = 1950] [id = 669]
11:40:21 INFO - --DOCSHELL 0x7f119e43c000 == 28 [pid = 1950] [id = 673]
11:40:21 INFO - --DOCSHELL 0x7f119104f800 == 27 [pid = 1950] [id = 666]
11:40:21 INFO - --DOCSHELL 0x7f1176f28800 == 26 [pid = 1950] [id = 665]
11:40:21 INFO - --DOCSHELL 0x7f118115d000 == 25 [pid = 1950] [id = 656]
11:40:21 INFO - --DOCSHELL 0x7f1176f13800 == 24 [pid = 1950] [id = 661]
11:40:21 INFO - --DOCSHELL 0x7f11835df800 == 23 [pid = 1950] [id = 657]
11:40:21 INFO - --DOCSHELL 0x7f1176f73800 == 22 [pid = 1950] [id = 670]
11:40:21 INFO - --DOCSHELL 0x7f11810af800 == 21 [pid = 1950] [id = 660]
11:40:21 INFO - --DOCSHELL 0x7f118d4ab000 == 20 [pid = 1950] [id = 664]
11:40:21 INFO - --DOCSHELL 0x7f118126f800 == 19 [pid = 1950] [id = 652]
11:40:21 INFO - --DOCSHELL 0x7f1180f68000 == 18 [pid = 1950] [id = 649]
11:40:21 INFO - --DOCSHELL 0x7f1176f8c000 == 17 [pid = 1950] [id = 676]
11:40:21 INFO - --DOCSHELL 0x7f11770c4000 == 16 [pid = 1950] [id = 678]
11:40:21 INFO - --DOMWINDOW == 55 (0x7f1181146000) [pid = 1950] [serial = 1566] [outer = (nil)] [url = about:blank]
11:40:21 INFO - ++DOMWINDOW == 56 (0x7f1176fb6400) [pid = 1950] [serial = 1650] [outer = 0x7f1181d93400]
11:40:22 INFO - --DOCSHELL 0x7f11770ae800 == 15 [pid = 1950] [id = 682]
11:40:23 INFO - MEMORY STAT | vsize 1304MB | residentFast 356MB | heapAllocated 134MB
11:40:23 INFO - 250 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js | took 7006ms
11:40:23 INFO - ++DOCSHELL 0x7f11773ad800 == 16 [pid = 1950] [id = 684]
11:40:23 INFO - ++DOMWINDOW == 57 (0x7f117720e000) [pid = 1950] [serial = 1651] [outer = (nil)]
11:40:23 INFO - ++DOMWINDOW == 58 (0x7f11773e6800) [pid = 1950] [serial = 1652] [outer = 0x7f117720e000]
11:40:23 INFO - 251 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js
11:40:23 INFO - ++DOCSHELL 0x7f117a610800 == 17 [pid = 1950] [id = 685]
11:40:23 INFO - ++DOMWINDOW == 59 (0x7f1177681400) [pid = 1950] [serial = 1653] [outer = (nil)]
11:40:23 INFO - ++DOMWINDOW == 60 (0x7f11776eb000) [pid = 1950] [serial = 1654] [outer = 0x7f1177681400]
11:40:23 INFO - ++DOMWINDOW == 61 (0x7f11776f8800) [pid = 1950] [serial = 1655] [outer = 0x7f1177681400]
11:40:24 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-errors.js, line 7: TypeError: document.bar is not a function
11:40:24 INFO - ++DOCSHELL 0x7f11810ab000 == 18 [pid = 1950] [id = 686]
11:40:24 INFO - ++DOMWINDOW == 62 (0x7f1176dae400) [pid = 1950] [serial = 1656] [outer = (nil)]
11:40:24 INFO - ++DOMWINDOW == 63 (0x7f1180f34c00) [pid = 1950] [serial = 1657] [outer = 0x7f1176dae400]
11:40:24 INFO - ++DOMWINDOW == 64 (0x7f117738b400) [pid = 1950] [serial = 1658] [outer = 0x7f1176dae400]
11:40:24 INFO - ++DOCSHELL 0x7f11810c9800 == 19 [pid = 1950] [id = 687]
11:40:24 INFO - ++DOMWINDOW == 65 (0x7f1176ee0c00) [pid = 1950] [serial = 1659] [outer = (nil)]
11:40:24 INFO - ++DOMWINDOW == 66 (0x7f1181491800) [pid = 1950] [serial = 1660] [outer = 0x7f1176ee0c00]
11:40:26 INFO - --DOMWINDOW == 65 (0x7f1176dd0c00) [pid = 1950] [serial = 1633] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 64 (0x7f1177126c00) [pid = 1950] [serial = 1626] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 63 (0x7f117720fc00) [pid = 1950] [serial = 1628] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 62 (0x7f1176d86000) [pid = 1950] [serial = 1631] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 61 (0x7f11910ae800) [pid = 1950] [serial = 1607] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 60 (0x7f1185aad800) [pid = 1950] [serial = 1583] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 59 (0x7f11776ed800) [pid = 1950] [serial = 1620] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 58 (0x7f1176d87800) [pid = 1950] [serial = 1632] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 57 (0x7f11837e6000) [pid = 1950] [serial = 1573] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 56 (0x7f11776f2000) [pid = 1950] [serial = 1562] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:26 INFO - --DOMWINDOW == 55 (0x7f117712dc00) [pid = 1950] [serial = 1635] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:26 INFO - --DOMWINDOW == 54 (0x7f1176fb5400) [pid = 1950] [serial = 1625] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 53 (0x7f117720a800) [pid = 1950] [serial = 1627] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html]
11:40:26 INFO - --DOMWINDOW == 52 (0x7f1176d7e400) [pid = 1950] [serial = 1630] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 51 (0x7f11773ef000) [pid = 1950] [serial = 1640] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 50 (0x7f11776f3c00) [pid = 1950] [serial = 1643] [outer = (nil)] [url = about:blank]
11:40:26 INFO - --DOMWINDOW == 49 (0x7f11776f1400) [pid = 1950] [serial = 1629] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html]
11:40:26 INFO - ++DOCSHELL 0x7f117a616000 == 20 [pid = 1950] [id = 688]
11:40:26 INFO - ++DOMWINDOW == 50 (0x7f118148c000) [pid = 1950] [serial = 1661] [outer = (nil)]
11:40:26 INFO - ++DOMWINDOW == 51 (0x7f1181d99c00) [pid = 1950] [serial = 1662] [outer = 0x7f118148c000]
11:40:27 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:40:27 INFO - ++DOCSHELL 0x7f11846b4000 == 21 [pid = 1950] [id = 689]
11:40:27 INFO - ++DOMWINDOW == 52 (0x7f1187d40000) [pid = 1950] [serial = 1663] [outer = (nil)]
11:40:27 INFO - ++DOMWINDOW == 53 (0x7f1181d99000) [pid = 1950] [serial = 1664] [outer = 0x7f1187d40000]
11:40:31 INFO - --DOCSHELL 0x7f1177262800 == 20 [pid = 1950] [id = 675]
11:40:31 INFO - --DOCSHELL 0x7f1176f1f000 == 19 [pid = 1950] [id = 674]
11:40:31 INFO - --DOCSHELL 0x7f11770c3000 == 18 [pid = 1950] [id = 677]
11:40:31 INFO - --DOCSHELL 0x7f117a603000 == 17 [pid = 1950] [id = 679]
11:40:31 INFO - --DOCSHELL 0x7f1180e46800 == 16 [pid = 1950] [id = 680]
11:40:31 INFO - --DOCSHELL 0x7f11810c9800 == 15 [pid = 1950] [id = 687]
11:40:31 INFO - --DOCSHELL 0x7f11770c8800 == 14 [pid = 1950] [id = 683]
11:40:31 INFO - --DOCSHELL 0x7f1180f6b800 == 13 [pid = 1950] [id = 681]
11:40:31 INFO - --DOCSHELL 0x7f117a616000 == 12 [pid = 1950] [id = 688]
11:40:31 INFO - --DOCSHELL 0x7f11846b4000 == 11 [pid = 1950] [id = 689]
11:40:31 INFO - --DOMWINDOW == 52 (0x7f1176dd4800) [pid = 1950] [serial = 1634] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:31 INFO - --DOMWINDOW == 51 (0x7f1176d83c00) [pid = 1950] [serial = 1575] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:31 INFO - --DOMWINDOW == 50 (0x7f1177674c00) [pid = 1950] [serial = 1564] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:31 INFO - --DOMWINDOW == 49 (0x7f1177131800) [pid = 1950] [serial = 1636] [outer = (nil)] [url = about:blank]
11:40:31 INFO - --DOMWINDOW == 48 (0x7f11776f3400) [pid = 1950] [serial = 1641] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:31 INFO - --DOMWINDOW == 47 (0x7f118113f800) [pid = 1950] [serial = 1585] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:31 INFO - --DOMWINDOW == 46 (0x7f118758c800) [pid = 1950] [serial = 1622] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:31 INFO - --DOMWINDOW == 45 (0x7f1184369800) [pid = 1950] [serial = 1609] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:32 INFO - --DOMWINDOW == 44 (0x7f1176ddb800) [pid = 1950] [serial = 1642] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:32 INFO - --DOMWINDOW == 43 (0x7f1181d93400) [pid = 1950] [serial = 1648] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:32 INFO - --DOMWINDOW == 42 (0x7f1176eda800) [pid = 1950] [serial = 1637] [outer = (nil)] [url = about:blank]
11:40:32 INFO - --DOMWINDOW == 41 (0x7f1177397c00) [pid = 1950] [serial = 1639] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:32 INFO - --DOMWINDOW == 40 (0x7f1180f34c00) [pid = 1950] [serial = 1657] [outer = (nil)] [url = about:blank]
11:40:32 INFO - --DOMWINDOW == 39 (0x7f1176ee0c00) [pid = 1950] [serial = 1659] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:32 INFO - --DOMWINDOW == 38 (0x7f1187d40000) [pid = 1950] [serial = 1663] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:40:32 INFO - --DOMWINDOW == 37 (0x7f1176ddc000) [pid = 1950] [serial = 1645] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:40:32 INFO - --DOMWINDOW == 36 (0x7f11776eb000) [pid = 1950] [serial = 1654] [outer = (nil)] [url = about:blank]
11:40:32 INFO - --DOMWINDOW == 35 (0x7f1181d9bc00) [pid = 1950] [serial = 1649] [outer = (nil)] [url = about:blank]
11:40:32 INFO - --DOMWINDOW == 34 (0x7f1176fadc00) [pid = 1950] [serial = 1638] [outer = (nil)] [url = about:blank]
11:40:32 INFO - MEMORY STAT | vsize 1300MB | residentFast 355MB | heapAllocated 135MB
11:40:32 INFO - 252 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js | took 8987ms
11:40:32 INFO - ++DOCSHELL 0x7f1176f76000 == 12 [pid = 1950] [id = 690]
11:40:32 INFO - ++DOMWINDOW == 35 (0x7f1176d80c00) [pid = 1950] [serial = 1665] [outer = (nil)]
11:40:32 INFO - ++DOMWINDOW == 36 (0x7f1176dac800) [pid = 1950] [serial = 1666] [outer = 0x7f1176d80c00]
11:40:32 INFO - 253 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js
11:40:32 INFO - ++DOCSHELL 0x7f1177245000 == 13 [pid = 1950] [id = 691]
11:40:32 INFO - ++DOMWINDOW == 37 (0x7f1176dc2400) [pid = 1950] [serial = 1667] [outer = (nil)]
11:40:32 INFO - ++DOMWINDOW == 38 (0x7f1176dc9c00) [pid = 1950] [serial = 1668] [outer = 0x7f1176dc2400]
11:40:33 INFO - ++DOCSHELL 0x7f11770ba800 == 14 [pid = 1950] [id = 692]
11:40:33 INFO - ++DOMWINDOW == 39 (0x7f1176dcbc00) [pid = 1950] [serial = 1669] [outer = (nil)]
11:40:33 INFO - ++DOMWINDOW == 40 (0x7f1176de0400) [pid = 1950] [serial = 1670] [outer = 0x7f1176dcbc00]
11:40:33 INFO - ++DOMWINDOW == 41 (0x7f1176dd9800) [pid = 1950] [serial = 1671] [outer = 0x7f1176dcbc00]
11:40:33 INFO - ++DOCSHELL 0x7f117a60a000 == 15 [pid = 1950] [id = 693]
11:40:33 INFO - ++DOMWINDOW == 42 (0x7f117712c000) [pid = 1950] [serial = 1672] [outer = (nil)]
11:40:33 INFO - ++DOMWINDOW == 43 (0x7f117712f400) [pid = 1950] [serial = 1673] [outer = 0x7f117712c000]
11:40:35 INFO - ++DOMWINDOW == 44 (0x7f11773ec800) [pid = 1950] [serial = 1674] [outer = 0x7f1176dc2400]
11:40:35 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:40:37 INFO - MEMORY STAT | vsize 1303MB | residentFast 357MB | heapAllocated 140MB
11:40:37 INFO - 254 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js | took 4549ms
11:40:37 INFO - ++DOCSHELL 0x7f1176f1f000 == 16 [pid = 1950] [id = 694]
11:40:37 INFO - ++DOMWINDOW == 45 (0x7f1176ed6400) [pid = 1950] [serial = 1675] [outer = (nil)]
11:40:37 INFO - ++DOMWINDOW == 46 (0x7f1177128400) [pid = 1950] [serial = 1676] [outer = 0x7f1176ed6400]
11:40:37 INFO - 255 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js
11:40:37 INFO - ++DOCSHELL 0x7f1180f71800 == 17 [pid = 1950] [id = 695]
11:40:37 INFO - ++DOMWINDOW == 47 (0x7f117738a400) [pid = 1950] [serial = 1677] [outer = (nil)]
11:40:37 INFO - ++DOMWINDOW == 48 (0x7f1177398000) [pid = 1950] [serial = 1678] [outer = 0x7f117738a400]
11:40:38 INFO - ++DOMWINDOW == 49 (0x7f1181eeb400) [pid = 1950] [serial = 1679] [outer = 0x7f117738a400]
11:40:38 INFO - ++DOCSHELL 0x7f11810c6000 == 18 [pid = 1950] [id = 696]
11:40:38 INFO - ++DOMWINDOW == 50 (0x7f11776f2000) [pid = 1950] [serial = 1680] [outer = (nil)]
11:40:38 INFO - ++DOMWINDOW == 51 (0x7f11776f6c00) [pid = 1950] [serial = 1681] [outer = 0x7f11776f2000]
11:40:38 INFO - ++DOMWINDOW == 52 (0x7f117712b400) [pid = 1950] [serial = 1682] [outer = 0x7f11776f2000]
11:40:39 INFO - ++DOCSHELL 0x7f1181168000 == 19 [pid = 1950] [id = 697]
11:40:39 INFO - ++DOMWINDOW == 53 (0x7f11812cdc00) [pid = 1950] [serial = 1683] [outer = (nil)]
11:40:39 INFO - ++DOMWINDOW == 54 (0x7f11812d1800) [pid = 1950] [serial = 1684] [outer = 0x7f11812cdc00]
11:40:41 INFO - ++DOCSHELL 0x7f1181522800 == 20 [pid = 1950] [id = 698]
11:40:41 INFO - ++DOMWINDOW == 55 (0x7f118242d000) [pid = 1950] [serial = 1685] [outer = (nil)]
11:40:41 INFO - ++DOMWINDOW == 56 (0x7f118242fc00) [pid = 1950] [serial = 1686] [outer = 0x7f118242d000]
11:40:42 INFO - ++DOCSHELL 0x7f1183b2c800 == 21 [pid = 1950] [id = 699]
11:40:42 INFO - ++DOMWINDOW == 57 (0x7f1187fa4000) [pid = 1950] [serial = 1687] [outer = (nil)]
11:40:42 INFO - ++DOMWINDOW == 58 (0x7f1187fa8400) [pid = 1950] [serial = 1688] [outer = 0x7f1187fa4000]
11:40:44 INFO - ++DOCSHELL 0x7f118a01d000 == 22 [pid = 1950] [id = 700]
11:40:44 INFO - ++DOMWINDOW == 59 (0x7f1185aad400) [pid = 1950] [serial = 1689] [outer = (nil)]
11:40:44 INFO - ++DOMWINDOW == 60 (0x7f118148fc00) [pid = 1950] [serial = 1690] [outer = 0x7f1185aad400]
11:40:46 INFO - MEMORY STAT | vsize 1309MB | residentFast 383MB | heapAllocated 160MB
11:40:46 INFO - 256 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js | took 8870ms
11:40:46 INFO - ++DOCSHELL 0x7f11826ba000 == 23 [pid = 1950] [id = 701]
11:40:46 INFO - ++DOMWINDOW == 61 (0x7f1177683000) [pid = 1950] [serial = 1691] [outer = (nil)]
11:40:46 INFO - ++DOMWINDOW == 62 (0x7f1181d1a400) [pid = 1950] [serial = 1692] [outer = 0x7f1177683000]
11:40:46 INFO - 257 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js
11:40:46 INFO - ++DOCSHELL 0x7f1188184000 == 24 [pid = 1950] [id = 702]
11:40:46 INFO - ++DOMWINDOW == 63 (0x7f1185a9ac00) [pid = 1950] [serial = 1693] [outer = (nil)]
11:40:47 INFO - ++DOMWINDOW == 64 (0x7f1185a9fc00) [pid = 1950] [serial = 1694] [outer = 0x7f1185a9ac00]
11:40:47 INFO - ++DOCSHELL 0x7f118d384000 == 25 [pid = 1950] [id = 703]
11:40:47 INFO - ++DOMWINDOW == 65 (0x7f1181492400) [pid = 1950] [serial = 1695] [outer = (nil)]
11:40:47 INFO - ++DOMWINDOW == 66 (0x7f118de78000) [pid = 1950] [serial = 1696] [outer = 0x7f1181492400]
11:40:47 INFO - ++DOMWINDOW == 67 (0x7f118260b400) [pid = 1950] [serial = 1697] [outer = 0x7f1181492400]
11:40:48 INFO - ++DOCSHELL 0x7f118d53a800 == 26 [pid = 1950] [id = 704]
11:40:48 INFO - ++DOMWINDOW == 68 (0x7f11a1ff3c00) [pid = 1950] [serial = 1698] [outer = (nil)]
11:40:48 INFO - ++DOMWINDOW == 69 (0x7f11a3849000) [pid = 1950] [serial = 1699] [outer = 0x7f11a1ff3c00]
11:40:50 INFO - MEMORY STAT | vsize 1311MB | residentFast 391MB | heapAllocated 165MB
11:40:50 INFO - 258 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js | took 3451ms
11:40:50 INFO - ++DOCSHELL 0x7f118d52c800 == 27 [pid = 1950] [id = 705]
11:40:50 INFO - ++DOMWINDOW == 70 (0x7f118db05000) [pid = 1950] [serial = 1700] [outer = (nil)]
11:40:50 INFO - ++DOMWINDOW == 71 (0x7f11a1feb800) [pid = 1950] [serial = 1701] [outer = 0x7f118db05000]
11:40:50 INFO - 259 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js
11:40:50 INFO - ++DOCSHELL 0x7f118f14c800 == 28 [pid = 1950] [id = 706]
11:40:50 INFO - ++DOMWINDOW == 72 (0x7f11a63d0400) [pid = 1950] [serial = 1702] [outer = (nil)]
11:40:50 INFO - ++DOMWINDOW == 73 (0x7f11a63d5400) [pid = 1950] [serial = 1703] [outer = 0x7f11a63d0400]
11:40:51 INFO - ++DOMWINDOW == 74 (0x7f1175639400) [pid = 1950] [serial = 1704] [outer = 0x7f11a63d0400]
11:40:51 INFO - ++DOCSHELL 0x7f1190aca800 == 29 [pid = 1950] [id = 707]
11:40:51 INFO - ++DOMWINDOW == 75 (0x7f117563b800) [pid = 1950] [serial = 1705] [outer = (nil)]
11:40:51 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 437
11:40:51 INFO - ++DOMWINDOW == 76 (0x7f117563cc00) [pid = 1950] [serial = 1706] [outer = 0x7f117563b800]
11:40:51 INFO - ++DOCSHELL 0x7f1191052000 == 30 [pid = 1950] [id = 708]
11:40:51 INFO - ++DOMWINDOW == 77 (0x7f117563e000) [pid = 1950] [serial = 1707] [outer = (nil)]
11:40:51 INFO - ++DOMWINDOW == 78 (0x7f1175642800) [pid = 1950] [serial = 1708] [outer = 0x7f117563e000]
11:40:51 INFO - ++DOMWINDOW == 79 (0x7f117563a800) [pid = 1950] [serial = 1709] [outer = 0x7f117563e000]
11:40:52 INFO - ++DOCSHELL 0x7f119163f800 == 31 [pid = 1950] [id = 709]
11:40:52 INFO - ++DOMWINDOW == 80 (0x7f1175642000) [pid = 1950] [serial = 1710] [outer = (nil)]
11:40:52 INFO - ++DOMWINDOW == 81 (0x7f11a6476000) [pid = 1950] [serial = 1711] [outer = 0x7f1175642000]
11:40:54 INFO - MEMORY STAT | vsize 1312MB | residentFast 400MB | heapAllocated 171MB
11:40:54 INFO - 260 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js | took 3881ms
11:40:54 INFO - ++DOCSHELL 0x7f118f63d000 == 32 [pid = 1950] [id = 710]
11:40:54 INFO - ++DOMWINDOW == 82 (0x7f1175194400) [pid = 1950] [serial = 1712] [outer = (nil)]
11:40:54 INFO - ++DOMWINDOW == 83 (0x7f1175641800) [pid = 1950] [serial = 1713] [outer = 0x7f1175194400]
11:40:54 INFO - 261 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js
11:40:55 INFO - ++DOCSHELL 0x7f1192569800 == 33 [pid = 1950] [id = 711]
11:40:55 INFO - ++DOMWINDOW == 84 (0x7f11a646f000) [pid = 1950] [serial = 1714] [outer = (nil)]
11:40:55 INFO - ++DOMWINDOW == 85 (0x7f11a649a000) [pid = 1950] [serial = 1715] [outer = 0x7f11a646f000]
11:40:55 INFO - ++DOCSHELL 0x7f119e00e000 == 34 [pid = 1950] [id = 712]
11:40:55 INFO - ++DOMWINDOW == 86 (0x7f11a649b800) [pid = 1950] [serial = 1716] [outer = (nil)]
11:40:55 INFO - ++DOMWINDOW == 87 (0x7f11a7197000) [pid = 1950] [serial = 1717] [outer = 0x7f11a649b800]
11:40:55 INFO - ++DOMWINDOW == 88 (0x7f11a60b2400) [pid = 1950] [serial = 1718] [outer = 0x7f11a649b800]
11:40:55 INFO - ++DOCSHELL 0x7f119f0ae800 == 35 [pid = 1950] [id = 713]
11:40:55 INFO - ++DOMWINDOW == 89 (0x7f11876f0c00) [pid = 1950] [serial = 1719] [outer = (nil)]
11:40:55 INFO - ++DOMWINDOW == 90 (0x7f11876f3400) [pid = 1950] [serial = 1720] [outer = 0x7f11876f0c00]
11:40:58 INFO - --DOCSHELL 0x7f11770ba800 == 34 [pid = 1950] [id = 692]
11:40:58 INFO - --DOCSHELL 0x7f117a60a000 == 33 [pid = 1950] [id = 693]
11:40:58 INFO - --DOCSHELL 0x7f117a610800 == 32 [pid = 1950] [id = 685]
11:40:58 INFO - --DOCSHELL 0x7f11810ab000 == 31 [pid = 1950] [id = 686]
11:40:58 INFO - --DOCSHELL 0x7f11773ad800 == 30 [pid = 1950] [id = 684]
11:40:58 INFO - --DOCSHELL 0x7f1181168000 == 29 [pid = 1950] [id = 697]
11:40:58 INFO - --DOCSHELL 0x7f1181522800 == 28 [pid = 1950] [id = 698]
11:40:58 INFO - --DOCSHELL 0x7f1183b2c800 == 27 [pid = 1950] [id = 699]
11:40:58 INFO - --DOCSHELL 0x7f118a01d000 == 26 [pid = 1950] [id = 700]
11:40:58 INFO - --DOCSHELL 0x7f118d53a800 == 25 [pid = 1950] [id = 704]
11:40:58 INFO - --DOCSHELL 0x7f119163f800 == 24 [pid = 1950] [id = 709]
11:40:58 INFO - --DOMWINDOW == 89 (0x7f1181d99000) [pid = 1950] [serial = 1664] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:40:58 INFO - --DOMWINDOW == 88 (0x7f1181491800) [pid = 1950] [serial = 1660] [outer = (nil)] [url = about:blank]
11:40:58 INFO - --DOMWINDOW == 87 (0x7f1176de1000) [pid = 1950] [serial = 1646] [outer = (nil)] [url = about:blank]
11:40:58 INFO - --DOMWINDOW == 86 (0x7f1176cc4c00) [pid = 1950] [serial = 1644] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:40:58 INFO - --DOMWINDOW == 85 (0x7f1181499400) [pid = 1950] [serial = 1647] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:40:58 INFO - --DOMWINDOW == 84 (0x7f1176fb6400) [pid = 1950] [serial = 1650] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:41:00 INFO - MEMORY STAT | vsize 1310MB | residentFast 394MB | heapAllocated 159MB
11:41:00 INFO - 262 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js | took 5064ms
11:41:00 INFO - ++DOCSHELL 0x7f11770ba800 == 25 [pid = 1950] [id = 714]
11:41:00 INFO - ++DOMWINDOW == 85 (0x7f1175656800) [pid = 1950] [serial = 1721] [outer = (nil)]
11:41:00 INFO - ++DOMWINDOW == 86 (0x7f1176ddc800) [pid = 1950] [serial = 1722] [outer = 0x7f1175656800]
11:41:00 INFO - 263 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js
11:41:00 INFO - ++DOCSHELL 0x7f117a612000 == 26 [pid = 1950] [id = 715]
11:41:00 INFO - ++DOMWINDOW == 87 (0x7f1176fac400) [pid = 1950] [serial = 1723] [outer = (nil)]
11:41:00 INFO - ++DOMWINDOW == 88 (0x7f1176fb2000) [pid = 1950] [serial = 1724] [outer = 0x7f1176fac400]
11:41:00 INFO - ++DOCSHELL 0x7f1180e21800 == 27 [pid = 1950] [id = 716]
11:41:00 INFO - ++DOMWINDOW == 89 (0x7f1176fb5c00) [pid = 1950] [serial = 1725] [outer = (nil)]
11:41:00 INFO - ++DOMWINDOW == 90 (0x7f1177132400) [pid = 1950] [serial = 1726] [outer = 0x7f1176fb5c00]
11:41:00 INFO - ++DOMWINDOW == 91 (0x7f1176ddd800) [pid = 1950] [serial = 1727] [outer = 0x7f1176fb5c00]
11:41:01 INFO - ++DOCSHELL 0x7f1181155000 == 28 [pid = 1950] [id = 717]
11:41:01 INFO - ++DOMWINDOW == 92 (0x7f11773f2400) [pid = 1950] [serial = 1728] [outer = (nil)]
11:41:01 INFO - ++DOMWINDOW == 93 (0x7f1177678800) [pid = 1950] [serial = 1729] [outer = 0x7f11773f2400]
11:41:04 INFO - [1950] WARNING: Must complete empty transaction when compositing!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsPresShell.cpp, line 5934
11:41:06 INFO - --DOMWINDOW == 92 (0x7f1176d80c00) [pid = 1950] [serial = 1665] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 91 (0x7f118148c000) [pid = 1950] [serial = 1661] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:41:06 INFO - --DOMWINDOW == 90 (0x7f1176dac800) [pid = 1950] [serial = 1666] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 89 (0x7f1176de0400) [pid = 1950] [serial = 1670] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 88 (0x7f1176dcbc00) [pid = 1950] [serial = 1669] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:06 INFO - --DOMWINDOW == 87 (0x7f117712c000) [pid = 1950] [serial = 1672] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:06 INFO - --DOMWINDOW == 86 (0x7f1175642000) [pid = 1950] [serial = 1710] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:06 INFO - --DOMWINDOW == 85 (0x7f1176dae400) [pid = 1950] [serial = 1656] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:06 INFO - --DOMWINDOW == 84 (0x7f11a1ff3c00) [pid = 1950] [serial = 1698] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:06 INFO - --DOMWINDOW == 83 (0x7f1176dc2400) [pid = 1950] [serial = 1667] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html]
11:41:06 INFO - --DOMWINDOW == 82 (0x7f117720e000) [pid = 1950] [serial = 1651] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 81 (0x7f1177681400) [pid = 1950] [serial = 1653] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html]
11:41:06 INFO - --DOMWINDOW == 80 (0x7f118de78000) [pid = 1950] [serial = 1696] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 79 (0x7f11776f6c00) [pid = 1950] [serial = 1681] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 78 (0x7f1176dc9c00) [pid = 1950] [serial = 1668] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 77 (0x7f1175642800) [pid = 1950] [serial = 1708] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 76 (0x7f11a7197000) [pid = 1950] [serial = 1717] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 75 (0x7f11773e6800) [pid = 1950] [serial = 1652] [outer = (nil)] [url = about:blank]
11:41:06 INFO - --DOMWINDOW == 74 (0x7f11776f8800) [pid = 1950] [serial = 1655] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html]
11:41:06 INFO - --DOMWINDOW == 73 (0x7f11773ec800) [pid = 1950] [serial = 1674] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html]
11:41:14 INFO - --DOCSHELL 0x7f119f0ae800 == 27 [pid = 1950] [id = 713]
11:41:14 INFO - --DOCSHELL 0x7f1190aca800 == 26 [pid = 1950] [id = 707]
11:41:14 INFO - --DOCSHELL 0x7f119e00e000 == 25 [pid = 1950] [id = 712]
11:41:14 INFO - --DOCSHELL 0x7f1176f1f000 == 24 [pid = 1950] [id = 694]
11:41:14 INFO - --DOCSHELL 0x7f1191052000 == 23 [pid = 1950] [id = 708]
11:41:14 INFO - --DOCSHELL 0x7f1176f76000 == 22 [pid = 1950] [id = 690]
11:41:14 INFO - --DOCSHELL 0x7f118d52c800 == 21 [pid = 1950] [id = 705]
11:41:14 INFO - --DOCSHELL 0x7f118f14c800 == 20 [pid = 1950] [id = 706]
11:41:14 INFO - --DOCSHELL 0x7f1192569800 == 19 [pid = 1950] [id = 711]
11:41:14 INFO - --DOCSHELL 0x7f11826ba000 == 18 [pid = 1950] [id = 701]
11:41:14 INFO - --DOCSHELL 0x7f118f63d000 == 17 [pid = 1950] [id = 710]
11:41:14 INFO - --DOCSHELL 0x7f1180f71800 == 16 [pid = 1950] [id = 695]
11:41:14 INFO - --DOCSHELL 0x7f1188184000 == 15 [pid = 1950] [id = 702]
11:41:14 INFO - --DOCSHELL 0x7f118d384000 == 14 [pid = 1950] [id = 703]
11:41:14 INFO - --DOCSHELL 0x7f1177245000 == 13 [pid = 1950] [id = 691]
11:41:14 INFO - --DOCSHELL 0x7f11810c6000 == 12 [pid = 1950] [id = 696]
11:41:14 INFO - --DOMWINDOW == 72 (0x7f1181d99c00) [pid = 1950] [serial = 1662] [outer = (nil)] [url = about:blank]
11:41:14 INFO - --DOMWINDOW == 71 (0x7f11a6476000) [pid = 1950] [serial = 1711] [outer = (nil)] [url = about:blank]
11:41:14 INFO - --DOMWINDOW == 70 (0x7f117712f400) [pid = 1950] [serial = 1673] [outer = (nil)] [url = about:blank]
11:41:14 INFO - --DOMWINDOW == 69 (0x7f117738b400) [pid = 1950] [serial = 1658] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:14 INFO - --DOMWINDOW == 68 (0x7f1176dd9800) [pid = 1950] [serial = 1671] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:14 INFO - --DOMWINDOW == 67 (0x7f11a3849000) [pid = 1950] [serial = 1699] [outer = (nil)] [url = about:blank]
11:41:14 INFO - --DOCSHELL 0x7f1181155000 == 11 [pid = 1950] [id = 717]
11:41:15 INFO - MEMORY STAT | vsize 1296MB | residentFast 369MB | heapAllocated 144MB
11:41:15 INFO - 264 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js | took 14743ms
11:41:15 INFO - ++DOCSHELL 0x7f1176f72800 == 12 [pid = 1950] [id = 718]
11:41:15 INFO - ++DOMWINDOW == 68 (0x7f1175191000) [pid = 1950] [serial = 1730] [outer = (nil)]
11:41:15 INFO - ++DOMWINDOW == 69 (0x7f1175641c00) [pid = 1950] [serial = 1731] [outer = 0x7f1175191000]
11:41:15 INFO - 265 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js
11:41:15 INFO - ++DOCSHELL 0x7f11770c4800 == 13 [pid = 1950] [id = 719]
11:41:15 INFO - ++DOMWINDOW == 70 (0x7f1175657800) [pid = 1950] [serial = 1732] [outer = (nil)]
11:41:15 INFO - ++DOMWINDOW == 71 (0x7f117565a800) [pid = 1950] [serial = 1733] [outer = 0x7f1175657800]
11:41:15 INFO - ++DOMWINDOW == 72 (0x7f11758ddc00) [pid = 1950] [serial = 1734] [outer = 0x7f1175657800]
11:41:16 INFO - ++DOCSHELL 0x7f117725f800 == 14 [pid = 1950] [id = 720]
11:41:16 INFO - ++DOMWINDOW == 73 (0x7f1176cca400) [pid = 1950] [serial = 1735] [outer = (nil)]
11:41:16 INFO - ++DOMWINDOW == 74 (0x7f1176ccfc00) [pid = 1950] [serial = 1736] [outer = 0x7f1176cca400]
11:41:16 INFO - ++DOCSHELL 0x7f1176f6d000 == 15 [pid = 1950] [id = 721]
11:41:16 INFO - ++DOMWINDOW == 75 (0x7f1176dad400) [pid = 1950] [serial = 1737] [outer = (nil)]
11:41:16 INFO - ++DOMWINDOW == 76 (0x7f1176daf400) [pid = 1950] [serial = 1738] [outer = 0x7f1176dad400]
11:41:16 INFO - ++DOMWINDOW == 77 (0x7f1176cc4800) [pid = 1950] [serial = 1739] [outer = 0x7f1176dad400]
11:41:17 INFO - ++DOCSHELL 0x7f1180e09800 == 16 [pid = 1950] [id = 722]
11:41:17 INFO - ++DOMWINDOW == 78 (0x7f1176de0c00) [pid = 1950] [serial = 1740] [outer = (nil)]
11:41:17 INFO - ++DOMWINDOW == 79 (0x7f1176eda400) [pid = 1950] [serial = 1741] [outer = 0x7f1176de0c00]
11:41:21 INFO - --DOCSHELL 0x7f1180e21800 == 15 [pid = 1950] [id = 716]
11:41:21 INFO - --DOCSHELL 0x7f11770ba800 == 14 [pid = 1950] [id = 714]
11:41:21 INFO - --DOCSHELL 0x7f117a612000 == 13 [pid = 1950] [id = 715]
11:41:25 INFO - --DOCSHELL 0x7f1180e09800 == 12 [pid = 1950] [id = 722]
11:41:27 INFO - --DOCSHELL 0x7f1176f6d000 == 11 [pid = 1950] [id = 721]
11:41:27 INFO - --DOMWINDOW == 78 (0x7f1176fac400) [pid = 1950] [serial = 1723] [outer = (nil)] [url = data:text/html;charset=utf8,test%20cached%20autocompletion%20results]
11:41:27 INFO - --DOMWINDOW == 77 (0x7f11812cdc00) [pid = 1950] [serial = 1683] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:27 INFO - --DOMWINDOW == 76 (0x7f1176fb5c00) [pid = 1950] [serial = 1725] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 75 (0x7f118242d000) [pid = 1950] [serial = 1685] [outer = (nil)] [url = chrome://devtools/content/styleeditor/styleeditor.xul]
11:41:27 INFO - --DOMWINDOW == 74 (0x7f11a649b800) [pid = 1950] [serial = 1716] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 73 (0x7f11a646f000) [pid = 1950] [serial = 1714] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20922212:%20%20Add%20console.dirxml]
11:41:27 INFO - --DOMWINDOW == 72 (0x7f1175194400) [pid = 1950] [serial = 1712] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 71 (0x7f117563b800) [pid = 1950] [serial = 1705] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 70 (0x7f11a63d0400) [pid = 1950] [serial = 1702] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html]
11:41:27 INFO - --DOMWINDOW == 69 (0x7f118db05000) [pid = 1950] [serial = 1700] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 68 (0x7f1185a9ac00) [pid = 1950] [serial = 1693] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20817834]
11:41:27 INFO - --DOMWINDOW == 67 (0x7f1175656800) [pid = 1950] [serial = 1721] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 66 (0x7f1177683000) [pid = 1950] [serial = 1691] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 65 (0x7f117738a400) [pid = 1950] [serial = 1677] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html]
11:41:27 INFO - --DOMWINDOW == 64 (0x7f1176ed6400) [pid = 1950] [serial = 1675] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 63 (0x7f1187fa4000) [pid = 1950] [serial = 1687] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:41:27 INFO - --DOMWINDOW == 62 (0x7f1185aad400) [pid = 1950] [serial = 1689] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:41:27 INFO - --DOMWINDOW == 61 (0x7f117563e000) [pid = 1950] [serial = 1707] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 60 (0x7f11776f2000) [pid = 1950] [serial = 1680] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 59 (0x7f11773f2400) [pid = 1950] [serial = 1728] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:27 INFO - --DOMWINDOW == 58 (0x7f1181492400) [pid = 1950] [serial = 1695] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 57 (0x7f11876f0c00) [pid = 1950] [serial = 1719] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:27 INFO - --DOMWINDOW == 56 (0x7f11a649a000) [pid = 1950] [serial = 1715] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 55 (0x7f1175641800) [pid = 1950] [serial = 1713] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 54 (0x7f117563cc00) [pid = 1950] [serial = 1706] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 53 (0x7f11a63d5400) [pid = 1950] [serial = 1703] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 52 (0x7f11a1feb800) [pid = 1950] [serial = 1701] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 51 (0x7f1185a9fc00) [pid = 1950] [serial = 1694] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 50 (0x7f1176ddc800) [pid = 1950] [serial = 1722] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 49 (0x7f1181d1a400) [pid = 1950] [serial = 1692] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 48 (0x7f1177398000) [pid = 1950] [serial = 1678] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 47 (0x7f1177128400) [pid = 1950] [serial = 1676] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 46 (0x7f1177132400) [pid = 1950] [serial = 1726] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 45 (0x7f1187fa8400) [pid = 1950] [serial = 1688] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:41:27 INFO - --DOMWINDOW == 44 (0x7f118148fc00) [pid = 1950] [serial = 1690] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:41:27 INFO - --DOMWINDOW == 43 (0x7f117565a800) [pid = 1950] [serial = 1733] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 42 (0x7f1176fb2000) [pid = 1950] [serial = 1724] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 41 (0x7f11812d1800) [pid = 1950] [serial = 1684] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 40 (0x7f1176ddd800) [pid = 1950] [serial = 1727] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 39 (0x7f118242fc00) [pid = 1950] [serial = 1686] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 38 (0x7f11a60b2400) [pid = 1950] [serial = 1718] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 37 (0x7f117712b400) [pid = 1950] [serial = 1682] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 36 (0x7f117563a800) [pid = 1950] [serial = 1709] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 35 (0x7f11876f3400) [pid = 1950] [serial = 1720] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 34 (0x7f1177678800) [pid = 1950] [serial = 1729] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOMWINDOW == 33 (0x7f118260b400) [pid = 1950] [serial = 1697] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:27 INFO - --DOMWINDOW == 32 (0x7f1175639400) [pid = 1950] [serial = 1704] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html]
11:41:27 INFO - --DOMWINDOW == 31 (0x7f1181eeb400) [pid = 1950] [serial = 1679] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html]
11:41:27 INFO - --DOMWINDOW == 30 (0x7f1176daf400) [pid = 1950] [serial = 1738] [outer = (nil)] [url = about:blank]
11:41:27 INFO - --DOCSHELL 0x7f117725f800 == 10 [pid = 1950] [id = 720]
11:41:27 INFO - MEMORY STAT | vsize 1295MB | residentFast 342MB | heapAllocated 127MB
11:41:27 INFO - 266 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js | took 12307ms
11:41:27 INFO - ++DOCSHELL 0x7f1176f2a000 == 11 [pid = 1950] [id = 723]
11:41:27 INFO - ++DOMWINDOW == 31 (0x7f1175636c00) [pid = 1950] [serial = 1742] [outer = (nil)]
11:41:27 INFO - ++DOMWINDOW == 32 (0x7f117563f800) [pid = 1950] [serial = 1743] [outer = 0x7f1175636c00]
11:41:28 INFO - 267 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js
11:41:28 INFO - ++DOCSHELL 0x7f117724f800 == 12 [pid = 1950] [id = 724]
11:41:28 INFO - ++DOMWINDOW == 33 (0x7f1175653000) [pid = 1950] [serial = 1744] [outer = (nil)]
11:41:28 INFO - ++DOMWINDOW == 34 (0x7f1175656800) [pid = 1950] [serial = 1745] [outer = 0x7f1175653000]
11:41:28 INFO - ++DOCSHELL 0x7f1176f6e800 == 13 [pid = 1950] [id = 725]
11:41:28 INFO - ++DOMWINDOW == 35 (0x7f117563d400) [pid = 1950] [serial = 1746] [outer = (nil)]
11:41:28 INFO - ++DOMWINDOW == 36 (0x7f1175643800) [pid = 1950] [serial = 1747] [outer = 0x7f117563d400]
11:41:28 INFO - ++DOMWINDOW == 37 (0x7f1175191400) [pid = 1950] [serial = 1748] [outer = 0x7f117563d400]
11:41:29 INFO - ++DOCSHELL 0x7f1176f13800 == 14 [pid = 1950] [id = 726]
11:41:29 INFO - ++DOMWINDOW == 38 (0x7f1176d80800) [pid = 1950] [serial = 1749] [outer = (nil)]
11:41:29 INFO - ++DOMWINDOW == 39 (0x7f1176d83c00) [pid = 1950] [serial = 1750] [outer = 0x7f1176d80800]
11:41:31 INFO - ++DOMWINDOW == 40 (0x7f117712fc00) [pid = 1950] [serial = 1751] [outer = 0x7f1175653000]
11:41:31 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:41:32 INFO - --DOCSHELL 0x7f1176f72800 == 13 [pid = 1950] [id = 718]
11:41:32 INFO - --DOCSHELL 0x7f11770c4800 == 12 [pid = 1950] [id = 719]
11:41:33 INFO - ++DOMWINDOW == 41 (0x7f1176d81c00) [pid = 1950] [serial = 1752] [outer = 0x7f1175653000]
11:41:33 INFO - [1950] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175
11:41:33 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:41:34 INFO - ++DOMWINDOW == 42 (0x7f1176fb8000) [pid = 1950] [serial = 1753] [outer = 0x7f1175653000]
11:41:34 INFO - [1950] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175
11:41:34 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:41:35 INFO - ++DOMWINDOW == 43 (0x7f117720a000) [pid = 1950] [serial = 1754] [outer = 0x7f1175653000]
11:41:35 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:41:36 INFO - --DOCSHELL 0x7f1176f13800 == 11 [pid = 1950] [id = 726]
11:41:37 INFO - --DOMWINDOW == 42 (0x7f1175191000) [pid = 1950] [serial = 1730] [outer = (nil)] [url = about:blank]
11:41:37 INFO - --DOMWINDOW == 41 (0x7f1176cca400) [pid = 1950] [serial = 1735] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html]
11:41:37 INFO - --DOMWINDOW == 40 (0x7f1175657800) [pid = 1950] [serial = 1732] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html]
11:41:37 INFO - --DOMWINDOW == 39 (0x7f1176eda400) [pid = 1950] [serial = 1741] [outer = (nil)] [url = about:blank]
11:41:37 INFO - --DOMWINDOW == 38 (0x7f1176cc4800) [pid = 1950] [serial = 1739] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:37 INFO - --DOMWINDOW == 37 (0x7f1175641c00) [pid = 1950] [serial = 1731] [outer = (nil)] [url = about:blank]
11:41:37 INFO - --DOMWINDOW == 36 (0x7f1176de0c00) [pid = 1950] [serial = 1740] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:37 INFO - --DOMWINDOW == 35 (0x7f1176dad400) [pid = 1950] [serial = 1737] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:37 INFO - --DOMWINDOW == 34 (0x7f1176ccfc00) [pid = 1950] [serial = 1736] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html]
11:41:37 INFO - --DOMWINDOW == 33 (0x7f11758ddc00) [pid = 1950] [serial = 1734] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html]
11:41:37 INFO - --DOMWINDOW == 32 (0x7f1175656800) [pid = 1950] [serial = 1745] [outer = (nil)] [url = about:blank]
11:41:37 INFO - --DOMWINDOW == 31 (0x7f1175643800) [pid = 1950] [serial = 1747] [outer = (nil)] [url = about:blank]
11:41:37 INFO - MEMORY STAT | vsize 1298MB | residentFast 337MB | heapAllocated 127MB
11:41:37 INFO - 268 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js | took 9928ms
11:41:37 INFO - ++DOCSHELL 0x7f1176f83800 == 12 [pid = 1950] [id = 727]
11:41:37 INFO - ++DOMWINDOW == 32 (0x7f1175650400) [pid = 1950] [serial = 1755] [outer = (nil)]
11:41:38 INFO - ++DOMWINDOW == 33 (0x7f1175656800) [pid = 1950] [serial = 1756] [outer = 0x7f1175650400]
11:41:38 INFO - 269 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_change_font_size.js
11:41:38 INFO - ++DOCSHELL 0x7f1177258000 == 13 [pid = 1950] [id = 728]
11:41:38 INFO - ++DOMWINDOW == 34 (0x7f11758d8c00) [pid = 1950] [serial = 1757] [outer = (nil)]
11:41:38 INFO - ++DOMWINDOW == 35 (0x7f11758dc800) [pid = 1950] [serial = 1758] [outer = 0x7f11758d8c00]
11:41:38 INFO - ++DOMWINDOW == 36 (0x7f1176cc6c00) [pid = 1950] [serial = 1759] [outer = 0x7f11758d8c00]
11:41:39 INFO - ++DOCSHELL 0x7f1176f7d000 == 14 [pid = 1950] [id = 729]
11:41:39 INFO - ++DOMWINDOW == 37 (0x7f117565e000) [pid = 1950] [serial = 1760] [outer = (nil)]
11:41:39 INFO - ++DOMWINDOW == 38 (0x7f11758db800) [pid = 1950] [serial = 1761] [outer = 0x7f117565e000]
11:41:43 INFO - MEMORY STAT | vsize 1300MB | residentFast 345MB | heapAllocated 138MB
11:41:43 INFO - 270 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_change_font_size.js | took 4831ms
11:41:43 INFO - ++DOCSHELL 0x7f117724e800 == 15 [pid = 1950] [id = 730]
11:41:43 INFO - ++DOMWINDOW == 39 (0x7f117565d000) [pid = 1950] [serial = 1762] [outer = (nil)]
11:41:43 INFO - ++DOMWINDOW == 40 (0x7f1176daec00) [pid = 1950] [serial = 1763] [outer = 0x7f117565d000]
11:41:43 INFO - 271 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_chrome.js
11:41:43 INFO - ++DOCSHELL 0x7f11773c4000 == 16 [pid = 1950] [id = 731]
11:41:43 INFO - ++DOMWINDOW == 41 (0x7f1176d79800) [pid = 1950] [serial = 1764] [outer = (nil)]
11:41:43 INFO - ++DOMWINDOW == 42 (0x7f1176d7dc00) [pid = 1950] [serial = 1765] [outer = 0x7f1176d79800]
11:41:43 INFO - ++DOMWINDOW == 43 (0x7f1187590c00) [pid = 1950] [serial = 1766] [outer = 0x7f1176d79800]
11:41:44 INFO - ++DOCSHELL 0x7f118150c000 == 17 [pid = 1950] [id = 732]
11:41:44 INFO - ++DOMWINDOW == 44 (0x7f118a034c00) [pid = 1950] [serial = 1767] [outer = (nil)]
11:41:44 INFO - ++DOMWINDOW == 45 (0x7f118a32a800) [pid = 1950] [serial = 1768] [outer = 0x7f118a034c00]
11:41:44 INFO - ++DOMWINDOW == 46 (0x7f118a3e2000) [pid = 1950] [serial = 1769] [outer = 0x7f118a034c00]
11:41:45 INFO - ++DOCSHELL 0x7f1182493800 == 18 [pid = 1950] [id = 733]
11:41:45 INFO - ++DOMWINDOW == 47 (0x7f118a91b400) [pid = 1950] [serial = 1770] [outer = (nil)]
11:41:45 INFO - ++DOMWINDOW == 48 (0x7f118a92c000) [pid = 1950] [serial = 1771] [outer = 0x7f118a91b400]
11:41:47 INFO - --DOCSHELL 0x7f117724f800 == 17 [pid = 1950] [id = 724]
11:41:47 INFO - --DOCSHELL 0x7f1176f6e800 == 16 [pid = 1950] [id = 725]
11:41:48 INFO - --DOCSHELL 0x7f1182493800 == 15 [pid = 1950] [id = 733]
11:41:49 INFO - --DOCSHELL 0x7f118150c000 == 14 [pid = 1950] [id = 732]
11:41:49 INFO - --DOCSHELL 0x7f1176f83800 == 13 [pid = 1950] [id = 727]
11:41:49 INFO - --DOCSHELL 0x7f1176f2a000 == 12 [pid = 1950] [id = 723]
11:41:49 INFO - --DOCSHELL 0x7f1177258000 == 11 [pid = 1950] [id = 728]
11:41:49 INFO - --DOCSHELL 0x7f1176f7d000 == 10 [pid = 1950] [id = 729]
11:41:50 INFO - --DOMWINDOW == 47 (0x7f1175653000) [pid = 1950] [serial = 1744] [outer = (nil)] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html]
11:41:50 INFO - --DOMWINDOW == 46 (0x7f117563d400) [pid = 1950] [serial = 1746] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:50 INFO - --DOMWINDOW == 45 (0x7f11758d8c00) [pid = 1950] [serial = 1757] [outer = (nil)] [url = http://example.com/]
11:41:50 INFO - --DOMWINDOW == 44 (0x7f11758dc800) [pid = 1950] [serial = 1758] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 43 (0x7f117565e000) [pid = 1950] [serial = 1760] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:50 INFO - --DOMWINDOW == 42 (0x7f118a91b400) [pid = 1950] [serial = 1770] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:50 INFO - --DOMWINDOW == 41 (0x7f1176cc6c00) [pid = 1950] [serial = 1759] [outer = (nil)] [url = http://example.com/]
11:41:50 INFO - --DOMWINDOW == 40 (0x7f118a32a800) [pid = 1950] [serial = 1768] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 39 (0x7f1176ccc000) [pid = 1950] [serial = 1224] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:50 INFO - --DOMWINDOW == 38 (0x7f1176d80800) [pid = 1950] [serial = 1749] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:41:50 INFO - --DOMWINDOW == 37 (0x7f1181ee6800) [pid = 1950] [serial = 1221] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:50 INFO - --DOMWINDOW == 36 (0x7f1175656800) [pid = 1950] [serial = 1756] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 35 (0x7f117563f800) [pid = 1950] [serial = 1743] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 34 (0x7f1175650400) [pid = 1950] [serial = 1755] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 33 (0x7f1175636c00) [pid = 1950] [serial = 1742] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 32 (0x7f1176d7dc00) [pid = 1950] [serial = 1765] [outer = (nil)] [url = about:blank]
11:41:50 INFO - --DOMWINDOW == 31 (0x7f117720a000) [pid = 1950] [serial = 1754] [outer = (nil)] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html]
11:41:50 INFO - --DOMWINDOW == 30 (0x7f117712fc00) [pid = 1950] [serial = 1751] [outer = (nil)] [url = https://sha1ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html]
11:41:50 INFO - --DOMWINDOW == 29 (0x7f1176d81c00) [pid = 1950] [serial = 1752] [outer = (nil)] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html]
11:41:50 INFO - --DOMWINDOW == 28 (0x7f1176fb8000) [pid = 1950] [serial = 1753] [outer = (nil)] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html?]
11:41:50 INFO - MEMORY STAT | vsize 1298MB | residentFast 342MB | heapAllocated 131MB
11:41:50 INFO - 272 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_chrome.js | took 7065ms
11:41:50 INFO - ++DOCSHELL 0x7f1176f27800 == 11 [pid = 1950] [id = 734]
11:41:50 INFO - ++DOMWINDOW == 29 (0x7f1175640000) [pid = 1950] [serial = 1772] [outer = (nil)]
11:41:50 INFO - ++DOMWINDOW == 30 (0x7f1175651800) [pid = 1950] [serial = 1773] [outer = 0x7f1175640000]
11:41:50 INFO - 273 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js
11:41:50 INFO - ++DOCSHELL 0x7f11773af800 == 12 [pid = 1950] [id = 735]
11:41:50 INFO - ++DOMWINDOW == 31 (0x7f1175185800) [pid = 1950] [serial = 1774] [outer = (nil)]
11:41:50 INFO - ++DOMWINDOW == 32 (0x7f11758da000) [pid = 1950] [serial = 1775] [outer = 0x7f1175185800]
11:41:51 INFO - ++DOCSHELL 0x7f1176f72000 == 13 [pid = 1950] [id = 736]
11:41:51 INFO - ++DOMWINDOW == 33 (0x7f11758dc400) [pid = 1950] [serial = 1776] [outer = (nil)]
11:41:51 INFO - ++DOMWINDOW == 34 (0x7f1176ccf000) [pid = 1950] [serial = 1777] [outer = 0x7f11758dc400]
11:41:51 INFO - ++DOMWINDOW == 35 (0x7f1176cc3000) [pid = 1950] [serial = 1778] [outer = 0x7f11758dc400]
11:41:51 INFO - ++DOCSHELL 0x7f1180e43000 == 14 [pid = 1950] [id = 737]
11:41:51 INFO - ++DOMWINDOW == 36 (0x7f1176dd4800) [pid = 1950] [serial = 1779] [outer = (nil)]
11:41:51 INFO - ++DOMWINDOW == 37 (0x7f1176dd7400) [pid = 1950] [serial = 1780] [outer = 0x7f1176dd4800]
11:41:54 INFO - ++DOCSHELL 0x7f1176f2a000 == 15 [pid = 1950] [id = 738]
11:41:54 INFO - ++DOMWINDOW == 38 (0x7f117563ac00) [pid = 1950] [serial = 1781] [outer = (nil)]
11:41:54 INFO - ++DOMWINDOW == 39 (0x7f1175657400) [pid = 1950] [serial = 1782] [outer = 0x7f117563ac00]
11:41:54 INFO - ++DOMWINDOW == 40 (0x7f1176cd0400) [pid = 1950] [serial = 1783] [outer = 0x7f117563ac00]
11:41:56 INFO - --DOCSHELL 0x7f117724e800 == 14 [pid = 1950] [id = 730]
11:41:56 INFO - --DOCSHELL 0x7f11773c4000 == 13 [pid = 1950] [id = 731]
11:41:56 INFO - --DOMWINDOW == 39 (0x7f11758db800) [pid = 1950] [serial = 1761] [outer = (nil)] [url = about:blank]
11:41:56 INFO - --DOMWINDOW == 38 (0x7f118a92c000) [pid = 1950] [serial = 1771] [outer = (nil)] [url = about:blank]
11:41:56 INFO - --DOMWINDOW == 37 (0x7f1176d83c00) [pid = 1950] [serial = 1750] [outer = (nil)] [url = about:blank]
11:41:56 INFO - --DOMWINDOW == 36 (0x7f1175191400) [pid = 1950] [serial = 1748] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:56 INFO - --DOMWINDOW == 35 (0x7f1185aa8000) [pid = 1950] [serial = 1225] [outer = (nil)] [url = about:blank]
11:41:56 INFO - --DOMWINDOW == 34 (0x7f1182844800) [pid = 1950] [serial = 1223] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:41:56 INFO - ++DOCSHELL 0x7f11770b9800 == 14 [pid = 1950] [id = 739]
11:41:56 INFO - ++DOMWINDOW == 35 (0x7f117565d400) [pid = 1950] [serial = 1784] [outer = (nil)]
11:41:56 INFO - ++DOMWINDOW == 36 (0x7f11758db000) [pid = 1950] [serial = 1785] [outer = 0x7f117565d400]
11:41:57 INFO - ++DOMWINDOW == 37 (0x7f1176cc9000) [pid = 1950] [serial = 1786] [outer = 0x7f117565d400]
11:41:59 INFO - --DOCSHELL 0x7f1176f2a000 == 13 [pid = 1950] [id = 738]
11:41:59 INFO - ++DOCSHELL 0x7f1177257800 == 14 [pid = 1950] [id = 740]
11:41:59 INFO - ++DOMWINDOW == 38 (0x7f11758d9c00) [pid = 1950] [serial = 1787] [outer = (nil)]
11:41:59 INFO - ++DOMWINDOW == 39 (0x7f11758e1c00) [pid = 1950] [serial = 1788] [outer = 0x7f11758d9c00]
11:42:00 INFO - ++DOMWINDOW == 40 (0x7f1176ccbc00) [pid = 1950] [serial = 1789] [outer = 0x7f11758d9c00]
11:42:02 INFO - ++DOCSHELL 0x7f1180e4f800 == 15 [pid = 1950] [id = 741]
11:42:02 INFO - ++DOMWINDOW == 41 (0x7f1176dd5c00) [pid = 1950] [serial = 1790] [outer = (nil)]
11:42:02 INFO - ++DOMWINDOW == 42 (0x7f1176edc000) [pid = 1950] [serial = 1791] [outer = 0x7f1176dd5c00]
11:42:02 INFO - --DOMWINDOW == 41 (0x7f1176cc9000) [pid = 1950] [serial = 1786] [outer = (nil)] [url = https://example.com/]
11:42:02 INFO - --DOMWINDOW == 40 (0x7f11758db000) [pid = 1950] [serial = 1785] [outer = (nil)] [url = about:blank]
11:42:02 INFO - --DOMWINDOW == 39 (0x7f118a034c00) [pid = 1950] [serial = 1767] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:02 INFO - --DOMWINDOW == 38 (0x7f1176d79800) [pid = 1950] [serial = 1764] [outer = (nil)] [url = about:config]
11:42:02 INFO - --DOMWINDOW == 37 (0x7f117565d000) [pid = 1950] [serial = 1762] [outer = (nil)] [url = about:blank]
11:42:02 INFO - --DOMWINDOW == 36 (0x7f117563ac00) [pid = 1950] [serial = 1781] [outer = (nil)] [url = http://example.com/]
11:42:02 INFO - --DOMWINDOW == 35 (0x7f117565d400) [pid = 1950] [serial = 1784] [outer = (nil)] [url = https://example.com/]
11:42:02 INFO - --DOMWINDOW == 34 (0x7f1176daec00) [pid = 1950] [serial = 1763] [outer = (nil)] [url = about:blank]
11:42:02 INFO - --DOMWINDOW == 33 (0x7f1176ccf000) [pid = 1950] [serial = 1777] [outer = (nil)] [url = about:blank]
11:42:02 INFO - --DOMWINDOW == 32 (0x7f1176cd0400) [pid = 1950] [serial = 1783] [outer = (nil)] [url = http://example.com/]
11:42:02 INFO - --DOMWINDOW == 31 (0x7f1175657400) [pid = 1950] [serial = 1782] [outer = (nil)] [url = about:blank]
11:42:02 INFO - ++DOMWINDOW == 32 (0x7f1176fb6400) [pid = 1950] [serial = 1792] [outer = 0x7f1176dd5c00]
11:42:03 INFO - ++DOCSHELL 0x7f11810c8000 == 16 [pid = 1950] [id = 742]
11:42:03 INFO - ++DOMWINDOW == 33 (0x7f1176fb5800) [pid = 1950] [serial = 1793] [outer = (nil)]
11:42:03 INFO - ++DOMWINDOW == 34 (0x7f117712a800) [pid = 1950] [serial = 1794] [outer = 0x7f1176fb5800]
11:42:04 INFO - ++DOMWINDOW == 35 (0x7f1177129800) [pid = 1950] [serial = 1795] [outer = 0x7f1176fb5800]
11:42:05 INFO - --DOCSHELL 0x7f11770b9800 == 15 [pid = 1950] [id = 739]
11:42:05 INFO - --DOCSHELL 0x7f1177257800 == 14 [pid = 1950] [id = 740]
11:42:05 INFO - --DOCSHELL 0x7f1180e4f800 == 13 [pid = 1950] [id = 741]
11:42:05 INFO - --DOMWINDOW == 34 (0x7f1187590c00) [pid = 1950] [serial = 1766] [outer = (nil)] [url = about:config]
11:42:05 INFO - --DOMWINDOW == 33 (0x7f118a3e2000) [pid = 1950] [serial = 1769] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:06 INFO - --DOCSHELL 0x7f11810c8000 == 12 [pid = 1950] [id = 742]
11:42:06 INFO - ++DOCSHELL 0x7f1177243000 == 13 [pid = 1950] [id = 743]
11:42:06 INFO - ++DOMWINDOW == 34 (0x7f1175659c00) [pid = 1950] [serial = 1796] [outer = (nil)]
11:42:06 INFO - ++DOMWINDOW == 35 (0x7f117565e000) [pid = 1950] [serial = 1797] [outer = 0x7f1175659c00]
11:42:07 INFO - ++DOMWINDOW == 36 (0x7f11758e4400) [pid = 1950] [serial = 1798] [outer = 0x7f1175659c00]
11:42:08 INFO - ++DOCSHELL 0x7f1180e39000 == 14 [pid = 1950] [id = 744]
11:42:08 INFO - ++DOMWINDOW == 37 (0x7f1176db7000) [pid = 1950] [serial = 1799] [outer = (nil)]
11:42:08 INFO - ++DOMWINDOW == 38 (0x7f1176ddc000) [pid = 1950] [serial = 1800] [outer = 0x7f1176db7000]
11:42:08 INFO - ++DOMWINDOW == 39 (0x7f1176dd1000) [pid = 1950] [serial = 1801] [outer = 0x7f1176db7000]
11:42:10 INFO - ++DOCSHELL 0x7f1181510800 == 15 [pid = 1950] [id = 745]
11:42:10 INFO - ++DOMWINDOW == 40 (0x7f11773e3c00) [pid = 1950] [serial = 1802] [outer = (nil)]
11:42:10 INFO - ++DOMWINDOW == 41 (0x7f11773eb800) [pid = 1950] [serial = 1803] [outer = 0x7f11773e3c00]
11:42:11 INFO - ++DOMWINDOW == 42 (0x7f117712b800) [pid = 1950] [serial = 1804] [outer = 0x7f11773e3c00]
11:42:11 INFO - ++DOCSHELL 0x7f11826c8800 == 16 [pid = 1950] [id = 746]
11:42:11 INFO - ++DOMWINDOW == 43 (0x7f117720a000) [pid = 1950] [serial = 1805] [outer = (nil)]
11:42:11 INFO - ++DOMWINDOW == 44 (0x7f11773eb000) [pid = 1950] [serial = 1806] [outer = 0x7f117720a000]
11:42:12 INFO - ++DOMWINDOW == 45 (0x7f117767a800) [pid = 1950] [serial = 1807] [outer = 0x7f117720a000]
11:42:13 INFO - --DOCSHELL 0x7f1180e43000 == 15 [pid = 1950] [id = 737]
11:42:14 INFO - --DOCSHELL 0x7f1176f72000 == 14 [pid = 1950] [id = 736]
11:42:14 INFO - --DOMWINDOW == 44 (0x7f1176fb6400) [pid = 1950] [serial = 1792] [outer = (nil)] [url = http://example.com/foo]
11:42:14 INFO - --DOMWINDOW == 43 (0x7f1176edc000) [pid = 1950] [serial = 1791] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 42 (0x7f1176ccbc00) [pid = 1950] [serial = 1789] [outer = (nil)] [url = https://example.com/]
11:42:14 INFO - --DOMWINDOW == 41 (0x7f11758e1c00) [pid = 1950] [serial = 1788] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 40 (0x7f1176fb5800) [pid = 1950] [serial = 1793] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 39 (0x7f117712a800) [pid = 1950] [serial = 1794] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 38 (0x7f1177129800) [pid = 1950] [serial = 1795] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 37 (0x7f1176dd5c00) [pid = 1950] [serial = 1790] [outer = (nil)] [url = http://example.com/foo]
11:42:14 INFO - --DOMWINDOW == 36 (0x7f11758d9c00) [pid = 1950] [serial = 1787] [outer = (nil)] [url = https://example.com/]
11:42:14 INFO - --DOMWINDOW == 35 (0x7f117565e000) [pid = 1950] [serial = 1797] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 34 (0x7f11758e4400) [pid = 1950] [serial = 1798] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 33 (0x7f1176ddc000) [pid = 1950] [serial = 1800] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 32 (0x7f1176dd1000) [pid = 1950] [serial = 1801] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 31 (0x7f11773eb800) [pid = 1950] [serial = 1803] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 30 (0x7f117712b800) [pid = 1950] [serial = 1804] [outer = (nil)] [url = http://example.com/abcdefghijabcdefghij]
11:42:14 INFO - --DOMWINDOW == 29 (0x7f11773eb000) [pid = 1950] [serial = 1806] [outer = (nil)] [url = about:blank]
11:42:14 INFO - --DOMWINDOW == 28 (0x7f117767a800) [pid = 1950] [serial = 1807] [outer = (nil)] [url = http://example.com/abcdefghijabcdefghij]
11:42:14 INFO - --DOMWINDOW == 27 (0x7f1175659c00) [pid = 1950] [serial = 1796] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 26 (0x7f1176db7000) [pid = 1950] [serial = 1799] [outer = (nil)] [url = http://example.com/]
11:42:14 INFO - --DOMWINDOW == 25 (0x7f11773e3c00) [pid = 1950] [serial = 1802] [outer = (nil)] [url = http://example.com/abcdefghijabcdefghij]
11:42:14 INFO - --DOMWINDOW == 24 (0x7f117720a000) [pid = 1950] [serial = 1805] [outer = (nil)] [url = http://example.com/abcdefghijabcdefghij]
11:42:14 INFO - MEMORY STAT | vsize 1298MB | residentFast 338MB | heapAllocated 128MB
11:42:14 INFO - 274 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js | took 24217ms
11:42:14 INFO - ++DOCSHELL 0x7f11770bb000 == 15 [pid = 1950] [id = 747]
11:42:14 INFO - ++DOMWINDOW == 25 (0x7f117563e800) [pid = 1950] [serial = 1808] [outer = (nil)]
11:42:14 INFO - ++DOMWINDOW == 26 (0x7f117564fc00) [pid = 1950] [serial = 1809] [outer = 0x7f117563e800]
11:42:15 INFO - 275 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js
11:42:15 INFO - ++DOCSHELL 0x7f11773b6800 == 16 [pid = 1950] [id = 748]
11:42:15 INFO - ++DOMWINDOW == 27 (0x7f1175659800) [pid = 1950] [serial = 1810] [outer = (nil)]
11:42:15 INFO - ++DOMWINDOW == 28 (0x7f117565d800) [pid = 1950] [serial = 1811] [outer = 0x7f1175659800]
11:42:15 INFO - ++DOMWINDOW == 29 (0x7f11758dd800) [pid = 1950] [serial = 1812] [outer = 0x7f1175659800]
11:42:15 INFO - ++DOCSHELL 0x7f11770b8000 == 17 [pid = 1950] [id = 749]
11:42:15 INFO - ++DOMWINDOW == 30 (0x7f1176ccd800) [pid = 1950] [serial = 1813] [outer = (nil)]
11:42:15 INFO - ++DOMWINDOW == 31 (0x7f1176cce400) [pid = 1950] [serial = 1814] [outer = 0x7f1176ccd800]
11:42:15 INFO - ++DOMWINDOW == 32 (0x7f11758e3800) [pid = 1950] [serial = 1815] [outer = 0x7f1176ccd800]
11:42:16 INFO - ++DOCSHELL 0x7f1180f6f000 == 18 [pid = 1950] [id = 750]
11:42:16 INFO - ++DOMWINDOW == 33 (0x7f1176dd1000) [pid = 1950] [serial = 1816] [outer = (nil)]
11:42:16 INFO - ++DOMWINDOW == 34 (0x7f1176dd4400) [pid = 1950] [serial = 1817] [outer = 0x7f1176dd1000]
11:42:18 INFO - ++DOCSHELL 0x7f11773ab800 == 19 [pid = 1950] [id = 751]
11:42:18 INFO - ++DOMWINDOW == 35 (0x7f1175644000) [pid = 1950] [serial = 1818] [outer = (nil)]
11:42:18 INFO - ++DOMWINDOW == 36 (0x7f11758dd000) [pid = 1950] [serial = 1819] [outer = 0x7f1175644000]
11:42:18 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:42:19 INFO - ++DOCSHELL 0x7f117a61d800 == 20 [pid = 1950] [id = 752]
11:42:19 INFO - ++DOMWINDOW == 37 (0x7f11812d9800) [pid = 1950] [serial = 1820] [outer = (nil)]
11:42:19 INFO - ++DOMWINDOW == 38 (0x7f11758dfc00) [pid = 1950] [serial = 1821] [outer = 0x7f11812d9800]
11:42:21 INFO - --DOCSHELL 0x7f1177243000 == 19 [pid = 1950] [id = 743]
11:42:21 INFO - --DOCSHELL 0x7f1181510800 == 18 [pid = 1950] [id = 745]
11:42:21 INFO - --DOCSHELL 0x7f1180e39000 == 17 [pid = 1950] [id = 744]
11:42:21 INFO - --DOCSHELL 0x7f11826c8800 == 16 [pid = 1950] [id = 746]
11:42:21 INFO - --DOCSHELL 0x7f11773af800 == 15 [pid = 1950] [id = 735]
11:42:21 INFO - --DOCSHELL 0x7f1176f27800 == 14 [pid = 1950] [id = 734]
11:42:23 INFO - ++DOCSHELL 0x7f1182795800 == 15 [pid = 1950] [id = 753]
11:42:23 INFO - ++DOMWINDOW == 39 (0x7f1181499800) [pid = 1950] [serial = 1822] [outer = (nil)]
11:42:23 INFO - ++DOMWINDOW == 40 (0x7f1181497000) [pid = 1950] [serial = 1823] [outer = 0x7f1181499800]
11:42:24 INFO - [1950] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 174
11:42:24 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 278
11:42:25 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js, line 3125: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:42:31 INFO - --DOCSHELL 0x7f117a61d800 == 14 [pid = 1950] [id = 752]
11:42:31 INFO - --DOCSHELL 0x7f11773ab800 == 13 [pid = 1950] [id = 751]
11:42:31 INFO - --DOCSHELL 0x7f1180f6f000 == 12 [pid = 1950] [id = 750]
11:42:35 INFO - --DOCSHELL 0x7f1182795800 == 11 [pid = 1950] [id = 753]
11:42:35 INFO - --DOMWINDOW == 39 (0x7f1176dd7400) [pid = 1950] [serial = 1780] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 38 (0x7f11758dc400) [pid = 1950] [serial = 1776] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:35 INFO - --DOMWINDOW == 37 (0x7f1175640000) [pid = 1950] [serial = 1772] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 36 (0x7f1176dd4800) [pid = 1950] [serial = 1779] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:42:35 INFO - --DOMWINDOW == 35 (0x7f1175185800) [pid = 1950] [serial = 1774] [outer = (nil)] [url = data:text/html;charset=utf8,Bug%201005909%20-%20Clickable%20URLS]
11:42:35 INFO - --DOMWINDOW == 34 (0x7f1176cce400) [pid = 1950] [serial = 1814] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 33 (0x7f117565d800) [pid = 1950] [serial = 1811] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 32 (0x7f11758da000) [pid = 1950] [serial = 1775] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 31 (0x7f1176cc3000) [pid = 1950] [serial = 1778] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:35 INFO - --DOMWINDOW == 30 (0x7f1175651800) [pid = 1950] [serial = 1773] [outer = (nil)] [url = about:blank]
11:42:35 INFO - --DOMWINDOW == 29 (0x7f11812d9800) [pid = 1950] [serial = 1820] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:42:35 INFO - MEMORY STAT | vsize 1296MB | residentFast 358MB | heapAllocated 144MB
11:42:35 INFO - 276 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js | took 20699ms
11:42:35 INFO - ++DOCSHELL 0x7f1176f7b800 == 12 [pid = 1950] [id = 754]
11:42:35 INFO - ++DOMWINDOW == 30 (0x7f117565ec00) [pid = 1950] [serial = 1824] [outer = (nil)]
11:42:35 INFO - ++DOMWINDOW == 31 (0x7f11758de800) [pid = 1950] [serial = 1825] [outer = 0x7f117565ec00]
11:42:36 INFO - 277 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_column_numbers.js
11:42:36 INFO - ++DOCSHELL 0x7f11773bb000 == 13 [pid = 1950] [id = 755]
11:42:36 INFO - ++DOMWINDOW == 32 (0x7f1176ccf000) [pid = 1950] [serial = 1826] [outer = (nil)]
11:42:36 INFO - ++DOMWINDOW == 33 (0x7f1176d7a400) [pid = 1950] [serial = 1827] [outer = 0x7f1176ccf000]
11:42:36 INFO - ++DOMWINDOW == 34 (0x7f1181491800) [pid = 1950] [serial = 1828] [outer = 0x7f1176ccf000]
11:42:36 INFO - ++DOCSHELL 0x7f1180e22000 == 14 [pid = 1950] [id = 756]
11:42:36 INFO - ++DOMWINDOW == 35 (0x7f1176d7b800) [pid = 1950] [serial = 1829] [outer = (nil)]
11:42:36 INFO - ++DOMWINDOW == 36 (0x7f1176dd3800) [pid = 1950] [serial = 1830] [outer = 0x7f1176d7b800]
11:42:36 INFO - ++DOMWINDOW == 37 (0x7f1176dad000) [pid = 1950] [serial = 1831] [outer = 0x7f1176d7b800]
11:42:37 INFO - ++DOCSHELL 0x7f1180f75800 == 15 [pid = 1950] [id = 757]
11:42:37 INFO - ++DOMWINDOW == 38 (0x7f1176ee0c00) [pid = 1950] [serial = 1832] [outer = (nil)]
11:42:37 INFO - ++DOMWINDOW == 39 (0x7f1176faf400) [pid = 1950] [serial = 1833] [outer = 0x7f1176ee0c00]
11:42:40 INFO - --DOCSHELL 0x7f11770b8000 == 14 [pid = 1950] [id = 749]
11:42:40 INFO - --DOCSHELL 0x7f11773b6800 == 13 [pid = 1950] [id = 748]
11:42:40 INFO - --DOCSHELL 0x7f11770bb000 == 12 [pid = 1950] [id = 747]
11:42:40 INFO - --DOCSHELL 0x7f1180f75800 == 11 [pid = 1950] [id = 757]
11:42:41 INFO - --DOMWINDOW == 38 (0x7f11758dfc00) [pid = 1950] [serial = 1821] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:42:41 INFO - --DOMWINDOW == 37 (0x7f1181499800) [pid = 1950] [serial = 1822] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:42:41 INFO - --DOMWINDOW == 36 (0x7f117564fc00) [pid = 1950] [serial = 1809] [outer = (nil)] [url = about:blank]
11:42:41 INFO - --DOMWINDOW == 35 (0x7f117563e800) [pid = 1950] [serial = 1808] [outer = (nil)] [url = about:blank]
11:42:41 INFO - --DOMWINDOW == 34 (0x7f1176dd3800) [pid = 1950] [serial = 1830] [outer = (nil)] [url = about:blank]
11:42:41 INFO - --DOMWINDOW == 33 (0x7f1175659800) [pid = 1950] [serial = 1810] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html]
11:42:41 INFO - --DOMWINDOW == 32 (0x7f1176d7a400) [pid = 1950] [serial = 1827] [outer = (nil)] [url = about:blank]
11:42:41 INFO - --DOMWINDOW == 31 (0x7f1175644000) [pid = 1950] [serial = 1818] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:42:41 INFO - --DOMWINDOW == 30 (0x7f1176ccd800) [pid = 1950] [serial = 1813] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:41 INFO - --DOMWINDOW == 29 (0x7f1176dd1000) [pid = 1950] [serial = 1816] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:42:42 INFO - MEMORY STAT | vsize 1297MB | residentFast 350MB | heapAllocated 138MB
11:42:42 INFO - 278 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_column_numbers.js | took 5936ms
11:42:42 INFO - ++DOCSHELL 0x7f11770b6800 == 12 [pid = 1950] [id = 758]
11:42:42 INFO - ++DOMWINDOW == 30 (0x7f1175659800) [pid = 1950] [serial = 1834] [outer = (nil)]
11:42:42 INFO - ++DOMWINDOW == 31 (0x7f11758dbc00) [pid = 1950] [serial = 1835] [outer = 0x7f1175659800]
11:42:42 INFO - 279 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_completion.js
11:42:42 INFO - ++DOCSHELL 0x7f117a60e800 == 13 [pid = 1950] [id = 759]
11:42:42 INFO - ++DOMWINDOW == 32 (0x7f1176cc7000) [pid = 1950] [serial = 1836] [outer = (nil)]
11:42:42 INFO - ++DOMWINDOW == 33 (0x7f1176ccbc00) [pid = 1950] [serial = 1837] [outer = 0x7f1176cc7000]
11:42:42 INFO - ++DOCSHELL 0x7f1177254800 == 14 [pid = 1950] [id = 760]
11:42:42 INFO - ++DOMWINDOW == 34 (0x7f1176dac800) [pid = 1950] [serial = 1838] [outer = (nil)]
11:42:42 INFO - ++DOMWINDOW == 35 (0x7f1176daf400) [pid = 1950] [serial = 1839] [outer = 0x7f1176dac800]
11:42:43 INFO - ++DOMWINDOW == 36 (0x7f1176d81000) [pid = 1950] [serial = 1840] [outer = 0x7f1176dac800]
11:42:43 INFO - ++DOCSHELL 0x7f1180f75000 == 15 [pid = 1950] [id = 761]
11:42:43 INFO - ++DOMWINDOW == 37 (0x7f1176ed5c00) [pid = 1950] [serial = 1841] [outer = (nil)]
11:42:43 INFO - ++DOMWINDOW == 38 (0x7f1176ed9c00) [pid = 1950] [serial = 1842] [outer = 0x7f1176ed5c00]
11:42:46 INFO - --DOCSHELL 0x7f1180e22000 == 14 [pid = 1950] [id = 756]
11:42:46 INFO - --DOCSHELL 0x7f11773bb000 == 13 [pid = 1950] [id = 755]
11:42:46 INFO - --DOCSHELL 0x7f1176f7b800 == 12 [pid = 1950] [id = 754]
11:42:46 INFO - --DOMWINDOW == 37 (0x7f11758dd800) [pid = 1950] [serial = 1812] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html]
11:42:46 INFO - --DOMWINDOW == 36 (0x7f11758dd000) [pid = 1950] [serial = 1819] [outer = (nil)] [url = about:blank]
11:42:46 INFO - --DOMWINDOW == 35 (0x7f1176dd4400) [pid = 1950] [serial = 1817] [outer = (nil)] [url = about:blank]
11:42:46 INFO - --DOMWINDOW == 34 (0x7f11758e3800) [pid = 1950] [serial = 1815] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:46 INFO - --DOMWINDOW == 33 (0x7f1181497000) [pid = 1950] [serial = 1823] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:42:47 INFO - --DOCSHELL 0x7f1180f75000 == 11 [pid = 1950] [id = 761]
11:42:47 INFO - MEMORY STAT | vsize 1295MB | residentFast 346MB | heapAllocated 132MB
11:42:47 INFO - 280 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_completion.js | took 5194ms
11:42:47 INFO - ++DOCSHELL 0x7f11770c8800 == 12 [pid = 1950] [id = 762]
11:42:47 INFO - ++DOMWINDOW == 34 (0x7f1176cc3000) [pid = 1950] [serial = 1843] [outer = (nil)]
11:42:47 INFO - ++DOMWINDOW == 35 (0x7f1176cd0000) [pid = 1950] [serial = 1844] [outer = 0x7f1176cc3000]
11:42:47 INFO - 281 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js
11:42:48 INFO - ++DOCSHELL 0x7f1180e1a000 == 13 [pid = 1950] [id = 763]
11:42:48 INFO - ++DOMWINDOW == 36 (0x7f1176d7f400) [pid = 1950] [serial = 1845] [outer = (nil)]
11:42:48 INFO - ++DOMWINDOW == 37 (0x7f1176d88800) [pid = 1950] [serial = 1846] [outer = 0x7f1176d7f400]
11:42:48 INFO - ++DOMWINDOW == 38 (0x7f1176fb6c00) [pid = 1950] [serial = 1847] [outer = 0x7f1176d7f400]
11:42:48 INFO - ++DOCSHELL 0x7f1177252000 == 14 [pid = 1950] [id = 764]
11:42:48 INFO - ++DOMWINDOW == 39 (0x7f1176daec00) [pid = 1950] [serial = 1848] [outer = (nil)]
11:42:48 INFO - ++DOMWINDOW == 40 (0x7f1176dd9400) [pid = 1950] [serial = 1849] [outer = 0x7f1176daec00]
11:42:48 INFO - ++DOMWINDOW == 41 (0x7f1176dca800) [pid = 1950] [serial = 1850] [outer = 0x7f1176daec00]
11:42:49 INFO - ++DOCSHELL 0x7f11810c8800 == 15 [pid = 1950] [id = 765]
11:42:49 INFO - ++DOMWINDOW == 42 (0x7f1177125400) [pid = 1950] [serial = 1851] [outer = (nil)]
11:42:49 INFO - ++DOMWINDOW == 43 (0x7f1177128400) [pid = 1950] [serial = 1852] [outer = 0x7f1177125400]
11:42:50 INFO - --DOMWINDOW == 42 (0x7f11758de800) [pid = 1950] [serial = 1825] [outer = (nil)] [url = about:blank]
11:42:50 INFO - --DOMWINDOW == 41 (0x7f1176daf400) [pid = 1950] [serial = 1839] [outer = (nil)] [url = about:blank]
11:42:50 INFO - --DOMWINDOW == 40 (0x7f1176ee0c00) [pid = 1950] [serial = 1832] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:42:50 INFO - --DOMWINDOW == 39 (0x7f1176d7b800) [pid = 1950] [serial = 1829] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:50 INFO - --DOMWINDOW == 38 (0x7f1176ccf000) [pid = 1950] [serial = 1826] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html]
11:42:50 INFO - --DOMWINDOW == 37 (0x7f117565ec00) [pid = 1950] [serial = 1824] [outer = (nil)] [url = about:blank]
11:42:50 INFO - --DOMWINDOW == 36 (0x7f1181491800) [pid = 1950] [serial = 1828] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html]
11:42:52 INFO - --DOCSHELL 0x7f1177254800 == 14 [pid = 1950] [id = 760]
11:42:52 INFO - --DOCSHELL 0x7f11770b6800 == 13 [pid = 1950] [id = 758]
11:42:52 INFO - --DOCSHELL 0x7f1177252000 == 12 [pid = 1950] [id = 764]
11:42:52 INFO - --DOCSHELL 0x7f11810c8800 == 11 [pid = 1950] [id = 765]
11:42:52 INFO - --DOCSHELL 0x7f117a60e800 == 10 [pid = 1950] [id = 759]
11:42:52 INFO - --DOMWINDOW == 35 (0x7f1176faf400) [pid = 1950] [serial = 1833] [outer = (nil)] [url = about:blank]
11:42:52 INFO - --DOMWINDOW == 34 (0x7f1176dad000) [pid = 1950] [serial = 1831] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:52 INFO - --DOMWINDOW == 33 (0x7f1176d88800) [pid = 1950] [serial = 1846] [outer = (nil)] [url = about:blank]
11:42:52 INFO - --DOMWINDOW == 32 (0x7f1176ccbc00) [pid = 1950] [serial = 1837] [outer = (nil)] [url = about:blank]
11:42:52 INFO - --DOMWINDOW == 31 (0x7f11758dbc00) [pid = 1950] [serial = 1835] [outer = (nil)] [url = about:blank]
11:42:52 INFO - --DOMWINDOW == 30 (0x7f1176dd9400) [pid = 1950] [serial = 1849] [outer = (nil)] [url = about:blank]
11:42:52 INFO - --DOMWINDOW == 29 (0x7f1176ed5c00) [pid = 1950] [serial = 1841] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:42:52 INFO - --DOMWINDOW == 28 (0x7f1176dac800) [pid = 1950] [serial = 1838] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:52 INFO - --DOMWINDOW == 27 (0x7f1176cc7000) [pid = 1950] [serial = 1836] [outer = (nil)] [url = data:text/html;charset=utf8,test%20code%20completion]
11:42:52 INFO - --DOMWINDOW == 26 (0x7f1175659800) [pid = 1950] [serial = 1834] [outer = (nil)] [url = about:blank]
11:42:53 INFO - MEMORY STAT | vsize 1293MB | residentFast 335MB | heapAllocated 128MB
11:42:53 INFO - 282 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js | took 5104ms
11:42:53 INFO - ++DOCSHELL 0x7f1176f72800 == 11 [pid = 1950] [id = 766]
11:42:53 INFO - ++DOMWINDOW == 27 (0x7f1175643800) [pid = 1950] [serial = 1853] [outer = (nil)]
11:42:53 INFO - ++DOMWINDOW == 28 (0x7f1175652800) [pid = 1950] [serial = 1854] [outer = 0x7f1175643800]
11:42:53 INFO - 283 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js
11:42:53 INFO - ++DOCSHELL 0x7f1177258000 == 12 [pid = 1950] [id = 767]
11:42:53 INFO - ++DOMWINDOW == 29 (0x7f117565c800) [pid = 1950] [serial = 1855] [outer = (nil)]
11:42:53 INFO - ++DOMWINDOW == 30 (0x7f11758d7000) [pid = 1950] [serial = 1856] [outer = 0x7f117565c800]
11:42:53 INFO - ++DOCSHELL 0x7f1176f28000 == 13 [pid = 1950] [id = 768]
11:42:53 INFO - ++DOMWINDOW == 31 (0x7f11758d8000) [pid = 1950] [serial = 1857] [outer = (nil)]
11:42:53 INFO - ++DOMWINDOW == 32 (0x7f1176cc7000) [pid = 1950] [serial = 1858] [outer = 0x7f11758d8000]
11:42:53 INFO - ++DOMWINDOW == 33 (0x7f11758e4800) [pid = 1950] [serial = 1859] [outer = 0x7f11758d8000]
11:42:54 INFO - ++DOCSHELL 0x7f1180e4e000 == 14 [pid = 1950] [id = 769]
11:42:54 INFO - ++DOMWINDOW == 34 (0x7f1176dd0000) [pid = 1950] [serial = 1860] [outer = (nil)]
11:42:54 INFO - ++DOMWINDOW == 35 (0x7f1176dd3000) [pid = 1950] [serial = 1861] [outer = 0x7f1176dd0000]
11:42:57 INFO - --DOCSHELL 0x7f1180e1a000 == 13 [pid = 1950] [id = 763]
11:42:57 INFO - --DOCSHELL 0x7f1180e4e000 == 12 [pid = 1950] [id = 769]
11:42:57 INFO - --DOCSHELL 0x7f11770c8800 == 11 [pid = 1950] [id = 762]
11:42:57 INFO - --DOCSHELL 0x7f1176f28000 == 10 [pid = 1950] [id = 768]
11:42:57 INFO - --DOMWINDOW == 34 (0x7f1176ed9c00) [pid = 1950] [serial = 1842] [outer = (nil)] [url = about:blank]
11:42:57 INFO - --DOMWINDOW == 33 (0x7f1176d81000) [pid = 1950] [serial = 1840] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:57 INFO - --DOMWINDOW == 32 (0x7f1176cc7000) [pid = 1950] [serial = 1858] [outer = (nil)] [url = about:blank]
11:42:57 INFO - --DOMWINDOW == 31 (0x7f1176cd0000) [pid = 1950] [serial = 1844] [outer = (nil)] [url = about:blank]
11:42:57 INFO - --DOMWINDOW == 30 (0x7f1177125400) [pid = 1950] [serial = 1851] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:42:57 INFO - --DOMWINDOW == 29 (0x7f1176daec00) [pid = 1950] [serial = 1848] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:42:57 INFO - --DOMWINDOW == 28 (0x7f1176d7f400) [pid = 1950] [serial = 1845] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html]
11:42:57 INFO - --DOMWINDOW == 27 (0x7f1176cc3000) [pid = 1950] [serial = 1843] [outer = (nil)] [url = about:blank]
11:42:58 INFO - --DOMWINDOW == 26 (0x7f1176fb6c00) [pid = 1950] [serial = 1847] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html]
11:42:58 INFO - MEMORY STAT | vsize 1293MB | residentFast 333MB | heapAllocated 128MB
11:42:58 INFO - 284 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js | took 4953ms
11:42:58 INFO - ++DOCSHELL 0x7f1176f76000 == 11 [pid = 1950] [id = 770]
11:42:58 INFO - ++DOMWINDOW == 27 (0x7f117564f400) [pid = 1950] [serial = 1862] [outer = (nil)]
11:42:58 INFO - ++DOMWINDOW == 28 (0x7f117565ac00) [pid = 1950] [serial = 1863] [outer = 0x7f117564f400]
11:42:58 INFO - 285 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_extras.js
11:42:58 INFO - ++DOCSHELL 0x7f1176f18800 == 12 [pid = 1950] [id = 771]
11:42:58 INFO - ++DOMWINDOW == 29 (0x7f11758ddc00) [pid = 1950] [serial = 1864] [outer = (nil)]
11:42:58 INFO - ++DOMWINDOW == 30 (0x7f11758e1400) [pid = 1950] [serial = 1865] [outer = 0x7f11758ddc00]
11:42:59 INFO - ++DOMWINDOW == 31 (0x7f1176cca400) [pid = 1950] [serial = 1866] [outer = 0x7f11758ddc00]
11:42:59 INFO - ++DOCSHELL 0x7f117a622000 == 13 [pid = 1950] [id = 772]
11:42:59 INFO - ++DOMWINDOW == 32 (0x7f11758e2800) [pid = 1950] [serial = 1867] [outer = (nil)]
11:42:59 INFO - ++DOMWINDOW == 33 (0x7f1176db0000) [pid = 1950] [serial = 1868] [outer = 0x7f11758e2800]
11:42:59 INFO - ++DOMWINDOW == 34 (0x7f1176cce400) [pid = 1950] [serial = 1869] [outer = 0x7f11758e2800]
11:42:59 INFO - ++DOCSHELL 0x7f1180f77000 == 14 [pid = 1950] [id = 773]
11:42:59 INFO - ++DOMWINDOW == 35 (0x7f1176ddd000) [pid = 1950] [serial = 1870] [outer = (nil)]
11:42:59 INFO - ++DOMWINDOW == 36 (0x7f1176ddf800) [pid = 1950] [serial = 1871] [outer = 0x7f1176ddd000]
11:43:03 INFO - --DOCSHELL 0x7f117a622000 == 13 [pid = 1950] [id = 772]
11:43:03 INFO - --DOCSHELL 0x7f1176f72800 == 12 [pid = 1950] [id = 766]
11:43:03 INFO - --DOCSHELL 0x7f1180f77000 == 11 [pid = 1950] [id = 773]
11:43:03 INFO - --DOCSHELL 0x7f1177258000 == 10 [pid = 1950] [id = 767]
11:43:03 INFO - --DOMWINDOW == 35 (0x7f1177128400) [pid = 1950] [serial = 1852] [outer = (nil)] [url = about:blank]
11:43:03 INFO - --DOMWINDOW == 34 (0x7f1176dca800) [pid = 1950] [serial = 1850] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:03 INFO - --DOMWINDOW == 33 (0x7f11758e1400) [pid = 1950] [serial = 1865] [outer = (nil)] [url = about:blank]
11:43:03 INFO - --DOMWINDOW == 32 (0x7f11758d7000) [pid = 1950] [serial = 1856] [outer = (nil)] [url = about:blank]
11:43:03 INFO - --DOMWINDOW == 31 (0x7f1175652800) [pid = 1950] [serial = 1854] [outer = (nil)] [url = about:blank]
11:43:03 INFO - --DOMWINDOW == 30 (0x7f1176db0000) [pid = 1950] [serial = 1868] [outer = (nil)] [url = about:blank]
11:43:03 INFO - --DOMWINDOW == 29 (0x7f1176dd0000) [pid = 1950] [serial = 1860] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:03 INFO - --DOMWINDOW == 28 (0x7f11758d8000) [pid = 1950] [serial = 1857] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:03 INFO - --DOMWINDOW == 27 (0x7f117565c800) [pid = 1950] [serial = 1855] [outer = (nil)] [url = data:text/html;charset=utf8,
test%20for%20console.log('%ccustom%20styles',%20'color:red')]
11:43:03 INFO - --DOMWINDOW == 26 (0x7f1175643800) [pid = 1950] [serial = 1853] [outer = (nil)] [url = about:blank]
11:43:03 INFO - MEMORY STAT | vsize 1291MB | residentFast 332MB | heapAllocated 128MB
11:43:03 INFO - 286 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_extras.js | took 5102ms
11:43:03 INFO - ++DOCSHELL 0x7f11770a9800 == 11 [pid = 1950] [id = 774]
11:43:03 INFO - ++DOMWINDOW == 27 (0x7f1175645800) [pid = 1950] [serial = 1872] [outer = (nil)]
11:43:03 INFO - ++DOMWINDOW == 28 (0x7f117565d400) [pid = 1950] [serial = 1873] [outer = 0x7f1175645800]
11:43:03 INFO - 287 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js
11:43:03 INFO - ++DOCSHELL 0x7f117a606800 == 12 [pid = 1950] [id = 775]
11:43:03 INFO - ++DOMWINDOW == 29 (0x7f11758e4400) [pid = 1950] [serial = 1874] [outer = (nil)]
11:43:04 INFO - ++DOMWINDOW == 30 (0x7f1176cc5400) [pid = 1950] [serial = 1875] [outer = 0x7f11758e4400]
11:43:04 INFO - ++DOMWINDOW == 31 (0x7f1176d7a000) [pid = 1950] [serial = 1876] [outer = 0x7f11758e4400]
11:43:04 INFO - ++DOCSHELL 0x7f1176f6d000 == 13 [pid = 1950] [id = 776]
11:43:04 INFO - ++DOMWINDOW == 32 (0x7f1176dacc00) [pid = 1950] [serial = 1877] [outer = (nil)]
11:43:04 INFO - ++DOMWINDOW == 33 (0x7f1176dafc00) [pid = 1950] [serial = 1878] [outer = 0x7f1176dacc00]
11:43:04 INFO - ++DOMWINDOW == 34 (0x7f1176d7a400) [pid = 1950] [serial = 1879] [outer = 0x7f1176dacc00]
11:43:04 INFO - ++DOCSHELL 0x7f1180f72000 == 14 [pid = 1950] [id = 777]
11:43:04 INFO - ++DOMWINDOW == 35 (0x7f1176ddc000) [pid = 1950] [serial = 1880] [outer = (nil)]
11:43:04 INFO - ++DOMWINDOW == 36 (0x7f1176ddf000) [pid = 1950] [serial = 1881] [outer = 0x7f1176ddc000]
11:43:09 INFO - MEMORY STAT | vsize 1296MB | residentFast 342MB | heapAllocated 136MB
11:43:09 INFO - 288 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js | took 5936ms
11:43:09 INFO - ++DOCSHELL 0x7f1176f8b800 == 15 [pid = 1950] [id = 778]
11:43:09 INFO - ++DOMWINDOW == 37 (0x7f1176dbbc00) [pid = 1950] [serial = 1882] [outer = (nil)]
11:43:09 INFO - ++DOMWINDOW == 38 (0x7f117712c400) [pid = 1950] [serial = 1883] [outer = 0x7f1176dbbc00]
11:43:10 INFO - 289 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js
11:43:10 INFO - ++DOCSHELL 0x7f118150c800 == 16 [pid = 1950] [id = 779]
11:43:10 INFO - ++DOMWINDOW == 39 (0x7f1177205000) [pid = 1950] [serial = 1884] [outer = (nil)]
11:43:10 INFO - ++DOMWINDOW == 40 (0x7f11773e5400) [pid = 1950] [serial = 1885] [outer = 0x7f1177205000]
11:43:10 INFO - ++DOMWINDOW == 41 (0x7f1180f29800) [pid = 1950] [serial = 1886] [outer = 0x7f1177205000]
11:43:11 INFO - ++DOCSHELL 0x7f11826c0800 == 17 [pid = 1950] [id = 780]
11:43:11 INFO - ++DOMWINDOW == 42 (0x7f1176ee0c00) [pid = 1950] [serial = 1887] [outer = (nil)]
11:43:11 INFO - ++DOMWINDOW == 43 (0x7f11776f4c00) [pid = 1950] [serial = 1888] [outer = 0x7f1176ee0c00]
11:43:11 INFO - ++DOMWINDOW == 44 (0x7f1176d87c00) [pid = 1950] [serial = 1889] [outer = 0x7f1176ee0c00]
11:43:11 INFO - ++DOCSHELL 0x7f11827df000 == 18 [pid = 1950] [id = 781]
11:43:11 INFO - ++DOMWINDOW == 45 (0x7f11773f0000) [pid = 1950] [serial = 1890] [outer = (nil)]
11:43:11 INFO - ++DOMWINDOW == 46 (0x7f118114a800) [pid = 1950] [serial = 1891] [outer = 0x7f11773f0000]
11:43:13 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:43:14 INFO - MEMORY STAT | vsize 1298MB | residentFast 352MB | heapAllocated 143MB
11:43:14 INFO - 290 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js | took 4143ms
11:43:14 INFO - ++DOCSHELL 0x7f1182788000 == 19 [pid = 1950] [id = 782]
11:43:14 INFO - ++DOMWINDOW == 47 (0x7f11776f8800) [pid = 1950] [serial = 1892] [outer = (nil)]
11:43:14 INFO - ++DOMWINDOW == 48 (0x7f1180f31800) [pid = 1950] [serial = 1893] [outer = 0x7f11776f8800]
11:43:14 INFO - 291 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js
11:43:14 INFO - ++DOCSHELL 0x7f1185a29800 == 20 [pid = 1950] [id = 783]
11:43:14 INFO - ++DOMWINDOW == 49 (0x7f1181491800) [pid = 1950] [serial = 1894] [outer = (nil)]
11:43:14 INFO - ++DOMWINDOW == 50 (0x7f1181d9bc00) [pid = 1950] [serial = 1895] [outer = 0x7f1181491800]
11:43:15 INFO - ++DOCSHELL 0x7f1187d7b800 == 21 [pid = 1950] [id = 784]
11:43:15 INFO - ++DOMWINDOW == 51 (0x7f1176d7cc00) [pid = 1950] [serial = 1896] [outer = (nil)]
11:43:15 INFO - ++DOMWINDOW == 52 (0x7f1181eebc00) [pid = 1950] [serial = 1897] [outer = 0x7f1176d7cc00]
11:43:15 INFO - ++DOMWINDOW == 53 (0x7f11812d4400) [pid = 1950] [serial = 1898] [outer = 0x7f1176d7cc00]
11:43:15 INFO - ++DOCSHELL 0x7f1187fc8000 == 22 [pid = 1950] [id = 785]
11:43:15 INFO - ++DOMWINDOW == 54 (0x7f118274a800) [pid = 1950] [serial = 1899] [outer = (nil)]
11:43:15 INFO - ++DOMWINDOW == 55 (0x7f1182752800) [pid = 1950] [serial = 1900] [outer = 0x7f118274a800]
11:43:17 INFO - ++DOMWINDOW == 56 (0x7f11838c6400) [pid = 1950] [serial = 1901] [outer = 0x7f1181491800]
11:43:17 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:43:18 INFO - --DOCSHELL 0x7f1176f76000 == 21 [pid = 1950] [id = 770]
11:43:18 INFO - --DOCSHELL 0x7f11770a9800 == 20 [pid = 1950] [id = 774]
11:43:18 INFO - --DOCSHELL 0x7f1176f18800 == 19 [pid = 1950] [id = 771]
11:43:18 INFO - --DOCSHELL 0x7f1176f6d000 == 18 [pid = 1950] [id = 776]
11:43:18 INFO - --DOCSHELL 0x7f1180f72000 == 17 [pid = 1950] [id = 777]
11:43:18 INFO - --DOCSHELL 0x7f11827df000 == 16 [pid = 1950] [id = 781]
11:43:18 INFO - --DOMWINDOW == 55 (0x7f1176dd3000) [pid = 1950] [serial = 1861] [outer = (nil)] [url = about:blank]
11:43:18 INFO - --DOMWINDOW == 54 (0x7f11758e4800) [pid = 1950] [serial = 1859] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:19 INFO - --DOCSHELL 0x7f1187fc8000 == 15 [pid = 1950] [id = 785]
11:43:19 INFO - MEMORY STAT | vsize 1299MB | residentFast 354MB | heapAllocated 141MB
11:43:19 INFO - 292 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js | took 5076ms
11:43:19 INFO - ++DOCSHELL 0x7f11773c6800 == 16 [pid = 1950] [id = 786]
11:43:19 INFO - ++DOMWINDOW == 55 (0x7f1176dc8400) [pid = 1950] [serial = 1902] [outer = (nil)]
11:43:19 INFO - ++DOMWINDOW == 56 (0x7f1176dd3000) [pid = 1950] [serial = 1903] [outer = 0x7f1176dc8400]
11:43:20 INFO - 293 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js
11:43:20 INFO - ++DOCSHELL 0x7f1180f75800 == 17 [pid = 1950] [id = 787]
11:43:20 INFO - ++DOMWINDOW == 57 (0x7f1176fb7c00) [pid = 1950] [serial = 1904] [outer = (nil)]
11:43:20 INFO - ++DOMWINDOW == 58 (0x7f1177126800) [pid = 1950] [serial = 1905] [outer = 0x7f1176fb7c00]
11:43:20 INFO - ++DOCSHELL 0x7f11810c1800 == 18 [pid = 1950] [id = 788]
11:43:20 INFO - ++DOMWINDOW == 59 (0x7f117720ec00) [pid = 1950] [serial = 1906] [outer = (nil)]
11:43:20 INFO - ++DOMWINDOW == 60 (0x7f117738b000) [pid = 1950] [serial = 1907] [outer = 0x7f117720ec00]
11:43:20 INFO - ++DOMWINDOW == 61 (0x7f1176dd9c00) [pid = 1950] [serial = 1908] [outer = 0x7f117720ec00]
11:43:21 INFO - ++DOCSHELL 0x7f118278b800 == 19 [pid = 1950] [id = 789]
11:43:21 INFO - ++DOMWINDOW == 62 (0x7f117767c000) [pid = 1950] [serial = 1909] [outer = (nil)]
11:43:21 INFO - ++DOMWINDOW == 63 (0x7f117767fc00) [pid = 1950] [serial = 1910] [outer = 0x7f117767c000]
11:43:22 INFO - ++DOMWINDOW == 64 (0x7f1181d97800) [pid = 1950] [serial = 1911] [outer = 0x7f1176fb7c00]
11:43:22 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:43:24 INFO - --DOCSHELL 0x7f1187d7b800 == 18 [pid = 1950] [id = 784]
11:43:24 INFO - --DOCSHELL 0x7f118278b800 == 17 [pid = 1950] [id = 789]
11:43:24 INFO - --DOCSHELL 0x7f1176f8b800 == 16 [pid = 1950] [id = 778]
11:43:24 INFO - --DOCSHELL 0x7f11826c0800 == 15 [pid = 1950] [id = 780]
11:43:24 INFO - --DOMWINDOW == 63 (0x7f1175645800) [pid = 1950] [serial = 1872] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 62 (0x7f1176ee0c00) [pid = 1950] [serial = 1887] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:24 INFO - --DOMWINDOW == 61 (0x7f1176ddd000) [pid = 1950] [serial = 1870] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:24 INFO - --DOMWINDOW == 60 (0x7f11758e2800) [pid = 1950] [serial = 1867] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:24 INFO - --DOMWINDOW == 59 (0x7f11773f0000) [pid = 1950] [serial = 1890] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:24 INFO - --DOMWINDOW == 58 (0x7f11758e4400) [pid = 1950] [serial = 1874] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:43:24 INFO - --DOMWINDOW == 57 (0x7f11758ddc00) [pid = 1950] [serial = 1864] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html]
11:43:24 INFO - --DOMWINDOW == 56 (0x7f117564f400) [pid = 1950] [serial = 1862] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 55 (0x7f11776f4c00) [pid = 1950] [serial = 1888] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 54 (0x7f1176dafc00) [pid = 1950] [serial = 1878] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 53 (0x7f117565d400) [pid = 1950] [serial = 1873] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 52 (0x7f1176cc5400) [pid = 1950] [serial = 1875] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 51 (0x7f117565ac00) [pid = 1950] [serial = 1863] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 50 (0x7f1181eebc00) [pid = 1950] [serial = 1897] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 49 (0x7f1176cce400) [pid = 1950] [serial = 1869] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:24 INFO - --DOMWINDOW == 48 (0x7f118114a800) [pid = 1950] [serial = 1891] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 47 (0x7f1176d87c00) [pid = 1950] [serial = 1889] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:24 INFO - --DOMWINDOW == 46 (0x7f1176ddf800) [pid = 1950] [serial = 1871] [outer = (nil)] [url = about:blank]
11:43:24 INFO - --DOMWINDOW == 45 (0x7f1176cca400) [pid = 1950] [serial = 1866] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html]
11:43:24 INFO - --DOMWINDOW == 44 (0x7f1176d7a000) [pid = 1950] [serial = 1876] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:43:25 INFO - --DOMWINDOW == 43 (0x7f1176ddc000) [pid = 1950] [serial = 1880] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:25 INFO - --DOMWINDOW == 42 (0x7f1176dbbc00) [pid = 1950] [serial = 1882] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 41 (0x7f1177205000) [pid = 1950] [serial = 1884] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html]
11:43:25 INFO - --DOMWINDOW == 40 (0x7f11776f8800) [pid = 1950] [serial = 1892] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 39 (0x7f117712c400) [pid = 1950] [serial = 1883] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 38 (0x7f11773e5400) [pid = 1950] [serial = 1885] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 37 (0x7f1180f31800) [pid = 1950] [serial = 1893] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 36 (0x7f1181d9bc00) [pid = 1950] [serial = 1895] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 35 (0x7f1176dacc00) [pid = 1950] [serial = 1877] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:25 INFO - --DOMWINDOW == 34 (0x7f117738b000) [pid = 1950] [serial = 1907] [outer = (nil)] [url = about:blank]
11:43:25 INFO - --DOMWINDOW == 33 (0x7f1181491800) [pid = 1950] [serial = 1894] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html]
11:43:25 INFO - --DOMWINDOW == 32 (0x7f1180f29800) [pid = 1950] [serial = 1886] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html]
11:43:25 INFO - MEMORY STAT | vsize 1301MB | residentFast 355MB | heapAllocated 137MB
11:43:25 INFO - 294 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js | took 5254ms
11:43:25 INFO - ++DOCSHELL 0x7f1176f6e800 == 16 [pid = 1950] [id = 790]
11:43:25 INFO - ++DOMWINDOW == 33 (0x7f117565ac00) [pid = 1950] [serial = 1912] [outer = (nil)]
11:43:25 INFO - ++DOMWINDOW == 34 (0x7f11758dec00) [pid = 1950] [serial = 1913] [outer = 0x7f117565ac00]
11:43:25 INFO - 295 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js
11:43:25 INFO - ++DOCSHELL 0x7f11773c6000 == 17 [pid = 1950] [id = 791]
11:43:25 INFO - ++DOMWINDOW == 35 (0x7f1176cc5800) [pid = 1950] [serial = 1914] [outer = (nil)]
11:43:25 INFO - ++DOMWINDOW == 36 (0x7f1176ccb800) [pid = 1950] [serial = 1915] [outer = 0x7f1176cc5800]
11:43:26 INFO - ++DOCSHELL 0x7f1176f6e000 == 18 [pid = 1950] [id = 792]
11:43:26 INFO - ++DOMWINDOW == 37 (0x7f1175194400) [pid = 1950] [serial = 1916] [outer = (nil)]
11:43:26 INFO - ++DOMWINDOW == 38 (0x7f1175637000) [pid = 1950] [serial = 1917] [outer = 0x7f1175194400]
11:43:26 INFO - ++DOMWINDOW == 39 (0x7f1175638c00) [pid = 1950] [serial = 1918] [outer = 0x7f1175194400]
11:43:27 INFO - ++DOCSHELL 0x7f1180e06800 == 19 [pid = 1950] [id = 793]
11:43:27 INFO - ++DOMWINDOW == 40 (0x7f1176db6c00) [pid = 1950] [serial = 1919] [outer = (nil)]
11:43:27 INFO - ++DOMWINDOW == 41 (0x7f1176dbbc00) [pid = 1950] [serial = 1920] [outer = 0x7f1176db6c00]
11:43:30 INFO - MEMORY STAT | vsize 1303MB | residentFast 357MB | heapAllocated 138MB
11:43:30 INFO - 296 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js | took 4211ms
11:43:30 INFO - ++DOCSHELL 0x7f11770c3800 == 20 [pid = 1950] [id = 794]
11:43:30 INFO - ++DOMWINDOW == 42 (0x7f117565d400) [pid = 1950] [serial = 1921] [outer = (nil)]
11:43:30 INFO - ++DOMWINDOW == 43 (0x7f1176daf400) [pid = 1950] [serial = 1922] [outer = 0x7f117565d400]
11:43:30 INFO - 297 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js
11:43:30 INFO - ++DOCSHELL 0x7f1181520000 == 21 [pid = 1950] [id = 795]
11:43:30 INFO - ++DOMWINDOW == 44 (0x7f1176fbac00) [pid = 1950] [serial = 1923] [outer = (nil)]
11:43:30 INFO - ++DOMWINDOW == 45 (0x7f1177205800) [pid = 1950] [serial = 1924] [outer = 0x7f1176fbac00]
11:43:30 INFO - ++DOCSHELL 0x7f1182795000 == 22 [pid = 1950] [id = 796]
11:43:30 INFO - ++DOMWINDOW == 46 (0x7f1175194000) [pid = 1950] [serial = 1925] [outer = (nil)]
11:43:30 INFO - ++DOMWINDOW == 47 (0x7f1177674c00) [pid = 1950] [serial = 1926] [outer = 0x7f1175194000]
11:43:31 INFO - ++DOMWINDOW == 48 (0x7f1176dd9800) [pid = 1950] [serial = 1927] [outer = 0x7f1175194000]
11:43:31 INFO - ++DOCSHELL 0x7f11827e3800 == 23 [pid = 1950] [id = 797]
11:43:31 INFO - ++DOMWINDOW == 49 (0x7f11776ee800) [pid = 1950] [serial = 1928] [outer = (nil)]
11:43:31 INFO - ++DOMWINDOW == 50 (0x7f11776f2800) [pid = 1950] [serial = 1929] [outer = 0x7f11776ee800]
11:43:34 INFO - --DOCSHELL 0x7f118150c800 == 22 [pid = 1950] [id = 779]
11:43:34 INFO - --DOCSHELL 0x7f117a606800 == 21 [pid = 1950] [id = 775]
11:43:34 INFO - --DOCSHELL 0x7f11810c1800 == 20 [pid = 1950] [id = 788]
11:43:34 INFO - --DOCSHELL 0x7f1180e06800 == 19 [pid = 1950] [id = 793]
11:43:34 INFO - --DOCSHELL 0x7f1180f75800 == 18 [pid = 1950] [id = 787]
11:43:34 INFO - --DOCSHELL 0x7f1185a29800 == 17 [pid = 1950] [id = 783]
11:43:34 INFO - --DOCSHELL 0x7f1182788000 == 16 [pid = 1950] [id = 782]
11:43:34 INFO - --DOMWINDOW == 49 (0x7f1176ddf000) [pid = 1950] [serial = 1881] [outer = (nil)] [url = about:blank]
11:43:34 INFO - --DOMWINDOW == 48 (0x7f1176d7a400) [pid = 1950] [serial = 1879] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:34 INFO - --DOMWINDOW == 47 (0x7f11838c6400) [pid = 1950] [serial = 1901] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html]
11:43:34 INFO - --DOCSHELL 0x7f11827e3800 == 15 [pid = 1950] [id = 797]
11:43:35 INFO - MEMORY STAT | vsize 1300MB | residentFast 352MB | heapAllocated 137MB
11:43:35 INFO - 298 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js | took 4866ms
11:43:35 INFO - ++DOCSHELL 0x7f11770b8800 == 16 [pid = 1950] [id = 798]
11:43:35 INFO - ++DOMWINDOW == 48 (0x7f1176d79800) [pid = 1950] [serial = 1930] [outer = (nil)]
11:43:35 INFO - ++DOMWINDOW == 49 (0x7f1176d82400) [pid = 1950] [serial = 1931] [outer = 0x7f1176d79800]
11:43:35 INFO - 299 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_count.js
11:43:35 INFO - ++DOCSHELL 0x7f1180e34000 == 17 [pid = 1950] [id = 799]
11:43:35 INFO - ++DOMWINDOW == 50 (0x7f1176dcd800) [pid = 1950] [serial = 1932] [outer = (nil)]
11:43:35 INFO - ++DOMWINDOW == 51 (0x7f1176dd9000) [pid = 1950] [serial = 1933] [outer = 0x7f1176dcd800]
11:43:35 INFO - ++DOMWINDOW == 52 (0x7f117712c400) [pid = 1950] [serial = 1934] [outer = 0x7f1176dcd800]
11:43:36 INFO - ++DOCSHELL 0x7f11770ac000 == 18 [pid = 1950] [id = 800]
11:43:36 INFO - ++DOMWINDOW == 53 (0x7f1177210c00) [pid = 1950] [serial = 1935] [outer = (nil)]
11:43:36 INFO - ++DOMWINDOW == 54 (0x7f1177211800) [pid = 1950] [serial = 1936] [outer = 0x7f1177210c00]
11:43:36 INFO - ++DOMWINDOW == 55 (0x7f1175652c00) [pid = 1950] [serial = 1937] [outer = 0x7f1177210c00]
11:43:36 INFO - ++DOCSHELL 0x7f1181522000 == 19 [pid = 1950] [id = 801]
11:43:36 INFO - ++DOMWINDOW == 56 (0x7f1177676c00) [pid = 1950] [serial = 1938] [outer = (nil)]
11:43:36 INFO - ++DOMWINDOW == 57 (0x7f117767a000) [pid = 1950] [serial = 1939] [outer = 0x7f1177676c00]
11:43:39 INFO - --DOMWINDOW == 56 (0x7f1176fb7c00) [pid = 1950] [serial = 1904] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html]
11:43:39 INFO - --DOMWINDOW == 55 (0x7f1176dc8400) [pid = 1950] [serial = 1902] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 54 (0x7f1176cc5800) [pid = 1950] [serial = 1914] [outer = (nil)] [url = data:text/html,]
11:43:39 INFO - --DOMWINDOW == 53 (0x7f117565ac00) [pid = 1950] [serial = 1912] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 52 (0x7f1177674c00) [pid = 1950] [serial = 1926] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 51 (0x7f1177126800) [pid = 1950] [serial = 1905] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 50 (0x7f1175637000) [pid = 1950] [serial = 1917] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 49 (0x7f1176dd3000) [pid = 1950] [serial = 1903] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 48 (0x7f1176ccb800) [pid = 1950] [serial = 1915] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 47 (0x7f11758dec00) [pid = 1950] [serial = 1913] [outer = (nil)] [url = about:blank]
11:43:39 INFO - --DOMWINDOW == 46 (0x7f117720ec00) [pid = 1950] [serial = 1906] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:39 INFO - --DOMWINDOW == 45 (0x7f1176d7cc00) [pid = 1950] [serial = 1896] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:39 INFO - --DOMWINDOW == 44 (0x7f117767c000) [pid = 1950] [serial = 1909] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:39 INFO - --DOMWINDOW == 43 (0x7f118274a800) [pid = 1950] [serial = 1899] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:39 INFO - --DOMWINDOW == 42 (0x7f1176db6c00) [pid = 1950] [serial = 1919] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:39 INFO - --DOMWINDOW == 41 (0x7f1175194400) [pid = 1950] [serial = 1916] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:39 INFO - --DOMWINDOW == 40 (0x7f1181d97800) [pid = 1950] [serial = 1911] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html]
11:43:40 INFO - --DOCSHELL 0x7f1181522000 == 18 [pid = 1950] [id = 801]
11:43:40 INFO - --DOCSHELL 0x7f1182795000 == 17 [pid = 1950] [id = 796]
11:43:40 INFO - --DOCSHELL 0x7f11770c3800 == 16 [pid = 1950] [id = 794]
11:43:40 INFO - --DOCSHELL 0x7f1176f6e000 == 15 [pid = 1950] [id = 792]
11:43:40 INFO - --DOCSHELL 0x7f1176f6e800 == 14 [pid = 1950] [id = 790]
11:43:40 INFO - --DOCSHELL 0x7f11773c6800 == 13 [pid = 1950] [id = 786]
11:43:40 INFO - --DOMWINDOW == 39 (0x7f1182752800) [pid = 1950] [serial = 1900] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 38 (0x7f1176dbbc00) [pid = 1950] [serial = 1920] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 37 (0x7f1175638c00) [pid = 1950] [serial = 1918] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:40 INFO - --DOMWINDOW == 36 (0x7f11812d4400) [pid = 1950] [serial = 1898] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:40 INFO - --DOMWINDOW == 35 (0x7f1176dd9c00) [pid = 1950] [serial = 1908] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:40 INFO - --DOMWINDOW == 34 (0x7f117767fc00) [pid = 1950] [serial = 1910] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 33 (0x7f1175194000) [pid = 1950] [serial = 1925] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:40 INFO - --DOMWINDOW == 32 (0x7f1176dd9000) [pid = 1950] [serial = 1933] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 31 (0x7f1177205800) [pid = 1950] [serial = 1924] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 30 (0x7f1176daf400) [pid = 1950] [serial = 1922] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 29 (0x7f1177211800) [pid = 1950] [serial = 1936] [outer = (nil)] [url = about:blank]
11:43:40 INFO - --DOMWINDOW == 28 (0x7f11776ee800) [pid = 1950] [serial = 1928] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:40 INFO - --DOMWINDOW == 27 (0x7f1176fbac00) [pid = 1950] [serial = 1923] [outer = (nil)] [url = data:text/html,]
11:43:40 INFO - --DOMWINDOW == 26 (0x7f117565d400) [pid = 1950] [serial = 1921] [outer = (nil)] [url = about:blank]
11:43:40 INFO - MEMORY STAT | vsize 1301MB | residentFast 352MB | heapAllocated 134MB
11:43:40 INFO - 300 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_count.js | took 5200ms
11:43:40 INFO - ++DOCSHELL 0x7f1176f8b000 == 14 [pid = 1950] [id = 802]
11:43:40 INFO - ++DOMWINDOW == 27 (0x7f1175651c00) [pid = 1950] [serial = 1940] [outer = (nil)]
11:43:40 INFO - ++DOMWINDOW == 28 (0x7f1175657800) [pid = 1950] [serial = 1941] [outer = 0x7f1175651c00]
11:43:41 INFO - 301 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js
11:43:41 INFO - ++DOCSHELL 0x7f1180e06800 == 15 [pid = 1950] [id = 803]
11:43:41 INFO - ++DOMWINDOW == 29 (0x7f1176cc7000) [pid = 1950] [serial = 1942] [outer = (nil)]
11:43:41 INFO - ++DOMWINDOW == 30 (0x7f1176cd0400) [pid = 1950] [serial = 1943] [outer = 0x7f1176cc7000]
11:43:41 INFO - ++DOCSHELL 0x7f117a610800 == 16 [pid = 1950] [id = 804]
11:43:41 INFO - ++DOMWINDOW == 31 (0x7f1176d7a400) [pid = 1950] [serial = 1944] [outer = (nil)]
11:43:41 INFO - ++DOMWINDOW == 32 (0x7f1176dd5c00) [pid = 1950] [serial = 1945] [outer = 0x7f1176d7a400]
11:43:41 INFO - ++DOMWINDOW == 33 (0x7f11758ddc00) [pid = 1950] [serial = 1946] [outer = 0x7f1176d7a400]
11:43:41 INFO - ++DOCSHELL 0x7f11810ca800 == 17 [pid = 1950] [id = 805]
11:43:41 INFO - ++DOMWINDOW == 34 (0x7f1177132400) [pid = 1950] [serial = 1947] [outer = (nil)]
11:43:41 INFO - ++DOMWINDOW == 35 (0x7f1177207000) [pid = 1950] [serial = 1948] [outer = 0x7f1177132400]
11:43:43 INFO - ++DOMWINDOW == 36 (0x7f117720f800) [pid = 1950] [serial = 1949] [outer = 0x7f1176cc7000]
11:43:43 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:43:45 INFO - --DOCSHELL 0x7f11770b8800 == 16 [pid = 1950] [id = 798]
11:43:45 INFO - --DOCSHELL 0x7f11770ac000 == 15 [pid = 1950] [id = 800]
11:43:45 INFO - --DOMWINDOW == 35 (0x7f1176dd9800) [pid = 1950] [serial = 1927] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:43:45 INFO - --DOMWINDOW == 34 (0x7f11776f2800) [pid = 1950] [serial = 1929] [outer = (nil)] [url = about:blank]
11:43:45 INFO - --DOMWINDOW == 33 (0x7f1176d82400) [pid = 1950] [serial = 1931] [outer = (nil)] [url = about:blank]
11:43:45 INFO - --DOMWINDOW == 32 (0x7f1176dd5c00) [pid = 1950] [serial = 1945] [outer = (nil)] [url = about:blank]
11:43:45 INFO - --DOMWINDOW == 31 (0x7f1177676c00) [pid = 1950] [serial = 1938] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:45 INFO - --DOMWINDOW == 30 (0x7f1176d79800) [pid = 1950] [serial = 1930] [outer = (nil)] [url = about:blank]
11:43:45 INFO - --DOMWINDOW == 29 (0x7f1176dcd800) [pid = 1950] [serial = 1932] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html]
11:43:45 INFO - MEMORY STAT | vsize 1303MB | residentFast 352MB | heapAllocated 136MB
11:43:45 INFO - 302 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js | took 4741ms
11:43:45 INFO - ++DOCSHELL 0x7f1176f6e000 == 16 [pid = 1950] [id = 806]
11:43:45 INFO - ++DOMWINDOW == 30 (0x7f1176cce800) [pid = 1950] [serial = 1950] [outer = (nil)]
11:43:45 INFO - ++DOMWINDOW == 31 (0x7f1176d88c00) [pid = 1950] [serial = 1951] [outer = 0x7f1176cce800]
11:43:46 INFO - 303 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js
11:43:46 INFO - ++DOCSHELL 0x7f1180e33000 == 17 [pid = 1950] [id = 807]
11:43:46 INFO - ++DOMWINDOW == 32 (0x7f1176dd5c00) [pid = 1950] [serial = 1952] [outer = (nil)]
11:43:46 INFO - ++DOMWINDOW == 33 (0x7f1176ddf400) [pid = 1950] [serial = 1953] [outer = 0x7f1176dd5c00]
11:43:46 INFO - ++DOMWINDOW == 34 (0x7f1176fb9400) [pid = 1950] [serial = 1954] [outer = 0x7f1176dd5c00]
11:43:46 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html, line 21: ReferenceError: nonExistingMethodCall is not defined
11:43:46 INFO - ++DOCSHELL 0x7f117724d800 == 18 [pid = 1950] [id = 808]
11:43:46 INFO - ++DOMWINDOW == 35 (0x7f1176edac00) [pid = 1950] [serial = 1955] [outer = (nil)]
11:43:46 INFO - ++DOMWINDOW == 36 (0x7f1177203c00) [pid = 1950] [serial = 1956] [outer = 0x7f1176edac00]
11:43:46 INFO - ++DOMWINDOW == 37 (0x7f117712d800) [pid = 1950] [serial = 1957] [outer = 0x7f1176edac00]
11:43:47 INFO - ++DOCSHELL 0x7f1182790800 == 19 [pid = 1950] [id = 809]
11:43:47 INFO - ++DOMWINDOW == 38 (0x7f1177675c00) [pid = 1950] [serial = 1958] [outer = (nil)]
11:43:47 INFO - ++DOMWINDOW == 39 (0x7f117767b000) [pid = 1950] [serial = 1959] [outer = 0x7f1177675c00]
11:43:49 INFO - --DOMWINDOW == 38 (0x7f117767a000) [pid = 1950] [serial = 1939] [outer = (nil)] [url = about:blank]
11:43:49 INFO - --DOMWINDOW == 37 (0x7f117712c400) [pid = 1950] [serial = 1934] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html]
11:43:50 INFO - --DOMWINDOW == 36 (0x7f1176ddf400) [pid = 1950] [serial = 1953] [outer = (nil)] [url = about:blank]
11:43:50 INFO - --DOMWINDOW == 35 (0x7f1176cd0400) [pid = 1950] [serial = 1943] [outer = (nil)] [url = about:blank]
11:43:50 INFO - --DOMWINDOW == 34 (0x7f1175657800) [pid = 1950] [serial = 1941] [outer = (nil)] [url = about:blank]
11:43:50 INFO - --DOMWINDOW == 33 (0x7f1177203c00) [pid = 1950] [serial = 1956] [outer = (nil)] [url = about:blank]
11:43:50 INFO - --DOMWINDOW == 32 (0x7f1177132400) [pid = 1950] [serial = 1947] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:43:50 INFO - --DOMWINDOW == 31 (0x7f1176cc7000) [pid = 1950] [serial = 1942] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1454442221088]
11:43:50 INFO - --DOMWINDOW == 30 (0x7f1175651c00) [pid = 1950] [serial = 1940] [outer = (nil)] [url = about:blank]
11:43:50 INFO - --DOMWINDOW == 29 (0x7f117720f800) [pid = 1950] [serial = 1949] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1454442221088]
11:43:50 INFO - MEMORY STAT | vsize 1303MB | residentFast 353MB | heapAllocated 136MB
11:43:50 INFO - 304 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js | took 4371ms
11:43:50 INFO - ++DOCSHELL 0x7f1176f76000 == 20 [pid = 1950] [id = 810]
11:43:50 INFO - ++DOMWINDOW == 30 (0x7f1176cc9000) [pid = 1950] [serial = 1960] [outer = (nil)]
11:43:50 INFO - ++DOMWINDOW == 31 (0x7f1176db9800) [pid = 1950] [serial = 1961] [outer = 0x7f1176cc9000]
11:43:50 INFO - 305 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_execution_scope.js
11:43:50 INFO - ++DOCSHELL 0x7f1180f7e000 == 21 [pid = 1950] [id = 811]
11:43:50 INFO - ++DOMWINDOW == 32 (0x7f1176ddfc00) [pid = 1950] [serial = 1962] [outer = (nil)]
11:43:50 INFO - ++DOMWINDOW == 33 (0x7f1176fb9000) [pid = 1950] [serial = 1963] [outer = 0x7f1176ddfc00]
11:43:50 INFO - ++DOMWINDOW == 34 (0x7f1177208000) [pid = 1950] [serial = 1964] [outer = 0x7f1176ddfc00]
11:43:51 INFO - ++DOCSHELL 0x7f1176f1e800 == 22 [pid = 1950] [id = 812]
11:43:51 INFO - ++DOMWINDOW == 35 (0x7f1176fbac00) [pid = 1950] [serial = 1965] [outer = (nil)]
11:43:51 INFO - ++DOMWINDOW == 36 (0x7f1177211800) [pid = 1950] [serial = 1966] [outer = 0x7f1176fbac00]
11:43:51 INFO - ++DOMWINDOW == 37 (0x7f1177134800) [pid = 1950] [serial = 1967] [outer = 0x7f1176fbac00]
11:43:51 INFO - ++DOCSHELL 0x7f11827a0800 == 23 [pid = 1950] [id = 813]
11:43:51 INFO - ++DOMWINDOW == 38 (0x7f11776f2400) [pid = 1950] [serial = 1968] [outer = (nil)]
11:43:51 INFO - ++DOMWINDOW == 39 (0x7f11776f8000) [pid = 1950] [serial = 1969] [outer = 0x7f11776f2400]
11:43:54 INFO - MEMORY STAT | vsize 1305MB | residentFast 350MB | heapAllocated 133MB
11:43:54 INFO - 306 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_execution_scope.js | took 3320ms
11:43:54 INFO - ++DOCSHELL 0x7f1176f0c800 == 24 [pid = 1950] [id = 814]
11:43:54 INFO - ++DOMWINDOW == 40 (0x7f1175188c00) [pid = 1950] [serial = 1970] [outer = (nil)]
11:43:54 INFO - ++DOMWINDOW == 41 (0x7f1175193800) [pid = 1950] [serial = 1971] [outer = 0x7f1175188c00]
11:43:54 INFO - 307 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js
11:43:54 INFO - ++DOCSHELL 0x7f1177248000 == 25 [pid = 1950] [id = 815]
11:43:54 INFO - ++DOMWINDOW == 42 (0x7f1175656000) [pid = 1950] [serial = 1972] [outer = (nil)]
11:43:54 INFO - ++DOMWINDOW == 43 (0x7f117565ac00) [pid = 1950] [serial = 1973] [outer = 0x7f1175656000]
11:43:54 INFO - ++DOCSHELL 0x7f1180e09800 == 26 [pid = 1950] [id = 816]
11:43:54 INFO - ++DOMWINDOW == 44 (0x7f11758da800) [pid = 1950] [serial = 1974] [outer = (nil)]
11:43:54 INFO - ++DOMWINDOW == 45 (0x7f1176d79c00) [pid = 1950] [serial = 1975] [outer = 0x7f11758da800]
11:43:55 INFO - ++DOMWINDOW == 46 (0x7f1175644000) [pid = 1950] [serial = 1976] [outer = 0x7f11758da800]
11:43:55 INFO - ++DOCSHELL 0x7f11810b7000 == 27 [pid = 1950] [id = 817]
11:43:55 INFO - ++DOMWINDOW == 47 (0x7f1176dd9c00) [pid = 1950] [serial = 1977] [outer = (nil)]
11:43:55 INFO - ++DOMWINDOW == 48 (0x7f1176de0c00) [pid = 1950] [serial = 1978] [outer = 0x7f1176dd9c00]
11:43:57 INFO - ++DOCSHELL 0x7f11835e8800 == 28 [pid = 1950] [id = 818]
11:43:57 INFO - ++DOMWINDOW == 49 (0x7f117767c400) [pid = 1950] [serial = 1979] [outer = (nil)]
11:43:57 INFO - ++DOMWINDOW == 50 (0x7f117767d400) [pid = 1950] [serial = 1980] [outer = 0x7f117767c400]
11:43:58 INFO - MEMORY STAT | vsize 1308MB | residentFast 362MB | heapAllocated 142MB
11:43:58 INFO - 308 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js | took 4435ms
11:43:58 INFO - ++DOCSHELL 0x7f11810c4800 == 29 [pid = 1950] [id = 819]
11:43:58 INFO - ++DOMWINDOW == 51 (0x7f1176d7dc00) [pid = 1950] [serial = 1981] [outer = (nil)]
11:43:58 INFO - ++DOMWINDOW == 52 (0x7f1176db3c00) [pid = 1950] [serial = 1982] [outer = 0x7f1176d7dc00]
11:43:59 INFO - 309 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js
11:43:59 INFO - ++DOCSHELL 0x7f1185a38800 == 30 [pid = 1950] [id = 820]
11:43:59 INFO - ++DOMWINDOW == 53 (0x7f1177398c00) [pid = 1950] [serial = 1983] [outer = (nil)]
11:43:59 INFO - ++DOMWINDOW == 54 (0x7f11773f2000) [pid = 1950] [serial = 1984] [outer = 0x7f1177398c00]
11:43:59 INFO - ++DOMWINDOW == 55 (0x7f1180f38800) [pid = 1950] [serial = 1985] [outer = 0x7f1177398c00]
11:44:00 INFO - ++DOCSHELL 0x7f118a151800 == 31 [pid = 1950] [id = 821]
11:44:00 INFO - ++DOMWINDOW == 56 (0x7f1177683400) [pid = 1950] [serial = 1986] [outer = (nil)]
11:44:00 INFO - ++DOMWINDOW == 57 (0x7f1181d91400) [pid = 1950] [serial = 1987] [outer = 0x7f1177683400]
11:44:00 INFO - ++DOMWINDOW == 58 (0x7f117712ec00) [pid = 1950] [serial = 1988] [outer = 0x7f1177683400]
11:44:01 INFO - ++DOCSHELL 0x7f118aa29000 == 32 [pid = 1950] [id = 822]
11:44:01 INFO - ++DOMWINDOW == 59 (0x7f1181ee7800) [pid = 1950] [serial = 1989] [outer = (nil)]
11:44:01 INFO - ++DOMWINDOW == 60 (0x7f1181f53c00) [pid = 1950] [serial = 1990] [outer = 0x7f1181ee7800]
11:44:05 INFO - --DOCSHELL 0x7f117a610800 == 31 [pid = 1950] [id = 804]
11:44:05 INFO - --DOCSHELL 0x7f1182790800 == 30 [pid = 1950] [id = 809]
11:44:05 INFO - --DOCSHELL 0x7f11773c6000 == 29 [pid = 1950] [id = 791]
11:44:05 INFO - --DOCSHELL 0x7f1181520000 == 28 [pid = 1950] [id = 795]
11:44:05 INFO - --DOCSHELL 0x7f1180e06800 == 27 [pid = 1950] [id = 803]
11:44:05 INFO - --DOCSHELL 0x7f11810ca800 == 26 [pid = 1950] [id = 805]
11:44:05 INFO - --DOCSHELL 0x7f1180e34000 == 25 [pid = 1950] [id = 799]
11:44:05 INFO - --DOCSHELL 0x7f1176f8b000 == 24 [pid = 1950] [id = 802]
11:44:05 INFO - --DOCSHELL 0x7f1176f6e000 == 23 [pid = 1950] [id = 806]
11:44:05 INFO - --DOCSHELL 0x7f1176f76000 == 22 [pid = 1950] [id = 810]
11:44:05 INFO - --DOCSHELL 0x7f1180f7e000 == 21 [pid = 1950] [id = 811]
11:44:05 INFO - --DOCSHELL 0x7f1176f1e800 == 20 [pid = 1950] [id = 812]
11:44:05 INFO - --DOCSHELL 0x7f1180e33000 == 19 [pid = 1950] [id = 807]
11:44:05 INFO - --DOCSHELL 0x7f11827a0800 == 18 [pid = 1950] [id = 813]
11:44:05 INFO - --DOCSHELL 0x7f117724d800 == 17 [pid = 1950] [id = 808]
11:44:05 INFO - --DOCSHELL 0x7f11810b7000 == 16 [pid = 1950] [id = 817]
11:44:05 INFO - --DOCSHELL 0x7f11835e8800 == 15 [pid = 1950] [id = 818]
11:44:05 INFO - --DOCSHELL 0x7f118aa29000 == 14 [pid = 1950] [id = 822]
11:44:05 INFO - --DOMWINDOW == 59 (0x7f1177207000) [pid = 1950] [serial = 1948] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 58 (0x7f1176ddfc00) [pid = 1950] [serial = 1962] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:44:05 INFO - --DOMWINDOW == 57 (0x7f1175656000) [pid = 1950] [serial = 1972] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20722267%20-%20preference%20for%20toggling%20timestamps%20in%20messages]
11:44:05 INFO - --DOMWINDOW == 56 (0x7f11776f2400) [pid = 1950] [serial = 1968] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:05 INFO - --DOMWINDOW == 55 (0x7f1176db9800) [pid = 1950] [serial = 1961] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 54 (0x7f1176dd9c00) [pid = 1950] [serial = 1977] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:05 INFO - --DOMWINDOW == 53 (0x7f1175193800) [pid = 1950] [serial = 1971] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 52 (0x7f1175188c00) [pid = 1950] [serial = 1970] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 51 (0x7f1176cc9000) [pid = 1950] [serial = 1960] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 50 (0x7f1176fb9000) [pid = 1950] [serial = 1963] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 49 (0x7f1176d79c00) [pid = 1950] [serial = 1975] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 48 (0x7f117565ac00) [pid = 1950] [serial = 1973] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 47 (0x7f11758da800) [pid = 1950] [serial = 1974] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:05 INFO - --DOMWINDOW == 46 (0x7f1176fbac00) [pid = 1950] [serial = 1965] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:05 INFO - --DOMWINDOW == 45 (0x7f1181d91400) [pid = 1950] [serial = 1987] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 44 (0x7f11773f2000) [pid = 1950] [serial = 1984] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 43 (0x7f117767c400) [pid = 1950] [serial = 1979] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox-options.xul]
11:44:05 INFO - --DOMWINDOW == 42 (0x7f1176cce800) [pid = 1950] [serial = 1950] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 41 (0x7f1177210c00) [pid = 1950] [serial = 1935] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:05 INFO - --DOMWINDOW == 40 (0x7f1177675c00) [pid = 1950] [serial = 1958] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:05 INFO - --DOMWINDOW == 39 (0x7f1176edac00) [pid = 1950] [serial = 1955] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:05 INFO - --DOMWINDOW == 38 (0x7f1176dd5c00) [pid = 1950] [serial = 1952] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html]
11:44:05 INFO - --DOMWINDOW == 37 (0x7f1176d7a400) [pid = 1950] [serial = 1944] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:05 INFO - --DOMWINDOW == 36 (0x7f1176d88c00) [pid = 1950] [serial = 1951] [outer = (nil)] [url = about:blank]
11:44:05 INFO - --DOMWINDOW == 35 (0x7f1177211800) [pid = 1950] [serial = 1966] [outer = (nil)] [url = about:blank]
11:44:06 INFO - --DOMWINDOW == 34 (0x7f1176fb9400) [pid = 1950] [serial = 1954] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html]
11:44:06 INFO - MEMORY STAT | vsize 1302MB | residentFast 360MB | heapAllocated 139MB
11:44:06 INFO - 310 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js | took 6970ms
11:44:06 INFO - ++DOCSHELL 0x7f11770b1000 == 15 [pid = 1950] [id = 823]
11:44:06 INFO - ++DOMWINDOW == 35 (0x7f11758d8000) [pid = 1950] [serial = 1991] [outer = (nil)]
11:44:06 INFO - ++DOMWINDOW == 36 (0x7f11758e3400) [pid = 1950] [serial = 1992] [outer = 0x7f11758d8000]
11:44:06 INFO - 311 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_for_of.js
11:44:06 INFO - ++DOCSHELL 0x7f117a618000 == 16 [pid = 1950] [id = 824]
11:44:06 INFO - ++DOMWINDOW == 37 (0x7f1176d7d000) [pid = 1950] [serial = 1993] [outer = (nil)]
11:44:06 INFO - ++DOMWINDOW == 38 (0x7f1176d87800) [pid = 1950] [serial = 1994] [outer = 0x7f1176d7d000]
11:44:06 INFO - ++DOMWINDOW == 39 (0x7f118148f800) [pid = 1950] [serial = 1995] [outer = 0x7f1176d7d000]
11:44:07 INFO - ++DOCSHELL 0x7f11770a9800 == 17 [pid = 1950] [id = 825]
11:44:07 INFO - ++DOMWINDOW == 40 (0x7f1176ddb000) [pid = 1950] [serial = 1996] [outer = (nil)]
11:44:07 INFO - ++DOMWINDOW == 41 (0x7f1176ddc000) [pid = 1950] [serial = 1997] [outer = 0x7f1176ddb000]
11:44:07 INFO - ++DOMWINDOW == 42 (0x7f1176cc2400) [pid = 1950] [serial = 1998] [outer = 0x7f1176ddb000]
11:44:07 INFO - ++DOCSHELL 0x7f1181279800 == 18 [pid = 1950] [id = 826]
11:44:07 INFO - ++DOMWINDOW == 43 (0x7f1177207c00) [pid = 1950] [serial = 1999] [outer = (nil)]
11:44:07 INFO - ++DOMWINDOW == 44 (0x7f117720c000) [pid = 1950] [serial = 2000] [outer = 0x7f1177207c00]
11:44:10 INFO - --DOCSHELL 0x7f1176f0c800 == 17 [pid = 1950] [id = 814]
11:44:10 INFO - --DOCSHELL 0x7f1177248000 == 16 [pid = 1950] [id = 815]
11:44:10 INFO - --DOCSHELL 0x7f11810c4800 == 15 [pid = 1950] [id = 819]
11:44:10 INFO - --DOCSHELL 0x7f118a151800 == 14 [pid = 1950] [id = 821]
11:44:10 INFO - --DOCSHELL 0x7f1185a38800 == 13 [pid = 1950] [id = 820]
11:44:10 INFO - --DOCSHELL 0x7f1180e09800 == 12 [pid = 1950] [id = 816]
11:44:11 INFO - --DOMWINDOW == 43 (0x7f117767b000) [pid = 1950] [serial = 1959] [outer = (nil)] [url = about:blank]
11:44:11 INFO - --DOMWINDOW == 42 (0x7f1177208000) [pid = 1950] [serial = 1964] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:44:11 INFO - --DOMWINDOW == 41 (0x7f1175644000) [pid = 1950] [serial = 1976] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:11 INFO - --DOMWINDOW == 40 (0x7f11758ddc00) [pid = 1950] [serial = 1946] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:11 INFO - --DOMWINDOW == 39 (0x7f1176de0c00) [pid = 1950] [serial = 1978] [outer = (nil)] [url = about:blank]
11:44:11 INFO - --DOMWINDOW == 38 (0x7f117767d400) [pid = 1950] [serial = 1980] [outer = (nil)] [url = about:blank]
11:44:11 INFO - --DOMWINDOW == 37 (0x7f1175652c00) [pid = 1950] [serial = 1937] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:11 INFO - --DOMWINDOW == 36 (0x7f117712d800) [pid = 1950] [serial = 1957] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:11 INFO - --DOMWINDOW == 35 (0x7f11776f8000) [pid = 1950] [serial = 1969] [outer = (nil)] [url = about:blank]
11:44:11 INFO - --DOMWINDOW == 34 (0x7f1177134800) [pid = 1950] [serial = 1967] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:11 INFO - --DOCSHELL 0x7f1181279800 == 11 [pid = 1950] [id = 826]
11:44:12 INFO - MEMORY STAT | vsize 1290MB | residentFast 331MB | heapAllocated 131MB
11:44:12 INFO - 312 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_for_of.js | took 5874ms
11:44:12 INFO - ++DOCSHELL 0x7f11770b8800 == 12 [pid = 1950] [id = 827]
11:44:12 INFO - ++DOMWINDOW == 35 (0x7f1175655000) [pid = 1950] [serial = 2001] [outer = (nil)]
11:44:12 INFO - ++DOMWINDOW == 36 (0x7f117565e800) [pid = 1950] [serial = 2002] [outer = 0x7f1175655000]
11:44:12 INFO - 313 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_history.js
11:44:12 INFO - ++DOCSHELL 0x7f1180e04000 == 13 [pid = 1950] [id = 828]
11:44:12 INFO - ++DOMWINDOW == 37 (0x7f11758e0c00) [pid = 1950] [serial = 2003] [outer = (nil)]
11:44:12 INFO - ++DOMWINDOW == 38 (0x7f11758e4800) [pid = 1950] [serial = 2004] [outer = 0x7f11758e0c00]
11:44:12 INFO - ++DOMWINDOW == 39 (0x7f1176d79800) [pid = 1950] [serial = 2005] [outer = 0x7f11758e0c00]
11:44:13 INFO - ++DOCSHELL 0x7f1176f17000 == 14 [pid = 1950] [id = 829]
11:44:13 INFO - ++DOMWINDOW == 40 (0x7f1176cc2c00) [pid = 1950] [serial = 2006] [outer = (nil)]
11:44:13 INFO - ++DOMWINDOW == 41 (0x7f1176db2800) [pid = 1950] [serial = 2007] [outer = 0x7f1176cc2c00]
11:44:13 INFO - ++DOMWINDOW == 42 (0x7f1176d7a400) [pid = 1950] [serial = 2008] [outer = 0x7f1176cc2c00]
11:44:13 INFO - ++DOCSHELL 0x7f11810af000 == 15 [pid = 1950] [id = 830]
11:44:13 INFO - ++DOMWINDOW == 43 (0x7f1176dd7800) [pid = 1950] [serial = 2009] [outer = (nil)]
11:44:13 INFO - ++DOMWINDOW == 44 (0x7f1176dd9c00) [pid = 1950] [serial = 2010] [outer = 0x7f1176dd7800]
11:44:16 INFO - --DOMWINDOW == 43 (0x7f1176d7dc00) [pid = 1950] [serial = 1981] [outer = (nil)] [url = about:blank]
11:44:16 INFO - --DOMWINDOW == 42 (0x7f1177398c00) [pid = 1950] [serial = 1983] [outer = (nil)] [url = http://example.com/]
11:44:16 INFO - --DOMWINDOW == 41 (0x7f1176db3c00) [pid = 1950] [serial = 1982] [outer = (nil)] [url = about:blank]
11:44:16 INFO - --DOMWINDOW == 40 (0x7f1180f38800) [pid = 1950] [serial = 1985] [outer = (nil)] [url = http://example.com/]
11:44:16 INFO - --DOMWINDOW == 39 (0x7f1177683400) [pid = 1950] [serial = 1986] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:16 INFO - --DOMWINDOW == 38 (0x7f1181ee7800) [pid = 1950] [serial = 1989] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:16 INFO - --DOMWINDOW == 37 (0x7f1176d87800) [pid = 1950] [serial = 1994] [outer = (nil)] [url = about:blank]
11:44:16 INFO - --DOMWINDOW == 36 (0x7f1176ddc000) [pid = 1950] [serial = 1997] [outer = (nil)] [url = about:blank]
11:44:17 INFO - MEMORY STAT | vsize 1293MB | residentFast 342MB | heapAllocated 138MB
11:44:17 INFO - 314 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_history.js | took 4424ms
11:44:17 INFO - ++DOCSHELL 0x7f11810c3000 == 16 [pid = 1950] [id = 831]
11:44:17 INFO - ++DOMWINDOW == 37 (0x7f1176dce000) [pid = 1950] [serial = 2011] [outer = (nil)]
11:44:17 INFO - ++DOMWINDOW == 38 (0x7f1176fb6c00) [pid = 1950] [serial = 2012] [outer = 0x7f1176dce000]
11:44:17 INFO - 315 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js
11:44:17 INFO - ++DOCSHELL 0x7f1182798000 == 17 [pid = 1950] [id = 832]
11:44:17 INFO - ++DOMWINDOW == 39 (0x7f11773e3400) [pid = 1950] [serial = 2013] [outer = (nil)]
11:44:17 INFO - ++DOMWINDOW == 40 (0x7f11773e7000) [pid = 1950] [serial = 2014] [outer = 0x7f11773e3400]
11:44:17 INFO - ++DOCSHELL 0x7f1183660800 == 18 [pid = 1950] [id = 833]
11:44:17 INFO - ++DOMWINDOW == 41 (0x7f11773e7c00) [pid = 1950] [serial = 2015] [outer = (nil)]
11:44:17 INFO - ++DOMWINDOW == 42 (0x7f11776f6800) [pid = 1950] [serial = 2016] [outer = 0x7f11773e7c00]
11:44:18 INFO - ++DOMWINDOW == 43 (0x7f1175188800) [pid = 1950] [serial = 2017] [outer = 0x7f11773e7c00]
11:44:18 INFO - ++DOCSHELL 0x7f11846b4000 == 19 [pid = 1950] [id = 834]
11:44:18 INFO - ++DOMWINDOW == 44 (0x7f118114b400) [pid = 1950] [serial = 2018] [outer = (nil)]
11:44:18 INFO - ++DOMWINDOW == 45 (0x7f11812cf000) [pid = 1950] [serial = 2019] [outer = 0x7f118114b400]
11:44:20 INFO - ++DOMWINDOW == 46 (0x7f1182750000) [pid = 1950] [serial = 2020] [outer = 0x7f11773e3400]
11:44:20 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:20 INFO - --DOCSHELL 0x7f11770a9800 == 18 [pid = 1950] [id = 825]
11:44:20 INFO - ++DOMWINDOW == 47 (0x7f1181f54400) [pid = 1950] [serial = 2021] [outer = 0x7f11773e3400]
11:44:21 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:21 INFO - ++DOMWINDOW == 48 (0x7f118242cc00) [pid = 1950] [serial = 2022] [outer = 0x7f11773e3400]
11:44:21 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:22 INFO - ++DOMWINDOW == 49 (0x7f118288e000) [pid = 1950] [serial = 2023] [outer = 0x7f11773e3400]
11:44:22 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:23 INFO - ++DOMWINDOW == 50 (0x7f1183caac00) [pid = 1950] [serial = 2024] [outer = 0x7f11773e3400]
11:44:23 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:23 INFO - ++DOMWINDOW == 51 (0x7f1177210400) [pid = 1950] [serial = 2025] [outer = 0x7f11773e3400]
11:44:23 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:24 INFO - ++DOMWINDOW == 52 (0x7f118461f800) [pid = 1950] [serial = 2026] [outer = 0x7f11773e3400]
11:44:24 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:25 INFO - ++DOMWINDOW == 53 (0x7f11872b1400) [pid = 1950] [serial = 2027] [outer = 0x7f11773e3400]
11:44:25 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:26 INFO - ++DOMWINDOW == 54 (0x7f1185aa8000) [pid = 1950] [serial = 2028] [outer = 0x7f11773e3400]
11:44:26 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:27 INFO - MEMORY STAT | vsize 1297MB | residentFast 359MB | heapAllocated 150MB
11:44:27 INFO - 316 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js | took 9678ms
11:44:27 INFO - ++DOCSHELL 0x7f118151b800 == 19 [pid = 1950] [id = 835]
11:44:27 INFO - ++DOMWINDOW == 55 (0x7f118148c400) [pid = 1950] [serial = 2029] [outer = (nil)]
11:44:27 INFO - ++DOMWINDOW == 56 (0x7f1181493400) [pid = 1950] [serial = 2030] [outer = 0x7f118148c400]
11:44:27 INFO - 317 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js
11:44:27 INFO - ++DOCSHELL 0x7f118aa3b800 == 20 [pid = 1950] [id = 836]
11:44:27 INFO - ++DOMWINDOW == 57 (0x7f1181ee4800) [pid = 1950] [serial = 2031] [outer = (nil)]
11:44:27 INFO - ++DOMWINDOW == 58 (0x7f11838e0400) [pid = 1950] [serial = 2032] [outer = 0x7f1181ee4800]
11:44:28 INFO - ++DOCSHELL 0x7f1176f73000 == 21 [pid = 1950] [id = 837]
11:44:28 INFO - ++DOMWINDOW == 59 (0x7f117563fc00) [pid = 1950] [serial = 2033] [outer = (nil)]
11:44:28 INFO - ++DOMWINDOW == 60 (0x7f1175650400) [pid = 1950] [serial = 2034] [outer = 0x7f117563fc00]
11:44:28 INFO - ++DOMWINDOW == 61 (0x7f1175638c00) [pid = 1950] [serial = 2035] [outer = 0x7f117563fc00]
11:44:28 INFO - ++DOCSHELL 0x7f11810ad000 == 22 [pid = 1950] [id = 838]
11:44:28 INFO - ++DOMWINDOW == 62 (0x7f1176dda800) [pid = 1950] [serial = 2036] [outer = (nil)]
11:44:28 INFO - ++DOMWINDOW == 63 (0x7f1176fb2800) [pid = 1950] [serial = 2037] [outer = 0x7f1176dda800]
11:44:30 INFO - ++DOMWINDOW == 64 (0x7f118148a800) [pid = 1950] [serial = 2038] [outer = 0x7f1181ee4800]
11:44:30 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:31 INFO - ++DOMWINDOW == 65 (0x7f1183fc5400) [pid = 1950] [serial = 2039] [outer = 0x7f1181ee4800]
11:44:31 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:32 INFO - ++DOMWINDOW == 66 (0x7f1187faac00) [pid = 1950] [serial = 2040] [outer = 0x7f1181ee4800]
11:44:32 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:33 INFO - ++DOMWINDOW == 67 (0x7f118a335c00) [pid = 1950] [serial = 2041] [outer = 0x7f1181ee4800]
11:44:33 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:34 INFO - ++DOMWINDOW == 68 (0x7f118a922800) [pid = 1950] [serial = 2042] [outer = 0x7f1181ee4800]
11:44:34 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:35 INFO - ++DOMWINDOW == 69 (0x7f118a940400) [pid = 1950] [serial = 2043] [outer = 0x7f1181ee4800]
11:44:35 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:44:36 INFO - MEMORY STAT | vsize 1301MB | residentFast 373MB | heapAllocated 157MB
11:44:36 INFO - 318 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js | took 9311ms
11:44:36 INFO - ++DOCSHELL 0x7f118150e800 == 23 [pid = 1950] [id = 839]
11:44:36 INFO - ++DOMWINDOW == 70 (0x7f117720dc00) [pid = 1950] [serial = 2044] [outer = (nil)]
11:44:36 INFO - ++DOMWINDOW == 71 (0x7f117767f000) [pid = 1950] [serial = 2045] [outer = 0x7f117720dc00]
11:44:37 INFO - 319 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js
11:44:37 INFO - ++DOCSHELL 0x7f118de31000 == 24 [pid = 1950] [id = 840]
11:44:37 INFO - ++DOMWINDOW == 72 (0x7f118a912800) [pid = 1950] [serial = 2046] [outer = (nil)]
11:44:37 INFO - ++DOMWINDOW == 73 (0x7f118a945800) [pid = 1950] [serial = 2047] [outer = 0x7f118a912800]
11:44:38 INFO - ++DOCSHELL 0x7f119040f800 == 25 [pid = 1950] [id = 841]
11:44:38 INFO - ++DOMWINDOW == 74 (0x7f118a9bb000) [pid = 1950] [serial = 2048] [outer = (nil)]
11:44:38 INFO - ++DOMWINDOW == 75 (0x7f118ce9ac00) [pid = 1950] [serial = 2049] [outer = 0x7f118a9bb000]
11:44:38 INFO - ++DOMWINDOW == 76 (0x7f118a9b7000) [pid = 1950] [serial = 2050] [outer = 0x7f118a9bb000]
11:44:39 INFO - ++DOCSHELL 0x7f119096c800 == 26 [pid = 1950] [id = 842]
11:44:39 INFO - ++DOMWINDOW == 77 (0x7f118d56a800) [pid = 1950] [serial = 2051] [outer = (nil)]
11:44:39 INFO - ++DOMWINDOW == 78 (0x7f118d56d000) [pid = 1950] [serial = 2052] [outer = 0x7f118d56a800]
11:44:40 INFO - ++DOCSHELL 0x7f119143b800 == 27 [pid = 1950] [id = 843]
11:44:40 INFO - ++DOMWINDOW == 79 (0x7f118ce90400) [pid = 1950] [serial = 2053] [outer = (nil)]
11:44:40 INFO - ++DOMWINDOW == 80 (0x7f118db97c00) [pid = 1950] [serial = 2054] [outer = 0x7f118ce90400]
11:44:41 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:44:41 INFO - ++DOCSHELL 0x7f119104f800 == 28 [pid = 1950] [id = 844]
11:44:41 INFO - ++DOMWINDOW == 81 (0x7f11a3853800) [pid = 1950] [serial = 2055] [outer = (nil)]
11:44:41 INFO - ++DOMWINDOW == 82 (0x7f11812d8c00) [pid = 1950] [serial = 2056] [outer = 0x7f11a3853800]
11:44:43 INFO - --DOCSHELL 0x7f117a618000 == 27 [pid = 1950] [id = 824]
11:44:43 INFO - --DOCSHELL 0x7f11770b1000 == 26 [pid = 1950] [id = 823]
11:44:43 INFO - --DOCSHELL 0x7f11770b8800 == 25 [pid = 1950] [id = 827]
11:44:43 INFO - --DOCSHELL 0x7f1176f17000 == 24 [pid = 1950] [id = 829]
11:44:43 INFO - --DOCSHELL 0x7f11810af000 == 23 [pid = 1950] [id = 830]
11:44:43 INFO - --DOCSHELL 0x7f1180e04000 == 22 [pid = 1950] [id = 828]
11:44:43 INFO - --DOCSHELL 0x7f11846b4000 == 21 [pid = 1950] [id = 834]
11:44:44 INFO - --DOCSHELL 0x7f11810ad000 == 20 [pid = 1950] [id = 838]
11:44:44 INFO - --DOMWINDOW == 81 (0x7f117712ec00) [pid = 1950] [serial = 1988] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:44 INFO - --DOMWINDOW == 80 (0x7f1181f53c00) [pid = 1950] [serial = 1990] [outer = (nil)] [url = about:blank]
11:44:44 INFO - --DOCSHELL 0x7f119104f800 == 19 [pid = 1950] [id = 844]
11:44:44 INFO - --DOCSHELL 0x7f119143b800 == 18 [pid = 1950] [id = 843]
11:44:44 INFO - --DOCSHELL 0x7f119096c800 == 17 [pid = 1950] [id = 842]
11:44:45 INFO - MEMORY STAT | vsize 1298MB | residentFast 368MB | heapAllocated 146MB
11:44:45 INFO - 320 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js | took 8224ms
11:44:45 INFO - ++DOCSHELL 0x7f1176f8b000 == 18 [pid = 1950] [id = 845]
11:44:45 INFO - ++DOMWINDOW == 81 (0x7f11758dd000) [pid = 1950] [serial = 2057] [outer = (nil)]
11:44:45 INFO - ++DOMWINDOW == 82 (0x7f1176cc9800) [pid = 1950] [serial = 2058] [outer = 0x7f11758dd000]
11:44:45 INFO - 321 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js
11:44:45 INFO - ++DOCSHELL 0x7f1177253800 == 19 [pid = 1950] [id = 846]
11:44:45 INFO - ++DOMWINDOW == 83 (0x7f1176d7c000) [pid = 1950] [serial = 2059] [outer = (nil)]
11:44:45 INFO - ++DOMWINDOW == 84 (0x7f1176d86400) [pid = 1950] [serial = 2060] [outer = 0x7f1176d7c000]
11:44:46 INFO - ++DOCSHELL 0x7f1177251000 == 20 [pid = 1950] [id = 847]
11:44:46 INFO - ++DOMWINDOW == 85 (0x7f1176d87c00) [pid = 1950] [serial = 2061] [outer = (nil)]
11:44:46 INFO - ++DOMWINDOW == 86 (0x7f1176dcc000) [pid = 1950] [serial = 2062] [outer = 0x7f1176d87c00]
11:44:46 INFO - ++DOMWINDOW == 87 (0x7f11758e5800) [pid = 1950] [serial = 2063] [outer = 0x7f1176d87c00]
11:44:46 INFO - ++DOCSHELL 0x7f11810c1800 == 21 [pid = 1950] [id = 848]
11:44:46 INFO - ++DOMWINDOW == 88 (0x7f1176edb800) [pid = 1950] [serial = 2064] [outer = (nil)]
11:44:46 INFO - ++DOMWINDOW == 89 (0x7f1176fac400) [pid = 1950] [serial = 2065] [outer = 0x7f1176edb800]
11:44:49 INFO - ++DOCSHELL 0x7f118365e000 == 22 [pid = 1950] [id = 849]
11:44:49 INFO - ++DOMWINDOW == 90 (0x7f11776f0c00) [pid = 1950] [serial = 2066] [outer = (nil)]
11:44:49 INFO - ++DOMWINDOW == 91 (0x7f1180f2ec00) [pid = 1950] [serial = 2067] [outer = 0x7f11776f0c00]
11:44:49 INFO - --DOMWINDOW == 90 (0x7f1176ddb000) [pid = 1950] [serial = 1996] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:49 INFO - --DOMWINDOW == 89 (0x7f118148c400) [pid = 1950] [serial = 2029] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 88 (0x7f1181ee4800) [pid = 1950] [serial = 2031] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge]
11:44:49 INFO - --DOMWINDOW == 87 (0x7f1176dd7800) [pid = 1950] [serial = 2009] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:49 INFO - --DOMWINDOW == 86 (0x7f1177207c00) [pid = 1950] [serial = 1999] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:49 INFO - --DOMWINDOW == 85 (0x7f1176cc2c00) [pid = 1950] [serial = 2006] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:49 INFO - --DOMWINDOW == 84 (0x7f11758d8000) [pid = 1950] [serial = 1991] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 83 (0x7f1176d7d000) [pid = 1950] [serial = 1993] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html]
11:44:49 INFO - --DOMWINDOW == 82 (0x7f1175655000) [pid = 1950] [serial = 2001] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 81 (0x7f11758e0c00) [pid = 1950] [serial = 2003] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:44:49 INFO - --DOMWINDOW == 80 (0x7f1176dce000) [pid = 1950] [serial = 2011] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 79 (0x7f11773e3400) [pid = 1950] [serial = 2013] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch]
11:44:49 INFO - --DOMWINDOW == 78 (0x7f1175650400) [pid = 1950] [serial = 2034] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 77 (0x7f1181493400) [pid = 1950] [serial = 2030] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 76 (0x7f11838e0400) [pid = 1950] [serial = 2032] [outer = (nil)] [url = about:blank]
11:44:49 INFO - --DOMWINDOW == 75 (0x7f11758e3400) [pid = 1950] [serial = 1992] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 74 (0x7f117565e800) [pid = 1950] [serial = 2002] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 73 (0x7f11758e4800) [pid = 1950] [serial = 2004] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 72 (0x7f1176fb6c00) [pid = 1950] [serial = 2012] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 71 (0x7f11773e7000) [pid = 1950] [serial = 2014] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 70 (0x7f118ce9ac00) [pid = 1950] [serial = 2049] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 69 (0x7f1176db2800) [pid = 1950] [serial = 2007] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 68 (0x7f11776f6800) [pid = 1950] [serial = 2016] [outer = (nil)] [url = about:blank]
11:44:50 INFO - --DOMWINDOW == 67 (0x7f118148a800) [pid = 1950] [serial = 2038] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?badSyntax]
11:44:50 INFO - --DOMWINDOW == 66 (0x7f118148f800) [pid = 1950] [serial = 1995] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html]
11:44:50 INFO - --DOMWINDOW == 65 (0x7f1182750000) [pid = 1950] [serial = 2020] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?badSyntax]
11:44:50 INFO - --DOMWINDOW == 64 (0x7f1181f54400) [pid = 1950] [serial = 2021] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?noMaxAge]
11:44:50 INFO - --DOMWINDOW == 63 (0x7f118242cc00) [pid = 1950] [serial = 2022] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidIncludeSubDomains]
11:44:50 INFO - --DOMWINDOW == 62 (0x7f118288e000) [pid = 1950] [serial = 2023] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidMaxAge]
11:44:50 INFO - --DOMWINDOW == 61 (0x7f1183caac00) [pid = 1950] [serial = 2024] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleIncludeSubDomains]
11:44:50 INFO - --DOMWINDOW == 60 (0x7f1177210400) [pid = 1950] [serial = 2025] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleMaxAge]
11:44:50 INFO - --DOMWINDOW == 59 (0x7f118461f800) [pid = 1950] [serial = 2026] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleReportURIs]
11:44:50 INFO - --DOMWINDOW == 58 (0x7f11872b1400) [pid = 1950] [serial = 2027] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch]
11:44:50 INFO - --DOMWINDOW == 57 (0x7f1185aa8000) [pid = 1950] [serial = 2028] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch]
11:44:50 INFO - --DOMWINDOW == 56 (0x7f118a940400) [pid = 1950] [serial = 2043] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge]
11:44:50 INFO - --DOMWINDOW == 55 (0x7f118a922800) [pid = 1950] [serial = 2042] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleIncludeSubDomains]
11:44:50 INFO - --DOMWINDOW == 54 (0x7f1187faac00) [pid = 1950] [serial = 2040] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidIncludeSubDomains]
11:44:50 INFO - --DOMWINDOW == 53 (0x7f118a335c00) [pid = 1950] [serial = 2041] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidMaxAge]
11:44:50 INFO - --DOMWINDOW == 52 (0x7f1183fc5400) [pid = 1950] [serial = 2039] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?noMaxAge]
11:44:51 INFO - ++DOCSHELL 0x7f11853ef800 == 23 [pid = 1950] [id = 850]
11:44:51 INFO - ++DOMWINDOW == 53 (0x7f1181491c00) [pid = 1950] [serial = 2068] [outer = (nil)]
11:44:51 INFO - ++DOMWINDOW == 54 (0x7f1181497000) [pid = 1950] [serial = 2069] [outer = 0x7f1181491c00]
11:44:53 INFO - --DOCSHELL 0x7f119040f800 == 22 [pid = 1950] [id = 841]
11:44:53 INFO - --DOCSHELL 0x7f118151b800 == 21 [pid = 1950] [id = 835]
11:44:53 INFO - --DOCSHELL 0x7f118aa3b800 == 20 [pid = 1950] [id = 836]
11:44:53 INFO - --DOCSHELL 0x7f1183660800 == 19 [pid = 1950] [id = 833]
11:44:53 INFO - --DOCSHELL 0x7f1176f73000 == 18 [pid = 1950] [id = 837]
11:44:53 INFO - --DOCSHELL 0x7f118de31000 == 17 [pid = 1950] [id = 840]
11:44:53 INFO - --DOCSHELL 0x7f118365e000 == 16 [pid = 1950] [id = 849]
11:44:53 INFO - --DOCSHELL 0x7f118150e800 == 15 [pid = 1950] [id = 839]
11:44:53 INFO - --DOCSHELL 0x7f1182798000 == 14 [pid = 1950] [id = 832]
11:44:53 INFO - --DOCSHELL 0x7f11810c3000 == 13 [pid = 1950] [id = 831]
11:44:53 INFO - --DOCSHELL 0x7f11853ef800 == 12 [pid = 1950] [id = 850]
11:44:54 INFO - --DOMWINDOW == 53 (0x7f1176d79800) [pid = 1950] [serial = 2005] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:44:54 INFO - --DOMWINDOW == 52 (0x7f1176cc2400) [pid = 1950] [serial = 1998] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:54 INFO - --DOMWINDOW == 51 (0x7f1176d7a400) [pid = 1950] [serial = 2008] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:54 INFO - --DOMWINDOW == 50 (0x7f117720c000) [pid = 1950] [serial = 2000] [outer = (nil)] [url = about:blank]
11:44:54 INFO - --DOMWINDOW == 49 (0x7f1176dd9c00) [pid = 1950] [serial = 2010] [outer = (nil)] [url = about:blank]
11:44:54 INFO - ++DOCSHELL 0x7f11770bb800 == 13 [pid = 1950] [id = 851]
11:44:54 INFO - ++DOMWINDOW == 50 (0x7f1175652c00) [pid = 1950] [serial = 2070] [outer = (nil)]
11:44:54 INFO - ++DOMWINDOW == 51 (0x7f1175654000) [pid = 1950] [serial = 2071] [outer = 0x7f1175652c00]
11:44:54 INFO - --DOCSHELL 0x7f11810c1800 == 12 [pid = 1950] [id = 848]
11:44:56 INFO - MEMORY STAT | vsize 1293MB | residentFast 363MB | heapAllocated 147MB
11:44:56 INFO - 322 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js | took 10363ms
11:44:56 INFO - ++DOCSHELL 0x7f11770c9000 == 13 [pid = 1950] [id = 852]
11:44:56 INFO - ++DOMWINDOW == 52 (0x7f1176dc2800) [pid = 1950] [serial = 2072] [outer = (nil)]
11:44:56 INFO - ++DOMWINDOW == 53 (0x7f1176dcbc00) [pid = 1950] [serial = 2073] [outer = 0x7f1176dc2800]
11:44:56 INFO - 323 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js
11:44:56 INFO - ++DOCSHELL 0x7f1176f88800 == 14 [pid = 1950] [id = 853]
11:44:56 INFO - ++DOMWINDOW == 54 (0x7f1176dd4400) [pid = 1950] [serial = 2074] [outer = (nil)]
11:44:56 INFO - ++DOMWINDOW == 55 (0x7f1176dd7c00) [pid = 1950] [serial = 2075] [outer = 0x7f1176dd4400]
11:44:56 INFO - ++DOMWINDOW == 56 (0x7f1176ee0c00) [pid = 1950] [serial = 2076] [outer = 0x7f1176dd4400]
11:44:57 INFO - ++DOCSHELL 0x7f11773ba800 == 15 [pid = 1950] [id = 854]
11:44:57 INFO - ++DOMWINDOW == 57 (0x7f1176dd9400) [pid = 1950] [serial = 2077] [outer = (nil)]
11:44:57 INFO - ++DOMWINDOW == 58 (0x7f117564fc00) [pid = 1950] [serial = 2078] [outer = 0x7f1176dd9400]
11:44:57 INFO - ++DOMWINDOW == 59 (0x7f1176ee3c00) [pid = 1950] [serial = 2079] [outer = 0x7f1176dd9400]
11:44:57 INFO - ++DOCSHELL 0x7f11827a0800 == 16 [pid = 1950] [id = 855]
11:44:57 INFO - ++DOMWINDOW == 60 (0x7f1177204400) [pid = 1950] [serial = 2080] [outer = (nil)]
11:44:57 INFO - ++DOMWINDOW == 61 (0x7f1177207c00) [pid = 1950] [serial = 2081] [outer = 0x7f1177204400]
11:44:59 INFO - --DOMWINDOW == 60 (0x7f117563fc00) [pid = 1950] [serial = 2033] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:59 INFO - --DOMWINDOW == 59 (0x7f11773e7c00) [pid = 1950] [serial = 2015] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:44:59 INFO - --DOMWINDOW == 58 (0x7f11a3853800) [pid = 1950] [serial = 2055] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:44:59 INFO - --DOMWINDOW == 57 (0x7f118ce90400) [pid = 1950] [serial = 2053] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:44:59 INFO - --DOMWINDOW == 56 (0x7f118d56a800) [pid = 1950] [serial = 2051] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:59 INFO - --DOMWINDOW == 55 (0x7f118114b400) [pid = 1950] [serial = 2018] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:59 INFO - --DOMWINDOW == 54 (0x7f118a912800) [pid = 1950] [serial = 2046] [outer = (nil)] [url = data:text/html;charset=utf8,hello]
11:44:59 INFO - --DOMWINDOW == 53 (0x7f117720dc00) [pid = 1950] [serial = 2044] [outer = (nil)] [url = about:blank]
11:44:59 INFO - --DOMWINDOW == 52 (0x7f11776f0c00) [pid = 1950] [serial = 2066] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:44:59 INFO - --DOMWINDOW == 51 (0x7f118a945800) [pid = 1950] [serial = 2047] [outer = (nil)] [url = about:blank]
11:44:59 INFO - --DOMWINDOW == 50 (0x7f117767f000) [pid = 1950] [serial = 2045] [outer = (nil)] [url = about:blank]
11:44:59 INFO - --DOMWINDOW == 49 (0x7f1176dcc000) [pid = 1950] [serial = 2062] [outer = (nil)] [url = about:blank]
11:44:59 INFO - --DOMWINDOW == 48 (0x7f1176dda800) [pid = 1950] [serial = 2036] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:44:59 INFO - --DOMWINDOW == 47 (0x7f118a9bb000) [pid = 1950] [serial = 2048] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:01 INFO - MEMORY STAT | vsize 1296MB | residentFast 366MB | heapAllocated 153MB
11:45:01 INFO - 324 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js | took 4571ms
11:45:01 INFO - ++DOCSHELL 0x7f1176f79800 == 17 [pid = 1950] [id = 856]
11:45:01 INFO - ++DOMWINDOW == 48 (0x7f1177207000) [pid = 1950] [serial = 2082] [outer = (nil)]
11:45:01 INFO - ++DOMWINDOW == 49 (0x7f1177674c00) [pid = 1950] [serial = 2083] [outer = 0x7f1177207000]
11:45:01 INFO - 325 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_jsterm.js
11:45:01 INFO - ++DOCSHELL 0x7f1187d84800 == 18 [pid = 1950] [id = 857]
11:45:01 INFO - ++DOMWINDOW == 50 (0x7f118114ec00) [pid = 1950] [serial = 2084] [outer = (nil)]
11:45:01 INFO - ++DOMWINDOW == 51 (0x7f11812d2000) [pid = 1950] [serial = 2085] [outer = 0x7f118114ec00]
11:45:01 INFO - ++DOMWINDOW == 52 (0x7f1181d19800) [pid = 1950] [serial = 2086] [outer = 0x7f118114ec00]
11:45:02 INFO - ++DOCSHELL 0x7f1176f7d800 == 19 [pid = 1950] [id = 858]
11:45:02 INFO - ++DOMWINDOW == 53 (0x7f1175636400) [pid = 1950] [serial = 2087] [outer = (nil)]
11:45:02 INFO - ++DOMWINDOW == 54 (0x7f11758d6800) [pid = 1950] [serial = 2088] [outer = 0x7f1175636400]
11:45:02 INFO - ++DOMWINDOW == 55 (0x7f1175655c00) [pid = 1950] [serial = 2089] [outer = 0x7f1175636400]
11:45:03 INFO - ++DOCSHELL 0x7f118150d800 == 20 [pid = 1950] [id = 859]
11:45:03 INFO - ++DOMWINDOW == 56 (0x7f1177208c00) [pid = 1950] [serial = 2090] [outer = (nil)]
11:45:03 INFO - ++DOMWINDOW == 57 (0x7f117720e400) [pid = 1950] [serial = 2091] [outer = 0x7f1177208c00]
11:45:06 INFO - --DOCSHELL 0x7f11770bb800 == 19 [pid = 1950] [id = 851]
11:45:06 INFO - --DOCSHELL 0x7f1177251000 == 18 [pid = 1950] [id = 847]
11:45:06 INFO - --DOCSHELL 0x7f1177253800 == 17 [pid = 1950] [id = 846]
11:45:06 INFO - --DOCSHELL 0x7f1176f8b000 == 16 [pid = 1950] [id = 845]
11:45:06 INFO - --DOCSHELL 0x7f11827a0800 == 15 [pid = 1950] [id = 855]
11:45:06 INFO - --DOMWINDOW == 56 (0x7f1175638c00) [pid = 1950] [serial = 2035] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:06 INFO - --DOMWINDOW == 55 (0x7f1175188800) [pid = 1950] [serial = 2017] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:06 INFO - --DOMWINDOW == 54 (0x7f1180f2ec00) [pid = 1950] [serial = 2067] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:45:06 INFO - --DOMWINDOW == 53 (0x7f11812d8c00) [pid = 1950] [serial = 2056] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:45:06 INFO - --DOMWINDOW == 52 (0x7f118db97c00) [pid = 1950] [serial = 2054] [outer = (nil)] [url = about:blank]
11:45:06 INFO - --DOMWINDOW == 51 (0x7f118d56d000) [pid = 1950] [serial = 2052] [outer = (nil)] [url = about:blank]
11:45:06 INFO - --DOMWINDOW == 50 (0x7f11812cf000) [pid = 1950] [serial = 2019] [outer = (nil)] [url = about:blank]
11:45:06 INFO - --DOMWINDOW == 49 (0x7f1176fb2800) [pid = 1950] [serial = 2037] [outer = (nil)] [url = about:blank]
11:45:06 INFO - --DOMWINDOW == 48 (0x7f118a9b7000) [pid = 1950] [serial = 2050] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:10 INFO - --DOCSHELL 0x7f118150d800 == 14 [pid = 1950] [id = 859]
11:45:11 INFO - MEMORY STAT | vsize 1298MB | residentFast 360MB | heapAllocated 144MB
11:45:11 INFO - 326 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_jsterm.js | took 9843ms
11:45:11 INFO - ++DOCSHELL 0x7f11773ba000 == 15 [pid = 1950] [id = 860]
11:45:11 INFO - ++DOMWINDOW == 49 (0x7f1176cc4c00) [pid = 1950] [serial = 2092] [outer = (nil)]
11:45:11 INFO - ++DOMWINDOW == 50 (0x7f1176de1800) [pid = 1950] [serial = 2093] [outer = 0x7f1176cc4c00]
11:45:11 INFO - --DOMWINDOW == 49 (0x7f1181491c00) [pid = 1950] [serial = 2068] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:45:11 INFO - --DOMWINDOW == 48 (0x7f1176dd9400) [pid = 1950] [serial = 2077] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:11 INFO - --DOMWINDOW == 47 (0x7f11758dd000) [pid = 1950] [serial = 2057] [outer = (nil)] [url = about:blank]
11:45:11 INFO - --DOMWINDOW == 46 (0x7f1176dc2800) [pid = 1950] [serial = 2072] [outer = (nil)] [url = about:blank]
11:45:11 INFO - --DOMWINDOW == 45 (0x7f1176dd4400) [pid = 1950] [serial = 2074] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:11 INFO - --DOMWINDOW == 44 (0x7f1176d87c00) [pid = 1950] [serial = 2061] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:11 INFO - --DOMWINDOW == 43 (0x7f1175652c00) [pid = 1950] [serial = 2070] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:45:11 INFO - --DOMWINDOW == 42 (0x7f1176d7c000) [pid = 1950] [serial = 2059] [outer = (nil)] [url = data:text/html;charset=utf8,browser_webconsole_inspect-parsed-documents.js]
11:45:11 INFO - --DOMWINDOW == 41 (0x7f1177204400) [pid = 1950] [serial = 2080] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:11 INFO - --DOMWINDOW == 40 (0x7f1176edb800) [pid = 1950] [serial = 2064] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:11 INFO - --DOMWINDOW == 39 (0x7f117564fc00) [pid = 1950] [serial = 2078] [outer = (nil)] [url = about:blank]
11:45:11 INFO - --DOMWINDOW == 38 (0x7f1176cc9800) [pid = 1950] [serial = 2058] [outer = (nil)] [url = about:blank]
11:45:11 INFO - --DOMWINDOW == 37 (0x7f1176dcbc00) [pid = 1950] [serial = 2073] [outer = (nil)] [url = about:blank]
11:45:11 INFO - --DOMWINDOW == 36 (0x7f1176dd7c00) [pid = 1950] [serial = 2075] [outer = (nil)] [url = about:blank]
11:45:11 INFO - 327 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js
11:45:11 INFO - ++DOCSHELL 0x7f11810b4000 == 16 [pid = 1950] [id = 861]
11:45:11 INFO - ++DOMWINDOW == 37 (0x7f1176cc9800) [pid = 1950] [serial = 2094] [outer = (nil)]
11:45:11 INFO - ++DOMWINDOW == 38 (0x7f1176fb8000) [pid = 1950] [serial = 2095] [outer = 0x7f1176cc9800]
11:45:11 INFO - ++DOMWINDOW == 39 (0x7f117712d800) [pid = 1950] [serial = 2096] [outer = 0x7f1176cc9800]
11:45:12 INFO - ++DOCSHELL 0x7f1177259800 == 17 [pid = 1950] [id = 862]
11:45:12 INFO - ++DOMWINDOW == 40 (0x7f1176fba000) [pid = 1950] [serial = 2097] [outer = (nil)]
11:45:12 INFO - ++DOMWINDOW == 41 (0x7f1177203400) [pid = 1950] [serial = 2098] [outer = 0x7f1176fba000]
11:45:12 INFO - ++DOMWINDOW == 42 (0x7f1176fb7400) [pid = 1950] [serial = 2099] [outer = 0x7f1176fba000]
11:45:12 INFO - ++DOCSHELL 0x7f1182490000 == 18 [pid = 1950] [id = 863]
11:45:12 INFO - ++DOMWINDOW == 43 (0x7f11773ec000) [pid = 1950] [serial = 2100] [outer = (nil)]
11:45:12 INFO - ++DOMWINDOW == 44 (0x7f11773eec00) [pid = 1950] [serial = 2101] [outer = 0x7f11773ec000]
11:45:16 INFO - MEMORY STAT | vsize 1301MB | residentFast 365MB | heapAllocated 147MB
11:45:16 INFO - 328 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js | took 4923ms
11:45:16 INFO - ++DOCSHELL 0x7f11770b4800 == 19 [pid = 1950] [id = 864]
11:45:16 INFO - ++DOMWINDOW == 45 (0x7f117712e800) [pid = 1950] [serial = 2102] [outer = (nil)]
11:45:16 INFO - ++DOMWINDOW == 46 (0x7f1177208400) [pid = 1950] [serial = 2103] [outer = 0x7f117712e800]
11:45:16 INFO - 329 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js
11:45:16 INFO - ++DOCSHELL 0x7f11826ba000 == 20 [pid = 1950] [id = 865]
11:45:16 INFO - ++DOMWINDOW == 47 (0x7f11776f5c00) [pid = 1950] [serial = 2104] [outer = (nil)]
11:45:16 INFO - ++DOMWINDOW == 48 (0x7f1180f2fc00) [pid = 1950] [serial = 2105] [outer = 0x7f11776f5c00]
11:45:17 INFO - ++DOMWINDOW == 49 (0x7f1180f31c00) [pid = 1950] [serial = 2106] [outer = 0x7f11776f5c00]
11:45:17 INFO - ++DOCSHELL 0x7f1183e2c800 == 21 [pid = 1950] [id = 866]
11:45:17 INFO - ++DOMWINDOW == 50 (0x7f118242c400) [pid = 1950] [serial = 2107] [outer = (nil)]
11:45:17 INFO - ++DOMWINDOW == 51 (0x7f118242dc00) [pid = 1950] [serial = 2108] [outer = 0x7f118242c400]
11:45:17 INFO - ++DOMWINDOW == 52 (0x7f1181f55000) [pid = 1950] [serial = 2109] [outer = 0x7f118242c400]
11:45:18 INFO - ++DOCSHELL 0x7f1185a2d800 == 22 [pid = 1950] [id = 867]
11:45:18 INFO - ++DOMWINDOW == 53 (0x7f1177676000) [pid = 1950] [serial = 2110] [outer = (nil)]
11:45:18 INFO - ++DOMWINDOW == 54 (0x7f11835a1000) [pid = 1950] [serial = 2111] [outer = 0x7f1177676000]
11:45:23 INFO - MEMORY STAT | vsize 1304MB | residentFast 374MB | heapAllocated 156MB
11:45:23 INFO - 330 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js | took 6418ms
11:45:23 INFO - ++DOCSHELL 0x7f11810ac000 == 23 [pid = 1950] [id = 868]
11:45:23 INFO - ++DOMWINDOW == 55 (0x7f118274f400) [pid = 1950] [serial = 2112] [outer = (nil)]
11:45:23 INFO - ++DOMWINDOW == 56 (0x7f11838c1c00) [pid = 1950] [serial = 2113] [outer = 0x7f118274f400]
11:45:23 INFO - 331 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js
11:45:23 INFO - ++DOCSHELL 0x7f118d531000 == 24 [pid = 1950] [id = 869]
11:45:23 INFO - ++DOMWINDOW == 57 (0x7f11858f6c00) [pid = 1950] [serial = 2114] [outer = (nil)]
11:45:23 INFO - ++DOMWINDOW == 58 (0x7f1185aa4800) [pid = 1950] [serial = 2115] [outer = 0x7f11858f6c00]
11:45:24 INFO - ++DOMWINDOW == 59 (0x7f118db0ac00) [pid = 1950] [serial = 2116] [outer = 0x7f11858f6c00]
11:45:24 INFO - ++DOCSHELL 0x7f118d5e2800 == 25 [pid = 1950] [id = 870]
11:45:24 INFO - ++DOMWINDOW == 60 (0x7f118a923400) [pid = 1950] [serial = 2117] [outer = (nil)]
11:45:24 INFO - ++DOMWINDOW == 61 (0x7f118a93d000) [pid = 1950] [serial = 2118] [outer = 0x7f118a923400]
11:45:24 INFO - ++DOMWINDOW == 62 (0x7f118242ac00) [pid = 1950] [serial = 2119] [outer = 0x7f118a923400]
11:45:25 INFO - ++DOCSHELL 0x7f118de43800 == 26 [pid = 1950] [id = 871]
11:45:25 INFO - ++DOMWINDOW == 63 (0x7f118a9bb000) [pid = 1950] [serial = 2120] [outer = (nil)]
11:45:25 INFO - ++DOMWINDOW == 64 (0x7f118a9c0000) [pid = 1950] [serial = 2121] [outer = 0x7f118a9bb000]
11:45:27 INFO - MEMORY STAT | vsize 1305MB | residentFast 382MB | heapAllocated 162MB
11:45:27 INFO - 332 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js | took 4244ms
11:45:27 INFO - ++DOCSHELL 0x7f11907bc000 == 27 [pid = 1950] [id = 872]
11:45:27 INFO - ++DOMWINDOW == 65 (0x7f118260e800) [pid = 1950] [serial = 2122] [outer = (nil)]
11:45:27 INFO - ++DOMWINDOW == 66 (0x7f118a9b8400) [pid = 1950] [serial = 2123] [outer = 0x7f118260e800]
11:45:28 INFO - 333 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_message_node_id.js
11:45:28 INFO - ++DOCSHELL 0x7f118db54800 == 28 [pid = 1950] [id = 873]
11:45:28 INFO - ++DOMWINDOW == 67 (0x7f118d566000) [pid = 1950] [serial = 2124] [outer = (nil)]
11:45:28 INFO - ++DOMWINDOW == 68 (0x7f118d570800) [pid = 1950] [serial = 2125] [outer = 0x7f118d566000]
11:45:28 INFO - ++DOMWINDOW == 69 (0x7f118db04000) [pid = 1950] [serial = 2126] [outer = 0x7f118d566000]
11:45:29 INFO - ++DOCSHELL 0x7f119199a000 == 29 [pid = 1950] [id = 874]
11:45:29 INFO - ++DOMWINDOW == 70 (0x7f118d9eb400) [pid = 1950] [serial = 2127] [outer = (nil)]
11:45:29 INFO - ++DOMWINDOW == 71 (0x7f118dda7000) [pid = 1950] [serial = 2128] [outer = 0x7f118d9eb400]
11:45:29 INFO - ++DOMWINDOW == 72 (0x7f118ce99400) [pid = 1950] [serial = 2129] [outer = 0x7f118d9eb400]
11:45:29 INFO - ++DOCSHELL 0x7f119c269800 == 30 [pid = 1950] [id = 875]
11:45:29 INFO - ++DOMWINDOW == 73 (0x7f118a93d800) [pid = 1950] [serial = 2130] [outer = (nil)]
11:45:29 INFO - ++DOMWINDOW == 74 (0x7f11916cf400) [pid = 1950] [serial = 2131] [outer = 0x7f118a93d800]
11:45:32 INFO - --DOCSHELL 0x7f1176f7d800 == 29 [pid = 1950] [id = 858]
11:45:32 INFO - --DOCSHELL 0x7f1176f88800 == 28 [pid = 1950] [id = 853]
11:45:32 INFO - --DOCSHELL 0x7f1177259800 == 27 [pid = 1950] [id = 862]
11:45:32 INFO - --DOCSHELL 0x7f1182490000 == 26 [pid = 1950] [id = 863]
11:45:32 INFO - --DOCSHELL 0x7f1176f79800 == 25 [pid = 1950] [id = 856]
11:45:32 INFO - --DOCSHELL 0x7f1187d84800 == 24 [pid = 1950] [id = 857]
11:45:32 INFO - --DOCSHELL 0x7f11773ba800 == 23 [pid = 1950] [id = 854]
11:45:32 INFO - --DOCSHELL 0x7f1185a2d800 == 22 [pid = 1950] [id = 867]
11:45:32 INFO - --DOCSHELL 0x7f11770c9000 == 21 [pid = 1950] [id = 852]
11:45:32 INFO - --DOCSHELL 0x7f118de43800 == 20 [pid = 1950] [id = 871]
11:45:32 INFO - --DOMWINDOW == 73 (0x7f1181497000) [pid = 1950] [serial = 2069] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:45:32 INFO - --DOMWINDOW == 72 (0x7f11758e5800) [pid = 1950] [serial = 2063] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:32 INFO - --DOMWINDOW == 71 (0x7f1175654000) [pid = 1950] [serial = 2071] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:45:32 INFO - --DOMWINDOW == 70 (0x7f1176ee0c00) [pid = 1950] [serial = 2076] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:32 INFO - --DOMWINDOW == 69 (0x7f1176d86400) [pid = 1950] [serial = 2060] [outer = (nil)] [url = about:blank]
11:45:32 INFO - --DOMWINDOW == 68 (0x7f1176ee3c00) [pid = 1950] [serial = 2079] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:32 INFO - --DOMWINDOW == 67 (0x7f1176fac400) [pid = 1950] [serial = 2065] [outer = (nil)] [url = about:blank]
11:45:32 INFO - --DOMWINDOW == 66 (0x7f1177207c00) [pid = 1950] [serial = 2081] [outer = (nil)] [url = about:blank]
11:45:33 INFO - --DOCSHELL 0x7f119c269800 == 19 [pid = 1950] [id = 875]
11:45:33 INFO - MEMORY STAT | vsize 1303MB | residentFast 380MB | heapAllocated 149MB
11:45:33 INFO - 334 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_message_node_id.js | took 5243ms
11:45:33 INFO - ++DOCSHELL 0x7f1176f7d800 == 20 [pid = 1950] [id = 876]
11:45:33 INFO - ++DOMWINDOW == 67 (0x7f11758d8800) [pid = 1950] [serial = 2132] [outer = (nil)]
11:45:33 INFO - ++DOMWINDOW == 68 (0x7f1176cc5000) [pid = 1950] [serial = 2133] [outer = 0x7f11758d8800]
11:45:33 INFO - 335 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging.js
11:45:33 INFO - ++DOCSHELL 0x7f11773b7800 == 21 [pid = 1950] [id = 877]
11:45:33 INFO - ++DOMWINDOW == 69 (0x7f1176d7c400) [pid = 1950] [serial = 2134] [outer = (nil)]
11:45:33 INFO - ++DOMWINDOW == 70 (0x7f1176d86400) [pid = 1950] [serial = 2135] [outer = 0x7f1176d7c400]
11:45:34 INFO - ++DOCSHELL 0x7f1180f6a000 == 22 [pid = 1950] [id = 878]
11:45:34 INFO - ++DOMWINDOW == 71 (0x7f1176d88800) [pid = 1950] [serial = 2136] [outer = (nil)]
11:45:34 INFO - ++DOMWINDOW == 72 (0x7f1176dcbc00) [pid = 1950] [serial = 2137] [outer = 0x7f1176d88800]
11:45:34 INFO - ++DOMWINDOW == 73 (0x7f1176dc8c00) [pid = 1950] [serial = 2138] [outer = 0x7f1176d88800]
11:45:34 INFO - ++DOCSHELL 0x7f118150e800 == 23 [pid = 1950] [id = 879]
11:45:34 INFO - ++DOMWINDOW == 74 (0x7f1176faf400) [pid = 1950] [serial = 2139] [outer = (nil)]
11:45:34 INFO - ++DOMWINDOW == 75 (0x7f1176fb2000) [pid = 1950] [serial = 2140] [outer = 0x7f1176faf400]
11:45:36 INFO - ++DOMWINDOW == 76 (0x7f117767d400) [pid = 1950] [serial = 2141] [outer = 0x7f1176d7c400]
11:45:36 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:36 INFO - ++DOCSHELL 0x7f1180e41800 == 24 [pid = 1950] [id = 880]
11:45:36 INFO - ++DOMWINDOW == 77 (0x7f118114b400) [pid = 1950] [serial = 2142] [outer = (nil)]
11:45:36 INFO - ++DOMWINDOW == 78 (0x7f118148a400) [pid = 1950] [serial = 2143] [outer = 0x7f118114b400]
11:45:37 INFO - ++DOCSHELL 0x7f118a991800 == 25 [pid = 1950] [id = 881]
11:45:37 INFO - ++DOMWINDOW == 79 (0x7f117712cc00) [pid = 1950] [serial = 2144] [outer = (nil)]
11:45:37 INFO - ++DOMWINDOW == 80 (0x7f1177683c00) [pid = 1950] [serial = 2145] [outer = 0x7f117712cc00]
11:45:37 INFO - ++DOMWINDOW == 81 (0x7f11758da800) [pid = 1950] [serial = 2146] [outer = 0x7f117712cc00]
11:45:37 INFO - --DOMWINDOW == 80 (0x7f1176cc4c00) [pid = 1950] [serial = 2092] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 79 (0x7f1176cc9800) [pid = 1950] [serial = 2094] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:37 INFO - --DOMWINDOW == 78 (0x7f1175636400) [pid = 1950] [serial = 2087] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:37 INFO - --DOMWINDOW == 77 (0x7f118a923400) [pid = 1950] [serial = 2117] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:37 INFO - --DOMWINDOW == 76 (0x7f1177208c00) [pid = 1950] [serial = 2090] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:37 INFO - --DOMWINDOW == 75 (0x7f118a9bb000) [pid = 1950] [serial = 2120] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:37 INFO - --DOMWINDOW == 74 (0x7f1177207000) [pid = 1950] [serial = 2082] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 73 (0x7f118114ec00) [pid = 1950] [serial = 2084] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:37 INFO - --DOMWINDOW == 72 (0x7f1176de1800) [pid = 1950] [serial = 2093] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 71 (0x7f1176fb8000) [pid = 1950] [serial = 2095] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 70 (0x7f11758d6800) [pid = 1950] [serial = 2088] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 69 (0x7f11812d2000) [pid = 1950] [serial = 2085] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 68 (0x7f118242dc00) [pid = 1950] [serial = 2108] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 67 (0x7f1177203400) [pid = 1950] [serial = 2098] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 66 (0x7f118a93d000) [pid = 1950] [serial = 2118] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 65 (0x7f1177674c00) [pid = 1950] [serial = 2083] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 64 (0x7f118dda7000) [pid = 1950] [serial = 2128] [outer = (nil)] [url = about:blank]
11:45:37 INFO - --DOMWINDOW == 63 (0x7f1181d19800) [pid = 1950] [serial = 2086] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:38 INFO - ++DOCSHELL 0x7f1181274000 == 26 [pid = 1950] [id = 882]
11:45:38 INFO - ++DOMWINDOW == 64 (0x7f11773f2400) [pid = 1950] [serial = 2147] [outer = (nil)]
11:45:38 INFO - ++DOMWINDOW == 65 (0x7f11776ee800) [pid = 1950] [serial = 2148] [outer = 0x7f11773f2400]
11:45:39 INFO - ++DOMWINDOW == 66 (0x7f1183fc9800) [pid = 1950] [serial = 2149] [outer = 0x7f118114b400]
11:45:39 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:39 INFO - ++DOCSHELL 0x7f1176f26800 == 27 [pid = 1950] [id = 883]
11:45:39 INFO - ++DOMWINDOW == 67 (0x7f1175644400) [pid = 1950] [serial = 2150] [outer = (nil)]
11:45:39 INFO - ++DOMWINDOW == 68 (0x7f1175657000) [pid = 1950] [serial = 2151] [outer = 0x7f1175644400]
11:45:40 INFO - ++DOCSHELL 0x7f117725d000 == 28 [pid = 1950] [id = 884]
11:45:40 INFO - ++DOMWINDOW == 69 (0x7f1175192400) [pid = 1950] [serial = 2152] [outer = (nil)]
11:45:40 INFO - ++DOMWINDOW == 70 (0x7f1176dd1800) [pid = 1950] [serial = 2153] [outer = 0x7f1175192400]
11:45:40 INFO - ++DOMWINDOW == 71 (0x7f11758da000) [pid = 1950] [serial = 2154] [outer = 0x7f1175192400]
11:45:41 INFO - ++DOCSHELL 0x7f11827a0800 == 29 [pid = 1950] [id = 885]
11:45:41 INFO - ++DOMWINDOW == 72 (0x7f11776ebc00) [pid = 1950] [serial = 2155] [outer = (nil)]
11:45:41 INFO - ++DOMWINDOW == 73 (0x7f1180f2ac00) [pid = 1950] [serial = 2156] [outer = 0x7f11776ebc00]
11:45:43 INFO - ++DOMWINDOW == 74 (0x7f1185865400) [pid = 1950] [serial = 2157] [outer = 0x7f1175644400]
11:45:43 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:44 INFO - --DOCSHELL 0x7f11810b4000 == 28 [pid = 1950] [id = 861]
11:45:44 INFO - --DOCSHELL 0x7f118d5e2800 == 27 [pid = 1950] [id = 870]
11:45:44 INFO - --DOCSHELL 0x7f11907bc000 == 26 [pid = 1950] [id = 872]
11:45:44 INFO - --DOCSHELL 0x7f11810ac000 == 25 [pid = 1950] [id = 868]
11:45:44 INFO - --DOCSHELL 0x7f11773ba000 == 24 [pid = 1950] [id = 860]
11:45:44 INFO - --DOCSHELL 0x7f1183e2c800 == 23 [pid = 1950] [id = 866]
11:45:44 INFO - --DOCSHELL 0x7f118db54800 == 22 [pid = 1950] [id = 873]
11:45:44 INFO - --DOCSHELL 0x7f119199a000 == 21 [pid = 1950] [id = 874]
11:45:44 INFO - --DOCSHELL 0x7f11826ba000 == 20 [pid = 1950] [id = 865]
11:45:44 INFO - --DOCSHELL 0x7f11770b4800 == 19 [pid = 1950] [id = 864]
11:45:44 INFO - --DOCSHELL 0x7f118d531000 == 18 [pid = 1950] [id = 869]
11:45:44 INFO - --DOMWINDOW == 73 (0x7f1175655c00) [pid = 1950] [serial = 2089] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:44 INFO - --DOMWINDOW == 72 (0x7f117712d800) [pid = 1950] [serial = 2096] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:44 INFO - --DOMWINDOW == 71 (0x7f118a9c0000) [pid = 1950] [serial = 2121] [outer = (nil)] [url = about:blank]
11:45:44 INFO - --DOMWINDOW == 70 (0x7f117720e400) [pid = 1950] [serial = 2091] [outer = (nil)] [url = about:blank]
11:45:44 INFO - --DOMWINDOW == 69 (0x7f118242ac00) [pid = 1950] [serial = 2119] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:45 INFO - ++DOCSHELL 0x7f11773af800 == 19 [pid = 1950] [id = 886]
11:45:45 INFO - ++DOMWINDOW == 70 (0x7f11758de800) [pid = 1950] [serial = 2158] [outer = (nil)]
11:45:45 INFO - ++DOMWINDOW == 71 (0x7f1176d79400) [pid = 1950] [serial = 2159] [outer = 0x7f11758de800]
11:45:45 INFO - ++DOCSHELL 0x7f1177253800 == 20 [pid = 1950] [id = 887]
11:45:45 INFO - ++DOMWINDOW == 72 (0x7f1176dba000) [pid = 1950] [serial = 2160] [outer = (nil)]
11:45:45 INFO - ++DOMWINDOW == 73 (0x7f1176dbb800) [pid = 1950] [serial = 2161] [outer = 0x7f1176dba000]
11:45:45 INFO - ++DOMWINDOW == 74 (0x7f1176ccd800) [pid = 1950] [serial = 2162] [outer = 0x7f1176dba000]
11:45:46 INFO - ++DOCSHELL 0x7f1181277800 == 21 [pid = 1950] [id = 888]
11:45:46 INFO - ++DOMWINDOW == 75 (0x7f117712c400) [pid = 1950] [serial = 2163] [outer = (nil)]
11:45:46 INFO - ++DOMWINDOW == 76 (0x7f1177133c00) [pid = 1950] [serial = 2164] [outer = 0x7f117712c400]
11:45:47 INFO - ++DOMWINDOW == 77 (0x7f1181ee5000) [pid = 1950] [serial = 2165] [outer = 0x7f11758de800]
11:45:47 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:48 INFO - ++DOMWINDOW == 78 (0x7f118585e400) [pid = 1950] [serial = 2166] [outer = 0x7f11758de800]
11:45:48 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:49 INFO - --DOCSHELL 0x7f11827a0800 == 20 [pid = 1950] [id = 885]
11:45:49 INFO - --DOCSHELL 0x7f1181274000 == 19 [pid = 1950] [id = 882]
11:45:49 INFO - --DOCSHELL 0x7f118a991800 == 18 [pid = 1950] [id = 881]
11:45:49 INFO - --DOCSHELL 0x7f118150e800 == 17 [pid = 1950] [id = 879]
11:45:49 INFO - --DOCSHELL 0x7f1180f6a000 == 16 [pid = 1950] [id = 878]
11:45:50 INFO - --DOMWINDOW == 77 (0x7f1176fba000) [pid = 1950] [serial = 2097] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:50 INFO - --DOMWINDOW == 76 (0x7f1177676000) [pid = 1950] [serial = 2110] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:50 INFO - --DOMWINDOW == 75 (0x7f118a93d800) [pid = 1950] [serial = 2130] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:50 INFO - --DOMWINDOW == 74 (0x7f118d9eb400) [pid = 1950] [serial = 2127] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:50 INFO - --DOMWINDOW == 73 (0x7f118242c400) [pid = 1950] [serial = 2107] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:50 INFO - --DOMWINDOW == 72 (0x7f11773ec000) [pid = 1950] [serial = 2100] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:50 INFO - --DOMWINDOW == 71 (0x7f118d566000) [pid = 1950] [serial = 2124] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:50 INFO - --DOMWINDOW == 70 (0x7f118260e800) [pid = 1950] [serial = 2122] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 69 (0x7f11858f6c00) [pid = 1950] [serial = 2114] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html]
11:45:50 INFO - --DOMWINDOW == 68 (0x7f118274f400) [pid = 1950] [serial = 2112] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 67 (0x7f11776f5c00) [pid = 1950] [serial = 2104] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:50 INFO - --DOMWINDOW == 66 (0x7f117712e800) [pid = 1950] [serial = 2102] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 65 (0x7f118d570800) [pid = 1950] [serial = 2125] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 64 (0x7f118a9b8400) [pid = 1950] [serial = 2123] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 63 (0x7f1185aa4800) [pid = 1950] [serial = 2115] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 62 (0x7f11838c1c00) [pid = 1950] [serial = 2113] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 61 (0x7f1180f2fc00) [pid = 1950] [serial = 2105] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 60 (0x7f1177208400) [pid = 1950] [serial = 2103] [outer = (nil)] [url = about:blank]
11:45:50 INFO - --DOMWINDOW == 59 (0x7f118db04000) [pid = 1950] [serial = 2126] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:50 INFO - --DOMWINDOW == 58 (0x7f118db0ac00) [pid = 1950] [serial = 2116] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html]
11:45:50 INFO - --DOMWINDOW == 57 (0x7f1180f31c00) [pid = 1950] [serial = 2106] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:45:50 INFO - MEMORY STAT | vsize 1301MB | residentFast 371MB | heapAllocated 147MB
11:45:50 INFO - 336 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging.js | took 17158ms
11:45:51 INFO - ++DOCSHELL 0x7f1176f1a000 == 17 [pid = 1950] [id = 889]
11:45:51 INFO - ++DOMWINDOW == 58 (0x7f1176fb5400) [pid = 1950] [serial = 2167] [outer = (nil)]
11:45:51 INFO - ++DOMWINDOW == 59 (0x7f1176fba000) [pid = 1950] [serial = 2168] [outer = 0x7f1176fb5400]
11:45:51 INFO - 337 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_basic.js
11:45:51 INFO - ++DOCSHELL 0x7f117a603800 == 18 [pid = 1950] [id = 890]
11:45:51 INFO - ++DOMWINDOW == 60 (0x7f11773eac00) [pid = 1950] [serial = 2169] [outer = (nil)]
11:45:51 INFO - ++DOMWINDOW == 61 (0x7f117767dc00) [pid = 1950] [serial = 2170] [outer = 0x7f11773eac00]
11:45:52 INFO - --DOCSHELL 0x7f1181277800 == 17 [pid = 1950] [id = 888]
11:45:52 INFO - --DOCSHELL 0x7f117725d000 == 16 [pid = 1950] [id = 884]
11:45:52 INFO - --DOMWINDOW == 60 (0x7f1176fb7400) [pid = 1950] [serial = 2099] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:52 INFO - --DOMWINDOW == 59 (0x7f118ce99400) [pid = 1950] [serial = 2129] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:52 INFO - --DOMWINDOW == 58 (0x7f1181f55000) [pid = 1950] [serial = 2109] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:52 INFO - --DOMWINDOW == 57 (0x7f11773eec00) [pid = 1950] [serial = 2101] [outer = (nil)] [url = about:blank]
11:45:52 INFO - --DOMWINDOW == 56 (0x7f11916cf400) [pid = 1950] [serial = 2131] [outer = (nil)] [url = about:blank]
11:45:52 INFO - --DOMWINDOW == 55 (0x7f11835a1000) [pid = 1950] [serial = 2111] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 54 (0x7f1177133c00) [pid = 1950] [serial = 2164] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 53 (0x7f1180f2ac00) [pid = 1950] [serial = 2156] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 52 (0x7f11758de800) [pid = 1950] [serial = 2158] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 51 (0x7f1175644400) [pid = 1950] [serial = 2150] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 50 (0x7f118114b400) [pid = 1950] [serial = 2142] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 49 (0x7f1176d7c400) [pid = 1950] [serial = 2134] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 48 (0x7f1176dd1800) [pid = 1950] [serial = 2153] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 47 (0x7f11758d8800) [pid = 1950] [serial = 2132] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 46 (0x7f1176cc5000) [pid = 1950] [serial = 2133] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 45 (0x7f11776ebc00) [pid = 1950] [serial = 2155] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:54 INFO - --DOMWINDOW == 44 (0x7f117712c400) [pid = 1950] [serial = 2163] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:54 INFO - --DOMWINDOW == 43 (0x7f1176dba000) [pid = 1950] [serial = 2160] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:54 INFO - --DOMWINDOW == 42 (0x7f1176ccd800) [pid = 1950] [serial = 2162] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:45:54 INFO - --DOMWINDOW == 41 (0x7f1176d79400) [pid = 1950] [serial = 2159] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 40 (0x7f1175657000) [pid = 1950] [serial = 2151] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 39 (0x7f118148a400) [pid = 1950] [serial = 2143] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 38 (0x7f1176d86400) [pid = 1950] [serial = 2135] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 37 (0x7f1176dbb800) [pid = 1950] [serial = 2161] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 36 (0x7f1176dcbc00) [pid = 1950] [serial = 2137] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 35 (0x7f1177683c00) [pid = 1950] [serial = 2145] [outer = (nil)] [url = about:blank]
11:45:54 INFO - --DOMWINDOW == 34 (0x7f118585e400) [pid = 1950] [serial = 2166] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 33 (0x7f1181ee5000) [pid = 1950] [serial = 2165] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 32 (0x7f1185865400) [pid = 1950] [serial = 2157] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 31 (0x7f1183fc9800) [pid = 1950] [serial = 2149] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:54 INFO - --DOMWINDOW == 30 (0x7f117767d400) [pid = 1950] [serial = 2141] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:45:55 INFO - --DOCSHELL 0x7f1177253800 == 15 [pid = 1950] [id = 887]
11:45:55 INFO - --DOCSHELL 0x7f1176f7d800 == 14 [pid = 1950] [id = 876]
11:45:55 INFO - --DOMWINDOW == 29 (0x7f11776ee800) [pid = 1950] [serial = 2148] [outer = (nil)] [url = about:blank]
11:45:55 INFO - --DOMWINDOW == 28 (0x7f11773f2400) [pid = 1950] [serial = 2147] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:55 INFO - --DOMWINDOW == 27 (0x7f1176faf400) [pid = 1950] [serial = 2139] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:45:55 INFO - ++DOCSHELL 0x7f1176f84800 == 15 [pid = 1950] [id = 891]
11:45:55 INFO - ++DOMWINDOW == 28 (0x7f1175644c00) [pid = 1950] [serial = 2171] [outer = (nil)]
11:45:55 INFO - ++DOMWINDOW == 29 (0x7f1175655400) [pid = 1950] [serial = 2172] [outer = 0x7f1175644c00]
11:45:55 INFO - ++DOMWINDOW == 30 (0x7f1175655c00) [pid = 1950] [serial = 2173] [outer = 0x7f1175644c00]
11:45:55 INFO - ++DOCSHELL 0x7f11773b8800 == 16 [pid = 1950] [id = 892]
11:45:55 INFO - ++DOMWINDOW == 31 (0x7f1176d79400) [pid = 1950] [serial = 2174] [outer = (nil)]
11:45:55 INFO - ++DOMWINDOW == 32 (0x7f1176d7d800) [pid = 1950] [serial = 2175] [outer = 0x7f1176d79400]
11:45:57 INFO - ++DOMWINDOW == 33 (0x7f1176fb6400) [pid = 1950] [serial = 2176] [outer = 0x7f11773eac00]
11:45:57 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:45:58 INFO - MEMORY STAT | vsize 1300MB | residentFast 352MB | heapAllocated 139MB
11:45:58 INFO - 338 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_basic.js | took 7483ms
11:45:58 INFO - ++DOCSHELL 0x7f11770c4000 == 17 [pid = 1950] [id = 893]
11:45:58 INFO - ++DOMWINDOW == 34 (0x7f1176dde800) [pid = 1950] [serial = 2177] [outer = (nil)]
11:45:58 INFO - ++DOMWINDOW == 35 (0x7f1176edb000) [pid = 1950] [serial = 2178] [outer = 0x7f1176dde800]
11:45:59 INFO - 339 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_panel.js
11:45:59 INFO - ++DOCSHELL 0x7f117a618800 == 18 [pid = 1950] [id = 894]
11:45:59 INFO - ++DOMWINDOW == 36 (0x7f1177131000) [pid = 1950] [serial = 2179] [outer = (nil)]
11:45:59 INFO - ++DOMWINDOW == 37 (0x7f117720a400) [pid = 1950] [serial = 2180] [outer = 0x7f1177131000]
11:45:59 INFO - ++DOCSHELL 0x7f1176f77800 == 19 [pid = 1950] [id = 895]
11:45:59 INFO - ++DOMWINDOW == 38 (0x7f117563a000) [pid = 1950] [serial = 2181] [outer = (nil)]
11:45:59 INFO - ++DOMWINDOW == 39 (0x7f117563d000) [pid = 1950] [serial = 2182] [outer = 0x7f117563a000]
11:45:59 INFO - ++DOMWINDOW == 40 (0x7f1175636400) [pid = 1950] [serial = 2183] [outer = 0x7f117563a000]
11:46:00 INFO - ++DOCSHELL 0x7f11810af800 == 20 [pid = 1950] [id = 896]
11:46:00 INFO - ++DOMWINDOW == 41 (0x7f1176dc3400) [pid = 1950] [serial = 2184] [outer = (nil)]
11:46:00 INFO - ++DOMWINDOW == 42 (0x7f1176dd3400) [pid = 1950] [serial = 2185] [outer = 0x7f1176dc3400]
11:46:02 INFO - ++DOMWINDOW == 43 (0x7f117767ec00) [pid = 1950] [serial = 2186] [outer = 0x7f1177131000]
11:46:02 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:46:03 INFO - --DOCSHELL 0x7f1180e41800 == 19 [pid = 1950] [id = 880]
11:46:03 INFO - --DOCSHELL 0x7f11773b7800 == 18 [pid = 1950] [id = 877]
11:46:03 INFO - --DOCSHELL 0x7f1176f26800 == 17 [pid = 1950] [id = 883]
11:46:03 INFO - --DOCSHELL 0x7f11773af800 == 16 [pid = 1950] [id = 886]
11:46:03 INFO - --DOCSHELL 0x7f11773b8800 == 15 [pid = 1950] [id = 892]
11:46:03 INFO - --DOMWINDOW == 42 (0x7f1176fb2000) [pid = 1950] [serial = 2140] [outer = (nil)] [url = about:blank]
11:46:03 INFO - ++DOCSHELL 0x7f1176f7d800 == 16 [pid = 1950] [id = 897]
11:46:03 INFO - ++DOMWINDOW == 43 (0x7f11758e2000) [pid = 1950] [serial = 2187] [outer = (nil)]
11:46:03 INFO - ++DOMWINDOW == 44 (0x7f11758e4000) [pid = 1950] [serial = 2188] [outer = 0x7f11758e2000]
11:46:04 INFO - ++DOCSHELL 0x7f117a60f000 == 17 [pid = 1950] [id = 898]
11:46:04 INFO - ++DOMWINDOW == 45 (0x7f1176dd3800) [pid = 1950] [serial = 2189] [outer = (nil)]
11:46:04 INFO - ++DOMWINDOW == 46 (0x7f1176d82800) [pid = 1950] [serial = 2190] [outer = 0x7f1176dd3800]
11:46:04 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:46:05 INFO - --DOCSHELL 0x7f117a60f000 == 16 [pid = 1950] [id = 898]
11:46:05 INFO - --DOCSHELL 0x7f11810af800 == 15 [pid = 1950] [id = 896]
11:46:05 INFO - MEMORY STAT | vsize 1298MB | residentFast 349MB | heapAllocated 138MB
11:46:05 INFO - 340 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_panel.js | took 6805ms
11:46:05 INFO - ++DOCSHELL 0x7f11773ac000 == 16 [pid = 1950] [id = 899]
11:46:05 INFO - ++DOMWINDOW == 47 (0x7f1176cccc00) [pid = 1950] [serial = 2191] [outer = (nil)]
11:46:05 INFO - ++DOMWINDOW == 48 (0x7f1176db9800) [pid = 1950] [serial = 2192] [outer = 0x7f1176cccc00]
11:46:06 INFO - 341 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js
11:46:06 INFO - ++DOCSHELL 0x7f1182493000 == 17 [pid = 1950] [id = 900]
11:46:06 INFO - ++DOMWINDOW == 49 (0x7f1176dd6800) [pid = 1950] [serial = 2193] [outer = (nil)]
11:46:06 INFO - ++DOMWINDOW == 50 (0x7f1176facc00) [pid = 1950] [serial = 2194] [outer = 0x7f1176dd6800]
11:46:06 INFO - ++DOCSHELL 0x7f1176f24800 == 18 [pid = 1950] [id = 901]
11:46:06 INFO - ++DOMWINDOW == 51 (0x7f1176dbb400) [pid = 1950] [serial = 2195] [outer = (nil)]
11:46:06 INFO - ++DOMWINDOW == 52 (0x7f1176fae800) [pid = 1950] [serial = 2196] [outer = 0x7f1176dbb400]
11:46:06 INFO - ++DOMWINDOW == 53 (0x7f1175652000) [pid = 1950] [serial = 2197] [outer = 0x7f1176dbb400]
11:46:07 INFO - ++DOCSHELL 0x7f1185a1f000 == 19 [pid = 1950] [id = 902]
11:46:07 INFO - ++DOMWINDOW == 54 (0x7f11776f2400) [pid = 1950] [serial = 2198] [outer = (nil)]
11:46:07 INFO - ++DOMWINDOW == 55 (0x7f11776f5000) [pid = 1950] [serial = 2199] [outer = 0x7f11776f2400]
11:46:08 INFO - --DOMWINDOW == 54 (0x7f117563d000) [pid = 1950] [serial = 2182] [outer = (nil)] [url = about:blank]
11:46:08 INFO - --DOMWINDOW == 53 (0x7f117712cc00) [pid = 1950] [serial = 2144] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:08 INFO - --DOMWINDOW == 52 (0x7f1175192400) [pid = 1950] [serial = 2152] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:08 INFO - --DOMWINDOW == 51 (0x7f1176d88800) [pid = 1950] [serial = 2136] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:08 INFO - --DOMWINDOW == 50 (0x7f1176fb5400) [pid = 1950] [serial = 2167] [outer = (nil)] [url = about:blank]
11:46:08 INFO - --DOMWINDOW == 49 (0x7f11773eac00) [pid = 1950] [serial = 2169] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1454442351316]
11:46:08 INFO - --DOMWINDOW == 48 (0x7f1175655400) [pid = 1950] [serial = 2172] [outer = (nil)] [url = about:blank]
11:46:08 INFO - --DOMWINDOW == 47 (0x7f1176fba000) [pid = 1950] [serial = 2168] [outer = (nil)] [url = about:blank]
11:46:08 INFO - --DOMWINDOW == 46 (0x7f117767dc00) [pid = 1950] [serial = 2170] [outer = (nil)] [url = about:blank]
11:46:08 INFO - --DOMWINDOW == 45 (0x7f1176fb6400) [pid = 1950] [serial = 2176] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1454442351316]
11:46:09 INFO - ++DOMWINDOW == 46 (0x7f1176ddf000) [pid = 1950] [serial = 2200] [outer = 0x7f1176dd6800]
11:46:09 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:46:09 INFO - ++DOCSHELL 0x7f11810ca800 == 20 [pid = 1950] [id = 903]
11:46:09 INFO - ++DOMWINDOW == 47 (0x7f11773e7c00) [pid = 1950] [serial = 2201] [outer = (nil)]
11:46:09 INFO - ++DOMWINDOW == 48 (0x7f118148f000) [pid = 1950] [serial = 2202] [outer = 0x7f11773e7c00]
11:46:09 INFO - ++DOCSHELL 0x7f11810ab000 == 21 [pid = 1950] [id = 904]
11:46:09 INFO - ++DOMWINDOW == 49 (0x7f118260c000) [pid = 1950] [serial = 2203] [outer = (nil)]
11:46:09 INFO - ++DOMWINDOW == 50 (0x7f1176dcd800) [pid = 1950] [serial = 2204] [outer = 0x7f118260c000]
11:46:10 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:46:10 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:46:11 INFO - --DOCSHELL 0x7f11810ab000 == 20 [pid = 1950] [id = 904]
11:46:12 INFO - MEMORY STAT | vsize 1301MB | residentFast 355MB | heapAllocated 141MB
11:46:12 INFO - 342 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js | took 5952ms
11:46:12 INFO - ++DOCSHELL 0x7f1180e39000 == 21 [pid = 1950] [id = 905]
11:46:12 INFO - ++DOMWINDOW == 51 (0x7f11758de000) [pid = 1950] [serial = 2205] [outer = (nil)]
11:46:12 INFO - ++DOMWINDOW == 52 (0x7f1176d82400) [pid = 1950] [serial = 2206] [outer = 0x7f11758de000]
11:46:12 INFO - 343 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_notifications.js
11:46:12 INFO - ++DOCSHELL 0x7f11810b9000 == 22 [pid = 1950] [id = 906]
11:46:12 INFO - ++DOMWINDOW == 53 (0x7f1176dcc000) [pid = 1950] [serial = 2207] [outer = (nil)]
11:46:12 INFO - ++DOMWINDOW == 54 (0x7f1176ddfc00) [pid = 1950] [serial = 2208] [outer = 0x7f1176dcc000]
11:46:13 INFO - ++DOCSHELL 0x7f1183660800 == 23 [pid = 1950] [id = 907]
11:46:13 INFO - ++DOMWINDOW == 55 (0x7f1177207400) [pid = 1950] [serial = 2209] [outer = (nil)]
11:46:13 INFO - ++DOMWINDOW == 56 (0x7f117720c800) [pid = 1950] [serial = 2210] [outer = 0x7f1177207400]
11:46:13 INFO - ++DOMWINDOW == 57 (0x7f1176d7c800) [pid = 1950] [serial = 2211] [outer = 0x7f1177207400]
11:46:13 INFO - ++DOCSHELL 0x7f1187d67000 == 24 [pid = 1950] [id = 908]
11:46:13 INFO - ++DOMWINDOW == 58 (0x7f1180f30400) [pid = 1950] [serial = 2212] [outer = (nil)]
11:46:13 INFO - ++DOMWINDOW == 59 (0x7f1180f34c00) [pid = 1950] [serial = 2213] [outer = 0x7f1180f30400]
11:46:16 INFO - MEMORY STAT | vsize 1303MB | residentFast 365MB | heapAllocated 147MB
11:46:16 INFO - 344 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_notifications.js | took 3779ms
11:46:16 INFO - ++DOCSHELL 0x7f1187d84000 == 25 [pid = 1950] [id = 909]
11:46:16 INFO - ++DOMWINDOW == 60 (0x7f1177675800) [pid = 1950] [serial = 2214] [outer = (nil)]
11:46:16 INFO - ++DOMWINDOW == 61 (0x7f1181491400) [pid = 1950] [serial = 2215] [outer = 0x7f1177675800]
11:46:16 INFO - 345 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js
11:46:16 INFO - ++DOCSHELL 0x7f118d4aa800 == 26 [pid = 1950] [id = 910]
11:46:16 INFO - ++DOMWINDOW == 62 (0x7f118283e000) [pid = 1950] [serial = 2216] [outer = (nil)]
11:46:16 INFO - ++DOMWINDOW == 63 (0x7f118288f000) [pid = 1950] [serial = 2217] [outer = 0x7f118283e000]
11:46:17 INFO - ++DOMWINDOW == 64 (0x7f1183a7d800) [pid = 1950] [serial = 2218] [outer = 0x7f118283e000]
11:46:17 INFO - ++DOCSHELL 0x7f118db5c800 == 27 [pid = 1950] [id = 911]
11:46:17 INFO - ++DOMWINDOW == 65 (0x7f11838c0800) [pid = 1950] [serial = 2219] [outer = (nil)]
11:46:17 INFO - ++DOMWINDOW == 66 (0x7f118436ac00) [pid = 1950] [serial = 2220] [outer = 0x7f11838c0800]
11:46:17 INFO - ++DOMWINDOW == 67 (0x7f1181495400) [pid = 1950] [serial = 2221] [outer = 0x7f11838c0800]
11:46:17 INFO - ++DOCSHELL 0x7f118f637800 == 28 [pid = 1950] [id = 912]
11:46:17 INFO - ++DOMWINDOW == 68 (0x7f11858fb800) [pid = 1950] [serial = 2222] [outer = (nil)]
11:46:17 INFO - ++DOMWINDOW == 69 (0x7f1185aa1800) [pid = 1950] [serial = 2223] [outer = 0x7f11858fb800]
11:46:20 INFO - --DOCSHELL 0x7f1176f7d800 == 27 [pid = 1950] [id = 897]
11:46:20 INFO - --DOCSHELL 0x7f1176f84800 == 26 [pid = 1950] [id = 891]
11:46:20 INFO - --DOCSHELL 0x7f1176f1a000 == 25 [pid = 1950] [id = 889]
11:46:20 INFO - --DOCSHELL 0x7f117a603800 == 24 [pid = 1950] [id = 890]
11:46:20 INFO - --DOCSHELL 0x7f1176f77800 == 23 [pid = 1950] [id = 895]
11:46:20 INFO - --DOCSHELL 0x7f117a618800 == 22 [pid = 1950] [id = 894]
11:46:20 INFO - --DOCSHELL 0x7f11770c4000 == 21 [pid = 1950] [id = 893]
11:46:20 INFO - --DOCSHELL 0x7f11773ac000 == 20 [pid = 1950] [id = 899]
11:46:20 INFO - --DOCSHELL 0x7f1182493000 == 19 [pid = 1950] [id = 900]
11:46:20 INFO - --DOCSHELL 0x7f1176f24800 == 18 [pid = 1950] [id = 901]
11:46:20 INFO - --DOCSHELL 0x7f1185a1f000 == 17 [pid = 1950] [id = 902]
11:46:20 INFO - --DOCSHELL 0x7f11810ca800 == 16 [pid = 1950] [id = 903]
11:46:20 INFO - --DOCSHELL 0x7f1187d67000 == 15 [pid = 1950] [id = 908]
11:46:20 INFO - --DOMWINDOW == 68 (0x7f11758da000) [pid = 1950] [serial = 2154] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:20 INFO - --DOMWINDOW == 67 (0x7f1176dc8c00) [pid = 1950] [serial = 2138] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:20 INFO - --DOMWINDOW == 66 (0x7f11758da800) [pid = 1950] [serial = 2146] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:21 INFO - --DOCSHELL 0x7f118f637800 == 14 [pid = 1950] [id = 912]
11:46:22 INFO - --DOCSHELL 0x7f118db5c800 == 13 [pid = 1950] [id = 911]
11:46:22 INFO - --DOCSHELL 0x7f1183660800 == 12 [pid = 1950] [id = 907]
11:46:22 INFO - --DOCSHELL 0x7f1180e39000 == 11 [pid = 1950] [id = 905]
11:46:22 INFO - --DOMWINDOW == 65 (0x7f1176dd3800) [pid = 1950] [serial = 2189] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 64 (0x7f1176dde800) [pid = 1950] [serial = 2177] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 63 (0x7f1177131000) [pid = 1950] [serial = 2179] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:46:22 INFO - --DOMWINDOW == 62 (0x7f1176dcc000) [pid = 1950] [serial = 2207] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20notifications]
11:46:22 INFO - --DOMWINDOW == 61 (0x7f11758de000) [pid = 1950] [serial = 2205] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 60 (0x7f1176dc3400) [pid = 1950] [serial = 2184] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:22 INFO - --DOMWINDOW == 59 (0x7f11758e2000) [pid = 1950] [serial = 2187] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul]
11:46:22 INFO - --DOMWINDOW == 58 (0x7f1176dcd800) [pid = 1950] [serial = 2204] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 57 (0x7f1176db9800) [pid = 1950] [serial = 2192] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 56 (0x7f11776f2400) [pid = 1950] [serial = 2198] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:22 INFO - --DOMWINDOW == 55 (0x7f11773e7c00) [pid = 1950] [serial = 2201] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul]
11:46:22 INFO - --DOMWINDOW == 54 (0x7f1175644c00) [pid = 1950] [serial = 2171] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:22 INFO - --DOMWINDOW == 53 (0x7f1176d79400) [pid = 1950] [serial = 2174] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:22 INFO - --DOMWINDOW == 52 (0x7f117563a000) [pid = 1950] [serial = 2181] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:22 INFO - --DOMWINDOW == 51 (0x7f117720c800) [pid = 1950] [serial = 2210] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 50 (0x7f1177207400) [pid = 1950] [serial = 2209] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:22 INFO - --DOMWINDOW == 49 (0x7f1176cccc00) [pid = 1950] [serial = 2191] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 48 (0x7f1176dbb400) [pid = 1950] [serial = 2195] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:22 INFO - --DOMWINDOW == 47 (0x7f118288f000) [pid = 1950] [serial = 2217] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 46 (0x7f1176ddfc00) [pid = 1950] [serial = 2208] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 45 (0x7f1176d82400) [pid = 1950] [serial = 2206] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 44 (0x7f118436ac00) [pid = 1950] [serial = 2220] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 43 (0x7f1180f30400) [pid = 1950] [serial = 2212] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:22 INFO - --DOMWINDOW == 42 (0x7f1176fae800) [pid = 1950] [serial = 2196] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 41 (0x7f1176facc00) [pid = 1950] [serial = 2194] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 40 (0x7f1176dd6800) [pid = 1950] [serial = 2193] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html]
11:46:22 INFO - --DOMWINDOW == 39 (0x7f118260c000) [pid = 1950] [serial = 2203] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 38 (0x7f1176d82800) [pid = 1950] [serial = 2190] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 37 (0x7f1176edb000) [pid = 1950] [serial = 2178] [outer = (nil)] [url = about:blank]
11:46:22 INFO - --DOMWINDOW == 36 (0x7f117720a400) [pid = 1950] [serial = 2180] [outer = (nil)] [url = about:blank]
11:46:23 INFO - --DOMWINDOW == 35 (0x7f1176ddf000) [pid = 1950] [serial = 2200] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html]
11:46:23 INFO - --DOMWINDOW == 34 (0x7f117767ec00) [pid = 1950] [serial = 2186] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html]
11:46:23 INFO - MEMORY STAT | vsize 1301MB | residentFast 359MB | heapAllocated 139MB
11:46:23 INFO - 346 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js | took 6634ms
11:46:23 INFO - ++DOCSHELL 0x7f1176f1a800 == 12 [pid = 1950] [id = 913]
11:46:23 INFO - ++DOMWINDOW == 35 (0x7f11758e4800) [pid = 1950] [serial = 2224] [outer = (nil)]
11:46:23 INFO - ++DOMWINDOW == 36 (0x7f1176ccac00) [pid = 1950] [serial = 2225] [outer = 0x7f11758e4800]
11:46:23 INFO - 347 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_01.js
11:46:23 INFO - ++DOCSHELL 0x7f1180e18800 == 13 [pid = 1950] [id = 914]
11:46:23 INFO - ++DOMWINDOW == 37 (0x7f1176dac800) [pid = 1950] [serial = 2226] [outer = (nil)]
11:46:23 INFO - ++DOMWINDOW == 38 (0x7f1176db6000) [pid = 1950] [serial = 2227] [outer = 0x7f1176dac800]
11:46:23 INFO - ++DOCSHELL 0x7f117a619800 == 14 [pid = 1950] [id = 915]
11:46:23 INFO - ++DOMWINDOW == 39 (0x7f1176dd5000) [pid = 1950] [serial = 2228] [outer = (nil)]
11:46:23 INFO - ++DOMWINDOW == 40 (0x7f1176dd6800) [pid = 1950] [serial = 2229] [outer = 0x7f1176dd5000]
11:46:24 INFO - ++DOMWINDOW == 41 (0x7f1176dd0000) [pid = 1950] [serial = 2230] [outer = 0x7f1176dd5000]
11:46:24 INFO - ++DOCSHELL 0x7f118151b000 == 15 [pid = 1950] [id = 916]
11:46:24 INFO - ++DOMWINDOW == 42 (0x7f117712a400) [pid = 1950] [serial = 2231] [outer = (nil)]
11:46:24 INFO - ++DOMWINDOW == 43 (0x7f117712f800) [pid = 1950] [serial = 2232] [outer = 0x7f117712a400]
11:46:27 INFO - --DOCSHELL 0x7f11810b9000 == 14 [pid = 1950] [id = 906]
11:46:27 INFO - --DOCSHELL 0x7f1187d84000 == 13 [pid = 1950] [id = 909]
11:46:27 INFO - --DOCSHELL 0x7f118d4aa800 == 12 [pid = 1950] [id = 910]
11:46:27 INFO - --DOMWINDOW == 42 (0x7f1180f34c00) [pid = 1950] [serial = 2213] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 41 (0x7f1176d7c800) [pid = 1950] [serial = 2211] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:27 INFO - --DOMWINDOW == 40 (0x7f118148f000) [pid = 1950] [serial = 2202] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 39 (0x7f11776f5000) [pid = 1950] [serial = 2199] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 38 (0x7f1175652000) [pid = 1950] [serial = 2197] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:27 INFO - --DOMWINDOW == 37 (0x7f11758e4000) [pid = 1950] [serial = 2188] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 36 (0x7f1176dd3400) [pid = 1950] [serial = 2185] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 35 (0x7f1175636400) [pid = 1950] [serial = 2183] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:27 INFO - --DOMWINDOW == 34 (0x7f1176d7d800) [pid = 1950] [serial = 2175] [outer = (nil)] [url = about:blank]
11:46:27 INFO - --DOMWINDOW == 33 (0x7f1175655c00) [pid = 1950] [serial = 2173] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:32 INFO - ++DOCSHELL 0x7f117a606000 == 13 [pid = 1950] [id = 917]
11:46:32 INFO - ++DOMWINDOW == 34 (0x7f11758e0000) [pid = 1950] [serial = 2233] [outer = (nil)]
11:46:32 INFO - ++DOMWINDOW == 35 (0x7f1176cc6000) [pid = 1950] [serial = 2234] [outer = 0x7f11758e0000]
11:46:33 INFO - --DOCSHELL 0x7f118151b000 == 12 [pid = 1950] [id = 916]
11:46:34 INFO - --DOCSHELL 0x7f117a606000 == 11 [pid = 1950] [id = 917]
11:46:34 INFO - --DOCSHELL 0x7f117a619800 == 10 [pid = 1950] [id = 915]
11:46:35 INFO - --DOMWINDOW == 34 (0x7f11858fb800) [pid = 1950] [serial = 2222] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:35 INFO - --DOMWINDOW == 33 (0x7f11838c0800) [pid = 1950] [serial = 2219] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:35 INFO - --DOMWINDOW == 32 (0x7f1177675800) [pid = 1950] [serial = 2214] [outer = (nil)] [url = about:blank]
11:46:35 INFO - --DOMWINDOW == 31 (0x7f118283e000) [pid = 1950] [serial = 2216] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:46:35 INFO - --DOMWINDOW == 30 (0x7f1176dd6800) [pid = 1950] [serial = 2229] [outer = (nil)] [url = about:blank]
11:46:35 INFO - --DOMWINDOW == 29 (0x7f1181491400) [pid = 1950] [serial = 2215] [outer = (nil)] [url = about:blank]
11:46:35 INFO - --DOMWINDOW == 28 (0x7f11758e0000) [pid = 1950] [serial = 2233] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:35 INFO - --DOMWINDOW == 27 (0x7f1183a7d800) [pid = 1950] [serial = 2218] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:46:35 INFO - MEMORY STAT | vsize 1292MB | residentFast 337MB | heapAllocated 131MB
11:46:35 INFO - 348 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_01.js | took 11986ms
11:46:35 INFO - ++DOCSHELL 0x7f1176f8a800 == 11 [pid = 1950] [id = 918]
11:46:35 INFO - ++DOMWINDOW == 28 (0x7f117563f000) [pid = 1950] [serial = 2235] [outer = (nil)]
11:46:35 INFO - ++DOMWINDOW == 29 (0x7f1175652400) [pid = 1950] [serial = 2236] [outer = 0x7f117563f000]
11:46:35 INFO - 349 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_02.js
11:46:35 INFO - ++DOCSHELL 0x7f117725d000 == 12 [pid = 1950] [id = 919]
11:46:35 INFO - ++DOMWINDOW == 30 (0x7f117565d000) [pid = 1950] [serial = 2237] [outer = (nil)]
11:46:35 INFO - ++DOMWINDOW == 31 (0x7f11758d8c00) [pid = 1950] [serial = 2238] [outer = 0x7f117565d000]
11:46:36 INFO - ++DOMWINDOW == 32 (0x7f1176cc5800) [pid = 1950] [serial = 2239] [outer = 0x7f117565d000]
11:46:36 INFO - ++DOCSHELL 0x7f1176f26800 == 13 [pid = 1950] [id = 920]
11:46:36 INFO - ++DOMWINDOW == 33 (0x7f11758da000) [pid = 1950] [serial = 2240] [outer = (nil)]
11:46:36 INFO - ++DOMWINDOW == 34 (0x7f1176daec00) [pid = 1950] [serial = 2241] [outer = 0x7f11758da000]
11:46:36 INFO - ++DOMWINDOW == 35 (0x7f1176ccc400) [pid = 1950] [serial = 2242] [outer = 0x7f11758da000]
11:46:37 INFO - ++DOCSHELL 0x7f11810c9800 == 14 [pid = 1950] [id = 921]
11:46:37 INFO - ++DOMWINDOW == 36 (0x7f1176dda400) [pid = 1950] [serial = 2243] [outer = (nil)]
11:46:37 INFO - ++DOMWINDOW == 37 (0x7f1176de1000) [pid = 1950] [serial = 2244] [outer = 0x7f1176dda400]
11:46:39 INFO - --DOCSHELL 0x7f1176f1a800 == 13 [pid = 1950] [id = 913]
11:46:39 INFO - --DOCSHELL 0x7f1180e18800 == 12 [pid = 1950] [id = 914]
11:46:39 INFO - --DOMWINDOW == 36 (0x7f1185aa1800) [pid = 1950] [serial = 2223] [outer = (nil)] [url = about:blank]
11:46:39 INFO - --DOMWINDOW == 35 (0x7f1181495400) [pid = 1950] [serial = 2221] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:39 INFO - --DOMWINDOW == 34 (0x7f1176cc6000) [pid = 1950] [serial = 2234] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:40 INFO - ++DOCSHELL 0x7f1176f79000 == 13 [pid = 1950] [id = 922]
11:46:40 INFO - ++DOMWINDOW == 35 (0x7f117565ac00) [pid = 1950] [serial = 2245] [outer = (nil)]
11:46:40 INFO - ++DOMWINDOW == 36 (0x7f117518d800) [pid = 1950] [serial = 2246] [outer = 0x7f117565ac00]
11:46:40 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn208.obj32
11:46:43 INFO - ++DOCSHELL 0x7f1180e4c000 == 14 [pid = 1950] [id = 923]
11:46:43 INFO - ++DOMWINDOW == 37 (0x7f1177125800) [pid = 1950] [serial = 2247] [outer = (nil)]
11:46:43 INFO - ++DOMWINDOW == 38 (0x7f1177126000) [pid = 1950] [serial = 2248] [outer = 0x7f1177125800]
11:46:43 INFO - ++DOCSHELL 0x7f1181272800 == 15 [pid = 1950] [id = 924]
11:46:43 INFO - ++DOMWINDOW == 39 (0x7f11776ebc00) [pid = 1950] [serial = 2249] [outer = (nil)]
11:46:44 INFO - ++DOMWINDOW == 40 (0x7f11776eac00) [pid = 1950] [serial = 2250] [outer = 0x7f11776ebc00]
11:46:44 INFO - ++DOCSHELL 0x7f1183e2e800 == 16 [pid = 1950] [id = 925]
11:46:44 INFO - ++DOMWINDOW == 41 (0x7f1180f29800) [pid = 1950] [serial = 2251] [outer = (nil)]
11:46:45 INFO - ++DOMWINDOW == 42 (0x7f1180f2d800) [pid = 1950] [serial = 2252] [outer = 0x7f1180f29800]
11:46:45 INFO - --DOMWINDOW == 41 (0x7f11758d8c00) [pid = 1950] [serial = 2238] [outer = (nil)] [url = about:blank]
11:46:45 INFO - --DOMWINDOW == 40 (0x7f1176db6000) [pid = 1950] [serial = 2227] [outer = (nil)] [url = about:blank]
11:46:45 INFO - --DOMWINDOW == 39 (0x7f1176ccac00) [pid = 1950] [serial = 2225] [outer = (nil)] [url = about:blank]
11:46:45 INFO - --DOMWINDOW == 38 (0x7f1176daec00) [pid = 1950] [serial = 2241] [outer = (nil)] [url = about:blank]
11:46:45 INFO - --DOMWINDOW == 37 (0x7f117712a400) [pid = 1950] [serial = 2231] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:46:45 INFO - --DOMWINDOW == 36 (0x7f1176dd5000) [pid = 1950] [serial = 2228] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:45 INFO - --DOMWINDOW == 35 (0x7f1176dac800) [pid = 1950] [serial = 2226] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2001]
11:46:45 INFO - --DOMWINDOW == 34 (0x7f11758e4800) [pid = 1950] [serial = 2224] [outer = (nil)] [url = about:blank]
11:46:45 INFO - ++DOCSHELL 0x7f1180e0b000 == 17 [pid = 1950] [id = 926]
11:46:45 INFO - ++DOMWINDOW == 35 (0x7f1175642800) [pid = 1950] [serial = 2253] [outer = (nil)]
11:46:46 INFO - ++DOMWINDOW == 36 (0x7f1176d7ec00) [pid = 1950] [serial = 2254] [outer = 0x7f1175642800]
11:46:46 INFO - ++DOCSHELL 0x7f11826bf000 == 18 [pid = 1950] [id = 927]
11:46:46 INFO - ++DOMWINDOW == 37 (0x7f11776f1400) [pid = 1950] [serial = 2255] [outer = (nil)]
11:46:46 INFO - ++DOMWINDOW == 38 (0x7f1180f38c00) [pid = 1950] [serial = 2256] [outer = 0x7f11776f1400]
11:46:47 INFO - ++DOCSHELL 0x7f11810c8000 == 19 [pid = 1950] [id = 928]
11:46:47 INFO - ++DOMWINDOW == 39 (0x7f11812cf400) [pid = 1950] [serial = 2257] [outer = (nil)]
11:46:47 INFO - ++DOMWINDOW == 40 (0x7f1181143c00) [pid = 1950] [serial = 2258] [outer = 0x7f11812cf400]
11:46:48 INFO - ++DOCSHELL 0x7f1185a1d000 == 20 [pid = 1950] [id = 929]
11:46:48 INFO - ++DOMWINDOW == 41 (0x7f1176fbb400) [pid = 1950] [serial = 2259] [outer = (nil)]
11:46:48 INFO - ++DOMWINDOW == 42 (0x7f118148b400) [pid = 1950] [serial = 2260] [outer = 0x7f1176fbb400]
11:46:49 INFO - --DOCSHELL 0x7f1176f79000 == 19 [pid = 1950] [id = 922]
11:46:49 INFO - --DOCSHELL 0x7f1180e4c000 == 18 [pid = 1950] [id = 923]
11:46:49 INFO - --DOCSHELL 0x7f1181272800 == 17 [pid = 1950] [id = 924]
11:46:49 INFO - --DOCSHELL 0x7f1183e2e800 == 16 [pid = 1950] [id = 925]
11:46:49 INFO - --DOCSHELL 0x7f1180e0b000 == 15 [pid = 1950] [id = 926]
11:46:49 INFO - --DOCSHELL 0x7f11826bf000 == 14 [pid = 1950] [id = 927]
11:46:49 INFO - --DOCSHELL 0x7f11810c8000 == 13 [pid = 1950] [id = 928]
11:46:49 INFO - --DOCSHELL 0x7f1185a1d000 == 12 [pid = 1950] [id = 929]
11:46:50 INFO - --DOMWINDOW == 41 (0x7f1176dd0000) [pid = 1950] [serial = 2230] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:46:50 INFO - --DOMWINDOW == 40 (0x7f117712f800) [pid = 1950] [serial = 2232] [outer = (nil)] [url = about:blank]
11:46:50 INFO - ++DOCSHELL 0x7f11770bb800 == 13 [pid = 1950] [id = 930]
11:46:50 INFO - ++DOMWINDOW == 41 (0x7f1175644c00) [pid = 1950] [serial = 2261] [outer = (nil)]
11:46:50 INFO - ++DOMWINDOW == 42 (0x7f1175650400) [pid = 1950] [serial = 2262] [outer = 0x7f1175644c00]
11:46:51 INFO - ++DOCSHELL 0x7f1180e4c000 == 14 [pid = 1950] [id = 931]
11:46:51 INFO - ++DOMWINDOW == 43 (0x7f1176db5800) [pid = 1950] [serial = 2263] [outer = (nil)]
11:46:51 INFO - ++DOMWINDOW == 44 (0x7f1176db6000) [pid = 1950] [serial = 2264] [outer = 0x7f1176db5800]
11:46:52 INFO - ++DOCSHELL 0x7f1177250800 == 15 [pid = 1950] [id = 932]
11:46:52 INFO - ++DOMWINDOW == 45 (0x7f1176ddd400) [pid = 1950] [serial = 2265] [outer = (nil)]
11:46:52 INFO - ++DOMWINDOW == 46 (0x7f1176ddf000) [pid = 1950] [serial = 2266] [outer = 0x7f1176ddd400]
11:46:53 INFO - ++DOCSHELL 0x7f117725c800 == 16 [pid = 1950] [id = 933]
11:46:53 INFO - ++DOMWINDOW == 47 (0x7f1176fb5000) [pid = 1950] [serial = 2267] [outer = (nil)]
11:46:53 INFO - ++DOMWINDOW == 48 (0x7f1176edac00) [pid = 1950] [serial = 2268] [outer = 0x7f1176fb5000]
11:46:53 INFO - ++DOCSHELL 0x7f118278b800 == 17 [pid = 1950] [id = 934]
11:46:53 INFO - ++DOMWINDOW == 49 (0x7f1176db5000) [pid = 1950] [serial = 2269] [outer = (nil)]
11:46:53 INFO - ++DOMWINDOW == 50 (0x7f117565cc00) [pid = 1950] [serial = 2270] [outer = 0x7f1176db5000]
11:46:54 INFO - --DOMWINDOW == 49 (0x7f1175642800) [pid = 1950] [serial = 2253] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 48 (0x7f11812cf400) [pid = 1950] [serial = 2257] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 47 (0x7f11776ebc00) [pid = 1950] [serial = 2249] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 46 (0x7f1177125800) [pid = 1950] [serial = 2247] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 45 (0x7f117565ac00) [pid = 1950] [serial = 2245] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 44 (0x7f1180f29800) [pid = 1950] [serial = 2251] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOMWINDOW == 43 (0x7f11776f1400) [pid = 1950] [serial = 2255] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:54 INFO - --DOCSHELL 0x7f11810c9800 == 16 [pid = 1950] [id = 921]
11:46:55 INFO - --DOCSHELL 0x7f11770bb800 == 15 [pid = 1950] [id = 930]
11:46:55 INFO - --DOCSHELL 0x7f1180e4c000 == 14 [pid = 1950] [id = 931]
11:46:55 INFO - --DOCSHELL 0x7f1177250800 == 13 [pid = 1950] [id = 932]
11:46:55 INFO - --DOCSHELL 0x7f1176f26800 == 12 [pid = 1950] [id = 920]
11:46:55 INFO - --DOMWINDOW == 42 (0x7f1176d7ec00) [pid = 1950] [serial = 2254] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 41 (0x7f1181143c00) [pid = 1950] [serial = 2258] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 40 (0x7f11776eac00) [pid = 1950] [serial = 2250] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 39 (0x7f1177126000) [pid = 1950] [serial = 2248] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 38 (0x7f117518d800) [pid = 1950] [serial = 2246] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 37 (0x7f1180f2d800) [pid = 1950] [serial = 2252] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 36 (0x7f1180f38c00) [pid = 1950] [serial = 2256] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:55 INFO - --DOMWINDOW == 35 (0x7f1176fbb400) [pid = 1950] [serial = 2259] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:46:56 INFO - MEMORY STAT | vsize 1294MB | residentFast 343MB | heapAllocated 132MB
11:46:56 INFO - 350 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_02.js | took 20232ms
11:46:56 INFO - ++DOCSHELL 0x7f1176f75000 == 13 [pid = 1950] [id = 935]
11:46:56 INFO - ++DOMWINDOW == 36 (0x7f1175657800) [pid = 1950] [serial = 2271] [outer = (nil)]
11:46:56 INFO - ++DOMWINDOW == 37 (0x7f117565e400) [pid = 1950] [serial = 2272] [outer = 0x7f1175657800]
11:46:56 INFO - 351 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_03.js
11:46:56 INFO - ++DOCSHELL 0x7f11773bb800 == 14 [pid = 1950] [id = 936]
11:46:56 INFO - ++DOMWINDOW == 38 (0x7f11758e4000) [pid = 1950] [serial = 2273] [outer = (nil)]
11:46:56 INFO - ++DOMWINDOW == 39 (0x7f1176cc6000) [pid = 1950] [serial = 2274] [outer = 0x7f11758e4000]
11:46:56 INFO - ++DOMWINDOW == 40 (0x7f11776f0c00) [pid = 1950] [serial = 2275] [outer = 0x7f11758e4000]
11:46:56 INFO - ++DOCSHELL 0x7f1176f24800 == 15 [pid = 1950] [id = 937]
11:46:56 INFO - ++DOMWINDOW == 41 (0x7f1176cc7800) [pid = 1950] [serial = 2276] [outer = (nil)]
11:46:56 INFO - ++DOMWINDOW == 42 (0x7f1176db5400) [pid = 1950] [serial = 2277] [outer = 0x7f1176cc7800]
11:46:57 INFO - ++DOMWINDOW == 43 (0x7f1176d7c800) [pid = 1950] [serial = 2278] [outer = 0x7f1176cc7800]
11:46:57 INFO - ++DOCSHELL 0x7f11810c8000 == 16 [pid = 1950] [id = 938]
11:46:57 INFO - ++DOMWINDOW == 44 (0x7f1176ee0c00) [pid = 1950] [serial = 2279] [outer = (nil)]
11:46:57 INFO - ++DOMWINDOW == 45 (0x7f1176faf000) [pid = 1950] [serial = 2280] [outer = 0x7f1176ee0c00]
11:47:00 INFO - --DOCSHELL 0x7f1176f8a800 == 15 [pid = 1950] [id = 918]
11:47:00 INFO - --DOCSHELL 0x7f117725d000 == 14 [pid = 1950] [id = 919]
11:47:00 INFO - --DOCSHELL 0x7f117725c800 == 13 [pid = 1950] [id = 933]
11:47:00 INFO - --DOCSHELL 0x7f118278b800 == 12 [pid = 1950] [id = 934]
11:47:00 INFO - --DOMWINDOW == 44 (0x7f118148b400) [pid = 1950] [serial = 2260] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:02 INFO - ++DOCSHELL 0x7f1181161000 == 13 [pid = 1950] [id = 939]
11:47:02 INFO - ++DOMWINDOW == 45 (0x7f1176fbbc00) [pid = 1950] [serial = 2281] [outer = (nil)]
11:47:02 INFO - ++DOMWINDOW == 46 (0x7f1177125c00) [pid = 1950] [serial = 2282] [outer = 0x7f1176fbbc00]
11:47:03 INFO - ++DOCSHELL 0x7f118279e000 == 14 [pid = 1950] [id = 940]
11:47:03 INFO - ++DOMWINDOW == 47 (0x7f1177134c00) [pid = 1950] [serial = 2283] [outer = (nil)]
11:47:03 INFO - ++DOMWINDOW == 48 (0x7f117518dc00) [pid = 1950] [serial = 2284] [outer = 0x7f1177134c00]
11:47:04 INFO - ++DOCSHELL 0x7f1183b26800 == 15 [pid = 1950] [id = 941]
11:47:04 INFO - ++DOMWINDOW == 49 (0x7f1180f38400) [pid = 1950] [serial = 2285] [outer = (nil)]
11:47:04 INFO - ++DOMWINDOW == 50 (0x7f118113f800) [pid = 1950] [serial = 2286] [outer = 0x7f1180f38400]
11:47:05 INFO - --DOMWINDOW == 49 (0x7f1176db5000) [pid = 1950] [serial = 2269] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:05 INFO - --DOMWINDOW == 48 (0x7f1176fb5000) [pid = 1950] [serial = 2267] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:05 INFO - --DOMWINDOW == 47 (0x7f1176ddd400) [pid = 1950] [serial = 2265] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:05 INFO - --DOMWINDOW == 46 (0x7f1176dda400) [pid = 1950] [serial = 2243] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:47:05 INFO - --DOMWINDOW == 45 (0x7f11758da000) [pid = 1950] [serial = 2240] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:05 INFO - --DOMWINDOW == 44 (0x7f117563f000) [pid = 1950] [serial = 2235] [outer = (nil)] [url = about:blank]
11:47:05 INFO - --DOMWINDOW == 43 (0x7f1175644c00) [pid = 1950] [serial = 2261] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:05 INFO - --DOMWINDOW == 42 (0x7f1176db5800) [pid = 1950] [serial = 2263] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:05 INFO - --DOMWINDOW == 41 (0x7f117565d000) [pid = 1950] [serial = 2237] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html]
11:47:05 INFO - --DOMWINDOW == 40 (0x7f1176cc6000) [pid = 1950] [serial = 2274] [outer = (nil)] [url = about:blank]
11:47:05 INFO - --DOMWINDOW == 39 (0x7f1175652400) [pid = 1950] [serial = 2236] [outer = (nil)] [url = about:blank]
11:47:05 INFO - --DOMWINDOW == 38 (0x7f1176db5400) [pid = 1950] [serial = 2277] [outer = (nil)] [url = about:blank]
11:47:05 INFO - ++DOCSHELL 0x7f1182496800 == 16 [pid = 1950] [id = 942]
11:47:05 INFO - ++DOMWINDOW == 39 (0x7f1177130800) [pid = 1950] [serial = 2287] [outer = (nil)]
11:47:05 INFO - ++DOMWINDOW == 40 (0x7f1180f32c00) [pid = 1950] [serial = 2288] [outer = 0x7f1177130800]
11:47:06 INFO - ++DOCSHELL 0x7f1183b1b800 == 17 [pid = 1950] [id = 943]
11:47:06 INFO - ++DOMWINDOW == 41 (0x7f117738e800) [pid = 1950] [serial = 2289] [outer = (nil)]
11:47:06 INFO - ++DOMWINDOW == 42 (0x7f11812d7800) [pid = 1950] [serial = 2290] [outer = 0x7f117738e800]
11:47:08 INFO - --DOCSHELL 0x7f1181161000 == 16 [pid = 1950] [id = 939]
11:47:08 INFO - --DOCSHELL 0x7f118279e000 == 15 [pid = 1950] [id = 940]
11:47:08 INFO - --DOCSHELL 0x7f1183b26800 == 14 [pid = 1950] [id = 941]
11:47:08 INFO - --DOCSHELL 0x7f1182496800 == 13 [pid = 1950] [id = 942]
11:47:08 INFO - --DOCSHELL 0x7f1183b1b800 == 12 [pid = 1950] [id = 943]
11:47:08 INFO - --DOMWINDOW == 41 (0x7f1176db6000) [pid = 1950] [serial = 2264] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:08 INFO - --DOMWINDOW == 40 (0x7f1176cc5800) [pid = 1950] [serial = 2239] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html]
11:47:08 INFO - --DOMWINDOW == 39 (0x7f117565cc00) [pid = 1950] [serial = 2270] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:08 INFO - --DOMWINDOW == 38 (0x7f1176edac00) [pid = 1950] [serial = 2268] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:08 INFO - --DOMWINDOW == 37 (0x7f1176ddf000) [pid = 1950] [serial = 2266] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:08 INFO - --DOMWINDOW == 36 (0x7f1176de1000) [pid = 1950] [serial = 2244] [outer = (nil)] [url = about:blank]
11:47:08 INFO - --DOMWINDOW == 35 (0x7f1176ccc400) [pid = 1950] [serial = 2242] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:08 INFO - --DOMWINDOW == 34 (0x7f1175650400) [pid = 1950] [serial = 2262] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:09 INFO - ++DOCSHELL 0x7f1180f69000 == 13 [pid = 1950] [id = 944]
11:47:09 INFO - ++DOMWINDOW == 35 (0x7f1176d83400) [pid = 1950] [serial = 2291] [outer = (nil)]
11:47:09 INFO - ++DOMWINDOW == 36 (0x7f117565d800) [pid = 1950] [serial = 2292] [outer = 0x7f1176d83400]
11:47:11 INFO - ++DOCSHELL 0x7f1181273000 == 14 [pid = 1950] [id = 945]
11:47:11 INFO - ++DOMWINDOW == 37 (0x7f1176fbb800) [pid = 1950] [serial = 2293] [outer = (nil)]
11:47:11 INFO - ++DOMWINDOW == 38 (0x7f1177126800) [pid = 1950] [serial = 2294] [outer = 0x7f1176fbb800]
11:47:11 INFO - ++DOCSHELL 0x7f11826bf000 == 15 [pid = 1950] [id = 946]
11:47:11 INFO - ++DOMWINDOW == 39 (0x7f1177396000) [pid = 1950] [serial = 2295] [outer = (nil)]
11:47:11 INFO - ++DOMWINDOW == 40 (0x7f1176ed9c00) [pid = 1950] [serial = 2296] [outer = 0x7f1177396000]
11:47:12 INFO - ++DOCSHELL 0x7f11827f3800 == 16 [pid = 1950] [id = 947]
11:47:12 INFO - ++DOMWINDOW == 41 (0x7f1176dacc00) [pid = 1950] [serial = 2297] [outer = (nil)]
11:47:12 INFO - ++DOMWINDOW == 42 (0x7f11773ea000) [pid = 1950] [serial = 2298] [outer = 0x7f1176dacc00]
11:47:12 INFO - --DOCSHELL 0x7f11810c8000 == 15 [pid = 1950] [id = 938]
11:47:14 INFO - --DOCSHELL 0x7f1180f69000 == 14 [pid = 1950] [id = 944]
11:47:14 INFO - --DOCSHELL 0x7f1181273000 == 13 [pid = 1950] [id = 945]
11:47:14 INFO - --DOCSHELL 0x7f11826bf000 == 12 [pid = 1950] [id = 946]
11:47:14 INFO - --DOCSHELL 0x7f1176f24800 == 11 [pid = 1950] [id = 937]
11:47:14 INFO - --DOMWINDOW == 41 (0x7f1176d83400) [pid = 1950] [serial = 2291] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 40 (0x7f1176fbb800) [pid = 1950] [serial = 2293] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 39 (0x7f1177396000) [pid = 1950] [serial = 2295] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 38 (0x7f1180f38400) [pid = 1950] [serial = 2285] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 37 (0x7f1176fbbc00) [pid = 1950] [serial = 2281] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 36 (0x7f1177130800) [pid = 1950] [serial = 2287] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:14 INFO - --DOMWINDOW == 35 (0x7f1177134c00) [pid = 1950] [serial = 2283] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:15 INFO - MEMORY STAT | vsize 1293MB | residentFast 342MB | heapAllocated 137MB
11:47:15 INFO - 352 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_03.js | took 18749ms
11:47:15 INFO - ++DOCSHELL 0x7f1176f24800 == 12 [pid = 1950] [id = 948]
11:47:15 INFO - ++DOMWINDOW == 36 (0x7f1176cd1400) [pid = 1950] [serial = 2299] [outer = (nil)]
11:47:15 INFO - ++DOMWINDOW == 37 (0x7f1176d85800) [pid = 1950] [serial = 2300] [outer = 0x7f1176cd1400]
11:47:15 INFO - 353 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_04.js
11:47:15 INFO - ++DOCSHELL 0x7f1180f70800 == 13 [pid = 1950] [id = 949]
11:47:15 INFO - ++DOMWINDOW == 38 (0x7f1176dce400) [pid = 1950] [serial = 2301] [outer = (nil)]
11:47:15 INFO - ++DOMWINDOW == 39 (0x7f1176ed5400) [pid = 1950] [serial = 2302] [outer = 0x7f1176dce400]
11:47:15 INFO - ++DOMWINDOW == 40 (0x7f1181d9b800) [pid = 1950] [serial = 2303] [outer = 0x7f1176dce400]
11:47:15 INFO - ++DOCSHELL 0x7f1176f7b800 == 14 [pid = 1950] [id = 950]
11:47:15 INFO - ++DOMWINDOW == 41 (0x7f1176ed7c00) [pid = 1950] [serial = 2304] [outer = (nil)]
11:47:15 INFO - ++DOMWINDOW == 42 (0x7f1177211c00) [pid = 1950] [serial = 2305] [outer = 0x7f1176ed7c00]
11:47:16 INFO - ++DOMWINDOW == 43 (0x7f117712a800) [pid = 1950] [serial = 2306] [outer = 0x7f1176ed7c00]
11:47:16 INFO - ++DOCSHELL 0x7f1183b26800 == 15 [pid = 1950] [id = 951]
11:47:16 INFO - ++DOMWINDOW == 44 (0x7f1177679c00) [pid = 1950] [serial = 2307] [outer = (nil)]
11:47:16 INFO - ++DOMWINDOW == 45 (0x7f1177683c00) [pid = 1950] [serial = 2308] [outer = 0x7f1177679c00]
11:47:19 INFO - --DOCSHELL 0x7f1176f75000 == 14 [pid = 1950] [id = 935]
11:47:19 INFO - --DOCSHELL 0x7f11827f3800 == 13 [pid = 1950] [id = 947]
11:47:19 INFO - --DOCSHELL 0x7f11773bb800 == 12 [pid = 1950] [id = 936]
11:47:19 INFO - --DOMWINDOW == 44 (0x7f118113f800) [pid = 1950] [serial = 2286] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 43 (0x7f117565d800) [pid = 1950] [serial = 2292] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 42 (0x7f1177126800) [pid = 1950] [serial = 2294] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 41 (0x7f1176ed9c00) [pid = 1950] [serial = 2296] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 40 (0x7f1177125c00) [pid = 1950] [serial = 2282] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 39 (0x7f1180f32c00) [pid = 1950] [serial = 2288] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:19 INFO - --DOMWINDOW == 38 (0x7f117518dc00) [pid = 1950] [serial = 2284] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:20 INFO - ++DOCSHELL 0x7f117724c000 == 13 [pid = 1950] [id = 952]
11:47:20 INFO - ++DOMWINDOW == 39 (0x7f1176dd6400) [pid = 1950] [serial = 2309] [outer = (nil)]
11:47:20 INFO - ++DOMWINDOW == 40 (0x7f1176dd7400) [pid = 1950] [serial = 2310] [outer = 0x7f1176dd6400]
11:47:21 INFO - ++DOCSHELL 0x7f1181265000 == 14 [pid = 1950] [id = 953]
11:47:21 INFO - ++DOMWINDOW == 41 (0x7f117712bc00) [pid = 1950] [serial = 2311] [outer = (nil)]
11:47:21 INFO - ++DOMWINDOW == 42 (0x7f1175191c00) [pid = 1950] [serial = 2312] [outer = 0x7f117712bc00]
11:47:22 INFO - ++DOCSHELL 0x7f118248e000 == 15 [pid = 1950] [id = 954]
11:47:22 INFO - ++DOMWINDOW == 43 (0x7f11773e5800) [pid = 1950] [serial = 2313] [outer = (nil)]
11:47:22 INFO - ++DOMWINDOW == 44 (0x7f11773e8800) [pid = 1950] [serial = 2314] [outer = 0x7f11773e5800]
11:47:23 INFO - --DOMWINDOW == 43 (0x7f1176dacc00) [pid = 1950] [serial = 2297] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:23 INFO - --DOMWINDOW == 42 (0x7f1176cc7800) [pid = 1950] [serial = 2276] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:23 INFO - --DOMWINDOW == 41 (0x7f1176ee0c00) [pid = 1950] [serial = 2279] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:47:23 INFO - --DOMWINDOW == 40 (0x7f117738e800) [pid = 1950] [serial = 2289] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:23 INFO - --DOMWINDOW == 39 (0x7f11758e4000) [pid = 1950] [serial = 2273] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html]
11:47:23 INFO - --DOMWINDOW == 38 (0x7f1175657800) [pid = 1950] [serial = 2271] [outer = (nil)] [url = about:blank]
11:47:23 INFO - --DOMWINDOW == 37 (0x7f1176ed5400) [pid = 1950] [serial = 2302] [outer = (nil)] [url = about:blank]
11:47:23 INFO - --DOMWINDOW == 36 (0x7f117565e400) [pid = 1950] [serial = 2272] [outer = (nil)] [url = about:blank]
11:47:23 INFO - --DOMWINDOW == 35 (0x7f1177211c00) [pid = 1950] [serial = 2305] [outer = (nil)] [url = about:blank]
11:47:23 INFO - --DOMWINDOW == 34 (0x7f11776f0c00) [pid = 1950] [serial = 2275] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html]
11:47:23 INFO - ++DOCSHELL 0x7f11810bd000 == 16 [pid = 1950] [id = 955]
11:47:23 INFO - ++DOMWINDOW == 35 (0x7f117720dc00) [pid = 1950] [serial = 2315] [outer = (nil)]
11:47:23 INFO - ++DOMWINDOW == 36 (0x7f1177679800) [pid = 1950] [serial = 2316] [outer = 0x7f117720dc00]
11:47:24 INFO - ++DOCSHELL 0x7f118278a800 == 17 [pid = 1950] [id = 956]
11:47:24 INFO - ++DOMWINDOW == 37 (0x7f11776f6000) [pid = 1950] [serial = 2317] [outer = (nil)]
11:47:24 INFO - ++DOMWINDOW == 38 (0x7f1180f29400) [pid = 1950] [serial = 2318] [outer = 0x7f11776f6000]
11:47:25 INFO - ++DOCSHELL 0x7f118281b800 == 18 [pid = 1950] [id = 957]
11:47:25 INFO - ++DOMWINDOW == 39 (0x7f1180f33c00) [pid = 1950] [serial = 2319] [outer = (nil)]
11:47:25 INFO - ++DOMWINDOW == 40 (0x7f1180f35400) [pid = 1950] [serial = 2320] [outer = 0x7f1180f33c00]
11:47:26 INFO - --DOCSHELL 0x7f117724c000 == 17 [pid = 1950] [id = 952]
11:47:26 INFO - --DOCSHELL 0x7f1181265000 == 16 [pid = 1950] [id = 953]
11:47:26 INFO - --DOCSHELL 0x7f118248e000 == 15 [pid = 1950] [id = 954]
11:47:26 INFO - --DOCSHELL 0x7f11810bd000 == 14 [pid = 1950] [id = 955]
11:47:26 INFO - --DOCSHELL 0x7f118278a800 == 13 [pid = 1950] [id = 956]
11:47:26 INFO - --DOCSHELL 0x7f118281b800 == 12 [pid = 1950] [id = 957]
11:47:26 INFO - --DOMWINDOW == 39 (0x7f11773ea000) [pid = 1950] [serial = 2298] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:26 INFO - --DOMWINDOW == 38 (0x7f1176d7c800) [pid = 1950] [serial = 2278] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:26 INFO - --DOMWINDOW == 37 (0x7f1176faf000) [pid = 1950] [serial = 2280] [outer = (nil)] [url = about:blank]
11:47:26 INFO - --DOMWINDOW == 36 (0x7f11812d7800) [pid = 1950] [serial = 2290] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:27 INFO - ++DOCSHELL 0x7f1176f8a800 == 13 [pid = 1950] [id = 958]
11:47:27 INFO - ++DOMWINDOW == 37 (0x7f117563fc00) [pid = 1950] [serial = 2321] [outer = (nil)]
11:47:27 INFO - ++DOMWINDOW == 38 (0x7f1175643800) [pid = 1950] [serial = 2322] [outer = 0x7f117563fc00]
11:47:28 INFO - ++DOCSHELL 0x7f117a617000 == 14 [pid = 1950] [id = 959]
11:47:28 INFO - ++DOMWINDOW == 39 (0x7f1176cc3400) [pid = 1950] [serial = 2323] [outer = (nil)]
11:47:28 INFO - ++DOMWINDOW == 40 (0x7f1176cc6c00) [pid = 1950] [serial = 2324] [outer = 0x7f1176cc3400]
11:47:28 INFO - --DOCSHELL 0x7f1183b26800 == 13 [pid = 1950] [id = 951]
11:47:29 INFO - --DOCSHELL 0x7f1176f8a800 == 12 [pid = 1950] [id = 958]
11:47:29 INFO - --DOCSHELL 0x7f117a617000 == 11 [pid = 1950] [id = 959]
11:47:29 INFO - --DOCSHELL 0x7f1176f7b800 == 10 [pid = 1950] [id = 950]
11:47:30 INFO - --DOMWINDOW == 39 (0x7f1180f33c00) [pid = 1950] [serial = 2319] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - --DOMWINDOW == 38 (0x7f11773e5800) [pid = 1950] [serial = 2313] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - --DOMWINDOW == 37 (0x7f11776f6000) [pid = 1950] [serial = 2317] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - --DOMWINDOW == 36 (0x7f1176dd6400) [pid = 1950] [serial = 2309] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - --DOMWINDOW == 35 (0x7f117720dc00) [pid = 1950] [serial = 2315] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - --DOMWINDOW == 34 (0x7f117712bc00) [pid = 1950] [serial = 2311] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:30 INFO - MEMORY STAT | vsize 1293MB | residentFast 338MB | heapAllocated 132MB
11:47:30 INFO - 354 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_04.js | took 15230ms
11:47:30 INFO - ++DOCSHELL 0x7f1176f22800 == 11 [pid = 1950] [id = 960]
11:47:30 INFO - ++DOMWINDOW == 35 (0x7f1175656800) [pid = 1950] [serial = 2325] [outer = (nil)]
11:47:30 INFO - ++DOMWINDOW == 36 (0x7f117565b400) [pid = 1950] [serial = 2326] [outer = 0x7f1175656800]
11:47:30 INFO - 355 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_05.js
11:47:30 INFO - ++DOCSHELL 0x7f1177261800 == 12 [pid = 1950] [id = 961]
11:47:30 INFO - ++DOMWINDOW == 37 (0x7f11758e0400) [pid = 1950] [serial = 2327] [outer = (nil)]
11:47:30 INFO - ++DOMWINDOW == 38 (0x7f11758e4400) [pid = 1950] [serial = 2328] [outer = 0x7f11758e0400]
11:47:31 INFO - ++DOCSHELL 0x7f1176f75800 == 13 [pid = 1950] [id = 962]
11:47:31 INFO - ++DOMWINDOW == 39 (0x7f1176dbb800) [pid = 1950] [serial = 2329] [outer = (nil)]
11:47:31 INFO - ++DOMWINDOW == 40 (0x7f1176dc2800) [pid = 1950] [serial = 2330] [outer = 0x7f1176dbb800]
11:47:31 INFO - ++DOMWINDOW == 41 (0x7f1176dacc00) [pid = 1950] [serial = 2331] [outer = 0x7f1176dbb800]
11:47:31 INFO - ++DOCSHELL 0x7f1181155000 == 14 [pid = 1950] [id = 963]
11:47:31 INFO - ++DOMWINDOW == 42 (0x7f1176fb4400) [pid = 1950] [serial = 2332] [outer = (nil)]
11:47:31 INFO - ++DOMWINDOW == 43 (0x7f1176fb7800) [pid = 1950] [serial = 2333] [outer = 0x7f1176fb4400]
11:47:33 INFO - ++DOCSHELL 0x7f118278a800 == 15 [pid = 1950] [id = 964]
11:47:33 INFO - ++DOMWINDOW == 44 (0x7f11776f5000) [pid = 1950] [serial = 2334] [outer = (nil)]
11:47:34 INFO - [1950] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9306
11:47:34 INFO - ++DOMWINDOW == 45 (0x7f1175188400) [pid = 1950] [serial = 2335] [outer = 0x7f11776f5000]
11:47:35 INFO - --DOCSHELL 0x7f1176f24800 == 14 [pid = 1950] [id = 948]
11:47:35 INFO - --DOCSHELL 0x7f1180f70800 == 13 [pid = 1950] [id = 949]
11:47:35 INFO - --DOCSHELL 0x7f118278a800 == 12 [pid = 1950] [id = 964]
11:47:35 INFO - --DOMWINDOW == 44 (0x7f1180f35400) [pid = 1950] [serial = 2320] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:35 INFO - --DOMWINDOW == 43 (0x7f1180f29400) [pid = 1950] [serial = 2318] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:35 INFO - --DOMWINDOW == 42 (0x7f1177679800) [pid = 1950] [serial = 2316] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:35 INFO - --DOMWINDOW == 41 (0x7f11773e8800) [pid = 1950] [serial = 2314] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:35 INFO - --DOMWINDOW == 40 (0x7f1175191c00) [pid = 1950] [serial = 2312] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:35 INFO - --DOMWINDOW == 39 (0x7f1176dd7400) [pid = 1950] [serial = 2310] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:37 INFO - ++DOCSHELL 0x7f1181168000 == 13 [pid = 1950] [id = 965]
11:47:37 INFO - ++DOMWINDOW == 40 (0x7f1176db8c00) [pid = 1950] [serial = 2336] [outer = (nil)]
11:47:37 INFO - ++DOMWINDOW == 41 (0x7f117712dc00) [pid = 1950] [serial = 2337] [outer = 0x7f1176db8c00]
11:47:38 INFO - --DOMWINDOW == 40 (0x7f1176dc2800) [pid = 1950] [serial = 2330] [outer = (nil)] [url = about:blank]
11:47:38 INFO - --DOMWINDOW == 39 (0x7f1176d85800) [pid = 1950] [serial = 2300] [outer = (nil)] [url = about:blank]
11:47:38 INFO - --DOMWINDOW == 38 (0x7f1176ed7c00) [pid = 1950] [serial = 2304] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:38 INFO - --DOMWINDOW == 37 (0x7f1177679c00) [pid = 1950] [serial = 2307] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:47:38 INFO - --DOMWINDOW == 36 (0x7f1176cd1400) [pid = 1950] [serial = 2299] [outer = (nil)] [url = about:blank]
11:47:38 INFO - --DOMWINDOW == 35 (0x7f1176dce400) [pid = 1950] [serial = 2301] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html]
11:47:38 INFO - --DOMWINDOW == 34 (0x7f1176cc3400) [pid = 1950] [serial = 2323] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:38 INFO - --DOMWINDOW == 33 (0x7f117563fc00) [pid = 1950] [serial = 2321] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:38 INFO - --DOCSHELL 0x7f1181168000 == 12 [pid = 1950] [id = 965]
11:47:39 INFO - --DOMWINDOW == 32 (0x7f117712a800) [pid = 1950] [serial = 2306] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:39 INFO - --DOMWINDOW == 31 (0x7f1177683c00) [pid = 1950] [serial = 2308] [outer = (nil)] [url = about:blank]
11:47:39 INFO - --DOMWINDOW == 30 (0x7f1181d9b800) [pid = 1950] [serial = 2303] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html]
11:47:39 INFO - --DOMWINDOW == 29 (0x7f1176cc6c00) [pid = 1950] [serial = 2324] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:39 INFO - --DOMWINDOW == 28 (0x7f1175643800) [pid = 1950] [serial = 2322] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:39 INFO - ++DOCSHELL 0x7f1176f88000 == 13 [pid = 1950] [id = 966]
11:47:39 INFO - ++DOMWINDOW == 29 (0x7f1175638c00) [pid = 1950] [serial = 2338] [outer = (nil)]
11:47:39 INFO - ++DOMWINDOW == 30 (0x7f117563b400) [pid = 1950] [serial = 2339] [outer = 0x7f1175638c00]
11:47:40 INFO - ++DOCSHELL 0x7f1180e41800 == 14 [pid = 1950] [id = 967]
11:47:40 INFO - ++DOMWINDOW == 31 (0x7f11758e4800) [pid = 1950] [serial = 2340] [outer = (nil)]
11:47:40 INFO - ++DOMWINDOW == 32 (0x7f1176ccbc00) [pid = 1950] [serial = 2341] [outer = 0x7f11758e4800]
11:47:41 INFO - ++DOCSHELL 0x7f11810b4800 == 15 [pid = 1950] [id = 968]
11:47:41 INFO - ++DOMWINDOW == 33 (0x7f1176dd9000) [pid = 1950] [serial = 2342] [outer = (nil)]
11:47:41 INFO - ++DOMWINDOW == 34 (0x7f1176ddb000) [pid = 1950] [serial = 2343] [outer = 0x7f1176dd9000]
11:47:42 INFO - --DOCSHELL 0x7f1176f88000 == 14 [pid = 1950] [id = 966]
11:47:42 INFO - --DOCSHELL 0x7f1180e41800 == 13 [pid = 1950] [id = 967]
11:47:42 INFO - --DOCSHELL 0x7f11810b4800 == 12 [pid = 1950] [id = 968]
11:47:43 INFO - ++DOCSHELL 0x7f1180e1b800 == 13 [pid = 1950] [id = 969]
11:47:43 INFO - ++DOMWINDOW == 35 (0x7f1176cc5800) [pid = 1950] [serial = 2344] [outer = (nil)]
11:47:43 INFO - ++DOMWINDOW == 36 (0x7f1176cc6c00) [pid = 1950] [serial = 2345] [outer = 0x7f1176cc5800]
11:47:44 INFO - ++DOCSHELL 0x7f11810ca800 == 14 [pid = 1950] [id = 970]
11:47:44 INFO - ++DOMWINDOW == 37 (0x7f1176de1400) [pid = 1950] [serial = 2346] [outer = (nil)]
11:47:44 INFO - ++DOMWINDOW == 38 (0x7f1176ed6800) [pid = 1950] [serial = 2347] [outer = 0x7f1176de1400]
11:47:45 INFO - ++DOCSHELL 0x7f1181272000 == 15 [pid = 1950] [id = 971]
11:47:45 INFO - ++DOMWINDOW == 39 (0x7f1176fbb000) [pid = 1950] [serial = 2348] [outer = (nil)]
11:47:45 INFO - ++DOMWINDOW == 40 (0x7f1176fb6000) [pid = 1950] [serial = 2349] [outer = 0x7f1176fbb000]
11:47:46 INFO - ++DOCSHELL 0x7f118151f000 == 16 [pid = 1950] [id = 972]
11:47:46 INFO - ++DOMWINDOW == 41 (0x7f1176db3400) [pid = 1950] [serial = 2350] [outer = (nil)]
11:47:46 INFO - ++DOMWINDOW == 42 (0x7f1177395c00) [pid = 1950] [serial = 2351] [outer = 0x7f1176db3400]
11:47:46 INFO - ++DOCSHELL 0x7f118281b800 == 17 [pid = 1950] [id = 973]
11:47:46 INFO - ++DOMWINDOW == 43 (0x7f1176de0400) [pid = 1950] [serial = 2352] [outer = (nil)]
11:47:46 INFO - ++DOMWINDOW == 44 (0x7f11773f0400) [pid = 1950] [serial = 2353] [outer = 0x7f1176de0400]
11:47:47 INFO - ++DOCSHELL 0x7f1180f69800 == 18 [pid = 1950] [id = 974]
11:47:47 INFO - ++DOMWINDOW == 45 (0x7f11776f3000) [pid = 1950] [serial = 2354] [outer = (nil)]
11:47:47 INFO - ++DOMWINDOW == 46 (0x7f11776f5c00) [pid = 1950] [serial = 2355] [outer = 0x7f11776f3000]
11:47:48 INFO - ++DOCSHELL 0x7f1183b2c800 == 19 [pid = 1950] [id = 975]
11:47:48 INFO - ++DOMWINDOW == 47 (0x7f1180f34400) [pid = 1950] [serial = 2356] [outer = (nil)]
11:47:48 INFO - ++DOMWINDOW == 48 (0x7f1180f30000) [pid = 1950] [serial = 2357] [outer = 0x7f1180f34400]
11:47:48 INFO - --DOCSHELL 0x7f1181155000 == 18 [pid = 1950] [id = 963]
11:47:49 INFO - --DOCSHELL 0x7f1180e1b800 == 17 [pid = 1950] [id = 969]
11:47:49 INFO - --DOCSHELL 0x7f11810ca800 == 16 [pid = 1950] [id = 970]
11:47:49 INFO - --DOCSHELL 0x7f1181272000 == 15 [pid = 1950] [id = 971]
11:47:49 INFO - --DOCSHELL 0x7f1176f75800 == 14 [pid = 1950] [id = 962]
11:47:49 INFO - --DOMWINDOW == 47 (0x7f1176db8c00) [pid = 1950] [serial = 2336] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 46 (0x7f11776f5000) [pid = 1950] [serial = 2334] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 45 (0x7f11758e4800) [pid = 1950] [serial = 2340] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 44 (0x7f1175638c00) [pid = 1950] [serial = 2338] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 43 (0x7f117712dc00) [pid = 1950] [serial = 2337] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 42 (0x7f1175188400) [pid = 1950] [serial = 2335] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 41 (0x7f1176ccbc00) [pid = 1950] [serial = 2341] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 40 (0x7f117563b400) [pid = 1950] [serial = 2339] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 39 (0x7f1180f34400) [pid = 1950] [serial = 2356] [outer = (nil)] [url = about:blank]
11:47:49 INFO - --DOMWINDOW == 38 (0x7f1180f30000) [pid = 1950] [serial = 2357] [outer = (nil)] [url = about:blank]
11:47:49 INFO - --DOMWINDOW == 37 (0x7f1176de1400) [pid = 1950] [serial = 2346] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 36 (0x7f1176cc5800) [pid = 1950] [serial = 2344] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:49 INFO - --DOMWINDOW == 35 (0x7f1176dd9000) [pid = 1950] [serial = 2342] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:50 INFO - MEMORY STAT | vsize 1294MB | residentFast 342MB | heapAllocated 136MB
11:47:50 INFO - 356 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_05.js | took 19513ms
11:47:50 INFO - ++DOCSHELL 0x7f1176f17000 == 15 [pid = 1950] [id = 976]
11:47:50 INFO - ++DOMWINDOW == 36 (0x7f11758d8000) [pid = 1950] [serial = 2358] [outer = (nil)]
11:47:50 INFO - ++DOMWINDOW == 37 (0x7f1176ccbc00) [pid = 1950] [serial = 2359] [outer = 0x7f11758d8000]
11:47:50 INFO - 357 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_06.js
11:47:50 INFO - ++DOCSHELL 0x7f11810af000 == 16 [pid = 1950] [id = 977]
11:47:50 INFO - ++DOMWINDOW == 38 (0x7f1176dcd400) [pid = 1950] [serial = 2360] [outer = (nil)]
11:47:50 INFO - ++DOMWINDOW == 39 (0x7f1176dd2c00) [pid = 1950] [serial = 2361] [outer = 0x7f1176dcd400]
11:47:51 INFO - ++DOCSHELL 0x7f1176f20800 == 17 [pid = 1950] [id = 978]
11:47:51 INFO - ++DOMWINDOW == 40 (0x7f1176dd4c00) [pid = 1950] [serial = 2362] [outer = (nil)]
11:47:51 INFO - ++DOMWINDOW == 41 (0x7f1176fb2000) [pid = 1950] [serial = 2363] [outer = 0x7f1176dd4c00]
11:47:51 INFO - ++DOMWINDOW == 42 (0x7f1176d86800) [pid = 1950] [serial = 2364] [outer = 0x7f1176dd4c00]
11:47:51 INFO - ++DOCSHELL 0x7f11835ef000 == 18 [pid = 1950] [id = 979]
11:47:51 INFO - ++DOMWINDOW == 43 (0x7f1177397c00) [pid = 1950] [serial = 2365] [outer = (nil)]
11:47:51 INFO - ++DOMWINDOW == 44 (0x7f11773e5400) [pid = 1950] [serial = 2366] [outer = 0x7f1177397c00]
11:47:54 INFO - --DOCSHELL 0x7f1177261800 == 17 [pid = 1950] [id = 961]
11:47:54 INFO - --DOCSHELL 0x7f1180f69800 == 16 [pid = 1950] [id = 974]
11:47:54 INFO - --DOCSHELL 0x7f1176f22800 == 15 [pid = 1950] [id = 960]
11:47:54 INFO - --DOCSHELL 0x7f118151f000 == 14 [pid = 1950] [id = 972]
11:47:54 INFO - --DOCSHELL 0x7f118281b800 == 13 [pid = 1950] [id = 973]
11:47:54 INFO - --DOCSHELL 0x7f1183b2c800 == 12 [pid = 1950] [id = 975]
11:47:54 INFO - --DOMWINDOW == 43 (0x7f1176ddb000) [pid = 1950] [serial = 2343] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:54 INFO - --DOMWINDOW == 42 (0x7f1176ed6800) [pid = 1950] [serial = 2347] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:54 INFO - --DOMWINDOW == 41 (0x7f1176cc6c00) [pid = 1950] [serial = 2345] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:54 INFO - ++DOCSHELL 0x7f1177243800 == 13 [pid = 1950] [id = 980]
11:47:54 INFO - ++DOMWINDOW == 42 (0x7f1175658400) [pid = 1950] [serial = 2367] [outer = (nil)]
11:47:55 INFO - ++DOMWINDOW == 43 (0x7f11758d6c00) [pid = 1950] [serial = 2368] [outer = 0x7f1175658400]
11:47:55 INFO - ++DOCSHELL 0x7f11810b7800 == 14 [pid = 1950] [id = 981]
11:47:55 INFO - ++DOMWINDOW == 44 (0x7f1176dd1400) [pid = 1950] [serial = 2369] [outer = (nil)]
11:47:55 INFO - ++DOMWINDOW == 45 (0x7f1176dd8c00) [pid = 1950] [serial = 2370] [outer = 0x7f1176dd1400]
11:47:56 INFO - ++DOCSHELL 0x7f11810c7800 == 15 [pid = 1950] [id = 982]
11:47:56 INFO - ++DOMWINDOW == 46 (0x7f117712a800) [pid = 1950] [serial = 2371] [outer = (nil)]
11:47:56 INFO - ++DOMWINDOW == 47 (0x7f1176fb6800) [pid = 1950] [serial = 2372] [outer = 0x7f117712a800]
11:47:57 INFO - ++DOCSHELL 0x7f1182798000 == 16 [pid = 1950] [id = 983]
11:47:57 INFO - ++DOMWINDOW == 48 (0x7f117720a000) [pid = 1950] [serial = 2373] [outer = (nil)]
11:47:57 INFO - ++DOMWINDOW == 49 (0x7f1177677400) [pid = 1950] [serial = 2374] [outer = 0x7f117720a000]
11:47:58 INFO - ++DOCSHELL 0x7f11835ee000 == 17 [pid = 1950] [id = 984]
11:47:58 INFO - ++DOMWINDOW == 50 (0x7f1176dd5400) [pid = 1950] [serial = 2375] [outer = (nil)]
11:47:58 INFO - ++DOMWINDOW == 51 (0x7f1177209c00) [pid = 1950] [serial = 2376] [outer = 0x7f1176dd5400]
11:47:58 INFO - --DOMWINDOW == 50 (0x7f11758e0400) [pid = 1950] [serial = 2327] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2005]
11:47:58 INFO - --DOMWINDOW == 49 (0x7f1176db3400) [pid = 1950] [serial = 2350] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:58 INFO - --DOMWINDOW == 48 (0x7f11776f3000) [pid = 1950] [serial = 2354] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:58 INFO - --DOMWINDOW == 47 (0x7f1176fbb000) [pid = 1950] [serial = 2348] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:58 INFO - --DOMWINDOW == 46 (0x7f1176de0400) [pid = 1950] [serial = 2352] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:47:58 INFO - --DOMWINDOW == 45 (0x7f1175656800) [pid = 1950] [serial = 2325] [outer = (nil)] [url = about:blank]
11:47:58 INFO - --DOMWINDOW == 44 (0x7f1176fb2000) [pid = 1950] [serial = 2363] [outer = (nil)] [url = about:blank]
11:47:58 INFO - --DOMWINDOW == 43 (0x7f117565b400) [pid = 1950] [serial = 2326] [outer = (nil)] [url = about:blank]
11:47:58 INFO - --DOMWINDOW == 42 (0x7f1176dbb800) [pid = 1950] [serial = 2329] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:47:58 INFO - --DOMWINDOW == 41 (0x7f1176fb4400) [pid = 1950] [serial = 2332] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:47:59 INFO - ++DOCSHELL 0x7f1180f7d800 == 18 [pid = 1950] [id = 985]
11:47:59 INFO - ++DOMWINDOW == 42 (0x7f11773ec400) [pid = 1950] [serial = 2377] [outer = (nil)]
11:47:59 INFO - ++DOMWINDOW == 43 (0x7f1180f30c00) [pid = 1950] [serial = 2378] [outer = 0x7f11773ec400]
11:47:59 INFO - ++DOCSHELL 0x7f118364c800 == 19 [pid = 1950] [id = 986]
11:47:59 INFO - ++DOMWINDOW == 44 (0x7f118114a000) [pid = 1950] [serial = 2379] [outer = (nil)]
11:47:59 INFO - ++DOMWINDOW == 45 (0x7f118113fc00) [pid = 1950] [serial = 2380] [outer = 0x7f118114a000]
11:48:00 INFO - ++DOCSHELL 0x7f1183e4c000 == 20 [pid = 1950] [id = 987]
11:48:00 INFO - ++DOMWINDOW == 46 (0x7f1176d88800) [pid = 1950] [serial = 2381] [outer = (nil)]
11:48:00 INFO - ++DOMWINDOW == 47 (0x7f1176dad000) [pid = 1950] [serial = 2382] [outer = 0x7f1176d88800]
11:48:01 INFO - --DOCSHELL 0x7f1177243800 == 19 [pid = 1950] [id = 980]
11:48:01 INFO - --DOCSHELL 0x7f11810b7800 == 18 [pid = 1950] [id = 981]
11:48:01 INFO - --DOCSHELL 0x7f11810c7800 == 17 [pid = 1950] [id = 982]
11:48:01 INFO - --DOCSHELL 0x7f1182798000 == 16 [pid = 1950] [id = 983]
11:48:01 INFO - --DOCSHELL 0x7f11835ee000 == 15 [pid = 1950] [id = 984]
11:48:01 INFO - --DOCSHELL 0x7f1180f7d800 == 14 [pid = 1950] [id = 985]
11:48:01 INFO - --DOCSHELL 0x7f118364c800 == 13 [pid = 1950] [id = 986]
11:48:01 INFO - --DOCSHELL 0x7f1183e4c000 == 12 [pid = 1950] [id = 987]
11:48:02 INFO - --DOMWINDOW == 46 (0x7f11758e4400) [pid = 1950] [serial = 2328] [outer = (nil)] [url = about:blank]
11:48:02 INFO - --DOMWINDOW == 45 (0x7f1177395c00) [pid = 1950] [serial = 2351] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:02 INFO - --DOMWINDOW == 44 (0x7f11776f5c00) [pid = 1950] [serial = 2355] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:02 INFO - --DOMWINDOW == 43 (0x7f1176fb6000) [pid = 1950] [serial = 2349] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:02 INFO - --DOMWINDOW == 42 (0x7f11773f0400) [pid = 1950] [serial = 2353] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:02 INFO - --DOMWINDOW == 41 (0x7f1176dacc00) [pid = 1950] [serial = 2331] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:02 INFO - --DOMWINDOW == 40 (0x7f1176fb7800) [pid = 1950] [serial = 2333] [outer = (nil)] [url = about:blank]
11:48:02 INFO - ++DOCSHELL 0x7f1176f7f000 == 13 [pid = 1950] [id = 988]
11:48:02 INFO - ++DOMWINDOW == 41 (0x7f1175650400) [pid = 1950] [serial = 2383] [outer = (nil)]
11:48:02 INFO - ++DOMWINDOW == 42 (0x7f1175651800) [pid = 1950] [serial = 2384] [outer = 0x7f1175650400]
11:48:03 INFO - ++DOCSHELL 0x7f1180e3b000 == 14 [pid = 1950] [id = 989]
11:48:03 INFO - ++DOMWINDOW == 43 (0x7f1176db0800) [pid = 1950] [serial = 2385] [outer = (nil)]
11:48:03 INFO - ++DOMWINDOW == 44 (0x7f1176db6000) [pid = 1950] [serial = 2386] [outer = 0x7f1176db0800]
11:48:04 INFO - ++DOCSHELL 0x7f11810c0000 == 15 [pid = 1950] [id = 990]
11:48:04 INFO - ++DOMWINDOW == 45 (0x7f1176ed6800) [pid = 1950] [serial = 2387] [outer = (nil)]
11:48:04 INFO - ++DOMWINDOW == 46 (0x7f1176ed7c00) [pid = 1950] [serial = 2388] [outer = 0x7f1176ed6800]
11:48:05 INFO - ++DOCSHELL 0x7f1176f84800 == 16 [pid = 1950] [id = 991]
11:48:05 INFO - ++DOMWINDOW == 47 (0x7f117720a400) [pid = 1950] [serial = 2389] [outer = (nil)]
11:48:05 INFO - ++DOMWINDOW == 48 (0x7f1176fb2000) [pid = 1950] [serial = 2390] [outer = 0x7f117720a400]
11:48:05 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 404: TypeError: this._tabs is null
11:48:05 INFO - ++DOCSHELL 0x7f1182492800 == 17 [pid = 1950] [id = 992]
11:48:05 INFO - ++DOMWINDOW == 49 (0x7f1177398400) [pid = 1950] [serial = 2391] [outer = (nil)]
11:48:05 INFO - ++DOMWINDOW == 50 (0x7f11773e3c00) [pid = 1950] [serial = 2392] [outer = 0x7f1177398400]
11:48:05 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 404: TypeError: this._tabs is null
11:48:05 INFO - --DOMWINDOW == 49 (0x7f1176dd5400) [pid = 1950] [serial = 2375] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 48 (0x7f11773ec400) [pid = 1950] [serial = 2377] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 47 (0x7f1175658400) [pid = 1950] [serial = 2367] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 46 (0x7f1176dd1400) [pid = 1950] [serial = 2369] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 45 (0x7f1176d88800) [pid = 1950] [serial = 2381] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 44 (0x7f117720a000) [pid = 1950] [serial = 2373] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 43 (0x7f117712a800) [pid = 1950] [serial = 2371] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:05 INFO - --DOMWINDOW == 42 (0x7f118114a000) [pid = 1950] [serial = 2379] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:06 INFO - ++DOCSHELL 0x7f117724a000 == 18 [pid = 1950] [id = 993]
11:48:06 INFO - ++DOMWINDOW == 43 (0x7f11773e8400) [pid = 1950] [serial = 2393] [outer = (nil)]
11:48:06 INFO - ++DOMWINDOW == 44 (0x7f11773e9c00) [pid = 1950] [serial = 2394] [outer = 0x7f11773e8400]
11:48:06 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 404: TypeError: this._tabs is null
11:48:06 INFO - ++DOCSHELL 0x7f1182790800 == 19 [pid = 1950] [id = 994]
11:48:06 INFO - ++DOMWINDOW == 45 (0x7f1177133800) [pid = 1950] [serial = 2395] [outer = (nil)]
11:48:06 INFO - ++DOMWINDOW == 46 (0x7f11773ee800) [pid = 1950] [serial = 2396] [outer = 0x7f1177133800]
11:48:07 INFO - ++DOCSHELL 0x7f1182792000 == 20 [pid = 1950] [id = 995]
11:48:07 INFO - ++DOMWINDOW == 47 (0x7f117767d000) [pid = 1950] [serial = 2397] [outer = (nil)]
11:48:07 INFO - ++DOMWINDOW == 48 (0x7f117712dc00) [pid = 1950] [serial = 2398] [outer = 0x7f117767d000]
11:48:07 INFO - --DOCSHELL 0x7f11835ef000 == 19 [pid = 1950] [id = 979]
11:48:08 INFO - --DOCSHELL 0x7f1176f7f000 == 18 [pid = 1950] [id = 988]
11:48:08 INFO - --DOCSHELL 0x7f1180e3b000 == 17 [pid = 1950] [id = 989]
11:48:08 INFO - --DOCSHELL 0x7f11810c0000 == 16 [pid = 1950] [id = 990]
11:48:08 INFO - --DOCSHELL 0x7f1176f84800 == 15 [pid = 1950] [id = 991]
11:48:08 INFO - --DOCSHELL 0x7f1176f20800 == 14 [pid = 1950] [id = 978]
11:48:08 INFO - --DOMWINDOW == 47 (0x7f1177209c00) [pid = 1950] [serial = 2376] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 46 (0x7f1180f30c00) [pid = 1950] [serial = 2378] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 45 (0x7f11758d6c00) [pid = 1950] [serial = 2368] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 44 (0x7f1176dd8c00) [pid = 1950] [serial = 2370] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 43 (0x7f1176dad000) [pid = 1950] [serial = 2382] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 42 (0x7f1177677400) [pid = 1950] [serial = 2374] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 41 (0x7f1176fb6800) [pid = 1950] [serial = 2372] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 40 (0x7f118113fc00) [pid = 1950] [serial = 2380] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 39 (0x7f1176fb2000) [pid = 1950] [serial = 2390] [outer = (nil)] [url = about:blank]
11:48:09 INFO - --DOMWINDOW == 38 (0x7f11773e3c00) [pid = 1950] [serial = 2392] [outer = (nil)] [url = about:blank]
11:48:09 INFO - --DOMWINDOW == 37 (0x7f11773e9c00) [pid = 1950] [serial = 2394] [outer = (nil)] [url = about:blank]
11:48:09 INFO - --DOMWINDOW == 36 (0x7f1176db0800) [pid = 1950] [serial = 2385] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 35 (0x7f1175650400) [pid = 1950] [serial = 2383] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:09 INFO - --DOMWINDOW == 34 (0x7f117720a400) [pid = 1950] [serial = 2389] [outer = (nil)] [url = about:blank]
11:48:09 INFO - --DOMWINDOW == 33 (0x7f1177398400) [pid = 1950] [serial = 2391] [outer = (nil)] [url = about:blank]
11:48:09 INFO - --DOMWINDOW == 32 (0x7f11773e8400) [pid = 1950] [serial = 2393] [outer = (nil)] [url = about:blank]
11:48:09 INFO - MEMORY STAT | vsize 1293MB | residentFast 343MB | heapAllocated 134MB
11:48:09 INFO - 358 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_06.js | took 18868ms
11:48:09 INFO - ++DOCSHELL 0x7f11770ad800 == 15 [pid = 1950] [id = 996]
11:48:09 INFO - ++DOMWINDOW == 33 (0x7f11758e5c00) [pid = 1950] [serial = 2399] [outer = (nil)]
11:48:09 INFO - ++DOMWINDOW == 34 (0x7f1176d7cc00) [pid = 1950] [serial = 2400] [outer = 0x7f11758e5c00]
11:48:09 INFO - 359 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js
11:48:09 INFO - ++DOCSHELL 0x7f11810c7800 == 16 [pid = 1950] [id = 997]
11:48:09 INFO - ++DOMWINDOW == 35 (0x7f1176db5400) [pid = 1950] [serial = 2401] [outer = (nil)]
11:48:09 INFO - ++DOMWINDOW == 36 (0x7f1176dc2c00) [pid = 1950] [serial = 2402] [outer = 0x7f1176db5400]
11:48:10 INFO - ++DOCSHELL 0x7f11773ab000 == 17 [pid = 1950] [id = 998]
11:48:10 INFO - ++DOMWINDOW == 37 (0x7f1176dc5400) [pid = 1950] [serial = 2403] [outer = (nil)]
11:48:10 INFO - ++DOMWINDOW == 38 (0x7f1176eda800) [pid = 1950] [serial = 2404] [outer = 0x7f1176dc5400]
11:48:10 INFO - ++DOMWINDOW == 39 (0x7f11758d8c00) [pid = 1950] [serial = 2405] [outer = 0x7f1176dc5400]
11:48:10 INFO - ++DOCSHELL 0x7f11827a0000 == 18 [pid = 1950] [id = 999]
11:48:10 INFO - ++DOMWINDOW == 40 (0x7f1177133c00) [pid = 1950] [serial = 2406] [outer = (nil)]
11:48:10 INFO - ++DOMWINDOW == 41 (0x7f1177209000) [pid = 1950] [serial = 2407] [outer = 0x7f1177133c00]
11:48:13 INFO - MEMORY STAT | vsize 1295MB | residentFast 343MB | heapAllocated 136MB
11:48:13 INFO - 360 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js | took 3401ms
11:48:13 INFO - ++DOCSHELL 0x7f1176f19800 == 19 [pid = 1950] [id = 1000]
11:48:13 INFO - ++DOMWINDOW == 42 (0x7f1175190800) [pid = 1950] [serial = 2408] [outer = (nil)]
11:48:13 INFO - ++DOMWINDOW == 43 (0x7f117563c000) [pid = 1950] [serial = 2409] [outer = 0x7f1175190800]
11:48:13 INFO - 361 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js
11:48:13 INFO - ++DOCSHELL 0x7f11770c1000 == 20 [pid = 1950] [id = 1001]
11:48:13 INFO - ++DOMWINDOW == 44 (0x7f11758e3c00) [pid = 1950] [serial = 2410] [outer = (nil)]
11:48:13 INFO - ++DOMWINDOW == 45 (0x7f1176cca400) [pid = 1950] [serial = 2411] [outer = 0x7f11758e3c00]
11:48:14 INFO - ++DOMWINDOW == 46 (0x7f118148e000) [pid = 1950] [serial = 2412] [outer = 0x7f11758e3c00]
11:48:14 INFO - ++DOCSHELL 0x7f1176f0f000 == 21 [pid = 1950] [id = 1002]
11:48:14 INFO - ++DOMWINDOW == 47 (0x7f1176de1c00) [pid = 1950] [serial = 2413] [outer = (nil)]
11:48:14 INFO - ++DOMWINDOW == 48 (0x7f1176fb0800) [pid = 1950] [serial = 2414] [outer = 0x7f1176de1c00]
11:48:15 INFO - ++DOCSHELL 0x7f1180f7b800 == 22 [pid = 1950] [id = 1003]
11:48:15 INFO - ++DOMWINDOW == 49 (0x7f1176fbb800) [pid = 1950] [serial = 2415] [outer = (nil)]
11:48:15 INFO - ++DOMWINDOW == 50 (0x7f1177129400) [pid = 1950] [serial = 2416] [outer = 0x7f1176fbb800]
11:48:15 INFO - ++DOMWINDOW == 51 (0x7f1176dba400) [pid = 1950] [serial = 2417] [outer = 0x7f1176fbb800]
11:48:16 INFO - ++DOCSHELL 0x7f1185a25000 == 23 [pid = 1950] [id = 1004]
11:48:16 INFO - ++DOMWINDOW == 52 (0x7f117767a800) [pid = 1950] [serial = 2418] [outer = (nil)]
11:48:16 INFO - ++DOMWINDOW == 53 (0x7f1177681400) [pid = 1950] [serial = 2419] [outer = 0x7f117767a800]
11:48:18 INFO - --DOCSHELL 0x7f11770ad800 == 22 [pid = 1950] [id = 996]
11:48:18 INFO - --DOCSHELL 0x7f11810c7800 == 21 [pid = 1950] [id = 997]
11:48:18 INFO - --DOCSHELL 0x7f11773ab000 == 20 [pid = 1950] [id = 998]
11:48:18 INFO - --DOCSHELL 0x7f1182792000 == 19 [pid = 1950] [id = 995]
11:48:18 INFO - --DOCSHELL 0x7f11827a0000 == 18 [pid = 1950] [id = 999]
11:48:18 INFO - --DOCSHELL 0x7f1182790800 == 17 [pid = 1950] [id = 994]
11:48:18 INFO - --DOCSHELL 0x7f117724a000 == 16 [pid = 1950] [id = 993]
11:48:18 INFO - --DOCSHELL 0x7f1182492800 == 15 [pid = 1950] [id = 992]
11:48:18 INFO - --DOCSHELL 0x7f11810af000 == 14 [pid = 1950] [id = 977]
11:48:18 INFO - --DOCSHELL 0x7f1176f17000 == 13 [pid = 1950] [id = 976]
11:48:18 INFO - --DOMWINDOW == 52 (0x7f1176db6000) [pid = 1950] [serial = 2386] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:18 INFO - --DOMWINDOW == 51 (0x7f1175651800) [pid = 1950] [serial = 2384] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:23 INFO - --DOMWINDOW == 50 (0x7f117767d000) [pid = 1950] [serial = 2397] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:23 INFO - --DOMWINDOW == 49 (0x7f1177133800) [pid = 1950] [serial = 2395] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:23 INFO - --DOMWINDOW == 48 (0x7f1176ed6800) [pid = 1950] [serial = 2387] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:23 INFO - --DOMWINDOW == 47 (0x7f1176db5400) [pid = 1950] [serial = 2401] [outer = (nil)] [url = data:text/html;charset=utf8,
hello%20world,%20bug%20916997]
11:48:23 INFO - --DOMWINDOW == 46 (0x7f11758e5c00) [pid = 1950] [serial = 2399] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 45 (0x7f1176dc2c00) [pid = 1950] [serial = 2402] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 44 (0x7f1176d7cc00) [pid = 1950] [serial = 2400] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 43 (0x7f1177133c00) [pid = 1950] [serial = 2406] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:48:23 INFO - --DOMWINDOW == 42 (0x7f1176dd4c00) [pid = 1950] [serial = 2362] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:23 INFO - --DOMWINDOW == 41 (0x7f1176dc5400) [pid = 1950] [serial = 2403] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:23 INFO - --DOMWINDOW == 40 (0x7f1177397c00) [pid = 1950] [serial = 2365] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:48:23 INFO - --DOMWINDOW == 39 (0x7f11758d8000) [pid = 1950] [serial = 2358] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 38 (0x7f1176dcd400) [pid = 1950] [serial = 2360] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2006]
11:48:23 INFO - --DOMWINDOW == 37 (0x7f1176eda800) [pid = 1950] [serial = 2404] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 36 (0x7f1176ccbc00) [pid = 1950] [serial = 2359] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 35 (0x7f1176dd2c00) [pid = 1950] [serial = 2361] [outer = (nil)] [url = about:blank]
11:48:23 INFO - --DOMWINDOW == 34 (0x7f1177129400) [pid = 1950] [serial = 2416] [outer = (nil)] [url = about:blank]
11:48:26 INFO - --DOMWINDOW == 33 (0x7f117712dc00) [pid = 1950] [serial = 2398] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:26 INFO - --DOMWINDOW == 32 (0x7f11773ee800) [pid = 1950] [serial = 2396] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:26 INFO - --DOMWINDOW == 31 (0x7f1176ed7c00) [pid = 1950] [serial = 2388] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:48:26 INFO - --DOMWINDOW == 30 (0x7f11758d8c00) [pid = 1950] [serial = 2405] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:26 INFO - --DOMWINDOW == 29 (0x7f11773e5400) [pid = 1950] [serial = 2366] [outer = (nil)] [url = about:blank]
11:48:26 INFO - --DOMWINDOW == 28 (0x7f1177209000) [pid = 1950] [serial = 2407] [outer = (nil)] [url = about:blank]
11:48:26 INFO - --DOMWINDOW == 27 (0x7f1176d86800) [pid = 1950] [serial = 2364] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:29 INFO - --DOCSHELL 0x7f1185a25000 == 12 [pid = 1950] [id = 1004]
11:48:30 INFO - --DOCSHELL 0x7f1180f7b800 == 11 [pid = 1950] [id = 1003]
11:48:30 INFO - --DOMWINDOW == 26 (0x7f1176cca400) [pid = 1950] [serial = 2411] [outer = (nil)] [url = about:blank]
11:48:31 INFO - MEMORY STAT | vsize 1292MB | residentFast 337MB | heapAllocated 132MB
11:48:31 INFO - 362 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js | took 17650ms
11:48:31 INFO - ++DOCSHELL 0x7f1176f72800 == 12 [pid = 1950] [id = 1005]
11:48:31 INFO - ++DOMWINDOW == 27 (0x7f1175655400) [pid = 1950] [serial = 2420] [outer = (nil)]
11:48:31 INFO - ++DOMWINDOW == 28 (0x7f11758d9400) [pid = 1950] [serial = 2421] [outer = 0x7f1175655400]
11:48:31 INFO - 363 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js
11:48:31 INFO - ++DOCSHELL 0x7f117a60c800 == 13 [pid = 1950] [id = 1006]
11:48:31 INFO - ++DOMWINDOW == 29 (0x7f1176ccbc00) [pid = 1950] [serial = 2422] [outer = (nil)]
11:48:31 INFO - ++DOMWINDOW == 30 (0x7f1176d7a400) [pid = 1950] [serial = 2423] [outer = 0x7f1176ccbc00]
11:48:31 INFO - ++DOMWINDOW == 31 (0x7f1176db3c00) [pid = 1950] [serial = 2424] [outer = 0x7f1176ccbc00]
11:48:31 INFO - ++DOCSHELL 0x7f1180f78000 == 14 [pid = 1950] [id = 1007]
11:48:31 INFO - ++DOMWINDOW == 32 (0x7f1176dc2400) [pid = 1950] [serial = 2425] [outer = (nil)]
11:48:31 INFO - ++DOMWINDOW == 33 (0x7f1176db0800) [pid = 1950] [serial = 2426] [outer = 0x7f1176dc2400]
11:48:32 INFO - ++DOCSHELL 0x7f1176f88800 == 15 [pid = 1950] [id = 1008]
11:48:32 INFO - ++DOMWINDOW == 34 (0x7f1176d7cc00) [pid = 1950] [serial = 2427] [outer = (nil)]
11:48:32 INFO - ++DOMWINDOW == 35 (0x7f1176dd1800) [pid = 1950] [serial = 2428] [outer = 0x7f1176d7cc00]
11:48:32 INFO - ++DOMWINDOW == 36 (0x7f1176db6000) [pid = 1950] [serial = 2429] [outer = 0x7f1176d7cc00]
11:48:32 INFO - ++DOCSHELL 0x7f118116d000 == 16 [pid = 1950] [id = 1009]
11:48:32 INFO - ++DOMWINDOW == 37 (0x7f1176fb9c00) [pid = 1950] [serial = 2430] [outer = (nil)]
11:48:32 INFO - ++DOMWINDOW == 38 (0x7f1177126000) [pid = 1950] [serial = 2431] [outer = 0x7f1176fb9c00]
11:48:35 INFO - ++DOCSHELL 0x7f118116b000 == 17 [pid = 1950] [id = 1010]
11:48:35 INFO - ++DOMWINDOW == 39 (0x7f117767e000) [pid = 1950] [serial = 2432] [outer = (nil)]
11:48:35 INFO - ++DOMWINDOW == 40 (0x7f11776f2400) [pid = 1950] [serial = 2433] [outer = 0x7f117767e000]
11:48:35 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:35 INFO - ++DOCSHELL 0x7f11835f4000 == 18 [pid = 1950] [id = 1011]
11:48:35 INFO - ++DOMWINDOW == 41 (0x7f11776f6800) [pid = 1950] [serial = 2434] [outer = (nil)]
11:48:35 INFO - ++DOMWINDOW == 42 (0x7f1180f2b400) [pid = 1950] [serial = 2435] [outer = 0x7f11776f6800]
11:48:35 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:35 INFO - ++DOCSHELL 0x7f11827a1000 == 19 [pid = 1950] [id = 1012]
11:48:35 INFO - ++DOMWINDOW == 43 (0x7f1180f38000) [pid = 1950] [serial = 2436] [outer = (nil)]
11:48:35 INFO - ++DOCSHELL 0x7f1182826000 == 20 [pid = 1950] [id = 1013]
11:48:35 INFO - ++DOMWINDOW == 44 (0x7f1180f38c00) [pid = 1950] [serial = 2437] [outer = (nil)]
11:48:35 INFO - ++DOCSHELL 0x7f118364d000 == 21 [pid = 1950] [id = 1014]
11:48:35 INFO - ++DOMWINDOW == 45 (0x7f118113fc00) [pid = 1950] [serial = 2438] [outer = (nil)]
11:48:35 INFO - ++DOCSHELL 0x7f1183660800 == 22 [pid = 1950] [id = 1015]
11:48:35 INFO - ++DOMWINDOW == 46 (0x7f1181140c00) [pid = 1950] [serial = 2439] [outer = (nil)]
11:48:35 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:35 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:35 INFO - ++DOCSHELL 0x7f1183b11000 == 23 [pid = 1950] [id = 1016]
11:48:35 INFO - ++DOMWINDOW == 47 (0x7f1175185400) [pid = 1950] [serial = 2440] [outer = (nil)]
11:48:35 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:35 INFO - ++DOCSHELL 0x7f1183b26800 == 24 [pid = 1950] [id = 1017]
11:48:35 INFO - ++DOMWINDOW == 48 (0x7f118114a000) [pid = 1950] [serial = 2441] [outer = (nil)]
11:48:35 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:48:35 INFO - ++DOMWINDOW == 49 (0x7f11812cb400) [pid = 1950] [serial = 2442] [outer = 0x7f1180f38000]
11:48:35 INFO - ++DOMWINDOW == 50 (0x7f11812cf400) [pid = 1950] [serial = 2443] [outer = 0x7f1180f38c00]
11:48:35 INFO - ++DOMWINDOW == 51 (0x7f11812d2000) [pid = 1950] [serial = 2444] [outer = 0x7f118113fc00]
11:48:36 INFO - ++DOMWINDOW == 52 (0x7f11812d3400) [pid = 1950] [serial = 2445] [outer = 0x7f1181140c00]
11:48:36 INFO - ++DOMWINDOW == 53 (0x7f11812d8c00) [pid = 1950] [serial = 2446] [outer = 0x7f1175185400]
11:48:36 INFO - ++DOMWINDOW == 54 (0x7f11812da400) [pid = 1950] [serial = 2447] [outer = 0x7f118114a000]
11:48:36 INFO - ++DOCSHELL 0x7f1187fca000 == 25 [pid = 1950] [id = 1018]
11:48:36 INFO - ++DOMWINDOW == 55 (0x7f1181d10000) [pid = 1950] [serial = 2448] [outer = (nil)]
11:48:36 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:36 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:36 INFO - ++DOCSHELL 0x7f118816f800 == 26 [pid = 1950] [id = 1019]
11:48:36 INFO - ++DOMWINDOW == 56 (0x7f1181d16400) [pid = 1950] [serial = 2449] [outer = (nil)]
11:48:36 INFO - ++DOMWINDOW == 57 (0x7f1181d18000) [pid = 1950] [serial = 2450] [outer = 0x7f1181d16400]
11:48:37 INFO - ++DOMWINDOW == 58 (0x7f11773e8c00) [pid = 1950] [serial = 2451] [outer = 0x7f1181d10000]
11:48:37 INFO - ++DOMWINDOW == 59 (0x7f1180f29400) [pid = 1950] [serial = 2452] [outer = 0x7f1181d16400]
11:48:39 INFO - --DOCSHELL 0x7f1176f0f000 == 25 [pid = 1950] [id = 1002]
11:48:39 INFO - --DOCSHELL 0x7f1176f19800 == 24 [pid = 1950] [id = 1000]
11:48:39 INFO - --DOCSHELL 0x7f11770c1000 == 23 [pid = 1950] [id = 1001]
11:48:41 INFO - [1950] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142
11:48:41 INFO - (firefox:1950): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed
11:48:41 INFO - --DOCSHELL 0x7f118816f800 == 22 [pid = 1950] [id = 1019]
11:48:42 INFO - [1950] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142
11:48:42 INFO - (firefox:1950): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed
11:48:43 INFO - [1950] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142
11:48:43 INFO - (firefox:1950): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed
11:48:45 INFO - --DOMWINDOW == 58 (0x7f117563c000) [pid = 1950] [serial = 2409] [outer = (nil)] [url = about:blank]
11:48:45 INFO - --DOMWINDOW == 57 (0x7f1176fb0800) [pid = 1950] [serial = 2414] [outer = (nil)] [url = data:text/html,
hello%20from%20iframe
]
11:48:45 INFO - --DOMWINDOW == 56 (0x7f1176d7a400) [pid = 1950] [serial = 2423] [outer = (nil)] [url = about:blank]
11:48:45 INFO - --DOMWINDOW == 55 (0x7f1176dd1800) [pid = 1950] [serial = 2428] [outer = (nil)] [url = about:blank]
11:48:45 INFO - --DOMWINDOW == 54 (0x7f1176fbb800) [pid = 1950] [serial = 2415] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:45 INFO - --DOMWINDOW == 53 (0x7f117767a800) [pid = 1950] [serial = 2418] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:48:45 INFO - --DOMWINDOW == 52 (0x7f1175190800) [pid = 1950] [serial = 2408] [outer = (nil)] [url = about:blank]
11:48:45 INFO - --DOMWINDOW == 51 (0x7f11758e3c00) [pid = 1950] [serial = 2410] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:48:45 INFO - --DOMWINDOW == 50 (0x7f1176de1c00) [pid = 1950] [serial = 2413] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:48:45 INFO - --DOMWINDOW == 49 (0x7f118148e000) [pid = 1950] [serial = 2412] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:48:45 INFO - [1950] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142
11:48:45 INFO - (firefox:1950): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed
11:48:46 INFO - --DOCSHELL 0x7f1182826000 == 21 [pid = 1950] [id = 1013]
11:48:46 INFO - --DOCSHELL 0x7f118364d000 == 20 [pid = 1950] [id = 1014]
11:48:46 INFO - --DOCSHELL 0x7f11827a1000 == 19 [pid = 1950] [id = 1012]
11:48:46 INFO - --DOCSHELL 0x7f1183660800 == 18 [pid = 1950] [id = 1015]
11:48:46 INFO - --DOCSHELL 0x7f1183b11000 == 17 [pid = 1950] [id = 1016]
11:48:46 INFO - --DOCSHELL 0x7f1187fca000 == 16 [pid = 1950] [id = 1018]
11:48:47 INFO - --DOCSHELL 0x7f118116b000 == 15 [pid = 1950] [id = 1010]
11:48:47 INFO - --DOCSHELL 0x7f118116d000 == 14 [pid = 1950] [id = 1009]
11:48:48 INFO - --DOCSHELL 0x7f11835f4000 == 13 [pid = 1950] [id = 1011]
11:48:48 INFO - --DOCSHELL 0x7f1176f88800 == 12 [pid = 1950] [id = 1008]
11:48:48 INFO - --DOCSHELL 0x7f1183b26800 == 11 [pid = 1950] [id = 1017]
11:48:48 INFO - --DOMWINDOW == 48 (0x7f1176dba400) [pid = 1950] [serial = 2417] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:48 INFO - --DOMWINDOW == 47 (0x7f1177681400) [pid = 1950] [serial = 2419] [outer = (nil)] [url = about:blank]
11:48:49 INFO - --DOMWINDOW == 46 (0x7f1181d16400) [pid = 1950] [serial = 2449] [outer = (nil)] [url = data:text/html,]
11:48:49 INFO - --DOMWINDOW == 45 (0x7f1180f38c00) [pid = 1950] [serial = 2437] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:48:49 INFO - --DOMWINDOW == 44 (0x7f118113fc00) [pid = 1950] [serial = 2438] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:48:49 INFO - --DOMWINDOW == 43 (0x7f1180f38000) [pid = 1950] [serial = 2436] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:48:49 INFO - --DOMWINDOW == 42 (0x7f1181d10000) [pid = 1950] [serial = 2448] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:48:49 INFO - --DOMWINDOW == 41 (0x7f1181140c00) [pid = 1950] [serial = 2439] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:48:49 INFO - --DOMWINDOW == 40 (0x7f1175185400) [pid = 1950] [serial = 2440] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:48:49 INFO - --DOMWINDOW == 39 (0x7f1180f29400) [pid = 1950] [serial = 2452] [outer = (nil)] [url = data:text/html,]
11:48:49 INFO - --DOMWINDOW == 38 (0x7f1181d18000) [pid = 1950] [serial = 2450] [outer = (nil)] [url = about:blank]
11:48:49 INFO - --DOMWINDOW == 37 (0x7f117767e000) [pid = 1950] [serial = 2432] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:48:49 INFO - --DOMWINDOW == 36 (0x7f118114a000) [pid = 1950] [serial = 2441] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:48:49 INFO - --DOMWINDOW == 35 (0x7f11776f6800) [pid = 1950] [serial = 2434] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:48:49 INFO - --DOCSHELL 0x7f1180f78000 == 10 [pid = 1950] [id = 1007]
11:48:49 INFO - MEMORY STAT | vsize 1289MB | residentFast 344MB | heapAllocated 137MB
11:48:49 INFO - 364 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js | took 18052ms
11:48:49 INFO - ++DOCSHELL 0x7f1176f24800 == 11 [pid = 1950] [id = 1020]
11:48:49 INFO - ++DOMWINDOW == 36 (0x7f1175658c00) [pid = 1950] [serial = 2453] [outer = (nil)]
11:48:49 INFO - ++DOMWINDOW == 37 (0x7f11758d7000) [pid = 1950] [serial = 2454] [outer = 0x7f1175658c00]
11:48:49 INFO - 365 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js
11:48:49 INFO - ++DOCSHELL 0x7f1180e3a800 == 12 [pid = 1950] [id = 1021]
11:48:49 INFO - ++DOMWINDOW == 38 (0x7f1176cc5800) [pid = 1950] [serial = 2455] [outer = (nil)]
11:48:49 INFO - ++DOMWINDOW == 39 (0x7f1176ccec00) [pid = 1950] [serial = 2456] [outer = 0x7f1176cc5800]
11:48:50 INFO - ++DOMWINDOW == 40 (0x7f1176db6c00) [pid = 1950] [serial = 2457] [outer = 0x7f1176cc5800]
11:48:50 INFO - ++DOCSHELL 0x7f11810c8800 == 13 [pid = 1950] [id = 1022]
11:48:50 INFO - ++DOMWINDOW == 41 (0x7f1176db5c00) [pid = 1950] [serial = 2458] [outer = (nil)]
11:48:50 INFO - ++DOMWINDOW == 42 (0x7f1176dc7800) [pid = 1950] [serial = 2459] [outer = 0x7f1176db5c00]
11:48:50 INFO - ++DOCSHELL 0x7f1180e33000 == 14 [pid = 1950] [id = 1023]
11:48:50 INFO - ++DOMWINDOW == 43 (0x7f1176d7ac00) [pid = 1950] [serial = 2460] [outer = (nil)]
11:48:50 INFO - ++DOMWINDOW == 44 (0x7f1176dd9000) [pid = 1950] [serial = 2461] [outer = 0x7f1176d7ac00]
11:48:50 INFO - ++DOMWINDOW == 45 (0x7f1176dc5400) [pid = 1950] [serial = 2462] [outer = 0x7f1176d7ac00]
11:48:50 INFO - ++DOCSHELL 0x7f1182798800 == 15 [pid = 1950] [id = 1024]
11:48:50 INFO - ++DOMWINDOW == 46 (0x7f1177206000) [pid = 1950] [serial = 2463] [outer = (nil)]
11:48:50 INFO - ++DOMWINDOW == 47 (0x7f117720d800) [pid = 1950] [serial = 2464] [outer = 0x7f1177206000]
11:48:53 INFO - ++DOCSHELL 0x7f11810c6000 == 16 [pid = 1950] [id = 1025]
11:48:53 INFO - ++DOMWINDOW == 48 (0x7f1175642800) [pid = 1950] [serial = 2465] [outer = (nil)]
11:48:53 INFO - ++DOMWINDOW == 49 (0x7f1177132400) [pid = 1950] [serial = 2466] [outer = 0x7f1175642800]
11:48:53 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:53 INFO - ++DOCSHELL 0x7f1182826000 == 17 [pid = 1950] [id = 1026]
11:48:53 INFO - ++DOMWINDOW == 50 (0x7f11773ee400) [pid = 1950] [serial = 2467] [outer = (nil)]
11:48:53 INFO - ++DOMWINDOW == 51 (0x7f11776f3800) [pid = 1950] [serial = 2468] [outer = 0x7f11773ee400]
11:48:53 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:53 INFO - ++DOCSHELL 0x7f1182787800 == 18 [pid = 1950] [id = 1027]
11:48:53 INFO - ++DOMWINDOW == 52 (0x7f1180f37800) [pid = 1950] [serial = 2469] [outer = (nil)]
11:48:53 INFO - ++DOCSHELL 0x7f11835ee000 == 19 [pid = 1950] [id = 1028]
11:48:53 INFO - ++DOMWINDOW == 53 (0x7f118113fc00) [pid = 1950] [serial = 2470] [outer = (nil)]
11:48:53 INFO - ++DOCSHELL 0x7f118364c800 == 20 [pid = 1950] [id = 1029]
11:48:53 INFO - ++DOMWINDOW == 54 (0x7f1181141400) [pid = 1950] [serial = 2471] [outer = (nil)]
11:48:53 INFO - ++DOCSHELL 0x7f1183b20000 == 21 [pid = 1950] [id = 1030]
11:48:53 INFO - ++DOMWINDOW == 55 (0x7f1181143c00) [pid = 1950] [serial = 2472] [outer = (nil)]
11:48:53 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:53 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:53 INFO - ++DOCSHELL 0x7f1183b26800 == 22 [pid = 1950] [id = 1031]
11:48:53 INFO - ++DOMWINDOW == 56 (0x7f118114b000) [pid = 1950] [serial = 2473] [outer = (nil)]
11:48:53 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:53 INFO - ++DOCSHELL 0x7f1183e36800 == 23 [pid = 1950] [id = 1032]
11:48:53 INFO - ++DOMWINDOW == 57 (0x7f11812d3000) [pid = 1950] [serial = 2474] [outer = (nil)]
11:48:53 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:48:53 INFO - ++DOMWINDOW == 58 (0x7f118148cc00) [pid = 1950] [serial = 2475] [outer = 0x7f1180f37800]
11:48:53 INFO - ++DOMWINDOW == 59 (0x7f118148f800) [pid = 1950] [serial = 2476] [outer = 0x7f118113fc00]
11:48:53 INFO - ++DOMWINDOW == 60 (0x7f1181492800) [pid = 1950] [serial = 2477] [outer = 0x7f1181141400]
11:48:53 INFO - ++DOMWINDOW == 61 (0x7f1181497000) [pid = 1950] [serial = 2478] [outer = 0x7f1181143c00]
11:48:53 INFO - ++DOMWINDOW == 62 (0x7f1181d95800) [pid = 1950] [serial = 2479] [outer = 0x7f118114b000]
11:48:53 INFO - ++DOMWINDOW == 63 (0x7f1181d97000) [pid = 1950] [serial = 2480] [outer = 0x7f11812d3000]
11:48:54 INFO - ++DOCSHELL 0x7f118aa2c800 == 24 [pid = 1950] [id = 1033]
11:48:54 INFO - ++DOMWINDOW == 64 (0x7f1181ee8c00) [pid = 1950] [serial = 2481] [outer = (nil)]
11:48:54 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:54 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:48:54 INFO - ++DOCSHELL 0x7f118aa30800 == 25 [pid = 1950] [id = 1034]
11:48:54 INFO - ++DOMWINDOW == 65 (0x7f1177126400) [pid = 1950] [serial = 2482] [outer = (nil)]
11:48:54 INFO - ++DOMWINDOW == 66 (0x7f1181f50400) [pid = 1950] [serial = 2483] [outer = 0x7f1177126400]
11:48:54 INFO - ++DOMWINDOW == 67 (0x7f1182846800) [pid = 1950] [serial = 2484] [outer = 0x7f1181ee8c00]
11:48:54 INFO - ++DOMWINDOW == 68 (0x7f1182881400) [pid = 1950] [serial = 2485] [outer = 0x7f1177126400]
11:48:55 INFO - --DOCSHELL 0x7f1176f72800 == 24 [pid = 1950] [id = 1005]
11:48:55 INFO - --DOCSHELL 0x7f117a60c800 == 23 [pid = 1950] [id = 1006]
11:48:56 INFO - --DOMWINDOW == 67 (0x7f11776f2400) [pid = 1950] [serial = 2433] [outer = (nil)] [url = about:blank]
11:48:56 INFO - --DOMWINDOW == 66 (0x7f11812da400) [pid = 1950] [serial = 2447] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:48:56 INFO - --DOMWINDOW == 65 (0x7f11812cf400) [pid = 1950] [serial = 2443] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:48:56 INFO - --DOMWINDOW == 64 (0x7f11812d2000) [pid = 1950] [serial = 2444] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:48:56 INFO - --DOMWINDOW == 63 (0x7f11812cb400) [pid = 1950] [serial = 2442] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:48:56 INFO - --DOMWINDOW == 62 (0x7f11773e8c00) [pid = 1950] [serial = 2451] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:48:56 INFO - --DOMWINDOW == 61 (0x7f11812d3400) [pid = 1950] [serial = 2445] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:48:56 INFO - --DOMWINDOW == 60 (0x7f11812d8c00) [pid = 1950] [serial = 2446] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:48:56 INFO - --DOMWINDOW == 59 (0x7f1180f2b400) [pid = 1950] [serial = 2435] [outer = (nil)] [url = about:blank]
11:48:57 INFO - --DOCSHELL 0x7f118aa30800 == 22 [pid = 1950] [id = 1034]
11:48:57 INFO - --DOCSHELL 0x7f11835ee000 == 21 [pid = 1950] [id = 1028]
11:48:57 INFO - --DOCSHELL 0x7f118364c800 == 20 [pid = 1950] [id = 1029]
11:48:57 INFO - --DOCSHELL 0x7f1182787800 == 19 [pid = 1950] [id = 1027]
11:48:57 INFO - --DOCSHELL 0x7f1183b20000 == 18 [pid = 1950] [id = 1030]
11:48:57 INFO - --DOCSHELL 0x7f1183b26800 == 17 [pid = 1950] [id = 1031]
11:48:57 INFO - --DOCSHELL 0x7f118aa2c800 == 16 [pid = 1950] [id = 1033]
11:48:57 INFO - --DOCSHELL 0x7f11810c6000 == 15 [pid = 1950] [id = 1025]
11:48:57 INFO - --DOCSHELL 0x7f1182798800 == 14 [pid = 1950] [id = 1024]
11:48:59 INFO - --DOCSHELL 0x7f1182826000 == 13 [pid = 1950] [id = 1026]
11:48:59 INFO - --DOCSHELL 0x7f1183e36800 == 12 [pid = 1950] [id = 1032]
11:48:59 INFO - --DOCSHELL 0x7f1180e33000 == 11 [pid = 1950] [id = 1023]
11:48:59 INFO - --DOMWINDOW == 58 (0x7f1176db0800) [pid = 1950] [serial = 2426] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:48:59 INFO - --DOMWINDOW == 57 (0x7f1181f50400) [pid = 1950] [serial = 2483] [outer = (nil)] [url = about:blank]
11:48:59 INFO - --DOMWINDOW == 56 (0x7f1175655400) [pid = 1950] [serial = 2420] [outer = (nil)] [url = about:blank]
11:48:59 INFO - --DOMWINDOW == 55 (0x7f11758d9400) [pid = 1950] [serial = 2421] [outer = (nil)] [url = about:blank]
11:48:59 INFO - --DOMWINDOW == 54 (0x7f1176ccec00) [pid = 1950] [serial = 2456] [outer = (nil)] [url = about:blank]
11:48:59 INFO - --DOMWINDOW == 53 (0x7f1176dd9000) [pid = 1950] [serial = 2461] [outer = (nil)] [url = about:blank]
11:48:59 INFO - --DOMWINDOW == 52 (0x7f1176d7cc00) [pid = 1950] [serial = 2427] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:48:59 INFO - --DOMWINDOW == 51 (0x7f1176fb9c00) [pid = 1950] [serial = 2430] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:48:59 INFO - --DOMWINDOW == 50 (0x7f1176ccbc00) [pid = 1950] [serial = 2422] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:48:59 INFO - --DOMWINDOW == 49 (0x7f1176dc2400) [pid = 1950] [serial = 2425] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:48:59 INFO - --DOMWINDOW == 48 (0x7f1176db3c00) [pid = 1950] [serial = 2424] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:00 INFO - MEMORY STAT | vsize 1294MB | residentFast 347MB | heapAllocated 139MB
11:49:00 INFO - 366 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js | took 10311ms
11:49:00 INFO - ++DOCSHELL 0x7f1176f73800 == 12 [pid = 1950] [id = 1035]
11:49:00 INFO - ++DOMWINDOW == 49 (0x7f1175650800) [pid = 1950] [serial = 2486] [outer = (nil)]
11:49:00 INFO - ++DOMWINDOW == 50 (0x7f117565c000) [pid = 1950] [serial = 2487] [outer = 0x7f1175650800]
11:49:00 INFO - 367 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js
11:49:00 INFO - ++DOCSHELL 0x7f1180f7e800 == 13 [pid = 1950] [id = 1036]
11:49:00 INFO - ++DOMWINDOW == 51 (0x7f1176d81c00) [pid = 1950] [serial = 2488] [outer = (nil)]
11:49:00 INFO - ++DOMWINDOW == 52 (0x7f1176db3c00) [pid = 1950] [serial = 2489] [outer = 0x7f1176d81c00]
11:49:00 INFO - ++DOMWINDOW == 53 (0x7f1176de1400) [pid = 1950] [serial = 2490] [outer = 0x7f1176d81c00]
11:49:00 INFO - ++DOCSHELL 0x7f11770c4000 == 14 [pid = 1950] [id = 1037]
11:49:00 INFO - ++DOMWINDOW == 54 (0x7f1176fb5800) [pid = 1950] [serial = 2491] [outer = (nil)]
11:49:00 INFO - ++DOMWINDOW == 55 (0x7f1176de0c00) [pid = 1950] [serial = 2492] [outer = 0x7f1176fb5800]
11:49:00 INFO - ++DOCSHELL 0x7f118150b800 == 15 [pid = 1950] [id = 1038]
11:49:00 INFO - ++DOMWINDOW == 56 (0x7f1176db8800) [pid = 1950] [serial = 2493] [outer = (nil)]
11:49:00 INFO - ++DOMWINDOW == 57 (0x7f1177133400) [pid = 1950] [serial = 2494] [outer = 0x7f1176db8800]
11:49:01 INFO - ++DOMWINDOW == 58 (0x7f117712c400) [pid = 1950] [serial = 2495] [outer = 0x7f1176db8800]
11:49:01 INFO - ++DOCSHELL 0x7f1184014000 == 16 [pid = 1950] [id = 1039]
11:49:01 INFO - ++DOMWINDOW == 59 (0x7f1177680800) [pid = 1950] [serial = 2496] [outer = (nil)]
11:49:01 INFO - ++DOMWINDOW == 60 (0x7f11776f2800) [pid = 1950] [serial = 2497] [outer = 0x7f1177680800]
11:49:05 INFO - --DOCSHELL 0x7f11810c8800 == 15 [pid = 1950] [id = 1022]
11:49:05 INFO - --DOCSHELL 0x7f1176f24800 == 14 [pid = 1950] [id = 1020]
11:49:05 INFO - --DOCSHELL 0x7f1180e3a800 == 13 [pid = 1950] [id = 1021]
11:49:05 INFO - --DOMWINDOW == 59 (0x7f1177126000) [pid = 1950] [serial = 2431] [outer = (nil)] [url = about:blank]
11:49:05 INFO - --DOMWINDOW == 58 (0x7f1176db6000) [pid = 1950] [serial = 2429] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:07 INFO - ++DOMWINDOW == 59 (0x7f117720c400) [pid = 1950] [serial = 2498] [outer = 0x7f1176d81c00]
11:49:07 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:49:07 INFO - ++DOCSHELL 0x7f1176f8b000 == 14 [pid = 1950] [id = 1040]
11:49:07 INFO - ++DOMWINDOW == 60 (0x7f117712d400) [pid = 1950] [serial = 2499] [outer = (nil)]
11:49:07 INFO - ++DOMWINDOW == 61 (0x7f1177394c00) [pid = 1950] [serial = 2500] [outer = 0x7f117712d400]
11:49:08 INFO - ++DOCSHELL 0x7f1176f7c000 == 15 [pid = 1950] [id = 1041]
11:49:08 INFO - ++DOMWINDOW == 62 (0x7f1180f30c00) [pid = 1950] [serial = 2501] [outer = (nil)]
11:49:08 INFO - ++DOMWINDOW == 63 (0x7f1180f33400) [pid = 1950] [serial = 2502] [outer = 0x7f1180f30c00]
11:49:08 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:08 INFO - ++DOCSHELL 0x7f1183b0d800 == 16 [pid = 1950] [id = 1042]
11:49:08 INFO - ++DOMWINDOW == 64 (0x7f1177676400) [pid = 1950] [serial = 2503] [outer = (nil)]
11:49:08 INFO - ++DOMWINDOW == 65 (0x7f1181d97c00) [pid = 1950] [serial = 2504] [outer = 0x7f1177676400]
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - ++DOCSHELL 0x7f117724c000 == 17 [pid = 1950] [id = 1043]
11:49:09 INFO - ++DOMWINDOW == 66 (0x7f1181ede400) [pid = 1950] [serial = 2505] [outer = (nil)]
11:49:09 INFO - ++DOCSHELL 0x7f118279e000 == 18 [pid = 1950] [id = 1044]
11:49:09 INFO - ++DOMWINDOW == 67 (0x7f1181ee1000) [pid = 1950] [serial = 2506] [outer = (nil)]
11:49:09 INFO - ++DOCSHELL 0x7f118400a000 == 19 [pid = 1950] [id = 1045]
11:49:09 INFO - ++DOMWINDOW == 68 (0x7f1181ee2000) [pid = 1950] [serial = 2507] [outer = (nil)]
11:49:09 INFO - ++DOCSHELL 0x7f118400c800 == 20 [pid = 1950] [id = 1046]
11:49:09 INFO - ++DOMWINDOW == 69 (0x7f1181ee6c00) [pid = 1950] [serial = 2508] [outer = (nil)]
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - ++DOCSHELL 0x7f1176f2b800 == 21 [pid = 1950] [id = 1047]
11:49:09 INFO - ++DOMWINDOW == 70 (0x7f1181eea800) [pid = 1950] [serial = 2509] [outer = (nil)]
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - ++DOCSHELL 0x7f11853e8000 == 22 [pid = 1950] [id = 1048]
11:49:09 INFO - ++DOMWINDOW == 71 (0x7f1181f53800) [pid = 1950] [serial = 2510] [outer = (nil)]
11:49:09 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:49:09 INFO - ++DOMWINDOW == 72 (0x7f1181eeb000) [pid = 1950] [serial = 2511] [outer = 0x7f1181ede400]
11:49:09 INFO - ++DOMWINDOW == 73 (0x7f118242bc00) [pid = 1950] [serial = 2512] [outer = 0x7f1181ee1000]
11:49:09 INFO - ++DOMWINDOW == 74 (0x7f1182751c00) [pid = 1950] [serial = 2513] [outer = 0x7f1181ee2000]
11:49:09 INFO - ++DOMWINDOW == 75 (0x7f1182845800) [pid = 1950] [serial = 2514] [outer = 0x7f1181ee6c00]
11:49:09 INFO - ++DOMWINDOW == 76 (0x7f1182883400) [pid = 1950] [serial = 2515] [outer = 0x7f1181eea800]
11:49:09 INFO - ++DOMWINDOW == 77 (0x7f1182883c00) [pid = 1950] [serial = 2516] [outer = 0x7f1181f53800]
11:49:09 INFO - ++DOCSHELL 0x7f1185a1f000 == 23 [pid = 1950] [id = 1049]
11:49:09 INFO - ++DOMWINDOW == 78 (0x7f118242cc00) [pid = 1950] [serial = 2517] [outer = (nil)]
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:49:09 INFO - ++DOCSHELL 0x7f1185a2d800 == 24 [pid = 1950] [id = 1050]
11:49:09 INFO - ++DOMWINDOW == 79 (0x7f11773f0c00) [pid = 1950] [serial = 2518] [outer = (nil)]
11:49:09 INFO - ++DOMWINDOW == 80 (0x7f11838e1000) [pid = 1950] [serial = 2519] [outer = 0x7f11773f0c00]
11:49:10 INFO - ++DOMWINDOW == 81 (0x7f1176db3400) [pid = 1950] [serial = 2520] [outer = 0x7f118242cc00]
11:49:10 INFO - ++DOMWINDOW == 82 (0x7f1185861400) [pid = 1950] [serial = 2521] [outer = 0x7f11773f0c00]
11:49:11 INFO - --DOMWINDOW == 81 (0x7f1182881400) [pid = 1950] [serial = 2485] [outer = (nil)] [url = data:text/html,]
11:49:11 INFO - --DOMWINDOW == 80 (0x7f118114b000) [pid = 1950] [serial = 2473] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:11 INFO - --DOMWINDOW == 79 (0x7f1181143c00) [pid = 1950] [serial = 2472] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:49:11 INFO - --DOMWINDOW == 78 (0x7f1181141400) [pid = 1950] [serial = 2471] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:49:11 INFO - --DOMWINDOW == 77 (0x7f118113fc00) [pid = 1950] [serial = 2470] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:49:11 INFO - --DOMWINDOW == 76 (0x7f1180f37800) [pid = 1950] [serial = 2469] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:11 INFO - --DOMWINDOW == 75 (0x7f1177126400) [pid = 1950] [serial = 2482] [outer = (nil)] [url = data:text/html,]
11:49:11 INFO - --DOMWINDOW == 74 (0x7f1175642800) [pid = 1950] [serial = 2465] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:49:11 INFO - --DOMWINDOW == 73 (0x7f1176d7ac00) [pid = 1950] [serial = 2460] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:11 INFO - --DOMWINDOW == 72 (0x7f11812d3000) [pid = 1950] [serial = 2474] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:49:11 INFO - --DOMWINDOW == 71 (0x7f1175658c00) [pid = 1950] [serial = 2453] [outer = (nil)] [url = about:blank]
11:49:11 INFO - --DOMWINDOW == 70 (0x7f1176cc5800) [pid = 1950] [serial = 2455] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:11 INFO - --DOMWINDOW == 69 (0x7f1176db5c00) [pid = 1950] [serial = 2458] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:49:11 INFO - --DOMWINDOW == 68 (0x7f1181ee8c00) [pid = 1950] [serial = 2481] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:49:11 INFO - --DOMWINDOW == 67 (0x7f11773ee400) [pid = 1950] [serial = 2467] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:49:11 INFO - --DOMWINDOW == 66 (0x7f1177133400) [pid = 1950] [serial = 2494] [outer = (nil)] [url = about:blank]
11:49:11 INFO - --DOMWINDOW == 65 (0x7f11758d7000) [pid = 1950] [serial = 2454] [outer = (nil)] [url = about:blank]
11:49:11 INFO - --DOMWINDOW == 64 (0x7f1176dc7800) [pid = 1950] [serial = 2459] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:49:11 INFO - --DOMWINDOW == 63 (0x7f1176db3c00) [pid = 1950] [serial = 2489] [outer = (nil)] [url = about:blank]
11:49:11 INFO - --DOMWINDOW == 62 (0x7f1177206000) [pid = 1950] [serial = 2463] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:11 INFO - --DOMWINDOW == 61 (0x7f1181d97000) [pid = 1950] [serial = 2480] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:49:11 INFO - --DOMWINDOW == 60 (0x7f1176db6c00) [pid = 1950] [serial = 2457] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:13 INFO - --DOCSHELL 0x7f118279e000 == 23 [pid = 1950] [id = 1044]
11:49:13 INFO - --DOCSHELL 0x7f118400a000 == 22 [pid = 1950] [id = 1045]
11:49:13 INFO - --DOCSHELL 0x7f117724c000 == 21 [pid = 1950] [id = 1043]
11:49:13 INFO - --DOCSHELL 0x7f118400c800 == 20 [pid = 1950] [id = 1046]
11:49:13 INFO - --DOCSHELL 0x7f1176f2b800 == 19 [pid = 1950] [id = 1047]
11:49:13 INFO - --DOCSHELL 0x7f1185a1f000 == 18 [pid = 1950] [id = 1049]
11:49:14 INFO - --DOCSHELL 0x7f1184014000 == 17 [pid = 1950] [id = 1039]
11:49:15 INFO - --DOCSHELL 0x7f11770c4000 == 16 [pid = 1950] [id = 1037]
11:49:15 INFO - --DOCSHELL 0x7f1185a2d800 == 15 [pid = 1950] [id = 1050]
11:49:15 INFO - --DOCSHELL 0x7f1176f7c000 == 14 [pid = 1950] [id = 1041]
11:49:15 INFO - --DOCSHELL 0x7f1183b0d800 == 13 [pid = 1950] [id = 1042]
11:49:15 INFO - --DOCSHELL 0x7f11853e8000 == 12 [pid = 1950] [id = 1048]
11:49:15 INFO - --DOMWINDOW == 59 (0x7f1181d95800) [pid = 1950] [serial = 2479] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 58 (0x7f1181497000) [pid = 1950] [serial = 2478] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 57 (0x7f1181492800) [pid = 1950] [serial = 2477] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 56 (0x7f118148f800) [pid = 1950] [serial = 2476] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 55 (0x7f118148cc00) [pid = 1950] [serial = 2475] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 54 (0x7f1177132400) [pid = 1950] [serial = 2466] [outer = (nil)] [url = about:blank]
11:49:15 INFO - --DOMWINDOW == 53 (0x7f1176dc5400) [pid = 1950] [serial = 2462] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:15 INFO - --DOMWINDOW == 52 (0x7f1182846800) [pid = 1950] [serial = 2484] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:49:15 INFO - --DOMWINDOW == 51 (0x7f11776f3800) [pid = 1950] [serial = 2468] [outer = (nil)] [url = about:blank]
11:49:15 INFO - --DOMWINDOW == 50 (0x7f117720d800) [pid = 1950] [serial = 2464] [outer = (nil)] [url = about:blank]
11:49:15 INFO - --DOMWINDOW == 49 (0x7f1185861400) [pid = 1950] [serial = 2521] [outer = (nil)] [url = data:text/html,]
11:49:15 INFO - --DOMWINDOW == 48 (0x7f11838e1000) [pid = 1950] [serial = 2519] [outer = (nil)] [url = about:blank]
11:49:15 INFO - --DOMWINDOW == 47 (0x7f1176de0c00) [pid = 1950] [serial = 2492] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:49:15 INFO - --DOMWINDOW == 46 (0x7f118242cc00) [pid = 1950] [serial = 2517] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:49:15 INFO - --DOMWINDOW == 45 (0x7f1181ede400) [pid = 1950] [serial = 2505] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:15 INFO - --DOMWINDOW == 44 (0x7f11773f0c00) [pid = 1950] [serial = 2518] [outer = (nil)] [url = data:text/html,]
11:49:15 INFO - --DOMWINDOW == 43 (0x7f1176fb5800) [pid = 1950] [serial = 2491] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:49:16 INFO - --DOMWINDOW == 42 (0x7f1176de1400) [pid = 1950] [serial = 2490] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:16 INFO - MEMORY STAT | vsize 1294MB | residentFast 354MB | heapAllocated 140MB
11:49:16 INFO - 368 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js | took 16134ms
11:49:16 INFO - ++DOCSHELL 0x7f1176f84800 == 13 [pid = 1950] [id = 1051]
11:49:16 INFO - ++DOMWINDOW == 43 (0x7f1176cc6000) [pid = 1950] [serial = 2522] [outer = (nil)]
11:49:16 INFO - ++DOMWINDOW == 44 (0x7f1176cccc00) [pid = 1950] [serial = 2523] [outer = 0x7f1176cc6000]
11:49:16 INFO - 369 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_events.js
11:49:16 INFO - ++DOCSHELL 0x7f117a613000 == 14 [pid = 1950] [id = 1052]
11:49:16 INFO - ++DOMWINDOW == 45 (0x7f1176d83400) [pid = 1950] [serial = 2524] [outer = (nil)]
11:49:16 INFO - ++DOMWINDOW == 46 (0x7f1176db3000) [pid = 1950] [serial = 2525] [outer = 0x7f1176d83400]
11:49:17 INFO - ++DOMWINDOW == 47 (0x7f1176dd1800) [pid = 1950] [serial = 2526] [outer = 0x7f1176d83400]
11:49:17 INFO - ++DOCSHELL 0x7f1176f6f800 == 15 [pid = 1950] [id = 1053]
11:49:17 INFO - ++DOMWINDOW == 48 (0x7f1176db6000) [pid = 1950] [serial = 2527] [outer = (nil)]
11:49:17 INFO - ++DOMWINDOW == 49 (0x7f1176fae400) [pid = 1950] [serial = 2528] [outer = 0x7f1176db6000]
11:49:17 INFO - ++DOMWINDOW == 50 (0x7f1176dcfc00) [pid = 1950] [serial = 2529] [outer = 0x7f1176db6000]
11:49:17 INFO - ++DOCSHELL 0x7f1182786800 == 16 [pid = 1950] [id = 1054]
11:49:17 INFO - ++DOMWINDOW == 51 (0x7f117720c800) [pid = 1950] [serial = 2530] [outer = (nil)]
11:49:17 INFO - ++DOMWINDOW == 52 (0x7f117720f000) [pid = 1950] [serial = 2531] [outer = 0x7f117720c800]
11:49:20 INFO - --DOCSHELL 0x7f1176f8b000 == 15 [pid = 1950] [id = 1040]
11:49:20 INFO - --DOCSHELL 0x7f118150b800 == 14 [pid = 1950] [id = 1038]
11:49:20 INFO - --DOCSHELL 0x7f1180f7e800 == 13 [pid = 1950] [id = 1036]
11:49:20 INFO - --DOCSHELL 0x7f1176f73800 == 12 [pid = 1950] [id = 1035]
11:49:20 INFO - --DOMWINDOW == 51 (0x7f1176db3400) [pid = 1950] [serial = 2520] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:49:20 INFO - --DOMWINDOW == 50 (0x7f1181eeb000) [pid = 1950] [serial = 2511] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:21 INFO - --DOCSHELL 0x7f1182786800 == 11 [pid = 1950] [id = 1054]
11:49:21 INFO - MEMORY STAT | vsize 1292MB | residentFast 346MB | heapAllocated 138MB
11:49:21 INFO - 370 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_events.js | took 5133ms
11:49:21 INFO - ++DOCSHELL 0x7f11770c3800 == 12 [pid = 1950] [id = 1055]
11:49:21 INFO - ++DOMWINDOW == 51 (0x7f1176dcd400) [pid = 1950] [serial = 2532] [outer = (nil)]
11:49:21 INFO - ++DOMWINDOW == 52 (0x7f1176de1000) [pid = 1950] [serial = 2533] [outer = 0x7f1176dcd400]
11:49:22 INFO - 371 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_order.js
11:49:22 INFO - ++DOCSHELL 0x7f1177244800 == 13 [pid = 1950] [id = 1056]
11:49:22 INFO - ++DOMWINDOW == 53 (0x7f1176d88800) [pid = 1950] [serial = 2534] [outer = (nil)]
11:49:22 INFO - ++DOMWINDOW == 54 (0x7f1176db9800) [pid = 1950] [serial = 2535] [outer = 0x7f1176d88800]
11:49:22 INFO - ++DOMWINDOW == 55 (0x7f1176fb3800) [pid = 1950] [serial = 2536] [outer = 0x7f1176d88800]
11:49:22 INFO - ++DOCSHELL 0x7f1177256000 == 14 [pid = 1950] [id = 1057]
11:49:22 INFO - ++DOMWINDOW == 56 (0x7f1176dc8400) [pid = 1950] [serial = 2537] [outer = (nil)]
11:49:22 INFO - ++DOMWINDOW == 57 (0x7f1177129c00) [pid = 1950] [serial = 2538] [outer = 0x7f1176dc8400]
11:49:22 INFO - ++DOMWINDOW == 58 (0x7f1176fb5800) [pid = 1950] [serial = 2539] [outer = 0x7f1176dc8400]
11:49:23 INFO - ++DOCSHELL 0x7f1183659000 == 15 [pid = 1950] [id = 1058]
11:49:23 INFO - ++DOMWINDOW == 59 (0x7f1177394400) [pid = 1950] [serial = 2540] [outer = (nil)]
11:49:23 INFO - ++DOMWINDOW == 60 (0x7f1177397400) [pid = 1950] [serial = 2541] [outer = 0x7f1177394400]
11:49:26 INFO - MEMORY STAT | vsize 1295MB | residentFast 355MB | heapAllocated 149MB
11:49:26 INFO - 372 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_order.js | took 4116ms
11:49:26 INFO - ++DOCSHELL 0x7f118a998800 == 16 [pid = 1950] [id = 1059]
11:49:26 INFO - ++DOMWINDOW == 61 (0x7f117738ac00) [pid = 1950] [serial = 2542] [outer = (nil)]
11:49:26 INFO - ++DOMWINDOW == 62 (0x7f1180f36800) [pid = 1950] [serial = 2543] [outer = 0x7f117738ac00]
11:49:26 INFO - 373 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_regexp.js
11:49:26 INFO - ++DOCSHELL 0x7f118d4b0800 == 17 [pid = 1950] [id = 1060]
11:49:26 INFO - ++DOMWINDOW == 63 (0x7f1180f36000) [pid = 1950] [serial = 2544] [outer = (nil)]
11:49:26 INFO - ++DOMWINDOW == 64 (0x7f1181d9a000) [pid = 1950] [serial = 2545] [outer = 0x7f1180f36000]
11:49:26 INFO - --DOMWINDOW == 63 (0x7f1181eea800) [pid = 1950] [serial = 2509] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:26 INFO - --DOMWINDOW == 62 (0x7f1175650800) [pid = 1950] [serial = 2486] [outer = (nil)] [url = about:blank]
11:49:26 INFO - --DOMWINDOW == 61 (0x7f1181ee2000) [pid = 1950] [serial = 2507] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:49:26 INFO - --DOMWINDOW == 60 (0x7f1181ee6c00) [pid = 1950] [serial = 2508] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:49:26 INFO - --DOMWINDOW == 59 (0x7f1181ee1000) [pid = 1950] [serial = 2506] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:49:26 INFO - --DOMWINDOW == 58 (0x7f1177680800) [pid = 1950] [serial = 2496] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:26 INFO - --DOMWINDOW == 57 (0x7f1176db8800) [pid = 1950] [serial = 2493] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:26 INFO - --DOMWINDOW == 56 (0x7f117712d400) [pid = 1950] [serial = 2499] [outer = (nil)] [url = data:text/html,hello%20from%20iframe
]
11:49:26 INFO - --DOMWINDOW == 55 (0x7f1176d81c00) [pid = 1950] [serial = 2488] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:26 INFO - --DOMWINDOW == 54 (0x7f1181f53800) [pid = 1950] [serial = 2510] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:49:26 INFO - --DOMWINDOW == 53 (0x7f1177676400) [pid = 1950] [serial = 2503] [outer = (nil)] [url = chrome://devtools/content/inspector/markup/markup.xhtml]
11:49:26 INFO - --DOMWINDOW == 52 (0x7f1177394c00) [pid = 1950] [serial = 2500] [outer = (nil)] [url = about:blank]
11:49:26 INFO - --DOMWINDOW == 51 (0x7f117565c000) [pid = 1950] [serial = 2487] [outer = (nil)] [url = about:blank]
11:49:26 INFO - --DOMWINDOW == 50 (0x7f1176fae400) [pid = 1950] [serial = 2528] [outer = (nil)] [url = about:blank]
11:49:26 INFO - --DOMWINDOW == 49 (0x7f1176db3000) [pid = 1950] [serial = 2525] [outer = (nil)] [url = about:blank]
11:49:26 INFO - --DOMWINDOW == 48 (0x7f1180f30c00) [pid = 1950] [serial = 2501] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul]
11:49:26 INFO - --DOMWINDOW == 47 (0x7f117720c400) [pid = 1950] [serial = 2498] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html]
11:49:26 INFO - --DOMWINDOW == 46 (0x7f1182883c00) [pid = 1950] [serial = 2516] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml]
11:49:27 INFO - ++DOMWINDOW == 47 (0x7f11872b3c00) [pid = 1950] [serial = 2546] [outer = 0x7f1180f36000]
11:49:27 INFO - ++DOCSHELL 0x7f11827f3800 == 18 [pid = 1950] [id = 1061]
11:49:27 INFO - ++DOMWINDOW == 48 (0x7f117720c400) [pid = 1950] [serial = 2547] [outer = (nil)]
11:49:27 INFO - ++DOMWINDOW == 49 (0x7f1177676400) [pid = 1950] [serial = 2548] [outer = 0x7f117720c400]
11:49:27 INFO - ++DOMWINDOW == 50 (0x7f1177205800) [pid = 1950] [serial = 2549] [outer = 0x7f117720c400]
11:49:27 INFO - ++DOCSHELL 0x7f1187fcb800 == 19 [pid = 1950] [id = 1062]
11:49:27 INFO - ++DOMWINDOW == 51 (0x7f1182847000) [pid = 1950] [serial = 2550] [outer = (nil)]
11:49:27 INFO - ++DOMWINDOW == 52 (0x7f1182886400) [pid = 1950] [serial = 2551] [outer = 0x7f1182847000]
11:49:30 INFO - --DOCSHELL 0x7f1176f6f800 == 18 [pid = 1950] [id = 1053]
11:49:30 INFO - --DOCSHELL 0x7f1176f84800 == 17 [pid = 1950] [id = 1051]
11:49:30 INFO - --DOCSHELL 0x7f11770c3800 == 16 [pid = 1950] [id = 1055]
11:49:30 INFO - --DOCSHELL 0x7f1177244800 == 15 [pid = 1950] [id = 1056]
11:49:30 INFO - --DOCSHELL 0x7f117a613000 == 14 [pid = 1950] [id = 1052]
11:49:30 INFO - --DOCSHELL 0x7f1177256000 == 13 [pid = 1950] [id = 1057]
11:49:30 INFO - --DOCSHELL 0x7f1183659000 == 12 [pid = 1950] [id = 1058]
11:49:30 INFO - --DOMWINDOW == 51 (0x7f1182883400) [pid = 1950] [serial = 2515] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:49:30 INFO - --DOMWINDOW == 50 (0x7f1181d97c00) [pid = 1950] [serial = 2504] [outer = (nil)] [url = about:blank]
11:49:30 INFO - --DOMWINDOW == 49 (0x7f1182751c00) [pid = 1950] [serial = 2513] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:49:30 INFO - --DOMWINDOW == 48 (0x7f1182845800) [pid = 1950] [serial = 2514] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:49:30 INFO - --DOMWINDOW == 47 (0x7f118242bc00) [pid = 1950] [serial = 2512] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:49:30 INFO - --DOMWINDOW == 46 (0x7f1180f33400) [pid = 1950] [serial = 2502] [outer = (nil)] [url = about:blank]
11:49:30 INFO - --DOMWINDOW == 45 (0x7f11776f2800) [pid = 1950] [serial = 2497] [outer = (nil)] [url = about:blank]
11:49:30 INFO - --DOMWINDOW == 44 (0x7f117712c400) [pid = 1950] [serial = 2495] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:30 INFO - ++DOCSHELL 0x7f11770c1000 == 13 [pid = 1950] [id = 1063]
11:49:30 INFO - ++DOMWINDOW == 45 (0x7f11758da800) [pid = 1950] [serial = 2552] [outer = (nil)]
11:49:31 INFO - ++DOMWINDOW == 46 (0x7f11758e2000) [pid = 1950] [serial = 2553] [outer = 0x7f11758da800]
11:49:31 INFO - --DOCSHELL 0x7f1187fcb800 == 12 [pid = 1950] [id = 1062]
11:49:32 INFO - --DOCSHELL 0x7f11770c1000 == 11 [pid = 1950] [id = 1063]
11:49:32 INFO - --DOCSHELL 0x7f11827f3800 == 10 [pid = 1950] [id = 1061]
11:49:33 INFO - --DOMWINDOW == 45 (0x7f11758da800) [pid = 1950] [serial = 2552] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:49:33 INFO - --DOMWINDOW == 44 (0x7f1176d83400) [pid = 1950] [serial = 2524] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html]
11:49:33 INFO - --DOMWINDOW == 43 (0x7f1177394400) [pid = 1950] [serial = 2540] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:33 INFO - --DOMWINDOW == 42 (0x7f117720c800) [pid = 1950] [serial = 2530] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:33 INFO - --DOMWINDOW == 41 (0x7f1176db6000) [pid = 1950] [serial = 2527] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:33 INFO - --DOMWINDOW == 40 (0x7f1176dc8400) [pid = 1950] [serial = 2537] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:33 INFO - --DOMWINDOW == 39 (0x7f1176d88800) [pid = 1950] [serial = 2534] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:49:33 INFO - --DOMWINDOW == 38 (0x7f1176dcd400) [pid = 1950] [serial = 2532] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 37 (0x7f1176cc6000) [pid = 1950] [serial = 2522] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 36 (0x7f1181d9a000) [pid = 1950] [serial = 2545] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 35 (0x7f1176db9800) [pid = 1950] [serial = 2535] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 34 (0x7f1176de1000) [pid = 1950] [serial = 2533] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 33 (0x7f1176cccc00) [pid = 1950] [serial = 2523] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 32 (0x7f1177676400) [pid = 1950] [serial = 2548] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 31 (0x7f1177129c00) [pid = 1950] [serial = 2538] [outer = (nil)] [url = about:blank]
11:49:33 INFO - --DOMWINDOW == 30 (0x7f1176fb3800) [pid = 1950] [serial = 2536] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html]
11:49:33 INFO - MEMORY STAT | vsize 1292MB | residentFast 340MB | heapAllocated 134MB
11:49:33 INFO - 374 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_regexp.js | took 6756ms
11:49:33 INFO - ++DOCSHELL 0x7f1176f75800 == 11 [pid = 1950] [id = 1064]
11:49:33 INFO - ++DOMWINDOW == 31 (0x7f1175652000) [pid = 1950] [serial = 2554] [outer = (nil)]
11:49:33 INFO - ++DOMWINDOW == 32 (0x7f117565b400) [pid = 1950] [serial = 2555] [outer = 0x7f1175652000]
11:49:33 INFO - 375 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_table.js
11:49:33 INFO - ++DOCSHELL 0x7f1180e20800 == 12 [pid = 1950] [id = 1065]
11:49:33 INFO - ++DOMWINDOW == 33 (0x7f11758dc800) [pid = 1950] [serial = 2556] [outer = (nil)]
11:49:33 INFO - ++DOMWINDOW == 34 (0x7f11758e1c00) [pid = 1950] [serial = 2557] [outer = 0x7f11758dc800]
11:49:34 INFO - ++DOMWINDOW == 35 (0x7f1176cccc00) [pid = 1950] [serial = 2558] [outer = 0x7f11758dc800]
11:49:34 INFO - ++DOCSHELL 0x7f1180e1d000 == 13 [pid = 1950] [id = 1066]
11:49:34 INFO - ++DOMWINDOW == 36 (0x7f11758e3400) [pid = 1950] [serial = 2559] [outer = (nil)]
11:49:34 INFO - ++DOMWINDOW == 37 (0x7f1176dba400) [pid = 1950] [serial = 2560] [outer = 0x7f11758e3400]
11:49:34 INFO - ++DOMWINDOW == 38 (0x7f1176d82c00) [pid = 1950] [serial = 2561] [outer = 0x7f11758e3400]
11:49:34 INFO - ++DOCSHELL 0x7f1182782800 == 14 [pid = 1950] [id = 1067]
11:49:34 INFO - ++DOMWINDOW == 39 (0x7f1176fb2000) [pid = 1950] [serial = 2562] [outer = (nil)]
11:49:34 INFO - ++DOMWINDOW == 40 (0x7f1176fb5c00) [pid = 1950] [serial = 2563] [outer = 0x7f1176fb2000]
11:49:37 INFO - --DOCSHELL 0x7f118a998800 == 13 [pid = 1950] [id = 1059]
11:49:37 INFO - --DOCSHELL 0x7f118d4b0800 == 12 [pid = 1950] [id = 1060]
11:49:37 INFO - --DOMWINDOW == 39 (0x7f1176dd1800) [pid = 1950] [serial = 2526] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html]
11:49:37 INFO - --DOMWINDOW == 38 (0x7f1177397400) [pid = 1950] [serial = 2541] [outer = (nil)] [url = about:blank]
11:49:37 INFO - --DOMWINDOW == 37 (0x7f1176fb5800) [pid = 1950] [serial = 2539] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:37 INFO - --DOMWINDOW == 36 (0x7f117720f000) [pid = 1950] [serial = 2531] [outer = (nil)] [url = about:blank]
11:49:37 INFO - --DOMWINDOW == 35 (0x7f1176dcfc00) [pid = 1950] [serial = 2529] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:37 INFO - --DOMWINDOW == 34 (0x7f11758e2000) [pid = 1950] [serial = 2553] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:49:41 INFO - --DOMWINDOW == 33 (0x7f1182847000) [pid = 1950] [serial = 2550] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:41 INFO - --DOMWINDOW == 32 (0x7f117720c400) [pid = 1950] [serial = 2547] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:41 INFO - --DOMWINDOW == 31 (0x7f1180f36000) [pid = 1950] [serial = 2544] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html]
11:49:41 INFO - --DOMWINDOW == 30 (0x7f117738ac00) [pid = 1950] [serial = 2542] [outer = (nil)] [url = about:blank]
11:49:41 INFO - --DOMWINDOW == 29 (0x7f11758e1c00) [pid = 1950] [serial = 2557] [outer = (nil)] [url = about:blank]
11:49:41 INFO - --DOMWINDOW == 28 (0x7f1180f36800) [pid = 1950] [serial = 2543] [outer = (nil)] [url = about:blank]
11:49:41 INFO - --DOMWINDOW == 27 (0x7f1176dba400) [pid = 1950] [serial = 2560] [outer = (nil)] [url = about:blank]
11:49:41 INFO - --DOMWINDOW == 26 (0x7f11872b3c00) [pid = 1950] [serial = 2546] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html]
11:49:41 INFO - --DOCSHELL 0x7f1182782800 == 11 [pid = 1950] [id = 1067]
11:49:42 INFO - MEMORY STAT | vsize 1293MB | residentFast 341MB | heapAllocated 137MB
11:49:42 INFO - 376 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_table.js | took 8629ms
11:49:42 INFO - ++DOCSHELL 0x7f1176f7c000 == 12 [pid = 1950] [id = 1068]
11:49:42 INFO - ++DOMWINDOW == 27 (0x7f1176dcbc00) [pid = 1950] [serial = 2564] [outer = (nil)]
11:49:42 INFO - ++DOMWINDOW == 28 (0x7f1177208c00) [pid = 1950] [serial = 2565] [outer = 0x7f1176dcbc00]
11:49:42 INFO - 377 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_promise.js
11:49:42 INFO - ++DOCSHELL 0x7f118249e000 == 13 [pid = 1950] [id = 1069]
11:49:42 INFO - ++DOMWINDOW == 29 (0x7f117738e000) [pid = 1950] [serial = 2566] [outer = (nil)]
11:49:42 INFO - ++DOMWINDOW == 30 (0x7f11773f0000) [pid = 1950] [serial = 2567] [outer = 0x7f117738e000]
11:49:43 INFO - ++DOCSHELL 0x7f1176f1b800 == 14 [pid = 1950] [id = 1070]
11:49:43 INFO - ++DOMWINDOW == 31 (0x7f1177676400) [pid = 1950] [serial = 2568] [outer = (nil)]
11:49:43 INFO - ++DOMWINDOW == 32 (0x7f1180f2dc00) [pid = 1950] [serial = 2569] [outer = 0x7f1177676400]
11:49:43 INFO - ++DOMWINDOW == 33 (0x7f11776f8800) [pid = 1950] [serial = 2570] [outer = 0x7f1177676400]
11:49:43 INFO - ++DOCSHELL 0x7f11853ee000 == 15 [pid = 1950] [id = 1071]
11:49:43 INFO - ++DOMWINDOW == 34 (0x7f1181144000) [pid = 1950] [serial = 2571] [outer = (nil)]
11:49:43 INFO - ++DOMWINDOW == 35 (0x7f11812cc000) [pid = 1950] [serial = 2572] [outer = 0x7f1181144000]
11:49:47 INFO - --DOCSHELL 0x7f1180e20800 == 14 [pid = 1950] [id = 1065]
11:49:47 INFO - --DOCSHELL 0x7f1180e1d000 == 13 [pid = 1950] [id = 1066]
11:49:47 INFO - --DOCSHELL 0x7f1176f75800 == 12 [pid = 1950] [id = 1064]
11:49:47 INFO - --DOMWINDOW == 34 (0x7f1182886400) [pid = 1950] [serial = 2551] [outer = (nil)] [url = about:blank]
11:49:47 INFO - --DOMWINDOW == 33 (0x7f1177205800) [pid = 1950] [serial = 2549] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:48 INFO - ++DOCSHELL 0x7f1176f7f000 == 13 [pid = 1950] [id = 1072]
11:49:48 INFO - ++DOMWINDOW == 34 (0x7f11758dac00) [pid = 1950] [serial = 2573] [outer = (nil)]
11:49:48 INFO - ++DOMWINDOW == 35 (0x7f117565e400) [pid = 1950] [serial = 2574] [outer = 0x7f11758dac00]
11:49:48 INFO - --DOCSHELL 0x7f11853ee000 == 12 [pid = 1950] [id = 1071]
11:49:49 INFO - --DOCSHELL 0x7f1176f7f000 == 11 [pid = 1950] [id = 1072]
11:49:49 INFO - --DOCSHELL 0x7f1176f1b800 == 10 [pid = 1950] [id = 1070]
11:49:49 INFO - --DOMWINDOW == 34 (0x7f11758dac00) [pid = 1950] [serial = 2573] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:49:49 INFO - --DOMWINDOW == 33 (0x7f1176fb2000) [pid = 1950] [serial = 2562] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:49:49 INFO - --DOMWINDOW == 32 (0x7f11758e3400) [pid = 1950] [serial = 2559] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:49:49 INFO - --DOMWINDOW == 31 (0x7f1175652000) [pid = 1950] [serial = 2554] [outer = (nil)] [url = about:blank]
11:49:49 INFO - --DOMWINDOW == 30 (0x7f11758dc800) [pid = 1950] [serial = 2556] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html]
11:49:49 INFO - --DOMWINDOW == 29 (0x7f1180f2dc00) [pid = 1950] [serial = 2569] [outer = (nil)] [url = about:blank]
11:49:49 INFO - --DOMWINDOW == 28 (0x7f117565b400) [pid = 1950] [serial = 2555] [outer = (nil)] [url = about:blank]
11:49:50 INFO - --DOMWINDOW == 27 (0x7f1176cccc00) [pid = 1950] [serial = 2558] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html]
11:49:50 INFO - MEMORY STAT | vsize 1293MB | residentFast 338MB | heapAllocated 131MB
11:49:50 INFO - 378 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_promise.js | took 7608ms
11:49:50 INFO - ++DOCSHELL 0x7f1176f84800 == 11 [pid = 1950] [id = 1073]
11:49:50 INFO - ++DOMWINDOW == 28 (0x7f1175652000) [pid = 1950] [serial = 2575] [outer = (nil)]
11:49:50 INFO - ++DOMWINDOW == 29 (0x7f117565bc00) [pid = 1950] [serial = 2576] [outer = 0x7f1175652000]
11:49:50 INFO - 379 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_property_provider.js
11:49:50 INFO - ++DOCSHELL 0x7f1180e49000 == 12 [pid = 1950] [id = 1074]
11:49:50 INFO - ++DOMWINDOW == 30 (0x7f1176cc2400) [pid = 1950] [serial = 2577] [outer = (nil)]
11:49:50 INFO - ++DOMWINDOW == 31 (0x7f1176cccc00) [pid = 1950] [serial = 2578] [outer = 0x7f1176cc2400]
11:49:50 INFO - [1950] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100
11:49:50 INFO - [1950] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4105
11:49:51 INFO - MEMORY STAT | vsize 1294MB | residentFast 341MB | heapAllocated 134MB
11:49:51 INFO - 380 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_property_provider.js | took 1145ms
11:49:51 INFO - ++DOCSHELL 0x7f118248f000 == 13 [pid = 1950] [id = 1075]
11:49:51 INFO - ++DOMWINDOW == 32 (0x7f1176dd8000) [pid = 1950] [serial = 2579] [outer = (nil)]
11:49:51 INFO - ++DOMWINDOW == 33 (0x7f1176ed7c00) [pid = 1950] [serial = 2580] [outer = 0x7f1176dd8000]
11:49:51 INFO - 381 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_reflow.js
11:49:51 INFO - ++DOCSHELL 0x7f1180e41800 == 14 [pid = 1950] [id = 1076]
11:49:51 INFO - ++DOMWINDOW == 34 (0x7f1176fb1800) [pid = 1950] [serial = 2581] [outer = (nil)]
11:49:51 INFO - ++DOMWINDOW == 35 (0x7f1176fb5400) [pid = 1950] [serial = 2582] [outer = 0x7f1176fb1800]
11:49:52 INFO - ++DOCSHELL 0x7f11810c6800 == 15 [pid = 1950] [id = 1077]
11:49:52 INFO - ++DOMWINDOW == 36 (0x7f1176de1c00) [pid = 1950] [serial = 2583] [outer = (nil)]
11:49:52 INFO - ++DOMWINDOW == 37 (0x7f1176fb9000) [pid = 1950] [serial = 2584] [outer = 0x7f1176de1c00]
11:49:52 INFO - ++DOMWINDOW == 38 (0x7f1175654000) [pid = 1950] [serial = 2585] [outer = 0x7f1176de1c00]
11:49:52 INFO - ++DOCSHELL 0x7f1185a1b800 == 16 [pid = 1950] [id = 1078]
11:49:52 INFO - ++DOMWINDOW == 39 (0x7f1177211c00) [pid = 1950] [serial = 2586] [outer = (nil)]
11:49:52 INFO - ++DOMWINDOW == 40 (0x7f117738f000) [pid = 1950] [serial = 2587] [outer = 0x7f1177211c00]
11:49:55 INFO - MEMORY STAT | vsize 1296MB | residentFast 347MB | heapAllocated 138MB
11:49:55 INFO - 382 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_reflow.js | took 3729ms
11:49:55 INFO - ++DOCSHELL 0x7f1180e4c000 == 17 [pid = 1950] [id = 1079]
11:49:55 INFO - ++DOMWINDOW == 41 (0x7f1176dda400) [pid = 1950] [serial = 2588] [outer = (nil)]
11:49:55 INFO - ++DOMWINDOW == 42 (0x7f1176fb1c00) [pid = 1950] [serial = 2589] [outer = 0x7f1176dda400]
11:49:55 INFO - 383 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js
11:49:56 INFO - ++DOCSHELL 0x7f1183660800 == 18 [pid = 1950] [id = 1080]
11:49:56 INFO - ++DOMWINDOW == 43 (0x7f117712b800) [pid = 1950] [serial = 2590] [outer = (nil)]
11:49:56 INFO - ++DOMWINDOW == 44 (0x7f117712e400) [pid = 1950] [serial = 2591] [outer = 0x7f117712b800]
11:49:56 INFO - ++DOCSHELL 0x7f1185a28800 == 19 [pid = 1950] [id = 1081]
11:49:56 INFO - ++DOMWINDOW == 45 (0x7f11773e7c00) [pid = 1950] [serial = 2592] [outer = (nil)]
11:49:56 INFO - ++DOMWINDOW == 46 (0x7f11773f1400) [pid = 1950] [serial = 2593] [outer = 0x7f11773e7c00]
11:49:56 INFO - ++DOCSHELL 0x7f1187d7c800 == 20 [pid = 1950] [id = 1082]
11:49:56 INFO - ++DOMWINDOW == 47 (0x7f1176fad000) [pid = 1950] [serial = 2594] [outer = (nil)]
11:49:56 INFO - ++DOMWINDOW == 48 (0x7f117767a800) [pid = 1950] [serial = 2595] [outer = 0x7f1176fad000]
11:49:56 INFO - ++DOMWINDOW == 49 (0x7f117767fc00) [pid = 1950] [serial = 2596] [outer = 0x7f1176fad000]
11:49:57 INFO - ++DOCSHELL 0x7f118aa28000 == 21 [pid = 1950] [id = 1083]
11:49:57 INFO - ++DOMWINDOW == 50 (0x7f1181141800) [pid = 1950] [serial = 2597] [outer = (nil)]
11:49:57 INFO - ++DOMWINDOW == 51 (0x7f1181142800) [pid = 1950] [serial = 2598] [outer = 0x7f1181141800]
11:49:58 INFO - ++DOCSHELL 0x7f118d52c000 == 22 [pid = 1950] [id = 1084]
11:49:58 INFO - ++DOMWINDOW == 52 (0x7f1181490c00) [pid = 1950] [serial = 2599] [outer = (nil)]
11:49:58 INFO - ++DOMWINDOW == 53 (0x7f1180f2e800) [pid = 1950] [serial = 2600] [outer = 0x7f1181490c00]
11:50:01 INFO - ++DOCSHELL 0x7f118d53b800 == 23 [pid = 1950] [id = 1085]
11:50:01 INFO - ++DOMWINDOW == 54 (0x7f11776eb000) [pid = 1950] [serial = 2601] [outer = (nil)]
11:50:01 INFO - ++DOMWINDOW == 55 (0x7f118a93cc00) [pid = 1950] [serial = 2602] [outer = 0x7f11776eb000]
11:50:03 INFO - --DOCSHELL 0x7f1176f84800 == 22 [pid = 1950] [id = 1073]
11:50:03 INFO - --DOCSHELL 0x7f1180e49000 == 21 [pid = 1950] [id = 1074]
11:50:03 INFO - --DOCSHELL 0x7f11810c6800 == 20 [pid = 1950] [id = 1077]
11:50:03 INFO - --DOCSHELL 0x7f1185a1b800 == 19 [pid = 1950] [id = 1078]
11:50:03 INFO - --DOCSHELL 0x7f1176f7c000 == 18 [pid = 1950] [id = 1068]
11:50:03 INFO - --DOCSHELL 0x7f118249e000 == 17 [pid = 1950] [id = 1069]
11:50:03 INFO - --DOMWINDOW == 54 (0x7f117565e400) [pid = 1950] [serial = 2574] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul]
11:50:03 INFO - --DOMWINDOW == 53 (0x7f1176fb5c00) [pid = 1950] [serial = 2563] [outer = (nil)] [url = about:blank]
11:50:03 INFO - --DOMWINDOW == 52 (0x7f1176d82c00) [pid = 1950] [serial = 2561] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:04 INFO - MEMORY STAT | vsize 1300MB | residentFast 370MB | heapAllocated 150MB
11:50:04 INFO - 384 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js | took 8215ms
11:50:04 INFO - ++DOCSHELL 0x7f1176f72800 == 18 [pid = 1950] [id = 1086]
11:50:04 INFO - ++DOMWINDOW == 53 (0x7f1176db3000) [pid = 1950] [serial = 2603] [outer = (nil)]
11:50:04 INFO - ++DOMWINDOW == 54 (0x7f1176dc4400) [pid = 1950] [serial = 2604] [outer = 0x7f1176db3000]
11:50:04 INFO - 385 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js
11:50:04 INFO - ++DOCSHELL 0x7f1182798000 == 19 [pid = 1950] [id = 1087]
11:50:04 INFO - ++DOMWINDOW == 55 (0x7f1176dd7000) [pid = 1950] [serial = 2605] [outer = (nil)]
11:50:04 INFO - ++DOMWINDOW == 56 (0x7f1176ed9400) [pid = 1950] [serial = 2606] [outer = 0x7f1176dd7000]
11:50:05 INFO - ++DOCSHELL 0x7f117724a000 == 20 [pid = 1950] [id = 1088]
11:50:05 INFO - ++DOMWINDOW == 57 (0x7f1176eda400) [pid = 1950] [serial = 2607] [outer = (nil)]
11:50:05 INFO - ++DOMWINDOW == 58 (0x7f1177205800) [pid = 1950] [serial = 2608] [outer = 0x7f1176eda400]
11:50:05 INFO - ++DOMWINDOW == 59 (0x7f1177131c00) [pid = 1950] [serial = 2609] [outer = 0x7f1176eda400]
11:50:05 INFO - ++DOCSHELL 0x7f118aa2c800 == 21 [pid = 1950] [id = 1089]
11:50:05 INFO - ++DOMWINDOW == 60 (0x7f11776f3400) [pid = 1950] [serial = 2610] [outer = (nil)]
11:50:05 INFO - ++DOMWINDOW == 61 (0x7f118113fc00) [pid = 1950] [serial = 2611] [outer = 0x7f11776f3400]
11:50:07 INFO - ++DOMWINDOW == 62 (0x7f1187d3f800) [pid = 1950] [serial = 2612] [outer = 0x7f1176dd7000]
11:50:07 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:50:08 INFO - --DOMWINDOW == 61 (0x7f117738e000) [pid = 1950] [serial = 2566] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20and%20promises]
11:50:08 INFO - --DOMWINDOW == 60 (0x7f1176dd8000) [pid = 1950] [serial = 2579] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 59 (0x7f1177676400) [pid = 1950] [serial = 2568] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:08 INFO - --DOMWINDOW == 58 (0x7f1181144000) [pid = 1950] [serial = 2571] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:50:08 INFO - --DOMWINDOW == 57 (0x7f1176de1c00) [pid = 1950] [serial = 2583] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:08 INFO - --DOMWINDOW == 56 (0x7f1177211c00) [pid = 1950] [serial = 2586] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:50:08 INFO - --DOMWINDOW == 55 (0x7f1176fb1800) [pid = 1950] [serial = 2581] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20reflow%20activity]
11:50:08 INFO - --DOMWINDOW == 54 (0x7f1176dcbc00) [pid = 1950] [serial = 2564] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 53 (0x7f1175652000) [pid = 1950] [serial = 2575] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 52 (0x7f1176cc2400) [pid = 1950] [serial = 2577] [outer = (nil)] [url = data:text/html;charset=utf8,test%20the%20JS%20property%20provider]
11:50:08 INFO - --DOMWINDOW == 51 (0x7f1176fb5400) [pid = 1950] [serial = 2582] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 50 (0x7f1177208c00) [pid = 1950] [serial = 2565] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 49 (0x7f117565bc00) [pid = 1950] [serial = 2576] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 48 (0x7f1176cccc00) [pid = 1950] [serial = 2578] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 47 (0x7f1176fb9000) [pid = 1950] [serial = 2584] [outer = (nil)] [url = about:blank]
11:50:08 INFO - --DOMWINDOW == 46 (0x7f1176ed7c00) [pid = 1950] [serial = 2580] [outer = (nil)] [url = about:blank]
11:50:08 INFO - MEMORY STAT | vsize 1302MB | residentFast 375MB | heapAllocated 155MB
11:50:08 INFO - 386 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js | took 4318ms
11:50:08 INFO - ++DOCSHELL 0x7f11770c3800 == 22 [pid = 1950] [id = 1090]
11:50:08 INFO - ++DOMWINDOW == 47 (0x7f1176d7ac00) [pid = 1950] [serial = 2613] [outer = (nil)]
11:50:08 INFO - ++DOMWINDOW == 48 (0x7f1176ed7800) [pid = 1950] [serial = 2614] [outer = 0x7f1176d7ac00]
11:50:09 INFO - 387 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js
11:50:09 INFO - ++DOCSHELL 0x7f1183e34800 == 23 [pid = 1950] [id = 1091]
11:50:09 INFO - ++DOMWINDOW == 49 (0x7f11776f6000) [pid = 1950] [serial = 2615] [outer = (nil)]
11:50:09 INFO - ++DOMWINDOW == 50 (0x7f11812dac00) [pid = 1950] [serial = 2616] [outer = 0x7f11776f6000]
11:50:09 INFO - ++DOCSHELL 0x7f118d4a9800 == 24 [pid = 1950] [id = 1092]
11:50:09 INFO - ++DOMWINDOW == 51 (0x7f1181d9a000) [pid = 1950] [serial = 2617] [outer = (nil)]
11:50:09 INFO - ++DOMWINDOW == 52 (0x7f118a915000) [pid = 1950] [serial = 2618] [outer = 0x7f1181d9a000]
11:50:09 INFO - ++DOMWINDOW == 53 (0x7f1181495800) [pid = 1950] [serial = 2619] [outer = 0x7f1181d9a000]
11:50:10 INFO - ++DOCSHELL 0x7f119e27b800 == 25 [pid = 1950] [id = 1093]
11:50:10 INFO - ++DOMWINDOW == 54 (0x7f118ce8fc00) [pid = 1950] [serial = 2620] [outer = (nil)]
11:50:10 INFO - ++DOMWINDOW == 55 (0x7f118ce98c00) [pid = 1950] [serial = 2621] [outer = 0x7f118ce8fc00]
11:50:10 INFO - ++DOCSHELL 0x7f119f0c3000 == 26 [pid = 1950] [id = 1094]
11:50:10 INFO - ++DOMWINDOW == 56 (0x7f118d568000) [pid = 1950] [serial = 2622] [outer = (nil)]
11:50:10 INFO - ++DOMWINDOW == 57 (0x7f11812d2000) [pid = 1950] [serial = 2623] [outer = 0x7f118d568000]
11:50:11 INFO - ++DOMWINDOW == 58 (0x7f1176dafc00) [pid = 1950] [serial = 2624] [outer = 0x7f11776f6000]
11:50:11 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:50:12 INFO - --DOCSHELL 0x7f1180e41800 == 25 [pid = 1950] [id = 1076]
11:50:12 INFO - --DOCSHELL 0x7f1176f72800 == 24 [pid = 1950] [id = 1086]
11:50:12 INFO - --DOCSHELL 0x7f1182798000 == 23 [pid = 1950] [id = 1087]
11:50:12 INFO - --DOCSHELL 0x7f1183660800 == 22 [pid = 1950] [id = 1080]
11:50:12 INFO - --DOCSHELL 0x7f117724a000 == 21 [pid = 1950] [id = 1088]
11:50:12 INFO - --DOCSHELL 0x7f1180e4c000 == 20 [pid = 1950] [id = 1079]
11:50:12 INFO - --DOCSHELL 0x7f118aa2c800 == 19 [pid = 1950] [id = 1089]
11:50:12 INFO - --DOCSHELL 0x7f118248f000 == 18 [pid = 1950] [id = 1075]
11:50:12 INFO - --DOCSHELL 0x7f118aa28000 == 17 [pid = 1950] [id = 1083]
11:50:12 INFO - --DOCSHELL 0x7f118d52c000 == 16 [pid = 1950] [id = 1084]
11:50:12 INFO - --DOCSHELL 0x7f118d53b800 == 15 [pid = 1950] [id = 1085]
11:50:12 INFO - --DOCSHELL 0x7f1187d7c800 == 14 [pid = 1950] [id = 1082]
11:50:12 INFO - --DOCSHELL 0x7f1185a28800 == 13 [pid = 1950] [id = 1081]
11:50:13 INFO - --DOMWINDOW == 57 (0x7f117738f000) [pid = 1950] [serial = 2587] [outer = (nil)] [url = about:blank]
11:50:13 INFO - --DOMWINDOW == 56 (0x7f11773f0000) [pid = 1950] [serial = 2567] [outer = (nil)] [url = about:blank]
11:50:13 INFO - --DOMWINDOW == 55 (0x7f1175654000) [pid = 1950] [serial = 2585] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:13 INFO - --DOMWINDOW == 54 (0x7f11776f8800) [pid = 1950] [serial = 2570] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:13 INFO - --DOMWINDOW == 53 (0x7f11812cc000) [pid = 1950] [serial = 2572] [outer = (nil)] [url = about:blank]
11:50:13 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:13 INFO - ++DOCSHELL 0x7f1180e18800 == 14 [pid = 1950] [id = 1095]
11:50:13 INFO - ++DOMWINDOW == 54 (0x7f1176ccd400) [pid = 1950] [serial = 2625] [outer = (nil)]
11:50:13 INFO - ++DOMWINDOW == 55 (0x7f1176ccfc00) [pid = 1950] [serial = 2626] [outer = 0x7f1176ccd400]
11:50:14 INFO - --DOCSHELL 0x7f119f0c3000 == 13 [pid = 1950] [id = 1094]
11:50:14 INFO - --DOCSHELL 0x7f119e27b800 == 12 [pid = 1950] [id = 1093]
11:50:15 INFO - MEMORY STAT | vsize 1296MB | residentFast 360MB | heapAllocated 146MB
11:50:15 INFO - 388 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js | took 6041ms
11:50:15 INFO - ++DOCSHELL 0x7f1180f76800 == 13 [pid = 1950] [id = 1096]
11:50:15 INFO - ++DOMWINDOW == 56 (0x7f1176dad000) [pid = 1950] [serial = 2627] [outer = (nil)]
11:50:15 INFO - ++DOMWINDOW == 57 (0x7f1176dd1c00) [pid = 1950] [serial = 2628] [outer = 0x7f1176dad000]
11:50:15 INFO - 389 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split.js
11:50:15 INFO - ++DOCSHELL 0x7f11835ee000 == 14 [pid = 1950] [id = 1097]
11:50:15 INFO - ++DOMWINDOW == 58 (0x7f1177129400) [pid = 1950] [serial = 2629] [outer = (nil)]
11:50:15 INFO - ++DOMWINDOW == 59 (0x7f117712f000) [pid = 1950] [serial = 2630] [outer = 0x7f1177129400]
11:50:15 INFO - ++DOCSHELL 0x7f1183e31800 == 15 [pid = 1950] [id = 1098]
11:50:15 INFO - ++DOMWINDOW == 60 (0x7f117720d400) [pid = 1950] [serial = 2631] [outer = (nil)]
11:50:15 INFO - ++DOMWINDOW == 61 (0x7f117720e800) [pid = 1950] [serial = 2632] [outer = 0x7f117720d400]
11:50:16 INFO - ++DOMWINDOW == 62 (0x7f1177209400) [pid = 1950] [serial = 2633] [outer = 0x7f117720d400]
11:50:17 INFO - ++DOCSHELL 0x7f118a99c800 == 16 [pid = 1950] [id = 1099]
11:50:17 INFO - ++DOMWINDOW == 63 (0x7f118148b800) [pid = 1950] [serial = 2634] [outer = (nil)]
11:50:17 INFO - ++DOMWINDOW == 64 (0x7f1181d8e400) [pid = 1950] [serial = 2635] [outer = 0x7f118148b800]
11:50:18 INFO - --DOMWINDOW == 63 (0x7f11773e7c00) [pid = 1950] [serial = 2592] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox-window.xul]
11:50:18 INFO - --DOMWINDOW == 62 (0x7f1181490c00) [pid = 1950] [serial = 2599] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:50:18 INFO - --DOMWINDOW == 61 (0x7f1181141800) [pid = 1950] [serial = 2597] [outer = (nil)] [url = chrome://devtools/content/scratchpad/scratchpad.xul]
11:50:18 INFO - --DOMWINDOW == 60 (0x7f1176db3000) [pid = 1950] [serial = 2603] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 59 (0x7f1176dd7000) [pid = 1950] [serial = 2605] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html]
11:50:18 INFO - --DOMWINDOW == 58 (0x7f1176dda400) [pid = 1950] [serial = 2588] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 57 (0x7f117712b800) [pid = 1950] [serial = 2590] [outer = (nil)] [url = data:text/html;charset=utf8,test%20Scratchpad%20panel%20linking
]
11:50:18 INFO - --DOMWINDOW == 56 (0x7f1177205800) [pid = 1950] [serial = 2608] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 55 (0x7f118a915000) [pid = 1950] [serial = 2618] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 54 (0x7f1176fb1c00) [pid = 1950] [serial = 2589] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 53 (0x7f117712e400) [pid = 1950] [serial = 2591] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 52 (0x7f11776eb000) [pid = 1950] [serial = 2601] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:50:18 INFO - --DOMWINDOW == 51 (0x7f1176eda400) [pid = 1950] [serial = 2607] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:18 INFO - --DOMWINDOW == 50 (0x7f1176fad000) [pid = 1950] [serial = 2594] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:18 INFO - --DOMWINDOW == 49 (0x7f11776f3400) [pid = 1950] [serial = 2610] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:50:18 INFO - --DOMWINDOW == 48 (0x7f117767a800) [pid = 1950] [serial = 2595] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 47 (0x7f1176dc4400) [pid = 1950] [serial = 2604] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 46 (0x7f1176ed9400) [pid = 1950] [serial = 2606] [outer = (nil)] [url = about:blank]
11:50:18 INFO - --DOMWINDOW == 45 (0x7f1187d3f800) [pid = 1950] [serial = 2612] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html]
11:50:18 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:18 INFO - ++DOCSHELL 0x7f11853e5800 == 17 [pid = 1950] [id = 1100]
11:50:18 INFO - ++DOMWINDOW == 46 (0x7f117712e400) [pid = 1950] [serial = 2636] [outer = (nil)]
11:50:18 INFO - ++DOMWINDOW == 47 (0x7f1177209000) [pid = 1950] [serial = 2637] [outer = 0x7f117712e400]
11:50:18 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:18 INFO - ++DOCSHELL 0x7f118d542000 == 18 [pid = 1950] [id = 1101]
11:50:18 INFO - ++DOMWINDOW == 48 (0x7f118114c000) [pid = 1950] [serial = 2638] [outer = (nil)]
11:50:18 INFO - ++DOCSHELL 0x7f118d546800 == 19 [pid = 1950] [id = 1102]
11:50:18 INFO - ++DOMWINDOW == 49 (0x7f1181d8e800) [pid = 1950] [serial = 2639] [outer = (nil)]
11:50:18 INFO - ++DOCSHELL 0x7f118d5da800 == 20 [pid = 1950] [id = 1103]
11:50:18 INFO - ++DOMWINDOW == 50 (0x7f1181d91000) [pid = 1950] [serial = 2640] [outer = (nil)]
11:50:18 INFO - ++DOCSHELL 0x7f118d5e2800 == 21 [pid = 1950] [id = 1104]
11:50:18 INFO - ++DOMWINDOW == 51 (0x7f1181d91800) [pid = 1950] [serial = 2641] [outer = (nil)]
11:50:18 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:18 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:18 INFO - ++DOCSHELL 0x7f118d5ea000 == 22 [pid = 1950] [id = 1105]
11:50:18 INFO - ++DOMWINDOW == 52 (0x7f1181d92400) [pid = 1950] [serial = 2642] [outer = (nil)]
11:50:18 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:18 INFO - ++DOCSHELL 0x7f118d718000 == 23 [pid = 1950] [id = 1106]
11:50:18 INFO - ++DOMWINDOW == 53 (0x7f1181d9b800) [pid = 1950] [serial = 2643] [outer = (nil)]
11:50:18 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80520012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/Loader.cpp, line 2121
11:50:18 INFO - ++DOMWINDOW == 54 (0x7f1181ee7c00) [pid = 1950] [serial = 2644] [outer = 0x7f118114c000]
11:50:18 INFO - ++DOMWINDOW == 55 (0x7f118242c400) [pid = 1950] [serial = 2645] [outer = 0x7f1181d8e800]
11:50:18 INFO - ++DOMWINDOW == 56 (0x7f1182431800) [pid = 1950] [serial = 2646] [outer = 0x7f1181d91000]
11:50:18 INFO - ++DOMWINDOW == 57 (0x7f118260bc00) [pid = 1950] [serial = 2647] [outer = 0x7f1181d91800]
11:50:18 INFO - ++DOMWINDOW == 58 (0x7f118283d800) [pid = 1950] [serial = 2648] [outer = 0x7f1181d92400]
11:50:18 INFO - ++DOMWINDOW == 59 (0x7f1182847c00) [pid = 1950] [serial = 2649] [outer = 0x7f1181d9b800]
11:50:19 INFO - ++DOCSHELL 0x7f1191987000 == 24 [pid = 1950] [id = 1107]
11:50:19 INFO - ++DOMWINDOW == 60 (0x7f118758b400) [pid = 1950] [serial = 2650] [outer = (nil)]
11:50:19 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:19 INFO - [1950] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 393
11:50:19 INFO - ++DOCSHELL 0x7f1191992000 == 25 [pid = 1950] [id = 1108]
11:50:19 INFO - ++DOMWINDOW == 61 (0x7f1187d44c00) [pid = 1950] [serial = 2651] [outer = (nil)]
11:50:19 INFO - ++DOMWINDOW == 62 (0x7f1187d45400) [pid = 1950] [serial = 2652] [outer = 0x7f1187d44c00]
11:50:19 INFO - ++DOMWINDOW == 63 (0x7f118a915400) [pid = 1950] [serial = 2653] [outer = 0x7f118758b400]
11:50:19 INFO - ++DOMWINDOW == 64 (0x7f1176fb4800) [pid = 1950] [serial = 2654] [outer = 0x7f1187d44c00]
11:50:19 INFO - ++DOCSHELL 0x7f118d912000 == 26 [pid = 1950] [id = 1109]
11:50:19 INFO - ++DOMWINDOW == 65 (0x7f118a927400) [pid = 1950] [serial = 2655] [outer = (nil)]
11:50:19 INFO - ++DOMWINDOW == 66 (0x7f118a92dc00) [pid = 1950] [serial = 2656] [outer = 0x7f118a927400]
11:50:21 INFO - ++DOCSHELL 0x7f11826c8800 == 27 [pid = 1950] [id = 1110]
11:50:21 INFO - ++DOMWINDOW == 67 (0x7f1176dcfc00) [pid = 1950] [serial = 2657] [outer = (nil)]
11:50:21 INFO - ++DOMWINDOW == 68 (0x7f1176dde800) [pid = 1950] [serial = 2658] [outer = 0x7f1176dcfc00]
11:50:21 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:50:22 INFO - ++DOCSHELL 0x7f118166a000 == 28 [pid = 1950] [id = 1111]
11:50:22 INFO - ++DOMWINDOW == 69 (0x7f1192682000) [pid = 1950] [serial = 2659] [outer = (nil)]
11:50:22 INFO - ++DOMWINDOW == 70 (0x7f1176dda400) [pid = 1950] [serial = 2660] [outer = 0x7f1192682000]
11:50:23 INFO - ++DOCSHELL 0x7f1180f94800 == 29 [pid = 1950] [id = 1112]
11:50:23 INFO - ++DOMWINDOW == 71 (0x7f117720d000) [pid = 1950] [serial = 2661] [outer = (nil)]
11:50:23 INFO - ++DOMWINDOW == 72 (0x7f11a60b4400) [pid = 1950] [serial = 2662] [outer = 0x7f117720d000]
11:50:24 INFO - --DOCSHELL 0x7f1191992000 == 28 [pid = 1950] [id = 1108]
11:50:24 INFO - --DOCSHELL 0x7f118d4a9800 == 27 [pid = 1950] [id = 1092]
11:50:24 INFO - --DOCSHELL 0x7f1180e18800 == 26 [pid = 1950] [id = 1095]
11:50:24 INFO - --DOCSHELL 0x7f11770c3800 == 25 [pid = 1950] [id = 1090]
11:50:25 INFO - --DOCSHELL 0x7f1183e34800 == 24 [pid = 1950] [id = 1091]
11:50:26 INFO - --DOMWINDOW == 71 (0x7f11773f1400) [pid = 1950] [serial = 2593] [outer = (nil)] [url = about:blank]
11:50:26 INFO - --DOMWINDOW == 70 (0x7f1180f2e800) [pid = 1950] [serial = 2600] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:50:26 INFO - --DOMWINDOW == 69 (0x7f1181142800) [pid = 1950] [serial = 2598] [outer = (nil)] [url = about:blank]
11:50:26 INFO - --DOMWINDOW == 68 (0x7f1177131c00) [pid = 1950] [serial = 2609] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:26 INFO - --DOMWINDOW == 67 (0x7f117767fc00) [pid = 1950] [serial = 2596] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:50:26 INFO - --DOMWINDOW == 66 (0x7f118113fc00) [pid = 1950] [serial = 2611] [outer = (nil)] [url = about:blank]
11:50:26 INFO - --DOMWINDOW == 65 (0x7f118a93cc00) [pid = 1950] [serial = 2602] [outer = (nil)] [url = about:blank]
11:50:26 INFO - ++DOCSHELL 0x7f1180e50000 == 25 [pid = 1950] [id = 1113]
11:50:26 INFO - ++DOMWINDOW == 66 (0x7f1176dce400) [pid = 1950] [serial = 2663] [outer = (nil)]
11:50:26 INFO - ++DOMWINDOW == 67 (0x7f1176dd1800) [pid = 1950] [serial = 2664] [outer = 0x7f1176dce400]
11:50:30 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/demangle.js, line 0: Successfully compiled asm.js code (total compilation time 3046ms; unable to cache asm.js in synchronous scripts; try loading asm.js via , line 1: SyntaxError: redefining arguments is deprecated
11:51:33 INFO - ++DOCSHELL 0x7f11715ef000 == 13 [pid = 1950] [id = 1206]
11:51:33 INFO - ++DOMWINDOW == 39 (0x7f1176de0000) [pid = 1950] [serial = 2862] [outer = (nil)]
11:51:33 INFO - ++DOMWINDOW == 40 (0x7f1176de0c00) [pid = 1950] [serial = 2863] [outer = 0x7f1176de0000]
11:51:33 INFO - ++DOMWINDOW == 41 (0x7f1176ddb800) [pid = 1950] [serial = 2864] [outer = 0x7f1176de0000]
11:51:34 INFO - ++DOCSHELL 0x7f1181522800 == 14 [pid = 1950] [id = 1207]
11:51:34 INFO - ++DOMWINDOW == 42 (0x7f117712e000) [pid = 1950] [serial = 2865] [outer = (nil)]
11:51:34 INFO - ++DOMWINDOW == 43 (0x7f1177133000) [pid = 1950] [serial = 2866] [outer = 0x7f117712e000]
11:51:36 INFO - ++DOMWINDOW == 44 (0x7f1181493400) [pid = 1950] [serial = 2867] [outer = 0x7f1176daf800]
11:51:36 INFO - JavaScript error: data:text/html;charset=utf8,, line 1: SyntaxError: duplicate formal argument a
11:51:36 INFO - ++DOMWINDOW == 45 (0x7f1176d7f400) [pid = 1950] [serial = 2868] [outer = 0x7f1176daf800]
11:51:37 INFO - --DOCSHELL 0x7f11773be000 == 13 [pid = 1950] [id = 1200]
11:51:37 INFO - --DOCSHELL 0x7f1180f86800 == 12 [pid = 1950] [id = 1201]
11:51:37 INFO - JavaScript error: data:text/html;charset=utf8,, line 1: TypeError: setting a property that has only a getter
11:51:37 INFO - --DOMWINDOW == 44 (0x7f118148e800) [pid = 1950] [serial = 2829] [outer = (nil)] [url = about:blank]
11:51:37 INFO - --DOMWINDOW == 43 (0x7f1176d88000) [pid = 1950] [serial = 2827] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:37 INFO - --DOMWINDOW == 42 (0x7f11881f5000) [pid = 1950] [serial = 2820] [outer = (nil)] [url = about:blank]
11:51:37 INFO - --DOMWINDOW == 41 (0x7f1176d87000) [pid = 1950] [serial = 2799] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:37 INFO - --DOMWINDOW == 40 (0x7f1181eebc00) [pid = 1950] [serial = 2831] [outer = (nil)] [url = about:blank]
11:51:37 INFO - --DOMWINDOW == 39 (0x7f1176d87800) [pid = 1950] [serial = 2838] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:51:37 INFO - --DOMWINDOW == 38 (0x7f1176fac400) [pid = 1950] [serial = 2839] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml]
11:51:37 INFO - --DOMWINDOW == 37 (0x7f1177206c00) [pid = 1950] [serial = 2840] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml]
11:51:37 INFO - --DOMWINDOW == 36 (0x7f1177209400) [pid = 1950] [serial = 2841] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml]
11:51:37 INFO - --DOMWINDOW == 35 (0x7f117720a800) [pid = 1950] [serial = 2842] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml]
11:51:38 INFO - ++DOMWINDOW == 36 (0x7f11758e2000) [pid = 1950] [serial = 2869] [outer = 0x7f1176daf800]
11:51:38 INFO - JavaScript error: data:text/html;charset=utf8,, line 1: ReferenceError: assignment to undeclared variable v
11:51:38 INFO - --DOCSHELL 0x7f1181522800 == 11 [pid = 1950] [id = 1207]
11:51:39 INFO - MEMORY STAT | vsize 7452MB | residentFast 354MB | heapAllocated 143MB
11:51:39 INFO - 400 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_strict_mode_errors.js | took 5879ms
11:51:39 INFO - ++DOCSHELL 0x7f11773be000 == 12 [pid = 1950] [id = 1208]
11:51:39 INFO - ++DOMWINDOW == 37 (0x7f1176ccb800) [pid = 1950] [serial = 2870] [outer = (nil)]
11:51:39 INFO - ++DOMWINDOW == 38 (0x7f1176dc2c00) [pid = 1950] [serial = 2871] [outer = 0x7f1176ccb800]
11:51:39 INFO - 401 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js
11:51:39 INFO - ++DOCSHELL 0x7f11810c6800 == 13 [pid = 1950] [id = 1209]
11:51:39 INFO - ++DOMWINDOW == 39 (0x7f1176faf400) [pid = 1950] [serial = 2872] [outer = (nil)]
11:51:39 INFO - ++DOMWINDOW == 40 (0x7f1176fb2c00) [pid = 1950] [serial = 2873] [outer = 0x7f1176faf400]
11:51:39 INFO - ++DOMWINDOW == 41 (0x7f117712c400) [pid = 1950] [serial = 2874] [outer = 0x7f1176faf400]
11:51:40 INFO - ++DOCSHELL 0x7f1176f7e000 == 14 [pid = 1950] [id = 1210]
11:51:40 INFO - ++DOMWINDOW == 42 (0x7f117720d400) [pid = 1950] [serial = 2875] [outer = (nil)]
11:51:40 INFO - [1950] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9306
11:51:40 INFO - ++DOCSHELL 0x7f1176f27800 == 15 [pid = 1950] [id = 1211]
11:51:40 INFO - ++DOMWINDOW == 43 (0x7f11758e1c00) [pid = 1950] [serial = 2876] [outer = (nil)]
11:51:40 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:51:40 INFO - ++DOMWINDOW == 44 (0x7f11758e4000) [pid = 1950] [serial = 2877] [outer = 0x7f11758e1c00]
11:51:40 INFO - ++DOMWINDOW == 45 (0x7f1176cca400) [pid = 1950] [serial = 2878] [outer = 0x7f117720d400]
11:51:40 INFO - ++DOCSHELL 0x7f1180f8c800 == 16 [pid = 1950] [id = 1212]
11:51:40 INFO - ++DOMWINDOW == 46 (0x7f1175640c00) [pid = 1950] [serial = 2879] [outer = (nil)]
11:51:40 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:51:40 INFO - ++DOMWINDOW == 47 (0x7f1176d7ec00) [pid = 1950] [serial = 2880] [outer = 0x7f1175640c00]
11:51:40 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:51:40 INFO - [1950] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 97
11:51:40 INFO - [1950] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 97
11:51:41 INFO - [1950] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109
11:51:41 INFO - ++DOMWINDOW == 48 (0x7f11773e8400) [pid = 1950] [serial = 2881] [outer = 0x7f1175640c00]
11:51:41 INFO - [1950] WARNING: Image width or height is non-positive: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6500
11:51:41 INFO - --DOCSHELL 0x7f1176f27800 == 15 [pid = 1950] [id = 1211]
11:51:42 INFO - ++DOCSHELL 0x7f1183b28000 == 16 [pid = 1950] [id = 1213]
11:51:42 INFO - ++DOMWINDOW == 49 (0x7f1181495800) [pid = 1950] [serial = 2882] [outer = (nil)]
11:51:42 INFO - [1950] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004002: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsChannelClassifier.cpp, line 80
11:51:42 INFO - ++DOMWINDOW == 50 (0x7f1181499400) [pid = 1950] [serial = 2883] [outer = 0x7f1181495800]
11:51:45 INFO - MEMORY STAT | vsize 7456MB | residentFast 365MB | heapAllocated 153MB
11:51:45 INFO - 402 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js | took 5967ms
11:51:45 INFO - ++DOCSHELL 0x7f118165e800 == 17 [pid = 1950] [id = 1214]
11:51:45 INFO - ++DOMWINDOW == 51 (0x7f117712dc00) [pid = 1950] [serial = 2884] [outer = (nil)]
11:51:45 INFO - ++DOMWINDOW == 52 (0x7f11812d0800) [pid = 1950] [serial = 2885] [outer = 0x7f117712dc00]
11:51:45 INFO - 403 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_view_source.js
11:51:45 INFO - ++DOCSHELL 0x7f118a318800 == 18 [pid = 1950] [id = 1215]
11:51:45 INFO - ++DOMWINDOW == 53 (0x7f1183672000) [pid = 1950] [serial = 2886] [outer = (nil)]
11:51:45 INFO - ++DOMWINDOW == 54 (0x7f1183ca8c00) [pid = 1950] [serial = 2887] [outer = 0x7f1183672000]
11:51:46 INFO - ++DOMWINDOW == 55 (0x7f11881f4c00) [pid = 1950] [serial = 2888] [outer = 0x7f1183672000]
11:51:46 INFO - ++DOCSHELL 0x7f118d4a0000 == 19 [pid = 1950] [id = 1216]
11:51:46 INFO - ++DOMWINDOW == 56 (0x7f1176dc5000) [pid = 1950] [serial = 2889] [outer = (nil)]
11:51:46 INFO - ++DOMWINDOW == 57 (0x7f118a3e9c00) [pid = 1950] [serial = 2890] [outer = 0x7f1176dc5000]
11:51:46 INFO - ++DOMWINDOW == 58 (0x7f1182428c00) [pid = 1950] [serial = 2891] [outer = 0x7f1176dc5000]
11:51:47 INFO - ++DOCSHELL 0x7f118d541000 == 20 [pid = 1950] [id = 1217]
11:51:47 INFO - ++DOMWINDOW == 59 (0x7f118a92c000) [pid = 1950] [serial = 2892] [outer = (nil)]
11:51:47 INFO - ++DOMWINDOW == 60 (0x7f118a93bc00) [pid = 1950] [serial = 2893] [outer = 0x7f118a92c000]
11:51:48 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined
11:51:48 INFO - ++DOCSHELL 0x7f118a991800 == 21 [pid = 1950] [id = 1218]
11:51:48 INFO - ++DOMWINDOW == 61 (0x7f1176dcfc00) [pid = 1950] [serial = 2894] [outer = (nil)]
11:51:48 INFO - ++DOMWINDOW == 62 (0x7f1177683400) [pid = 1950] [serial = 2895] [outer = 0x7f1176dcfc00]
11:51:49 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/shared/vendor/react-redux.js, line 409: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create
11:51:49 INFO - ++DOCSHELL 0x7f11a67cf000 == 22 [pid = 1950] [id = 1219]
11:51:49 INFO - ++DOMWINDOW == 63 (0x7f119267f000) [pid = 1950] [serial = 2896] [outer = (nil)]
11:51:50 INFO - ++DOMWINDOW == 64 (0x7f1177683000) [pid = 1950] [serial = 2897] [outer = 0x7f119267f000]
11:51:51 INFO - --DOCSHELL 0x7f11715ef000 == 21 [pid = 1950] [id = 1206]
11:51:52 INFO - --DOCSHELL 0x7f1176f7e000 == 20 [pid = 1950] [id = 1210]
11:51:52 INFO - --DOCSHELL 0x7f1183b28000 == 19 [pid = 1950] [id = 1213]
11:51:53 INFO - ++DOCSHELL 0x7f117a612800 == 20 [pid = 1950] [id = 1220]
11:51:53 INFO - ++DOMWINDOW == 65 (0x7f1176cc8400) [pid = 1950] [serial = 2898] [outer = (nil)]
11:51:53 INFO - ++DOMWINDOW == 66 (0x7f1176cd0000) [pid = 1950] [serial = 2899] [outer = 0x7f1176cc8400]
11:51:53 INFO - ++DOMWINDOW == 67 (0x7f1176fb4800) [pid = 1950] [serial = 2900] [outer = 0x7f1176cc8400]
11:51:53 INFO - ++DOMWINDOW == 68 (0x7f1177126000) [pid = 1950] [serial = 2901] [outer = 0x7f1176cc8400]
11:51:53 INFO - [1950] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967
11:51:55 INFO - --DOCSHELL 0x7f11a67cf000 == 19 [pid = 1950] [id = 1219]
11:51:55 INFO - --DOCSHELL 0x7f118a991800 == 18 [pid = 1950] [id = 1218]
11:51:55 INFO - --DOCSHELL 0x7f118d541000 == 17 [pid = 1950] [id = 1217]
11:51:55 INFO - --DOMWINDOW == 67 (0x7f1176d83400) [pid = 1950] [serial = 2850] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 66 (0x7f1176dd6800) [pid = 1950] [serial = 2852] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 65 (0x7f1176d7ec00) [pid = 1950] [serial = 2880] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 64 (0x7f1175640c00) [pid = 1950] [serial = 2879] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:55 INFO - --DOMWINDOW == 63 (0x7f1176cca400) [pid = 1950] [serial = 2878] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 62 (0x7f11758e4000) [pid = 1950] [serial = 2877] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 61 (0x7f11758e1c00) [pid = 1950] [serial = 2876] [outer = (nil)] [url = about:srcdoc]
11:51:55 INFO - --DOMWINDOW == 60 (0x7f1176faf400) [pid = 1950] [serial = 2872] [outer = (nil)] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html]
11:51:55 INFO - --DOMWINDOW == 59 (0x7f117720d400) [pid = 1950] [serial = 2875] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 58 (0x7f1176fb2c00) [pid = 1950] [serial = 2873] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 57 (0x7f1176dc2c00) [pid = 1950] [serial = 2871] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 56 (0x7f1176dd1400) [pid = 1950] [serial = 2851] [outer = (nil)] [url = data:text/html;charset=utf8,hello]
11:51:55 INFO - --DOMWINDOW == 55 (0x7f1176de0000) [pid = 1950] [serial = 2862] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:55 INFO - --DOMWINDOW == 54 (0x7f1177394400) [pid = 1950] [serial = 2856] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:51:55 INFO - --DOMWINDOW == 53 (0x7f1176daf800) [pid = 1950] [serial = 2860] [outer = (nil)] [url = data:text/html;charset=utf8,]
11:51:55 INFO - --DOMWINDOW == 52 (0x7f1176edc800) [pid = 1950] [serial = 2853] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:55 INFO - --DOMWINDOW == 51 (0x7f117712e000) [pid = 1950] [serial = 2865] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:51:55 INFO - --DOMWINDOW == 50 (0x7f1176cc2400) [pid = 1950] [serial = 2858] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 49 (0x7f1176d7ac00) [pid = 1950] [serial = 2849] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 48 (0x7f1181493400) [pid = 1950] [serial = 2867] [outer = (nil)] [url = data:text/html;charset=utf8,]
11:51:55 INFO - --DOMWINDOW == 47 (0x7f1176cd0c00) [pid = 1950] [serial = 2859] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 46 (0x7f1176dbb400) [pid = 1950] [serial = 2861] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 45 (0x7f118a3e9c00) [pid = 1950] [serial = 2890] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 44 (0x7f1181495800) [pid = 1950] [serial = 2882] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:51:55 INFO - --DOMWINDOW == 43 (0x7f1176ccb800) [pid = 1950] [serial = 2870] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 42 (0x7f1176de0c00) [pid = 1950] [serial = 2863] [outer = (nil)] [url = about:blank]
11:51:55 INFO - --DOMWINDOW == 41 (0x7f117712c400) [pid = 1950] [serial = 2874] [outer = (nil)] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html]
11:51:55 INFO - MEMORY STAT | vsize 7459MB | residentFast 374MB | heapAllocated 157MB
11:51:55 INFO - 404 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_view_source.js | took 10160ms
11:51:55 INFO - ++DOCSHELL 0x7f1181505800 == 18 [pid = 1950] [id = 1221]
11:51:55 INFO - ++DOMWINDOW == 42 (0x7f1176edc800) [pid = 1950] [serial = 2902] [outer = (nil)]
11:51:55 INFO - ++DOMWINDOW == 43 (0x7f117712e000) [pid = 1950] [serial = 2903] [outer = 0x7f1176edc800]
11:51:56 INFO - ++DOMWINDOW == 44 (0x7f11773ebc00) [pid = 1950] [serial = 2904] [outer = 0x7f119144c800]
11:51:56 INFO - ++DOMWINDOW == 45 (0x7f11776f2800) [pid = 1950] [serial = 2905] [outer = 0x7f119144d000]
11:51:56 INFO - --DOCSHELL 0x7f1190ad0000 == 17 [pid = 1950] [id = 11]
11:51:56 INFO - ++DOMWINDOW == 46 (0x7f11758d9800) [pid = 1950] [serial = 2906] [outer = 0x7f119144c800]
11:51:56 INFO - ++DOMWINDOW == 47 (0x7f11812d2000) [pid = 1950] [serial = 2907] [outer = 0x7f119144d000]
11:51:57 INFO - --DOCSHELL 0x7f119163a800 == 16 [pid = 1950] [id = 12]
11:51:57 INFO - --DOCSHELL 0x7f11715ee800 == 15 [pid = 1950] [id = 1204]
11:51:57 INFO - --DOCSHELL 0x7f1180f79000 == 14 [pid = 1950] [id = 1205]
11:51:57 INFO - --DOCSHELL 0x7f11810c6800 == 13 [pid = 1950] [id = 1209]
11:51:57 INFO - --DOCSHELL 0x7f1187fc2800 == 12 [pid = 1950] [id = 8]
11:51:57 INFO - --DOCSHELL 0x7f11773be000 == 11 [pid = 1950] [id = 1208]
11:51:57 INFO - --DOCSHELL 0x7f1180f8c800 == 10 [pid = 1950] [id = 1212]
11:51:59 INFO - --DOCSHELL 0x7f118165e800 == 9 [pid = 1950] [id = 1214]
11:51:59 INFO - --DOCSHELL 0x7f118a318800 == 8 [pid = 1950] [id = 1215]
11:51:59 INFO - --DOCSHELL 0x7f118d4a0000 == 7 [pid = 1950] [id = 1216]
11:51:59 INFO - --DOMWINDOW == 46 (0x7f1176dca800) [pid = 1950] [serial = 2855] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:59 INFO - --DOMWINDOW == 45 (0x7f11758e2000) [pid = 1950] [serial = 2869] [outer = (nil)] [url = data:text/html;charset=utf8,]
11:51:59 INFO - --DOMWINDOW == 44 (0x7f1176d7f400) [pid = 1950] [serial = 2868] [outer = (nil)] [url = data:text/html;charset=utf8,]
11:51:59 INFO - --DOMWINDOW == 43 (0x7f1176ddb800) [pid = 1950] [serial = 2864] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:59 INFO - --DOMWINDOW == 42 (0x7f1177133000) [pid = 1950] [serial = 2866] [outer = (nil)] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 41 (0x7f11773e5000) [pid = 1950] [serial = 2857] [outer = (nil)] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 40 (0x7f11773e8400) [pid = 1950] [serial = 2881] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:51:59 INFO - --DOMWINDOW == 39 (0x7f1181499400) [pid = 1950] [serial = 2883] [outer = (nil)] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 38 (0x7f118f1a4400) [pid = 1950] [serial = 11] [outer = 0x7f119144d000] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 37 (0x7f118f1a3c00) [pid = 1950] [serial = 10] [outer = 0x7f119144c800] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 36 (0x7f11773ebc00) [pid = 1950] [serial = 2904] [outer = 0x7f119144c800] [url = about:blank]
11:51:59 INFO - --DOMWINDOW == 35 (0x7f11776f2800) [pid = 1950] [serial = 2905] [outer = 0x7f119144d000] [url = about:blank]
11:52:01 INFO - --DOMWINDOW == 34 (0x7f118a93bc00) [pid = 1950] [serial = 2893] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 33 (0x7f1182428c00) [pid = 1950] [serial = 2891] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:52:02 INFO - --DOMWINDOW == 32 (0x7f1185862800) [pid = 1950] [serial = 26] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,]
11:52:02 INFO - --DOMWINDOW == 31 (0x7f1176cc8400) [pid = 1950] [serial = 2898] [outer = (nil)] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:52:02 INFO - --DOMWINDOW == 30 (0x7f117712dc00) [pid = 1950] [serial = 2884] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 29 (0x7f1185865800) [pid = 1950] [serial = 29] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 28 (0x7f1188146c00) [pid = 1950] [serial = 18] [outer = (nil)] [url = about:newtab]
11:52:02 INFO - --DOMWINDOW == 27 (0x7f119267f000) [pid = 1950] [serial = 2896] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20
%20%20%20%20%20%20%20%20]
11:52:02 INFO - --DOMWINDOW == 26 (0x7f1176dcfc00) [pid = 1950] [serial = 2894] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul]
11:52:02 INFO - --DOMWINDOW == 25 (0x7f11858f3c00) [pid = 1950] [serial = 28] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,]
11:52:02 INFO - --DOMWINDOW == 24 (0x7f1177126000) [pid = 1950] [serial = 2901] [outer = (nil)] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:52:02 INFO - --DOMWINDOW == 23 (0x7f1176fb4800) [pid = 1950] [serial = 2900] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 22 (0x7f1176cd0000) [pid = 1950] [serial = 2899] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 21 (0x7f1183ca8c00) [pid = 1950] [serial = 2887] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 20 (0x7f11812d0800) [pid = 1950] [serial = 2885] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 19 (0x7f11858fc400) [pid = 1950] [serial = 30] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 18 (0x7f1183672000) [pid = 1950] [serial = 2886] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:52:02 INFO - --DOMWINDOW == 17 (0x7f11872ad400) [pid = 1950] [serial = 22] [outer = (nil)] [url = about:newtab]
11:52:02 INFO - --DOMWINDOW == 16 (0x7f1177683000) [pid = 1950] [serial = 2897] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20]
11:52:02 INFO - --DOMWINDOW == 15 (0x7f1177683400) [pid = 1950] [serial = 2895] [outer = (nil)] [url = about:blank]
11:52:02 INFO - --DOMWINDOW == 14 (0x7f118a92c000) [pid = 1950] [serial = 2892] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul]
11:52:02 INFO - --DOMWINDOW == 13 (0x7f1176dc5000) [pid = 1950] [serial = 2889] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul]
11:52:03 INFO - --DOMWINDOW == 12 (0x7f11881f4c00) [pid = 1950] [serial = 2888] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html]
11:52:03 INFO - --DOCSHELL 0x7f117a612800 == 6 [pid = 1950] [id = 1220]
11:52:10 INFO - Completed ShutdownLeaks collections in process 1950
11:52:10 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank]
11:52:10 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:52:11 INFO - --DOCSHELL 0x7f118d36b800 == 5 [pid = 1950] [id = 6]
11:52:11 INFO - --DOCSHELL 0x7f11a0d21800 == 4 [pid = 1950] [id = 1]
11:52:12 INFO - --DOCSHELL 0x7f1191430000 == 3 [pid = 1950] [id = 4]
11:52:12 INFO - --DOCSHELL 0x7f119142c800 == 2 [pid = 1950] [id = 3]
11:52:12 INFO - --DOCSHELL 0x7f1181505800 == 1 [pid = 1950] [id = 1221]
11:52:12 INFO - --DOCSHELL 0x7f119dd6d000 == 0 [pid = 1950] [id = 2]
11:52:12 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:52:12 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:52:12 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:52:12 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost
11:52:13 INFO - [1950] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 800
11:52:13 INFO - [1950] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 683
11:52:15 INFO - --DOMWINDOW == 11 (0x7f11812d2000) [pid = 1950] [serial = 2907] [outer = 0x7f119144d000] [url = about:blank]
11:52:15 INFO - --DOMWINDOW == 10 (0x7f11758d9800) [pid = 1950] [serial = 2906] [outer = 0x7f119144c800] [url = about:blank]
11:52:16 INFO - --DOMWINDOW == 9 (0x7f119144d000) [pid = 1950] [serial = 7] [outer = (nil)] [url = about:blank]
11:52:16 INFO - --DOMWINDOW == 8 (0x7f119144c800) [pid = 1950] [serial = 6] [outer = (nil)] [url = about:blank]
11:52:17 INFO - --DOMWINDOW == 7 (0x7f119dd5f800) [pid = 1950] [serial = 4] [outer = (nil)] [url = about:blank]
11:52:17 INFO - --DOMWINDOW == 6 (0x7f11a0d62400) [pid = 1950] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html]
11:52:17 INFO - --DOMWINDOW == 5 (0x7f118d34e000) [pid = 1950] [serial = 14] [outer = (nil)] [url = chrome://mochikit/content/browser-harness.xul]
11:52:17 INFO - --DOMWINDOW == 4 (0x7f118d34ec00) [pid = 1950] [serial = 15] [outer = (nil)] [url = about:blank]
11:52:17 INFO - --DOMWINDOW == 3 (0x7f119dd5ec00) [pid = 1950] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul]
11:52:17 INFO - --DOMWINDOW == 2 (0x7f117712e000) [pid = 1950] [serial = 2903] [outer = (nil)] [url = about:blank]
11:52:17 INFO - --DOMWINDOW == 1 (0x7f1176edc800) [pid = 1950] [serial = 2902] [outer = (nil)] [url = about:blank]
11:52:17 INFO - --DOMWINDOW == 0 (0x7f119e244400) [pid = 1950] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html]
11:52:17 INFO - [1950] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2800
11:52:17 INFO - nsStringStats
11:52:17 INFO - => mAllocCount: 2961226
11:52:17 INFO - => mReallocCount: 231244
11:52:17 INFO - => mFreeCount: 2961226
11:52:17 INFO - => mShareCount: 4073472
11:52:17 INFO - => mAdoptCount: 179263
11:52:17 INFO - => mAdoptFreeCount: 179263
11:52:17 INFO - => Process ID: 1950, Thread ID: 139714274961216
11:52:17 INFO - TEST-INFO | Main app process: exit 0
11:52:17 INFO - runtests.py | Application ran for: 0:28:11.815349
11:52:17 INFO - zombiecheck | Reading PID log: /tmp/tmpdDMt7Apidlog
11:52:17 INFO - Stopping web server
11:52:17 INFO - Stopping web socket server
11:52:17 INFO - Stopping ssltunnel
11:52:18 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes
11:52:18 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes
11:52:18 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes
11:52:18 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes
11:52:18 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1950
11:52:18 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->|
11:52:18 INFO - | | Per-Inst Leaked| Total Rem|
11:52:18 INFO - 0 |TOTAL | 21 0|207962550 0|
11:52:18 INFO - nsTraceRefcnt::DumpStatistics: 1560 entries
11:52:18 INFO - TEST-PASS | leakcheck | default process: no leaks detected!
11:52:18 INFO - runtests.py | Running tests: end.
11:52:18 INFO - 405 INFO checking window state
11:52:18 INFO - 406 INFO Console message: [JavaScript Error: "TelemetryStopwatch: requesting elapsed time for nonexisting stopwatch. Histogram: "FX_PAGE_LOAD_MS", key: "null"" {file: "resource://gre/modules/TelemetryStopwatch.jsm" line: 297}]
11:52:18 INFO - 407 INFO TEST-START | Shutdown
11:52:18 INFO - 408 INFO Browser Chrome Test Summary
11:52:18 INFO - 409 INFO Passed: 3002
11:52:18 INFO - 410 INFO Failed: 0
11:52:18 INFO - 411 INFO Todo: 1
11:52:18 INFO - 412 INFO *** End BrowserChrome Test Results ***
11:52:18 INFO - TEST-INFO | checking window state
11:52:18 INFO - Browser Chrome Test Summary
11:52:18 INFO - Passed: 3002
11:52:18 INFO - Failed: 0
11:52:18 INFO - Todo: 1
11:52:18 INFO - *** End BrowserChrome Test Results ***
11:52:18 INFO - SUITE-END | took 1694s
11:52:18 INFO - Return code: 0
11:52:18 INFO - TinderboxPrint: mochitest-mochitest-devtools-chrome-chunked
3002/0/1
11:52:18 INFO - # TBPL SUCCESS #
11:52:18 INFO - The mochitest suite: mochitest-devtools-chrome-chunked ran with return status: SUCCESS
11:52:18 INFO - Running post-action listener: _package_coverage_data
11:52:18 INFO - Running post-action listener: _resource_record_post_action
11:52:18 INFO - Running post-run listener: _resource_record_post_run
11:52:19 INFO - Total resource usage - Wall time: 1722s; CPU: 100.0%; Read bytes: 10653696; Write bytes: 377577472; Read time: 452; Write time: 208964
11:52:19 INFO - install - Wall time: 27s; CPU: 100.0%; Read bytes: 0; Write bytes: 25485312; Read time: 0; Write time: 20200
11:52:19 INFO - run-tests - Wall time: 1695s; CPU: 100.0%; Read bytes: 8437760; Write bytes: 297992192; Read time: 340; Write time: 127608
11:52:19 INFO - Running post-run listener: _upload_blobber_files
11:52:19 INFO - Blob upload gear active.
11:52:19 INFO - Preparing to upload files from /builds/slave/test/build/blobber_upload_dir.
11:52:19 INFO - Files from /builds/slave/test/build/blobber_upload_dir are to be uploaded with branch at the following location(s): https://blobupload.elasticbeanstalk.com
11:52:19 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '/builds/slave/test/build/venv/bin/blobberc.py', '-u', 'https://blobupload.elasticbeanstalk.com', '-a', '/builds/slave/test/oauth.txt', '-b', 'mozilla-inbound', '-d', '/builds/slave/test/build/blobber_upload_dir', '--output-manifest', '/builds/slave/test/build/uploaded_files.json']
11:52:19 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python /builds/slave/test/build/venv/bin/blobberc.py -u https://blobupload.elasticbeanstalk.com -a /builds/slave/test/oauth.txt -b mozilla-inbound -d /builds/slave/test/build/blobber_upload_dir --output-manifest /builds/slave/test/build/uploaded_files.json
11:52:19 INFO - (blobuploader) - INFO - Open directory for files ...
11:52:19 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log ...
11:52:20 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com
11:52:20 INFO - (blobuploader) - INFO - Uploading, attempt #1.
11:52:20 INFO - (blobuploader) - INFO - TinderboxPrint: mochitest-devtools-chrome-chunked_raw.log: uploaded
11:52:20 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded!
11:52:20 INFO - (blobuploader) - INFO - Done attempting.
11:52:20 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log ...
11:52:20 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com
11:52:20 INFO - (blobuploader) - INFO - Uploading, attempt #1.
11:52:21 INFO - (blobuploader) - INFO - TinderboxPrint: mochitest-devtools-chrome-chunked_errorsummary.log: uploaded
11:52:21 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded!
11:52:21 INFO - (blobuploader) - INFO - Done attempting.
11:52:21 INFO - (blobuploader) - INFO - Iteration through files over.
11:52:21 INFO - Return code: 0
11:52:21 INFO - rmtree: /builds/slave/test/build/uploaded_files.json
11:52:21 INFO - retry: Calling remove with args: ('/builds/slave/test/build/uploaded_files.json',), kwargs: {}, attempt #1
11:52:21 INFO - Setting buildbot property blobber_files to {"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/ded5dbec0cbeac84865c690cb233feb2f50a7da28db8a264e1689b5abddbf3496e3ec4d504e236da5dc3ba484cbd95df21bdf8e3e96dc194291d69e4443cd0bd", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/0c4b4dcc559483723010fb059e540d2b3dcc1b735c3f82d4516fa4033c348a3a6424f77ae450cf3add6cdafce7cbd0e0429d28951a0c05e058008c5b8d126436"}
11:52:21 INFO - Writing buildbot properties ['blobber_files'] to /builds/slave/test/properties/blobber_files
11:52:21 INFO - Writing to file /builds/slave/test/properties/blobber_files
11:52:21 INFO - Contents:
11:52:21 INFO - blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/ded5dbec0cbeac84865c690cb233feb2f50a7da28db8a264e1689b5abddbf3496e3ec4d504e236da5dc3ba484cbd95df21bdf8e3e96dc194291d69e4443cd0bd", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/0c4b4dcc559483723010fb059e540d2b3dcc1b735c3f82d4516fa4033c348a3a6424f77ae450cf3add6cdafce7cbd0e0429d28951a0c05e058008c5b8d126436"}
11:52:21 INFO - Running post-run listener: copy_logs_to_upload_dir
11:52:21 INFO - Copying logs to upload dir...
11:52:21 INFO - mkdir: /builds/slave/test/build/upload/logs
11:52:21 INFO - Copying logs to upload dir...
program finished with exit code 0
elapsedTime=1829.767006
========= master_lag: 0.11 =========
========= Finished '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 30 mins, 29 secs) (at 2016-02-02 11:52:21.676890) =========
========= Started set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2016-02-02 11:52:21.677919) =========
bash -c 'for file in `ls -1`; do cat $file; done'
in dir /builds/slave/test/properties (timeout 1200 secs)
watching logfiles {}
argv: ['bash', '-c', 'for file in `ls -1`; do cat $file; done']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test/properties
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/ded5dbec0cbeac84865c690cb233feb2f50a7da28db8a264e1689b5abddbf3496e3ec4d504e236da5dc3ba484cbd95df21bdf8e3e96dc194291d69e4443cd0bd", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/0c4b4dcc559483723010fb059e540d2b3dcc1b735c3f82d4516fa4033c348a3a6424f77ae450cf3add6cdafce7cbd0e0429d28951a0c05e058008c5b8d126436"}
build_url:https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2
symbols_url:https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip
program finished with exit code 0
elapsedTime=0.048851
build_url: 'https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.tar.bz2'
blobber_files: '{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/ded5dbec0cbeac84865c690cb233feb2f50a7da28db8a264e1689b5abddbf3496e3ec4d504e236da5dc3ba484cbd95df21bdf8e3e96dc194291d69e4443cd0bd", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/0c4b4dcc559483723010fb059e540d2b3dcc1b735c3f82d4516fa4033c348a3a6424f77ae450cf3add6cdafce7cbd0e0429d28951a0c05e058008c5b8d126436"}'
symbols_url: 'https://queue.taskcluster.net/v1/task/I_ZqMvZvTE6yGmpq7FR-Mw/artifacts/public/build/firefox-47.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'
========= master_lag: 0.05 =========
========= Finished set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2016-02-02 11:52:21.778325) =========
========= Started 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:52:21.778653) =========
rm -f oauth.txt
in dir /builds/slave/test/. (timeout 1200 secs)
watching logfiles {}
argv: ['rm', '-f', 'oauth.txt']
environment:
HOME=/home/cltbld
LANG=en_US.UTF-8
LOGNAME=cltbld
MAIL=/var/mail/cltbld
NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript
PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games
PWD=/builds/slave/test
SHELL=/bin/bash
SHLVL=1
TERM=linux
TMOUT=86400
USER=cltbld
XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1454440874.123269-438362851
_=/tools/buildbot/bin/python
using PTY: False
program finished with exit code 0
elapsedTime=0.028322
========= master_lag: 0.05 =========
========= Finished 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2016-02-02 11:52:21.858601) =========
========= Started reboot skipped (results: 3, elapsed: 0 secs) (at 2016-02-02 11:52:21.858891) =========
========= Finished reboot skipped (results: 3, elapsed: 0 secs) (at 2016-02-02 11:52:21.859253) =========
========= Total master_lag: 8.57 =========