builder: mozilla-inbound_ubuntu64_vm-debug_test-mochitest-e10s-5 slave: tst-linux64-spot-1041 starttime: 1451589995.11 results: retry (5) buildid: 20151231100938 builduid: f89abdc6a8e947aab5293caa0f506d0e revision: 3bcd3c276785b20eaa1b3ffac83149ae1d3a8b18 ========= Started set props: master (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.106637) ========= master: http://buildbot-master121.bb.releng.use1.mozilla.com:8201/ ========= Finished set props: master (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.107116) ========= ========= Started set props: basedir (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.107430) ========= bash -c pwd in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'pwd'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False /builds/slave/test program finished with exit code 0 elapsedTime=0.025021 basedir: '/builds/slave/test' ========= master_lag: 0.17 ========= ========= Finished set props: basedir (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.304970) ========= ========= Started downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.305263) ========= ========= Finished downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.347038) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.347311) ========= rm -rf properties in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'properties'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False program finished with exit code 0 elapsedTime=0.022148 ========= master_lag: 0.04 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.412482) ========= ========= Started set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.412814) ========= script_repo_url: https://hg.mozilla.org/build/mozharness ========= Finished set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.413191) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:35.413479) ========= bash -c 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False --2015-12-31 11:26:35-- https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py Resolving hg.mozilla.org (hg.mozilla.org)... 63.245.215.102, 63.245.215.25 Connecting to hg.mozilla.org (hg.mozilla.org)|63.245.215.102|:443... connected. HTTP request sent, awaiting response... 200 Script output follows Length: 12141 (12K) [text/x-python] Saving to: `archiver_client.py' 0K .......... . 100% 11.4M=0.001s 2015-12-31 11:26:35 (11.4 MB/s) - `archiver_client.py' saved [12141/12141] program finished with exit code 0 elapsedTime=0.655121 ========= master_lag: 0.07 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:36.139828) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:36.140150) ========= rm -rf scripts in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'scripts'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False program finished with exit code 0 elapsedTime=0.087300 ========= master_lag: 0.04 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:36.267664) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 1 secs) (at 2015-12-31 11:26:36.267996) ========= bash -c 'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev 3bcd3c276785b20eaa1b3ffac83149ae1d3a8b18 --destination scripts --debug' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', u'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev 3bcd3c276785b20eaa1b3ffac83149ae1d3a8b18 --destination scripts --debug'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False 2015-12-31 11:26:36,278 truncating revision to first 12 chars 2015-12-31 11:26:36,278 Setting DEBUG logging. 2015-12-31 11:26:36,279 attempt 1/10 2015-12-31 11:26:36,279 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/integration/mozilla-inbound/3bcd3c276785?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness 2015-12-31 11:26:37,478 unpacking tar archive at: mozilla-inbound-3bcd3c276785/testing/mozharness/ program finished with exit code 0 elapsedTime=1.761711 ========= master_lag: 0.04 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 1 secs) (at 2015-12-31 11:26:38.065006) ========= ========= Started downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:38.065328) ========= ========= Finished downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:38.096407) ========= ========= Started tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:38.096847) ========= TinderboxPrint: script_revlink: https://hg.mozilla.org/build/mozharness/rev/production ========= Finished tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-12-31 11:26:38.097421) ========= ========= Started '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' interrupted (results: 5, elapsed: 34 mins, 33 secs) (at 2015-12-31 11:26:38.098741) ========= /tools/buildbot/bin/python scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite plain-chunked --e10s --total-chunks 5 --this-chunk 5 --blob-upload-branch mozilla-inbound --download-symbols true in dir /builds/slave/test/. (timeout 1800 secs) (maxTime 7200 secs) watching logfiles {} argv: ['/tools/buildbot/bin/python', 'scripts/scripts/desktop_unittest.py', '--cfg', 'unittests/linux_unittest.py', '--mochitest-suite', 'plain-chunked', '--e10s', '--total-chunks', '5', '--this-chunk', '5', '--blob-upload-branch', 'mozilla-inbound', '--download-symbols', 'true'] environment: CCACHE_DIR=/builds/ccache CCACHE_UMASK=002 DISPLAY=:0 HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld MOZ_HIDE_RESULTS_TABLE=1 MOZ_NODE_PATH=/usr/bin/node MOZ_NO_REMOTE=1 NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript NO_FAIL_ON_TEST_ERRORS=1 PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PROPERTIES_FILE=/builds/slave/test/buildprops.json PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053 _=/tools/buildbot/bin/python using PTY: False 11:26:38 INFO - MultiFileLogger online at 20151231 11:26:38 in /builds/slave/test 11:26:38 INFO - Run as scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite plain-chunked --e10s --total-chunks 5 --this-chunk 5 --blob-upload-branch mozilla-inbound --download-symbols true 11:26:38 INFO - Dumping config to /builds/slave/test/logs/localconfig.json. 11:26:38 INFO - {'all_cppunittest_suites': {'cppunittest': {'tests': ('tests/cppunittest',)}}, 11:26:38 INFO - 'all_gtest_suites': {'gtest': ()}, 11:26:38 INFO - 'all_jittest_suites': {'jittest': (), 11:26:38 INFO - 'jittest-chunked': (), 11:26:38 INFO - 'jittest1': ('--total-chunks=2', '--this-chunk=1'), 11:26:38 INFO - 'jittest2': ('--total-chunks=2', '--this-chunk=2')}, 11:26:38 INFO - 'all_mochitest_suites': {'a11y': ('--a11y',), 11:26:38 INFO - 'browser-chrome': ('--browser-chrome',), 11:26:38 INFO - 'browser-chrome-addons': ('--browser-chrome', 11:26:38 INFO - '--chunk-by-runtime', 11:26:38 INFO - '--tag=addons'), 11:26:38 INFO - 'browser-chrome-chunked': ('--browser-chrome', 11:26:38 INFO - '--chunk-by-runtime'), 11:26:38 INFO - 'browser-chrome-coverage': ('--timeout=1200',), 11:26:38 INFO - 'chrome': ('--chrome',), 11:26:38 INFO - 'chrome-chunked': ('--chrome', '--chunk-by-dir=4'), 11:26:38 INFO - 'jetpack-addon': ('--jetpack-addon',), 11:26:38 INFO - 'jetpack-package': ('--jetpack-package',), 11:26:38 INFO - 'mochitest-devtools-chrome': ('--browser-chrome', 11:26:38 INFO - '--subsuite=devtools'), 11:26:38 INFO - 'mochitest-devtools-chrome-chunked': ('--browser-chrome', 11:26:38 INFO - '--subsuite=devtools', 11:26:38 INFO - '--chunk-by-runtime'), 11:26:38 INFO - 'mochitest-gl': ('--subsuite=webgl',), 11:26:38 INFO - 'mochitest-push': ('--subsuite=push',), 11:26:38 INFO - 'plain': (), 11:26:38 INFO - 'plain-chunked': ('--chunk-by-dir=4',)}, 11:26:38 INFO - 'all_mozbase_suites': {'mozbase': ()}, 11:26:38 INFO - 'all_reftest_suites': {'crashtest': {'options': ('--suite=crashtest',), 11:26:38 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 11:26:38 INFO - 'crashtest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1', 11:26:38 INFO - 'MOZ_OMTC_ENABLED': '1'}, 11:26:38 INFO - 'options': ('--suite=crashtest', 11:26:38 INFO - '--setpref=browser.tabs.remote=true', 11:26:38 INFO - '--setpref=browser.tabs.remote.autostart=true', 11:26:38 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true', 11:26:38 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 11:26:38 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 11:26:38 INFO - 'jsreftest': {'options': ('--extra-profile-file=tests/jsreftest/tests/user.js', 11:26:38 INFO - '--suite=jstestbrowser'), 11:26:38 INFO - 'tests': ('tests/jsreftest/tests/jstests.list',)}, 11:26:38 INFO - 'reftest': {'options': ('--suite=reftest',), 11:26:38 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}, 11:26:38 INFO - 'reftest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1', 11:26:38 INFO - 'MOZ_OMTC_ENABLED': '1'}, 11:26:38 INFO - 'options': ('--suite=reftest', 11:26:38 INFO - '--setpref=browser.tabs.remote=true', 11:26:38 INFO - '--setpref=browser.tabs.remote.autostart=true', 11:26:38 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true', 11:26:38 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 11:26:38 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest-sanity/reftest.list',)}, 11:26:38 INFO - 'reftest-no-accel': {'options': ('--suite=reftest', 11:26:38 INFO - '--setpref=layers.acceleration.force-enabled=disabled'), 11:26:38 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}}, 11:26:38 INFO - 'all_webapprt_suites': {'chrome': ('--webapprt-chrome', 11:26:38 INFO - '--browser-arg=-test-mode'), 11:26:38 INFO - 'content': ('--webapprt-content',)}, 11:26:38 INFO - 'all_xpcshell_suites': {'xpcshell': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 11:26:38 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 11:26:38 INFO - 'tests': ()}, 11:26:38 INFO - 'xpcshell-addons': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 11:26:38 INFO - '--tag=addons', 11:26:38 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 11:26:38 INFO - 'tests': ()}}, 11:26:38 INFO - 'append_to_log': False, 11:26:38 INFO - 'base_work_dir': '/builds/slave/test', 11:26:38 INFO - 'binary_path': '/builds/slave/test/build/firefox/firefox-bin', 11:26:38 INFO - 'blob_upload_branch': 'mozilla-inbound', 11:26:38 INFO - 'blob_uploader_auth_file': '/builds/slave/test/oauth.txt', 11:26:38 INFO - 'buildbot_json_path': 'buildprops.json', 11:26:38 INFO - 'buildbot_max_log_size': 52428800, 11:26:38 INFO - 'code_coverage': False, 11:26:38 INFO - 'config_files': ('unittests/linux_unittest.py',), 11:26:38 INFO - 'default_blob_upload_servers': ('https://blobupload.elasticbeanstalk.com',), 11:26:38 INFO - 'download_minidump_stackwalk': True, 11:26:38 INFO - 'download_symbols': 'true', 11:26:38 INFO - 'e10s': True, 11:26:38 INFO - 'exe_suffix': '', 11:26:38 INFO - 'exes': {'python': '/tools/buildbot/bin/python', 11:26:38 INFO - 'tooltool.py': '/tools/tooltool.py', 11:26:38 INFO - 'virtualenv': ('/tools/buildbot/bin/python', 11:26:38 INFO - '/tools/misc-python/virtualenv.py')}, 11:26:38 INFO - 'find_links': ('http://pypi.pvt.build.mozilla.org/pub', 11:26:38 INFO - 'http://pypi.pub.build.mozilla.org/pub'), 11:26:38 INFO - 'installer_path': '/builds/slave/test/build/installer.tar.bz2', 11:26:38 INFO - 'log_level': 'info', 11:26:38 INFO - 'log_to_console': True, 11:26:38 INFO - 'minidump_save_path': '%(abs_work_dir)s/../minidumps', 11:26:38 INFO - 'minidump_stackwalk_path': 'linux64-minidump_stackwalk', 11:26:38 INFO - 'minidump_tooltool_manifest_path': 'config/tooltool-manifests/linux64/releng.manifest', 11:26:38 INFO - 'minimum_tests_zip_dirs': ('bin/*', 11:26:38 INFO - 'certs/*', 11:26:38 INFO - 'modules/*', 11:26:38 INFO - 'mozbase/*', 11:26:38 INFO - 'config/*'), 11:26:38 INFO - 'no_random': False, 11:26:38 INFO - 'opt_config_files': (), 11:26:38 INFO - 'pip_index': False, 11:26:38 INFO - 'preflight_run_cmd_suites': ({'architectures': ('32bit', '64bit'), 11:26:38 INFO - 'cmd': ('xset', 's', 'off', 's', 'reset'), 11:26:38 INFO - 'enabled': True, 11:26:38 INFO - 'halt_on_failure': False, 11:26:38 INFO - 'name': 'disable_screen_saver'}, 11:26:38 INFO - {'architectures': ('32bit',), 11:26:38 INFO - 'cmd': ('python', 11:26:38 INFO - '../scripts/external_tools/mouse_and_screen_resolution.py', 11:26:38 INFO - '--configuration-url', 11:26:38 INFO - 'https://hg.mozilla.org/%(branch)s/raw-file/%(revision)s/testing/machine-configuration.json'), 11:26:38 INFO - 'enabled': False, 11:26:38 INFO - 'halt_on_failure': True, 11:26:38 INFO - 'name': 'run mouse & screen adjustment script'}), 11:26:38 INFO - 'require_test_zip': True, 11:26:38 INFO - 'run_all_suites': False, 11:26:38 INFO - 'run_cmd_checks_enabled': True, 11:26:38 INFO - 'run_file_names': {'cppunittest': 'runcppunittests.py', 11:26:38 INFO - 'gtest': 'rungtests.py', 11:26:38 INFO - 'jittest': 'jit_test.py', 11:26:38 INFO - 'mochitest': 'runtests.py', 11:26:38 INFO - 'mozbase': 'test.py', 11:26:38 INFO - 'mozmill': 'runtestlist.py', 11:26:38 INFO - 'reftest': 'runreftest.py', 11:26:38 INFO - 'webapprt': 'runtests.py', 11:26:38 INFO - 'xpcshell': 'runxpcshelltests.py'}, 11:26:38 INFO - 'specific_tests_zip_dirs': {'cppunittest': ('cppunittest/*',), 11:26:38 INFO - 'gtest': ('gtest/*',), 11:26:38 INFO - 'jittest': ('jit-test/*',), 11:26:38 INFO - 'mochitest': ('mochitest/*',), 11:26:38 INFO - 'mozbase': ('mozbase/*',), 11:26:38 INFO - 'mozmill': ('mozmill/*',), 11:26:38 INFO - 'reftest': ('reftest/*', 'jsreftest/*'), 11:26:38 INFO - 'webapprt': ('mochitest/*',), 11:26:38 INFO - 'xpcshell': ('xpcshell/*',)}, 11:26:38 INFO - 'specified_mochitest_suites': ('plain-chunked',), 11:26:38 INFO - 'strict_content_sandbox': False, 11:26:38 INFO - 'suite_definitions': {'cppunittest': {'options': ('--symbols-path=%(symbols_path)s', 11:26:38 INFO - '--xre-path=%(abs_app_dir)s'), 11:26:38 INFO - 'run_filename': 'runcppunittests.py', 11:26:38 INFO - 'testsdir': 'cppunittest'}, 11:26:38 INFO - 'gtest': {'options': ('--xre-path=%(abs_res_dir)s', 11:26:38 INFO - '--cwd=%(gtest_dir)s', 11:26:38 INFO - '--symbols-path=%(symbols_path)s', 11:26:38 INFO - '%(binary_path)s'), 11:26:38 INFO - 'run_filename': 'rungtests.py'}, 11:26:38 INFO - 'jittest': {'options': ('tests/bin/js', 11:26:38 INFO - '--no-slow', 11:26:38 INFO - '--no-progress', 11:26:38 INFO - '--format=automation', 11:26:38 INFO - '--jitflags=all'), 11:26:38 INFO - 'run_filename': 'jit_test.py', 11:26:38 INFO - 'testsdir': 'jit-test/jit-test'}, 11:26:38 INFO - 'luciddream-b2gdt': {'options': ('--startup-timeout=300', 11:26:38 INFO - '--log-raw=%(raw_log_file)s', 11:26:38 INFO - '--log-errorsummary=%(error_summary_file)s', 11:26:38 INFO - '--browser-path=%(browser_path)s', 11:26:38 INFO - '--b2g-desktop-path=%(fxos_desktop_path)s', 11:26:38 INFO - '--gaia-profile=%(gaia_profile)s', 11:26:38 INFO - '%(test_manifest)s')}, 11:26:38 INFO - 'luciddream-emulator': {'options': ('--startup-timeout=300', 11:26:38 INFO - '--log-raw=%(raw_log_file)s', 11:26:38 INFO - '--log-errorsummary=%(error_summary_file)s', 11:26:38 INFO - '--browser-path=%(browser_path)s', 11:26:38 INFO - '--b2gpath=%(emulator_path)s', 11:26:38 INFO - '%(test_manifest)s')}, 11:26:38 INFO - 'mochitest': {'options': ('--appname=%(binary_path)s', 11:26:38 INFO - '--utility-path=tests/bin', 11:26:38 INFO - '--extra-profile-file=tests/bin/plugins', 11:26:38 INFO - '--symbols-path=%(symbols_path)s', 11:26:38 INFO - '--certificate-path=tests/certs', 11:26:38 INFO - '--setpref=webgl.force-enabled=true', 11:26:38 INFO - '--quiet', 11:26:38 INFO - '--log-raw=%(raw_log_file)s', 11:26:38 INFO - '--log-errorsummary=%(error_summary_file)s', 11:26:38 INFO - '--use-test-media-devices', 11:26:38 INFO - '--screenshot-on-fail'), 11:26:38 INFO - 'run_filename': 'runtests.py', 11:26:38 INFO - 'testsdir': 'mochitest'}, 11:26:38 INFO - 'mozbase': {'options': ('-b', '%(binary_path)s'), 11:26:38 INFO - 'run_filename': 'test.py', 11:26:38 INFO - 'testsdir': 'mozbase'}, 11:26:38 INFO - 'mozmill': {'options': ('--binary=%(binary_path)s', 11:26:38 INFO - '--testing-modules-dir=test/modules', 11:26:38 INFO - '--symbols-path=%(symbols_path)s'), 11:26:38 INFO - 'run_filename': 'runtestlist.py', 11:26:38 INFO - 'testsdir': 'mozmill'}, 11:26:38 INFO - 'reftest': {'options': ('--appname=%(binary_path)s', 11:26:38 INFO - '--utility-path=tests/bin', 11:26:38 INFO - '--extra-profile-file=tests/bin/plugins', 11:26:38 INFO - '--symbols-path=%(symbols_path)s'), 11:26:38 INFO - 'run_filename': 'runreftest.py', 11:26:38 INFO - 'testsdir': 'reftest'}, 11:26:38 INFO - 'webapprt': {'options': ('--app=%(app_path)s', 11:26:38 INFO - '--utility-path=tests/bin', 11:26:38 INFO - '--extra-profile-file=tests/bin/plugins', 11:26:38 INFO - '--symbols-path=%(symbols_path)s', 11:26:38 INFO - '--certificate-path=tests/certs', 11:26:38 INFO - '--console-level=INFO', 11:26:38 INFO - '--testing-modules-dir=tests/modules', 11:26:38 INFO - '--quiet'), 11:26:38 INFO - 'run_filename': 'runtests.py', 11:26:38 INFO - 'testsdir': 'mochitest'}, 11:26:38 INFO - 'xpcshell': {'options': ('--symbols-path=%(symbols_path)s', 11:26:38 INFO - '--test-plugin-path=%(test_plugin_path)s', 11:26:38 INFO - '--log-raw=%(raw_log_file)s', 11:26:38 INFO - '--log-errorsummary=%(error_summary_file)s', 11:26:38 INFO - '--utility-path=tests/bin'), 11:26:38 INFO - 'run_filename': 'runxpcshelltests.py', 11:26:38 INFO - 'testsdir': 'xpcshell'}}, 11:26:38 INFO - 'this_chunk': '5', 11:26:38 INFO - 'tooltool_cache': '/builds/tooltool_cache', 11:26:38 INFO - 'total_chunks': '5', 11:26:38 INFO - 'vcs_output_timeout': 1000, 11:26:38 INFO - 'virtualenv_path': 'venv', 11:26:38 INFO - 'volatile_config': {'actions': None, 'add_actions': None, 'no_actions': None}, 11:26:38 INFO - 'work_dir': 'build', 11:26:38 INFO - 'xpcshell_name': 'xpcshell'} 11:26:38 INFO - ##### 11:26:38 INFO - ##### Running clobber step. 11:26:38 INFO - ##### 11:26:38 INFO - Running pre-action listener: _resource_record_pre_action 11:26:38 INFO - Running main action method: clobber 11:26:38 INFO - rmtree: /builds/slave/test/build 11:26:38 INFO - retry: Calling rmtree with args: ('/builds/slave/test/build',), kwargs: {}, attempt #1 11:26:40 INFO - Running post-action listener: _resource_record_post_action 11:26:40 INFO - ##### 11:26:40 INFO - ##### Running read-buildbot-config step. 11:26:40 INFO - ##### 11:26:40 INFO - Running pre-action listener: _resource_record_pre_action 11:26:40 INFO - Running main action method: read_buildbot_config 11:26:40 INFO - Using buildbot properties: 11:26:40 INFO - { 11:26:40 INFO - "project": "", 11:26:40 INFO - "product": "firefox", 11:26:40 INFO - "script_repo_revision": "production", 11:26:40 INFO - "scheduler": "tests-mozilla-inbound-ubuntu64_vm-debug-unittest", 11:26:40 INFO - "repository": "", 11:26:40 INFO - "buildername": "Ubuntu VM 12.04 x64 mozilla-inbound debug test mochitest-e10s-5", 11:26:40 INFO - "buildid": "20151231100938", 11:26:40 INFO - "pgo_build": "False", 11:26:40 INFO - "basedir": "/builds/slave/test", 11:26:40 INFO - "buildnumber": 301, 11:26:40 INFO - "slavename": "tst-linux64-spot-1041", 11:26:40 INFO - "master": "http://buildbot-master121.bb.releng.use1.mozilla.com:8201/", 11:26:40 INFO - "platform": "linux64", 11:26:40 INFO - "branch": "mozilla-inbound", 11:26:40 INFO - "revision": "3bcd3c276785b20eaa1b3ffac83149ae1d3a8b18", 11:26:40 INFO - "repo_path": "integration/mozilla-inbound", 11:26:40 INFO - "moz_repo_path": "", 11:26:40 INFO - "stage_platform": "linux64", 11:26:40 INFO - "builduid": "f89abdc6a8e947aab5293caa0f506d0e", 11:26:40 INFO - "slavebuilddir": "test" 11:26:40 INFO - } 11:26:40 INFO - Found installer url https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2. 11:26:40 INFO - Found a test packages url https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json. 11:26:40 INFO - Running post-action listener: _resource_record_post_action 11:26:40 INFO - ##### 11:26:40 INFO - ##### Running download-and-extract step. 11:26:40 INFO - ##### 11:26:40 INFO - Running pre-action listener: _resource_record_pre_action 11:26:40 INFO - Running main action method: download_and_extract 11:26:40 INFO - mkdir: /builds/slave/test/build/tests 11:26:40 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:26:40 INFO - https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json matches https://queue.taskcluster.net 11:26:40 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json 11:26:40 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json 11:26:40 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json to /builds/slave/test/build/test_packages.json 11:26:40 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/test_packages.json', 'file_name': '/builds/slave/test/build/test_packages.json'}, attempt #1 11:26:48 INFO - Downloaded 1302 bytes. 11:26:48 INFO - Reading from file /builds/slave/test/build/test_packages.json 11:26:48 INFO - Using the following test package requirements: 11:26:48 INFO - {u'common': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip'], 11:26:48 INFO - u'cppunittest': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.cppunittest.tests.zip'], 11:26:48 INFO - u'jittest': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'jsshell-linux-x86_64.zip'], 11:26:48 INFO - u'mochitest': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip'], 11:26:48 INFO - u'mozbase': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip'], 11:26:48 INFO - u'reftest': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.reftest.tests.zip'], 11:26:48 INFO - u'talos': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.talos.tests.zip'], 11:26:48 INFO - u'web-platform': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.web-platform.tests.zip'], 11:26:48 INFO - u'webapprt': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip'], 11:26:48 INFO - u'xpcshell': [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 11:26:48 INFO - u'firefox-46.0a1.en-US.linux-x86_64.xpcshell.tests.zip']} 11:26:48 INFO - Downloading packages: [u'firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', u'firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip'] for test suite category: mochitest 11:26:48 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:26:48 INFO - https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip matches https://queue.taskcluster.net 11:26:48 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip 11:26:48 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip 11:26:48 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip to /builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip 11:26:48 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip'}, attempt #1 11:26:52 INFO - Downloaded 22420664 bytes. 11:26:52 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 11:26:52 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 11:26:52 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 11:26:53 INFO - caution: filename not matched: mochitest/* 11:26:53 INFO - Return code: 11 11:26:53 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:26:53 INFO - https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip matches https://queue.taskcluster.net 11:26:53 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip 11:26:53 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip 11:26:53 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip to /builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip 11:26:53 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip'}, attempt #1 11:26:58 INFO - Downloaded 62469857 bytes. 11:26:58 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 11:26:58 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 11:26:58 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-46.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 11:27:02 INFO - caution: filename not matched: bin/* 11:27:02 INFO - caution: filename not matched: certs/* 11:27:02 INFO - caution: filename not matched: modules/* 11:27:02 INFO - caution: filename not matched: mozbase/* 11:27:02 INFO - caution: filename not matched: config/* 11:27:02 INFO - Return code: 11 11:27:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:02 INFO - https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 matches https://queue.taskcluster.net 11:27:02 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 11:27:02 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 11:27:02 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 to /builds/slave/test/build/installer.tar.bz2 11:27:02 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2', 'file_name': '/builds/slave/test/build/installer.tar.bz2'}, attempt #1 11:27:07 INFO - Downloaded 54989301 bytes. 11:27:07 INFO - Setting buildbot property build_url to https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 11:27:07 INFO - mkdir: /builds/slave/test/properties 11:27:07 INFO - Writing buildbot properties ['build_url'] to /builds/slave/test/properties/build_url 11:27:07 INFO - Writing to file /builds/slave/test/properties/build_url 11:27:07 INFO - Contents: 11:27:07 INFO - build_url:https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.tar.bz2 11:27:07 INFO - mkdir: /builds/slave/test/build/symbols 11:27:07 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:07 INFO - https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip matches https://queue.taskcluster.net 11:27:07 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:07 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:07 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip to /builds/slave/test/build/symbols/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:07 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.use1.mozilla.com/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip', 'file_name': '/builds/slave/test/build/symbols/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'}, attempt #1 11:27:12 INFO - Downloaded 52427771 bytes. 11:27:12 INFO - Setting buildbot property symbols_url to https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:12 INFO - Writing buildbot properties ['symbols_url'] to /builds/slave/test/properties/symbols_url 11:27:12 INFO - Writing to file /builds/slave/test/properties/symbols_url 11:27:12 INFO - Contents: 11:27:12 INFO - symbols_url:https://queue.taskcluster.net/v1/task/BHkln02eTA-361FML3yK-w/artifacts/public/build/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:12 INFO - Running command: ['unzip', '-q', '/builds/slave/test/build/symbols/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'] in /builds/slave/test/build/symbols 11:27:12 INFO - Copy/paste: unzip -q /builds/slave/test/build/symbols/firefox-46.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 11:27:15 INFO - Return code: 0 11:27:15 INFO - Running post-action listener: _resource_record_post_action 11:27:15 INFO - Running post-action listener: set_extra_try_arguments 11:27:15 INFO - ##### 11:27:15 INFO - ##### Running create-virtualenv step. 11:27:15 INFO - ##### 11:27:15 INFO - Running pre-action listener: _install_mozbase 11:27:15 INFO - Running pre-action listener: _pre_create_virtualenv 11:27:15 INFO - Running pre-action listener: _resource_record_pre_action 11:27:15 INFO - Running main action method: create_virtualenv 11:27:15 INFO - Creating virtualenv /builds/slave/test/build/venv 11:27:15 INFO - Running command: ['/tools/buildbot/bin/python', '/tools/misc-python/virtualenv.py', '--no-site-packages', '--distribute', '/builds/slave/test/build/venv'] in /builds/slave/test/build 11:27:15 INFO - Copy/paste: /tools/buildbot/bin/python /tools/misc-python/virtualenv.py --no-site-packages --distribute /builds/slave/test/build/venv 11:27:16 INFO - The --no-site-packages flag is deprecated; it is now the default behavior. 11:27:16 INFO - Using real prefix '/usr' 11:27:16 INFO - New python executable in /builds/slave/test/build/venv/bin/python 11:27:19 INFO - Installing distribute.............................................................................................................................................................................................done. 11:27:22 INFO - Installing pip.................done. 11:27:22 INFO - Return code: 0 11:27:22 INFO - Installing psutil>=0.7.1 into virtualenv /builds/slave/test/build/venv 11:27:22 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:22 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:22 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:22 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:22 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:22 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:22 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:22 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1'] in /builds/slave/test/build 11:27:22 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil>=0.7.1 11:27:22 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:22 INFO - 'CCACHE_UMASK': '002', 11:27:22 INFO - 'DISPLAY': ':0', 11:27:22 INFO - 'HOME': '/home/cltbld', 11:27:22 INFO - 'LANG': 'en_US.UTF-8', 11:27:22 INFO - 'LOGNAME': 'cltbld', 11:27:22 INFO - 'MAIL': '/var/mail/cltbld', 11:27:22 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:22 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:22 INFO - 'MOZ_NO_REMOTE': '1', 11:27:22 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:22 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:22 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:22 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:22 INFO - 'PWD': '/builds/slave/test', 11:27:22 INFO - 'SHELL': '/bin/bash', 11:27:22 INFO - 'SHLVL': '1', 11:27:22 INFO - 'TERM': 'linux', 11:27:22 INFO - 'TMOUT': '86400', 11:27:22 INFO - 'USER': 'cltbld', 11:27:22 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:22 INFO - '_': '/tools/buildbot/bin/python'} 11:27:23 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:23 INFO - Downloading/unpacking psutil>=0.7.1 11:27:23 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:23 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:23 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:23 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:23 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:23 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:27 INFO - Creating supposed download cache at /builds/slave/test/build/venv/cache 11:27:28 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fpsutil-3.1.1.tar.gz 11:27:28 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/psutil/setup.py) egg_info for package psutil 11:27:28 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 11:27:28 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 11:27:28 INFO - Installing collected packages: psutil 11:27:28 INFO - Running setup.py install for psutil 11:27:28 INFO - building 'psutil._psutil_linux' extension 11:27:28 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -DPSUTIL_VERSION=311 -I/usr/include/python2.7 -c psutil/_psutil_linux.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o 11:27:29 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_linux.so 11:27:29 INFO - building 'psutil._psutil_posix' extension 11:27:29 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c psutil/_psutil_posix.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o 11:27:29 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_posix.so 11:27:29 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 11:27:29 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 11:27:29 INFO - Successfully installed psutil 11:27:29 INFO - Cleaning up... 11:27:29 INFO - Return code: 0 11:27:29 INFO - Installing mozsystemmonitor==0.0.0 into virtualenv /builds/slave/test/build/venv 11:27:29 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:29 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:29 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:29 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:29 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:29 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:29 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:29 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0'] in /builds/slave/test/build 11:27:29 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mozsystemmonitor==0.0.0 11:27:29 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:29 INFO - 'CCACHE_UMASK': '002', 11:27:29 INFO - 'DISPLAY': ':0', 11:27:29 INFO - 'HOME': '/home/cltbld', 11:27:29 INFO - 'LANG': 'en_US.UTF-8', 11:27:29 INFO - 'LOGNAME': 'cltbld', 11:27:29 INFO - 'MAIL': '/var/mail/cltbld', 11:27:29 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:29 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:29 INFO - 'MOZ_NO_REMOTE': '1', 11:27:29 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:29 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:29 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:29 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:29 INFO - 'PWD': '/builds/slave/test', 11:27:29 INFO - 'SHELL': '/bin/bash', 11:27:29 INFO - 'SHLVL': '1', 11:27:29 INFO - 'TERM': 'linux', 11:27:29 INFO - 'TMOUT': '86400', 11:27:29 INFO - 'USER': 'cltbld', 11:27:29 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:29 INFO - '_': '/tools/buildbot/bin/python'} 11:27:30 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:30 INFO - Downloading/unpacking mozsystemmonitor==0.0.0 11:27:30 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:30 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:30 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:30 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:30 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:30 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:35 INFO - Downloading mozsystemmonitor-0.0.tar.gz 11:27:35 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmozsystemmonitor-0.0.tar.gz 11:27:35 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mozsystemmonitor/setup.py) egg_info for package mozsystemmonitor 11:27:35 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil>=0.7.1 in ./venv/lib/python2.7/site-packages (from mozsystemmonitor==0.0.0) 11:27:35 INFO - Installing collected packages: mozsystemmonitor 11:27:35 INFO - Running setup.py install for mozsystemmonitor 11:27:35 INFO - Successfully installed mozsystemmonitor 11:27:35 INFO - Cleaning up... 11:27:35 INFO - Return code: 0 11:27:35 INFO - Installing blobuploader==1.2.4 into virtualenv /builds/slave/test/build/venv 11:27:35 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:35 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:35 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:35 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:35 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:35 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:35 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:35 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4'] in /builds/slave/test/build 11:27:35 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub blobuploader==1.2.4 11:27:35 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:35 INFO - 'CCACHE_UMASK': '002', 11:27:35 INFO - 'DISPLAY': ':0', 11:27:35 INFO - 'HOME': '/home/cltbld', 11:27:35 INFO - 'LANG': 'en_US.UTF-8', 11:27:35 INFO - 'LOGNAME': 'cltbld', 11:27:35 INFO - 'MAIL': '/var/mail/cltbld', 11:27:35 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:35 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:35 INFO - 'MOZ_NO_REMOTE': '1', 11:27:35 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:35 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:35 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:35 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:35 INFO - 'PWD': '/builds/slave/test', 11:27:35 INFO - 'SHELL': '/bin/bash', 11:27:35 INFO - 'SHLVL': '1', 11:27:35 INFO - 'TERM': 'linux', 11:27:35 INFO - 'TMOUT': '86400', 11:27:35 INFO - 'USER': 'cltbld', 11:27:35 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:35 INFO - '_': '/tools/buildbot/bin/python'} 11:27:35 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:35 INFO - Downloading/unpacking blobuploader==1.2.4 11:27:35 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:35 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:35 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:35 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:35 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:35 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:40 INFO - Downloading blobuploader-1.2.4.tar.gz 11:27:40 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblobuploader-1.2.4.tar.gz 11:27:40 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blobuploader/setup.py) egg_info for package blobuploader 11:27:40 INFO - Downloading/unpacking requests==1.2.3. (from blobuploader==1.2.4) 11:27:40 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:40 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:40 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:40 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:40 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:40 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:41 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Frequests-1.2.3.tar.gz 11:27:41 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/requests/setup.py) egg_info for package requests 11:27:42 INFO - Downloading/unpacking docopt==0.6.1 (from blobuploader==1.2.4) 11:27:42 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:42 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:42 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:42 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:42 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:42 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:42 INFO - Downloading docopt-0.6.1.tar.gz 11:27:42 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fdocopt-0.6.1.tar.gz 11:27:42 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/docopt/setup.py) egg_info for package docopt 11:27:42 INFO - Installing collected packages: blobuploader, requests, docopt 11:27:42 INFO - Running setup.py install for blobuploader 11:27:43 INFO - changing mode of build/scripts-2.7/blobberc.py from 664 to 775 11:27:43 INFO - changing mode of /builds/slave/test/build/venv/bin/blobberc.py to 775 11:27:43 INFO - Running setup.py install for requests 11:27:43 INFO - Running setup.py install for docopt 11:27:44 INFO - Successfully installed blobuploader requests docopt 11:27:44 INFO - Cleaning up... 11:27:44 INFO - Return code: 0 11:27:44 INFO - Installing None into virtualenv /builds/slave/test/build/venv 11:27:44 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:44 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:44 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:44 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:44 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:44 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:44 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:44 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 11:27:44 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 11:27:44 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:44 INFO - 'CCACHE_UMASK': '002', 11:27:44 INFO - 'DISPLAY': ':0', 11:27:44 INFO - 'HOME': '/home/cltbld', 11:27:44 INFO - 'LANG': 'en_US.UTF-8', 11:27:44 INFO - 'LOGNAME': 'cltbld', 11:27:44 INFO - 'MAIL': '/var/mail/cltbld', 11:27:44 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:44 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:44 INFO - 'MOZ_NO_REMOTE': '1', 11:27:44 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:44 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:44 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:44 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:44 INFO - 'PWD': '/builds/slave/test', 11:27:44 INFO - 'SHELL': '/bin/bash', 11:27:44 INFO - 'SHLVL': '1', 11:27:44 INFO - 'TERM': 'linux', 11:27:44 INFO - 'TMOUT': '86400', 11:27:44 INFO - 'USER': 'cltbld', 11:27:44 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:44 INFO - '_': '/tools/buildbot/bin/python'} 11:27:44 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 11:27:44 INFO - Running setup.py (path:/tmp/pip-Y1TpVF-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 11:27:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 11:27:44 INFO - Running setup.py (path:/tmp/pip-OPq19Q-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 11:27:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 11:27:44 INFO - Running setup.py (path:/tmp/pip-ugU8gK-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 11:27:45 INFO - Running setup.py (path:/tmp/pip-O2z8k1-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 11:27:45 INFO - Running setup.py (path:/tmp/pip-a_YHge-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 11:27:45 INFO - Running setup.py (path:/tmp/pip-yLmqX9-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 11:27:45 INFO - Running setup.py (path:/tmp/pip-0ihTEi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 11:27:45 INFO - Running setup.py (path:/tmp/pip-tT4xjt-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 11:27:45 INFO - Running setup.py (path:/tmp/pip-20lrUA-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 11:27:45 INFO - Running setup.py (path:/tmp/pip-0nu5ba-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 11:27:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 11:27:45 INFO - Running setup.py (path:/tmp/pip-9rQaij-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 11:27:46 INFO - Running setup.py (path:/tmp/pip-v5XHog-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 11:27:46 INFO - Running setup.py (path:/tmp/pip-oZ7S9g-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 11:27:46 INFO - Running setup.py (path:/tmp/pip-QFW6R1-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 11:27:46 INFO - Running setup.py (path:/tmp/pip-nKAIk4-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 11:27:46 INFO - Running setup.py (path:/tmp/pip-5i4vtE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 11:27:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 11:27:46 INFO - Running setup.py (path:/tmp/pip-2yJ0jD-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 11:27:46 INFO - Installing collected packages: manifestparser, mozcrash, mozdebug, mozdevice, mozfile, mozhttpd, mozinfo, mozInstall, mozleak, mozlog, moznetwork, mozprocess, mozprofile, mozrunner, mozscreenshot, moztest, mozversion 11:27:46 INFO - Running setup.py install for manifestparser 11:27:47 INFO - Installing manifestparser script to /builds/slave/test/build/venv/bin 11:27:47 INFO - Running setup.py install for mozcrash 11:27:47 INFO - Running setup.py install for mozdebug 11:27:47 INFO - Running setup.py install for mozdevice 11:27:47 INFO - Installing sutini script to /builds/slave/test/build/venv/bin 11:27:47 INFO - Installing dm script to /builds/slave/test/build/venv/bin 11:27:47 INFO - Running setup.py install for mozfile 11:27:48 INFO - Running setup.py install for mozhttpd 11:27:48 INFO - Installing mozhttpd script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Running setup.py install for mozinfo 11:27:48 INFO - Installing mozinfo script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Running setup.py install for mozInstall 11:27:48 INFO - Installing moz_remove_from_system script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Installing mozuninstall script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Installing mozinstall script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Installing moz_add_to_system script to /builds/slave/test/build/venv/bin 11:27:48 INFO - Running setup.py install for mozleak 11:27:48 INFO - Running setup.py install for mozlog 11:27:49 INFO - Installing structlog script to /builds/slave/test/build/venv/bin 11:27:49 INFO - Running setup.py install for moznetwork 11:27:49 INFO - Installing moznetwork script to /builds/slave/test/build/venv/bin 11:27:49 INFO - Running setup.py install for mozprocess 11:27:49 INFO - Running setup.py install for mozprofile 11:27:49 INFO - Installing mozprofile script to /builds/slave/test/build/venv/bin 11:27:49 INFO - Installing diff-profiles script to /builds/slave/test/build/venv/bin 11:27:49 INFO - Installing view-profile script to /builds/slave/test/build/venv/bin 11:27:49 INFO - Running setup.py install for mozrunner 11:27:49 INFO - Installing mozrunner script to /builds/slave/test/build/venv/bin 11:27:50 INFO - Running setup.py install for mozscreenshot 11:27:50 INFO - Running setup.py install for moztest 11:27:50 INFO - Running setup.py install for mozversion 11:27:50 INFO - Installing mozversion script to /builds/slave/test/build/venv/bin 11:27:50 INFO - Successfully installed manifestparser mozcrash mozdebug mozdevice mozfile mozhttpd mozinfo mozInstall mozleak mozlog moznetwork mozprocess mozprofile mozrunner mozscreenshot moztest mozversion 11:27:50 INFO - Cleaning up... 11:27:50 INFO - Return code: 0 11:27:50 INFO - Installing None into virtualenv /builds/slave/test/build/venv 11:27:50 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:50 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:50 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:50 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:50 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:50 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:50 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:50 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 11:27:50 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 11:27:50 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:50 INFO - 'CCACHE_UMASK': '002', 11:27:50 INFO - 'DISPLAY': ':0', 11:27:50 INFO - 'HOME': '/home/cltbld', 11:27:50 INFO - 'LANG': 'en_US.UTF-8', 11:27:50 INFO - 'LOGNAME': 'cltbld', 11:27:50 INFO - 'MAIL': '/var/mail/cltbld', 11:27:50 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:50 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:50 INFO - 'MOZ_NO_REMOTE': '1', 11:27:50 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:50 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:50 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:50 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:50 INFO - 'PWD': '/builds/slave/test', 11:27:50 INFO - 'SHELL': '/bin/bash', 11:27:50 INFO - 'SHLVL': '1', 11:27:50 INFO - 'TERM': 'linux', 11:27:50 INFO - 'TMOUT': '86400', 11:27:50 INFO - 'USER': 'cltbld', 11:27:50 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:50 INFO - '_': '/tools/buildbot/bin/python'} 11:27:51 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 11:27:51 INFO - Running setup.py (path:/tmp/pip-WgvKyb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 11:27:51 INFO - Running setup.py (path:/tmp/pip-aoGaIo-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 11:27:51 INFO - Running setup.py (path:/tmp/pip-Y3P_8H-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 11:27:51 INFO - Running setup.py (path:/tmp/pip-EF1tJF-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 11:27:51 INFO - Running setup.py (path:/tmp/pip-iN4jCT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 11:27:51 INFO - Running setup.py (path:/tmp/pip-CuExlz-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 11:27:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 11:27:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 11:27:51 INFO - Running setup.py (path:/tmp/pip-wpWKUa-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 11:27:52 INFO - Running setup.py (path:/tmp/pip-c7B1nz-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 11:27:52 INFO - Running setup.py (path:/tmp/pip-3yR2bR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 11:27:52 INFO - Running setup.py (path:/tmp/pip-s7kx7U-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 11:27:52 INFO - Running setup.py (path:/tmp/pip-mBE063-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 11:27:52 INFO - Running setup.py (path:/tmp/pip-VNhayX-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 11:27:52 INFO - Running setup.py (path:/tmp/pip-ZQsyi1-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 11:27:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 11:27:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 11:27:52 INFO - Running setup.py (path:/tmp/pip-U9MFOm-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 11:27:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 11:27:53 INFO - Running setup.py (path:/tmp/pip-d3ozoi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 11:27:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 11:27:53 INFO - Running setup.py (path:/tmp/pip-ohx4Pq-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 11:27:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 11:27:53 INFO - Running setup.py (path:/tmp/pip-J4CcX6-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:27:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:27:53 INFO - Downloading/unpacking blessings>=1.3 (from mozlog==3.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 11:27:53 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:53 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:53 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:53 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:27:53 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:27:53 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:27:58 INFO - Downloading blessings-1.5.1.tar.gz 11:27:58 INFO - Storing download in cache at /builds/slave/test/build/venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblessings-1.5.1.tar.gz 11:27:58 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blessings/setup.py) egg_info for package blessings 11:27:58 INFO - Installing collected packages: blessings 11:27:58 INFO - Running setup.py install for blessings 11:27:58 INFO - Successfully installed blessings 11:27:58 INFO - Cleaning up... 11:27:58 INFO - Return code: 0 11:27:58 INFO - Installing pip>=1.5 into virtualenv /builds/slave/test/build/venv 11:27:58 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:58 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:58 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:58 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:58 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:58 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:58 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:58 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5'] in /builds/slave/test/build 11:27:58 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub pip>=1.5 11:27:58 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:58 INFO - 'CCACHE_UMASK': '002', 11:27:58 INFO - 'DISPLAY': ':0', 11:27:58 INFO - 'HOME': '/home/cltbld', 11:27:58 INFO - 'LANG': 'en_US.UTF-8', 11:27:58 INFO - 'LOGNAME': 'cltbld', 11:27:58 INFO - 'MAIL': '/var/mail/cltbld', 11:27:58 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:58 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:58 INFO - 'MOZ_NO_REMOTE': '1', 11:27:58 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:58 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:58 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:58 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:58 INFO - 'PWD': '/builds/slave/test', 11:27:58 INFO - 'SHELL': '/bin/bash', 11:27:58 INFO - 'SHLVL': '1', 11:27:58 INFO - 'TERM': 'linux', 11:27:58 INFO - 'TMOUT': '86400', 11:27:58 INFO - 'USER': 'cltbld', 11:27:58 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:58 INFO - '_': '/tools/buildbot/bin/python'} 11:27:59 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:59 INFO - Requirement already satisfied (use --upgrade to upgrade): pip>=1.5 in ./venv/lib/python2.7/site-packages/pip-1.5.5-py2.7.egg 11:27:59 INFO - Cleaning up... 11:27:59 INFO - Return code: 0 11:27:59 INFO - Installing psutil==3.1.1 into virtualenv /builds/slave/test/build/venv 11:27:59 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:59 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:59 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:59 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:59 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:59 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:59 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:59 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1'] in /builds/slave/test/build 11:27:59 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil==3.1.1 11:27:59 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:59 INFO - 'CCACHE_UMASK': '002', 11:27:59 INFO - 'DISPLAY': ':0', 11:27:59 INFO - 'HOME': '/home/cltbld', 11:27:59 INFO - 'LANG': 'en_US.UTF-8', 11:27:59 INFO - 'LOGNAME': 'cltbld', 11:27:59 INFO - 'MAIL': '/var/mail/cltbld', 11:27:59 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:59 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:59 INFO - 'MOZ_NO_REMOTE': '1', 11:27:59 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:59 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:59 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:59 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:59 INFO - 'PWD': '/builds/slave/test', 11:27:59 INFO - 'SHELL': '/bin/bash', 11:27:59 INFO - 'SHLVL': '1', 11:27:59 INFO - 'TERM': 'linux', 11:27:59 INFO - 'TMOUT': '86400', 11:27:59 INFO - 'USER': 'cltbld', 11:27:59 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:59 INFO - '_': '/tools/buildbot/bin/python'} 11:27:59 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:27:59 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil==3.1.1 in ./venv/lib/python2.7/site-packages 11:27:59 INFO - Cleaning up... 11:27:59 INFO - Return code: 0 11:27:59 INFO - Installing mock into virtualenv /builds/slave/test/build/venv 11:27:59 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:59 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:27:59 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:59 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:27:59 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:27:59 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:27:59 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:27:59 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock'] in /builds/slave/test/build 11:27:59 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mock 11:27:59 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:27:59 INFO - 'CCACHE_UMASK': '002', 11:27:59 INFO - 'DISPLAY': ':0', 11:27:59 INFO - 'HOME': '/home/cltbld', 11:27:59 INFO - 'LANG': 'en_US.UTF-8', 11:27:59 INFO - 'LOGNAME': 'cltbld', 11:27:59 INFO - 'MAIL': '/var/mail/cltbld', 11:27:59 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:27:59 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:27:59 INFO - 'MOZ_NO_REMOTE': '1', 11:27:59 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:27:59 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:27:59 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:27:59 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:27:59 INFO - 'PWD': '/builds/slave/test', 11:27:59 INFO - 'SHELL': '/bin/bash', 11:27:59 INFO - 'SHLVL': '1', 11:27:59 INFO - 'TERM': 'linux', 11:27:59 INFO - 'TMOUT': '86400', 11:27:59 INFO - 'USER': 'cltbld', 11:27:59 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:27:59 INFO - '_': '/tools/buildbot/bin/python'} 11:28:00 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:28:00 INFO - Downloading/unpacking mock 11:28:00 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:28:00 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:28:00 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:28:00 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:28:00 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:28:00 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:28:05 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmock-1.0.1.tar.gz 11:28:05 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mock/setup.py) egg_info for package mock 11:28:06 INFO - warning: no files found matching '*.png' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.css' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.html' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.js' under directory 'docs' 11:28:06 INFO - Installing collected packages: mock 11:28:06 INFO - Running setup.py install for mock 11:28:06 INFO - warning: no files found matching '*.png' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.css' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.html' under directory 'docs' 11:28:06 INFO - warning: no files found matching '*.js' under directory 'docs' 11:28:06 INFO - Successfully installed mock 11:28:06 INFO - Cleaning up... 11:28:06 INFO - Return code: 0 11:28:06 INFO - Installing simplejson into virtualenv /builds/slave/test/build/venv 11:28:06 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:06 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:28:06 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:06 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:06 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:28:06 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:06 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:28:06 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson'] in /builds/slave/test/build 11:28:06 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub simplejson 11:28:06 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:28:06 INFO - 'CCACHE_UMASK': '002', 11:28:06 INFO - 'DISPLAY': ':0', 11:28:06 INFO - 'HOME': '/home/cltbld', 11:28:06 INFO - 'LANG': 'en_US.UTF-8', 11:28:06 INFO - 'LOGNAME': 'cltbld', 11:28:06 INFO - 'MAIL': '/var/mail/cltbld', 11:28:06 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:28:06 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:28:06 INFO - 'MOZ_NO_REMOTE': '1', 11:28:06 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:28:06 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:28:06 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:28:06 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:28:06 INFO - 'PWD': '/builds/slave/test', 11:28:06 INFO - 'SHELL': '/bin/bash', 11:28:06 INFO - 'SHLVL': '1', 11:28:06 INFO - 'TERM': 'linux', 11:28:06 INFO - 'TMOUT': '86400', 11:28:06 INFO - 'USER': 'cltbld', 11:28:06 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:28:06 INFO - '_': '/tools/buildbot/bin/python'} 11:28:06 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:28:06 INFO - Downloading/unpacking simplejson 11:28:06 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:28:06 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:28:06 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:28:06 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com has it available 11:28:06 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 11:28:06 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 11:28:11 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fsimplejson-3.3.0.tar.gz 11:28:11 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/simplejson/setup.py) egg_info for package simplejson 11:28:12 INFO - Installing collected packages: simplejson 11:28:12 INFO - Running setup.py install for simplejson 11:28:12 INFO - building 'simplejson._speedups' extension 11:28:12 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c simplejson/_speedups.c -o build/temp.linux-x86_64-2.7/simplejson/_speedups.o 11:28:13 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/simplejson/_speedups.o -o build/lib.linux-x86_64-2.7/simplejson/_speedups.so 11:28:13 INFO - Successfully installed simplejson 11:28:13 INFO - Cleaning up... 11:28:14 INFO - Return code: 0 11:28:14 INFO - Installing None into virtualenv /builds/slave/test/build/venv 11:28:14 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:14 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:28:14 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:14 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:14 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:28:14 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:14 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:28:14 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 11:28:14 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 11:28:14 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:28:14 INFO - 'CCACHE_UMASK': '002', 11:28:14 INFO - 'DISPLAY': ':0', 11:28:14 INFO - 'HOME': '/home/cltbld', 11:28:14 INFO - 'LANG': 'en_US.UTF-8', 11:28:14 INFO - 'LOGNAME': 'cltbld', 11:28:14 INFO - 'MAIL': '/var/mail/cltbld', 11:28:14 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:28:14 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:28:14 INFO - 'MOZ_NO_REMOTE': '1', 11:28:14 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:28:14 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:28:14 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:28:14 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:28:14 INFO - 'PWD': '/builds/slave/test', 11:28:14 INFO - 'SHELL': '/bin/bash', 11:28:14 INFO - 'SHLVL': '1', 11:28:14 INFO - 'TERM': 'linux', 11:28:14 INFO - 'TMOUT': '86400', 11:28:14 INFO - 'USER': 'cltbld', 11:28:14 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:28:14 INFO - '_': '/tools/buildbot/bin/python'} 11:28:14 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:28:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 11:28:14 INFO - Running setup.py (path:/tmp/pip-AmXlHn-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 11:28:14 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 11:28:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 11:28:14 INFO - Running setup.py (path:/tmp/pip-T8XSYD-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 11:28:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:28:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 11:28:14 INFO - Running setup.py (path:/tmp/pip-0X8EeA-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 11:28:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 11:28:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 11:28:14 INFO - Running setup.py (path:/tmp/pip-CtA6ol-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 11:28:15 INFO - Running setup.py (path:/tmp/pip-oFNNwN-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 11:28:15 INFO - Running setup.py (path:/tmp/pip-CL6deS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 11:28:15 INFO - Running setup.py (path:/tmp/pip-fqVPBy-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 11:28:15 INFO - Running setup.py (path:/tmp/pip-I8c4fK-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 11:28:15 INFO - Running setup.py (path:/tmp/pip-BPsCSt-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 11:28:15 INFO - Running setup.py (path:/tmp/pip-zOCUqs-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 11:28:15 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 11:28:15 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 11:28:15 INFO - Running setup.py (path:/tmp/pip-GdeJgH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 11:28:16 INFO - Running setup.py (path:/tmp/pip-Qe4T6E-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 11:28:16 INFO - Running setup.py (path:/tmp/pip-7F8l5g-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 11:28:16 INFO - Running setup.py (path:/tmp/pip-mvanb8-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 11:28:16 INFO - Running setup.py (path:/tmp/pip-9GEn0r-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 11:28:16 INFO - Running setup.py (path:/tmp/pip-ZVgmTV-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 11:28:16 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 11:28:16 INFO - Running setup.py (path:/tmp/pip-JL6h7v-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 11:28:16 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 11:28:16 INFO - Cleaning up... 11:28:17 INFO - Return code: 0 11:28:17 INFO - Installing None into virtualenv /builds/slave/test/build/venv 11:28:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:17 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 11:28:17 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:17 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 11:28:17 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub 11:28:17 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x20a01f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7f207b0e2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x21dbb40>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 11:28:17 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 11:28:17 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.use1.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 11:28:17 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:28:17 INFO - 'CCACHE_UMASK': '002', 11:28:17 INFO - 'DISPLAY': ':0', 11:28:17 INFO - 'HOME': '/home/cltbld', 11:28:17 INFO - 'LANG': 'en_US.UTF-8', 11:28:17 INFO - 'LOGNAME': 'cltbld', 11:28:17 INFO - 'MAIL': '/var/mail/cltbld', 11:28:17 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:28:17 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:28:17 INFO - 'MOZ_NO_REMOTE': '1', 11:28:17 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:28:17 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:28:17 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:28:17 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:28:17 INFO - 'PWD': '/builds/slave/test', 11:28:17 INFO - 'SHELL': '/bin/bash', 11:28:17 INFO - 'SHLVL': '1', 11:28:17 INFO - 'TERM': 'linux', 11:28:17 INFO - 'TMOUT': '86400', 11:28:17 INFO - 'USER': 'cltbld', 11:28:17 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:28:17 INFO - '_': '/tools/buildbot/bin/python'} 11:28:17 INFO - Ignoring indexes: https://pypi.python.org/simple/ 11:28:17 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 11:28:17 INFO - Running setup.py (path:/tmp/pip-DQmAEm-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 11:28:17 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 11:28:17 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 11:28:17 INFO - Running setup.py (path:/tmp/pip-plAqIV-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 11:28:17 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:28:17 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 11:28:17 INFO - Running setup.py (path:/tmp/pip-AlIfBK-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 11:28:17 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 11:28:17 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 11:28:17 INFO - Running setup.py (path:/tmp/pip-fFvf46-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 11:28:18 INFO - Running setup.py (path:/tmp/pip-3UG31u-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 11:28:18 INFO - Running setup.py (path:/tmp/pip-Pujk4K-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 11:28:18 INFO - Running setup.py (path:/tmp/pip-W4WD1D-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 11:28:18 INFO - Running setup.py (path:/tmp/pip-ZPOKBb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 11:28:18 INFO - Running setup.py (path:/tmp/pip-9YuurY-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 11:28:18 INFO - Running setup.py (path:/tmp/pip-u1CzZz-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 11:28:18 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.1 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 11:28:18 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 11:28:18 INFO - Running setup.py (path:/tmp/pip-z7WFX_-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 11:28:19 INFO - Running setup.py (path:/tmp/pip-89dGNc-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 11:28:19 INFO - Running setup.py (path:/tmp/pip-AWyqMC-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.28 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 11:28:19 INFO - Running setup.py (path:/tmp/pip-bNGWyF-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 11:28:19 INFO - Running setup.py (path:/tmp/pip-pqm5Ey-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 11:28:19 INFO - Running setup.py (path:/tmp/pip-A9K37W-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 11:28:19 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 11:28:19 INFO - Running setup.py (path:/tmp/pip-q3MHyQ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 11:28:19 INFO - Requirement already satisfied (use --upgrade to upgrade): blessings>=1.3 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozlog==3.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 11:28:19 INFO - Cleaning up... 11:28:20 INFO - Return code: 0 11:28:20 INFO - Done creating virtualenv /builds/slave/test/build/venv. 11:28:20 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 11:28:20 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 11:28:20 INFO - Reading from file tmpfile_stdout 11:28:20 INFO - Current package versions: 11:28:20 INFO - argparse == 1.2.1 11:28:20 INFO - blessings == 1.5.1 11:28:20 INFO - blobuploader == 1.2.4 11:28:20 INFO - docopt == 0.6.1 11:28:20 INFO - manifestparser == 1.1 11:28:20 INFO - mock == 1.0.1 11:28:20 INFO - mozInstall == 1.12 11:28:20 INFO - mozcrash == 0.16 11:28:20 INFO - mozdebug == 0.1 11:28:20 INFO - mozdevice == 0.47 11:28:20 INFO - mozfile == 1.2 11:28:20 INFO - mozhttpd == 0.7 11:28:20 INFO - mozinfo == 0.9 11:28:20 INFO - mozleak == 0.1 11:28:20 INFO - mozlog == 3.1 11:28:20 INFO - moznetwork == 0.27 11:28:20 INFO - mozprocess == 0.22 11:28:20 INFO - mozprofile == 0.28 11:28:20 INFO - mozrunner == 6.11 11:28:20 INFO - mozscreenshot == 0.1 11:28:20 INFO - mozsystemmonitor == 0.0 11:28:20 INFO - moztest == 0.7 11:28:20 INFO - mozversion == 1.4 11:28:20 INFO - psutil == 3.1.1 11:28:20 INFO - requests == 1.2.3 11:28:20 INFO - simplejson == 3.3.0 11:28:20 INFO - wsgiref == 0.1.2 11:28:20 INFO - Running post-action listener: _resource_record_post_action 11:28:20 INFO - Running post-action listener: _start_resource_monitoring 11:28:20 INFO - Starting resource monitoring. 11:28:20 INFO - ##### 11:28:20 INFO - ##### Running install step. 11:28:20 INFO - ##### 11:28:20 INFO - Running pre-action listener: _resource_record_pre_action 11:28:20 INFO - Running main action method: install 11:28:20 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 11:28:20 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 11:28:20 INFO - Reading from file tmpfile_stdout 11:28:20 INFO - Detecting whether we're running mozinstall >=1.0... 11:28:21 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '-h'] 11:28:21 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall -h 11:28:21 INFO - Reading from file tmpfile_stdout 11:28:21 INFO - Output received: 11:28:21 INFO - Usage: mozinstall [options] installer 11:28:21 INFO - Options: 11:28:21 INFO - -h, --help show this help message and exit 11:28:21 INFO - -d DEST, --destination=DEST 11:28:21 INFO - Directory to install application into. [default: 11:28:21 INFO - "/builds/slave/test"] 11:28:21 INFO - --app=APP Application being installed. [default: firefox] 11:28:21 INFO - mkdir: /builds/slave/test/build/application 11:28:21 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '/builds/slave/test/build/installer.tar.bz2', '--destination', '/builds/slave/test/build/application'] 11:28:21 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall /builds/slave/test/build/installer.tar.bz2 --destination /builds/slave/test/build/application 11:28:48 INFO - Reading from file tmpfile_stdout 11:28:48 INFO - Output received: 11:28:48 INFO - /builds/slave/test/build/application/firefox/firefox 11:28:48 INFO - Running post-action listener: _resource_record_post_action 11:28:48 INFO - ##### 11:28:48 INFO - ##### Running run-tests step. 11:28:48 INFO - ##### 11:28:48 INFO - Running pre-action listener: _resource_record_pre_action 11:28:48 INFO - Running pre-action listener: _set_gcov_prefix 11:28:48 INFO - Running main action method: run_tests 11:28:48 INFO - Running pre test command disable_screen_saver with 'xset s off s reset' 11:28:48 INFO - Running command: ['xset', 's', 'off', 's', 'reset'] in /builds/slave/test/build 11:28:48 INFO - Copy/paste: xset s off s reset 11:28:48 INFO - Return code: 0 11:28:48 INFO - #### Running mochitest suites 11:28:48 INFO - grabbing minidump binary from tooltool 11:28:48 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 11:28:48 INFO - retry: Calling run_command with args: (['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'],), kwargs: {'error_list': [{'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d81f0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x21d9b50>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x21d9dd0>, 'level': 'critical'}, {'substr': 'ERROR - ', 'level': 'error'}], 'cwd': '/builds/slave/test/build', 'privileged': False}, attempt #1 11:28:48 INFO - Running command: ['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'] in /builds/slave/test/build 11:28:48 INFO - Copy/paste: /tools/tooltool.py --url https://api.pub.build.mozilla.org/tooltool/ --authentication-file /builds/relengapi.tok fetch -m /builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest -o -c /builds/tooltool_cache 11:28:48 INFO - INFO - File linux64-minidump_stackwalk retrieved from local cache /builds/tooltool_cache 11:28:48 INFO - Return code: 0 11:28:48 INFO - Chmoding /builds/slave/test/build/linux64-minidump_stackwalk to 0755 11:28:48 INFO - mkdir: /builds/slave/test/build/blobber_upload_dir 11:28:48 INFO - ENV: MOZ_UPLOAD_DIR is now /builds/slave/test/build/blobber_upload_dir 11:28:48 INFO - ENV: MINIDUMP_STACKWALK is now /builds/slave/test/build/linux64-minidump_stackwalk 11:28:48 INFO - ENV: MINIDUMP_SAVE_PATH is now /builds/slave/test/build/blobber_upload_dir 11:28:48 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--e10s', '--total-chunks', '5', '--this-chunk', '5', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/plain-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/plain-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--chunk-by-dir=4'] in /builds/slave/test/build 11:28:48 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python -u /builds/slave/test/build/tests/mochitest/runtests.py --e10s --total-chunks 5 --this-chunk 5 --appname=/builds/slave/test/build/application/firefox/firefox --utility-path=tests/bin --extra-profile-file=tests/bin/plugins --symbols-path=/builds/slave/test/build/symbols --certificate-path=tests/certs --setpref=webgl.force-enabled=true --quiet --log-raw=/builds/slave/test/build/blobber_upload_dir/plain-chunked_raw.log --log-errorsummary=/builds/slave/test/build/blobber_upload_dir/plain-chunked_errorsummary.log --use-test-media-devices --screenshot-on-fail --chunk-by-dir=4 11:28:48 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 11:28:48 INFO - 'CCACHE_UMASK': '002', 11:28:48 INFO - 'DISPLAY': ':0', 11:28:48 INFO - 'HOME': '/home/cltbld', 11:28:48 INFO - 'LANG': 'en_US.UTF-8', 11:28:48 INFO - 'LOGNAME': 'cltbld', 11:28:48 INFO - 'MAIL': '/var/mail/cltbld', 11:28:48 INFO - 'MINIDUMP_SAVE_PATH': '/builds/slave/test/build/blobber_upload_dir', 11:28:48 INFO - 'MINIDUMP_STACKWALK': '/builds/slave/test/build/linux64-minidump_stackwalk', 11:28:48 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 11:28:48 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 11:28:48 INFO - 'MOZ_NO_REMOTE': '1', 11:28:48 INFO - 'MOZ_UPLOAD_DIR': '/builds/slave/test/build/blobber_upload_dir', 11:28:48 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 11:28:48 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 11:28:48 INFO - 'PATH': '/builds/slave/test/build/venv/bin:/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 11:28:48 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 11:28:48 INFO - 'PWD': '/builds/slave/test', 11:28:48 INFO - 'SHELL': '/bin/bash', 11:28:48 INFO - 'SHLVL': '1', 11:28:48 INFO - 'TERM': 'linux', 11:28:48 INFO - 'TMOUT': '86400', 11:28:48 INFO - 'USER': 'cltbld', 11:28:48 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1451589390.127594-1057817053', 11:28:48 INFO - '_': '/tools/buildbot/bin/python'} 11:28:48 INFO - Calling ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--e10s', '--total-chunks', '5', '--this-chunk', '5', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/plain-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/plain-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--chunk-by-dir=4'] with output_timeout 1000 11:28:48 INFO - /builds/slave/test/build/venv/local/lib/python2.7/site-packages/mozrunner/utils.py:20: UserWarning: Module moznetwork was already imported from /builds/slave/test/build/tests/mochitest/moznetwork.py, but /builds/slave/test/build/venv/lib/python2.7/site-packages is being added to sys.path 11:28:48 INFO - import pkg_resources 11:28:48 INFO - Checking for orphan ssltunnel processes... 11:28:48 INFO - Checking for orphan xpcshell processes... 11:28:49 INFO - SUITE-START | Running 761 tests 11:28:49 INFO - TEST-START | gfx/tests/mochitest/test_bug513439.html 11:28:49 INFO - TEST-SKIP | gfx/tests/mochitest/test_bug513439.html | took 1ms 11:28:49 INFO - TEST-START | gfx/tests/mochitest/test_overdraw.html 11:28:49 INFO - TEST-SKIP | gfx/tests/mochitest/test_overdraw.html | took 1ms 11:28:49 INFO - TEST-START | image/test/mochitest/test_image_buffer_limit.html 11:28:49 INFO - TEST-SKIP | image/test/mochitest/test_image_buffer_limit.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug1120705.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug1120705.html | took 1ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug369950.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug369950.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug450930.xhtml 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug450930.xhtml | took 1ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug465448.xul 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug465448.xul | took 1ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug749186.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug749186.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_bug993936.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_bug993936.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_event_target_iframe_oop.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_event_target_iframe_oop.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_flush_on_paint.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_flush_on_paint.html | took 0ms 11:28:49 INFO - TEST-START | layout/base/tests/test_reftests_with_caret.html 11:28:49 INFO - TEST-SKIP | layout/base/tests/test_reftests_with_caret.html | took 0ms 11:28:49 INFO - TEST-START | layout/forms/test/test_bug345267.html 11:28:49 INFO - TEST-SKIP | layout/forms/test/test_bug345267.html | took 1ms 11:28:49 INFO - TEST-START | layout/forms/test/test_bug348236.html 11:28:49 INFO - TEST-SKIP | layout/forms/test/test_bug348236.html | took 0ms 11:28:49 INFO - TEST-START | layout/forms/test/test_bug903715.html 11:28:49 INFO - TEST-SKIP | layout/forms/test/test_bug903715.html | took 0ms 11:28:49 INFO - TEST-START | layout/forms/test/test_select_vertical.html 11:28:49 INFO - TEST-SKIP | layout/forms/test/test_select_vertical.html | took 1ms 11:28:49 INFO - TEST-START | layout/generic/test/test_bug421839-1.html 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_bug421839-1.html | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_bug448987.html 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_bug448987.html | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_bug488417.html 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_bug488417.html | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_bug507902.html 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_bug507902.html | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_movement_by_words.html 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_movement_by_words.html | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_plugin_clipping.xhtml 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_plugin_clipping.xhtml | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_plugin_clipping2.xhtml 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_plugin_clipping2.xhtml | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_plugin_clipping_table.xhtml 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_plugin_clipping_table.xhtml | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_plugin_clipping_transformed.xhtml 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_plugin_clipping_transformed.xhtml | took 0ms 11:28:49 INFO - TEST-START | layout/generic/test/test_plugin_position.xhtml 11:28:49 INFO - TEST-SKIP | layout/generic/test/test_plugin_position.xhtml | took 0ms 11:28:49 INFO - TEST-START | layout/style/test/test_bug401046.html 11:28:49 INFO - TEST-SKIP | layout/style/test/test_bug401046.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_origin_attributes_conversion.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_origin_attributes_conversion.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_rel_preconnect.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_rel_preconnect.html | took 1ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_signed_to_signed_web_packaged_app.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_signed_to_signed_web_packaged_app.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_signed_web_packaged_app.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_signed_web_packaged_app.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_signed_web_packaged_app_origin.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_signed_web_packaged_app_origin.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_user_agent_overrides.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_user_agent_overrides.html | took 0ms 11:28:49 INFO - TEST-START | netwerk/test/mochitests/test_user_agent_updates.html 11:28:49 INFO - TEST-SKIP | netwerk/test/mochitests/test_user_agent_updates.html | took 5ms 11:28:49 INFO - TEST-START | security/manager/ssl/tests/mochitest/mixedcontent/test_bug383369.html 11:28:49 INFO - TEST-SKIP | security/manager/ssl/tests/mochitest/mixedcontent/test_bug383369.html | took 0ms 11:28:49 INFO - TEST-START | security/manager/ssl/tests/mochitest/mixedcontent/test_unsecureRedirect.html 11:28:49 INFO - TEST-SKIP | security/manager/ssl/tests/mochitest/mixedcontent/test_unsecureRedirect.html | took 0ms 11:28:49 INFO - TEST-START | testing/mochitest/tests/Harness_sanity/test_TestsRunningAfterSimpleTestFinish.html 11:28:49 INFO - TEST-SKIP | testing/mochitest/tests/Harness_sanity/test_TestsRunningAfterSimpleTestFinish.html | took 0ms 11:28:49 INFO - TEST-START | testing/mochitest/tests/Harness_sanity/test_bug816847.html 11:28:49 INFO - TEST-SKIP | testing/mochitest/tests/Harness_sanity/test_bug816847.html | took 0ms 11:28:49 INFO - TEST-START | toolkit/components/extensions/test/mochitest/test_ext_cookies_permissions.html 11:28:49 INFO - TEST-SKIP | toolkit/components/extensions/test/mochitest/test_ext_cookies_permissions.html | took 0ms 11:28:49 INFO - TEST-START | toolkit/components/extensions/test/mochitest/test_ext_jsversion.html 11:28:49 INFO - TEST-SKIP | toolkit/components/extensions/test/mochitest/test_ext_jsversion.html | took 0ms 11:28:49 INFO - TEST-START | toolkit/mozapps/extensions/test/mochitest/test_bug687194.html 11:28:49 INFO - TEST-SKIP | toolkit/mozapps/extensions/test/mochitest/test_bug687194.html | took 1ms 11:28:49 INFO - TEST-START | uriloader/exthandler/tests/mochitest/test_handlerApps.xhtml 11:28:49 INFO - TEST-SKIP | uriloader/exthandler/tests/mochitest/test_handlerApps.xhtml | took 0ms 11:28:49 INFO - TEST-START | uriloader/exthandler/tests/mochitest/test_unsafeBidiChars.xhtml 11:28:49 INFO - TEST-SKIP | uriloader/exthandler/tests/mochitest/test_unsafeBidiChars.xhtml | took 0ms 11:28:49 INFO - dir: gfx/tests/mochitest 11:28:50 INFO - Setting pipeline to PAUSED ... 11:28:50 INFO - libv4l2: error getting pixformat: Invalid argument 11:28:50 INFO - Pipeline is PREROLLING ... 11:28:51 INFO - Pipeline is PREROLLED ... 11:28:51 INFO - Setting pipeline to PLAYING ... 11:28:51 INFO - New clock: GstSystemClock 11:28:51 INFO - Got EOS from element "pipeline0". 11:28:51 INFO - Execution ended after 32420601 ns. 11:28:51 INFO - Setting pipeline to PAUSED ... 11:28:51 INFO - Setting pipeline to READY ... 11:28:51 INFO - Setting pipeline to NULL ... 11:28:51 INFO - Freeing pipeline ... 11:28:51 INFO - 23 11:28:51 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:28:51 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpl5tu6U.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:28:51 INFO - runtests.py | Server pid: 1928 11:28:51 INFO - runtests.py | Websocket server pid: 1931 11:28:51 INFO - runtests.py | SSL tunnel pid: 1934 11:28:52 INFO - runtests.py | Running tests: start. 11:28:52 INFO - runtests.py | Application pid: 1956 11:28:52 INFO - TEST-INFO | started process Main app process 11:28:52 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpl5tu6U.mozrunner/runtests_leaks.log 11:28:56 INFO - ++DOCSHELL 0x7f5963781000 == 1 [pid = 1956] [id = 1] 11:28:56 INFO - ++DOMWINDOW == 1 (0x7f59637ab800) [pid = 1956] [serial = 1] [outer = (nil)] 11:28:56 INFO - [1956] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:28:56 INFO - ++DOMWINDOW == 2 (0x7f5962969800) [pid = 1956] [serial = 2] [outer = 0x7f59637ab800] 11:28:57 INFO - ++DOCSHELL 0x7f595de62800 == 2 [pid = 1956] [id = 2] 11:28:57 INFO - ++DOMWINDOW == 3 (0x7f595dd0d800) [pid = 1956] [serial = 3] [outer = (nil)] 11:28:57 INFO - ++DOMWINDOW == 4 (0x7f595dd0e400) [pid = 1956] [serial = 4] [outer = 0x7f595dd0d800] 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnptestjava.so returned 7f595ddc61f0 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnpsecondtest.so returned 7f595ddc65e0 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnptest.so returned 7f595ddc6910 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnpctrltest.so returned 7f595ddc6a00 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnpswftest.so returned 7f595ddc6d30 11:28:57 INFO - LoadPlugin() /tmp/tmpl5tu6U.mozrunner/plugins/libnpthirdtest.so returned 7f595cefd040 11:28:57 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f595cefd3a0 11:28:57 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f595ceff5b0 11:28:57 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f595ddf4700 11:28:57 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f595ddf4a00 11:28:57 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f595ddf4d30 11:28:57 INFO - ++DOMWINDOW == 5 (0x7f595ce69c00) [pid = 1956] [serial = 5] [outer = 0x7f59637ab800] 11:28:58 INFO - [1956] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:29:00 INFO - ++DOCSHELL 0x7f5952e38000 == 3 [pid = 1956] [id = 3] 11:29:00 INFO - ++DOMWINDOW == 6 (0x7f5952fae800) [pid = 1956] [serial = 6] [outer = (nil)] 11:29:00 INFO - ++DOCSHELL 0x7f5952e3c800 == 4 [pid = 1956] [id = 4] 11:29:00 INFO - ++DOMWINDOW == 7 (0x7f5952faf000) [pid = 1956] [serial = 7] [outer = (nil)] 11:29:00 INFO - [1956] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:29:01 INFO - ++DOCSHELL 0x7f5951140800 == 5 [pid = 1956] [id = 5] 11:29:01 INFO - ++DOMWINDOW == 8 (0x7f5951da6800) [pid = 1956] [serial = 8] [outer = (nil)] 11:29:01 INFO - [1956] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:29:01 INFO - ++DOMWINDOW == 9 (0x7f595100a000) [pid = 1956] [serial = 9] [outer = 0x7f5951da6800] 11:29:01 INFO - ++DOMWINDOW == 10 (0x7f5950edc000) [pid = 1956] [serial = 10] [outer = 0x7f5952fae800] 11:29:01 INFO - ++DOMWINDOW == 11 (0x7f5950edc800) [pid = 1956] [serial = 11] [outer = 0x7f5952faf000] 11:29:01 INFO - ++DOMWINDOW == 12 (0x7f5950ede400) [pid = 1956] [serial = 12] [outer = 0x7f5951da6800] 11:29:03 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpl5tu6U.mozrunner/runtests_leaks_tab_pid2012.log 11:29:04 INFO - [Child 2012] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:29:05 INFO - ++DOCSHELL 0x7f48dae2e800 == 1 [pid = 2012] [id = 1] 11:29:05 INFO - ++DOMWINDOW == 1 (0x7f48dae7b000) [pid = 2012] [serial = 1] [outer = (nil)] 11:29:05 INFO - ++DOMWINDOW == 2 (0x7f48da017000) [pid = 2012] [serial = 2] [outer = 0x7f48dae7b000] 11:29:05 INFO - [Parent 1956] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:29:06 INFO - [Parent 1956] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:29:06 INFO - ++DOMWINDOW == 3 (0x7f48d9dd6400) [pid = 2012] [serial = 3] [outer = 0x7f48dae7b000] 11:29:07 INFO - ++DOCSHELL 0x7f59510b8800 == 6 [pid = 1956] [id = 6] 11:29:07 INFO - ++DOMWINDOW == 13 (0x7f595328f800) [pid = 1956] [serial = 13] [outer = (nil)] 11:29:07 INFO - ++DOMWINDOW == 14 (0x7f595369bc00) [pid = 1956] [serial = 14] [outer = 0x7f595328f800] 11:29:08 INFO - ++DOMWINDOW == 15 (0x7f59507f0c00) [pid = 1956] [serial = 15] [outer = 0x7f595328f800] 11:29:08 INFO - ++DOCSHELL 0x7f595114a000 == 7 [pid = 1956] [id = 7] 11:29:08 INFO - ++DOMWINDOW == 16 (0x7f595219b400) [pid = 1956] [serial = 16] [outer = (nil)] 11:29:08 INFO - ++DOMWINDOW == 17 (0x7f595dd15000) [pid = 1956] [serial = 17] [outer = 0x7f595219b400] 11:29:08 INFO - [Child 2012] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:29:08 INFO - [Child 2012] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:29:08 INFO - ++DOCSHELL 0x7f48d92a1000 == 2 [pid = 2012] [id = 2] 11:29:08 INFO - ++DOMWINDOW == 4 (0x7f48d9291800) [pid = 2012] [serial = 4] [outer = (nil)] 11:29:08 INFO - ++DOMWINDOW == 5 (0x7f48d9292400) [pid = 2012] [serial = 5] [outer = 0x7f48d9291800] 11:29:09 INFO - 0 INFO SimpleTest START 11:29:09 INFO - 1 INFO TEST-START | gfx/tests/mochitest/test_acceleration.html 11:29:09 INFO - [Child 2012] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:29:09 INFO - ++DOMWINDOW == 6 (0x7f48d887c400) [pid = 2012] [serial = 6] [outer = 0x7f48d9291800] 11:29:09 INFO - [Parent 1956] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:29:10 INFO - ++DOMWINDOW == 7 (0x7f48d878c000) [pid = 2012] [serial = 7] [outer = 0x7f48d9291800] 11:29:11 INFO - --DOCSHELL 0x7f5951140800 == 6 [pid = 1956] [id = 5] 11:29:11 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:29:11 INFO - MEMORY STAT | vsize 507MB | residentFast 87MB | heapAllocated 18MB 11:29:11 INFO - 2 INFO TEST-OK | gfx/tests/mochitest/test_acceleration.html | took 2652ms 11:29:11 INFO - ++DOMWINDOW == 8 (0x7f48d87e4800) [pid = 2012] [serial = 8] [outer = 0x7f48d9291800] 11:29:12 INFO - 3 INFO TEST-START | gfx/tests/mochitest/test_bug509244.html 11:29:12 INFO - ++DOMWINDOW == 9 (0x7f48d87e5000) [pid = 2012] [serial = 9] [outer = 0x7f48d9291800] 11:29:13 INFO - --DOMWINDOW == 8 (0x7f48da017000) [pid = 2012] [serial = 2] [outer = (nil)] [url = about:blank] 11:29:13 INFO - --DOMWINDOW == 7 (0x7f48d9292400) [pid = 2012] [serial = 5] [outer = (nil)] [url = about:blank] 11:29:13 INFO - --DOMWINDOW == 6 (0x7f48d887c400) [pid = 2012] [serial = 6] [outer = (nil)] [url = about:blank] 11:29:13 INFO - --DOMWINDOW == 5 (0x7f48d87e4800) [pid = 2012] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:13 INFO - MEMORY STAT | vsize 507MB | residentFast 89MB | heapAllocated 15MB 11:29:13 INFO - 4 INFO TEST-OK | gfx/tests/mochitest/test_bug509244.html | took 1148ms 11:29:13 INFO - ++DOMWINDOW == 6 (0x7f48d8440c00) [pid = 2012] [serial = 10] [outer = 0x7f48d9291800] 11:29:13 INFO - ++DOMWINDOW == 7 (0x7f48d87e5c00) [pid = 2012] [serial = 11] [outer = 0x7f48d9291800] 11:29:13 INFO - --DOCSHELL 0x7f59510b8800 == 5 [pid = 1956] [id = 6] 11:29:13 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:29:14 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:29:14 INFO - --DOCSHELL 0x7f5963781000 == 4 [pid = 1956] [id = 1] 11:29:14 INFO - --DOCSHELL 0x7f595114a000 == 3 [pid = 1956] [id = 7] 11:29:14 INFO - --DOCSHELL 0x7f595de62800 == 2 [pid = 1956] [id = 2] 11:29:14 INFO - --DOCSHELL 0x7f5952e38000 == 1 [pid = 1956] [id = 3] 11:29:14 INFO - --DOCSHELL 0x7f5952e3c800 == 0 [pid = 1956] [id = 4] 11:29:14 INFO - [Child 2012] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:29:15 INFO - --DOCSHELL 0x7f48dae2e800 == 1 [pid = 2012] [id = 1] 11:29:15 INFO - ]: --DOCSHELL 0x7f48d92a1000 == 0 [pid = 2012] [id = 2] 11:29:15 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:29:15 INFO - --DOMWINDOW == 6 (0x7f48d878c000) [pid = 2012] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/gfx/tests/mochitest/test_acceleration.html] 11:29:15 INFO - --DOMWINDOW == 5 (0x7f48d9dd6400) [pid = 2012] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:29:15 INFO - --DOMWINDOW == 4 (0x7f48d8440c00) [pid = 2012] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:15 INFO - --DOMWINDOW == 3 (0x7f48d87e5c00) [pid = 2012] [serial = 11] [outer = (nil)] [url = about:blank] 11:29:15 INFO - --DOMWINDOW == 2 (0x7f48d87e5000) [pid = 2012] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/gfx/tests/mochitest/test_bug509244.html] 11:29:15 INFO - --DOMWINDOW == 1 (0x7f48dae7b000) [pid = 2012] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:29:15 INFO - --DOMWINDOW == 0 (0x7f48d9291800) [pid = 2012] [serial = 4] [outer = (nil)] [url = about:blank] 11:29:15 INFO - nsStringStats 11:29:15 INFO - => mAllocCount: 23037 11:29:15 INFO - => mReallocCount: 873 11:29:15 INFO - => mFreeCount: 23037 11:29:15 INFO - => mShareCount: 16288 11:29:15 INFO - => mAdoptCount: 1459 11:29:15 INFO - => mAdoptFreeCount: 1459 11:29:15 INFO - => Process ID: 2012, Thread ID: 139951379860032 11:29:15 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:29:15 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:29:15 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:29:16 INFO - [Parent 1956] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:29:16 INFO - [Parent 1956] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:29:17 INFO - --DOMWINDOW == 16 (0x7f5950edc800) [pid = 1956] [serial = 11] [outer = 0x7f5952faf000] [url = about:blank] 11:29:17 INFO - --DOMWINDOW == 15 (0x7f5950edc000) [pid = 1956] [serial = 10] [outer = 0x7f5952fae800] [url = about:blank] 11:29:17 INFO - --DOMWINDOW == 14 (0x7f5952faf000) [pid = 1956] [serial = 7] [outer = (nil)] [url = about:blank] 11:29:17 INFO - --DOMWINDOW == 13 (0x7f5952fae800) [pid = 1956] [serial = 6] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 12 (0x7f595dd0e400) [pid = 1956] [serial = 4] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 11 (0x7f595219b400) [pid = 1956] [serial = 16] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 10 (0x7f59507f0c00) [pid = 1956] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:29:18 INFO - --DOMWINDOW == 9 (0x7f595dd0d800) [pid = 1956] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:29:18 INFO - --DOMWINDOW == 8 (0x7f5962969800) [pid = 1956] [serial = 2] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 7 (0x7f59637ab800) [pid = 1956] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:29:18 INFO - --DOMWINDOW == 6 (0x7f595369bc00) [pid = 1956] [serial = 14] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 5 (0x7f595328f800) [pid = 1956] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:29:18 INFO - --DOMWINDOW == 4 (0x7f595dd15000) [pid = 1956] [serial = 17] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 3 (0x7f5950ede400) [pid = 1956] [serial = 12] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 2 (0x7f595100a000) [pid = 1956] [serial = 9] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 1 (0x7f5951da6800) [pid = 1956] [serial = 8] [outer = (nil)] [url = about:blank] 11:29:18 INFO - --DOMWINDOW == 0 (0x7f595ce69c00) [pid = 1956] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:29:18 INFO - nsStringStats 11:29:18 INFO - => mAllocCount: 81253 11:29:18 INFO - => mReallocCount: 8762 11:29:18 INFO - => mFreeCount: 81253 11:29:18 INFO - => mShareCount: 83724 11:29:18 INFO - => mAdoptCount: 3517 11:29:18 INFO - => mAdoptFreeCount: 3517 11:29:18 INFO - => Process ID: 1956, Thread ID: 140022480500544 11:29:18 INFO - TEST-INFO | Main app process: exit 0 11:29:18 INFO - runtests.py | Application ran for: 0:00:25.973374 11:29:18 INFO - zombiecheck | Reading PID log: /tmp/tmp9bStuUpidlog 11:29:18 INFO - ==> process 1956 launched child process 2012 11:29:18 INFO - zombiecheck | Checking for orphan process with PID: 2012 11:29:18 INFO - Stopping web server 11:29:18 INFO - Stopping web socket server 11:29:18 INFO - Stopping ssltunnel 11:29:18 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:29:18 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:29:18 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:29:18 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1956 11:29:18 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:29:18 INFO - | | Per-Inst Leaked| Total Rem| 11:29:18 INFO - 0 |TOTAL | 30 0| 1202334 0| 11:29:18 INFO - nsTraceRefcnt::DumpStatistics: 1314 entries 11:29:18 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:29:18 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2012 11:29:18 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:29:18 INFO - | | Per-Inst Leaked| Total Rem| 11:29:18 INFO - 0 |TOTAL | 31 4640| 181252 33| 11:29:18 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 3 1| 11:29:18 INFO - 45 |CompositorChild | 880 880| 1 1| 11:29:18 INFO - 47 |CondVar | 40 120| 28 3| 11:29:18 INFO - 134 |IPC::Channel | 16 32| 7 2| 11:29:18 INFO - 158 |MessagePump | 16 16| 10 1| 11:29:18 INFO - 161 |Mutex | 32 96| 144 3| 11:29:18 INFO - 172 |PCompositorChild | 776 776| 1 1| 11:29:18 INFO - 178 |PImageBridgeChild | 920 920| 1 1| 11:29:18 INFO - 227 |RefCountedMonitor | 80 160| 6 2| 11:29:18 INFO - 228 |RefCountedTask | 16 64| 12 4| 11:29:18 INFO - 260 |StoreRef | 16 32| 7 2| 11:29:18 INFO - 296 |WaitableEventKernel | 72 72| 13 1| 11:29:18 INFO - 301 |WeakReference | 16 32| 63 2| 11:29:18 INFO - 327 |base::Thread | 48 48| 3 1| 11:29:18 INFO - 350 |ipc::MessageChannel | 512 1024| 6 2| 11:29:18 INFO - 682 |nsTArray_base | 8 40| 46898 5| 11:29:18 INFO - 686 |nsThread | 256 256| 9 1| 11:29:18 INFO - nsTraceRefcnt::DumpStatistics: 748 entries 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:29:18 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:29:18 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:29:18 INFO - runtests.py | Running tests: end. 11:29:18 INFO - 5 INFO TEST-START | Shutdown 11:29:18 INFO - 6 INFO Passed: 2 11:29:18 INFO - 7 INFO Failed: 0 11:29:18 INFO - 8 INFO Todo: 0 11:29:18 INFO - 9 INFO Slowest: 2652ms - /tests/gfx/tests/mochitest/test_acceleration.html 11:29:18 INFO - 10 INFO SimpleTest FINISHED 11:29:18 INFO - 11 INFO TEST-INFO | Ran 1 Loops 11:29:18 INFO - 12 INFO SimpleTest FINISHED 11:29:18 INFO - dir: image/test/mochitest 11:29:18 INFO - Setting pipeline to PAUSED ... 11:29:18 INFO - Pipeline is PREROLLING ... 11:29:18 INFO - Pipeline is PREROLLED ... 11:29:18 INFO - Setting pipeline to PLAYING ... 11:29:18 INFO - New clock: GstSystemClock 11:29:18 INFO - Got EOS from element "pipeline0". 11:29:18 INFO - Execution ended after 32850649 ns. 11:29:18 INFO - Setting pipeline to PAUSED ... 11:29:18 INFO - Setting pipeline to READY ... 11:29:18 INFO - Setting pipeline to NULL ... 11:29:18 INFO - Freeing pipeline ... 11:29:19 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:29:19 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpFHSw8i.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:29:19 INFO - runtests.py | Server pid: 2069 11:29:19 INFO - runtests.py | Websocket server pid: 2072 11:29:19 INFO - runtests.py | SSL tunnel pid: 2075 11:29:19 INFO - runtests.py | Running tests: start. 11:29:19 INFO - runtests.py | Application pid: 2097 11:29:19 INFO - TEST-INFO | started process Main app process 11:29:20 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpFHSw8i.mozrunner/runtests_leaks.log 11:29:23 INFO - ++DOCSHELL 0x7fe2a9c81000 == 1 [pid = 2097] [id = 1] 11:29:23 INFO - ++DOMWINDOW == 1 (0x7fe2a9cab800) [pid = 2097] [serial = 1] [outer = (nil)] 11:29:23 INFO - [2097] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:29:23 INFO - ++DOMWINDOW == 2 (0x7fe2a8e69800) [pid = 2097] [serial = 2] [outer = 0x7fe2a9cab800] 11:29:24 INFO - ++DOCSHELL 0x7fe2a435e800 == 2 [pid = 2097] [id = 2] 11:29:24 INFO - ++DOMWINDOW == 3 (0x7fe2a420cc00) [pid = 2097] [serial = 3] [outer = (nil)] 11:29:24 INFO - ++DOMWINDOW == 4 (0x7fe2a420d800) [pid = 2097] [serial = 4] [outer = 0x7fe2a420cc00] 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnptestjava.so returned 7fe2a42c61c0 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnpsecondtest.so returned 7fe2a42c65b0 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnptest.so returned 7fe2a42c68e0 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnpctrltest.so returned 7fe2a42c69d0 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnpswftest.so returned 7fe2a42c6d00 11:29:24 INFO - LoadPlugin() /tmp/tmpFHSw8i.mozrunner/plugins/libnpthirdtest.so returned 7fe2cb2ddbb0 11:29:24 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7fe2a42fc370 11:29:24 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7fe2aa202580 11:29:24 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7fe2aa2066d0 11:29:24 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7fe2aa2069d0 11:29:24 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7fe2aa206d00 11:29:24 INFO - ++DOMWINDOW == 5 (0x7fe2a2c6e000) [pid = 2097] [serial = 5] [outer = 0x7fe2a9cab800] 11:29:26 INFO - [2097] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:29:27 INFO - ++DOCSHELL 0x7fe299a27800 == 3 [pid = 2097] [id = 3] 11:29:27 INFO - ++DOMWINDOW == 6 (0x7fe299bbbc00) [pid = 2097] [serial = 6] [outer = (nil)] 11:29:27 INFO - ++DOCSHELL 0x7fe299a29800 == 4 [pid = 2097] [id = 4] 11:29:27 INFO - ++DOMWINDOW == 7 (0x7fe299bbc400) [pid = 2097] [serial = 7] [outer = (nil)] 11:29:28 INFO - [2097] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:29:28 INFO - ++DOCSHELL 0x7fe297d23800 == 5 [pid = 2097] [id = 5] 11:29:28 INFO - ++DOMWINDOW == 8 (0x7fe297e92000) [pid = 2097] [serial = 8] [outer = (nil)] 11:29:28 INFO - [2097] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:29:28 INFO - ++DOMWINDOW == 9 (0x7fe297df4c00) [pid = 2097] [serial = 9] [outer = 0x7fe297e92000] 11:29:28 INFO - ++DOMWINDOW == 10 (0x7fe297729800) [pid = 2097] [serial = 10] [outer = 0x7fe299bbbc00] 11:29:28 INFO - ++DOMWINDOW == 11 (0x7fe29772a000) [pid = 2097] [serial = 11] [outer = 0x7fe299bbc400] 11:29:28 INFO - ++DOMWINDOW == 12 (0x7fe29772bc00) [pid = 2097] [serial = 12] [outer = 0x7fe297e92000] 11:29:30 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpFHSw8i.mozrunner/runtests_leaks_tab_pid2151.log 11:29:31 INFO - [Child 2151] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:29:32 INFO - ++DOCSHELL 0x7fe80422e800 == 1 [pid = 2151] [id = 1] 11:29:32 INFO - ++DOMWINDOW == 1 (0x7fe80427b000) [pid = 2151] [serial = 1] [outer = (nil)] 11:29:33 INFO - ++DOMWINDOW == 2 (0x7fe803417000) [pid = 2151] [serial = 2] [outer = 0x7fe80427b000] 11:29:33 INFO - [Parent 2097] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:29:33 INFO - [Parent 2097] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:29:34 INFO - ++DOMWINDOW == 3 (0x7fe8031d6400) [pid = 2151] [serial = 3] [outer = 0x7fe80427b000] 11:29:35 INFO - ++DOCSHELL 0x7fe297c94000 == 6 [pid = 2097] [id = 6] 11:29:35 INFO - ++DOMWINDOW == 13 (0x7fe298b21c00) [pid = 2097] [serial = 13] [outer = (nil)] 11:29:35 INFO - ++DOMWINDOW == 14 (0x7fe297d85800) [pid = 2097] [serial = 14] [outer = 0x7fe298b21c00] 11:29:35 INFO - ++DOMWINDOW == 15 (0x7fe2973c0000) [pid = 2097] [serial = 15] [outer = 0x7fe298b21c00] 11:29:35 INFO - ++DOCSHELL 0x7fe297d2d000 == 7 [pid = 2097] [id = 7] 11:29:35 INFO - ++DOMWINDOW == 16 (0x7fe297d87800) [pid = 2097] [serial = 16] [outer = (nil)] 11:29:35 INFO - ++DOMWINDOW == 17 (0x7fe299ef2000) [pid = 2097] [serial = 17] [outer = 0x7fe297d87800] 11:29:35 INFO - [Child 2151] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:29:35 INFO - [Child 2151] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:29:35 INFO - ++DOCSHELL 0x7fe8026a1800 == 2 [pid = 2151] [id = 2] 11:29:35 INFO - ++DOMWINDOW == 4 (0x7fe802691800) [pid = 2151] [serial = 4] [outer = (nil)] 11:29:35 INFO - ++DOMWINDOW == 5 (0x7fe8031d4800) [pid = 2151] [serial = 5] [outer = 0x7fe802691800] 11:29:36 INFO - 13 INFO TEST-START | image/test/mochitest/test_ImageContentLoaded.html 11:29:36 INFO - [Child 2151] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:29:36 INFO - ++DOMWINDOW == 6 (0x7fe801cf9000) [pid = 2151] [serial = 6] [outer = 0x7fe802691800] 11:29:36 INFO - [Parent 2097] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:29:38 INFO - ++DOMWINDOW == 7 (0x7fe801b92400) [pid = 2151] [serial = 7] [outer = 0x7fe802691800] 11:29:38 INFO - --DOCSHELL 0x7fe297d23800 == 6 [pid = 2097] [id = 5] 11:29:38 INFO - ++DOCSHELL 0x7fe801b7b800 == 3 [pid = 2151] [id = 3] 11:29:38 INFO - ++DOMWINDOW == 8 (0x7fe803418400) [pid = 2151] [serial = 8] [outer = (nil)] 11:29:38 INFO - ++DOMWINDOW == 9 (0x7fe8031d3c00) [pid = 2151] [serial = 9] [outer = 0x7fe803418400] 11:29:39 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:29:39 INFO - MEMORY STAT | vsize 507MB | residentFast 88MB | heapAllocated 18MB 11:29:39 INFO - 14 INFO TEST-OK | image/test/mochitest/test_ImageContentLoaded.html | took 2897ms 11:29:39 INFO - ++DOMWINDOW == 10 (0x7fe804275800) [pid = 2151] [serial = 10] [outer = 0x7fe802691800] 11:29:39 INFO - 15 INFO TEST-START | image/test/mochitest/test_animation_operators.html 11:29:39 INFO - ++DOMWINDOW == 11 (0x7fe801859800) [pid = 2151] [serial = 11] [outer = 0x7fe802691800] 11:29:40 INFO - ++DOCSHELL 0x7fe801bf4800 == 4 [pid = 2151] [id = 4] 11:29:40 INFO - ++DOMWINDOW == 12 (0x7fe80185c400) [pid = 2151] [serial = 12] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8026ba000 == 5 [pid = 2151] [id = 5] 11:29:40 INFO - ++DOMWINDOW == 13 (0x7fe801860000) [pid = 2151] [serial = 13] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe803198000 == 6 [pid = 2151] [id = 6] 11:29:40 INFO - ++DOMWINDOW == 14 (0x7fe801860c00) [pid = 2151] [serial = 14] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe805f9e000 == 7 [pid = 2151] [id = 7] 11:29:40 INFO - ++DOMWINDOW == 15 (0x7fe801861c00) [pid = 2151] [serial = 15] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018a5800 == 8 [pid = 2151] [id = 8] 11:29:40 INFO - ++DOMWINDOW == 16 (0x7fe801862400) [pid = 2151] [serial = 16] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018a6800 == 9 [pid = 2151] [id = 9] 11:29:40 INFO - ++DOMWINDOW == 17 (0x7fe801863000) [pid = 2151] [serial = 17] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018a7800 == 10 [pid = 2151] [id = 10] 11:29:40 INFO - ++DOMWINDOW == 18 (0x7fe801863800) [pid = 2151] [serial = 18] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018a9000 == 11 [pid = 2151] [id = 11] 11:29:40 INFO - ++DOMWINDOW == 19 (0x7fe801864000) [pid = 2151] [serial = 19] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018aa000 == 12 [pid = 2151] [id = 12] 11:29:40 INFO - ++DOMWINDOW == 20 (0x7fe801864800) [pid = 2151] [serial = 20] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018ab000 == 13 [pid = 2151] [id = 13] 11:29:40 INFO - ++DOMWINDOW == 21 (0x7fe801865000) [pid = 2151] [serial = 21] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018ac000 == 14 [pid = 2151] [id = 14] 11:29:40 INFO - ++DOMWINDOW == 22 (0x7fe801865c00) [pid = 2151] [serial = 22] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018ad000 == 15 [pid = 2151] [id = 15] 11:29:40 INFO - ++DOMWINDOW == 23 (0x7fe801866800) [pid = 2151] [serial = 23] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018ae000 == 16 [pid = 2151] [id = 16] 11:29:40 INFO - ++DOMWINDOW == 24 (0x7fe801867000) [pid = 2151] [serial = 24] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018af000 == 17 [pid = 2151] [id = 17] 11:29:40 INFO - ++DOMWINDOW == 25 (0x7fe801867800) [pid = 2151] [serial = 25] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b0800 == 18 [pid = 2151] [id = 18] 11:29:40 INFO - ++DOMWINDOW == 26 (0x7fe801867c00) [pid = 2151] [serial = 26] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b1800 == 19 [pid = 2151] [id = 19] 11:29:40 INFO - ++DOMWINDOW == 27 (0x7fe801ced800) [pid = 2151] [serial = 27] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b2800 == 20 [pid = 2151] [id = 20] 11:29:40 INFO - ++DOMWINDOW == 28 (0x7fe803151400) [pid = 2151] [serial = 28] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b3800 == 21 [pid = 2151] [id = 21] 11:29:40 INFO - ++DOMWINDOW == 29 (0x7fe801862c00) [pid = 2151] [serial = 29] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b5800 == 22 [pid = 2151] [id = 22] 11:29:40 INFO - ++DOMWINDOW == 30 (0x7fe80185ac00) [pid = 2151] [serial = 30] [outer = (nil)] 11:29:40 INFO - ++DOCSHELL 0x7fe8018b6800 == 23 [pid = 2151] [id = 23] 11:29:40 INFO - ++DOMWINDOW == 31 (0x7fe804275c00) [pid = 2151] [serial = 31] [outer = (nil)] 11:29:40 INFO - ++DOMWINDOW == 32 (0x7fe801625400) [pid = 2151] [serial = 32] [outer = 0x7fe80185c400] 11:29:40 INFO - ++DOMWINDOW == 33 (0x7fe801625c00) [pid = 2151] [serial = 33] [outer = 0x7fe801860000] 11:29:40 INFO - ++DOMWINDOW == 34 (0x7fe801627400) [pid = 2151] [serial = 34] [outer = 0x7fe801860c00] 11:29:40 INFO - ++DOMWINDOW == 35 (0x7fe801629800) [pid = 2151] [serial = 35] [outer = 0x7fe801861c00] 11:29:40 INFO - ++DOMWINDOW == 36 (0x7fe80162ac00) [pid = 2151] [serial = 36] [outer = 0x7fe801862400] 11:29:40 INFO - ++DOMWINDOW == 37 (0x7fe80162b400) [pid = 2151] [serial = 37] [outer = 0x7fe801863000] 11:29:40 INFO - ++DOMWINDOW == 38 (0x7fe80162c000) [pid = 2151] [serial = 38] [outer = 0x7fe801863800] 11:29:40 INFO - ++DOMWINDOW == 39 (0x7fe80162cc00) [pid = 2151] [serial = 39] [outer = 0x7fe801864000] 11:29:40 INFO - ++DOMWINDOW == 40 (0x7fe80162d800) [pid = 2151] [serial = 40] [outer = 0x7fe801864800] 11:29:40 INFO - ++DOMWINDOW == 41 (0x7fe80162e800) [pid = 2151] [serial = 41] [outer = 0x7fe801865000] 11:29:40 INFO - ++DOMWINDOW == 42 (0x7fe80162f400) [pid = 2151] [serial = 42] [outer = 0x7fe801865c00] 11:29:40 INFO - ++DOMWINDOW == 43 (0x7fe801630000) [pid = 2151] [serial = 43] [outer = 0x7fe801866800] 11:29:40 INFO - ++DOMWINDOW == 44 (0x7fe80185d400) [pid = 2151] [serial = 44] [outer = 0x7fe801867000] 11:29:40 INFO - ++DOMWINDOW == 45 (0x7fe801b92c00) [pid = 2151] [serial = 45] [outer = 0x7fe801867800] 11:29:40 INFO - ++DOMWINDOW == 46 (0x7fe801421800) [pid = 2151] [serial = 46] [outer = 0x7fe801867c00] 11:29:40 INFO - ++DOMWINDOW == 47 (0x7fe801422400) [pid = 2151] [serial = 47] [outer = 0x7fe801ced800] 11:29:40 INFO - ++DOMWINDOW == 48 (0x7fe801423800) [pid = 2151] [serial = 48] [outer = 0x7fe803151400] 11:29:40 INFO - ++DOMWINDOW == 49 (0x7fe801424400) [pid = 2151] [serial = 49] [outer = 0x7fe801862c00] 11:29:40 INFO - ++DOMWINDOW == 50 (0x7fe801425000) [pid = 2151] [serial = 50] [outer = 0x7fe80185ac00] 11:29:40 INFO - ++DOMWINDOW == 51 (0x7fe801425c00) [pid = 2151] [serial = 51] [outer = 0x7fe804275c00] 11:29:40 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:41 INFO - JavaScript error: , line 0: TypeError: can't access dead object 11:29:42 INFO - MEMORY STAT | vsize 520MB | residentFast 101MB | heapAllocated 26MB 11:29:42 INFO - 16 INFO TEST-OK | image/test/mochitest/test_animation_operators.html | took 3208ms 11:29:42 INFO - ++DOMWINDOW == 52 (0x7fe800eb5400) [pid = 2151] [serial = 52] [outer = 0x7fe802691800] 11:29:42 INFO - 17 INFO TEST-START | image/test/mochitest/test_bug1180105.html 11:29:43 INFO - ++DOMWINDOW == 53 (0x7fe800eb5800) [pid = 2151] [serial = 53] [outer = 0x7fe802691800] 11:29:44 INFO - --DOCSHELL 0x7fe801b7b800 == 22 [pid = 2151] [id = 3] 11:29:45 INFO - ++DOCSHELL 0x7fe800ecf800 == 23 [pid = 2151] [id = 24] 11:29:45 INFO - ++DOMWINDOW == 54 (0x7fe801429800) [pid = 2151] [serial = 54] [outer = (nil)] 11:29:45 INFO - ++DOMWINDOW == 55 (0x7fe80142ac00) [pid = 2151] [serial = 55] [outer = 0x7fe801429800] 11:29:45 INFO - --DOCSHELL 0x7fe801bf4800 == 22 [pid = 2151] [id = 4] 11:29:45 INFO - --DOCSHELL 0x7fe8026ba000 == 21 [pid = 2151] [id = 5] 11:29:45 INFO - --DOCSHELL 0x7fe803198000 == 20 [pid = 2151] [id = 6] 11:29:45 INFO - --DOCSHELL 0x7fe805f9e000 == 19 [pid = 2151] [id = 7] 11:29:45 INFO - --DOCSHELL 0x7fe8018a5800 == 18 [pid = 2151] [id = 8] 11:29:45 INFO - --DOCSHELL 0x7fe8018a6800 == 17 [pid = 2151] [id = 9] 11:29:45 INFO - --DOCSHELL 0x7fe8018a7800 == 16 [pid = 2151] [id = 10] 11:29:45 INFO - --DOCSHELL 0x7fe8018a9000 == 15 [pid = 2151] [id = 11] 11:29:45 INFO - --DOCSHELL 0x7fe8018aa000 == 14 [pid = 2151] [id = 12] 11:29:45 INFO - --DOCSHELL 0x7fe8018ab000 == 13 [pid = 2151] [id = 13] 11:29:45 INFO - --DOCSHELL 0x7fe8018ac000 == 12 [pid = 2151] [id = 14] 11:29:45 INFO - --DOCSHELL 0x7fe8018ad000 == 11 [pid = 2151] [id = 15] 11:29:45 INFO - --DOCSHELL 0x7fe8018ae000 == 10 [pid = 2151] [id = 16] 11:29:45 INFO - --DOCSHELL 0x7fe8018af000 == 9 [pid = 2151] [id = 17] 11:29:45 INFO - --DOCSHELL 0x7fe8018b0800 == 8 [pid = 2151] [id = 18] 11:29:45 INFO - --DOCSHELL 0x7fe8018b1800 == 7 [pid = 2151] [id = 19] 11:29:45 INFO - --DOCSHELL 0x7fe8018b2800 == 6 [pid = 2151] [id = 20] 11:29:45 INFO - --DOCSHELL 0x7fe8018b3800 == 5 [pid = 2151] [id = 21] 11:29:45 INFO - --DOCSHELL 0x7fe8018b5800 == 4 [pid = 2151] [id = 22] 11:29:45 INFO - --DOCSHELL 0x7fe8018b6800 == 3 [pid = 2151] [id = 23] 11:29:45 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:45 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:45 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:45 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:45 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:46 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:47 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:29:47 INFO - ++DOMWINDOW == 56 (0x7fe801388400) [pid = 2151] [serial = 56] [outer = 0x7fe801429800] 11:29:47 INFO - MEMORY STAT | vsize 521MB | residentFast 103MB | heapAllocated 21MB 11:29:47 INFO - 18 INFO TEST-OK | image/test/mochitest/test_bug1180105.html | took 4254ms 11:29:47 INFO - ++DOMWINDOW == 57 (0x7fe801393000) [pid = 2151] [serial = 57] [outer = 0x7fe802691800] 11:29:47 INFO - 19 INFO TEST-START | image/test/mochitest/test_bug1217571.html 11:29:47 INFO - ++DOMWINDOW == 58 (0x7fe800f3e400) [pid = 2151] [serial = 58] [outer = 0x7fe802691800] 11:29:47 INFO - ++DOCSHELL 0x7fe80146c000 == 4 [pid = 2151] [id = 25] 11:29:47 INFO - ++DOMWINDOW == 59 (0x7fe80142b400) [pid = 2151] [serial = 59] [outer = (nil)] 11:29:47 INFO - ++DOCSHELL 0x7fe8018b3800 == 5 [pid = 2151] [id = 26] 11:29:47 INFO - ++DOMWINDOW == 60 (0x7fe80142dc00) [pid = 2151] [serial = 60] [outer = (nil)] 11:29:47 INFO - ++DOMWINDOW == 61 (0x7fe80142fc00) [pid = 2151] [serial = 61] [outer = 0x7fe80142b400] 11:29:47 INFO - ++DOMWINDOW == 62 (0x7fe801627800) [pid = 2151] [serial = 62] [outer = 0x7fe80142dc00] 11:29:48 INFO - MEMORY STAT | vsize 521MB | residentFast 103MB | heapAllocated 23MB 11:29:48 INFO - 20 INFO TEST-OK | image/test/mochitest/test_bug1217571.html | took 1177ms 11:29:48 INFO - ++DOMWINDOW == 63 (0x7fe801858400) [pid = 2151] [serial = 63] [outer = 0x7fe802691800] 11:29:48 INFO - 21 INFO TEST-START | image/test/mochitest/test_bug399925.html 11:29:48 INFO - ++DOMWINDOW == 64 (0x7fe80138b000) [pid = 2151] [serial = 64] [outer = 0x7fe802691800] 11:29:51 INFO - --DOMWINDOW == 63 (0x7fe803417000) [pid = 2151] [serial = 2] [outer = (nil)] [url = about:blank] 11:29:51 INFO - --DOMWINDOW == 62 (0x7fe8031d4800) [pid = 2151] [serial = 5] [outer = (nil)] [url = about:blank] 11:29:51 INFO - --DOMWINDOW == 61 (0x7fe801cf9000) [pid = 2151] [serial = 6] [outer = (nil)] [url = about:blank] 11:29:51 INFO - --DOMWINDOW == 60 (0x7fe80185c400) [pid = 2151] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green-background.html?clear.gif] 11:29:51 INFO - --DOMWINDOW == 59 (0x7fe801860000) [pid = 2151] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 58 (0x7fe801860c00) [pid = 2151] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green-background.html?clear.png] 11:29:51 INFO - --DOMWINDOW == 57 (0x7fe801861c00) [pid = 2151] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 56 (0x7fe801862400) [pid = 2151] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/keep.gif] 11:29:51 INFO - --DOMWINDOW == 55 (0x7fe801863000) [pid = 2151] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 54 (0x7fe801863800) [pid = 2151] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/keep.png] 11:29:51 INFO - --DOMWINDOW == 53 (0x7fe801864000) [pid = 2151] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 52 (0x7fe801864800) [pid = 2151] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/restore-previous.gif] 11:29:51 INFO - --DOMWINDOW == 51 (0x7fe801865000) [pid = 2151] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 50 (0x7fe801865c00) [pid = 2151] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/restore-previous.png] 11:29:51 INFO - --DOMWINDOW == 49 (0x7fe801866800) [pid = 2151] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/green.png] 11:29:51 INFO - --DOMWINDOW == 48 (0x7fe801867000) [pid = 2151] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/over.png] 11:29:51 INFO - --DOMWINDOW == 47 (0x7fe801867800) [pid = 2151] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/grey.png] 11:29:51 INFO - --DOMWINDOW == 46 (0x7fe801867c00) [pid = 2151] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/source.png] 11:29:51 INFO - --DOMWINDOW == 45 (0x7fe801ced800) [pid = 2151] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/grey.png] 11:29:51 INFO - --DOMWINDOW == 44 (0x7fe803151400) [pid = 2151] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug900200.png] 11:29:51 INFO - --DOMWINDOW == 43 (0x7fe801862c00) [pid = 2151] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug900200-ref.png] 11:29:51 INFO - --DOMWINDOW == 42 (0x7fe80185ac00) [pid = 2151] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/clear2.gif] 11:29:51 INFO - --DOMWINDOW == 41 (0x7fe804275c00) [pid = 2151] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/clear2-results.gif] 11:29:52 INFO - --DOMWINDOW == 16 (0x7fe297e92000) [pid = 2097] [serial = 8] [outer = (nil)] [url = about:blank] 11:29:52 INFO - --DOMWINDOW == 15 (0x7fe297df4c00) [pid = 2097] [serial = 9] [outer = (nil)] [url = about:blank] 11:29:52 INFO - --DOMWINDOW == 14 (0x7fe29772bc00) [pid = 2097] [serial = 12] [outer = (nil)] [url = about:blank] 11:29:52 INFO - --DOMWINDOW == 13 (0x7fe297d85800) [pid = 2097] [serial = 14] [outer = (nil)] [url = about:blank] 11:29:52 INFO - --DOMWINDOW == 12 (0x7fe2a8e69800) [pid = 2097] [serial = 2] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOCSHELL 0x7fe80146c000 == 4 [pid = 2151] [id = 25] 11:29:54 INFO - --DOCSHELL 0x7fe8018b3800 == 3 [pid = 2151] [id = 26] 11:29:54 INFO - --DOCSHELL 0x7fe800ecf800 == 2 [pid = 2151] [id = 24] 11:29:54 INFO - --DOMWINDOW == 40 (0x7fe801625400) [pid = 2151] [serial = 32] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 39 (0x7fe801625c00) [pid = 2151] [serial = 33] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 38 (0x7fe801627400) [pid = 2151] [serial = 34] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 37 (0x7fe801629800) [pid = 2151] [serial = 35] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 36 (0x7fe80162ac00) [pid = 2151] [serial = 36] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 35 (0x7fe80162b400) [pid = 2151] [serial = 37] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 34 (0x7fe80162c000) [pid = 2151] [serial = 38] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 33 (0x7fe80162cc00) [pid = 2151] [serial = 39] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 32 (0x7fe80162d800) [pid = 2151] [serial = 40] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 31 (0x7fe80162e800) [pid = 2151] [serial = 41] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 30 (0x7fe80162f400) [pid = 2151] [serial = 42] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 29 (0x7fe801630000) [pid = 2151] [serial = 43] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 28 (0x7fe80185d400) [pid = 2151] [serial = 44] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 27 (0x7fe801b92c00) [pid = 2151] [serial = 45] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 26 (0x7fe801421800) [pid = 2151] [serial = 46] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 25 (0x7fe801422400) [pid = 2151] [serial = 47] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 24 (0x7fe801423800) [pid = 2151] [serial = 48] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 23 (0x7fe801424400) [pid = 2151] [serial = 49] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 22 (0x7fe801425000) [pid = 2151] [serial = 50] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 21 (0x7fe801425c00) [pid = 2151] [serial = 51] [outer = (nil)] [url = about:blank] 11:29:54 INFO - --DOMWINDOW == 20 (0x7fe801859800) [pid = 2151] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_animation_operators.html] 11:29:56 INFO - --DOMWINDOW == 19 (0x7fe801858400) [pid = 2151] [serial = 63] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:56 INFO - --DOMWINDOW == 18 (0x7fe801627800) [pid = 2151] [serial = 62] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1217571-iframe.html] 11:29:56 INFO - --DOMWINDOW == 17 (0x7fe80142fc00) [pid = 2151] [serial = 61] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1217571-iframe.html] 11:29:56 INFO - --DOMWINDOW == 16 (0x7fe800f3e400) [pid = 2151] [serial = 58] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug1217571.html] 11:29:56 INFO - --DOMWINDOW == 15 (0x7fe800eb5400) [pid = 2151] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:56 INFO - --DOMWINDOW == 14 (0x7fe804275800) [pid = 2151] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:56 INFO - --DOMWINDOW == 13 (0x7fe801393000) [pid = 2151] [serial = 57] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:29:56 INFO - --DOMWINDOW == 12 (0x7fe801388400) [pid = 2151] [serial = 56] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1180105-waiter.sjs] 11:29:56 INFO - --DOMWINDOW == 11 (0x7fe80142ac00) [pid = 2151] [serial = 55] [outer = (nil)] [url = about:blank] 11:29:56 INFO - --DOMWINDOW == 10 (0x7fe80142dc00) [pid = 2151] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1217571-iframe.html] 11:29:56 INFO - --DOMWINDOW == 9 (0x7fe80142b400) [pid = 2151] [serial = 59] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1217571-iframe.html] 11:29:56 INFO - --DOMWINDOW == 8 (0x7fe801429800) [pid = 2151] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug1180105-waiter.sjs] 11:29:56 INFO - --DOMWINDOW == 7 (0x7fe803418400) [pid = 2151] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/damon.jpg] 11:29:56 INFO - --DOMWINDOW == 6 (0x7fe8031d3c00) [pid = 2151] [serial = 9] [outer = (nil)] [url = about:blank] 11:30:00 INFO - --DOMWINDOW == 5 (0x7fe800eb5800) [pid = 2151] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug1180105.html] 11:31:39 INFO - MEMORY STAT | vsize 524MB | residentFast 94MB | heapAllocated 16MB 11:31:39 INFO - 22 INFO TEST-OK | image/test/mochitest/test_bug399925.html | took 110450ms 11:31:39 INFO - ++DOMWINDOW == 6 (0x7fe800e25c00) [pid = 2151] [serial = 65] [outer = 0x7fe802691800] 11:31:39 INFO - 23 INFO TEST-START | image/test/mochitest/test_bug466586.html 11:31:39 INFO - ++DOMWINDOW == 7 (0x7fe800e25800) [pid = 2151] [serial = 66] [outer = 0x7fe802691800] 11:31:40 INFO - MEMORY STAT | vsize 524MB | residentFast 96MB | heapAllocated 16MB 11:31:40 INFO - 24 INFO TEST-OK | image/test/mochitest/test_bug466586.html | took 721ms 11:31:40 INFO - ++DOMWINDOW == 8 (0x7fe800ebb800) [pid = 2151] [serial = 67] [outer = 0x7fe802691800] 11:31:40 INFO - 25 INFO TEST-START | image/test/mochitest/test_bug468160.html 11:31:40 INFO - ++DOMWINDOW == 9 (0x7fe800e23400) [pid = 2151] [serial = 68] [outer = 0x7fe802691800] 11:31:40 INFO - MEMORY STAT | vsize 524MB | residentFast 96MB | heapAllocated 17MB 11:31:40 INFO - 26 INFO TEST-OK | image/test/mochitest/test_bug468160.html | took 551ms 11:31:40 INFO - ++DOMWINDOW == 10 (0x7fe800e21400) [pid = 2151] [serial = 69] [outer = 0x7fe802691800] 11:31:40 INFO - 27 INFO TEST-START | image/test/mochitest/test_bug490949.html 11:31:41 INFO - ++DOMWINDOW == 11 (0x7fe800eb7800) [pid = 2151] [serial = 70] [outer = 0x7fe802691800] 11:31:41 INFO - ++DOCSHELL 0x7fe800ecf800 == 3 [pid = 2151] [id = 27] 11:31:41 INFO - ++DOMWINDOW == 12 (0x7fe800f36000) [pid = 2151] [serial = 71] [outer = (nil)] 11:31:41 INFO - ++DOMWINDOW == 13 (0x7fe801392c00) [pid = 2151] [serial = 72] [outer = 0x7fe800f36000] 11:31:41 INFO - ++DOMWINDOW == 14 (0x7fe800eb6c00) [pid = 2151] [serial = 73] [outer = 0x7fe800f36000] 11:31:41 INFO - [Child 2151] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4640 11:31:42 INFO - ++DOMWINDOW == 15 (0x7fe800eb7c00) [pid = 2151] [serial = 74] [outer = 0x7fe800f36000] 11:31:42 INFO - MEMORY STAT | vsize 524MB | residentFast 99MB | heapAllocated 19MB 11:31:42 INFO - 28 INFO TEST-OK | image/test/mochitest/test_bug490949.html | took 1555ms 11:31:42 INFO - ++DOMWINDOW == 16 (0x7fe800e22000) [pid = 2151] [serial = 75] [outer = 0x7fe802691800] 11:31:42 INFO - 29 INFO TEST-START | image/test/mochitest/test_bug496292.html 11:31:42 INFO - ++DOMWINDOW == 17 (0x7fe800e24000) [pid = 2151] [serial = 76] [outer = 0x7fe802691800] 11:31:43 INFO - ++DOCSHELL 0x7fe80165c000 == 4 [pid = 2151] [id = 28] 11:31:43 INFO - ++DOMWINDOW == 18 (0x7fe801625c00) [pid = 2151] [serial = 77] [outer = (nil)] 11:31:43 INFO - ++DOMWINDOW == 19 (0x7fe801626c00) [pid = 2151] [serial = 78] [outer = 0x7fe801625c00] 11:31:43 INFO - ++DOCSHELL 0x7fe801666000 == 5 [pid = 2151] [id = 29] 11:31:43 INFO - ++DOMWINDOW == 20 (0x7fe801629c00) [pid = 2151] [serial = 79] [outer = (nil)] 11:31:43 INFO - ++DOMWINDOW == 21 (0x7fe80162b000) [pid = 2151] [serial = 80] [outer = 0x7fe801629c00] 11:31:43 INFO - ++DOCSHELL 0x7fe8016d5800 == 6 [pid = 2151] [id = 30] 11:31:43 INFO - ++DOMWINDOW == 22 (0x7fe80162f000) [pid = 2151] [serial = 81] [outer = (nil)] 11:31:43 INFO - ++DOMWINDOW == 23 (0x7fe800ebcc00) [pid = 2151] [serial = 82] [outer = 0x7fe80162f000] 11:31:43 INFO - ++DOCSHELL 0x7fe8016dc800 == 7 [pid = 2151] [id = 31] 11:31:43 INFO - ++DOMWINDOW == 24 (0x7fe801627c00) [pid = 2151] [serial = 83] [outer = (nil)] 11:31:43 INFO - ++DOMWINDOW == 25 (0x7fe801859000) [pid = 2151] [serial = 84] [outer = 0x7fe801627c00] 11:31:43 INFO - MEMORY STAT | vsize 525MB | residentFast 101MB | heapAllocated 21MB 11:31:43 INFO - 30 INFO TEST-OK | image/test/mochitest/test_bug496292.html | took 1392ms 11:31:44 INFO - ++DOMWINDOW == 26 (0x7fe80185e000) [pid = 2151] [serial = 85] [outer = 0x7fe802691800] 11:31:44 INFO - 31 INFO TEST-START | image/test/mochitest/test_bug497665.html 11:31:44 INFO - ++DOMWINDOW == 27 (0x7fe801858800) [pid = 2151] [serial = 86] [outer = 0x7fe802691800] 11:31:44 INFO - ++DOCSHELL 0x7fe8016ec800 == 8 [pid = 2151] [id = 32] 11:31:44 INFO - ++DOMWINDOW == 28 (0x7fe801cec800) [pid = 2151] [serial = 87] [outer = (nil)] 11:31:44 INFO - ++DOMWINDOW == 29 (0x7fe801cee000) [pid = 2151] [serial = 88] [outer = 0x7fe801cec800] 11:31:44 INFO - ++DOMWINDOW == 30 (0x7fe801391400) [pid = 2151] [serial = 89] [outer = 0x7fe801cec800] 11:31:44 INFO - [Child 2151] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4640 11:31:44 INFO - --DOMWINDOW == 29 (0x7fe800e25c00) [pid = 2151] [serial = 65] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:45 INFO - ++DOMWINDOW == 30 (0x7fe801397000) [pid = 2151] [serial = 90] [outer = 0x7fe801cec800] 11:31:45 INFO - MEMORY STAT | vsize 525MB | residentFast 103MB | heapAllocated 23MB 11:31:45 INFO - 32 INFO TEST-OK | image/test/mochitest/test_bug497665.html | took 1225ms 11:31:45 INFO - ++DOMWINDOW == 31 (0x7fe802697000) [pid = 2151] [serial = 91] [outer = 0x7fe802691800] 11:31:45 INFO - 33 INFO TEST-START | image/test/mochitest/test_bug552605-1.html 11:31:45 INFO - ++DOMWINDOW == 32 (0x7fe801cf8c00) [pid = 2151] [serial = 92] [outer = 0x7fe802691800] 11:31:45 INFO - MEMORY STAT | vsize 525MB | residentFast 104MB | heapAllocated 24MB 11:31:46 INFO - 34 INFO TEST-OK | image/test/mochitest/test_bug552605-1.html | took 620ms 11:31:46 INFO - ++DOMWINDOW == 33 (0x7fe80331f400) [pid = 2151] [serial = 93] [outer = 0x7fe802691800] 11:31:46 INFO - 35 INFO TEST-START | image/test/mochitest/test_bug552605-2.html 11:31:46 INFO - ++DOMWINDOW == 34 (0x7fe801cf9c00) [pid = 2151] [serial = 94] [outer = 0x7fe802691800] 11:31:46 INFO - MEMORY STAT | vsize 525MB | residentFast 106MB | heapAllocated 26MB 11:31:46 INFO - 36 INFO TEST-OK | image/test/mochitest/test_bug552605-2.html | took 596ms 11:31:46 INFO - ++DOMWINDOW == 35 (0x7fe80426c400) [pid = 2151] [serial = 95] [outer = 0x7fe802691800] 11:31:46 INFO - 37 INFO TEST-START | image/test/mochitest/test_bug553982.html 11:31:46 INFO - ++DOMWINDOW == 36 (0x7fe80331d800) [pid = 2151] [serial = 96] [outer = 0x7fe802691800] 11:31:47 INFO - MEMORY STAT | vsize 526MB | residentFast 107MB | heapAllocated 27MB 11:31:47 INFO - 38 INFO TEST-OK | image/test/mochitest/test_bug553982.html | took 493ms 11:31:47 INFO - ++DOMWINDOW == 37 (0x7fe806a61000) [pid = 2151] [serial = 97] [outer = 0x7fe802691800] 11:31:47 INFO - 39 INFO TEST-START | image/test/mochitest/test_bug601470.html 11:31:47 INFO - ++DOMWINDOW == 38 (0x7fe800e20800) [pid = 2151] [serial = 98] [outer = 0x7fe802691800] 11:31:48 INFO - --DOCSHELL 0x7fe800ecf800 == 7 [pid = 2151] [id = 27] 11:31:48 INFO - --DOCSHELL 0x7fe80165c000 == 6 [pid = 2151] [id = 28] 11:31:48 INFO - --DOCSHELL 0x7fe801666000 == 5 [pid = 2151] [id = 29] 11:31:48 INFO - --DOCSHELL 0x7fe8016d5800 == 4 [pid = 2151] [id = 30] 11:31:48 INFO - --DOCSHELL 0x7fe8016dc800 == 3 [pid = 2151] [id = 31] 11:31:48 INFO - --DOCSHELL 0x7fe8016ec800 == 2 [pid = 2151] [id = 32] 11:31:48 INFO - MEMORY STAT | vsize 528MB | residentFast 106MB | heapAllocated 25MB 11:31:48 INFO - --DOMWINDOW == 37 (0x7fe800e25800) [pid = 2151] [serial = 66] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug466586.html] 11:31:48 INFO - 40 INFO TEST-OK | image/test/mochitest/test_bug601470.html | took 1061ms 11:31:48 INFO - ++DOMWINDOW == 38 (0x7fe801429800) [pid = 2151] [serial = 99] [outer = 0x7fe802691800] 11:31:48 INFO - 41 INFO TEST-START | image/test/mochitest/test_bug614392.html 11:31:48 INFO - ++DOMWINDOW == 39 (0x7fe800e1b800) [pid = 2151] [serial = 100] [outer = 0x7fe802691800] 11:31:48 INFO - MEMORY STAT | vsize 528MB | residentFast 107MB | heapAllocated 26MB 11:31:48 INFO - 42 INFO TEST-OK | image/test/mochitest/test_bug614392.html | took 307ms 11:31:49 INFO - ++DOMWINDOW == 40 (0x7fe801391800) [pid = 2151] [serial = 101] [outer = 0x7fe802691800] 11:31:49 INFO - 43 INFO TEST-START | image/test/mochitest/test_bug657191.html 11:31:49 INFO - ++DOMWINDOW == 41 (0x7fe801392800) [pid = 2151] [serial = 102] [outer = 0x7fe802691800] 11:31:49 INFO - [Child 2151] WARNING: VectorImage::OnStartRequest failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:31:49 INFO - [Child 2151] WARNING: VectorImage::OnStartRequest failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:31:49 INFO - MEMORY STAT | vsize 528MB | residentFast 107MB | heapAllocated 28MB 11:31:49 INFO - 44 INFO TEST-OK | image/test/mochitest/test_bug657191.html | took 781ms 11:31:49 INFO - ++DOMWINDOW == 42 (0x7fe801cf2400) [pid = 2151] [serial = 103] [outer = 0x7fe802691800] 11:31:50 INFO - 45 INFO TEST-START | image/test/mochitest/test_bug671906.html 11:31:50 INFO - ++DOMWINDOW == 43 (0x7fe803379c00) [pid = 2151] [serial = 104] [outer = 0x7fe802691800] 11:31:50 INFO - ++DOCSHELL 0x7fe801660000 == 3 [pid = 2151] [id = 33] 11:31:50 INFO - ++DOMWINDOW == 44 (0x7fe806abc400) [pid = 2151] [serial = 105] [outer = (nil)] 11:31:50 INFO - ++DOMWINDOW == 45 (0x7fe80337ac00) [pid = 2151] [serial = 106] [outer = 0x7fe806abc400] 11:31:50 INFO - ++DOMWINDOW == 46 (0x7fe80331c800) [pid = 2151] [serial = 107] [outer = 0x7fe806abc400] 11:31:51 INFO - ++DOMWINDOW == 47 (0x7fe80331d000) [pid = 2151] [serial = 108] [outer = 0x7fe806abc400] 11:31:51 INFO - MEMORY STAT | vsize 529MB | residentFast 111MB | heapAllocated 31MB 11:31:51 INFO - 46 INFO TEST-OK | image/test/mochitest/test_bug671906.html | took 1139ms 11:31:51 INFO - ++DOMWINDOW == 48 (0x7fe8033e8400) [pid = 2151] [serial = 109] [outer = 0x7fe802691800] 11:31:51 INFO - 47 INFO TEST-START | image/test/mochitest/test_bug733553.html 11:31:51 INFO - ++DOMWINDOW == 49 (0x7fe806ae4400) [pid = 2151] [serial = 110] [outer = 0x7fe802691800] 11:31:51 INFO - --DOMWINDOW == 48 (0x7fe806a61000) [pid = 2151] [serial = 97] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 47 (0x7fe80185e000) [pid = 2151] [serial = 85] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 46 (0x7fe80138b000) [pid = 2151] [serial = 64] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug399925.html] 11:31:51 INFO - --DOMWINDOW == 45 (0x7fe800e21400) [pid = 2151] [serial = 69] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 44 (0x7fe80426c400) [pid = 2151] [serial = 95] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 43 (0x7fe80331f400) [pid = 2151] [serial = 93] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 42 (0x7fe800e23400) [pid = 2151] [serial = 68] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug468160.html] 11:31:51 INFO - --DOMWINDOW == 41 (0x7fe802697000) [pid = 2151] [serial = 91] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 40 (0x7fe800e22000) [pid = 2151] [serial = 75] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 39 (0x7fe800ebb800) [pid = 2151] [serial = 67] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:51 INFO - --DOMWINDOW == 38 (0x7fe801626c00) [pid = 2151] [serial = 78] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug496292-iframe-ref.html] 11:31:51 INFO - --DOMWINDOW == 37 (0x7fe800eb7c00) [pid = 2151] [serial = 74] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug490949-iframe.html] 11:31:51 INFO - --DOMWINDOW == 36 (0x7fe800ebcc00) [pid = 2151] [serial = 82] [outer = (nil)] [url = about:blank] 11:31:51 INFO - --DOMWINDOW == 35 (0x7fe801397000) [pid = 2151] [serial = 90] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug497665-iframe.html] 11:31:51 INFO - --DOMWINDOW == 34 (0x7fe801cee000) [pid = 2151] [serial = 88] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug497665-iframe.html] 11:31:51 INFO - --DOMWINDOW == 33 (0x7fe80162b000) [pid = 2151] [serial = 80] [outer = (nil)] [url = about:blank] 11:31:51 INFO - --DOMWINDOW == 32 (0x7fe801859000) [pid = 2151] [serial = 84] [outer = (nil)] [url = about:blank] 11:31:51 INFO - --DOMWINDOW == 31 (0x7fe801391400) [pid = 2151] [serial = 89] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug497665-iframe.html] 11:31:51 INFO - --DOMWINDOW == 30 (0x7fe801392c00) [pid = 2151] [serial = 72] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug490949-iframe.html] 11:31:51 INFO - --DOMWINDOW == 29 (0x7fe800eb6c00) [pid = 2151] [serial = 73] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug490949-iframe.html] 11:31:51 INFO - --DOMWINDOW == 28 (0x7fe801625c00) [pid = 2151] [serial = 77] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug496292-iframe-ref.html] 11:31:51 INFO - --DOMWINDOW == 27 (0x7fe800f36000) [pid = 2151] [serial = 71] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug490949-iframe.html] 11:31:51 INFO - --DOMWINDOW == 26 (0x7fe80162f000) [pid = 2151] [serial = 81] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug496292-iframe-2.html] 11:31:51 INFO - --DOMWINDOW == 25 (0x7fe801cec800) [pid = 2151] [serial = 87] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug497665-iframe.html] 11:31:51 INFO - --DOMWINDOW == 24 (0x7fe801629c00) [pid = 2151] [serial = 79] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug496292-iframe-1.html] 11:31:51 INFO - --DOMWINDOW == 23 (0x7fe801627c00) [pid = 2151] [serial = 83] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug496292-iframe-1.html] 11:31:51 INFO - ++DOCSHELL 0x7fe800ec6800 == 4 [pid = 2151] [id = 34] 11:31:51 INFO - ++DOMWINDOW == 24 (0x7fe8005f5800) [pid = 2151] [serial = 111] [outer = (nil)] 11:31:51 INFO - ++DOMWINDOW == 25 (0x7fe8005f6c00) [pid = 2151] [serial = 112] [outer = 0x7fe8005f5800] 11:31:52 INFO - ++DOMWINDOW == 26 (0x7fe8005fb000) [pid = 2151] [serial = 113] [outer = 0x7fe8005f5800] 11:31:54 INFO - ++DOMWINDOW == 27 (0x7fe8005fc400) [pid = 2151] [serial = 114] [outer = 0x7fe8005f5800] 11:31:55 INFO - --DOCSHELL 0x7fe801660000 == 3 [pid = 2151] [id = 33] 11:31:55 INFO - --DOMWINDOW == 26 (0x7fe80331d800) [pid = 2151] [serial = 96] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug553982.html] 11:31:55 INFO - --DOMWINDOW == 25 (0x7fe801cf8c00) [pid = 2151] [serial = 92] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug552605-1.html] 11:31:55 INFO - --DOMWINDOW == 24 (0x7fe800e24000) [pid = 2151] [serial = 76] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug496292.html] 11:31:55 INFO - --DOMWINDOW == 23 (0x7fe801cf9c00) [pid = 2151] [serial = 94] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug552605-2.html] 11:31:55 INFO - --DOMWINDOW == 22 (0x7fe801858800) [pid = 2151] [serial = 86] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug497665.html] 11:31:55 INFO - --DOMWINDOW == 21 (0x7fe800eb7800) [pid = 2151] [serial = 70] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug490949.html] 11:31:55 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:31:56 INFO - ++DOMWINDOW == 22 (0x7fe8005fbc00) [pid = 2151] [serial = 115] [outer = 0x7fe8005f5800] 11:31:57 INFO - --DOMWINDOW == 21 (0x7fe800e20800) [pid = 2151] [serial = 98] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug601470.html] 11:31:57 INFO - --DOMWINDOW == 20 (0x7fe8005f6c00) [pid = 2151] [serial = 112] [outer = (nil)] [url = about:blank] 11:31:57 INFO - --DOMWINDOW == 19 (0x7fe8033e8400) [pid = 2151] [serial = 109] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:57 INFO - --DOMWINDOW == 18 (0x7fe80331d000) [pid = 2151] [serial = 108] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug671906-iframe.html] 11:31:57 INFO - --DOMWINDOW == 17 (0x7fe80331c800) [pid = 2151] [serial = 107] [outer = (nil)] [url = http://example.com/tests/image/test/mochitest/bug671906-iframe.html] 11:31:57 INFO - --DOMWINDOW == 16 (0x7fe80337ac00) [pid = 2151] [serial = 106] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug671906-iframe.html] 11:31:57 INFO - --DOMWINDOW == 15 (0x7fe801cf2400) [pid = 2151] [serial = 103] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:57 INFO - --DOMWINDOW == 14 (0x7fe801392800) [pid = 2151] [serial = 102] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug657191.html] 11:31:57 INFO - --DOMWINDOW == 13 (0x7fe801391800) [pid = 2151] [serial = 101] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:57 INFO - --DOMWINDOW == 12 (0x7fe800e1b800) [pid = 2151] [serial = 100] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug614392.html] 11:31:57 INFO - --DOMWINDOW == 11 (0x7fe801429800) [pid = 2151] [serial = 99] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:31:57 INFO - --DOMWINDOW == 10 (0x7fe806abc400) [pid = 2151] [serial = 105] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug671906-iframe.html] 11:31:57 INFO - --DOMWINDOW == 9 (0x7fe8005fb000) [pid = 2151] [serial = 113] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?0] 11:31:57 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:31:58 INFO - ++DOMWINDOW == 10 (0x7fe8005fb000) [pid = 2151] [serial = 116] [outer = 0x7fe8005f5800] 11:31:59 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:00 INFO - ++DOMWINDOW == 11 (0x7fe800e1f400) [pid = 2151] [serial = 117] [outer = 0x7fe8005f5800] 11:32:01 INFO - --DOMWINDOW == 10 (0x7fe803379c00) [pid = 2151] [serial = 104] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug671906.html] 11:32:01 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:02 INFO - ++DOMWINDOW == 11 (0x7fe8005fa000) [pid = 2151] [serial = 118] [outer = 0x7fe8005f5800] 11:32:03 INFO - --DOMWINDOW == 10 (0x7fe8005fc400) [pid = 2151] [serial = 114] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?1] 11:32:03 INFO - --DOMWINDOW == 9 (0x7fe8005fbc00) [pid = 2151] [serial = 115] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?2] 11:32:03 INFO - --DOMWINDOW == 8 (0x7fe8005fb000) [pid = 2151] [serial = 116] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?3] 11:32:03 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:04 INFO - ++DOMWINDOW == 9 (0x7fe8005fb000) [pid = 2151] [serial = 119] [outer = 0x7fe8005f5800] 11:32:05 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:06 INFO - ++DOMWINDOW == 10 (0x7fe8005fa400) [pid = 2151] [serial = 120] [outer = 0x7fe8005f5800] 11:32:08 INFO - [Child 2151] WARNING: Appending an extra chunk for SourceBuffer: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/SourceBuffer.cpp, line 70 11:32:08 INFO - [Child 2151] WARNING: Appending an extra chunk for SourceBuffer: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/SourceBuffer.cpp, line 70 11:32:08 INFO - [Child 2151] WARNING: Appending an extra chunk for SourceBuffer: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/SourceBuffer.cpp, line 70 11:32:08 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:08 INFO - ++DOMWINDOW == 11 (0x7fe8005f7000) [pid = 2151] [serial = 121] [outer = 0x7fe8005f5800] 11:32:10 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:10 INFO - ++DOMWINDOW == 12 (0x7fe8005f9c00) [pid = 2151] [serial = 122] [outer = 0x7fe8005f5800] 11:32:10 INFO - --DOMWINDOW == 11 (0x7fe800e1f400) [pid = 2151] [serial = 117] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?4] 11:32:10 INFO - --DOMWINDOW == 10 (0x7fe8005fa000) [pid = 2151] [serial = 118] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?5] 11:32:10 INFO - --DOMWINDOW == 9 (0x7fe8005fb000) [pid = 2151] [serial = 119] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?6] 11:32:10 INFO - --DOMWINDOW == 8 (0x7fe8005fa400) [pid = 2151] [serial = 120] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?7] 11:32:12 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:12 INFO - ++DOMWINDOW == 9 (0x7fe8005fb000) [pid = 2151] [serial = 123] [outer = 0x7fe8005f5800] 11:32:14 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:14 INFO - ++DOMWINDOW == 10 (0x7fe8005ff800) [pid = 2151] [serial = 124] [outer = 0x7fe8005f5800] 11:32:16 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:16 INFO - ++DOMWINDOW == 11 (0x7fe8005f8c00) [pid = 2151] [serial = 125] [outer = 0x7fe8005f5800] 11:32:17 INFO - --DOMWINDOW == 10 (0x7fe8005f9c00) [pid = 2151] [serial = 122] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?9] 11:32:17 INFO - --DOMWINDOW == 9 (0x7fe8005f7000) [pid = 2151] [serial = 121] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?8] 11:32:17 INFO - --DOMWINDOW == 8 (0x7fe8005fb000) [pid = 2151] [serial = 123] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?10] 11:32:18 INFO - [Child 2151] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:32:18 INFO - [Child 2151] WARNING: Appending an extra chunk for SourceBuffer: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/SourceBuffer.cpp, line 70 11:32:18 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:18 INFO - ++DOMWINDOW == 9 (0x7fe8005fbc00) [pid = 2151] [serial = 126] [outer = 0x7fe8005f5800] 11:32:20 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:20 INFO - ++DOMWINDOW == 10 (0x7fe8005fe800) [pid = 2151] [serial = 127] [outer = 0x7fe8005f5800] 11:32:22 INFO - Corrupt JPEG data: 1865 extraneous bytes before marker 0xd9 11:32:22 INFO - JPEG decoding error: 11:32:22 INFO - Invalid JPEG file structure: missing SOS marker 11:32:22 INFO - Corrupt JPEG data: 1865 extraneous bytes before marker 0xd9 11:32:22 INFO - JPEG decoding error: 11:32:22 INFO - Invalid JPEG file structure: missing SOS marker 11:32:22 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:22 INFO - ++DOMWINDOW == 11 (0x7fe8005f8000) [pid = 2151] [serial = 128] [outer = 0x7fe8005f5800] 11:32:23 INFO - --DOMWINDOW == 10 (0x7fe8005ff800) [pid = 2151] [serial = 124] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?11] 11:32:23 INFO - --DOMWINDOW == 9 (0x7fe8005f8c00) [pid = 2151] [serial = 125] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?12] 11:32:23 INFO - --DOMWINDOW == 8 (0x7fe8005fbc00) [pid = 2151] [serial = 126] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?13] 11:32:24 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:24 INFO - ++DOMWINDOW == 9 (0x7fe8005fcc00) [pid = 2151] [serial = 129] [outer = 0x7fe8005f5800] 11:32:26 INFO - JPEG decoding error: 11:32:26 INFO - Not a JPEG file: starts with 0x6e 0x6f 11:32:26 INFO - JPEG decoding error: 11:32:26 INFO - Not a JPEG file: starts with 0x6e 0x6f 11:32:26 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:26 INFO - ++DOMWINDOW == 10 (0x7fe8005ff400) [pid = 2151] [serial = 130] [outer = 0x7fe8005f5800] 11:32:28 INFO - [Child 2151] WARNING: Forced to copy ObserverTable due to nested notifications: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ProgressTracker.h, line 88 11:32:28 INFO - MEMORY STAT | vsize 529MB | residentFast 99MB | heapAllocated 17MB 11:32:28 INFO - 48 INFO TEST-OK | image/test/mochitest/test_bug733553.html | took 37204ms 11:32:28 INFO - ++DOMWINDOW == 11 (0x7fe800e1e400) [pid = 2151] [serial = 131] [outer = 0x7fe802691800] 11:32:28 INFO - 49 INFO TEST-START | image/test/mochitest/test_bug767779.html 11:32:28 INFO - ++DOMWINDOW == 12 (0x7fe800e1f000) [pid = 2151] [serial = 132] [outer = 0x7fe802691800] 11:32:29 INFO - --DOCSHELL 0x7fe800ec6800 == 2 [pid = 2151] [id = 34] 11:32:31 INFO - --DOMWINDOW == 11 (0x7fe800e1e400) [pid = 2151] [serial = 131] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:31 INFO - --DOMWINDOW == 10 (0x7fe8005fe800) [pid = 2151] [serial = 127] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?14] 11:32:31 INFO - --DOMWINDOW == 9 (0x7fe8005f8000) [pid = 2151] [serial = 128] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?15] 11:32:31 INFO - --DOMWINDOW == 8 (0x7fe8005fcc00) [pid = 2151] [serial = 129] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?16] 11:32:34 INFO - MEMORY STAT | vsize 529MB | residentFast 100MB | heapAllocated 19MB 11:32:34 INFO - 50 INFO TEST-OK | image/test/mochitest/test_bug767779.html | took 5608ms 11:32:34 INFO - ++DOMWINDOW == 9 (0x7fe800f39800) [pid = 2151] [serial = 133] [outer = 0x7fe802691800] 11:32:34 INFO - 51 INFO TEST-START | image/test/mochitest/test_bug865919.html 11:32:34 INFO - ++DOMWINDOW == 10 (0x7fe800f3bc00) [pid = 2151] [serial = 134] [outer = 0x7fe802691800] 11:32:34 INFO - MEMORY STAT | vsize 530MB | residentFast 102MB | heapAllocated 21MB 11:32:34 INFO - 52 INFO TEST-OK | image/test/mochitest/test_bug865919.html | took 605ms 11:32:34 INFO - ++DOMWINDOW == 11 (0x7fe801422c00) [pid = 2151] [serial = 135] [outer = 0x7fe802691800] 11:32:35 INFO - 53 INFO TEST-START | image/test/mochitest/test_bug89419-1.html 11:32:35 INFO - ++DOMWINDOW == 12 (0x7fe800eb5800) [pid = 2151] [serial = 136] [outer = 0x7fe802691800] 11:32:35 INFO - ++DOCSHELL 0x7fe801477000 == 3 [pid = 2151] [id = 35] 11:32:35 INFO - ++DOMWINDOW == 13 (0x7fe801421c00) [pid = 2151] [serial = 137] [outer = (nil)] 11:32:35 INFO - ++DOMWINDOW == 14 (0x7fe801428400) [pid = 2151] [serial = 138] [outer = 0x7fe801421c00] 11:32:36 INFO - ++DOMWINDOW == 15 (0x7fe800f40800) [pid = 2151] [serial = 139] [outer = 0x7fe801421c00] 11:32:36 INFO - ++DOMWINDOW == 16 (0x7fe800f40400) [pid = 2151] [serial = 140] [outer = 0x7fe801421c00] 11:32:36 INFO - MEMORY STAT | vsize 530MB | residentFast 104MB | heapAllocated 22MB 11:32:36 INFO - 54 INFO TEST-OK | image/test/mochitest/test_bug89419-1.html | took 1690ms 11:32:37 INFO - ++DOMWINDOW == 17 (0x7fe8005f2800) [pid = 2151] [serial = 141] [outer = 0x7fe802691800] 11:32:37 INFO - 55 INFO TEST-START | image/test/mochitest/test_bug89419-2.html 11:32:37 INFO - ++DOMWINDOW == 18 (0x7fe8005f3c00) [pid = 2151] [serial = 142] [outer = 0x7fe802691800] 11:32:37 INFO - ++DOCSHELL 0x7fe800ee3800 == 4 [pid = 2151] [id = 36] 11:32:37 INFO - ++DOMWINDOW == 19 (0x7fe8005fd800) [pid = 2151] [serial = 143] [outer = (nil)] 11:32:37 INFO - ++DOMWINDOW == 20 (0x7fe800f3c000) [pid = 2151] [serial = 144] [outer = 0x7fe8005fd800] 11:32:37 INFO - ++DOMWINDOW == 21 (0x7fe80138bc00) [pid = 2151] [serial = 145] [outer = 0x7fe8005fd800] 11:32:37 INFO - --DOCSHELL 0x7fe801477000 == 3 [pid = 2151] [id = 35] 11:32:38 INFO - ++DOMWINDOW == 22 (0x7fe80138f400) [pid = 2151] [serial = 146] [outer = 0x7fe8005fd800] 11:32:38 INFO - MEMORY STAT | vsize 530MB | residentFast 102MB | heapAllocated 21MB 11:32:38 INFO - 56 INFO TEST-OK | image/test/mochitest/test_bug89419-2.html | took 959ms 11:32:38 INFO - ++DOMWINDOW == 23 (0x7fe800f3f800) [pid = 2151] [serial = 147] [outer = 0x7fe802691800] 11:32:38 INFO - 57 INFO TEST-START | image/test/mochitest/test_drawDiscardedImage.html 11:32:38 INFO - ++DOMWINDOW == 24 (0x7fe8005fa800) [pid = 2151] [serial = 148] [outer = 0x7fe802691800] 11:32:38 INFO - ++DOCSHELL 0x7fe8016d7000 == 4 [pid = 2151] [id = 37] 11:32:38 INFO - ++DOMWINDOW == 25 (0x7fe80142f000) [pid = 2151] [serial = 149] [outer = (nil)] 11:32:38 INFO - ++DOMWINDOW == 26 (0x7fe80142f800) [pid = 2151] [serial = 150] [outer = 0x7fe80142f000] 11:32:38 INFO - MEMORY STAT | vsize 530MB | residentFast 104MB | heapAllocated 22MB 11:32:38 INFO - 58 INFO TEST-OK | image/test/mochitest/test_drawDiscardedImage.html | took 361ms 11:32:38 INFO - ++DOMWINDOW == 27 (0x7fe801392800) [pid = 2151] [serial = 151] [outer = 0x7fe802691800] 11:32:38 INFO - 59 INFO TEST-START | image/test/mochitest/test_error_events.html 11:32:38 INFO - --DOMWINDOW == 26 (0x7fe806ae4400) [pid = 2151] [serial = 110] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug733553.html] 11:32:39 INFO - --DOMWINDOW == 25 (0x7fe800f40800) [pid = 2151] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug89419-iframe.html] 11:32:39 INFO - --DOMWINDOW == 24 (0x7fe800f39800) [pid = 2151] [serial = 133] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:39 INFO - --DOMWINDOW == 23 (0x7fe801422c00) [pid = 2151] [serial = 135] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:39 INFO - --DOMWINDOW == 22 (0x7fe800e1f000) [pid = 2151] [serial = 132] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug767779.html] 11:32:39 INFO - --DOMWINDOW == 21 (0x7fe801428400) [pid = 2151] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug89419-iframe.html] 11:32:39 INFO - --DOMWINDOW == 20 (0x7fe8005f5800) [pid = 2151] [serial = 111] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?17] 11:32:39 INFO - --DOMWINDOW == 19 (0x7fe8005ff400) [pid = 2151] [serial = 130] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug733553-informant.sjs?17] 11:32:39 INFO - ++DOMWINDOW == 20 (0x7fe8005fd000) [pid = 2151] [serial = 152] [outer = 0x7fe802691800] 11:32:39 INFO - MEMORY STAT | vsize 530MB | residentFast 104MB | heapAllocated 23MB 11:32:39 INFO - 60 INFO TEST-OK | image/test/mochitest/test_error_events.html | took 914ms 11:32:39 INFO - ++DOMWINDOW == 21 (0x7fe80162cc00) [pid = 2151] [serial = 153] [outer = 0x7fe802691800] 11:32:39 INFO - 61 INFO TEST-START | image/test/mochitest/test_image_crossorigin_data_url.html 11:32:40 INFO - ++DOMWINDOW == 22 (0x7fe80162d000) [pid = 2151] [serial = 154] [outer = 0x7fe802691800] 11:32:40 INFO - MEMORY STAT | vsize 530MB | residentFast 105MB | heapAllocated 24MB 11:32:40 INFO - 62 INFO TEST-OK | image/test/mochitest/test_image_crossorigin_data_url.html | took 665ms 11:32:40 INFO - ++DOMWINDOW == 23 (0x7fe80185d000) [pid = 2151] [serial = 155] [outer = 0x7fe802691800] 11:32:40 INFO - 63 INFO TEST-START | image/test/mochitest/test_short_gif_header.html 11:32:40 INFO - ++DOMWINDOW == 24 (0x7fe800f41c00) [pid = 2151] [serial = 156] [outer = 0x7fe802691800] 11:32:41 INFO - MEMORY STAT | vsize 530MB | residentFast 106MB | heapAllocated 25MB 11:32:41 INFO - 64 INFO TEST-OK | image/test/mochitest/test_short_gif_header.html | took 688ms 11:32:41 INFO - ++DOMWINDOW == 25 (0x7fe801cef000) [pid = 2151] [serial = 157] [outer = 0x7fe802691800] 11:32:41 INFO - ++DOMWINDOW == 26 (0x7fe800eb9c00) [pid = 2151] [serial = 158] [outer = 0x7fe802691800] 11:32:41 INFO - --DOCSHELL 0x7fe297c94000 == 5 [pid = 2097] [id = 6] 11:32:41 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:32:42 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:32:42 INFO - --DOCSHELL 0x7fe2a9c81000 == 4 [pid = 2097] [id = 1] 11:32:42 INFO - [Child 2151] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:32:42 INFO - [Child 2151] WARNING: Finishing incremental GC in progress during CC: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/base/nsCycleCollector.cpp, line 3505 11:32:43 INFO - --DOCSHELL 0x7fe8026a1800 == 3 [pid = 2151] [id = 2] 11:32:43 INFO - --DOCSHELL 0x7fe80422e800 == 2 [pid = 2151] [id = 1] 11:32:43 INFO - --DOCSHELL 0x7fe800ee3800 == 1 [pid = 2151] [id = 36] 11:32:43 INFO - --DOCSHELL 0x7fe8016d7000 == 0 [pid = 2151] [id = 37] 11:32:43 INFO - [Child 2151] WARNING: 'NS_FAILED(DebuggerOnGCRunnable::Enqueue(aRuntime, aDesc)) && reason != JS::gcreason::SHUTDOWN_CC && reason != JS::gcreason::DESTROY_RUNTIME && reason != JS::gcreason::XPCONNECT_SHUTDOWN', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/base/CycleCollectedJSRuntime.cpp, line 740 11:32:43 INFO - --DOMWINDOW == 25 (0x7fe800f3bc00) [pid = 2151] [serial = 134] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug865919.html] 11:32:44 INFO - --DOCSHELL 0x7fe297d2d000 == 3 [pid = 2097] [id = 7] 11:32:44 INFO - --DOCSHELL 0x7fe299a27800 == 2 [pid = 2097] [id = 3] 11:32:44 INFO - --DOCSHELL 0x7fe299a29800 == 1 [pid = 2097] [id = 4] 11:32:44 INFO - --DOMWINDOW == 24 (0x7fe801b92400) [pid = 2151] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_ImageContentLoaded.html] 11:32:44 INFO - --DOMWINDOW == 23 (0x7fe800eb5800) [pid = 2151] [serial = 136] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug89419-1.html] 11:32:44 INFO - --DOMWINDOW == 22 (0x7fe8005f2800) [pid = 2151] [serial = 141] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 21 (0x7fe8005f3c00) [pid = 2151] [serial = 142] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_bug89419-2.html] 11:32:44 INFO - --DOMWINDOW == 20 (0x7fe800f3f800) [pid = 2151] [serial = 147] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 19 (0x7fe8005fa800) [pid = 2151] [serial = 148] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_drawDiscardedImage.html] 11:32:44 INFO - --DOMWINDOW == 18 (0x7fe801392800) [pid = 2151] [serial = 151] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 17 (0x7fe8005fd000) [pid = 2151] [serial = 152] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_error_events.html] 11:32:44 INFO - --DOMWINDOW == 16 (0x7fe80162cc00) [pid = 2151] [serial = 153] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 15 (0x7fe80185d000) [pid = 2151] [serial = 155] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 14 (0x7fe800f41c00) [pid = 2151] [serial = 156] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/test_short_gif_header.html] 11:32:44 INFO - --DOMWINDOW == 13 (0x7fe801cef000) [pid = 2151] [serial = 157] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:32:44 INFO - --DOMWINDOW == 12 (0x7fe800eb9c00) [pid = 2151] [serial = 158] [outer = (nil)] [url = about:blank] 11:32:44 INFO - --DOMWINDOW == 11 (0x7fe8031d6400) [pid = 2151] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:32:44 INFO - --DOMWINDOW == 10 (0x7fe80427b000) [pid = 2151] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:32:44 INFO - --DOMWINDOW == 9 (0x7fe802691800) [pid = 2151] [serial = 4] [outer = (nil)] [url = about:blank] 11:32:44 INFO - --DOMWINDOW == 8 (0x7fe800f3c000) [pid = 2151] [serial = 144] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug89419-iframe.html] 11:32:44 INFO - --DOMWINDOW == 7 (0x7fe80138bc00) [pid = 2151] [serial = 145] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug89419-iframe.html] 11:32:44 INFO - --DOMWINDOW == 6 (0x7fe80138f400) [pid = 2151] [serial = 146] [outer = (nil)] [url = http://mochi.test:8888/tests/image/test/mochitest/bug89419-iframe.html] 11:32:44 INFO - --DOMWINDOW == 5 (0x7fe80142f800) [pid = 2151] [serial = 150] [outer = (nil)] [url = data:text/html, mAllocCount: 75936 11:32:44 INFO - => mReallocCount: 3184 11:32:44 INFO - => mFreeCount: 75936 11:32:44 INFO - => mShareCount: 109123 11:32:44 INFO - => mAdoptCount: 8757 11:32:44 INFO - => mAdoptFreeCount: 8757 11:32:44 INFO - => Process ID: 2151, Thread ID: 140634971798080 11:32:44 INFO - ]: 11:32:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:32:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:32:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:32:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:32:44 INFO - [Parent 2097] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:32:44 INFO - [Parent 2097] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:32:45 INFO - --DOCSHELL 0x7fe2a435e800 == 0 [pid = 2097] [id = 2] 11:32:46 INFO - --DOMWINDOW == 11 (0x7fe297729800) [pid = 2097] [serial = 10] [outer = 0x7fe299bbbc00] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 10 (0x7fe29772a000) [pid = 2097] [serial = 11] [outer = 0x7fe299bbc400] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 9 (0x7fe299bbbc00) [pid = 2097] [serial = 6] [outer = (nil)] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 8 (0x7fe299bbc400) [pid = 2097] [serial = 7] [outer = (nil)] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 7 (0x7fe2a420d800) [pid = 2097] [serial = 4] [outer = (nil)] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 6 (0x7fe2a9cab800) [pid = 2097] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:32:46 INFO - --DOMWINDOW == 5 (0x7fe298b21c00) [pid = 2097] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:32:46 INFO - --DOMWINDOW == 4 (0x7fe299ef2000) [pid = 2097] [serial = 17] [outer = (nil)] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 3 (0x7fe297d87800) [pid = 2097] [serial = 16] [outer = (nil)] [url = about:blank] 11:32:46 INFO - --DOMWINDOW == 2 (0x7fe2973c0000) [pid = 2097] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:32:46 INFO - --DOMWINDOW == 1 (0x7fe2a420cc00) [pid = 2097] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:32:46 INFO - --DOMWINDOW == 0 (0x7fe2a2c6e000) [pid = 2097] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:32:47 INFO - nsStringStats 11:32:47 INFO - => mAllocCount: 136755 11:32:47 INFO - => mReallocCount: 19035 11:32:47 INFO - => mFreeCount: 136755 11:32:47 INFO - => mShareCount: 133552 11:32:47 INFO - => mAdoptCount: 5981 11:32:47 INFO - => mAdoptFreeCount: 5981 11:32:47 INFO - => Process ID: 2097, Thread ID: 140612070754112 11:32:47 INFO - TEST-INFO | Main app process: exit 0 11:32:47 INFO - runtests.py | Application ran for: 0:03:27.124836 11:32:47 INFO - zombiecheck | Reading PID log: /tmp/tmpCq6VRFpidlog 11:32:47 INFO - ==> process 2097 launched child process 2151 11:32:47 INFO - zombiecheck | Checking for orphan process with PID: 2151 11:32:47 INFO - Stopping web server 11:32:47 INFO - Stopping web socket server 11:32:47 INFO - Stopping ssltunnel 11:32:47 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:32:47 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:32:47 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:32:47 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2151 11:32:47 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:32:47 INFO - | | Per-Inst Leaked| Total Rem| 11:32:47 INFO - 0 |TOTAL | 23 4640| 2418728 33| 11:32:47 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 5 1| 11:32:47 INFO - 54 |CompositorChild | 880 880| 1 1| 11:32:47 INFO - 56 |CondVar | 40 120| 245 3| 11:32:47 INFO - 156 |IPC::Channel | 16 32| 7 2| 11:32:47 INFO - 188 |MessagePump | 16 16| 11 1| 11:32:47 INFO - 193 |Mutex | 32 96| 1792 3| 11:32:47 INFO - 206 |PCompositorChild | 776 776| 1 1| 11:32:47 INFO - 213 |PImageBridgeChild | 920 920| 1 1| 11:32:47 INFO - 264 |RefCountedMonitor | 80 160| 6 2| 11:32:47 INFO - 265 |RefCountedTask | 16 64| 12 4| 11:32:47 INFO - 306 |StoreRef | 16 32| 7 2| 11:32:47 INFO - 344 |WaitableEventKernel | 72 72| 14 1| 11:32:47 INFO - 349 |WeakReference | 16 32| 811 2| 11:32:47 INFO - 375 |base::Thread | 48 48| 3 1| 11:32:47 INFO - 402 |ipc::MessageChannel | 512 1024| 6 2| 11:32:47 INFO - 758 |nsTArray_base | 8 40| 657652 5| 11:32:47 INFO - 763 |nsThread | 256 256| 10 1| 11:32:47 INFO - nsTraceRefcnt::DumpStatistics: 826 entries 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:32:47 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:32:47 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:32:47 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2097 11:32:47 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:32:47 INFO - | | Per-Inst Leaked| Total Rem| 11:32:47 INFO - 0 |TOTAL | 24 0| 4009433 0| 11:32:47 INFO - nsTraceRefcnt::DumpStatistics: 1348 entries 11:32:47 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:32:47 INFO - runtests.py | Running tests: end. 11:32:47 INFO - 65 INFO TEST-START | Shutdown 11:32:47 INFO - 66 INFO Passed: 86 11:32:47 INFO - 67 INFO Failed: 0 11:32:47 INFO - 68 INFO Todo: 19 11:32:47 INFO - 69 INFO Slowest: 110449ms - /tests/image/test/mochitest/test_bug399925.html 11:32:47 INFO - 70 INFO SimpleTest FINISHED 11:32:47 INFO - 71 INFO TEST-INFO | Ran 1 Loops 11:32:47 INFO - 72 INFO SimpleTest FINISHED 11:32:47 INFO - dir: intl/uconv/tests 11:32:47 INFO - Setting pipeline to PAUSED ... 11:32:47 INFO - Pipeline is PREROLLING ... 11:32:47 INFO - Pipeline is PREROLLED ... 11:32:47 INFO - Setting pipeline to PLAYING ... 11:32:47 INFO - New clock: GstSystemClock 11:32:47 INFO - Got EOS from element "pipeline0". 11:32:47 INFO - Execution ended after 32848919 ns. 11:32:47 INFO - Setting pipeline to PAUSED ... 11:32:47 INFO - Setting pipeline to READY ... 11:32:47 INFO - Setting pipeline to NULL ... 11:32:47 INFO - Freeing pipeline ... 11:32:47 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:32:47 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpDY6W_X.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:32:47 INFO - runtests.py | Server pid: 2222 11:32:47 INFO - runtests.py | Websocket server pid: 2225 11:32:48 INFO - runtests.py | SSL tunnel pid: 2228 11:32:48 INFO - runtests.py | Running tests: start. 11:32:48 INFO - runtests.py | Application pid: 2250 11:32:48 INFO - TEST-INFO | started process Main app process 11:32:48 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpDY6W_X.mozrunner/runtests_leaks.log 11:32:52 INFO - ++DOCSHELL 0x7f0e4c781000 == 1 [pid = 2250] [id = 1] 11:32:52 INFO - ++DOMWINDOW == 1 (0x7f0e4c7ab800) [pid = 2250] [serial = 1] [outer = (nil)] 11:32:52 INFO - [2250] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:32:52 INFO - ++DOMWINDOW == 2 (0x7f0e4b969800) [pid = 2250] [serial = 2] [outer = 0x7f0e4c7ab800] 11:32:53 INFO - ++DOCSHELL 0x7f0e46e5d800 == 2 [pid = 2250] [id = 2] 11:32:53 INFO - ++DOMWINDOW == 3 (0x7f0e46d0b800) [pid = 2250] [serial = 3] [outer = (nil)] 11:32:53 INFO - ++DOMWINDOW == 4 (0x7f0e46d0c400) [pid = 2250] [serial = 4] [outer = 0x7f0e46d0b800] 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnptestjava.so returned 7f0e46dc41f0 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnpsecondtest.so returned 7f0e46dc45e0 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnptest.so returned 7f0e46dc4910 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnpctrltest.so returned 7f0e46dc4a00 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnpswftest.so returned 7f0e46dc4d30 11:32:53 INFO - LoadPlugin() /tmp/tmpDY6W_X.mozrunner/plugins/libnpthirdtest.so returned 7f0e460f9040 11:32:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f0e460f93a0 11:32:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f0e460fb5b0 11:32:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f0e460ff700 11:32:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f0e460ffa00 11:32:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f0e460ffd30 11:32:53 INFO - ++DOMWINDOW == 5 (0x7f0e46080800) [pid = 2250] [serial = 5] [outer = 0x7f0e4c7ab800] 11:32:55 INFO - [2250] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:32:56 INFO - ++DOCSHELL 0x7f0e3d0e9000 == 3 [pid = 2250] [id = 3] 11:32:56 INFO - ++DOMWINDOW == 6 (0x7f0e3d0a6c00) [pid = 2250] [serial = 6] [outer = (nil)] 11:32:56 INFO - ++DOCSHELL 0x7f0e3d0ed000 == 4 [pid = 2250] [id = 4] 11:32:56 INFO - ++DOMWINDOW == 7 (0x7f0e3d0a7400) [pid = 2250] [serial = 7] [outer = (nil)] 11:32:57 INFO - [2250] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:32:57 INFO - ++DOCSHELL 0x7f0e3bedf000 == 5 [pid = 2250] [id = 5] 11:32:57 INFO - ++DOMWINDOW == 8 (0x7f0e3be9c000) [pid = 2250] [serial = 8] [outer = (nil)] 11:32:57 INFO - [2250] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:32:57 INFO - ++DOMWINDOW == 9 (0x7f0e3b106c00) [pid = 2250] [serial = 9] [outer = 0x7f0e3be9c000] 11:32:57 INFO - ++DOMWINDOW == 10 (0x7f0e3ac0e800) [pid = 2250] [serial = 10] [outer = 0x7f0e3d0a6c00] 11:32:57 INFO - ++DOMWINDOW == 11 (0x7f0e3ac0f000) [pid = 2250] [serial = 11] [outer = 0x7f0e3d0a7400] 11:32:57 INFO - ++DOMWINDOW == 12 (0x7f0e3ac10c00) [pid = 2250] [serial = 12] [outer = 0x7f0e3be9c000] 11:33:00 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpDY6W_X.mozrunner/runtests_leaks_tab_pid2303.log 11:33:01 INFO - [Child 2303] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:33:02 INFO - ++DOCSHELL 0x7f4d1cc2e800 == 1 [pid = 2303] [id = 1] 11:33:02 INFO - ++DOMWINDOW == 1 (0x7f4d1cc7ac00) [pid = 2303] [serial = 1] [outer = (nil)] 11:33:02 INFO - ++DOMWINDOW == 2 (0x7f4d1be17000) [pid = 2303] [serial = 2] [outer = 0x7f4d1cc7ac00] 11:33:02 INFO - [Parent 2250] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:33:03 INFO - [Parent 2250] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:33:03 INFO - ++DOMWINDOW == 3 (0x7f4d1bbd5400) [pid = 2303] [serial = 3] [outer = 0x7f4d1cc7ac00] 11:33:04 INFO - ++DOCSHELL 0x7f0e3beda800 == 6 [pid = 2250] [id = 6] 11:33:04 INFO - ++DOMWINDOW == 13 (0x7f0e46081800) [pid = 2250] [serial = 13] [outer = (nil)] 11:33:04 INFO - ++DOMWINDOW == 14 (0x7f0e47265000) [pid = 2250] [serial = 14] [outer = 0x7f0e46081800] 11:33:04 INFO - ++DOMWINDOW == 15 (0x7f0e3a8cdc00) [pid = 2250] [serial = 15] [outer = 0x7f0e46081800] 11:33:05 INFO - ++DOCSHELL 0x7f0e3bf20000 == 7 [pid = 2250] [id = 7] 11:33:05 INFO - ++DOMWINDOW == 16 (0x7f0e3d07d800) [pid = 2250] [serial = 16] [outer = (nil)] 11:33:05 INFO - ++DOMWINDOW == 17 (0x7f0e46de5c00) [pid = 2250] [serial = 17] [outer = 0x7f0e3d07d800] 11:33:05 INFO - [Child 2303] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:33:05 INFO - [Child 2303] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:33:05 INFO - ++DOCSHELL 0x7f4d1b0a1000 == 2 [pid = 2303] [id = 2] 11:33:05 INFO - ++DOMWINDOW == 4 (0x7f4d1b091800) [pid = 2303] [serial = 4] [outer = (nil)] 11:33:05 INFO - ++DOMWINDOW == 5 (0x7f4d1b092400) [pid = 2303] [serial = 5] [outer = 0x7f4d1b091800] 11:33:05 INFO - 73 INFO TEST-START | intl/uconv/tests/test_big5_encoder.html 11:33:05 INFO - [Child 2303] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:33:06 INFO - ++DOMWINDOW == 6 (0x7f4d1a6f6c00) [pid = 2303] [serial = 6] [outer = 0x7f4d1b091800] 11:33:06 INFO - [Parent 2250] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:33:07 INFO - ++DOMWINDOW == 7 (0x7f4d1a58f000) [pid = 2303] [serial = 7] [outer = 0x7f4d1b091800] 11:33:08 INFO - --DOCSHELL 0x7f0e3bedf000 == 6 [pid = 2250] [id = 5] 11:33:08 INFO - ++DOCSHELL 0x7f4d1a57e800 == 3 [pid = 2303] [id = 3] 11:33:08 INFO - ++DOMWINDOW == 8 (0x7f4d1be1d400) [pid = 2303] [serial = 8] [outer = (nil)] 11:33:08 INFO - ++DOMWINDOW == 9 (0x7f4d1a5d3800) [pid = 2303] [serial = 9] [outer = 0x7f4d1be1d400] 11:33:08 INFO - ++DOMWINDOW == 10 (0x7f4d1a5da000) [pid = 2303] [serial = 10] [outer = 0x7f4d1be1d400] 11:33:08 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:33:08 INFO - MEMORY STAT | vsize 509MB | residentFast 88MB | heapAllocated 18MB 11:33:08 INFO - 74 INFO TEST-OK | intl/uconv/tests/test_big5_encoder.html | took 2821ms 11:33:08 INFO - ++DOMWINDOW == 11 (0x7f4d1a219000) [pid = 2303] [serial = 11] [outer = 0x7f4d1b091800] 11:33:09 INFO - 75 INFO TEST-START | intl/uconv/tests/test_bug335816.html 11:33:09 INFO - ++DOMWINDOW == 12 (0x7f4d1a219400) [pid = 2303] [serial = 12] [outer = 0x7f4d1b091800] 11:33:09 INFO - MEMORY STAT | vsize 510MB | residentFast 89MB | heapAllocated 19MB 11:33:09 INFO - 76 INFO TEST-OK | intl/uconv/tests/test_bug335816.html | took 386ms 11:33:09 INFO - ++DOMWINDOW == 13 (0x7f4d1a220c00) [pid = 2303] [serial = 13] [outer = 0x7f4d1b091800] 11:33:09 INFO - 77 INFO TEST-START | intl/uconv/tests/test_bug843434.html 11:33:09 INFO - ++DOMWINDOW == 14 (0x7f4d1a221800) [pid = 2303] [serial = 14] [outer = 0x7f4d1b091800] 11:33:09 INFO - MEMORY STAT | vsize 511MB | residentFast 91MB | heapAllocated 20MB 11:33:09 INFO - 78 INFO TEST-OK | intl/uconv/tests/test_bug843434.html | took 327ms 11:33:09 INFO - ++DOMWINDOW == 15 (0x7f4d1a066c00) [pid = 2303] [serial = 15] [outer = 0x7f4d1b091800] 11:33:10 INFO - 79 INFO TEST-START | intl/uconv/tests/test_bug959058-1.html 11:33:10 INFO - ++DOMWINDOW == 16 (0x7f4d1a067000) [pid = 2303] [serial = 16] [outer = 0x7f4d1b091800] 11:33:10 INFO - MEMORY STAT | vsize 522MB | residentFast 93MB | heapAllocated 21MB 11:33:10 INFO - 80 INFO TEST-OK | intl/uconv/tests/test_bug959058-1.html | took 267ms 11:33:10 INFO - ++DOMWINDOW == 17 (0x7f4d1a070400) [pid = 2303] [serial = 17] [outer = 0x7f4d1b091800] 11:33:10 INFO - 81 INFO TEST-START | intl/uconv/tests/test_bug959058-2.html 11:33:10 INFO - ++DOMWINDOW == 18 (0x7f4d1a070800) [pid = 2303] [serial = 18] [outer = 0x7f4d1b091800] 11:33:10 INFO - MEMORY STAT | vsize 524MB | residentFast 94MB | heapAllocated 21MB 11:33:10 INFO - 82 INFO TEST-OK | intl/uconv/tests/test_bug959058-2.html | took 278ms 11:33:10 INFO - ++DOMWINDOW == 19 (0x7f4d1a58e400) [pid = 2303] [serial = 19] [outer = 0x7f4d1b091800] 11:33:10 INFO - 83 INFO TEST-START | intl/uconv/tests/test_long_doc.html 11:33:10 INFO - ++DOMWINDOW == 20 (0x7f4d19ade800) [pid = 2303] [serial = 20] [outer = 0x7f4d1b091800] 11:33:11 INFO - ++DOCSHELL 0x7f4d19aa7000 == 4 [pid = 2303] [id = 4] 11:33:11 INFO - ++DOMWINDOW == 21 (0x7f4d19ae1400) [pid = 2303] [serial = 21] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 22 (0x7f4d19ae3800) [pid = 2303] [serial = 22] [outer = 0x7f4d19ae1400] 11:33:11 INFO - ++DOCSHELL 0x7f4d19aaa000 == 5 [pid = 2303] [id = 5] 11:33:11 INFO - ++DOMWINDOW == 23 (0x7f4d19ae5000) [pid = 2303] [serial = 23] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 24 (0x7f4d19ae5800) [pid = 2303] [serial = 24] [outer = 0x7f4d19ae5000] 11:33:11 INFO - ++DOCSHELL 0x7f4d19ab3800 == 6 [pid = 2303] [id = 6] 11:33:11 INFO - ++DOMWINDOW == 25 (0x7f4d19ae6c00) [pid = 2303] [serial = 25] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 26 (0x7f4d19ae7400) [pid = 2303] [serial = 26] [outer = 0x7f4d19ae6c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d1bb13800 == 7 [pid = 2303] [id = 7] 11:33:11 INFO - ++DOMWINDOW == 27 (0x7f4d19ae8400) [pid = 2303] [serial = 27] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 28 (0x7f4d19ae8c00) [pid = 2303] [serial = 28] [outer = 0x7f4d19ae8400] 11:33:11 INFO - ++DOCSHELL 0x7f4d1924d000 == 8 [pid = 2303] [id = 8] 11:33:11 INFO - ++DOMWINDOW == 29 (0x7f4d19aea000) [pid = 2303] [serial = 29] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 30 (0x7f4d19aea800) [pid = 2303] [serial = 30] [outer = 0x7f4d19aea000] 11:33:11 INFO - ++DOCSHELL 0x7f4d19252800 == 9 [pid = 2303] [id = 9] 11:33:11 INFO - ++DOMWINDOW == 31 (0x7f4d19aeb800) [pid = 2303] [serial = 31] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 32 (0x7f4d19aec000) [pid = 2303] [serial = 32] [outer = 0x7f4d19aeb800] 11:33:11 INFO - ++DOCSHELL 0x7f4d19257800 == 10 [pid = 2303] [id = 10] 11:33:11 INFO - ++DOMWINDOW == 33 (0x7f4d19aed000) [pid = 2303] [serial = 33] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 34 (0x7f4d19aed800) [pid = 2303] [serial = 34] [outer = 0x7f4d19aed000] 11:33:11 INFO - ++DOCSHELL 0x7f4d1925d800 == 11 [pid = 2303] [id = 11] 11:33:11 INFO - ++DOMWINDOW == 35 (0x7f4d1a221c00) [pid = 2303] [serial = 35] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 36 (0x7f4d1a224400) [pid = 2303] [serial = 36] [outer = 0x7f4d1a221c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d19264000 == 12 [pid = 2303] [id = 12] 11:33:11 INFO - ++DOMWINDOW == 37 (0x7f4d1a068c00) [pid = 2303] [serial = 37] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 38 (0x7f4d1bbd3400) [pid = 2303] [serial = 38] [outer = 0x7f4d1a068c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d1a351800 == 13 [pid = 2303] [id = 13] 11:33:11 INFO - ++DOMWINDOW == 39 (0x7f4d19078000) [pid = 2303] [serial = 39] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 40 (0x7f4d19078800) [pid = 2303] [serial = 40] [outer = 0x7f4d19078000] 11:33:11 INFO - ++DOCSHELL 0x7f4d190bd800 == 14 [pid = 2303] [id = 14] 11:33:11 INFO - ++DOMWINDOW == 41 (0x7f4d19079c00) [pid = 2303] [serial = 41] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 42 (0x7f4d1907a400) [pid = 2303] [serial = 42] [outer = 0x7f4d19079c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d190c3800 == 15 [pid = 2303] [id = 15] 11:33:11 INFO - ++DOMWINDOW == 43 (0x7f4d1907b400) [pid = 2303] [serial = 43] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 44 (0x7f4d1907bc00) [pid = 2303] [serial = 44] [outer = 0x7f4d1907b400] 11:33:11 INFO - ++DOCSHELL 0x7f4d190c8800 == 16 [pid = 2303] [id = 16] 11:33:11 INFO - ++DOMWINDOW == 45 (0x7f4d1907cc00) [pid = 2303] [serial = 45] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 46 (0x7f4d1907d800) [pid = 2303] [serial = 46] [outer = 0x7f4d1907cc00] 11:33:11 INFO - ++DOCSHELL 0x7f4d190cd800 == 17 [pid = 2303] [id = 17] 11:33:11 INFO - ++DOMWINDOW == 47 (0x7f4d1907e800) [pid = 2303] [serial = 47] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 48 (0x7f4d1907f400) [pid = 2303] [serial = 48] [outer = 0x7f4d1907e800] 11:33:11 INFO - ++DOCSHELL 0x7f4d190d3000 == 18 [pid = 2303] [id = 18] 11:33:11 INFO - ++DOMWINDOW == 49 (0x7f4d19080400) [pid = 2303] [serial = 49] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 50 (0x7f4d19080c00) [pid = 2303] [serial = 50] [outer = 0x7f4d19080400] 11:33:11 INFO - ++DOCSHELL 0x7f4d190d8000 == 19 [pid = 2303] [id = 19] 11:33:11 INFO - ++DOMWINDOW == 51 (0x7f4d19081c00) [pid = 2303] [serial = 51] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 52 (0x7f4d19082400) [pid = 2303] [serial = 52] [outer = 0x7f4d19081c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d18d29000 == 20 [pid = 2303] [id = 20] 11:33:11 INFO - ++DOMWINDOW == 53 (0x7f4d19083c00) [pid = 2303] [serial = 53] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 54 (0x7f4d19084400) [pid = 2303] [serial = 54] [outer = 0x7f4d19083c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d18d2e000 == 21 [pid = 2303] [id = 21] 11:33:11 INFO - ++DOMWINDOW == 55 (0x7f4d19085400) [pid = 2303] [serial = 55] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 56 (0x7f4d19085c00) [pid = 2303] [serial = 56] [outer = 0x7f4d19085400] 11:33:11 INFO - ++DOCSHELL 0x7f4d18d33000 == 22 [pid = 2303] [id = 22] 11:33:11 INFO - ++DOMWINDOW == 57 (0x7f4d19086c00) [pid = 2303] [serial = 57] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 58 (0x7f4d19ae7c00) [pid = 2303] [serial = 58] [outer = 0x7f4d19086c00] 11:33:11 INFO - ++DOCSHELL 0x7f4d18d38000 == 23 [pid = 2303] [id = 23] 11:33:11 INFO - ++DOMWINDOW == 59 (0x7f4d1a21f800) [pid = 2303] [serial = 59] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 60 (0x7f4d1e9f0800) [pid = 2303] [serial = 60] [outer = 0x7f4d1a21f800] 11:33:11 INFO - ++DOCSHELL 0x7f4d18d3d800 == 24 [pid = 2303] [id = 24] 11:33:11 INFO - ++DOMWINDOW == 61 (0x7f4d18c2dc00) [pid = 2303] [serial = 61] [outer = (nil)] 11:33:11 INFO - ++DOMWINDOW == 62 (0x7f4d18c2e400) [pid = 2303] [serial = 62] [outer = 0x7f4d18c2dc00] 11:33:12 INFO - ++DOCSHELL 0x7f4d18d42800 == 25 [pid = 2303] [id = 25] 11:33:12 INFO - ++DOMWINDOW == 63 (0x7f4d18c2f800) [pid = 2303] [serial = 63] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 64 (0x7f4d18c30800) [pid = 2303] [serial = 64] [outer = 0x7f4d18c2f800] 11:33:12 INFO - ++DOCSHELL 0x7f4d18cbd800 == 26 [pid = 2303] [id = 26] 11:33:12 INFO - ++DOMWINDOW == 65 (0x7f4d18c31800) [pid = 2303] [serial = 65] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 66 (0x7f4d18c32000) [pid = 2303] [serial = 66] [outer = 0x7f4d18c31800] 11:33:12 INFO - ++DOCSHELL 0x7f4d18cc2800 == 27 [pid = 2303] [id = 27] 11:33:12 INFO - ++DOMWINDOW == 67 (0x7f4d18c33000) [pid = 2303] [serial = 67] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 68 (0x7f4d18c33800) [pid = 2303] [serial = 68] [outer = 0x7f4d18c33000] 11:33:12 INFO - ++DOCSHELL 0x7f4d18cc7800 == 28 [pid = 2303] [id = 28] 11:33:12 INFO - ++DOMWINDOW == 69 (0x7f4d18c34800) [pid = 2303] [serial = 69] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 70 (0x7f4d18c35000) [pid = 2303] [serial = 70] [outer = 0x7f4d18c34800] 11:33:12 INFO - ++DOCSHELL 0x7f4d18ccd000 == 29 [pid = 2303] [id = 29] 11:33:12 INFO - ++DOMWINDOW == 71 (0x7f4d18c36000) [pid = 2303] [serial = 71] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 72 (0x7f4d18c36800) [pid = 2303] [serial = 72] [outer = 0x7f4d18c36000] 11:33:12 INFO - ++DOCSHELL 0x7f4d18cd2000 == 30 [pid = 2303] [id = 30] 11:33:12 INFO - ++DOMWINDOW == 73 (0x7f4d18c37c00) [pid = 2303] [serial = 73] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 74 (0x7f4d18c38400) [pid = 2303] [serial = 74] [outer = 0x7f4d18c37c00] 11:33:12 INFO - ++DOCSHELL 0x7f4d18cd7000 == 31 [pid = 2303] [id = 31] 11:33:12 INFO - ++DOMWINDOW == 75 (0x7f4d18c39400) [pid = 2303] [serial = 75] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 76 (0x7f4d18c39c00) [pid = 2303] [serial = 76] [outer = 0x7f4d18c39400] 11:33:12 INFO - ++DOCSHELL 0x7f4d18971800 == 32 [pid = 2303] [id = 32] 11:33:12 INFO - ++DOMWINDOW == 77 (0x7f4d18c3b000) [pid = 2303] [serial = 77] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 78 (0x7f4d18c3b800) [pid = 2303] [serial = 78] [outer = 0x7f4d18c3b000] 11:33:12 INFO - ++DOCSHELL 0x7f4d18976800 == 33 [pid = 2303] [id = 33] 11:33:12 INFO - ++DOMWINDOW == 79 (0x7f4d189a9c00) [pid = 2303] [serial = 79] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 80 (0x7f4d189aa400) [pid = 2303] [serial = 80] [outer = 0x7f4d189a9c00] 11:33:12 INFO - ++DOCSHELL 0x7f4d1897b800 == 34 [pid = 2303] [id = 34] 11:33:12 INFO - ++DOMWINDOW == 81 (0x7f4d189ab800) [pid = 2303] [serial = 81] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 82 (0x7f4d189ac000) [pid = 2303] [serial = 82] [outer = 0x7f4d189ab800] 11:33:12 INFO - ++DOCSHELL 0x7f4d18980800 == 35 [pid = 2303] [id = 35] 11:33:12 INFO - ++DOMWINDOW == 83 (0x7f4d189ad000) [pid = 2303] [serial = 83] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 84 (0x7f4d189ad800) [pid = 2303] [serial = 84] [outer = 0x7f4d189ad000] 11:33:12 INFO - ++DOCSHELL 0x7f4d18985800 == 36 [pid = 2303] [id = 36] 11:33:12 INFO - ++DOMWINDOW == 85 (0x7f4d189ae800) [pid = 2303] [serial = 85] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 86 (0x7f4d189af000) [pid = 2303] [serial = 86] [outer = 0x7f4d189ae800] 11:33:12 INFO - ++DOCSHELL 0x7f4d1898a800 == 37 [pid = 2303] [id = 37] 11:33:12 INFO - ++DOMWINDOW == 87 (0x7f4d189b0000) [pid = 2303] [serial = 87] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 88 (0x7f4d189b0800) [pid = 2303] [serial = 88] [outer = 0x7f4d189b0000] 11:33:12 INFO - ++DOCSHELL 0x7f4d1898f800 == 38 [pid = 2303] [id = 38] 11:33:12 INFO - ++DOMWINDOW == 89 (0x7f4d189b1800) [pid = 2303] [serial = 89] [outer = (nil)] 11:33:12 INFO - ++DOMWINDOW == 90 (0x7f4d189b2000) [pid = 2303] [serial = 90] [outer = 0x7f4d189b1800] 11:33:16 INFO - MEMORY STAT | vsize 573MB | residentFast 130MB | heapAllocated 47MB 11:33:16 INFO - 84 INFO TEST-OK | intl/uconv/tests/test_long_doc.html | took 6086ms 11:33:17 INFO - ++DOMWINDOW == 91 (0x7f4d1850b400) [pid = 2303] [serial = 91] [outer = 0x7f4d1b091800] 11:33:17 INFO - 85 INFO TEST-START | intl/uconv/tests/test_ncr_fallback.html 11:33:17 INFO - ++DOMWINDOW == 92 (0x7f4d1850c400) [pid = 2303] [serial = 92] [outer = 0x7f4d1b091800] 11:33:17 INFO - ++DOCSHELL 0x7f4d1897e800 == 39 [pid = 2303] [id = 39] 11:33:17 INFO - ++DOMWINDOW == 93 (0x7f4d186a1800) [pid = 2303] [serial = 93] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d1897f000 == 40 [pid = 2303] [id = 40] 11:33:17 INFO - ++DOMWINDOW == 94 (0x7f4d186a8c00) [pid = 2303] [serial = 94] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18980000 == 41 [pid = 2303] [id = 41] 11:33:17 INFO - ++DOMWINDOW == 95 (0x7f4d186aa400) [pid = 2303] [serial = 95] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18985000 == 42 [pid = 2303] [id = 42] 11:33:17 INFO - ++DOMWINDOW == 96 (0x7f4d186ac400) [pid = 2303] [serial = 96] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d1898a000 == 43 [pid = 2303] [id = 43] 11:33:17 INFO - ++DOMWINDOW == 97 (0x7f4d186ad400) [pid = 2303] [serial = 97] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d1898d800 == 44 [pid = 2303] [id = 44] 11:33:17 INFO - ++DOMWINDOW == 98 (0x7f4d189aa800) [pid = 2303] [serial = 98] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cbc800 == 45 [pid = 2303] [id = 45] 11:33:17 INFO - ++DOMWINDOW == 99 (0x7f4d189ae000) [pid = 2303] [serial = 99] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cc0800 == 46 [pid = 2303] [id = 46] 11:33:17 INFO - ++DOMWINDOW == 100 (0x7f4d189b1000) [pid = 2303] [serial = 100] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cc1000 == 47 [pid = 2303] [id = 47] 11:33:17 INFO - ++DOMWINDOW == 101 (0x7f4d189b3000) [pid = 2303] [serial = 101] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cc2000 == 48 [pid = 2303] [id = 48] 11:33:17 INFO - ++DOMWINDOW == 102 (0x7f4d189b4000) [pid = 2303] [serial = 102] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cc5800 == 49 [pid = 2303] [id = 49] 11:33:17 INFO - ++DOMWINDOW == 103 (0x7f4d189b5400) [pid = 2303] [serial = 103] [outer = (nil)] 11:33:17 INFO - ++DOCSHELL 0x7f4d18cc7000 == 50 [pid = 2303] [id = 50] 11:33:17 INFO - ++DOMWINDOW == 104 (0x7f4d189b6c00) [pid = 2303] [serial = 104] [outer = (nil)] 11:33:17 INFO - ++DOMWINDOW == 105 (0x7f4d18c30000) [pid = 2303] [serial = 105] [outer = 0x7f4d186a1800] 11:33:17 INFO - ++DOMWINDOW == 106 (0x7f4d18c32800) [pid = 2303] [serial = 106] [outer = 0x7f4d186a8c00] 11:33:17 INFO - ++DOMWINDOW == 107 (0x7f4d18c38800) [pid = 2303] [serial = 107] [outer = 0x7f4d186aa400] 11:33:17 INFO - ++DOMWINDOW == 108 (0x7f4d18c3a400) [pid = 2303] [serial = 108] [outer = 0x7f4d186ac400] 11:33:17 INFO - ++DOMWINDOW == 109 (0x7f4d19079000) [pid = 2303] [serial = 109] [outer = 0x7f4d186ad400] 11:33:17 INFO - ++DOMWINDOW == 110 (0x7f4d1907c400) [pid = 2303] [serial = 110] [outer = 0x7f4d189aa800] 11:33:17 INFO - ++DOMWINDOW == 111 (0x7f4d18c2c800) [pid = 2303] [serial = 111] [outer = 0x7f4d189ae000] 11:33:17 INFO - ++DOMWINDOW == 112 (0x7f4d1907e000) [pid = 2303] [serial = 112] [outer = 0x7f4d189b1000] 11:33:18 INFO - ++DOMWINDOW == 113 (0x7f4d19adf800) [pid = 2303] [serial = 113] [outer = 0x7f4d189b3000] 11:33:18 INFO - ++DOMWINDOW == 114 (0x7f4d1a066000) [pid = 2303] [serial = 114] [outer = 0x7f4d189b4000] 11:33:18 INFO - ++DOMWINDOW == 115 (0x7f4d1a069000) [pid = 2303] [serial = 115] [outer = 0x7f4d189b5400] 11:33:18 INFO - ++DOMWINDOW == 116 (0x7f4d1a06f800) [pid = 2303] [serial = 116] [outer = 0x7f4d189b6c00] 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:18 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:18 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:18 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:18 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:18 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:18 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:18 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:18 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:18 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:18 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:19 INFO - ++DOMWINDOW == 117 (0x7f4d1850e800) [pid = 2303] [serial = 117] [outer = 0x7f4d186a1800] 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:19 INFO - ++DOMWINDOW == 118 (0x7f4d18511000) [pid = 2303] [serial = 118] [outer = 0x7f4d186a8c00] 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 593 11:33:19 INFO - [Child 2303] WARNING: String ending in half a surrogate pair!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 494 11:33:19 INFO - ++DOMWINDOW == 119 (0x7f4d186a6c00) [pid = 2303] [serial = 119] [outer = 0x7f4d186aa400] 11:33:20 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:20 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:20 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:20 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:20 INFO - ++DOMWINDOW == 120 (0x7f4d189a8c00) [pid = 2303] [serial = 120] [outer = 0x7f4d186ac400] 11:33:20 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:20 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:20 INFO - [Child 2303] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:33:20 INFO - [Child 2303] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:33:20 INFO - --DOCSHELL 0x7f4d1a57e800 == 49 [pid = 2303] [id = 3] 11:33:20 INFO - --DOMWINDOW == 119 (0x7f4d1a5d3800) [pid = 2303] [serial = 9] [outer = 0x7f4d1be1d400] [url = data:text/html;charset=big5,
] 11:33:20 INFO - ++DOMWINDOW == 120 (0x7f4d1907a000) [pid = 2303] [serial = 121] [outer = 0x7f4d186ad400] 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:20 INFO - ++DOMWINDOW == 121 (0x7f4d19080800) [pid = 2303] [serial = 122] [outer = 0x7f4d189aa800] 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:20 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:21 INFO - ++DOMWINDOW == 122 (0x7f4d19084000) [pid = 2303] [serial = 123] [outer = 0x7f4d189ae000] 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:21 INFO - ++DOMWINDOW == 123 (0x7f4d19ae0000) [pid = 2303] [serial = 124] [outer = 0x7f4d189b1000] 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 623 11:33:21 INFO - [Child 2303] WARNING: got a low Surrogate but no high surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 537 11:33:21 INFO - ++DOMWINDOW == 124 (0x7f4d19ae3c00) [pid = 2303] [serial = 125] [outer = 0x7f4d189b3000] 11:33:21 INFO - --DOMWINDOW == 16 (0x7f0e3be9c000) [pid = 2250] [serial = 8] [outer = (nil)] [url = about:blank] 11:33:21 INFO - --DOMWINDOW == 15 (0x7f0e3ac10c00) [pid = 2250] [serial = 12] [outer = (nil)] [url = about:blank] 11:33:21 INFO - --DOMWINDOW == 14 (0x7f0e3b106c00) [pid = 2250] [serial = 9] [outer = (nil)] [url = about:blank] 11:33:21 INFO - --DOMWINDOW == 13 (0x7f0e4b969800) [pid = 2250] [serial = 2] [outer = (nil)] [url = about:blank] 11:33:21 INFO - --DOMWINDOW == 12 (0x7f0e47265000) [pid = 2250] [serial = 14] [outer = (nil)] [url = about:blank] 11:33:21 INFO - ++DOMWINDOW == 125 (0x7f4d19083800) [pid = 2303] [serial = 126] [outer = 0x7f4d189b4000] 11:33:21 INFO - ++DOMWINDOW == 126 (0x7f4d19ae9c00) [pid = 2303] [serial = 127] [outer = 0x7f4d189b5400] 11:33:22 INFO - ++DOMWINDOW == 127 (0x7f4d19aecc00) [pid = 2303] [serial = 128] [outer = 0x7f4d189b6c00] 11:33:22 INFO - MEMORY STAT | vsize 578MB | residentFast 134MB | heapAllocated 45MB 11:33:22 INFO - 86 INFO TEST-OK | intl/uconv/tests/test_ncr_fallback.html | took 4893ms 11:33:22 INFO - ++DOMWINDOW == 128 (0x7f4d1a06c800) [pid = 2303] [serial = 129] [outer = 0x7f4d1b091800] 11:33:22 INFO - 87 INFO TEST-START | intl/uconv/tests/test_singlebyte_overconsumption.html 11:33:22 INFO - ++DOMWINDOW == 129 (0x7f4d18c34400) [pid = 2303] [serial = 130] [outer = 0x7f4d1b091800] 11:33:22 INFO - MEMORY STAT | vsize 579MB | residentFast 134MB | heapAllocated 46MB 11:33:22 INFO - 88 INFO TEST-OK | intl/uconv/tests/test_singlebyte_overconsumption.html | took 345ms 11:33:22 INFO - ++DOMWINDOW == 130 (0x7f4d1850ec00) [pid = 2303] [serial = 131] [outer = 0x7f4d1b091800] 11:33:23 INFO - 89 INFO TEST-START | intl/uconv/tests/test_unicode_noncharacterescapes.html 11:33:23 INFO - ++DOMWINDOW == 131 (0x7f4d189adc00) [pid = 2303] [serial = 132] [outer = 0x7f4d1b091800] 11:33:23 INFO - MEMORY STAT | vsize 579MB | residentFast 136MB | heapAllocated 46MB 11:33:23 INFO - 90 INFO TEST-OK | intl/uconv/tests/test_unicode_noncharacterescapes.html | took 418ms 11:33:23 INFO - ++DOMWINDOW == 132 (0x7f4d18c35c00) [pid = 2303] [serial = 133] [outer = 0x7f4d1b091800] 11:33:23 INFO - 91 INFO TEST-START | intl/uconv/tests/test_unicode_noncharacters_gb18030.html 11:33:23 INFO - ++DOMWINDOW == 133 (0x7f4d18c39800) [pid = 2303] [serial = 134] [outer = 0x7f4d1b091800] 11:33:24 INFO - MEMORY STAT | vsize 581MB | residentFast 137MB | heapAllocated 47MB 11:33:24 INFO - 92 INFO TEST-OK | intl/uconv/tests/test_unicode_noncharacters_gb18030.html | took 800ms 11:33:24 INFO - ++DOMWINDOW == 134 (0x7f4d18c36400) [pid = 2303] [serial = 135] [outer = 0x7f4d1b091800] 11:33:24 INFO - 93 INFO TEST-START | intl/uconv/tests/test_unicode_noncharacters_utf8.html 11:33:25 INFO - ++DOMWINDOW == 135 (0x7f4d189b2800) [pid = 2303] [serial = 136] [outer = 0x7f4d1b091800] 11:33:25 INFO - MEMORY STAT | vsize 581MB | residentFast 128MB | heapAllocated 36MB 11:33:25 INFO - 94 INFO TEST-OK | intl/uconv/tests/test_unicode_noncharacters_utf8.html | took 687ms 11:33:25 INFO - ++DOMWINDOW == 136 (0x7f4d18c34c00) [pid = 2303] [serial = 137] [outer = 0x7f4d1b091800] 11:33:26 INFO - 95 INFO TEST-START | intl/uconv/tests/test_utf8_overconsumption.html 11:33:26 INFO - --DOCSHELL 0x7f4d1897e800 == 48 [pid = 2303] [id = 39] 11:33:26 INFO - --DOCSHELL 0x7f4d1897f000 == 47 [pid = 2303] [id = 40] 11:33:26 INFO - --DOCSHELL 0x7f4d18980000 == 46 [pid = 2303] [id = 41] 11:33:26 INFO - --DOCSHELL 0x7f4d18985000 == 45 [pid = 2303] [id = 42] 11:33:26 INFO - --DOCSHELL 0x7f4d1898a000 == 44 [pid = 2303] [id = 43] 11:33:26 INFO - --DOCSHELL 0x7f4d1898d800 == 43 [pid = 2303] [id = 44] 11:33:26 INFO - --DOCSHELL 0x7f4d18cbc800 == 42 [pid = 2303] [id = 45] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc0800 == 41 [pid = 2303] [id = 46] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc1000 == 40 [pid = 2303] [id = 47] 11:33:26 INFO - --DOCSHELL 0x7f4d19aa7000 == 39 [pid = 2303] [id = 4] 11:33:26 INFO - --DOCSHELL 0x7f4d19aaa000 == 38 [pid = 2303] [id = 5] 11:33:26 INFO - --DOCSHELL 0x7f4d19ab3800 == 37 [pid = 2303] [id = 6] 11:33:26 INFO - --DOCSHELL 0x7f4d1bb13800 == 36 [pid = 2303] [id = 7] 11:33:26 INFO - --DOCSHELL 0x7f4d1924d000 == 35 [pid = 2303] [id = 8] 11:33:26 INFO - --DOCSHELL 0x7f4d19252800 == 34 [pid = 2303] [id = 9] 11:33:26 INFO - --DOCSHELL 0x7f4d19257800 == 33 [pid = 2303] [id = 10] 11:33:26 INFO - --DOCSHELL 0x7f4d1925d800 == 32 [pid = 2303] [id = 11] 11:33:26 INFO - --DOCSHELL 0x7f4d19264000 == 31 [pid = 2303] [id = 12] 11:33:26 INFO - --DOCSHELL 0x7f4d1a351800 == 30 [pid = 2303] [id = 13] 11:33:26 INFO - --DOCSHELL 0x7f4d190bd800 == 29 [pid = 2303] [id = 14] 11:33:26 INFO - --DOCSHELL 0x7f4d190c8800 == 28 [pid = 2303] [id = 16] 11:33:26 INFO - --DOCSHELL 0x7f4d190cd800 == 27 [pid = 2303] [id = 17] 11:33:26 INFO - --DOCSHELL 0x7f4d18d29000 == 26 [pid = 2303] [id = 20] 11:33:26 INFO - --DOCSHELL 0x7f4d18d2e000 == 25 [pid = 2303] [id = 21] 11:33:26 INFO - --DOCSHELL 0x7f4d190c3800 == 24 [pid = 2303] [id = 15] 11:33:26 INFO - --DOCSHELL 0x7f4d190d8000 == 23 [pid = 2303] [id = 19] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc2000 == 22 [pid = 2303] [id = 48] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc5800 == 21 [pid = 2303] [id = 49] 11:33:26 INFO - --DOCSHELL 0x7f4d190d3000 == 20 [pid = 2303] [id = 18] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc7000 == 19 [pid = 2303] [id = 50] 11:33:26 INFO - --DOCSHELL 0x7f4d18d33000 == 18 [pid = 2303] [id = 22] 11:33:26 INFO - --DOCSHELL 0x7f4d18d38000 == 17 [pid = 2303] [id = 23] 11:33:26 INFO - --DOCSHELL 0x7f4d18d3d800 == 16 [pid = 2303] [id = 24] 11:33:26 INFO - --DOCSHELL 0x7f4d18d42800 == 15 [pid = 2303] [id = 25] 11:33:26 INFO - --DOCSHELL 0x7f4d18cbd800 == 14 [pid = 2303] [id = 26] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc2800 == 13 [pid = 2303] [id = 27] 11:33:26 INFO - --DOCSHELL 0x7f4d18cc7800 == 12 [pid = 2303] [id = 28] 11:33:26 INFO - --DOCSHELL 0x7f4d18ccd000 == 11 [pid = 2303] [id = 29] 11:33:26 INFO - --DOCSHELL 0x7f4d18cd7000 == 10 [pid = 2303] [id = 31] 11:33:26 INFO - --DOCSHELL 0x7f4d18971800 == 9 [pid = 2303] [id = 32] 11:33:26 INFO - --DOCSHELL 0x7f4d18976800 == 8 [pid = 2303] [id = 33] 11:33:26 INFO - --DOCSHELL 0x7f4d1897b800 == 7 [pid = 2303] [id = 34] 11:33:26 INFO - --DOCSHELL 0x7f4d18980800 == 6 [pid = 2303] [id = 35] 11:33:26 INFO - --DOCSHELL 0x7f4d18985800 == 5 [pid = 2303] [id = 36] 11:33:26 INFO - --DOCSHELL 0x7f4d1898f800 == 4 [pid = 2303] [id = 38] 11:33:26 INFO - --DOCSHELL 0x7f4d18cd2000 == 3 [pid = 2303] [id = 30] 11:33:26 INFO - --DOCSHELL 0x7f4d1898a800 == 2 [pid = 2303] [id = 37] 11:33:27 INFO - --DOMWINDOW == 135 (0x7f4d1a5da000) [pid = 2303] [serial = 10] [outer = 0x7f4d1be1d400] [url = data:text/html;charset=big5,
?foo=h%26%2340614%3Bi%26%23156267%3Bj%A1%40k%A3%E1l%A4%40m%C8%A4n%C8%CDo%FE%FEp%26%238365%3Bq%FDjr%F9%F9s%26%23128169%3Bt] 11:33:27 INFO - ++DOMWINDOW == 136 (0x7f4d1850dc00) [pid = 2303] [serial = 138] [outer = 0x7f4d1b091800] 11:33:27 INFO - --DOMWINDOW == 135 (0x7f4d19aecc00) [pid = 2303] [serial = 128] [outer = 0x7f4d189b6c00] [url = data:text/html;charset=iso-2022-jp,?foo=%1B%24B%22%29%1B%28B%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 134 (0x7f4d19ae9c00) [pid = 2303] [serial = 127] [outer = 0x7f4d189b5400] [url = data:text/html;charset=iso-2022-jp,?foo=%1B%24B%22%29%1B%28B] 11:33:27 INFO - --DOMWINDOW == 133 (0x7f4d19083800) [pid = 2303] [serial = 126] [outer = 0x7f4d189b4000] [url = data:text/html;charset=iso-2022-jp,?foo=%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 132 (0x7f4d19ae3c00) [pid = 2303] [serial = 125] [outer = 0x7f4d189b3000] [url = data:text/html;charset=big5,?foo=%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 131 (0x7f4d186a6c00) [pid = 2303] [serial = 119] [outer = 0x7f4d186aa400] [url = data:text/html;charset=big5,?foo=%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 130 (0x7f4d18511000) [pid = 2303] [serial = 118] [outer = 0x7f4d186a8c00] [url = data:text/html;charset=big5,?foo=a%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 129 (0x7f4d1850e800) [pid = 2303] [serial = 117] [outer = 0x7f4d186a1800] [url = data:text/html;charset=big5,?foo=%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 128 (0x7f4d1a06f800) [pid = 2303] [serial = 116] [outer = 0x7f4d189b6c00] [url = data:text/html;charset=iso-2022-jp,] 11:33:27 INFO - --DOMWINDOW == 127 (0x7f4d1a069000) [pid = 2303] [serial = 115] [outer = 0x7f4d189b5400] [url = data:text/html;charset=iso-2022-jp,] 11:33:27 INFO - --DOMWINDOW == 126 (0x7f4d1a066000) [pid = 2303] [serial = 114] [outer = 0x7f4d189b4000] [url = data:text/html;charset=iso-2022-jp,] 11:33:27 INFO - --DOMWINDOW == 125 (0x7f4d19adf800) [pid = 2303] [serial = 113] [outer = 0x7f4d189b3000] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 124 (0x7f4d18c38800) [pid = 2303] [serial = 107] [outer = 0x7f4d186aa400] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 123 (0x7f4d18c32800) [pid = 2303] [serial = 106] [outer = 0x7f4d186a8c00] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 122 (0x7f4d19ae0000) [pid = 2303] [serial = 124] [outer = 0x7f4d189b1000] [url = data:text/html;charset=big5,?foo=a%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 121 (0x7f4d1907e000) [pid = 2303] [serial = 112] [outer = 0x7f4d189b1000] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 120 (0x7f4d18c2c800) [pid = 2303] [serial = 111] [outer = 0x7f4d189ae000] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 119 (0x7f4d1907c400) [pid = 2303] [serial = 110] [outer = 0x7f4d189aa800] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 118 (0x7f4d19079000) [pid = 2303] [serial = 109] [outer = 0x7f4d186ad400] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 117 (0x7f4d18c3a400) [pid = 2303] [serial = 108] [outer = 0x7f4d186ac400] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 116 (0x7f4d18c30000) [pid = 2303] [serial = 105] [outer = 0x7f4d186a1800] [url = data:text/html;charset=big5,] 11:33:27 INFO - --DOMWINDOW == 115 (0x7f4d19084000) [pid = 2303] [serial = 123] [outer = 0x7f4d189ae000] [url = data:text/html;charset=big5,?foo=%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 114 (0x7f4d19080800) [pid = 2303] [serial = 122] [outer = 0x7f4d189aa800] [url = data:text/html;charset=big5,?foo=a%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 113 (0x7f4d1907a000) [pid = 2303] [serial = 121] [outer = 0x7f4d186ad400] [url = data:text/html;charset=big5,?foo=%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 112 (0x7f4d189a8c00) [pid = 2303] [serial = 120] [outer = 0x7f4d186ac400] [url = data:text/html;charset=big5,?foo=a%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 111 (0x7f4d1be1d400) [pid = 2303] [serial = 8] [outer = (nil)] [url = data:text/html;charset=big5,
?foo=h%26%2340614%3Bi%26%23156267%3Bj%A1%40k%A3%E1l%A4%40m%C8%A4n%C8%CDo%FE%FEp%26%238365%3Bq%FDjr%F9%F9s%26%23128169%3Bt] 11:33:27 INFO - --DOMWINDOW == 110 (0x7f4d186a8c00) [pid = 2303] [serial = 94] [outer = (nil)] [url = data:text/html;charset=big5,?foo=a%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 109 (0x7f4d186aa400) [pid = 2303] [serial = 95] [outer = (nil)] [url = data:text/html;charset=big5,?foo=%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 108 (0x7f4d186ac400) [pid = 2303] [serial = 96] [outer = (nil)] [url = data:text/html;charset=big5,?foo=a%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 107 (0x7f4d186ad400) [pid = 2303] [serial = 97] [outer = (nil)] [url = data:text/html;charset=big5,?foo=%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 106 (0x7f4d189aa800) [pid = 2303] [serial = 98] [outer = (nil)] [url = data:text/html;charset=big5,?foo=a%26%2365533%3B] 11:33:27 INFO - --DOMWINDOW == 105 (0x7f4d189ae000) [pid = 2303] [serial = 99] [outer = (nil)] [url = data:text/html;charset=big5,?foo=%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 104 (0x7f4d189b1000) [pid = 2303] [serial = 100] [outer = (nil)] [url = data:text/html;charset=big5,?foo=a%26%2365533%3Ba] 11:33:27 INFO - --DOMWINDOW == 103 (0x7f4d189b3000) [pid = 2303] [serial = 101] [outer = (nil)] [url = data:text/html;charset=big5,?foo=%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 102 (0x7f4d189b4000) [pid = 2303] [serial = 102] [outer = (nil)] [url = data:text/html;charset=iso-2022-jp,?foo=%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 101 (0x7f4d189b5400) [pid = 2303] [serial = 103] [outer = (nil)] [url = data:text/html;charset=iso-2022-jp,?foo=%1B%24B%22%29%1B%28B] 11:33:27 INFO - --DOMWINDOW == 100 (0x7f4d189b6c00) [pid = 2303] [serial = 104] [outer = (nil)] [url = data:text/html;charset=iso-2022-jp,?foo=%1B%24B%22%29%1B%28B%26%23128169%3B] 11:33:27 INFO - --DOMWINDOW == 99 (0x7f4d186a1800) [pid = 2303] [serial = 93] [outer = (nil)] [url = data:text/html;charset=big5,?foo=%26%2365533%3B] 11:33:27 INFO - MEMORY STAT | vsize 580MB | residentFast 107MB | heapAllocated 23MB 11:33:27 INFO - 96 INFO TEST-OK | intl/uconv/tests/test_utf8_overconsumption.html | took 1914ms 11:33:28 INFO - ++DOMWINDOW == 100 (0x7f4d189b1000) [pid = 2303] [serial = 139] [outer = 0x7f4d1b091800] 11:33:28 INFO - ++DOMWINDOW == 101 (0x7f4d189b3000) [pid = 2303] [serial = 140] [outer = 0x7f4d1b091800] 11:33:29 INFO - --DOCSHELL 0x7f0e3beda800 == 5 [pid = 2250] [id = 6] 11:33:29 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:33:29 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:33:30 INFO - --DOCSHELL 0x7f0e4c781000 == 4 [pid = 2250] [id = 1] 11:33:30 INFO - --DOMWINDOW == 100 (0x7f4d1a224400) [pid = 2303] [serial = 36] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 99 (0x7f4d19aed800) [pid = 2303] [serial = 34] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 98 (0x7f4d19aec000) [pid = 2303] [serial = 32] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 97 (0x7f4d19aea800) [pid = 2303] [serial = 30] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 96 (0x7f4d19ae8c00) [pid = 2303] [serial = 28] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 95 (0x7f4d19ae7400) [pid = 2303] [serial = 26] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 94 (0x7f4d19ae5800) [pid = 2303] [serial = 24] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 93 (0x7f4d19ae3800) [pid = 2303] [serial = 22] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 92 (0x7f4d189b2000) [pid = 2303] [serial = 90] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 91 (0x7f4d189b0800) [pid = 2303] [serial = 88] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 90 (0x7f4d189af000) [pid = 2303] [serial = 86] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 89 (0x7f4d189ad800) [pid = 2303] [serial = 84] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 88 (0x7f4d189ac000) [pid = 2303] [serial = 82] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 87 (0x7f4d189aa400) [pid = 2303] [serial = 80] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 86 (0x7f4d18c3b800) [pid = 2303] [serial = 78] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 85 (0x7f4d18c39c00) [pid = 2303] [serial = 76] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 84 (0x7f4d18c38400) [pid = 2303] [serial = 74] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 83 (0x7f4d18c36800) [pid = 2303] [serial = 72] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 82 (0x7f4d18c35000) [pid = 2303] [serial = 70] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 81 (0x7f4d18c33800) [pid = 2303] [serial = 68] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 80 (0x7f4d18c32000) [pid = 2303] [serial = 66] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 79 (0x7f4d18c30800) [pid = 2303] [serial = 64] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 78 (0x7f4d18c2e400) [pid = 2303] [serial = 62] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 77 (0x7f4d1e9f0800) [pid = 2303] [serial = 60] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 76 (0x7f4d19ae7c00) [pid = 2303] [serial = 58] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 75 (0x7f4d19085c00) [pid = 2303] [serial = 56] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 74 (0x7f4d19084400) [pid = 2303] [serial = 54] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 73 (0x7f4d19082400) [pid = 2303] [serial = 52] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 72 (0x7f4d19080c00) [pid = 2303] [serial = 50] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 71 (0x7f4d1907f400) [pid = 2303] [serial = 48] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 70 (0x7f4d1907d800) [pid = 2303] [serial = 46] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 69 (0x7f4d1907bc00) [pid = 2303] [serial = 44] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 68 (0x7f4d1907a400) [pid = 2303] [serial = 42] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 67 (0x7f4d19078800) [pid = 2303] [serial = 40] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 66 (0x7f4d1bbd3400) [pid = 2303] [serial = 38] [outer = (nil)] [url = about:blank] 11:33:30 INFO - --DOMWINDOW == 65 (0x7f4d1a221c00) [pid = 2303] [serial = 35] [outer = (nil)] [url = data:text/html;charset=ISO-8859-3,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 64 (0x7f4d19aed000) [pid = 2303] [serial = 33] [outer = (nil)] [url = data:text/html;charset=ISO-2022-JP,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 63 (0x7f4d19aeb800) [pid = 2303] [serial = 31] [outer = (nil)] [url = data:text/html;charset=IBM866,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%] 11:33:30 INFO - --DOMWINDOW == 62 (0x7f4d19aea000) [pid = 2303] [serial = 29] [outer = (nil)] [url = data:text/html;charset=gb18030,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.] 11:33:30 INFO - --DOMWINDOW == 61 (0x7f4d19ae8400) [pid = 2303] [serial = 27] [outer = (nil)] [url = data:text/html;charset=EUC-KR,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%] 11:33:30 INFO - --DOMWINDOW == 60 (0x7f4d19ae6c00) [pid = 2303] [serial = 25] [outer = (nil)] [url = data:text/html;charset=EUC-JP,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%] 11:33:30 INFO - --DOMWINDOW == 59 (0x7f4d19ae5000) [pid = 2303] [serial = 23] [outer = (nil)] [url = data:text/html;charset=Big5-HKSCS,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 58 (0x7f4d19ae1400) [pid = 2303] [serial = 21] [outer = (nil)] [url = data:text/html;charset=Big5,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%20] 11:33:30 INFO - --DOMWINDOW == 57 (0x7f4d189b1800) [pid = 2303] [serial = 89] [outer = (nil)] [url = data:text/html;charset=UTF-8,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%2] 11:33:30 INFO - --DOMWINDOW == 56 (0x7f4d189b0000) [pid = 2303] [serial = 87] [outer = (nil)] [url = data:text/html;charset=x-mac-cyrillic,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20mar] 11:33:30 INFO - --DOMWINDOW == 55 (0x7f4d189ae800) [pid = 2303] [serial = 85] [outer = (nil)] [url = data:text/html;charset=windows-874,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 54 (0x7f4d189ad000) [pid = 2303] [serial = 83] [outer = (nil)] [url = data:text/html;charset=windows-1258,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 53 (0x7f4d189ab800) [pid = 2303] [serial = 81] [outer = (nil)] [url = data:text/html;charset=windows-1257,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 52 (0x7f4d189a9c00) [pid = 2303] [serial = 79] [outer = (nil)] [url = data:text/html;charset=windows-1256,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 51 (0x7f4d18c3b000) [pid = 2303] [serial = 77] [outer = (nil)] [url = data:text/html;charset=windows-1255,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 50 (0x7f4d18c39400) [pid = 2303] [serial = 75] [outer = (nil)] [url = data:text/html;charset=windows-1254,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 49 (0x7f4d18c37c00) [pid = 2303] [serial = 73] [outer = (nil)] [url = data:text/html;charset=windows-1253,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 48 (0x7f4d18c36000) [pid = 2303] [serial = 71] [outer = (nil)] [url = data:text/html;charset=windows-1252,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 47 (0x7f4d18c34800) [pid = 2303] [serial = 69] [outer = (nil)] [url = data:text/html;charset=windows-1251,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 46 (0x7f4d18c33000) [pid = 2303] [serial = 67] [outer = (nil)] [url = data:text/html;charset=windows-1250,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 45 (0x7f4d18c31800) [pid = 2303] [serial = 65] [outer = (nil)] [url = data:text/html;charset=Shift_JIS,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-he] 11:33:30 INFO - --DOMWINDOW == 44 (0x7f4d18c2f800) [pid = 2303] [serial = 63] [outer = (nil)] [url = data:text/html;charset=KOI8-U,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%] 11:33:30 INFO - --DOMWINDOW == 43 (0x7f4d18c2dc00) [pid = 2303] [serial = 61] [outer = (nil)] [url = data:text/html;charset=KOI8-R,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-hen.%] 11:33:30 INFO - --DOMWINDOW == 42 (0x7f4d1a21f800) [pid = 2303] [serial = 59] [outer = (nil)] [url = data:text/html;charset=ISO-8859-2,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 41 (0x7f4d19086c00) [pid = 2303] [serial = 57] [outer = (nil)] [url = data:text/html;charset=ISO-8859-16,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 40 (0x7f4d19085400) [pid = 2303] [serial = 55] [outer = (nil)] [url = data:text/html;charset=ISO-8859-15,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 39 (0x7f4d19083c00) [pid = 2303] [serial = 53] [outer = (nil)] [url = data:text/html;charset=ISO-8859-14,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 38 (0x7f4d19081c00) [pid = 2303] [serial = 51] [outer = (nil)] [url = data:text/html;charset=ISO-8859-13,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 37 (0x7f4d19080400) [pid = 2303] [serial = 49] [outer = (nil)] [url = data:text/html;charset=ISO-8859-10,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-] 11:33:30 INFO - --DOMWINDOW == 36 (0x7f4d1907e800) [pid = 2303] [serial = 47] [outer = (nil)] [url = data:text/html;charset=ISO-8859-8-I,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh] 11:33:30 INFO - --DOMWINDOW == 35 (0x7f4d1907cc00) [pid = 2303] [serial = 45] [outer = (nil)] [url = data:text/html;charset=ISO-8859-8,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 34 (0x7f4d1907b400) [pid = 2303] [serial = 43] [outer = (nil)] [url = data:text/html;charset=ISO-8859-7,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 33 (0x7f4d19079c00) [pid = 2303] [serial = 41] [outer = (nil)] [url = data:text/html;charset=ISO-8859-6,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 32 (0x7f4d19078000) [pid = 2303] [serial = 39] [outer = (nil)] [url = data:text/html;charset=ISO-8859-5,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOMWINDOW == 31 (0x7f4d1a068c00) [pid = 2303] [serial = 37] [outer = (nil)] [url = data:text/html;charset=ISO-8859-4,%3Cpre%20id='testPara'%3EMany%20years%20ago,%20I%20contracted%20an%20intimacy%20with%20a%20Mr.%20William%20Legrand.%20He%20was%20of%20an%20ancient%20Huguenot%20family,%20and%20had%20once%20been%20wealthy;%20but%20a%20series%20of%20misfortunes%20had%20reduced%20him%20to%20want.%20To%20avoid%20the%20mortification%20consequent%20upon%20his%20disasters,%20he%20left%20New%20Orleans,%20the%20city%20of%20his%20forefathers,%20and%20took%20up%20his%20residence%20at%20Sullivan's%20Island,%20near%20Charleston,%20South%20Carolina.%20This%20island%20is%20a%20very%20singular%20one.%20It%20consists%20of%20little%20else%20than%20the%20sea%20sand,%20and%20is%20about%20three%20miles%20long.%20Its%20breadth%20at%20no%20point%20exceeds%20a%20quarter%20of%20a%20mile.%20It%20is%20separated%20from%20the%20mainland%20by%20a%20scarcely%20perceptible%20creek,%20oozing%20its%20way%20through%20a%20wilderness%20of%20reeds%20and%20slime,%20a%20favorite%20resort%20of%20the%20marsh-h] 11:33:30 INFO - --DOCSHELL 0x7f0e3bf20000 == 3 [pid = 2250] [id = 7] 11:33:30 INFO - --DOCSHELL 0x7f0e46e5d800 == 2 [pid = 2250] [id = 2] 11:33:30 INFO - --DOCSHELL 0x7f0e3d0e9000 == 1 [pid = 2250] [id = 3] 11:33:30 INFO - --DOCSHELL 0x7f0e3d0ed000 == 0 [pid = 2250] [id = 4] 11:33:30 INFO - [Child 2303] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:33:31 INFO - ]: 11:33:31 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:33:31 INFO - --DOCSHELL 0x7f4d1cc2e800 == 1 [pid = 2303] [id = 1] 11:33:31 INFO - --DOCSHELL 0x7f4d1b0a1000 == 0 [pid = 2303] [id = 2] 11:33:31 INFO - --DOMWINDOW == 30 (0x7f4d189b3000) [pid = 2303] [serial = 140] [outer = (nil)] [url = about:blank] 11:33:31 INFO - --DOMWINDOW == 29 (0x7f4d189b1000) [pid = 2303] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 28 (0x7f4d18c34c00) [pid = 2303] [serial = 137] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 27 (0x7f4d18c36400) [pid = 2303] [serial = 135] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 26 (0x7f4d18c35c00) [pid = 2303] [serial = 133] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 25 (0x7f4d1850ec00) [pid = 2303] [serial = 131] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 24 (0x7f4d1a06c800) [pid = 2303] [serial = 129] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 23 (0x7f4d1850b400) [pid = 2303] [serial = 91] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 22 (0x7f4d19ade800) [pid = 2303] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_long_doc.html] 11:33:31 INFO - --DOMWINDOW == 21 (0x7f4d1a58e400) [pid = 2303] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 20 (0x7f4d1a070400) [pid = 2303] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 19 (0x7f4d1a066c00) [pid = 2303] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 18 (0x7f4d1a220c00) [pid = 2303] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 17 (0x7f4d1a219000) [pid = 2303] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:33:31 INFO - --DOMWINDOW == 16 (0x7f4d1a6f6c00) [pid = 2303] [serial = 6] [outer = (nil)] [url = about:blank] 11:33:31 INFO - --DOMWINDOW == 15 (0x7f4d1b092400) [pid = 2303] [serial = 5] [outer = (nil)] [url = about:blank] 11:33:31 INFO - --DOMWINDOW == 14 (0x7f4d1b091800) [pid = 2303] [serial = 4] [outer = (nil)] [url = about:blank] 11:33:31 INFO - --DOMWINDOW == 13 (0x7f4d1bbd5400) [pid = 2303] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:33:31 INFO - --DOMWINDOW == 12 (0x7f4d1be17000) [pid = 2303] [serial = 2] [outer = (nil)] [url = about:blank] 11:33:31 INFO - --DOMWINDOW == 11 (0x7f4d1cc7ac00) [pid = 2303] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:33:31 INFO - --DOMWINDOW == 10 (0x7f4d1850dc00) [pid = 2303] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_utf8_overconsumption.html] 11:33:31 INFO - --DOMWINDOW == 9 (0x7f4d189b2800) [pid = 2303] [serial = 136] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_unicode_noncharacters_utf8.html] 11:33:31 INFO - --DOMWINDOW == 8 (0x7f4d18c39800) [pid = 2303] [serial = 134] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_unicode_noncharacters_gb18030.html] 11:33:31 INFO - --DOMWINDOW == 7 (0x7f4d189adc00) [pid = 2303] [serial = 132] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_unicode_noncharacterescapes.html] 11:33:31 INFO - --DOMWINDOW == 6 (0x7f4d18c34400) [pid = 2303] [serial = 130] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_singlebyte_overconsumption.html] 11:33:31 INFO - --DOMWINDOW == 5 (0x7f4d1850c400) [pid = 2303] [serial = 92] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_ncr_fallback.html] 11:33:31 INFO - --DOMWINDOW == 4 (0x7f4d1a070800) [pid = 2303] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_bug959058-2.html] 11:33:31 INFO - --DOMWINDOW == 3 (0x7f4d1a067000) [pid = 2303] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_bug959058-1.html] 11:33:31 INFO - --DOMWINDOW == 2 (0x7f4d1a221800) [pid = 2303] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_bug843434.html] 11:33:31 INFO - --DOMWINDOW == 1 (0x7f4d1a219400) [pid = 2303] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_bug335816.html] 11:33:31 INFO - --DOMWINDOW == 0 (0x7f4d1a58f000) [pid = 2303] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/intl/uconv/tests/test_big5_encoder.html] 11:33:31 INFO - nsStringStats 11:33:31 INFO - => mAllocCount: 69194 11:33:31 INFO - => mReallocCount: 9281 11:33:31 INFO - => mFreeCount: 69194 11:33:31 INFO - => mShareCount: 52809 11:33:31 INFO - => mAdoptCount: 3489 11:33:31 INFO - => mAdoptFreeCount: 3489 11:33:31 INFO - => Process ID: 2303, Thread ID: 139969665509952 11:33:32 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:33:32 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:33:32 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:33:32 INFO - [Parent 2250] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:33:32 INFO - [Parent 2250] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:33:33 INFO - --DOMWINDOW == 11 (0x7f0e3ac0f000) [pid = 2250] [serial = 11] [outer = 0x7f0e3d0a7400] [url = about:blank] 11:33:33 INFO - --DOMWINDOW == 10 (0x7f0e3ac0e800) [pid = 2250] [serial = 10] [outer = 0x7f0e3d0a6c00] [url = about:blank] 11:33:33 INFO - --DOMWINDOW == 9 (0x7f0e3d0a7400) [pid = 2250] [serial = 7] [outer = (nil)] [url = about:blank] 11:33:33 INFO - --DOMWINDOW == 8 (0x7f0e3d0a6c00) [pid = 2250] [serial = 6] [outer = (nil)] [url = about:blank] 11:33:34 INFO - --DOMWINDOW == 7 (0x7f0e46d0c400) [pid = 2250] [serial = 4] [outer = (nil)] [url = about:blank] 11:33:34 INFO - --DOMWINDOW == 6 (0x7f0e4c7ab800) [pid = 2250] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:33:34 INFO - --DOMWINDOW == 5 (0x7f0e3d07d800) [pid = 2250] [serial = 16] [outer = (nil)] [url = about:blank] 11:33:34 INFO - --DOMWINDOW == 4 (0x7f0e3a8cdc00) [pid = 2250] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:33:34 INFO - --DOMWINDOW == 3 (0x7f0e46081800) [pid = 2250] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:33:34 INFO - --DOMWINDOW == 2 (0x7f0e46de5c00) [pid = 2250] [serial = 17] [outer = (nil)] [url = about:blank] 11:33:34 INFO - --DOMWINDOW == 1 (0x7f0e46d0b800) [pid = 2250] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:33:34 INFO - --DOMWINDOW == 0 (0x7f0e46080800) [pid = 2250] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:33:34 INFO - nsStringStats 11:33:34 INFO - => mAllocCount: 95035 11:33:34 INFO - => mReallocCount: 10999 11:33:34 INFO - => mFreeCount: 95035 11:33:34 INFO - => mShareCount: 93916 11:33:34 INFO - => mAdoptCount: 3759 11:33:34 INFO - => mAdoptFreeCount: 3759 11:33:34 INFO - => Process ID: 2250, Thread ID: 139699972470592 11:33:34 INFO - TEST-INFO | Main app process: exit 0 11:33:34 INFO - runtests.py | Application ran for: 0:00:46.185064 11:33:34 INFO - zombiecheck | Reading PID log: /tmp/tmpMdhAIIpidlog 11:33:34 INFO - ==> process 2250 launched child process 2303 11:33:34 INFO - zombiecheck | Checking for orphan process with PID: 2303 11:33:34 INFO - Stopping web server 11:33:34 INFO - Stopping web socket server 11:33:34 INFO - Stopping ssltunnel 11:33:34 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:33:34 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:33:34 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:33:34 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2303 11:33:34 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:33:34 INFO - | | Per-Inst Leaked| Total Rem| 11:33:34 INFO - 0 |TOTAL | 26 4640| 1074882 33| 11:33:34 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 6 1| 11:33:34 INFO - 45 |CompositorChild | 880 880| 1 1| 11:33:34 INFO - 47 |CondVar | 40 120| 35 3| 11:33:34 INFO - 139 |IPC::Channel | 16 32| 7 2| 11:33:34 INFO - 164 |MessagePump | 16 16| 10 1| 11:33:34 INFO - 167 |Mutex | 32 96| 579 3| 11:33:34 INFO - 178 |PCompositorChild | 776 776| 1 1| 11:33:34 INFO - 185 |PImageBridgeChild | 920 920| 1 1| 11:33:34 INFO - 235 |RefCountedMonitor | 80 160| 6 2| 11:33:34 INFO - 236 |RefCountedTask | 16 64| 12 4| 11:33:34 INFO - 268 |StoreRef | 16 32| 7 2| 11:33:34 INFO - 305 |WaitableEventKernel | 72 72| 13 1| 11:33:34 INFO - 310 |WeakReference | 16 32| 225 2| 11:33:34 INFO - 337 |base::Thread | 48 48| 3 1| 11:33:34 INFO - 360 |ipc::MessageChannel | 512 1024| 6 2| 11:33:34 INFO - 700 |nsTArray_base | 8 40| 442986 5| 11:33:34 INFO - 705 |nsThread | 256 256| 9 1| 11:33:34 INFO - nsTraceRefcnt::DumpStatistics: 769 entries 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:33:34 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:33:34 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:33:34 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2250 11:33:34 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:33:34 INFO - | | Per-Inst Leaked| Total Rem| 11:33:34 INFO - 0 |TOTAL | 26 0| 2153883 0| 11:33:34 INFO - nsTraceRefcnt::DumpStatistics: 1317 entries 11:33:34 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:33:34 INFO - runtests.py | Running tests: end. 11:33:34 INFO - 97 INFO TEST-START | Shutdown 11:33:34 INFO - 98 INFO Passed: 57 11:33:34 INFO - 99 INFO Failed: 0 11:33:34 INFO - 100 INFO Todo: 0 11:33:34 INFO - 101 INFO Slowest: 6086ms - /tests/intl/uconv/tests/test_long_doc.html 11:33:34 INFO - 102 INFO SimpleTest FINISHED 11:33:34 INFO - 103 INFO TEST-INFO | Ran 1 Loops 11:33:34 INFO - 104 INFO SimpleTest FINISHED 11:33:34 INFO - dir: js/xpconnect/tests/mochitest 11:33:35 INFO - Setting pipeline to PAUSED ... 11:33:35 INFO - Pipeline is PREROLLING ... 11:33:35 INFO - Pipeline is PREROLLED ... 11:33:35 INFO - Setting pipeline to PLAYING ... 11:33:35 INFO - New clock: GstSystemClock 11:33:35 INFO - Got EOS from element "pipeline0". 11:33:35 INFO - Execution ended after 32828725 ns. 11:33:35 INFO - Setting pipeline to PAUSED ... 11:33:35 INFO - Setting pipeline to READY ... 11:33:35 INFO - Setting pipeline to NULL ... 11:33:35 INFO - Freeing pipeline ... 11:33:35 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:33:35 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpZM5fx2.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:33:35 INFO - runtests.py | Server pid: 2361 11:33:35 INFO - runtests.py | Websocket server pid: 2364 11:33:35 INFO - runtests.py | SSL tunnel pid: 2367 11:33:36 INFO - runtests.py | Running tests: start. 11:33:36 INFO - runtests.py | Application pid: 2389 11:33:36 INFO - TEST-INFO | started process Main app process 11:33:36 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpZM5fx2.mozrunner/runtests_leaks.log 11:33:40 INFO - ++DOCSHELL 0x7f2f64581000 == 1 [pid = 2389] [id = 1] 11:33:40 INFO - ++DOMWINDOW == 1 (0x7f2f645aac00) [pid = 2389] [serial = 1] [outer = (nil)] 11:33:40 INFO - [2389] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:33:40 INFO - ++DOMWINDOW == 2 (0x7f2f63769800) [pid = 2389] [serial = 2] [outer = 0x7f2f645aac00] 11:33:41 INFO - ++DOCSHELL 0x7f2f5ec66000 == 2 [pid = 2389] [id = 2] 11:33:41 INFO - ++DOMWINDOW == 3 (0x7f2f5eb0e400) [pid = 2389] [serial = 3] [outer = (nil)] 11:33:41 INFO - ++DOMWINDOW == 4 (0x7f2f5eb0f000) [pid = 2389] [serial = 4] [outer = 0x7f2f5eb0e400] 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnptestjava.so returned 7f2f5ebc61f0 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnpsecondtest.so returned 7f2f5ebc65e0 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnptest.so returned 7f2f5ebc6910 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnpctrltest.so returned 7f2f5ebc6a00 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnpswftest.so returned 7f2f5ebc6d30 11:33:41 INFO - LoadPlugin() /tmp/tmpZM5fx2.mozrunner/plugins/libnpthirdtest.so returned 7f2f5dcfd040 11:33:41 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f2f5dcfd3a0 11:33:41 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f2f5dcff5b0 11:33:41 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f2f5ebf4700 11:33:41 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f2f5ebf4a00 11:33:41 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f2f5ebf4d30 11:33:41 INFO - ++DOMWINDOW == 5 (0x7f2f5dc89400) [pid = 2389] [serial = 5] [outer = 0x7f2f645aac00] 11:33:43 INFO - [2389] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:33:44 INFO - ++DOCSHELL 0x7f2f54d37000 == 3 [pid = 2389] [id = 3] 11:33:44 INFO - ++DOMWINDOW == 6 (0x7f2f54d5cc00) [pid = 2389] [serial = 6] [outer = (nil)] 11:33:44 INFO - ++DOCSHELL 0x7f2f54d3c000 == 4 [pid = 2389] [id = 4] 11:33:44 INFO - ++DOMWINDOW == 7 (0x7f2f54d5d400) [pid = 2389] [serial = 7] [outer = (nil)] 11:33:45 INFO - [2389] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:33:45 INFO - ++DOCSHELL 0x7f2f53041000 == 5 [pid = 2389] [id = 5] 11:33:45 INFO - ++DOMWINDOW == 8 (0x7f2f53c19000) [pid = 2389] [serial = 8] [outer = (nil)] 11:33:45 INFO - [2389] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:33:45 INFO - ++DOMWINDOW == 9 (0x7f2f52f0a000) [pid = 2389] [serial = 9] [outer = 0x7f2f53c19000] 11:33:45 INFO - ++DOMWINDOW == 10 (0x7f2f52de4000) [pid = 2389] [serial = 10] [outer = 0x7f2f54d5cc00] 11:33:45 INFO - ++DOMWINDOW == 11 (0x7f2f52de4800) [pid = 2389] [serial = 11] [outer = 0x7f2f54d5d400] 11:33:45 INFO - ++DOMWINDOW == 12 (0x7f2f52de6400) [pid = 2389] [serial = 12] [outer = 0x7f2f53c19000] 11:33:47 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpZM5fx2.mozrunner/runtests_leaks_tab_pid2442.log 11:33:48 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:33:50 INFO - ++DOCSHELL 0x7f08b122e800 == 1 [pid = 2442] [id = 1] 11:33:50 INFO - ++DOMWINDOW == 1 (0x7f08b127b000) [pid = 2442] [serial = 1] [outer = (nil)] 11:33:50 INFO - ++DOMWINDOW == 2 (0x7f08b0417000) [pid = 2442] [serial = 2] [outer = 0x7f08b127b000] 11:33:50 INFO - [Parent 2389] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:33:51 INFO - [Parent 2389] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:33:51 INFO - ++DOMWINDOW == 3 (0x7f08b01d5400) [pid = 2442] [serial = 3] [outer = 0x7f08b127b000] 11:33:52 INFO - ++DOCSHELL 0x7f2f52dd6000 == 6 [pid = 2389] [id = 6] 11:33:52 INFO - ++DOMWINDOW == 13 (0x7f2f553d8c00) [pid = 2389] [serial = 13] [outer = (nil)] 11:33:52 INFO - ++DOMWINDOW == 14 (0x7f2f55d66400) [pid = 2389] [serial = 14] [outer = 0x7f2f553d8c00] 11:33:52 INFO - ++DOMWINDOW == 15 (0x7f2f526cdc00) [pid = 2389] [serial = 15] [outer = 0x7f2f553d8c00] 11:33:52 INFO - ++DOCSHELL 0x7f2f4d560000 == 7 [pid = 2389] [id = 7] 11:33:52 INFO - ++DOMWINDOW == 16 (0x7f2f55c4b800) [pid = 2389] [serial = 16] [outer = (nil)] 11:33:52 INFO - ++DOMWINDOW == 17 (0x7f2f5f007400) [pid = 2389] [serial = 17] [outer = 0x7f2f55c4b800] 11:33:53 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:33:53 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:33:53 INFO - ++DOCSHELL 0x7f08af6a1000 == 2 [pid = 2442] [id = 2] 11:33:53 INFO - ++DOMWINDOW == 4 (0x7f08af691c00) [pid = 2442] [serial = 4] [outer = (nil)] 11:33:53 INFO - ++DOMWINDOW == 5 (0x7f08aecd2c00) [pid = 2442] [serial = 5] [outer = 0x7f08af691c00] 11:33:53 INFO - 105 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug1005806.html 11:33:53 INFO - [Child 2442] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:33:53 INFO - ++DOMWINDOW == 6 (0x7f08aece1000) [pid = 2442] [serial = 6] [outer = 0x7f08af691c00] 11:33:54 INFO - [Parent 2389] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:33:55 INFO - ++DOMWINDOW == 7 (0x7f08aeb95800) [pid = 2442] [serial = 7] [outer = 0x7f08af691c00] 11:33:56 INFO - --DOCSHELL 0x7f2f53041000 == 6 [pid = 2389] [id = 5] 11:33:56 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:33:56 INFO - MEMORY STAT | vsize 507MB | residentFast 87MB | heapAllocated 18MB 11:33:56 INFO - 106 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug1005806.html | took 2530ms 11:33:56 INFO - ++DOMWINDOW == 8 (0x7f08aebe7400) [pid = 2442] [serial = 8] [outer = 0x7f08af691c00] 11:33:56 INFO - 107 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug1021258.html 11:33:56 INFO - ++DOMWINDOW == 9 (0x7f08aebe7c00) [pid = 2442] [serial = 9] [outer = 0x7f08af691c00] 11:33:56 INFO - ++DOCSHELL 0x7f08b069e000 == 3 [pid = 2442] [id = 3] 11:33:56 INFO - ++DOMWINDOW == 10 (0x7f08af697400) [pid = 2442] [serial = 10] [outer = (nil)] 11:33:56 INFO - ++DOMWINDOW == 11 (0x7f08ae83a400) [pid = 2442] [serial = 11] [outer = 0x7f08af697400] 11:33:56 INFO - ++DOCSHELL 0x7f08b06a6000 == 4 [pid = 2442] [id = 4] 11:33:56 INFO - ++DOMWINDOW == 12 (0x7f08ae83c000) [pid = 2442] [serial = 12] [outer = (nil)] 11:33:56 INFO - ++DOMWINDOW == 13 (0x7f08ae83f000) [pid = 2442] [serial = 13] [outer = 0x7f08ae83c000] 11:33:56 INFO - JavaScript warning: http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1021258.html line 23 > eval, line 1: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 11:33:57 INFO - ++DOMWINDOW == 14 (0x7f08ae842c00) [pid = 2442] [serial = 14] [outer = 0x7f08af697400] 11:33:57 INFO - [Child 2442] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4640 11:33:57 INFO - ++DOCSHELL 0x7f08ae8cb000 == 5 [pid = 2442] [id = 5] 11:33:57 INFO - ++DOMWINDOW == 15 (0x7f08ae845400) [pid = 2442] [serial = 15] [outer = (nil)] 11:33:57 INFO - ++DOMWINDOW == 16 (0x7f08ae60e800) [pid = 2442] [serial = 16] [outer = 0x7f08ae845400] 11:33:57 INFO - [Child 2442] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4640 11:33:57 INFO - JavaScript warning: http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1021258.html line 31 > eval, line 1: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 11:33:57 INFO - MEMORY STAT | vsize 510MB | residentFast 90MB | heapAllocated 20MB 11:33:57 INFO - 108 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug1021258.html | took 939ms 11:33:57 INFO - ++DOMWINDOW == 17 (0x7f08ae616800) [pid = 2442] [serial = 17] [outer = 0x7f08af691c00] 11:33:57 INFO - 109 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug1094930.html 11:33:57 INFO - ++DOMWINDOW == 18 (0x7f08ae616c00) [pid = 2442] [serial = 18] [outer = 0x7f08af691c00] 11:33:57 INFO - ++DOCSHELL 0x7f08ae8df000 == 6 [pid = 2442] [id = 6] 11:33:57 INFO - ++DOMWINDOW == 19 (0x7f08ae846800) [pid = 2442] [serial = 19] [outer = (nil)] 11:33:57 INFO - ++DOMWINDOW == 20 (0x7f08aeb94800) [pid = 2442] [serial = 20] [outer = 0x7f08ae846800] 11:33:57 INFO - MEMORY STAT | vsize 510MB | residentFast 91MB | heapAllocated 20MB 11:33:58 INFO - 110 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug1094930.html | took 462ms 11:33:58 INFO - ++DOMWINDOW == 21 (0x7f08ae619c00) [pid = 2442] [serial = 21] [outer = 0x7f08af691c00] 11:33:58 INFO - 111 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug1158558.html 11:33:58 INFO - ++DOMWINDOW == 22 (0x7f08ae61ac00) [pid = 2442] [serial = 22] [outer = 0x7f08af691c00] 11:33:58 INFO - MEMORY STAT | vsize 512MB | residentFast 92MB | heapAllocated 21MB 11:33:58 INFO - [Child 2442] WARNING: Finishing incremental GC in progress during CC: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/base/nsCycleCollector.cpp, line 3505 11:33:58 INFO - --DOMWINDOW == 21 (0x7f08b0417000) [pid = 2442] [serial = 2] [outer = (nil)] [url = about:blank] 11:33:58 INFO - --DOMWINDOW == 20 (0x7f08ae845400) [pid = 2442] [serial = 15] [outer = (nil)] [url = about:blank] 11:33:58 INFO - --DOMWINDOW == 19 (0x7f08aecd2c00) [pid = 2442] [serial = 5] [outer = (nil)] [url = about:blank] 11:33:58 INFO - --DOMWINDOW == 18 (0x7f08aece1000) [pid = 2442] [serial = 6] [outer = (nil)] [url = about:blank] 11:33:58 INFO - --DOMWINDOW == 17 (0x7f08af697400) [pid = 2442] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:33:58 INFO - --DOMWINDOW == 16 (0x7f08ae83a400) [pid = 2442] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:33:58 INFO - --DOMWINDOW == 15 (0x7f08ae83c000) [pid = 2442] [serial = 12] [outer = (nil)] [url = about:blank] 11:33:58 INFO - 112 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug1158558.html | took 579ms 11:33:58 INFO - ++DOMWINDOW == 16 (0x7f08ae619400) [pid = 2442] [serial = 23] [outer = 0x7f08af691c00] 11:33:58 INFO - 113 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug384632.html 11:33:59 INFO - ++DOMWINDOW == 17 (0x7f08ae61a000) [pid = 2442] [serial = 24] [outer = 0x7f08af691c00] 11:33:59 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 18MB 11:33:59 INFO - 114 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug384632.html | took 321ms 11:33:59 INFO - ++DOMWINDOW == 18 (0x7f08ae69f800) [pid = 2442] [serial = 25] [outer = 0x7f08af691c00] 11:33:59 INFO - 115 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug390488.html 11:33:59 INFO - ++DOMWINDOW == 19 (0x7f08ae6a0000) [pid = 2442] [serial = 26] [outer = 0x7f08af691c00] 11:33:59 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 18MB 11:33:59 INFO - 116 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug390488.html | took 293ms 11:33:59 INFO - ++DOMWINDOW == 20 (0x7f08aebe6800) [pid = 2442] [serial = 27] [outer = 0x7f08af691c00] 11:33:59 INFO - 117 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug393269.html 11:34:00 INFO - ++DOMWINDOW == 21 (0x7f08ae611c00) [pid = 2442] [serial = 28] [outer = 0x7f08af691c00] 11:34:00 INFO - ++DOCSHELL 0x7f08ae51c800 == 7 [pid = 2442] [id = 7] 11:34:00 INFO - ++DOMWINDOW == 22 (0x7f08ae611000) [pid = 2442] [serial = 29] [outer = (nil)] 11:34:00 INFO - ++DOMWINDOW == 23 (0x7f08ae83a000) [pid = 2442] [serial = 30] [outer = 0x7f08ae611000] 11:34:00 INFO - ++DOMWINDOW == 24 (0x7f08ae83bc00) [pid = 2442] [serial = 31] [outer = 0x7f08ae611000] 11:34:00 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(mState == WCC_ONWRITE) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/wyciwyg/WyciwygChannelChild.cpp, line 715 11:34:00 INFO - ++DOMWINDOW == 25 (0x7f08ae610c00) [pid = 2442] [serial = 32] [outer = 0x7f08ae611000] 11:34:00 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(mState == WCC_ONWRITE) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/wyciwyg/WyciwygChannelChild.cpp, line 715 11:34:00 INFO - MEMORY STAT | vsize 514MB | residentFast 95MB | heapAllocated 18MB 11:34:00 INFO - 118 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug393269.html | took 553ms 11:34:00 INFO - ++DOMWINDOW == 26 (0x7f08ae6a2400) [pid = 2442] [serial = 33] [outer = 0x7f08af691c00] 11:34:00 INFO - 119 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug396851.html 11:34:00 INFO - ++DOMWINDOW == 27 (0x7f08aeb8fc00) [pid = 2442] [serial = 34] [outer = 0x7f08af691c00] 11:34:00 INFO - ++DOCSHELL 0x7f08ae514800 == 8 [pid = 2442] [id = 8] 11:34:00 INFO - ++DOMWINDOW == 28 (0x7f08aebe9c00) [pid = 2442] [serial = 35] [outer = (nil)] 11:34:00 INFO - [Child 2442] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9245 11:34:01 INFO - ++DOMWINDOW == 29 (0x7f08ae618800) [pid = 2442] [serial = 36] [outer = 0x7f08aebe9c00] 11:34:01 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 19MB 11:34:01 INFO - 120 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug396851.html | took 761ms 11:34:01 INFO - ++DOMWINDOW == 30 (0x7f08aebe7800) [pid = 2442] [serial = 37] [outer = 0x7f08af691c00] 11:34:01 INFO - 121 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug428021.html 11:34:01 INFO - --DOCSHELL 0x7f08b069e000 == 7 [pid = 2442] [id = 3] 11:34:01 INFO - --DOCSHELL 0x7f08b06a6000 == 6 [pid = 2442] [id = 4] 11:34:01 INFO - --DOCSHELL 0x7f08ae8cb000 == 5 [pid = 2442] [id = 5] 11:34:01 INFO - --DOCSHELL 0x7f08ae514800 == 4 [pid = 2442] [id = 8] 11:34:01 INFO - --DOCSHELL 0x7f08ae8df000 == 3 [pid = 2442] [id = 6] 11:34:02 INFO - ++DOMWINDOW == 31 (0x7f08ae60f800) [pid = 2442] [serial = 38] [outer = 0x7f08af691c00] 11:34:02 INFO - --DOMWINDOW == 30 (0x7f08ae842c00) [pid = 2442] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:02 INFO - --DOMWINDOW == 29 (0x7f08ae60e800) [pid = 2442] [serial = 16] [outer = (nil)] [url = about:blank] 11:34:02 INFO - --DOMWINDOW == 28 (0x7f08ae616800) [pid = 2442] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:02 INFO - --DOMWINDOW == 27 (0x7f08ae619c00) [pid = 2442] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:02 INFO - --DOMWINDOW == 26 (0x7f08aeb95800) [pid = 2442] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1005806.html] 11:34:02 INFO - --DOMWINDOW == 25 (0x7f08aebe7400) [pid = 2442] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:02 INFO - --DOMWINDOW == 24 (0x7f08aebe7c00) [pid = 2442] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1021258.html] 11:34:02 INFO - --DOMWINDOW == 23 (0x7f08ae83f000) [pid = 2442] [serial = 13] [outer = (nil)] [url = about:blank] 11:34:02 INFO - --DOMWINDOW == 22 (0x7f08ae83bc00) [pid = 2442] [serial = 31] [outer = 0x7f08ae611000] [url = about:blank] 11:34:02 INFO - --DOMWINDOW == 21 (0x7f08ae83a000) [pid = 2442] [serial = 30] [outer = 0x7f08ae611000] [url = about:blank] 11:34:02 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 17MB 11:34:02 INFO - 122 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug428021.html | took 846ms 11:34:02 INFO - ++DOMWINDOW == 22 (0x7f08ae83b000) [pid = 2442] [serial = 39] [outer = 0x7f08af691c00] 11:34:02 INFO - 123 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug446584.html 11:34:02 INFO - ++DOMWINDOW == 23 (0x7f08ae6a8c00) [pid = 2442] [serial = 40] [outer = 0x7f08af691c00] 11:34:03 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 18MB 11:34:03 INFO - 124 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug446584.html | took 492ms 11:34:03 INFO - ++DOMWINDOW == 24 (0x7f08aebe5400) [pid = 2442] [serial = 41] [outer = 0x7f08af691c00] 11:34:03 INFO - 125 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug462428.html 11:34:03 INFO - ++DOMWINDOW == 25 (0x7f08ae83f400) [pid = 2442] [serial = 42] [outer = 0x7f08af691c00] 11:34:03 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 18MB 11:34:03 INFO - 126 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug462428.html | took 438ms 11:34:03 INFO - ++DOMWINDOW == 26 (0x7f08aecdb400) [pid = 2442] [serial = 43] [outer = 0x7f08af691c00] 11:34:03 INFO - 127 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug478438.html 11:34:04 INFO - ++DOMWINDOW == 27 (0x7f08ae612400) [pid = 2442] [serial = 44] [outer = 0x7f08af691c00] 11:34:04 INFO - ++DOCSHELL 0x7f08aeb78000 == 4 [pid = 2442] [id = 9] 11:34:04 INFO - ++DOMWINDOW == 28 (0x7f08af68f800) [pid = 2442] [serial = 45] [outer = (nil)] 11:34:04 INFO - ++DOMWINDOW == 29 (0x7f08ae60ec00) [pid = 2442] [serial = 46] [outer = 0x7f08af68f800] 11:34:04 INFO - ++DOMWINDOW == 30 (0x7f08ae847000) [pid = 2442] [serial = 47] [outer = 0x7f08af68f800] 11:34:05 INFO - --DOMWINDOW == 29 (0x7f08ae611c00) [pid = 2442] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug393269.html] 11:34:05 INFO - --DOMWINDOW == 28 (0x7f08ae610c00) [pid = 2442] [serial = 32] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug393269.html] 11:34:05 INFO - --DOMWINDOW == 27 (0x7f08ae6a2400) [pid = 2442] [serial = 33] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:05 INFO - --DOMWINDOW == 26 (0x7f08ae69f800) [pid = 2442] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:05 INFO - --DOMWINDOW == 25 (0x7f08aebe6800) [pid = 2442] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:05 INFO - --DOMWINDOW == 24 (0x7f08ae619400) [pid = 2442] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:05 INFO - --DOMWINDOW == 23 (0x7f08ae611000) [pid = 2442] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug393269.html] 11:34:05 INFO - --DOMWINDOW == 22 (0x7f08aebe9c00) [pid = 2442] [serial = 35] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/inner.html] 11:34:05 INFO - --DOMWINDOW == 21 (0x7f08ae846800) [pid = 2442] [serial = 19] [outer = (nil)] [url = about:blank] 11:34:05 INFO - --DOMWINDOW == 20 (0x7f08ae61ac00) [pid = 2442] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1158558.html] 11:34:05 INFO - [Child 2442] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:34:05 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 19MB 11:34:05 INFO - 128 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug478438.html | took 1883ms 11:34:06 INFO - [Parent 2389] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/components/mediasniffer/nsMediaSniffer.cpp, line 133 11:34:06 INFO - ++DOMWINDOW == 21 (0x7f08aebe7000) [pid = 2442] [serial = 48] [outer = 0x7f08af691c00] 11:34:06 INFO - 129 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug500691.html 11:34:07 INFO - ++DOMWINDOW == 22 (0x7f08b0156800) [pid = 2442] [serial = 49] [outer = 0x7f08af691c00] 11:34:07 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 19MB 11:34:07 INFO - 130 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug500691.html | took 666ms 11:34:08 INFO - ++DOMWINDOW == 23 (0x7f08ae618000) [pid = 2442] [serial = 50] [outer = 0x7f08af691c00] 11:34:08 INFO - 131 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug504877.html 11:34:08 INFO - ++DOMWINDOW == 24 (0x7f08ae846000) [pid = 2442] [serial = 51] [outer = 0x7f08af691c00] 11:34:09 INFO - ++DOCSHELL 0x7f08ae8d4000 == 5 [pid = 2442] [id = 10] 11:34:09 INFO - ++DOMWINDOW == 25 (0x7f08ae614800) [pid = 2442] [serial = 52] [outer = (nil)] 11:34:09 INFO - ++DOMWINDOW == 26 (0x7f08aebe3400) [pid = 2442] [serial = 53] [outer = 0x7f08ae614800] 11:34:10 INFO - ++DOMWINDOW == 27 (0x7f08ae6a7800) [pid = 2442] [serial = 54] [outer = 0x7f08ae614800] 11:34:10 INFO - --DOCSHELL 0x7f08aeb78000 == 4 [pid = 2442] [id = 9] 11:34:10 INFO - --DOMWINDOW == 26 (0x7f08ae616c00) [pid = 2442] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug1094930.html] 11:34:10 INFO - --DOMWINDOW == 25 (0x7f08aeb8fc00) [pid = 2442] [serial = 34] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug396851.html] 11:34:10 INFO - --DOMWINDOW == 24 (0x7f08ae6a0000) [pid = 2442] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug390488.html] 11:34:10 INFO - --DOMWINDOW == 23 (0x7f08ae618800) [pid = 2442] [serial = 36] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/inner.html] 11:34:10 INFO - --DOMWINDOW == 22 (0x7f08ae61a000) [pid = 2442] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug384632.html] 11:34:10 INFO - --DOMWINDOW == 21 (0x7f08aeb94800) [pid = 2442] [serial = 20] [outer = (nil)] [url = about:blank] 11:34:10 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 18MB 11:34:10 INFO - 132 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug504877.html | took 2297ms 11:34:10 INFO - --DOMWINDOW == 16 (0x7f2f53c19000) [pid = 2389] [serial = 8] [outer = (nil)] [url = about:blank] 11:34:10 INFO - --DOMWINDOW == 15 (0x7f2f52de6400) [pid = 2389] [serial = 12] [outer = (nil)] [url = about:blank] 11:34:10 INFO - --DOMWINDOW == 14 (0x7f2f52f0a000) [pid = 2389] [serial = 9] [outer = (nil)] [url = about:blank] 11:34:10 INFO - --DOMWINDOW == 13 (0x7f2f63769800) [pid = 2389] [serial = 2] [outer = (nil)] [url = about:blank] 11:34:10 INFO - --DOMWINDOW == 12 (0x7f2f55d66400) [pid = 2389] [serial = 14] [outer = (nil)] [url = about:blank] 11:34:10 INFO - ++DOMWINDOW == 22 (0x7f08ae69f800) [pid = 2442] [serial = 55] [outer = 0x7f08af691c00] 11:34:11 INFO - 133 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug505915.html 11:34:11 INFO - ++DOMWINDOW == 23 (0x7f08ae69fc00) [pid = 2442] [serial = 56] [outer = 0x7f08af691c00] 11:34:11 INFO - ++DOCSHELL 0x7f08ae515800 == 5 [pid = 2442] [id = 11] 11:34:11 INFO - ++DOMWINDOW == 24 (0x7f08ae845800) [pid = 2442] [serial = 57] [outer = (nil)] 11:34:11 INFO - ++DOMWINDOW == 25 (0x7f08ae847400) [pid = 2442] [serial = 58] [outer = 0x7f08ae845800] 11:34:11 INFO - ++DOMWINDOW == 26 (0x7f08ae846400) [pid = 2442] [serial = 59] [outer = 0x7f08ae845800] 11:34:12 INFO - MEMORY STAT | vsize 514MB | residentFast 93MB | heapAllocated 19MB 11:34:12 INFO - --DOCSHELL 0x7f08ae8d4000 == 4 [pid = 2442] [id = 10] 11:34:12 INFO - 134 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug505915.html | took 1571ms 11:34:12 INFO - ++DOMWINDOW == 27 (0x7f08ae69d800) [pid = 2442] [serial = 60] [outer = 0x7f08af691c00] 11:34:12 INFO - 135 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug560351.html 11:34:12 INFO - ++DOMWINDOW == 28 (0x7f08ae69ec00) [pid = 2442] [serial = 61] [outer = 0x7f08af691c00] 11:34:13 INFO - MEMORY STAT | vsize 514MB | residentFast 92MB | heapAllocated 19MB 11:34:13 INFO - --DOCSHELL 0x7f08ae515800 == 3 [pid = 2442] [id = 11] 11:34:13 INFO - 136 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug560351.html | took 476ms 11:34:13 INFO - ++DOMWINDOW == 29 (0x7f08ae844000) [pid = 2442] [serial = 62] [outer = 0x7f08af691c00] 11:34:13 INFO - 137 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug585745.html 11:34:13 INFO - ++DOMWINDOW == 30 (0x7f08ae83a800) [pid = 2442] [serial = 63] [outer = 0x7f08af691c00] 11:34:13 INFO - MEMORY STAT | vsize 514MB | residentFast 92MB | heapAllocated 19MB 11:34:13 INFO - 138 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug585745.html | took 324ms 11:34:13 INFO - ++DOMWINDOW == 31 (0x7f08aebe5000) [pid = 2442] [serial = 64] [outer = 0x7f08af691c00] 11:34:13 INFO - 139 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug589028.html 11:34:14 INFO - ++DOMWINDOW == 32 (0x7f08aebe5c00) [pid = 2442] [serial = 65] [outer = 0x7f08af691c00] 11:34:14 INFO - ++DOCSHELL 0x7f08ae8e4800 == 4 [pid = 2442] [id = 12] 11:34:14 INFO - ++DOMWINDOW == 33 (0x7f08ae83c000) [pid = 2442] [serial = 66] [outer = (nil)] 11:34:14 INFO - ++DOMWINDOW == 34 (0x7f08aeb93800) [pid = 2442] [serial = 67] [outer = 0x7f08ae83c000] 11:34:14 INFO - MEMORY STAT | vsize 514MB | residentFast 93MB | heapAllocated 20MB 11:34:14 INFO - 140 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug589028.html | took 410ms 11:34:14 INFO - ++DOMWINDOW == 35 (0x7f08aece1800) [pid = 2442] [serial = 68] [outer = 0x7f08af691c00] 11:34:14 INFO - --DOMWINDOW == 34 (0x7f08aebe7800) [pid = 2442] [serial = 37] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 33 (0x7f08aebe7000) [pid = 2442] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 32 (0x7f08ae847000) [pid = 2442] [serial = 47] [outer = (nil)] [url = http://example.com/] 11:34:14 INFO - --DOMWINDOW == 31 (0x7f08ae60ec00) [pid = 2442] [serial = 46] [outer = (nil)] [url = about:blank] 11:34:14 INFO - --DOMWINDOW == 30 (0x7f08aecdb400) [pid = 2442] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 29 (0x7f08ae83f400) [pid = 2442] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug462428.html] 11:34:14 INFO - --DOMWINDOW == 28 (0x7f08aebe5400) [pid = 2442] [serial = 41] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 27 (0x7f08ae83b000) [pid = 2442] [serial = 39] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 26 (0x7f08ae60f800) [pid = 2442] [serial = 38] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug428021.html] 11:34:14 INFO - --DOMWINDOW == 25 (0x7f08ae847400) [pid = 2442] [serial = 58] [outer = (nil)] [url = about:blank] 11:34:14 INFO - --DOMWINDOW == 24 (0x7f08aebe3400) [pid = 2442] [serial = 53] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/bug504877_helper.html] 11:34:14 INFO - --DOMWINDOW == 23 (0x7f08ae69f800) [pid = 2442] [serial = 55] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 22 (0x7f08ae618000) [pid = 2442] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:14 INFO - --DOMWINDOW == 21 (0x7f08ae6a8c00) [pid = 2442] [serial = 40] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug446584.html] 11:34:14 INFO - --DOMWINDOW == 20 (0x7f08b0156800) [pid = 2442] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug500691.html] 11:34:14 INFO - --DOMWINDOW == 19 (0x7f08ae6a7800) [pid = 2442] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/] 11:34:14 INFO - --DOMWINDOW == 18 (0x7f08af68f800) [pid = 2442] [serial = 45] [outer = (nil)] [url = http://example.com/] 11:34:14 INFO - --DOMWINDOW == 17 (0x7f08ae614800) [pid = 2442] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/] 11:34:14 INFO - 141 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug601299.html 11:34:14 INFO - ++DOMWINDOW == 18 (0x7f08ae619400) [pid = 2442] [serial = 69] [outer = 0x7f08af691c00] 11:34:14 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 19MB 11:34:15 INFO - 142 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug601299.html | took 411ms 11:34:15 INFO - ++DOMWINDOW == 19 (0x7f08aeb90000) [pid = 2442] [serial = 70] [outer = 0x7f08af691c00] 11:34:15 INFO - --DOMWINDOW == 18 (0x7f08ae846000) [pid = 2442] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug504877.html] 11:34:15 INFO - --DOMWINDOW == 17 (0x7f08ae612400) [pid = 2442] [serial = 44] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug478438.html] 11:34:15 INFO - 143 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug605167.html 11:34:15 INFO - ++DOMWINDOW == 18 (0x7f08ae611000) [pid = 2442] [serial = 71] [outer = 0x7f08af691c00] 11:34:15 INFO - ++DOCSHELL 0x7f08ae506800 == 5 [pid = 2442] [id = 13] 11:34:15 INFO - ++DOMWINDOW == 19 (0x7f08ae83dc00) [pid = 2442] [serial = 72] [outer = (nil)] 11:34:15 INFO - ++DOMWINDOW == 20 (0x7f08aebdc400) [pid = 2442] [serial = 73] [outer = 0x7f08ae83dc00] 11:34:15 INFO - ++DOMWINDOW == 21 (0x7f08aebe6400) [pid = 2442] [serial = 74] [outer = 0x7f08ae83dc00] 11:34:15 INFO - ++DOMWINDOW == 22 (0x7f08ae844c00) [pid = 2442] [serial = 75] [outer = 0x7f08ae83dc00] 11:34:16 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 20MB 11:34:16 INFO - 144 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug605167.html | took 1443ms 11:34:16 INFO - ++DOMWINDOW == 23 (0x7f08ae6a2800) [pid = 2442] [serial = 76] [outer = 0x7f08af691c00] 11:34:16 INFO - 145 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug618017.html 11:34:17 INFO - ++DOMWINDOW == 24 (0x7f08ae6a8c00) [pid = 2442] [serial = 77] [outer = 0x7f08af691c00] 11:34:17 INFO - MEMORY STAT | vsize 514MB | residentFast 94MB | heapAllocated 20MB 11:34:17 INFO - 146 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug618017.html | took 402ms 11:34:17 INFO - ++DOMWINDOW == 25 (0x7f08aeb94800) [pid = 2442] [serial = 78] [outer = 0x7f08af691c00] 11:34:17 INFO - --DOMWINDOW == 24 (0x7f08aece1800) [pid = 2442] [serial = 68] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:17 INFO - --DOMWINDOW == 23 (0x7f08aebe5000) [pid = 2442] [serial = 64] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:17 INFO - --DOMWINDOW == 22 (0x7f08ae844000) [pid = 2442] [serial = 62] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:17 INFO - --DOMWINDOW == 21 (0x7f08ae69d800) [pid = 2442] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:17 INFO - 147 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug623437.html 11:34:17 INFO - ++DOMWINDOW == 22 (0x7f08ae844000) [pid = 2442] [serial = 79] [outer = 0x7f08af691c00] 11:34:17 INFO - MEMORY STAT | vsize 514MB | residentFast 95MB | heapAllocated 20MB 11:34:17 INFO - 148 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug623437.html | took 412ms 11:34:17 INFO - ++DOMWINDOW == 23 (0x7f08b015a400) [pid = 2442] [serial = 80] [outer = 0x7f08af691c00] 11:34:17 INFO - 149 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug628410.html 11:34:18 INFO - ++DOMWINDOW == 24 (0x7f08ae613c00) [pid = 2442] [serial = 81] [outer = 0x7f08af691c00] 11:34:18 INFO - MEMORY STAT | vsize 516MB | residentFast 98MB | heapAllocated 21MB 11:34:19 INFO - 150 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug628410.html | took 1232ms 11:34:19 INFO - ++DOMWINDOW == 25 (0x7f08b01cec00) [pid = 2442] [serial = 82] [outer = 0x7f08af691c00] 11:34:19 INFO - 151 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug628794.html 11:34:20 INFO - ++DOMWINDOW == 26 (0x7f08ae6acc00) [pid = 2442] [serial = 83] [outer = 0x7f08af691c00] 11:34:20 INFO - MEMORY STAT | vsize 516MB | residentFast 98MB | heapAllocated 20MB 11:34:20 INFO - --DOCSHELL 0x7f08ae8e4800 == 4 [pid = 2442] [id = 12] 11:34:20 INFO - --DOCSHELL 0x7f08ae506800 == 3 [pid = 2442] [id = 13] 11:34:20 INFO - 152 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug628794.html | took 1042ms 11:34:20 INFO - ++DOMWINDOW == 27 (0x7f08ae69e400) [pid = 2442] [serial = 84] [outer = 0x7f08af691c00] 11:34:20 INFO - 153 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug629227.html 11:34:20 INFO - ++DOMWINDOW == 28 (0x7f08ae6a1400) [pid = 2442] [serial = 85] [outer = 0x7f08af691c00] 11:34:20 INFO - ++DOCSHELL 0x7f08ae518800 == 4 [pid = 2442] [id = 14] 11:34:20 INFO - ++DOMWINDOW == 29 (0x7f08ae83e800) [pid = 2442] [serial = 86] [outer = (nil)] 11:34:20 INFO - ++DOMWINDOW == 30 (0x7f08ae618000) [pid = 2442] [serial = 87] [outer = 0x7f08ae83e800] 11:34:21 INFO - ++DOMWINDOW == 31 (0x7f08ae83c400) [pid = 2442] [serial = 88] [outer = 0x7f08ae83e800] 11:34:21 INFO - ++DOCSHELL 0x7f08ae8ce800 == 5 [pid = 2442] [id = 15] 11:34:21 INFO - ++DOMWINDOW == 32 (0x7f08aebe0800) [pid = 2442] [serial = 89] [outer = (nil)] 11:34:21 INFO - ++DOMWINDOW == 33 (0x7f08aebdc800) [pid = 2442] [serial = 90] [outer = 0x7f08aebe0800] 11:34:21 INFO - ++DOMWINDOW == 34 (0x7f08aebdd400) [pid = 2442] [serial = 91] [outer = 0x7f08aebe0800] 11:34:21 INFO - MEMORY STAT | vsize 516MB | residentFast 98MB | heapAllocated 19MB 11:34:21 INFO - 154 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug629227.html | took 677ms 11:34:21 INFO - ++DOMWINDOW == 35 (0x7f08aecd9c00) [pid = 2442] [serial = 92] [outer = 0x7f08af691c00] 11:34:21 INFO - 155 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug629331.html 11:34:21 INFO - ++DOMWINDOW == 36 (0x7f08ae614c00) [pid = 2442] [serial = 93] [outer = 0x7f08af691c00] 11:34:21 INFO - ++DOCSHELL 0x7f08b0116800 == 6 [pid = 2442] [id = 16] 11:34:21 INFO - ++DOMWINDOW == 37 (0x7f08aebe1800) [pid = 2442] [serial = 94] [outer = (nil)] 11:34:21 INFO - ++DOMWINDOW == 38 (0x7f08b0156000) [pid = 2442] [serial = 95] [outer = 0x7f08aebe1800] 11:34:21 INFO - ++DOCSHELL 0x7f08b01ab800 == 7 [pid = 2442] [id = 17] 11:34:21 INFO - ++DOMWINDOW == 39 (0x7f08b0159c00) [pid = 2442] [serial = 96] [outer = (nil)] 11:34:21 INFO - ++DOMWINDOW == 40 (0x7f08b01cb800) [pid = 2442] [serial = 97] [outer = 0x7f08b0159c00] 11:34:22 INFO - ++DOMWINDOW == 41 (0x7f08b01d0400) [pid = 2442] [serial = 98] [outer = 0x7f08b0159c00] 11:34:22 INFO - MEMORY STAT | vsize 516MB | residentFast 98MB | heapAllocated 20MB 11:34:22 INFO - 156 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug629331.html | took 731ms 11:34:22 INFO - ++DOMWINDOW == 42 (0x7f08aece1800) [pid = 2442] [serial = 99] [outer = 0x7f08af691c00] 11:34:22 INFO - 157 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug636097.html 11:34:22 INFO - ++DOMWINDOW == 43 (0x7f08ae839800) [pid = 2442] [serial = 100] [outer = 0x7f08af691c00] 11:34:22 INFO - ++DOCSHELL 0x7f08b043d000 == 8 [pid = 2442] [id = 18] 11:34:22 INFO - ++DOMWINDOW == 44 (0x7f08b01d5800) [pid = 2442] [serial = 101] [outer = (nil)] 11:34:22 INFO - ++DOMWINDOW == 45 (0x7f08b0154400) [pid = 2442] [serial = 102] [outer = 0x7f08b01d5800] 11:34:22 INFO - ++DOMWINDOW == 46 (0x7f08ae83b000) [pid = 2442] [serial = 103] [outer = 0x7f08b01d5800] 11:34:23 INFO - --DOMWINDOW == 45 (0x7f08ae613c00) [pid = 2442] [serial = 81] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug628410.html] 11:34:23 INFO - --DOMWINDOW == 44 (0x7f08b015a400) [pid = 2442] [serial = 80] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:23 INFO - --DOMWINDOW == 43 (0x7f08ae844000) [pid = 2442] [serial = 79] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug623437.html] 11:34:23 INFO - --DOMWINDOW == 42 (0x7f08b01cec00) [pid = 2442] [serial = 82] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:23 INFO - --DOMWINDOW == 41 (0x7f08ae619400) [pid = 2442] [serial = 69] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug601299.html] 11:34:23 INFO - --DOMWINDOW == 40 (0x7f08aeb90000) [pid = 2442] [serial = 70] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:23 INFO - --DOMWINDOW == 39 (0x7f08ae83a800) [pid = 2442] [serial = 63] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug585745.html] 11:34:23 INFO - --DOMWINDOW == 38 (0x7f08ae69ec00) [pid = 2442] [serial = 61] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug560351.html] 11:34:23 INFO - --DOMWINDOW == 37 (0x7f08aeb94800) [pid = 2442] [serial = 78] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:23 INFO - --DOMWINDOW == 36 (0x7f08ae6a8c00) [pid = 2442] [serial = 77] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug618017.html] 11:34:23 INFO - --DOMWINDOW == 35 (0x7f08ae6a2800) [pid = 2442] [serial = 76] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:23 INFO - --DOMWINDOW == 34 (0x7f08aebdc400) [pid = 2442] [serial = 73] [outer = (nil)] [url = about:blank] 11:34:23 INFO - --DOMWINDOW == 33 (0x7f08ae83dc00) [pid = 2442] [serial = 72] [outer = (nil)] [url = http://example.com/] 11:34:23 INFO - --DOMWINDOW == 32 (0x7f08ae845800) [pid = 2442] [serial = 57] [outer = (nil)] [url = http://example.org/] 11:34:23 INFO - --DOMWINDOW == 31 (0x7f08ae83c000) [pid = 2442] [serial = 66] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/bug589028_helper.html] 11:34:23 INFO - ++DOMWINDOW == 32 (0x7f08ae613c00) [pid = 2442] [serial = 104] [outer = 0x7f08b01d5800] 11:34:23 INFO - MEMORY STAT | vsize 517MB | residentFast 99MB | heapAllocated 20MB 11:34:23 INFO - 158 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug636097.html | took 1318ms 11:34:23 INFO - ++DOMWINDOW == 33 (0x7f08ae83c000) [pid = 2442] [serial = 105] [outer = 0x7f08af691c00] 11:34:23 INFO - 159 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug650273.html 11:34:24 INFO - ++DOMWINDOW == 34 (0x7f08ae619000) [pid = 2442] [serial = 106] [outer = 0x7f08af691c00] 11:34:24 INFO - ++DOCSHELL 0x7f08b06a3000 == 9 [pid = 2442] [id = 19] 11:34:24 INFO - ++DOMWINDOW == 35 (0x7f08aeb9cc00) [pid = 2442] [serial = 107] [outer = (nil)] 11:34:24 INFO - ++DOMWINDOW == 36 (0x7f08b031c400) [pid = 2442] [serial = 108] [outer = 0x7f08aeb9cc00] 11:34:24 INFO - ++DOMWINDOW == 37 (0x7f08b037b400) [pid = 2442] [serial = 109] [outer = 0x7f08aeb9cc00] 11:34:25 INFO - MEMORY STAT | vsize 517MB | residentFast 99MB | heapAllocated 22MB 11:34:25 INFO - 160 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug650273.html | took 1496ms 11:34:25 INFO - ++DOMWINDOW == 38 (0x7f08b03cb800) [pid = 2442] [serial = 110] [outer = 0x7f08af691c00] 11:34:25 INFO - 161 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug655297-1.html 11:34:25 INFO - ++DOMWINDOW == 39 (0x7f08b03ccc00) [pid = 2442] [serial = 111] [outer = 0x7f08af691c00] 11:34:25 INFO - --DOMWINDOW == 38 (0x7f08aebe6400) [pid = 2442] [serial = 74] [outer = (nil)] [url = data:text/html,] 11:34:25 INFO - --DOMWINDOW == 37 (0x7f08ae611000) [pid = 2442] [serial = 71] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug605167.html] 11:34:25 INFO - --DOMWINDOW == 36 (0x7f08ae844c00) [pid = 2442] [serial = 75] [outer = (nil)] [url = http://example.com/] 11:34:25 INFO - --DOMWINDOW == 35 (0x7f08aebe5c00) [pid = 2442] [serial = 65] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug589028.html] 11:34:25 INFO - --DOMWINDOW == 34 (0x7f08ae69fc00) [pid = 2442] [serial = 56] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug505915.html] 11:34:25 INFO - --DOMWINDOW == 33 (0x7f08aeb93800) [pid = 2442] [serial = 67] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/bug589028_helper.html] 11:34:25 INFO - --DOMWINDOW == 32 (0x7f08ae846400) [pid = 2442] [serial = 59] [outer = (nil)] [url = http://example.org/] 11:34:25 INFO - MEMORY STAT | vsize 517MB | residentFast 99MB | heapAllocated 18MB 11:34:26 INFO - 162 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug655297-1.html | took 589ms 11:34:26 INFO - ++DOMWINDOW == 33 (0x7f08ae6a0000) [pid = 2442] [serial = 112] [outer = 0x7f08af691c00] 11:34:26 INFO - 163 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug655297-2.html 11:34:26 INFO - ++DOMWINDOW == 34 (0x7f08ae61a000) [pid = 2442] [serial = 113] [outer = 0x7f08af691c00] 11:34:26 INFO - --DOCSHELL 0x7f08b043d000 == 8 [pid = 2442] [id = 18] 11:34:26 INFO - --DOCSHELL 0x7f08b0116800 == 7 [pid = 2442] [id = 16] 11:34:26 INFO - --DOCSHELL 0x7f08b01ab800 == 6 [pid = 2442] [id = 17] 11:34:26 INFO - --DOCSHELL 0x7f08ae518800 == 5 [pid = 2442] [id = 14] 11:34:26 INFO - --DOCSHELL 0x7f08ae8ce800 == 4 [pid = 2442] [id = 15] 11:34:26 INFO - --DOCSHELL 0x7f08b06a3000 == 3 [pid = 2442] [id = 19] 11:34:26 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 18MB 11:34:26 INFO - 164 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug655297-2.html | took 753ms 11:34:27 INFO - ++DOMWINDOW == 35 (0x7f08ae83ac00) [pid = 2442] [serial = 114] [outer = 0x7f08af691c00] 11:34:27 INFO - 165 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug661980.html 11:34:27 INFO - ++DOMWINDOW == 36 (0x7f08ae83b800) [pid = 2442] [serial = 115] [outer = 0x7f08af691c00] 11:34:27 INFO - hello nurse 11:34:27 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 18MB 11:34:27 INFO - 166 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug661980.html | took 492ms 11:34:27 INFO - ++DOMWINDOW == 37 (0x7f08aebddc00) [pid = 2442] [serial = 116] [outer = 0x7f08af691c00] 11:34:27 INFO - 167 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug691059.html 11:34:28 INFO - ++DOMWINDOW == 38 (0x7f08aebe0c00) [pid = 2442] [serial = 117] [outer = 0x7f08af691c00] 11:34:28 INFO - MEMORY STAT | vsize 516MB | residentFast 97MB | heapAllocated 19MB 11:34:28 INFO - 168 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug691059.html | took 359ms 11:34:28 INFO - ++DOMWINDOW == 39 (0x7f08aebeb400) [pid = 2442] [serial = 118] [outer = 0x7f08af691c00] 11:34:28 INFO - 169 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug720619.html 11:34:28 INFO - ++DOMWINDOW == 40 (0x7f08ae846c00) [pid = 2442] [serial = 119] [outer = 0x7f08af691c00] 11:34:28 INFO - ++DOCSHELL 0x7f08ae50a000 == 4 [pid = 2442] [id = 20] 11:34:28 INFO - ++DOMWINDOW == 41 (0x7f08aece1400) [pid = 2442] [serial = 120] [outer = (nil)] 11:34:28 INFO - ++DOMWINDOW == 42 (0x7f08af68f800) [pid = 2442] [serial = 121] [outer = 0x7f08aece1400] 11:34:28 INFO - ++DOCSHELL 0x7f08aeb77000 == 5 [pid = 2442] [id = 21] 11:34:28 INFO - ++DOMWINDOW == 43 (0x7f08aecd7000) [pid = 2442] [serial = 122] [outer = (nil)] 11:34:28 INFO - ++DOMWINDOW == 44 (0x7f08ae842400) [pid = 2442] [serial = 123] [outer = 0x7f08aecd7000] 11:34:29 INFO - MEMORY STAT | vsize 516MB | residentFast 97MB | heapAllocated 20MB 11:34:29 INFO - 170 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug720619.html | took 754ms 11:34:29 INFO - ++DOMWINDOW == 45 (0x7f08aebe5400) [pid = 2442] [serial = 124] [outer = 0x7f08af691c00] 11:34:29 INFO - 171 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug731471.html 11:34:29 INFO - --DOMWINDOW == 44 (0x7f08ae6acc00) [pid = 2442] [serial = 83] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug628794.html] 11:34:29 INFO - --DOMWINDOW == 43 (0x7f08ae83c000) [pid = 2442] [serial = 105] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 42 (0x7f08b0154400) [pid = 2442] [serial = 102] [outer = (nil)] [url = about:blank] 11:34:29 INFO - --DOMWINDOW == 41 (0x7f08aece1800) [pid = 2442] [serial = 99] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 40 (0x7f08b01d0400) [pid = 2442] [serial = 98] [outer = (nil)] [url = http://test2.example.org/tests/js/xpconnect/tests/mochitest/test2_bug629331.html] 11:34:29 INFO - --DOMWINDOW == 39 (0x7f08b01cb800) [pid = 2442] [serial = 97] [outer = (nil)] [url = about:blank] 11:34:29 INFO - --DOMWINDOW == 38 (0x7f08b0156000) [pid = 2442] [serial = 95] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/test1_bug629331.html] 11:34:29 INFO - --DOMWINDOW == 37 (0x7f08ae614c00) [pid = 2442] [serial = 93] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug629331.html] 11:34:29 INFO - --DOMWINDOW == 36 (0x7f08aecd9c00) [pid = 2442] [serial = 92] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 35 (0x7f08aebdd400) [pid = 2442] [serial = 91] [outer = (nil)] [url = http://test2.example.org/tests/js/xpconnect/tests/mochitest/file2_bug629227.html] 11:34:29 INFO - --DOMWINDOW == 34 (0x7f08aebdc800) [pid = 2442] [serial = 90] [outer = (nil)] [url = about:blank] 11:34:29 INFO - --DOMWINDOW == 33 (0x7f08ae83c400) [pid = 2442] [serial = 88] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file1_bug629227.html] 11:34:29 INFO - --DOMWINDOW == 32 (0x7f08ae618000) [pid = 2442] [serial = 87] [outer = (nil)] [url = about:blank] 11:34:29 INFO - --DOMWINDOW == 31 (0x7f08ae6a1400) [pid = 2442] [serial = 85] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug629227.html] 11:34:29 INFO - --DOMWINDOW == 30 (0x7f08ae69e400) [pid = 2442] [serial = 84] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 29 (0x7f08b037b400) [pid = 2442] [serial = 109] [outer = (nil)] [url = http://example.com/] 11:34:29 INFO - --DOMWINDOW == 28 (0x7f08b031c400) [pid = 2442] [serial = 108] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_bug650273.html] 11:34:29 INFO - --DOMWINDOW == 27 (0x7f08ae6a0000) [pid = 2442] [serial = 112] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 26 (0x7f08b03cb800) [pid = 2442] [serial = 110] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:29 INFO - --DOMWINDOW == 25 (0x7f08b01d5800) [pid = 2442] [serial = 101] [outer = (nil)] [url = http://example.com/] 11:34:29 INFO - --DOMWINDOW == 24 (0x7f08b0159c00) [pid = 2442] [serial = 96] [outer = (nil)] [url = http://test2.example.org/tests/js/xpconnect/tests/mochitest/test2_bug629331.html] 11:34:29 INFO - --DOMWINDOW == 23 (0x7f08aebe1800) [pid = 2442] [serial = 94] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/test1_bug629331.html] 11:34:29 INFO - --DOMWINDOW == 22 (0x7f08aebe0800) [pid = 2442] [serial = 89] [outer = (nil)] [url = http://test2.example.org/tests/js/xpconnect/tests/mochitest/file2_bug629227.html] 11:34:29 INFO - --DOMWINDOW == 21 (0x7f08ae83e800) [pid = 2442] [serial = 86] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file1_bug629227.html] 11:34:29 INFO - --DOMWINDOW == 20 (0x7f08aeb9cc00) [pid = 2442] [serial = 107] [outer = (nil)] [url = http://example.com/] 11:34:30 INFO - ++DOMWINDOW == 21 (0x7f08ae6a0000) [pid = 2442] [serial = 125] [outer = 0x7f08af691c00] 11:34:30 INFO - ++DOCSHELL 0x7f08ae508800 == 6 [pid = 2442] [id = 22] 11:34:30 INFO - ++DOMWINDOW == 22 (0x7f08aecda000) [pid = 2442] [serial = 126] [outer = (nil)] 11:34:30 INFO - ++DOMWINDOW == 23 (0x7f08b015bc00) [pid = 2442] [serial = 127] [outer = 0x7f08aecda000] 11:34:30 INFO - ++DOCSHELL 0x7f2f4fb4a800 == 7 [pid = 2389] [id = 8] 11:34:30 INFO - ++DOMWINDOW == 13 (0x7f2f526c5400) [pid = 2389] [serial = 18] [outer = (nil)] 11:34:30 INFO - ++DOMWINDOW == 14 (0x7f2f54d53800) [pid = 2389] [serial = 19] [outer = 0x7f2f526c5400] 11:34:30 INFO - ++DOMWINDOW == 15 (0x7f2f5552a800) [pid = 2389] [serial = 20] [outer = 0x7f2f526c5400] 11:34:30 INFO - ++DOMWINDOW == 24 (0x7f08b03cb800) [pid = 2442] [serial = 128] [outer = 0x7f08aecda000] 11:34:31 INFO - ++DOMWINDOW == 25 (0x7f08aecd9400) [pid = 2442] [serial = 129] [outer = 0x7f08aecda000] 11:34:31 INFO - ++DOMWINDOW == 26 (0x7f08b0423400) [pid = 2442] [serial = 130] [outer = 0x7f08aecda000] 11:34:31 INFO - MEMORY STAT | vsize 517MB | residentFast 98MB | heapAllocated 20MB 11:34:31 INFO - [Parent 2389] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 11:34:32 INFO - 172 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug731471.html | took 2993ms 11:34:32 INFO - ++DOMWINDOW == 27 (0x7f08b12d2400) [pid = 2442] [serial = 131] [outer = 0x7f08af691c00] 11:34:32 INFO - 173 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug764389.html 11:34:32 INFO - ++DOMWINDOW == 28 (0x7f08b2f86400) [pid = 2442] [serial = 132] [outer = 0x7f08af691c00] 11:34:32 INFO - ++DOCSHELL 0x7f08ae505800 == 7 [pid = 2442] [id = 23] 11:34:32 INFO - ++DOMWINDOW == 29 (0x7f08ae61cc00) [pid = 2442] [serial = 133] [outer = (nil)] 11:34:32 INFO - ++DOMWINDOW == 30 (0x7f08b3abac00) [pid = 2442] [serial = 134] [outer = 0x7f08ae61cc00] 11:34:32 INFO - ++DOCSHELL 0x7f08b0699800 == 8 [pid = 2442] [id = 24] 11:34:32 INFO - ++DOMWINDOW == 31 (0x7f08b3abfc00) [pid = 2442] [serial = 135] [outer = (nil)] 11:34:32 INFO - ++DOMWINDOW == 32 (0x7f08b3ac2800) [pid = 2442] [serial = 136] [outer = 0x7f08b3abfc00] 11:34:32 INFO - ++DOMWINDOW == 33 (0x7f08ae61c400) [pid = 2442] [serial = 137] [outer = 0x7f08ae61cc00] 11:34:32 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(mState == WCC_ONWRITE) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/wyciwyg/WyciwygChannelChild.cpp, line 715 11:34:32 INFO - MEMORY STAT | vsize 517MB | residentFast 99MB | heapAllocated 20MB 11:34:33 INFO - 174 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug764389.html | took 502ms 11:34:33 INFO - ++DOMWINDOW == 34 (0x7f08aeb94800) [pid = 2442] [serial = 138] [outer = 0x7f08af691c00] 11:34:33 INFO - 175 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug772288.html 11:34:33 INFO - ++DOMWINDOW == 35 (0x7f08aeb94c00) [pid = 2442] [serial = 139] [outer = 0x7f08af691c00] 11:34:33 INFO - MEMORY STAT | vsize 517MB | residentFast 100MB | heapAllocated 21MB 11:34:34 INFO - 176 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug772288.html | took 797ms 11:34:34 INFO - ++DOMWINDOW == 36 (0x7f08ae6a1000) [pid = 2442] [serial = 140] [outer = 0x7f08af691c00] 11:34:34 INFO - 177 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug781476.html 11:34:34 INFO - --DOCSHELL 0x7f08ae50a000 == 7 [pid = 2442] [id = 20] 11:34:34 INFO - --DOCSHELL 0x7f08aeb77000 == 6 [pid = 2442] [id = 21] 11:34:34 INFO - --DOCSHELL 0x7f08ae508800 == 5 [pid = 2442] [id = 22] 11:34:34 INFO - --DOCSHELL 0x7f08b0699800 == 4 [pid = 2442] [id = 24] 11:34:34 INFO - ++DOMWINDOW == 37 (0x7f08ae610000) [pid = 2442] [serial = 141] [outer = 0x7f08af691c00] 11:34:34 INFO - --DOMWINDOW == 36 (0x7f08ae613c00) [pid = 2442] [serial = 104] [outer = (nil)] [url = http://example.com/] 11:34:34 INFO - --DOMWINDOW == 35 (0x7f08ae83b000) [pid = 2442] [serial = 103] [outer = (nil)] [url = about:blank] 11:34:34 INFO - --DOMWINDOW == 34 (0x7f08ae839800) [pid = 2442] [serial = 100] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug636097.html] 11:34:34 INFO - --DOMWINDOW == 33 (0x7f08ae619000) [pid = 2442] [serial = 106] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug650273.html] 11:34:34 INFO - --DOMWINDOW == 32 (0x7f08aecd9400) [pid = 2442] [serial = 129] [outer = 0x7f08aecda000] [url = data:text/html,1] 11:34:34 INFO - --DOMWINDOW == 31 (0x7f08b3abac00) [pid = 2442] [serial = 134] [outer = 0x7f08ae61cc00] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:35 INFO - ++DOCSHELL 0x7f08ae502800 == 5 [pid = 2442] [id = 25] 11:34:35 INFO - ++DOMWINDOW == 32 (0x7f08ae61bc00) [pid = 2442] [serial = 142] [outer = (nil)] 11:34:35 INFO - ++DOMWINDOW == 33 (0x7f08ae69e800) [pid = 2442] [serial = 143] [outer = 0x7f08ae61bc00] 11:34:35 INFO - MEMORY STAT | vsize 516MB | residentFast 99MB | heapAllocated 18MB 11:34:35 INFO - 178 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug781476.html | took 1326ms 11:34:35 INFO - ++DOMWINDOW == 34 (0x7f08ae83f400) [pid = 2442] [serial = 144] [outer = 0x7f08af691c00] 11:34:35 INFO - 179 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug789713.html 11:34:35 INFO - ++DOMWINDOW == 35 (0x7f08ae83f800) [pid = 2442] [serial = 145] [outer = 0x7f08af691c00] 11:34:35 INFO - ++DOCSHELL 0x7f08ae8dc000 == 6 [pid = 2442] [id = 26] 11:34:35 INFO - ++DOMWINDOW == 36 (0x7f08aeb8e800) [pid = 2442] [serial = 146] [outer = (nil)] 11:34:35 INFO - ++DOMWINDOW == 37 (0x7f08aeb9cc00) [pid = 2442] [serial = 147] [outer = 0x7f08aeb8e800] 11:34:36 INFO - ++DOMWINDOW == 38 (0x7f08ae847400) [pid = 2442] [serial = 148] [outer = 0x7f08aeb8e800] 11:34:36 INFO - ++DOCSHELL 0x7f08ae8e0000 == 7 [pid = 2442] [id = 27] 11:34:36 INFO - ++DOMWINDOW == 39 (0x7f08ae615800) [pid = 2442] [serial = 149] [outer = (nil)] 11:34:36 INFO - [Child 2442] WARNING: Subdocument container has no presshell: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsDocumentViewer.cpp, line 2446 11:34:36 INFO - ++DOMWINDOW == 40 (0x7f08ae69e400) [pid = 2442] [serial = 150] [outer = 0x7f08ae615800] 11:34:36 INFO - ++DOCSHELL 0x7f08aeb77800 == 8 [pid = 2442] [id = 28] 11:34:36 INFO - ++DOMWINDOW == 41 (0x7f08aebe2c00) [pid = 2442] [serial = 151] [outer = (nil)] 11:34:36 INFO - [Child 2442] WARNING: Subdocument container has no presshell: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsDocumentViewer.cpp, line 2446 11:34:36 INFO - ++DOMWINDOW == 42 (0x7f08ae61c000) [pid = 2442] [serial = 152] [outer = 0x7f08aebe2c00] 11:34:36 INFO - MEMORY STAT | vsize 516MB | residentFast 99MB | heapAllocated 19MB 11:34:36 INFO - 180 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug789713.html | took 799ms 11:34:36 INFO - ++DOMWINDOW == 43 (0x7f08aebe5000) [pid = 2442] [serial = 153] [outer = 0x7f08af691c00] 11:34:36 INFO - 181 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug790732.html 11:34:36 INFO - ++DOMWINDOW == 44 (0x7f08aebe9000) [pid = 2442] [serial = 154] [outer = 0x7f08af691c00] 11:34:36 INFO - ++DOCSHELL 0x7f08b010d800 == 9 [pid = 2442] [id = 29] 11:34:36 INFO - ++DOMWINDOW == 45 (0x7f08b03d2c00) [pid = 2442] [serial = 155] [outer = (nil)] 11:34:36 INFO - ++DOMWINDOW == 46 (0x7f08b03d4c00) [pid = 2442] [serial = 156] [outer = 0x7f08b03d2c00] 11:34:37 INFO - MEMORY STAT | vsize 517MB | residentFast 99MB | heapAllocated 20MB 11:34:37 INFO - 182 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug790732.html | took 575ms 11:34:37 INFO - --DOMWINDOW == 45 (0x7f08aeb94800) [pid = 2442] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 44 (0x7f08b0423400) [pid = 2442] [serial = 130] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug731471.html] 11:34:37 INFO - --DOMWINDOW == 43 (0x7f08b03ccc00) [pid = 2442] [serial = 111] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug655297-1.html] 11:34:37 INFO - --DOMWINDOW == 42 (0x7f08ae61a000) [pid = 2442] [serial = 113] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug655297-2.html] 11:34:37 INFO - --DOMWINDOW == 41 (0x7f08b03cb800) [pid = 2442] [serial = 128] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 40 (0x7f08b015bc00) [pid = 2442] [serial = 127] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 39 (0x7f08aebe5400) [pid = 2442] [serial = 124] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 38 (0x7f08ae842400) [pid = 2442] [serial = 123] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_bug720619.html] 11:34:37 INFO - --DOMWINDOW == 37 (0x7f08af68f800) [pid = 2442] [serial = 121] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 36 (0x7f08aebeb400) [pid = 2442] [serial = 118] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 35 (0x7f08aebddc00) [pid = 2442] [serial = 116] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 34 (0x7f08ae83b800) [pid = 2442] [serial = 115] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug661980.html] 11:34:37 INFO - --DOMWINDOW == 33 (0x7f08ae83ac00) [pid = 2442] [serial = 114] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 32 (0x7f08ae61c400) [pid = 2442] [serial = 137] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:37 INFO - --DOMWINDOW == 31 (0x7f08b3ac2800) [pid = 2442] [serial = 136] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 30 (0x7f08b12d2400) [pid = 2442] [serial = 131] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:37 INFO - --DOMWINDOW == 29 (0x7f08aecda000) [pid = 2442] [serial = 126] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug731471.html] 11:34:37 INFO - --DOMWINDOW == 28 (0x7f08aecd7000) [pid = 2442] [serial = 122] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_bug720619.html] 11:34:37 INFO - --DOMWINDOW == 27 (0x7f08aece1400) [pid = 2442] [serial = 120] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 26 (0x7f08ae61cc00) [pid = 2442] [serial = 133] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:37 INFO - --DOMWINDOW == 25 (0x7f08b3abfc00) [pid = 2442] [serial = 135] [outer = (nil)] [url = about:blank] 11:34:37 INFO - --DOMWINDOW == 24 (0x7f08ae6a0000) [pid = 2442] [serial = 125] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug731471.html] 11:34:37 INFO - ++DOMWINDOW == 25 (0x7f08aeb92400) [pid = 2442] [serial = 157] [outer = 0x7f08af691c00] 11:34:37 INFO - 183 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug793969.html 11:34:37 INFO - ++DOMWINDOW == 26 (0x7f08ae69dc00) [pid = 2442] [serial = 158] [outer = 0x7f08af691c00] 11:34:38 INFO - MEMORY STAT | vsize 517MB | residentFast 100MB | heapAllocated 19MB 11:34:38 INFO - 184 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug793969.html | took 622ms 11:34:38 INFO - ++DOMWINDOW == 27 (0x7f08aecd7000) [pid = 2442] [serial = 159] [outer = 0x7f08af691c00] 11:34:38 INFO - 185 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug800864.html 11:34:38 INFO - ++DOMWINDOW == 28 (0x7f08b03ce400) [pid = 2442] [serial = 160] [outer = 0x7f08af691c00] 11:34:39 INFO - ++DOCSHELL 0x7f08ae51d800 == 10 [pid = 2442] [id = 30] 11:34:39 INFO - ++DOMWINDOW == 29 (0x7f08ae83d800) [pid = 2442] [serial = 161] [outer = (nil)] 11:34:39 INFO - ++DOMWINDOW == 30 (0x7f08ae844c00) [pid = 2442] [serial = 162] [outer = 0x7f08ae83d800] 11:34:39 INFO - ++DOCSHELL 0x7f08ae8e5800 == 11 [pid = 2442] [id = 31] 11:34:39 INFO - ++DOMWINDOW == 31 (0x7f08aebdd000) [pid = 2442] [serial = 163] [outer = (nil)] 11:34:39 INFO - [Child 2442] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9245 11:34:39 INFO - --DOCSHELL 0x7f08ae502800 == 10 [pid = 2442] [id = 25] 11:34:39 INFO - --DOCSHELL 0x7f08ae8dc000 == 9 [pid = 2442] [id = 26] 11:34:39 INFO - --DOCSHELL 0x7f08ae8e0000 == 8 [pid = 2442] [id = 27] 11:34:39 INFO - --DOCSHELL 0x7f08aeb77800 == 7 [pid = 2442] [id = 28] 11:34:39 INFO - --DOCSHELL 0x7f08b010d800 == 6 [pid = 2442] [id = 29] 11:34:39 INFO - ++DOMWINDOW == 32 (0x7f08ae610800) [pid = 2442] [serial = 164] [outer = 0x7f08aebdd000] 11:34:39 INFO - --DOMWINDOW == 31 (0x7f08b2f86400) [pid = 2442] [serial = 132] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug764389.html] 11:34:39 INFO - --DOMWINDOW == 30 (0x7f08aebe0c00) [pid = 2442] [serial = 117] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug691059.html] 11:34:39 INFO - --DOMWINDOW == 29 (0x7f08ae846c00) [pid = 2442] [serial = 119] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug720619.html] 11:34:39 INFO - --DOMWINDOW == 28 (0x7f08ae61c000) [pid = 2442] [serial = 152] [outer = 0x7f08aebe2c00] [url = about:blank] 11:34:39 INFO - --DOMWINDOW == 27 (0x7f08ae69e400) [pid = 2442] [serial = 150] [outer = 0x7f08ae615800] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:39 INFO - --DOMWINDOW == 26 (0x7f08aeb9cc00) [pid = 2442] [serial = 147] [outer = 0x7f08aeb8e800] [url = about:blank] 11:34:39 INFO - ++DOMWINDOW == 27 (0x7f08ae61ac00) [pid = 2442] [serial = 165] [outer = 0x7f08ae83d800] 11:34:39 INFO - --DOMWINDOW == 26 (0x7f08ae615800) [pid = 2442] [serial = 149] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:39 INFO - --DOMWINDOW == 25 (0x7f08aebe2c00) [pid = 2442] [serial = 151] [outer = (nil)] [url = about:blank] 11:34:40 INFO - MEMORY STAT | vsize 516MB | residentFast 97MB | heapAllocated 18MB 11:34:40 INFO - 186 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug800864.html | took 2023ms 11:34:40 INFO - ++DOMWINDOW == 26 (0x7f08ae6acc00) [pid = 2442] [serial = 166] [outer = 0x7f08af691c00] 11:34:40 INFO - 187 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug802557.html 11:34:41 INFO - ++DOMWINDOW == 27 (0x7f08ae839400) [pid = 2442] [serial = 167] [outer = 0x7f08af691c00] 11:34:41 INFO - ++DOCSHELL 0x7f08aeb67000 == 7 [pid = 2442] [id = 32] 11:34:41 INFO - ++DOMWINDOW == 28 (0x7f08aebdc400) [pid = 2442] [serial = 168] [outer = (nil)] 11:34:41 INFO - ++DOMWINDOW == 29 (0x7f08aebe0c00) [pid = 2442] [serial = 169] [outer = 0x7f08aebdc400] 11:34:41 INFO - ++DOCSHELL 0x7f08aeb79800 == 8 [pid = 2442] [id = 33] 11:34:41 INFO - ++DOMWINDOW == 30 (0x7f08ae61a000) [pid = 2442] [serial = 170] [outer = (nil)] 11:34:41 INFO - ++DOMWINDOW == 31 (0x7f08ae618000) [pid = 2442] [serial = 171] [outer = 0x7f08ae61a000] 11:34:42 INFO - ++DOMWINDOW == 32 (0x7f08ae83ec00) [pid = 2442] [serial = 172] [outer = 0x7f08aebdc400] 11:34:42 INFO - ++DOCSHELL 0x7f08b010f800 == 9 [pid = 2442] [id = 34] 11:34:42 INFO - ++DOMWINDOW == 33 (0x7f08aebe4400) [pid = 2442] [serial = 173] [outer = (nil)] 11:34:42 INFO - ++DOMWINDOW == 34 (0x7f08ae846800) [pid = 2442] [serial = 174] [outer = 0x7f08aebe4400] 11:34:42 INFO - --DOMWINDOW == 33 (0x7f08ae6a1000) [pid = 2442] [serial = 140] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:42 INFO - --DOMWINDOW == 32 (0x7f08aebe5000) [pid = 2442] [serial = 153] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:42 INFO - --DOMWINDOW == 31 (0x7f08ae83f400) [pid = 2442] [serial = 144] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:42 INFO - --DOMWINDOW == 30 (0x7f08aecd7000) [pid = 2442] [serial = 159] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:42 INFO - --DOMWINDOW == 29 (0x7f08aeb92400) [pid = 2442] [serial = 157] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:42 INFO - --DOMWINDOW == 28 (0x7f08b03d4c00) [pid = 2442] [serial = 156] [outer = (nil)] [url = about:blank] 11:34:42 INFO - --DOMWINDOW == 27 (0x7f08aeb8e800) [pid = 2442] [serial = 146] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file_bug789713.html] 11:34:42 INFO - --DOMWINDOW == 26 (0x7f08ae61bc00) [pid = 2442] [serial = 142] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_bug781476.html] 11:34:42 INFO - --DOMWINDOW == 25 (0x7f08b03d2c00) [pid = 2442] [serial = 155] [outer = (nil)] [url = about:blank] 11:34:42 INFO - --DOMWINDOW == 24 (0x7f08aeb94c00) [pid = 2442] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug772288.html] 11:34:42 INFO - --DOMWINDOW == 23 (0x7f08ae69dc00) [pid = 2442] [serial = 158] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug793969.html] 11:34:42 INFO - --DOMWINDOW == 22 (0x7f08aebe9000) [pid = 2442] [serial = 154] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug790732.html] 11:34:42 INFO - ++DOMWINDOW == 23 (0x7f08ae69dc00) [pid = 2442] [serial = 175] [outer = 0x7f08aebdc400] 11:34:42 INFO - ++DOMWINDOW == 24 (0x7f08ae612c00) [pid = 2442] [serial = 176] [outer = 0x7f08aebdc400] 11:34:42 INFO - MEMORY STAT | vsize 516MB | residentFast 98MB | heapAllocated 19MB 11:34:43 INFO - 188 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug802557.html | took 2241ms 11:34:43 INFO - ++DOMWINDOW == 25 (0x7f08b0419000) [pid = 2442] [serial = 177] [outer = 0x7f08af691c00] 11:34:43 INFO - 189 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug803730.html 11:34:43 INFO - ++DOMWINDOW == 26 (0x7f08b041d400) [pid = 2442] [serial = 178] [outer = 0x7f08af691c00] 11:34:43 INFO - MEMORY STAT | vsize 516MB | residentFast 99MB | heapAllocated 20MB 11:34:43 INFO - 190 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug803730.html | took 376ms 11:34:43 INFO - ++DOMWINDOW == 27 (0x7f08aece1400) [pid = 2442] [serial = 179] [outer = 0x7f08af691c00] 11:34:43 INFO - 191 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug809547.html 11:34:43 INFO - ++DOMWINDOW == 28 (0x7f08b12ccc00) [pid = 2442] [serial = 180] [outer = 0x7f08af691c00] 11:34:44 INFO - --DOCSHELL 0x7f08ae8e5800 == 8 [pid = 2442] [id = 31] 11:34:44 INFO - --DOCSHELL 0x7f08ae51d800 == 7 [pid = 2442] [id = 30] 11:34:44 INFO - --DOMWINDOW == 27 (0x7f08ae610000) [pid = 2442] [serial = 141] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug781476.html] 11:34:44 INFO - --DOMWINDOW == 26 (0x7f08ae69e800) [pid = 2442] [serial = 143] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_bug781476.html] 11:34:44 INFO - --DOMWINDOW == 25 (0x7f08ae83f800) [pid = 2442] [serial = 145] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug789713.html] 11:34:44 INFO - --DOMWINDOW == 24 (0x7f08ae847400) [pid = 2442] [serial = 148] [outer = (nil)] [url = http://test1.example.org/tests/js/xpconnect/tests/mochitest/file_bug789713.html] 11:34:44 INFO - --DOCSHELL 0x7f08aeb67000 == 6 [pid = 2442] [id = 32] 11:34:44 INFO - --DOCSHELL 0x7f08aeb79800 == 5 [pid = 2442] [id = 33] 11:34:44 INFO - --DOCSHELL 0x7f08b010f800 == 4 [pid = 2442] [id = 34] 11:34:44 INFO - --DOMWINDOW == 23 (0x7f08aece1400) [pid = 2442] [serial = 179] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:44 INFO - --DOMWINDOW == 22 (0x7f08aebe0c00) [pid = 2442] [serial = 169] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:44 INFO - --DOMWINDOW == 21 (0x7f08ae61ac00) [pid = 2442] [serial = 165] [outer = (nil)] [url = http://test1.example.com/] 11:34:44 INFO - --DOMWINDOW == 20 (0x7f08ae844c00) [pid = 2442] [serial = 162] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:44 INFO - --DOMWINDOW == 19 (0x7f08b03ce400) [pid = 2442] [serial = 160] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug800864.html] 11:34:44 INFO - --DOMWINDOW == 18 (0x7f08ae69dc00) [pid = 2442] [serial = 175] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_bug802557.html] 11:34:44 INFO - --DOMWINDOW == 17 (0x7f08ae612c00) [pid = 2442] [serial = 176] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_bug802557.html] 11:34:44 INFO - --DOMWINDOW == 16 (0x7f08ae610800) [pid = 2442] [serial = 164] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 15 (0x7f08ae6acc00) [pid = 2442] [serial = 166] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:44 INFO - --DOMWINDOW == 14 (0x7f08ae618000) [pid = 2442] [serial = 171] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 13 (0x7f08ae83ec00) [pid = 2442] [serial = 172] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:34:44 INFO - --DOMWINDOW == 12 (0x7f08ae846800) [pid = 2442] [serial = 174] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 11 (0x7f08b0419000) [pid = 2442] [serial = 177] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:34:44 INFO - --DOMWINDOW == 10 (0x7f08aebdc400) [pid = 2442] [serial = 168] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_bug802557.html] 11:34:44 INFO - --DOMWINDOW == 9 (0x7f08ae83d800) [pid = 2442] [serial = 161] [outer = (nil)] [url = http://test1.example.com/] 11:34:44 INFO - --DOMWINDOW == 8 (0x7f08aebdd000) [pid = 2442] [serial = 163] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 7 (0x7f08ae61a000) [pid = 2442] [serial = 170] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 6 (0x7f08aebe4400) [pid = 2442] [serial = 173] [outer = (nil)] [url = about:blank] 11:34:44 INFO - --DOMWINDOW == 5 (0x7f08ae839400) [pid = 2442] [serial = 167] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug802557.html] 11:34:44 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 15MB 11:34:44 INFO - --DOMWINDOW == 14 (0x7f2f54d53800) [pid = 2389] [serial = 19] [outer = (nil)] [url = about:blank] 11:34:44 INFO - 192 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug809547.html | took 930ms 11:34:44 INFO - ++DOMWINDOW == 6 (0x7f08ae619800) [pid = 2442] [serial = 181] [outer = 0x7f08af691c00] 11:34:44 INFO - 193 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug829872.html 11:34:45 INFO - ++DOMWINDOW == 7 (0x7f08ae61ac00) [pid = 2442] [serial = 182] [outer = 0x7f08af691c00] 11:34:45 INFO - ++DOCSHELL 0x7f08ae519000 == 5 [pid = 2442] [id = 35] 11:34:45 INFO - ++DOMWINDOW == 8 (0x7f08ae6a1800) [pid = 2442] [serial = 183] [outer = (nil)] 11:34:45 INFO - ++DOCSHELL 0x7f08ae8c8000 == 6 [pid = 2442] [id = 36] 11:34:45 INFO - ++DOMWINDOW == 9 (0x7f08ae6a2400) [pid = 2442] [serial = 184] [outer = (nil)] 11:34:45 INFO - ++DOCSHELL 0x7f08ae8c9800 == 7 [pid = 2442] [id = 37] 11:34:45 INFO - ++DOMWINDOW == 10 (0x7f08ae69e400) [pid = 2442] [serial = 185] [outer = (nil)] 11:34:45 INFO - ++DOMWINDOW == 11 (0x7f08ae6abc00) [pid = 2442] [serial = 186] [outer = 0x7f08ae69e400] 11:34:45 INFO - ++DOMWINDOW == 12 (0x7f08ae83a000) [pid = 2442] [serial = 187] [outer = 0x7f08ae6a2400] 11:34:45 INFO - ++DOMWINDOW == 13 (0x7f08ae83b800) [pid = 2442] [serial = 188] [outer = 0x7f08ae6a1800] 11:34:45 INFO - ++DOCSHELL 0x7f08ae8dd800 == 8 [pid = 2442] [id = 38] 11:34:45 INFO - ++DOMWINDOW == 14 (0x7f08ae83ec00) [pid = 2442] [serial = 189] [outer = (nil)] 11:34:45 INFO - ++DOCSHELL 0x7f08ae8de800 == 9 [pid = 2442] [id = 39] 11:34:45 INFO - ++DOMWINDOW == 15 (0x7f08ae840000) [pid = 2442] [serial = 190] [outer = (nil)] 11:34:45 INFO - ++DOMWINDOW == 16 (0x7f08ae612000) [pid = 2442] [serial = 191] [outer = 0x7f08ae83ec00] 11:34:45 INFO - ++DOCSHELL 0x7f08ae8e3800 == 10 [pid = 2442] [id = 40] 11:34:45 INFO - ++DOMWINDOW == 17 (0x7f08ae845800) [pid = 2442] [serial = 192] [outer = (nil)] 11:34:45 INFO - ++DOMWINDOW == 18 (0x7f08ae847400) [pid = 2442] [serial = 193] [outer = 0x7f08ae840000] 11:34:45 INFO - ++DOMWINDOW == 19 (0x7f08ae69d800) [pid = 2442] [serial = 194] [outer = 0x7f08ae845800] 11:34:45 INFO - ++DOMWINDOW == 20 (0x7f08aeb95800) [pid = 2442] [serial = 195] [outer = 0x7f08ae845800] 11:34:45 INFO - ++DOCSHELL 0x7f08aeb7b800 == 11 [pid = 2442] [id = 41] 11:34:45 INFO - ++DOMWINDOW == 21 (0x7f08aeb9cc00) [pid = 2442] [serial = 196] [outer = (nil)] 11:34:45 INFO - ++DOMWINDOW == 22 (0x7f08ae6a7000) [pid = 2442] [serial = 197] [outer = 0x7f08aeb9cc00] 11:34:45 INFO - MEMORY STAT | vsize 516MB | residentFast 97MB | heapAllocated 18MB 11:34:45 INFO - 194 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug829872.html | took 726ms 11:34:45 INFO - ++DOMWINDOW == 23 (0x7f08af68c400) [pid = 2442] [serial = 198] [outer = 0x7f08af691c00] 11:34:45 INFO - 195 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug862380.html 11:34:46 INFO - ++DOMWINDOW == 24 (0x7f08af68f400) [pid = 2442] [serial = 199] [outer = 0x7f08af691c00] 11:34:46 INFO - ++DOCSHELL 0x7f08ae506000 == 12 [pid = 2442] [id = 42] 11:34:46 INFO - ++DOMWINDOW == 25 (0x7f08ae615800) [pid = 2442] [serial = 200] [outer = (nil)] 11:34:46 INFO - ++DOMWINDOW == 26 (0x7f08ae619400) [pid = 2442] [serial = 201] [outer = 0x7f08ae615800] 11:34:46 INFO - ++DOCSHELL 0x7f08ae8c9000 == 13 [pid = 2442] [id = 43] 11:34:46 INFO - ++DOMWINDOW == 27 (0x7f08ae6ac400) [pid = 2442] [serial = 202] [outer = (nil)] 11:34:46 INFO - ++DOMWINDOW == 28 (0x7f08ae83c400) [pid = 2442] [serial = 203] [outer = 0x7f08ae6ac400] 11:34:46 INFO - MEMORY STAT | vsize 516MB | residentFast 99MB | heapAllocated 20MB 11:34:46 INFO - 196 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug862380.html | took 847ms 11:34:46 INFO - ++DOMWINDOW == 29 (0x7f08ae61c800) [pid = 2442] [serial = 204] [outer = 0x7f08af691c00] 11:34:46 INFO - 197 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug865260.html 11:34:46 INFO - ++DOMWINDOW == 30 (0x7f08ae69f000) [pid = 2442] [serial = 205] [outer = 0x7f08af691c00] 11:34:47 INFO - ++DOCSHELL 0x7f08b0116800 == 14 [pid = 2442] [id = 44] 11:34:47 INFO - ++DOMWINDOW == 31 (0x7f08ae846800) [pid = 2442] [serial = 206] [outer = (nil)] 11:34:47 INFO - ++DOMWINDOW == 32 (0x7f08aeb96400) [pid = 2442] [serial = 207] [outer = 0x7f08ae846800] 11:34:47 INFO - ++DOMWINDOW == 33 (0x7f08aebe3400) [pid = 2442] [serial = 208] [outer = 0x7f08ae846800] 11:34:47 INFO - ++DOCSHELL 0x7f08b043a000 == 15 [pid = 2442] [id = 45] 11:34:47 INFO - ++DOMWINDOW == 34 (0x7f08ae83e000) [pid = 2442] [serial = 209] [outer = (nil)] 11:34:47 INFO - ++DOMWINDOW == 35 (0x7f08ae6a7800) [pid = 2442] [serial = 210] [outer = 0x7f08ae83e000] 11:34:47 INFO - MEMORY STAT | vsize 517MB | residentFast 100MB | heapAllocated 20MB 11:34:47 INFO - 198 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug865260.html | took 1050ms 11:34:48 INFO - ++DOMWINDOW == 36 (0x7f08ae69dc00) [pid = 2442] [serial = 211] [outer = 0x7f08af691c00] 11:34:48 INFO - 199 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug870423.html 11:34:48 INFO - --DOCSHELL 0x7f08aeb7b800 == 14 [pid = 2442] [id = 41] 11:34:48 INFO - --DOCSHELL 0x7f08ae519000 == 13 [pid = 2442] [id = 35] 11:34:48 INFO - --DOCSHELL 0x7f08ae8c8000 == 12 [pid = 2442] [id = 36] 11:34:48 INFO - --DOCSHELL 0x7f08ae8c9800 == 11 [pid = 2442] [id = 37] 11:34:48 INFO - --DOCSHELL 0x7f08ae8dd800 == 10 [pid = 2442] [id = 38] 11:34:48 INFO - --DOCSHELL 0x7f08ae8de800 == 9 [pid = 2442] [id = 39] 11:34:48 INFO - --DOCSHELL 0x7f08ae8e3800 == 8 [pid = 2442] [id = 40] 11:34:48 INFO - ++DOMWINDOW == 37 (0x7f08ae69e800) [pid = 2442] [serial = 212] [outer = 0x7f08af691c00] 11:34:49 INFO - ++DOCSHELL 0x7f08aeb6b800 == 9 [pid = 2442] [id = 46] 11:34:49 INFO - ++DOMWINDOW == 38 (0x7f08ae83e800) [pid = 2442] [serial = 213] [outer = (nil)] 11:34:49 INFO - ++DOCSHELL 0x7f08aeb7a800 == 10 [pid = 2442] [id = 47] 11:34:49 INFO - ++DOMWINDOW == 39 (0x7f08ae842c00) [pid = 2442] [serial = 214] [outer = (nil)] 11:34:49 INFO - ++DOMWINDOW == 40 (0x7f08aeb8d800) [pid = 2442] [serial = 215] [outer = 0x7f08ae83e800] 11:34:49 INFO - ++DOMWINDOW == 41 (0x7f08aeb8f400) [pid = 2442] [serial = 216] [outer = 0x7f08ae842c00] 11:34:49 INFO - ++DOCSHELL 0x7f08b0697000 == 11 [pid = 2442] [id = 48] 11:34:49 INFO - ++DOMWINDOW == 42 (0x7f08aebe1400) [pid = 2442] [serial = 217] [outer = (nil)] 11:34:49 INFO - ++DOCSHELL 0x7f08b0699800 == 12 [pid = 2442] [id = 49] 11:34:49 INFO - ++DOMWINDOW == 43 (0x7f08aebddc00) [pid = 2442] [serial = 218] [outer = (nil)] 11:34:49 INFO - ++DOMWINDOW == 44 (0x7f08aebe2c00) [pid = 2442] [serial = 219] [outer = 0x7f08aebe1400] 11:34:49 INFO - ++DOMWINDOW == 45 (0x7f08aebe5000) [pid = 2442] [serial = 220] [outer = 0x7f08aebddc00] 11:34:49 INFO - MEMORY STAT | vsize 517MB | residentFast 101MB | heapAllocated 20MB 11:34:49 INFO - 200 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug870423.html | took 1430ms 11:34:49 INFO - ++DOMWINDOW == 46 (0x7f08aebe8000) [pid = 2442] [serial = 221] [outer = 0x7f08af691c00] 11:34:49 INFO - 201 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug871887.html 11:34:50 INFO - ++DOMWINDOW == 47 (0x7f08aeb94800) [pid = 2442] [serial = 222] [outer = 0x7f08af691c00] 11:34:50 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:34:50 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:34:51 INFO - MEMORY STAT | vsize 518MB | residentFast 102MB | heapAllocated 22MB 11:34:51 INFO - 202 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug871887.html | took 1136ms 11:34:51 INFO - --DOMWINDOW == 46 (0x7f08ae69d800) [pid = 2442] [serial = 194] [outer = (nil)] [url = about:blank] 11:34:51 INFO - --DOMWINDOW == 45 (0x7f08b041d400) [pid = 2442] [serial = 178] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug803730.html] 11:34:51 INFO - ++DOMWINDOW == 46 (0x7f08b032a400) [pid = 2442] [serial = 223] [outer = 0x7f08af691c00] 11:34:51 INFO - 203 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug912322.html 11:34:51 INFO - ++DOMWINDOW == 47 (0x7f08b0376000) [pid = 2442] [serial = 224] [outer = 0x7f08af691c00] 11:34:51 INFO - MEMORY STAT | vsize 518MB | residentFast 102MB | heapAllocated 22MB 11:34:52 INFO - 204 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug912322.html | took 1156ms 11:34:52 INFO - ++DOMWINDOW == 48 (0x7f08b03cfc00) [pid = 2442] [serial = 225] [outer = 0x7f08af691c00] 11:34:52 INFO - 205 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug916945.html 11:34:53 INFO - ++DOMWINDOW == 49 (0x7f08b03d2400) [pid = 2442] [serial = 226] [outer = 0x7f08af691c00] 11:34:53 INFO - ++DOCSHELL 0x7f08b6f9c800 == 13 [pid = 2442] [id = 50] 11:34:53 INFO - ++DOMWINDOW == 50 (0x7f08b3abb800) [pid = 2442] [serial = 227] [outer = (nil)] 11:34:53 INFO - ++DOCSHELL 0x7f08b6f9f000 == 14 [pid = 2442] [id = 51] 11:34:53 INFO - ++DOMWINDOW == 51 (0x7f08b3abe800) [pid = 2442] [serial = 228] [outer = (nil)] 11:34:53 INFO - ++DOMWINDOW == 52 (0x7f08b3ac1000) [pid = 2442] [serial = 229] [outer = 0x7f08b3abb800] 11:34:53 INFO - ++DOCSHELL 0x7f08ae05a800 == 15 [pid = 2442] [id = 52] 11:34:53 INFO - ++DOMWINDOW == 53 (0x7f08b3ae7800) [pid = 2442] [serial = 230] [outer = (nil)] 11:34:53 INFO - ++DOMWINDOW == 54 (0x7f08b3aea000) [pid = 2442] [serial = 231] [outer = 0x7f08b3abe800] 11:34:53 INFO - ++DOMWINDOW == 55 (0x7f08b3aefc00) [pid = 2442] [serial = 232] [outer = 0x7f08b3ae7800] 11:34:53 INFO - ++DOCSHELL 0x7f08ae065800 == 16 [pid = 2442] [id = 53] 11:34:53 INFO - ++DOMWINDOW == 56 (0x7f08b3d41400) [pid = 2442] [serial = 233] [outer = (nil)] 11:34:53 INFO - ++DOMWINDOW == 57 (0x7f08b3a63000) [pid = 2442] [serial = 234] [outer = 0x7f08b3d41400] 11:34:53 INFO - MEMORY STAT | vsize 519MB | residentFast 103MB | heapAllocated 23MB 11:34:53 INFO - 206 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug916945.html | took 889ms 11:34:53 INFO - ++DOMWINDOW == 58 (0x7f08ae0bc000) [pid = 2442] [serial = 235] [outer = 0x7f08af691c00] 11:34:53 INFO - 207 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug92773.html 11:34:54 INFO - ++DOMWINDOW == 59 (0x7f08ae0bc400) [pid = 2442] [serial = 236] [outer = 0x7f08af691c00] 11:34:54 INFO - ++DOCSHELL 0x7f08ae058800 == 17 [pid = 2442] [id = 54] 11:34:54 INFO - ++DOMWINDOW == 60 (0x7f08ae0be800) [pid = 2442] [serial = 237] [outer = (nil)] 11:34:54 INFO - ++DOMWINDOW == 61 (0x7f08ae0c1c00) [pid = 2442] [serial = 238] [outer = 0x7f08ae0be800] 11:34:54 INFO - JavaScript error: http://example.com/tests/js/xpconnect/tests/mochitest/bug92773_helper.html, line 4: SyntaxError: missing ; before statement 11:34:54 INFO - MEMORY STAT | vsize 521MB | residentFast 105MB | heapAllocated 23MB 11:34:54 INFO - 208 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug92773.html | took 398ms 11:34:54 INFO - ++DOMWINDOW == 62 (0x7f08ae0c3400) [pid = 2442] [serial = 239] [outer = 0x7f08af691c00] 11:34:54 INFO - 209 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug940783.html 11:34:54 INFO - ++DOMWINDOW == 63 (0x7f08ae0c2000) [pid = 2442] [serial = 240] [outer = 0x7f08af691c00] 11:34:54 INFO - ++DOCSHELL 0x7f08add8e000 == 18 [pid = 2442] [id = 55] 11:34:54 INFO - ++DOMWINDOW == 64 (0x7f08ae0c6c00) [pid = 2442] [serial = 241] [outer = (nil)] 11:34:54 INFO - ++DOMWINDOW == 65 (0x7f08ae0c7c00) [pid = 2442] [serial = 242] [outer = 0x7f08ae0c6c00] 11:34:54 INFO - ++DOCSHELL 0x7f08add95800 == 19 [pid = 2442] [id = 56] 11:34:54 INFO - ++DOMWINDOW == 66 (0x7f08ae0c5c00) [pid = 2442] [serial = 243] [outer = (nil)] 11:34:54 INFO - [Child 2442] WARNING: Subdocument container has no presshell: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsDocumentViewer.cpp, line 2446 11:34:54 INFO - ++DOMWINDOW == 67 (0x7f08ae0bd000) [pid = 2442] [serial = 244] [outer = 0x7f08ae0c5c00] 11:34:54 INFO - ++DOMWINDOW == 68 (0x7f08ae0c9c00) [pid = 2442] [serial = 245] [outer = 0x7f08ae0c6c00] 11:34:54 INFO - ++DOCSHELL 0x7f08add9c800 == 20 [pid = 2442] [id = 57] 11:34:54 INFO - ++DOMWINDOW == 69 (0x7f08aebe3000) [pid = 2442] [serial = 246] [outer = (nil)] 11:34:54 INFO - [Child 2442] WARNING: Subdocument container has no presshell: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsDocumentViewer.cpp, line 2446 11:34:54 INFO - ++DOMWINDOW == 70 (0x7f08b0159c00) [pid = 2442] [serial = 247] [outer = 0x7f08aebe3000] 11:34:54 INFO - ++DOMWINDOW == 71 (0x7f08b3d42400) [pid = 2442] [serial = 248] [outer = 0x7f08ae0c6c00] 11:34:54 INFO - ++DOCSHELL 0x7f08adb04800 == 21 [pid = 2442] [id = 58] 11:34:54 INFO - ++DOMWINDOW == 72 (0x7f08b3d98000) [pid = 2442] [serial = 249] [outer = (nil)] 11:34:54 INFO - [Child 2442] WARNING: Subdocument container has no presshell: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsDocumentViewer.cpp, line 2446 11:34:54 INFO - ++DOMWINDOW == 73 (0x7f08b3d9ec00) [pid = 2442] [serial = 250] [outer = 0x7f08b3d98000] 11:34:54 INFO - MEMORY STAT | vsize 523MB | residentFast 106MB | heapAllocated 24MB 11:34:55 INFO - 210 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug940783.html | took 686ms 11:34:55 INFO - ++DOMWINDOW == 74 (0x7f08ae0bf000) [pid = 2442] [serial = 251] [outer = 0x7f08af691c00] 11:34:55 INFO - 211 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug960820.html 11:34:55 INFO - ++DOMWINDOW == 75 (0x7f08ae0c0000) [pid = 2442] [serial = 252] [outer = 0x7f08af691c00] 11:34:55 INFO - [Child 2442] WARNING: Silently denied access to property "stack": object is not safely Xrayable (@chrome://specialpowers/content/specialpowersAPI.js:298:19): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/XrayWrapper.cpp, line 215 11:34:55 INFO - [Child 2442] WARNING: Silently denied access to property "stack": object is not safely Xrayable (@chrome://specialpowers/content/specialpowersAPI.js:299:19): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/XrayWrapper.cpp, line 215 11:34:55 INFO - MEMORY STAT | vsize 523MB | residentFast 107MB | heapAllocated 24MB 11:34:55 INFO - 212 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug960820.html | took 462ms 11:34:55 INFO - ++DOMWINDOW == 76 (0x7f08ae0c8400) [pid = 2442] [serial = 253] [outer = 0x7f08af691c00] 11:34:55 INFO - 213 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug965082.html 11:34:56 INFO - ++DOMWINDOW == 77 (0x7f08ae6a1000) [pid = 2442] [serial = 254] [outer = 0x7f08af691c00] 11:34:56 INFO - ++DOCSHELL 0x7f08adb1e800 == 22 [pid = 2442] [id = 59] 11:34:56 INFO - ++DOMWINDOW == 78 (0x7f08b3ae5000) [pid = 2442] [serial = 255] [outer = (nil)] 11:34:56 INFO - ++DOMWINDOW == 79 (0x7f08b3d91c00) [pid = 2442] [serial = 256] [outer = 0x7f08b3ae5000] 11:34:56 INFO - ++DOCSHELL 0x7f08ae8c8000 == 23 [pid = 2442] [id = 60] 11:34:56 INFO - ++DOMWINDOW == 80 (0x7f08b8ff4c00) [pid = 2442] [serial = 257] [outer = (nil)] 11:34:56 INFO - ++DOMWINDOW == 81 (0x7f08adbe4400) [pid = 2442] [serial = 258] [outer = 0x7f08b8ff4c00] 11:34:56 INFO - JavaScript warning: http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug965082.html, line 23: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 11:34:56 INFO - MEMORY STAT | vsize 526MB | residentFast 109MB | heapAllocated 25MB 11:34:56 INFO - 214 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug965082.html | took 774ms 11:34:56 INFO - ++DOMWINDOW == 82 (0x7f08adbe8c00) [pid = 2442] [serial = 259] [outer = 0x7f08af691c00] 11:34:56 INFO - 215 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug986542.html 11:34:57 INFO - ++DOMWINDOW == 83 (0x7f08adbe9000) [pid = 2442] [serial = 260] [outer = 0x7f08af691c00] 11:34:57 INFO - --DOCSHELL 0x7f08ae506000 == 22 [pid = 2442] [id = 42] 11:34:57 INFO - --DOCSHELL 0x7f08ae8c9000 == 21 [pid = 2442] [id = 43] 11:34:57 INFO - --DOCSHELL 0x7f08b0116800 == 20 [pid = 2442] [id = 44] 11:34:57 INFO - --DOCSHELL 0x7f08aeb6b800 == 19 [pid = 2442] [id = 46] 11:34:57 INFO - --DOCSHELL 0x7f08b043a000 == 18 [pid = 2442] [id = 45] 11:34:57 INFO - --DOCSHELL 0x7f08aeb7a800 == 17 [pid = 2442] [id = 47] 11:34:57 INFO - --DOCSHELL 0x7f08b0697000 == 16 [pid = 2442] [id = 48] 11:34:57 INFO - --DOCSHELL 0x7f08b0699800 == 15 [pid = 2442] [id = 49] 11:34:57 INFO - --DOCSHELL 0x7f08b6f9c800 == 14 [pid = 2442] [id = 50] 11:34:57 INFO - --DOCSHELL 0x7f08b6f9f000 == 13 [pid = 2442] [id = 51] 11:34:57 INFO - --DOCSHELL 0x7f08ae05a800 == 12 [pid = 2442] [id = 52] 11:34:57 INFO - --DOCSHELL 0x7f08ae065800 == 11 [pid = 2442] [id = 53] 11:34:57 INFO - --DOCSHELL 0x7f08ae058800 == 10 [pid = 2442] [id = 54] 11:34:57 INFO - --DOCSHELL 0x7f08add8e000 == 9 [pid = 2442] [id = 55] 11:34:57 INFO - --DOCSHELL 0x7f08add95800 == 8 [pid = 2442] [id = 56] 11:34:57 INFO - --DOCSHELL 0x7f08add9c800 == 7 [pid = 2442] [id = 57] 11:34:57 INFO - --DOCSHELL 0x7f08adb04800 == 6 [pid = 2442] [id = 58] 11:34:57 INFO - --DOMWINDOW == 82 (0x7f08ae61ac00) [pid = 2442] [serial = 182] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug829872.html] 11:34:57 INFO - --DOMWINDOW == 81 (0x7f08ae0bd000) [pid = 2442] [serial = 244] [outer = 0x7f08ae0c5c00] [url = about:blank] 11:34:57 INFO - --DOMWINDOW == 80 (0x7f08b0159c00) [pid = 2442] [serial = 247] [outer = 0x7f08aebe3000] [url = about:blank] 11:34:57 INFO - --DOMWINDOW == 79 (0x7f08b3d9ec00) [pid = 2442] [serial = 250] [outer = 0x7f08b3d98000] [url = about:blank] 11:34:57 INFO - ++DOCSHELL 0x7f08adb03800 == 7 [pid = 2442] [id = 61] 11:34:57 INFO - ++DOMWINDOW == 80 (0x7f08adbefc00) [pid = 2442] [serial = 261] [outer = (nil)] 11:34:57 INFO - ++DOMWINDOW == 81 (0x7f08adbf0c00) [pid = 2442] [serial = 262] [outer = 0x7f08adbefc00] 11:34:57 INFO - MEMORY STAT | vsize 524MB | residentFast 105MB | heapAllocated 19MB 11:34:57 INFO - --DOCSHELL 0x7f08ae8c8000 == 6 [pid = 2442] [id = 60] 11:34:57 INFO - --DOCSHELL 0x7f08adb1e800 == 5 [pid = 2442] [id = 59] 11:34:57 INFO - 216 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug986542.html | took 827ms 11:34:57 INFO - --DOMWINDOW == 80 (0x7f08b3d98000) [pid = 2442] [serial = 249] [outer = (nil)] [url = about:blank] 11:34:57 INFO - --DOMWINDOW == 79 (0x7f08aebe3000) [pid = 2442] [serial = 246] [outer = (nil)] [url = about:blank] 11:34:57 INFO - --DOMWINDOW == 78 (0x7f08ae0c5c00) [pid = 2442] [serial = 243] [outer = (nil)] [url = about:blank] 11:34:57 INFO - ++DOMWINDOW == 79 (0x7f08adbed800) [pid = 2442] [serial = 263] [outer = 0x7f08af691c00] 11:34:57 INFO - 217 INFO TEST-START | js/xpconnect/tests/mochitest/test_bug993423.html 11:34:57 INFO - ++DOMWINDOW == 80 (0x7f08adbeec00) [pid = 2442] [serial = 264] [outer = 0x7f08af691c00] 11:34:58 INFO - MEMORY STAT | vsize 524MB | residentFast 106MB | heapAllocated 20MB 11:34:58 INFO - 218 INFO TEST-OK | js/xpconnect/tests/mochitest/test_bug993423.html | took 311ms 11:34:58 INFO - ++DOMWINDOW == 81 (0x7f08ae6a8800) [pid = 2442] [serial = 265] [outer = 0x7f08af691c00] 11:34:58 INFO - 219 INFO TEST-START | js/xpconnect/tests/mochitest/test_crossOriginObjects.html 11:34:58 INFO - ++DOMWINDOW == 82 (0x7f08adbedc00) [pid = 2442] [serial = 266] [outer = 0x7f08af691c00] 11:34:58 INFO - ++DOCSHELL 0x7f08ae056800 == 6 [pid = 2442] [id = 62] 11:34:58 INFO - ++DOMWINDOW == 83 (0x7f08ae83f800) [pid = 2442] [serial = 267] [outer = (nil)] 11:34:58 INFO - ++DOCSHELL 0x7f08ae058000 == 7 [pid = 2442] [id = 63] 11:34:58 INFO - ++DOMWINDOW == 84 (0x7f08aeb93800) [pid = 2442] [serial = 268] [outer = (nil)] 11:34:58 INFO - ++DOMWINDOW == 85 (0x7f08adbeb400) [pid = 2442] [serial = 269] [outer = 0x7f08ae83f800] 11:34:58 INFO - ++DOMWINDOW == 86 (0x7f08ae83a800) [pid = 2442] [serial = 270] [outer = 0x7f08aeb93800] 11:34:59 INFO - ++DOMWINDOW == 87 (0x7f08aebe1c00) [pid = 2442] [serial = 271] [outer = 0x7f08aeb93800] 11:34:59 INFO - ++DOMWINDOW == 88 (0x7f08aebe8800) [pid = 2442] [serial = 272] [outer = 0x7f08ae83f800] 11:34:59 INFO - ++DOMWINDOW == 89 (0x7f08aebe4800) [pid = 2442] [serial = 273] [outer = 0x7f08aeb93800] 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - [Child 2442] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4095 11:34:59 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4100 11:34:59 INFO - ++DOMWINDOW == 90 (0x7f08adbee400) [pid = 2442] [serial = 274] [outer = 0x7f08ae83f800] 11:34:59 INFO - ++DOMWINDOW == 91 (0x7f08aebea400) [pid = 2442] [serial = 275] [outer = 0x7f08aeb93800] 11:34:59 INFO - ++DOMWINDOW == 92 (0x7f08aebe7c00) [pid = 2442] [serial = 276] [outer = 0x7f08ae83f800] 11:34:59 INFO - ++DOMWINDOW == 93 (0x7f08aece1400) [pid = 2442] [serial = 277] [outer = 0x7f08aeb93800] 11:35:00 INFO - JavaScript warning: http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_crossOriginObjects.html, line 133: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 11:35:00 INFO - ++DOMWINDOW == 94 (0x7f08af693800) [pid = 2442] [serial = 278] [outer = 0x7f08ae83f800] 11:35:00 INFO - ++DOMWINDOW == 95 (0x7f08b0156000) [pid = 2442] [serial = 279] [outer = 0x7f08aeb93800] 11:35:00 INFO - ++DOMWINDOW == 96 (0x7f08aecd9c00) [pid = 2442] [serial = 280] [outer = 0x7f08ae83f800] 11:35:00 INFO - ++DOMWINDOW == 97 (0x7f08b031b400) [pid = 2442] [serial = 281] [outer = 0x7f08aeb93800] 11:35:00 INFO - ++DOMWINDOW == 98 (0x7f08b0153400) [pid = 2442] [serial = 282] [outer = 0x7f08ae83f800] 11:35:00 INFO - ++DOMWINDOW == 99 (0x7f08b0379000) [pid = 2442] [serial = 283] [outer = 0x7f08aeb93800] 11:35:00 INFO - --DOMWINDOW == 98 (0x7f08ae0c6c00) [pid = 2442] [serial = 241] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 97 (0x7f08ae69dc00) [pid = 2442] [serial = 211] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 96 (0x7f08aeb8d800) [pid = 2442] [serial = 215] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 95 (0x7f08aeb8f400) [pid = 2442] [serial = 216] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 94 (0x7f08aebe2c00) [pid = 2442] [serial = 219] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 93 (0x7f08aebe5000) [pid = 2442] [serial = 220] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 92 (0x7f08aebe8000) [pid = 2442] [serial = 221] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 91 (0x7f08b032a400) [pid = 2442] [serial = 223] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 90 (0x7f08b03cfc00) [pid = 2442] [serial = 225] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 89 (0x7f08b3ac1000) [pid = 2442] [serial = 229] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 88 (0x7f08b3aea000) [pid = 2442] [serial = 231] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 87 (0x7f08b3aefc00) [pid = 2442] [serial = 232] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 86 (0x7f08b3a63000) [pid = 2442] [serial = 234] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 85 (0x7f08ae0bc000) [pid = 2442] [serial = 235] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 84 (0x7f08ae0c3400) [pid = 2442] [serial = 239] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 83 (0x7f08ae619800) [pid = 2442] [serial = 181] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 82 (0x7f08ae6abc00) [pid = 2442] [serial = 186] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 81 (0x7f08ae83b800) [pid = 2442] [serial = 188] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 80 (0x7f08ae612000) [pid = 2442] [serial = 191] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 79 (0x7f08ae847400) [pid = 2442] [serial = 193] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 78 (0x7f08aeb95800) [pid = 2442] [serial = 195] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 77 (0x7f08ae6a7000) [pid = 2442] [serial = 197] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 76 (0x7f08af68c400) [pid = 2442] [serial = 198] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 75 (0x7f08ae619400) [pid = 2442] [serial = 201] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 74 (0x7f08ae83c400) [pid = 2442] [serial = 203] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 73 (0x7f08ae61c800) [pid = 2442] [serial = 204] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 72 (0x7f08aeb96400) [pid = 2442] [serial = 207] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 71 (0x7f08aebe3400) [pid = 2442] [serial = 208] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 70 (0x7f08ae6a7800) [pid = 2442] [serial = 210] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 69 (0x7f08ae0c8400) [pid = 2442] [serial = 253] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 68 (0x7f08ae0bf000) [pid = 2442] [serial = 251] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:00 INFO - --DOMWINDOW == 67 (0x7f08ae0c1c00) [pid = 2442] [serial = 238] [outer = (nil)] [url = http://example.com/tests/js/xpconnect/tests/mochitest/bug92773_helper.html] 11:35:00 INFO - --DOMWINDOW == 66 (0x7f08ae6a2400) [pid = 2442] [serial = 184] [outer = (nil)] [url = data:text/html,] 11:35:00 INFO - --DOMWINDOW == 65 (0x7f08ae83e800) [pid = 2442] [serial = 213] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 64 (0x7f08ae842c00) [pid = 2442] [serial = 214] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 63 (0x7f08aebe1400) [pid = 2442] [serial = 217] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 62 (0x7f08aebddc00) [pid = 2442] [serial = 218] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 61 (0x7f08b3abb800) [pid = 2442] [serial = 227] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 60 (0x7f08b3abe800) [pid = 2442] [serial = 228] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 59 (0x7f08b3ae7800) [pid = 2442] [serial = 230] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 58 (0x7f08b3d41400) [pid = 2442] [serial = 233] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 57 (0x7f08ae69e400) [pid = 2442] [serial = 185] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 56 (0x7f08ae6a1800) [pid = 2442] [serial = 183] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 55 (0x7f08ae83ec00) [pid = 2442] [serial = 189] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 54 (0x7f08ae840000) [pid = 2442] [serial = 190] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 53 (0x7f08ae845800) [pid = 2442] [serial = 192] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 52 (0x7f08aeb9cc00) [pid = 2442] [serial = 196] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 51 (0x7f08ae615800) [pid = 2442] [serial = 200] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 50 (0x7f08ae6ac400) [pid = 2442] [serial = 202] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 49 (0x7f08ae846800) [pid = 2442] [serial = 206] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:00 INFO - --DOMWINDOW == 48 (0x7f08ae83e000) [pid = 2442] [serial = 209] [outer = (nil)] [url = about:blank] 11:35:00 INFO - --DOMWINDOW == 47 (0x7f08ae0be800) [pid = 2442] [serial = 237] [outer = (nil)] [url = http://example.com/tests/js/xpconnect/tests/mochitest/bug92773_helper.html] 11:35:00 INFO - --DOMWINDOW == 46 (0x7f08ae69e800) [pid = 2442] [serial = 212] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug870423.html] 11:35:00 INFO - --DOMWINDOW == 45 (0x7f08b0376000) [pid = 2442] [serial = 224] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug912322.html] 11:35:00 INFO - --DOMWINDOW == 44 (0x7f08b12ccc00) [pid = 2442] [serial = 180] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug809547.html] 11:35:00 INFO - --DOMWINDOW == 43 (0x7f08ae0c0000) [pid = 2442] [serial = 252] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug960820.html] 11:35:00 INFO - --DOMWINDOW == 42 (0x7f08ae0c2000) [pid = 2442] [serial = 240] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug940783.html] 11:35:00 INFO - ++DOMWINDOW == 43 (0x7f08ae0c6c00) [pid = 2442] [serial = 284] [outer = 0x7f08ae83f800] 11:35:00 INFO - ++DOMWINDOW == 44 (0x7f08ae619400) [pid = 2442] [serial = 285] [outer = 0x7f08aeb93800] 11:35:00 INFO - ++DOMWINDOW == 45 (0x7f08ae6a7000) [pid = 2442] [serial = 286] [outer = 0x7f08ae83f800] 11:35:00 INFO - ++DOMWINDOW == 46 (0x7f08ae619800) [pid = 2442] [serial = 287] [outer = 0x7f08aeb93800] 11:35:01 INFO - ++DOMWINDOW == 47 (0x7f08ae6a1800) [pid = 2442] [serial = 288] [outer = 0x7f08ae83f800] 11:35:01 INFO - ++DOMWINDOW == 48 (0x7f08ae83e000) [pid = 2442] [serial = 289] [outer = 0x7f08aeb93800] 11:35:01 INFO - ++DOMWINDOW == 49 (0x7f08aeb96400) [pid = 2442] [serial = 290] [outer = 0x7f08ae83f800] 11:35:01 INFO - ++DOMWINDOW == 50 (0x7f08ae845800) [pid = 2442] [serial = 291] [outer = 0x7f08aeb93800] 11:35:01 INFO - ++DOMWINDOW == 51 (0x7f08ae83b800) [pid = 2442] [serial = 292] [outer = 0x7f08ae83f800] 11:35:01 INFO - ++DOMWINDOW == 52 (0x7f08b01d2800) [pid = 2442] [serial = 293] [outer = 0x7f08aeb93800] 11:35:01 INFO - ++DOMWINDOW == 53 (0x7f08aece1c00) [pid = 2442] [serial = 294] [outer = 0x7f08ae83f800] 11:35:01 INFO - ++DOMWINDOW == 54 (0x7f08b01d2c00) [pid = 2442] [serial = 295] [outer = 0x7f08aeb93800] 11:35:02 INFO - ++DOMWINDOW == 55 (0x7f08b031c800) [pid = 2442] [serial = 296] [outer = 0x7f08ae83f800] 11:35:02 INFO - ++DOMWINDOW == 56 (0x7f08b031bc00) [pid = 2442] [serial = 297] [outer = 0x7f08aeb93800] 11:35:02 INFO - ++DOMWINDOW == 57 (0x7f08b01d0400) [pid = 2442] [serial = 298] [outer = 0x7f08ae83f800] 11:35:02 INFO - ++DOMWINDOW == 58 (0x7f08b031d400) [pid = 2442] [serial = 299] [outer = 0x7f08aeb93800] 11:35:02 INFO - ++DOMWINDOW == 59 (0x7f08b0320400) [pid = 2442] [serial = 300] [outer = 0x7f08ae83f800] 11:35:02 INFO - ++DOMWINDOW == 60 (0x7f08b031e800) [pid = 2442] [serial = 301] [outer = 0x7f08aeb93800] 11:35:02 INFO - ++DOMWINDOW == 61 (0x7f08b031f000) [pid = 2442] [serial = 302] [outer = 0x7f08ae83f800] 11:35:02 INFO - ++DOMWINDOW == 62 (0x7f08b0376000) [pid = 2442] [serial = 303] [outer = 0x7f08aeb93800] 11:35:03 INFO - ++DOMWINDOW == 63 (0x7f08aeb95800) [pid = 2442] [serial = 304] [outer = 0x7f08ae83f800] 11:35:03 INFO - ++DOMWINDOW == 64 (0x7f08b0320800) [pid = 2442] [serial = 305] [outer = 0x7f08aeb93800] 11:35:03 INFO - ++DOCSHELL 0x7f08ad70b800 == 8 [pid = 2442] [id = 64] 11:35:03 INFO - ++DOMWINDOW == 65 (0x7f08b03d6800) [pid = 2442] [serial = 306] [outer = (nil)] 11:35:03 INFO - ++DOMWINDOW == 66 (0x7f08b041e000) [pid = 2442] [serial = 307] [outer = 0x7f08b03d6800] 11:35:03 INFO - ++DOMWINDOW == 67 (0x7f08b3ae5c00) [pid = 2442] [serial = 308] [outer = 0x7f08b03d6800] 11:35:04 INFO - ++DOCSHELL 0x7f08ad71c800 == 9 [pid = 2442] [id = 65] 11:35:04 INFO - ++DOMWINDOW == 68 (0x7f08ae0c2000) [pid = 2442] [serial = 309] [outer = (nil)] 11:35:04 INFO - ++DOCSHELL 0x7f08ad71f000 == 10 [pid = 2442] [id = 66] 11:35:04 INFO - ++DOMWINDOW == 69 (0x7f08ae0c2c00) [pid = 2442] [serial = 310] [outer = (nil)] 11:35:04 INFO - ++DOCSHELL 0x7f08ad721800 == 11 [pid = 2442] [id = 67] 11:35:04 INFO - ++DOMWINDOW == 70 (0x7f08ae0c3c00) [pid = 2442] [serial = 311] [outer = (nil)] 11:35:04 INFO - ++DOCSHELL 0x7f08ad722000 == 12 [pid = 2442] [id = 68] 11:35:04 INFO - ++DOMWINDOW == 71 (0x7f08ae0c4c00) [pid = 2442] [serial = 312] [outer = (nil)] 11:35:04 INFO - ++DOMWINDOW == 72 (0x7f08ae69d800) [pid = 2442] [serial = 313] [outer = 0x7f08ae0c2000] 11:35:04 INFO - ++DOMWINDOW == 73 (0x7f08ae6a0000) [pid = 2442] [serial = 314] [outer = 0x7f08ae0c2c00] 11:35:04 INFO - ++DOMWINDOW == 74 (0x7f08ae6acc00) [pid = 2442] [serial = 315] [outer = 0x7f08ae0c3c00] 11:35:04 INFO - ++DOMWINDOW == 75 (0x7f08ae842400) [pid = 2442] [serial = 316] [outer = 0x7f08ae0c4c00] 11:35:05 INFO - ++DOMWINDOW == 76 (0x7f08adbf0000) [pid = 2442] [serial = 317] [outer = 0x7f08ae0c2000] 11:35:05 INFO - ++DOMWINDOW == 77 (0x7f08aecdfc00) [pid = 2442] [serial = 318] [outer = 0x7f08ae0c3c00] 11:35:05 INFO - ++DOMWINDOW == 78 (0x7f08b031e000) [pid = 2442] [serial = 319] [outer = 0x7f08ae0c4c00] 11:35:05 INFO - ++DOMWINDOW == 79 (0x7f08b03d3400) [pid = 2442] [serial = 320] [outer = 0x7f08ae0c2c00] 11:35:06 INFO - MEMORY STAT | vsize 534MB | residentFast 117MB | heapAllocated 29MB 11:35:06 INFO - 220 INFO TEST-OK | js/xpconnect/tests/mochitest/test_crossOriginObjects.html | took 8329ms 11:35:06 INFO - ++DOMWINDOW == 80 (0x7f08ae0be400) [pid = 2442] [serial = 321] [outer = 0x7f08af691c00] 11:35:06 INFO - 221 INFO TEST-START | js/xpconnect/tests/mochitest/test_crosscompartment_weakmap.html 11:35:07 INFO - ++DOMWINDOW == 81 (0x7f08ae839800) [pid = 2442] [serial = 322] [outer = 0x7f08af691c00] 11:35:07 INFO - ++DOCSHELL 0x7f08acf36800 == 13 [pid = 2442] [id = 69] 11:35:07 INFO - ++DOMWINDOW == 82 (0x7f08b3af3800) [pid = 2442] [serial = 323] [outer = (nil)] 11:35:07 INFO - ++DOMWINDOW == 83 (0x7f08adbe5800) [pid = 2442] [serial = 324] [outer = 0x7f08b3af3800] 11:35:07 INFO - --DOCSHELL 0x7f08adb03800 == 12 [pid = 2442] [id = 61] 11:35:07 INFO - --DOCSHELL 0x7f08ad71c800 == 11 [pid = 2442] [id = 65] 11:35:07 INFO - --DOCSHELL 0x7f08ad71f000 == 10 [pid = 2442] [id = 66] 11:35:07 INFO - --DOCSHELL 0x7f08ad721800 == 9 [pid = 2442] [id = 67] 11:35:07 INFO - --DOCSHELL 0x7f08ad722000 == 8 [pid = 2442] [id = 68] 11:35:07 INFO - --DOCSHELL 0x7f08ad70b800 == 7 [pid = 2442] [id = 64] 11:35:07 INFO - --DOMWINDOW == 82 (0x7f08aeb94800) [pid = 2442] [serial = 222] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug871887.html] 11:35:07 INFO - --DOMWINDOW == 81 (0x7f08adbe8c00) [pid = 2442] [serial = 259] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:07 INFO - --DOMWINDOW == 80 (0x7f08ae83a000) [pid = 2442] [serial = 187] [outer = (nil)] [url = data:text/html,] 11:35:07 INFO - --DOMWINDOW == 79 (0x7f08ae69f000) [pid = 2442] [serial = 205] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug865260.html] 11:35:07 INFO - --DOMWINDOW == 78 (0x7f08af68f400) [pid = 2442] [serial = 199] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug862380.html] 11:35:07 INFO - --DOMWINDOW == 77 (0x7f08ae6a1000) [pid = 2442] [serial = 254] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug965082.html] 11:35:07 INFO - --DOMWINDOW == 76 (0x7f08ae0c9c00) [pid = 2442] [serial = 245] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:07 INFO - --DOMWINDOW == 75 (0x7f08ae0c7c00) [pid = 2442] [serial = 242] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:07 INFO - --DOMWINDOW == 74 (0x7f08b3d42400) [pid = 2442] [serial = 248] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:07 INFO - --DOMWINDOW == 73 (0x7f08ae0bc400) [pid = 2442] [serial = 236] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug92773.html] 11:35:07 INFO - --DOMWINDOW == 72 (0x7f08b03d2400) [pid = 2442] [serial = 226] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug916945.html] 11:35:07 INFO - --DOMWINDOW == 71 (0x7f08ae6acc00) [pid = 2442] [serial = 315] [outer = (nil)] [url = about:blank] 11:35:07 INFO - --DOMWINDOW == 70 (0x7f08ae0be400) [pid = 2442] [serial = 321] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:07 INFO - --DOMWINDOW == 69 (0x7f08ae6a0000) [pid = 2442] [serial = 314] [outer = (nil)] [url = about:blank] 11:35:07 INFO - --DOMWINDOW == 68 (0x7f08ae69d800) [pid = 2442] [serial = 313] [outer = (nil)] [url = about:blank] 11:35:07 INFO - --DOMWINDOW == 67 (0x7f08ae842400) [pid = 2442] [serial = 316] [outer = (nil)] [url = about:blank] 11:35:07 INFO - --DOMWINDOW == 66 (0x7f08b031e800) [pid = 2442] [serial = 301] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 65 (0x7f08b0320400) [pid = 2442] [serial = 300] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 64 (0x7f08b031d400) [pid = 2442] [serial = 299] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 63 (0x7f08b01d0400) [pid = 2442] [serial = 298] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 62 (0x7f08b031bc00) [pid = 2442] [serial = 297] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 61 (0x7f08b031c800) [pid = 2442] [serial = 296] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 60 (0x7f08b01d2c00) [pid = 2442] [serial = 295] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 59 (0x7f08aece1c00) [pid = 2442] [serial = 294] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 58 (0x7f08b01d2800) [pid = 2442] [serial = 293] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 57 (0x7f08ae83b800) [pid = 2442] [serial = 292] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:07 INFO - --DOMWINDOW == 56 (0x7f08adbe4400) [pid = 2442] [serial = 258] [outer = (nil)] [url = about:blank] 11:35:07 INFO - --DOMWINDOW == 55 (0x7f08b3d91c00) [pid = 2442] [serial = 256] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:07 INFO - --DOMWINDOW == 54 (0x7f08ae845800) [pid = 2442] [serial = 291] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 53 (0x7f08aeb96400) [pid = 2442] [serial = 290] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 52 (0x7f08ae83e000) [pid = 2442] [serial = 289] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 51 (0x7f08ae6a1800) [pid = 2442] [serial = 288] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 50 (0x7f08ae619800) [pid = 2442] [serial = 287] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 49 (0x7f08ae6a7000) [pid = 2442] [serial = 286] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 48 (0x7f08ae619400) [pid = 2442] [serial = 285] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 47 (0x7f08ae0c6c00) [pid = 2442] [serial = 284] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 46 (0x7f08b0379000) [pid = 2442] [serial = 283] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 45 (0x7f08b0153400) [pid = 2442] [serial = 282] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 44 (0x7f08b031b400) [pid = 2442] [serial = 281] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 43 (0x7f08aecd9c00) [pid = 2442] [serial = 280] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 42 (0x7f08b0156000) [pid = 2442] [serial = 279] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 41 (0x7f08af693800) [pid = 2442] [serial = 278] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 40 (0x7f08aece1400) [pid = 2442] [serial = 277] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 39 (0x7f08aebe7c00) [pid = 2442] [serial = 276] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 38 (0x7f08aebea400) [pid = 2442] [serial = 275] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 37 (0x7f08adbee400) [pid = 2442] [serial = 274] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 36 (0x7f08aebe4800) [pid = 2442] [serial = 273] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 35 (0x7f08aebe8800) [pid = 2442] [serial = 272] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 34 (0x7f08aebe1c00) [pid = 2442] [serial = 271] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 33 (0x7f08ae83a800) [pid = 2442] [serial = 270] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 32 (0x7f08adbeb400) [pid = 2442] [serial = 269] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 31 (0x7f08ae6a8800) [pid = 2442] [serial = 265] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:08 INFO - --DOMWINDOW == 30 (0x7f08adbed800) [pid = 2442] [serial = 263] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:08 INFO - --DOMWINDOW == 29 (0x7f08b031f000) [pid = 2442] [serial = 302] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 28 (0x7f08b0376000) [pid = 2442] [serial = 303] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:08 INFO - --DOMWINDOW == 27 (0x7f08adbf0c00) [pid = 2442] [serial = 262] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 26 (0x7f08b041e000) [pid = 2442] [serial = 307] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 25 (0x7f08b8ff4c00) [pid = 2442] [serial = 257] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 24 (0x7f08b3ae5000) [pid = 2442] [serial = 255] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:08 INFO - --DOMWINDOW == 23 (0x7f08adbefc00) [pid = 2442] [serial = 261] [outer = (nil)] [url = about:blank] 11:35:08 INFO - --DOMWINDOW == 22 (0x7f08adbe9000) [pid = 2442] [serial = 260] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug986542.html] 11:35:08 INFO - --DOMWINDOW == 21 (0x7f08adbeec00) [pid = 2442] [serial = 264] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_bug993423.html] 11:35:08 INFO - MEMORY STAT | vsize 536MB | residentFast 104MB | heapAllocated 18MB 11:35:08 INFO - --DOCSHELL 0x7f08ae056800 == 6 [pid = 2442] [id = 62] 11:35:08 INFO - --DOCSHELL 0x7f08ae058000 == 5 [pid = 2442] [id = 63] 11:35:08 INFO - 222 INFO TEST-OK | js/xpconnect/tests/mochitest/test_crosscompartment_weakmap.html | took 1755ms 11:35:08 INFO - ++DOMWINDOW == 22 (0x7f08ae0ba800) [pid = 2442] [serial = 325] [outer = 0x7f08af691c00] 11:35:08 INFO - 223 INFO TEST-START | js/xpconnect/tests/mochitest/test_frameWrapping.html 11:35:08 INFO - ++DOMWINDOW == 23 (0x7f08ae0bb000) [pid = 2442] [serial = 326] [outer = 0x7f08af691c00] 11:35:08 INFO - ++DOCSHELL 0x7f08ad21a800 == 6 [pid = 2442] [id = 70] 11:35:08 INFO - ++DOMWINDOW == 24 (0x7f08adbf0800) [pid = 2442] [serial = 327] [outer = (nil)] 11:35:08 INFO - ++DOMWINDOW == 25 (0x7f08ae0c1400) [pid = 2442] [serial = 328] [outer = 0x7f08adbf0800] 11:35:08 INFO - MEMORY STAT | vsize 536MB | residentFast 106MB | heapAllocated 19MB 11:35:09 INFO - 224 INFO TEST-OK | js/xpconnect/tests/mochitest/test_frameWrapping.html | took 434ms 11:35:09 INFO - ++DOMWINDOW == 26 (0x7f08ae617400) [pid = 2442] [serial = 329] [outer = 0x7f08af691c00] 11:35:09 INFO - 225 INFO TEST-START | js/xpconnect/tests/mochitest/test_getWebIDLCaller.html 11:35:09 INFO - ++DOMWINDOW == 27 (0x7f08ae618800) [pid = 2442] [serial = 330] [outer = 0x7f08af691c00] 11:35:09 INFO - MEMORY STAT | vsize 536MB | residentFast 106MB | heapAllocated 20MB 11:35:09 INFO - 226 INFO TEST-OK | js/xpconnect/tests/mochitest/test_getWebIDLCaller.html | took 330ms 11:35:09 INFO - ++DOMWINDOW == 28 (0x7f08ae839400) [pid = 2442] [serial = 331] [outer = 0x7f08af691c00] 11:35:09 INFO - 227 INFO TEST-START | js/xpconnect/tests/mochitest/test_nac.xhtml 11:35:09 INFO - ++DOMWINDOW == 29 (0x7f08adbeac00) [pid = 2442] [serial = 332] [outer = 0x7f08af691c00] 11:35:09 INFO - ++DOCSHELL 0x7f08adb04000 == 7 [pid = 2442] [id = 71] 11:35:09 INFO - ++DOMWINDOW == 30 (0x7f08ae845800) [pid = 2442] [serial = 333] [outer = (nil)] 11:35:09 INFO - ++DOMWINDOW == 31 (0x7f08ae847400) [pid = 2442] [serial = 334] [outer = 0x7f08ae845800] 11:35:09 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:35:09 INFO - [Child 2442] WARNING: failed to load URL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 250 11:35:10 INFO - MEMORY STAT | vsize 536MB | residentFast 107MB | heapAllocated 21MB 11:35:10 INFO - 228 INFO TEST-OK | js/xpconnect/tests/mochitest/test_nac.xhtml | took 375ms 11:35:10 INFO - ++DOMWINDOW == 32 (0x7f08aeb8f400) [pid = 2442] [serial = 335] [outer = 0x7f08af691c00] 11:35:10 INFO - 229 INFO TEST-START | js/xpconnect/tests/mochitest/test_sameOriginPolicy.html 11:35:10 INFO - ++DOMWINDOW == 33 (0x7f08adbee400) [pid = 2442] [serial = 336] [outer = 0x7f08af691c00] 11:35:10 INFO - ++DOCSHELL 0x7f08ad219000 == 8 [pid = 2442] [id = 72] 11:35:10 INFO - ++DOMWINDOW == 34 (0x7f08adbe5000) [pid = 2442] [serial = 337] [outer = (nil)] 11:35:10 INFO - ++DOMWINDOW == 35 (0x7f08aebe3c00) [pid = 2442] [serial = 338] [outer = 0x7f08adbe5000] 11:35:10 INFO - ++DOCSHELL 0x7f08adb16000 == 9 [pid = 2442] [id = 73] 11:35:10 INFO - ++DOMWINDOW == 36 (0x7f08aebe7000) [pid = 2442] [serial = 339] [outer = (nil)] 11:35:10 INFO - ++DOMWINDOW == 37 (0x7f08aebe8800) [pid = 2442] [serial = 340] [outer = 0x7f08aebe7000] 11:35:10 INFO - [Child 2442] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 174 11:35:11 INFO - ++DOMWINDOW == 38 (0x7f08aeb8d800) [pid = 2442] [serial = 341] [outer = 0x7f08adbe5000] 11:35:11 INFO - ++DOCSHELL 0x7f08add8c800 == 10 [pid = 2442] [id = 74] 11:35:11 INFO - ++DOMWINDOW == 39 (0x7f08adbe4400) [pid = 2442] [serial = 342] [outer = (nil)] 11:35:11 INFO - --DOMWINDOW == 38 (0x7f08b03d6800) [pid = 2442] [serial = 306] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects_documentDomain.html] 11:35:11 INFO - --DOMWINDOW == 37 (0x7f08ae0c2000) [pid = 2442] [serial = 309] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:11 INFO - --DOMWINDOW == 36 (0x7f08ae0c2c00) [pid = 2442] [serial = 310] [outer = (nil)] [url = http://test2.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:11 INFO - --DOMWINDOW == 35 (0x7f08ae0c3c00) [pid = 2442] [serial = 311] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:11 INFO - --DOMWINDOW == 34 (0x7f08ae0c4c00) [pid = 2442] [serial = 312] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:11 INFO - ++DOMWINDOW == 35 (0x7f08ae0c3c00) [pid = 2442] [serial = 343] [outer = 0x7f08adbe4400] 11:35:12 INFO - MEMORY STAT | vsize 537MB | residentFast 111MB | heapAllocated 24MB 11:35:12 INFO - 230 INFO TEST-OK | js/xpconnect/tests/mochitest/test_sameOriginPolicy.html | took 1939ms 11:35:12 INFO - ++DOMWINDOW == 36 (0x7f08ad732c00) [pid = 2442] [serial = 344] [outer = 0x7f08af691c00] 11:35:12 INFO - 231 INFO TEST-START | js/xpconnect/tests/mochitest/test_sandbox_fetch.html 11:35:12 INFO - ++DOMWINDOW == 37 (0x7f08ad731000) [pid = 2442] [serial = 345] [outer = 0x7f08af691c00] 11:35:13 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805303F4: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/http/nsCORSListenerProxy.cpp, line 856 11:35:13 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805303F4: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/security/nsContentSecurityManager.cpp, line 118 11:35:13 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805303F4: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/security/nsContentSecurityManager.cpp, line 354 11:35:13 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805303F4: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/modules/libjar/nsJARChannel.cpp, line 997 11:35:13 INFO - [Child 2442] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805303F4: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/fetch/FetchDriver.cpp, line 356 11:35:13 INFO - MEMORY STAT | vsize 537MB | residentFast 113MB | heapAllocated 25MB 11:35:14 INFO - 232 INFO TEST-OK | js/xpconnect/tests/mochitest/test_sandbox_fetch.html | took 1497ms 11:35:14 INFO - ++DOMWINDOW == 38 (0x7f08aebe1400) [pid = 2442] [serial = 346] [outer = 0x7f08af691c00] 11:35:14 INFO - ++DOMWINDOW == 39 (0x7f08adbc0000) [pid = 2442] [serial = 347] [outer = 0x7f08af691c00] 11:35:14 INFO - --DOCSHELL 0x7f08acf36800 == 9 [pid = 2442] [id = 69] 11:35:14 INFO - --DOCSHELL 0x7f08ad21a800 == 8 [pid = 2442] [id = 70] 11:35:14 INFO - --DOCSHELL 0x7f08adb04000 == 7 [pid = 2442] [id = 71] 11:35:14 INFO - --DOCSHELL 0x7f08adb16000 == 6 [pid = 2442] [id = 73] 11:35:14 INFO - --DOCSHELL 0x7f08ad219000 == 5 [pid = 2442] [id = 72] 11:35:14 INFO - --DOCSHELL 0x7f08add8c800 == 4 [pid = 2442] [id = 74] 11:35:15 INFO - --DOMWINDOW == 38 (0x7f08b3ae5c00) [pid = 2442] [serial = 308] [outer = (nil)] [url = about:blank] 11:35:15 INFO - --DOMWINDOW == 37 (0x7f08adbf0000) [pid = 2442] [serial = 317] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:15 INFO - --DOMWINDOW == 36 (0x7f08b03d3400) [pid = 2442] [serial = 320] [outer = (nil)] [url = http://test2.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:15 INFO - --DOMWINDOW == 35 (0x7f08aecdfc00) [pid = 2442] [serial = 318] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:15 INFO - --DOMWINDOW == 34 (0x7f08b031e000) [pid = 2442] [serial = 319] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:15 INFO - --DOCSHELL 0x7f2f52dd6000 == 6 [pid = 2389] [id = 6] 11:35:15 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:35:16 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:35:16 INFO - --DOCSHELL 0x7f2f64581000 == 5 [pid = 2389] [id = 1] 11:35:16 INFO - --DOCSHELL 0x7f08ae505800 == 3 [pid = 2442] [id = 23] 11:35:16 INFO - ###!!! [Child][MessageChannel] Error: (msgtype=0xA00027,name=PNecko::Msg_RemoveSchedulingContext) Closed channel: cannot send/recv 11:35:16 INFO - [Child 2442] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:35:16 INFO - --DOCSHELL 0x7f08ae51c800 == 2 [pid = 2442] [id = 7] 11:35:16 INFO - ###!!! [Child][MessageChannel] Error: (msgtype=0xA00027,name=PNecko::Msg_RemoveSchedulingContext) Closed channel: cannot send/recv 11:35:16 INFO - [Child 2442] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:35:16 INFO - [Child 2442] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:35:17 INFO - --DOCSHELL 0x7f08af6a1000 == 1 [pid = 2442] [id = 2] 11:35:17 INFO - --DOCSHELL 0x7f08b122e800 == 0 [pid = 2442] [id = 1] 11:35:17 INFO - --DOMWINDOW == 33 (0x7f08aebe8800) [pid = 2442] [serial = 340] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 32 (0x7f08ae847400) [pid = 2442] [serial = 334] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 31 (0x7f08aebe3c00) [pid = 2442] [serial = 338] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:17 INFO - --DOMWINDOW == 30 (0x7f08aebe7000) [pid = 2442] [serial = 339] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 29 (0x7f08adbe5000) [pid = 2442] [serial = 337] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:17 INFO - --DOMWINDOW == 28 (0x7f08adbeac00) [pid = 2442] [serial = 332] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_nac.xhtml] 11:35:17 INFO - --DOMWINDOW == 27 (0x7f08ae845800) [pid = 2442] [serial = 333] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 26 (0x7f08aeb8d800) [pid = 2442] [serial = 341] [outer = (nil)] [url = http://example.org/tests/js/xpconnect/tests/mochitest/file_empty.html] 11:35:17 INFO - --DOMWINDOW == 25 (0x7f08ad732c00) [pid = 2442] [serial = 344] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 24 (0x7f08ae0bb000) [pid = 2442] [serial = 326] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_frameWrapping.html] 11:35:17 INFO - --DOMWINDOW == 23 (0x7f08ae0c3c00) [pid = 2442] [serial = 343] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 22 (0x7f08ad731000) [pid = 2442] [serial = 345] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_sandbox_fetch.html] 11:35:17 INFO - --DOMWINDOW == 21 (0x7f08adbe4400) [pid = 2442] [serial = 342] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 20 (0x7f08aebe1400) [pid = 2442] [serial = 346] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 19 (0x7f08adbe5800) [pid = 2442] [serial = 324] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crosscompartment_weakmap.html] 11:35:17 INFO - --DOMWINDOW == 18 (0x7f08b0320800) [pid = 2442] [serial = 305] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:17 INFO - --DOMWINDOW == 17 (0x7f08aeb95800) [pid = 2442] [serial = 304] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:17 INFO - --DOMWINDOW == 16 (0x7f08aeb8f400) [pid = 2442] [serial = 335] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 15 (0x7f08ae839400) [pid = 2442] [serial = 331] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 14 (0x7f08ae617400) [pid = 2442] [serial = 329] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 13 (0x7f08ae0c1400) [pid = 2442] [serial = 328] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/inner.html] 11:35:17 INFO - --DOMWINDOW == 12 (0x7f08ae0ba800) [pid = 2442] [serial = 325] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:35:17 INFO - --DOMWINDOW == 11 (0x7f08b01d5400) [pid = 2442] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:35:17 INFO - --DOMWINDOW == 10 (0x7f08adbc0000) [pid = 2442] [serial = 347] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 9 (0x7f08b127b000) [pid = 2442] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:35:17 INFO - --DOMWINDOW == 8 (0x7f08af691c00) [pid = 2442] [serial = 4] [outer = (nil)] [url = about:blank] 11:35:17 INFO - --DOMWINDOW == 7 (0x7f08ae839800) [pid = 2442] [serial = 322] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_crosscompartment_weakmap.html] 11:35:17 INFO - --DOMWINDOW == 6 (0x7f08b3af3800) [pid = 2442] [serial = 323] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crosscompartment_weakmap.html] 11:35:17 INFO - --DOMWINDOW == 5 (0x7f08aeb93800) [pid = 2442] [serial = 268] [outer = (nil)] [url = http://test1.mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:17 INFO - --DOMWINDOW == 4 (0x7f08ae83f800) [pid = 2442] [serial = 267] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/file_crossOriginObjects.html] 11:35:17 INFO - --DOMWINDOW == 3 (0x7f08adbf0800) [pid = 2442] [serial = 327] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/inner.html] 11:35:17 INFO - --DOMWINDOW == 2 (0x7f08adbee400) [pid = 2442] [serial = 336] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_sameOriginPolicy.html] 11:35:17 INFO - --DOMWINDOW == 1 (0x7f08adbedc00) [pid = 2442] [serial = 266] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_crossOriginObjects.html] 11:35:17 INFO - --DOMWINDOW == 0 (0x7f08ae618800) [pid = 2442] [serial = 330] [outer = (nil)] [url = http://mochi.test:8888/tests/js/xpconnect/tests/mochitest/test_getWebIDLCaller.html] 11:35:18 INFO - nsStringStats 11:35:18 INFO - => mAllocCount: 112878 11:35:18 INFO - => mReallocCount: 4700 11:35:18 INFO - => mFreeCount: 112878 11:35:18 INFO - => mShareCount: 163368 11:35:18 INFO - => mAdoptCount: 12849 11:35:18 INFO - => mAdoptFreeCount: 12849 11:35:18 INFO - => Process ID: 2442, Thread ID: 139675801651776 11:35:18 INFO - --DOCSHELL 0x7f2f4d560000 == 4 [pid = 2389] [id = 7] 11:35:18 INFO - --DOCSHELL 0x7f2f5ec66000 == 3 [pid = 2389] [id = 2] 11:35:18 INFO - --DOCSHELL 0x7f2f54d37000 == 2 [pid = 2389] [id = 3] 11:35:18 INFO - --DOCSHELL 0x7f2f54d3c000 == 1 [pid = 2389] [id = 4] 11:35:18 INFO - --DOCSHELL 0x7f2f4fb4a800 == 0 [pid = 2389] [id = 8] 11:35:18 INFO - --DOMWINDOW == 13 (0x7f2f52de4000) [pid = 2389] [serial = 10] [outer = 0x7f2f54d5cc00] [url = about:blank] 11:35:18 INFO - ]: --DOMWINDOW == 12 (0x7f2f54d5cc00) [pid = 2389] [serial = 6] [outer = (nil)] [url = about:blank] 11:35:18 INFO - --DOMWINDOW == 11 (0x7f2f52de4800) [pid = 2389] [serial = 11] [outer = 0x7f2f54d5d400] [url = about:blank] 11:35:18 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:35:18 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:35:18 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:35:18 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:35:19 INFO - [Parent 2389] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:35:19 INFO - [Parent 2389] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:35:19 INFO - --DOMWINDOW == 10 (0x7f2f54d5d400) [pid = 2389] [serial = 7] [outer = (nil)] [url = about:blank] 11:35:21 INFO - --DOMWINDOW == 9 (0x7f2f5eb0f000) [pid = 2389] [serial = 4] [outer = (nil)] [url = about:blank] 11:35:21 INFO - --DOMWINDOW == 8 (0x7f2f526c5400) [pid = 2389] [serial = 18] [outer = (nil)] [url = about:newtab] 11:35:21 INFO - --DOMWINDOW == 7 (0x7f2f5552a800) [pid = 2389] [serial = 20] [outer = (nil)] [url = about:newtab] 11:35:21 INFO - --DOMWINDOW == 6 (0x7f2f645aac00) [pid = 2389] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:35:21 INFO - --DOMWINDOW == 5 (0x7f2f5eb0e400) [pid = 2389] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:35:21 INFO - --DOMWINDOW == 4 (0x7f2f526cdc00) [pid = 2389] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:35:21 INFO - --DOMWINDOW == 3 (0x7f2f55c4b800) [pid = 2389] [serial = 16] [outer = (nil)] [url = about:blank] 11:35:21 INFO - --DOMWINDOW == 2 (0x7f2f5f007400) [pid = 2389] [serial = 17] [outer = (nil)] [url = about:blank] 11:35:21 INFO - --DOMWINDOW == 1 (0x7f2f553d8c00) [pid = 2389] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:35:21 INFO - --DOMWINDOW == 0 (0x7f2f5dc89400) [pid = 2389] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:35:21 INFO - nsStringStats 11:35:21 INFO - => mAllocCount: 152900 11:35:21 INFO - => mReallocCount: 19221 11:35:21 INFO - => mFreeCount: 152900 11:35:21 INFO - => mShareCount: 150903 11:35:21 INFO - => mAdoptCount: 5758 11:35:21 INFO - => mAdoptFreeCount: 5758 11:35:21 INFO - => Process ID: 2389, Thread ID: 139842106984256 11:35:21 INFO - TEST-INFO | Main app process: exit 0 11:35:21 INFO - runtests.py | Application ran for: 0:01:44.791833 11:35:21 INFO - zombiecheck | Reading PID log: /tmp/tmpjRxrhrpidlog 11:35:21 INFO - ==> process 2389 launched child process 2442 11:35:21 INFO - zombiecheck | Checking for orphan process with PID: 2442 11:35:21 INFO - Stopping web server 11:35:21 INFO - Stopping web socket server 11:35:21 INFO - Stopping ssltunnel 11:35:21 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:35:21 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:35:21 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:35:21 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2442 11:35:21 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:35:21 INFO - | | Per-Inst Leaked| Total Rem| 11:35:21 INFO - 0 |TOTAL | 22 4640| 5403555 33| 11:35:21 INFO - 12 |AsyncTransactionTrackersHolder | 72 72| 99 1| 11:35:21 INFO - 58 |CompositorChild | 880 880| 1 1| 11:35:21 INFO - 60 |CondVar | 40 120| 231 3| 11:35:21 INFO - 181 |IPC::Channel | 16 32| 7 2| 11:35:21 INFO - 215 |MessagePump | 16 16| 10 1| 11:35:21 INFO - 221 |Mutex | 32 96| 1676 3| 11:35:21 INFO - 236 |PCompositorChild | 776 776| 1 1| 11:35:21 INFO - 243 |PImageBridgeChild | 920 920| 1 1| 11:35:21 INFO - 295 |RefCountedMonitor | 80 160| 6 2| 11:35:21 INFO - 296 |RefCountedTask | 16 64| 12 4| 11:35:21 INFO - 337 |StoreRef | 16 32| 7 2| 11:35:21 INFO - 380 |WaitableEventKernel | 72 72| 13 1| 11:35:21 INFO - 385 |WeakReference | 16 32| 1335 2| 11:35:21 INFO - 414 |base::Thread | 48 48| 3 1| 11:35:21 INFO - 439 |ipc::MessageChannel | 512 1024| 6 2| 11:35:21 INFO - 807 |nsTArray_base | 8 40| 1439307 5| 11:35:21 INFO - 812 |nsThread | 256 256| 9 1| 11:35:21 INFO - nsTraceRefcnt::DumpStatistics: 887 entries 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:35:21 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:35:21 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:35:21 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2389 11:35:21 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:35:21 INFO - | | Per-Inst Leaked| Total Rem| 11:35:21 INFO - 0 |TOTAL | 23 0| 6000104 0| 11:35:21 INFO - nsTraceRefcnt::DumpStatistics: 1374 entries 11:35:21 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:35:21 INFO - runtests.py | Running tests: end. 11:35:21 INFO - 233 INFO TEST-START | Shutdown 11:35:21 INFO - 234 INFO Passed: 1092 11:35:21 INFO - 235 INFO Failed: 0 11:35:21 INFO - 236 INFO Todo: 3 11:35:21 INFO - 237 INFO Slowest: 8329ms - /tests/js/xpconnect/tests/mochitest/test_crossOriginObjects.html 11:35:21 INFO - 238 INFO SimpleTest FINISHED 11:35:21 INFO - 239 INFO TEST-INFO | Ran 1 Loops 11:35:21 INFO - 240 INFO SimpleTest FINISHED 11:35:21 INFO - dir: layout/base/tests 11:35:21 INFO - Setting pipeline to PAUSED ... 11:35:21 INFO - Pipeline is PREROLLING ... 11:35:21 INFO - Pipeline is PREROLLED ... 11:35:21 INFO - Setting pipeline to PLAYING ... 11:35:21 INFO - New clock: GstSystemClock 11:35:21 INFO - Got EOS from element "pipeline0". 11:35:21 INFO - Execution ended after 32849278 ns. 11:35:21 INFO - Setting pipeline to PAUSED ... 11:35:21 INFO - Setting pipeline to READY ... 11:35:21 INFO - Setting pipeline to NULL ... 11:35:21 INFO - Freeing pipeline ... 11:35:21 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:35:22 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmp1UCf5s.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:35:22 INFO - runtests.py | Server pid: 2504 11:35:22 INFO - runtests.py | Websocket server pid: 2507 11:35:22 INFO - runtests.py | SSL tunnel pid: 2510 11:35:22 INFO - runtests.py | Running tests: start. 11:35:22 INFO - runtests.py | Application pid: 2532 11:35:22 INFO - TEST-INFO | started process Main app process 11:35:22 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp1UCf5s.mozrunner/runtests_leaks.log 11:35:26 INFO - ++DOCSHELL 0x7f9730781000 == 1 [pid = 2532] [id = 1] 11:35:26 INFO - ++DOMWINDOW == 1 (0x7f97307ab800) [pid = 2532] [serial = 1] [outer = (nil)] 11:35:26 INFO - [2532] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:35:26 INFO - ++DOMWINDOW == 2 (0x7f972f969800) [pid = 2532] [serial = 2] [outer = 0x7f97307ab800] 11:35:27 INFO - ++DOCSHELL 0x7f972ae5e800 == 2 [pid = 2532] [id = 2] 11:35:27 INFO - ++DOMWINDOW == 3 (0x7f972ad07800) [pid = 2532] [serial = 3] [outer = (nil)] 11:35:27 INFO - ++DOMWINDOW == 4 (0x7f972ad08400) [pid = 2532] [serial = 4] [outer = 0x7f972ad07800] 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnptestjava.so returned 7f972adc61f0 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnpsecondtest.so returned 7f972adc65e0 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnptest.so returned 7f972adc6910 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnpctrltest.so returned 7f972adc6a00 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnpswftest.so returned 7f972adc6d30 11:35:27 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnpthirdtest.so returned 7f9729eff040 11:35:27 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f9729eff3a0 11:35:27 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f972adfe5b0 11:35:27 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f9730d0d700 11:35:27 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f9730d0da00 11:35:27 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f9730d0dd30 11:35:28 INFO - ++DOMWINDOW == 5 (0x7f9729e8a800) [pid = 2532] [serial = 5] [outer = 0x7f97307ab800] 11:35:30 INFO - [2532] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:35:31 INFO - ++DOCSHELL 0x7f971fe1b800 == 3 [pid = 2532] [id = 3] 11:35:31 INFO - ++DOMWINDOW == 6 (0x7f971fe4e400) [pid = 2532] [serial = 6] [outer = (nil)] 11:35:31 INFO - ++DOCSHELL 0x7f971fe1c000 == 4 [pid = 2532] [id = 4] 11:35:31 INFO - ++DOMWINDOW == 7 (0x7f971fe4ec00) [pid = 2532] [serial = 7] [outer = (nil)] 11:35:31 INFO - [2532] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:35:32 INFO - ++DOCSHELL 0x7f971e127800 == 5 [pid = 2532] [id = 5] 11:35:32 INFO - ++DOMWINDOW == 8 (0x7f971e273800) [pid = 2532] [serial = 8] [outer = (nil)] 11:35:32 INFO - [2532] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:35:32 INFO - ++DOMWINDOW == 9 (0x7f971e1e9000) [pid = 2532] [serial = 9] [outer = 0x7f971e273800] 11:35:32 INFO - ++DOMWINDOW == 10 (0x7f971dcb6c00) [pid = 2532] [serial = 10] [outer = 0x7f971fe4e400] 11:35:32 INFO - ++DOMWINDOW == 11 (0x7f971dcb7400) [pid = 2532] [serial = 11] [outer = 0x7f971fe4ec00] 11:35:32 INFO - ++DOMWINDOW == 12 (0x7f971dcb9000) [pid = 2532] [serial = 12] [outer = 0x7f971e273800] 11:35:34 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp1UCf5s.mozrunner/runtests_leaks_tab_pid2587.log 11:35:35 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:35:36 INFO - ++DOCSHELL 0x7f5928e2e800 == 1 [pid = 2587] [id = 1] 11:35:36 INFO - ++DOMWINDOW == 1 (0x7f5928e7b000) [pid = 2587] [serial = 1] [outer = (nil)] 11:35:36 INFO - ++DOMWINDOW == 2 (0x7f5928017000) [pid = 2587] [serial = 2] [outer = 0x7f5928e7b000] 11:35:37 INFO - [Parent 2532] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:35:37 INFO - [Parent 2532] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:35:38 INFO - ++DOMWINDOW == 3 (0x7f5927dd5400) [pid = 2587] [serial = 3] [outer = 0x7f5928e7b000] 11:35:38 INFO - ++DOCSHELL 0x7f971e131000 == 6 [pid = 2532] [id = 6] 11:35:38 INFO - ++DOMWINDOW == 13 (0x7f9729e8b800) [pid = 2532] [serial = 13] [outer = (nil)] 11:35:38 INFO - ++DOMWINDOW == 14 (0x7f972b262c00) [pid = 2532] [serial = 14] [outer = 0x7f9729e8b800] 11:35:39 INFO - ++DOMWINDOW == 15 (0x7f971d7c2400) [pid = 2532] [serial = 15] [outer = 0x7f9729e8b800] 11:35:39 INFO - ++DOCSHELL 0x7f971edad000 == 7 [pid = 2532] [id = 7] 11:35:39 INFO - ++DOMWINDOW == 16 (0x7f971d79d800) [pid = 2532] [serial = 16] [outer = (nil)] 11:35:39 INFO - ++DOMWINDOW == 17 (0x7f972ade2c00) [pid = 2532] [serial = 17] [outer = 0x7f971d79d800] 11:35:39 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:35:39 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:35:39 INFO - ++DOCSHELL 0x7f59272a1800 == 2 [pid = 2587] [id = 2] 11:35:39 INFO - ++DOMWINDOW == 4 (0x7f5927291800) [pid = 2587] [serial = 4] [outer = (nil)] 11:35:39 INFO - ++DOMWINDOW == 5 (0x7f5927dd3800) [pid = 2587] [serial = 5] [outer = 0x7f5927291800] 11:35:40 INFO - 241 INFO TEST-START | layout/base/tests/test_after_paint_pref.html 11:35:40 INFO - [Child 2587] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:35:40 INFO - ++DOMWINDOW == 6 (0x7f59268e0400) [pid = 2587] [serial = 6] [outer = 0x7f5927291800] 11:35:40 INFO - [Parent 2532] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:35:42 INFO - ++DOMWINDOW == 7 (0x7f5926796400) [pid = 2587] [serial = 7] [outer = 0x7f5927291800] 11:35:42 INFO - --DOCSHELL 0x7f971e127800 == 6 [pid = 2532] [id = 5] 11:35:44 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:35:44 INFO - MEMORY STAT | vsize 509MB | residentFast 87MB | heapAllocated 18MB 11:35:44 INFO - 242 INFO TEST-OK | layout/base/tests/test_after_paint_pref.html | took 3866ms 11:35:44 INFO - ++DOMWINDOW == 8 (0x7f592640c800) [pid = 2587] [serial = 8] [outer = 0x7f5927291800] 11:35:44 INFO - 243 INFO TEST-START | layout/base/tests/test_border_radius_hit_testing.html 11:35:44 INFO - ++DOMWINDOW == 9 (0x7f592640cc00) [pid = 2587] [serial = 9] [outer = 0x7f5927291800] 11:35:44 INFO - ++DOCSHELL 0x7f5926557000 == 3 [pid = 2587] [id = 3] 11:35:44 INFO - ++DOMWINDOW == 10 (0x7f5926413800) [pid = 2587] [serial = 10] [outer = (nil)] 11:35:44 INFO - ++DOMWINDOW == 11 (0x7f5926415800) [pid = 2587] [serial = 11] [outer = 0x7f5926413800] 11:35:44 INFO - MEMORY STAT | vsize 511MB | residentFast 90MB | heapAllocated 19MB 11:35:44 INFO - 244 INFO TEST-OK | layout/base/tests/test_border_radius_hit_testing.html | took 549ms 11:35:45 INFO - ++DOMWINDOW == 12 (0x7f592620a400) [pid = 2587] [serial = 12] [outer = 0x7f5927291800] 11:35:45 INFO - 245 INFO TEST-START | layout/base/tests/test_bug1078327.html 11:35:45 INFO - ++DOMWINDOW == 13 (0x7f592620a800) [pid = 2587] [serial = 13] [outer = 0x7f5927291800] 11:35:45 INFO - ++DOCSHELL 0x7f5926222800 == 4 [pid = 2587] [id = 4] 11:35:45 INFO - ++DOMWINDOW == 14 (0x7f592620f400) [pid = 2587] [serial = 14] [outer = (nil)] 11:35:45 INFO - ++DOMWINDOW == 15 (0x7f592620d400) [pid = 2587] [serial = 15] [outer = 0x7f592620f400] 11:35:45 INFO - ++DOMWINDOW == 16 (0x7f59262ba000) [pid = 2587] [serial = 16] [outer = 0x7f592620f400] 11:35:46 INFO - MEMORY STAT | vsize 513MB | residentFast 92MB | heapAllocated 21MB 11:35:46 INFO - 246 INFO TEST-OK | layout/base/tests/test_bug1078327.html | took 1046ms 11:35:46 INFO - ++DOMWINDOW == 17 (0x7f592619d400) [pid = 2587] [serial = 17] [outer = 0x7f5927291800] 11:35:46 INFO - 247 INFO TEST-START | layout/base/tests/test_bug1080360.html 11:35:46 INFO - ++DOMWINDOW == 18 (0x7f592619e000) [pid = 2587] [serial = 18] [outer = 0x7f5927291800] 11:35:46 INFO - ++DOCSHELL 0x7f592616c000 == 5 [pid = 2587] [id = 5] 11:35:46 INFO - ++DOMWINDOW == 19 (0x7f59261a2c00) [pid = 2587] [serial = 19] [outer = (nil)] 11:35:46 INFO - ++DOMWINDOW == 20 (0x7f59261a3400) [pid = 2587] [serial = 20] [outer = 0x7f59261a2c00] 11:35:46 INFO - ++DOMWINDOW == 21 (0x7f59261a4800) [pid = 2587] [serial = 21] [outer = 0x7f59261a2c00] 11:35:46 INFO - MEMORY STAT | vsize 514MB | residentFast 95MB | heapAllocated 22MB 11:35:47 INFO - 248 INFO TEST-OK | layout/base/tests/test_bug1080360.html | took 752ms 11:35:47 INFO - ++DOMWINDOW == 22 (0x7f592619e400) [pid = 2587] [serial = 22] [outer = 0x7f5927291800] 11:35:47 INFO - 249 INFO TEST-START | layout/base/tests/test_bug1080361.html 11:35:47 INFO - ++DOMWINDOW == 23 (0x7f59261a0000) [pid = 2587] [serial = 23] [outer = 0x7f5927291800] 11:35:47 INFO - ++DOCSHELL 0x7f592655a800 == 6 [pid = 2587] [id = 6] 11:35:47 INFO - ++DOMWINDOW == 24 (0x7f592620cc00) [pid = 2587] [serial = 24] [outer = (nil)] 11:35:47 INFO - ++DOMWINDOW == 25 (0x7f592620dc00) [pid = 2587] [serial = 25] [outer = 0x7f592620cc00] 11:35:47 INFO - ++DOMWINDOW == 26 (0x7f59261a0400) [pid = 2587] [serial = 26] [outer = 0x7f592620cc00] 11:35:48 INFO - --DOCSHELL 0x7f592616c000 == 5 [pid = 2587] [id = 5] 11:35:48 INFO - --DOCSHELL 0x7f5926222800 == 4 [pid = 2587] [id = 4] 11:35:48 INFO - --DOCSHELL 0x7f5926557000 == 3 [pid = 2587] [id = 3] 11:35:49 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 19MB 11:35:49 INFO - 250 INFO TEST-OK | layout/base/tests/test_bug1080361.html | took 2101ms 11:35:49 INFO - ++DOMWINDOW == 27 (0x7f5926206c00) [pid = 2587] [serial = 27] [outer = 0x7f5927291800] 11:35:49 INFO - 251 INFO TEST-START | layout/base/tests/test_bug1093686.html 11:35:50 INFO - ++DOMWINDOW == 28 (0x7f59261a6000) [pid = 2587] [serial = 28] [outer = 0x7f5927291800] 11:35:50 INFO - ++DOCSHELL 0x7f592655e800 == 4 [pid = 2587] [id = 7] 11:35:50 INFO - ++DOMWINDOW == 29 (0x7f59262c5000) [pid = 2587] [serial = 29] [outer = (nil)] 11:35:50 INFO - ++DOMWINDOW == 30 (0x7f59262c4800) [pid = 2587] [serial = 30] [outer = 0x7f59262c5000] 11:35:50 INFO - ++DOMWINDOW == 31 (0x7f5926211c00) [pid = 2587] [serial = 31] [outer = 0x7f59262c5000] 11:35:51 INFO - MEMORY STAT | vsize 516MB | residentFast 97MB | heapAllocated 20MB 11:35:51 INFO - 252 INFO TEST-OK | layout/base/tests/test_bug1093686.html | took 1623ms 11:35:51 INFO - ++DOMWINDOW == 32 (0x7f59268e0800) [pid = 2587] [serial = 32] [outer = 0x7f5927291800] 11:35:51 INFO - 253 INFO TEST-START | layout/base/tests/test_bug114649.html 11:35:51 INFO - --DOMWINDOW == 16 (0x7f971e273800) [pid = 2532] [serial = 8] [outer = (nil)] [url = about:blank] 11:35:51 INFO - --DOMWINDOW == 15 (0x7f971e1e9000) [pid = 2532] [serial = 9] [outer = (nil)] [url = about:blank] 11:35:51 INFO - --DOMWINDOW == 14 (0x7f971dcb9000) [pid = 2532] [serial = 12] [outer = (nil)] [url = about:blank] 11:35:51 INFO - --DOMWINDOW == 13 (0x7f972f969800) [pid = 2532] [serial = 2] [outer = (nil)] [url = about:blank] 11:35:51 INFO - --DOMWINDOW == 12 (0x7f972b262c00) [pid = 2532] [serial = 14] [outer = (nil)] [url = about:blank] 11:35:51 INFO - ++DOMWINDOW == 33 (0x7f5926414400) [pid = 2587] [serial = 33] [outer = 0x7f5927291800] 11:35:51 INFO - ++DOCSHELL 0x7f5927d0a000 == 5 [pid = 2587] [id = 8] 11:35:51 INFO - ++DOMWINDOW == 34 (0x7f59268e1400) [pid = 2587] [serial = 34] [outer = (nil)] 11:35:51 INFO - ++DOMWINDOW == 35 (0x7f59261aa800) [pid = 2587] [serial = 35] [outer = 0x7f59268e1400] 11:35:51 INFO - ++DOMWINDOW == 36 (0x7f5927d53400) [pid = 2587] [serial = 36] [outer = 0x7f59268e1400] 11:35:52 INFO - MEMORY STAT | vsize 517MB | residentFast 98MB | heapAllocated 21MB 11:35:52 INFO - 254 INFO TEST-OK | layout/base/tests/test_bug114649.html | took 1280ms 11:35:52 INFO - ++DOMWINDOW == 37 (0x7f5927d59400) [pid = 2587] [serial = 37] [outer = 0x7f5927291800] 11:35:52 INFO - 255 INFO TEST-START | layout/base/tests/test_bug1153130.html 11:35:52 INFO - ++DOMWINDOW == 38 (0x7f592728c000) [pid = 2587] [serial = 38] [outer = 0x7f5927291800] 11:35:52 INFO - ++DOCSHELL 0x7f592803a000 == 6 [pid = 2587] [id = 9] 11:35:52 INFO - ++DOMWINDOW == 39 (0x7f5927f75000) [pid = 2587] [serial = 39] [outer = (nil)] 11:35:52 INFO - ++DOMWINDOW == 40 (0x7f5927f79c00) [pid = 2587] [serial = 40] [outer = 0x7f5927f75000] 11:35:53 INFO - ++DOMWINDOW == 41 (0x7f5927d55800) [pid = 2587] [serial = 41] [outer = 0x7f5927f75000] 11:35:53 INFO - MEMORY STAT | vsize 519MB | residentFast 99MB | heapAllocated 22MB 11:35:53 INFO - 256 INFO TEST-OK | layout/base/tests/test_bug1153130.html | took 863ms 11:35:53 INFO - ++DOMWINDOW == 42 (0x7f5928e70c00) [pid = 2587] [serial = 42] [outer = 0x7f5927291800] 11:35:53 INFO - 257 INFO TEST-START | layout/base/tests/test_bug1162990.html 11:35:53 INFO - ++DOMWINDOW == 43 (0x7f5928e71400) [pid = 2587] [serial = 43] [outer = 0x7f5927291800] 11:35:53 INFO - ++DOCSHELL 0x7f592b684800 == 7 [pid = 2587] [id = 10] 11:35:53 INFO - ++DOMWINDOW == 44 (0x7f5928e76000) [pid = 2587] [serial = 44] [outer = (nil)] 11:35:53 INFO - ++DOMWINDOW == 45 (0x7f5928e77000) [pid = 2587] [serial = 45] [outer = 0x7f5928e76000] 11:35:54 INFO - ++DOMWINDOW == 46 (0x7f5927dd3000) [pid = 2587] [serial = 46] [outer = 0x7f5928e76000] 11:35:54 INFO - ++DOMWINDOW == 47 (0x7f5928e77800) [pid = 2587] [serial = 47] [outer = 0x7f5928e76000] 11:35:55 INFO - MEMORY STAT | vsize 521MB | residentFast 101MB | heapAllocated 23MB 11:35:55 INFO - 258 INFO TEST-OK | layout/base/tests/test_bug1162990.html | took 1491ms 11:35:55 INFO - ++DOMWINDOW == 48 (0x7f592b6bf800) [pid = 2587] [serial = 48] [outer = 0x7f5927291800] 11:35:55 INFO - 259 INFO TEST-START | layout/base/tests/test_bug1226904.html 11:35:55 INFO - --DOMWINDOW == 47 (0x7f5928017000) [pid = 2587] [serial = 2] [outer = (nil)] [url = about:blank] 11:35:55 INFO - --DOMWINDOW == 46 (0x7f592620d400) [pid = 2587] [serial = 15] [outer = (nil)] [url = about:blank] 11:35:55 INFO - --DOMWINDOW == 45 (0x7f59261a3400) [pid = 2587] [serial = 20] [outer = (nil)] [url = about:blank] 11:35:55 INFO - --DOMWINDOW == 44 (0x7f5927dd3800) [pid = 2587] [serial = 5] [outer = (nil)] [url = about:blank] 11:35:55 INFO - --DOMWINDOW == 43 (0x7f59268e0400) [pid = 2587] [serial = 6] [outer = (nil)] [url = about:blank] 11:35:55 INFO - ++DOMWINDOW == 44 (0x7f59268e0400) [pid = 2587] [serial = 49] [outer = 0x7f5927291800] 11:35:55 INFO - ++DOCSHELL 0x7f5925dd9800 == 8 [pid = 2587] [id = 11] 11:35:55 INFO - ++DOMWINDOW == 45 (0x7f592b6bfc00) [pid = 2587] [serial = 50] [outer = (nil)] 11:35:55 INFO - ++DOMWINDOW == 46 (0x7f592b6e9800) [pid = 2587] [serial = 51] [outer = 0x7f592b6bfc00] 11:35:55 INFO - JavaScript error: http://mochi.test:8888/tests/layout/base/tests/bug1226904.html, line 1: ReferenceError: run is not defined 11:35:55 INFO - depth 0x7f592b6eade8 10.000000 11:35:55 INFO - depth 0x7f592b6ec1e8 10.000000 11:35:55 INFO - depth 0x7f592b6ef820 20.000000 11:35:55 INFO - MEMORY STAT | vsize 522MB | residentFast 103MB | heapAllocated 24MB 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:55 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:55 INFO - 260 INFO TEST-OK | layout/base/tests/test_bug1226904.html | took 536ms 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:55 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:55 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:55 INFO - ++DOMWINDOW == 47 (0x7f5928e71800) [pid = 2587] [serial = 52] [outer = 0x7f5927291800] 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:55 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:55 INFO - 261 INFO TEST-START | layout/base/tests/test_bug332655-1.html 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX3-]: Surface width or height <= 0! 11:35:55 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:55 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:56 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:56 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:56 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX3-]: Surface width or height <= 0! 11:35:56 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:35:56 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:35:56 INFO - ++DOMWINDOW == 48 (0x7f5928e72c00) [pid = 2587] [serial = 53] [outer = 0x7f5927291800] 11:35:56 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:35:56 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:35:56 INFO - MEMORY STAT | vsize 528MB | residentFast 106MB | heapAllocated 25MB 11:35:56 INFO - 262 INFO TEST-OK | layout/base/tests/test_bug332655-1.html | took 794ms 11:35:57 INFO - ++DOMWINDOW == 49 (0x7f5925896c00) [pid = 2587] [serial = 54] [outer = 0x7f5927291800] 11:35:57 INFO - 263 INFO TEST-START | layout/base/tests/test_bug332655-2.html 11:35:57 INFO - ++DOMWINDOW == 50 (0x7f5925892400) [pid = 2587] [serial = 55] [outer = 0x7f5927291800] 11:35:58 INFO - MEMORY STAT | vsize 533MB | residentFast 109MB | heapAllocated 26MB 11:35:58 INFO - 264 INFO TEST-OK | layout/base/tests/test_bug332655-2.html | took 1300ms 11:35:58 INFO - ++DOMWINDOW == 51 (0x7f592562d400) [pid = 2587] [serial = 56] [outer = 0x7f5927291800] 11:35:58 INFO - 265 INFO TEST-START | layout/base/tests/test_bug386575.xhtml 11:35:58 INFO - ++DOMWINDOW == 52 (0x7f592562d800) [pid = 2587] [serial = 57] [outer = 0x7f5927291800] 11:35:58 INFO - MEMORY STAT | vsize 534MB | residentFast 110MB | heapAllocated 27MB 11:35:59 INFO - 266 INFO TEST-OK | layout/base/tests/test_bug386575.xhtml | took 397ms 11:35:59 INFO - ++DOMWINDOW == 53 (0x7f5925377000) [pid = 2587] [serial = 58] [outer = 0x7f5927291800] 11:35:59 INFO - 267 INFO TEST-START | layout/base/tests/test_bug388019.html 11:35:59 INFO - ++DOMWINDOW == 54 (0x7f5925377400) [pid = 2587] [serial = 59] [outer = 0x7f5927291800] 11:35:59 INFO - MEMORY STAT | vsize 534MB | residentFast 111MB | heapAllocated 26MB 11:35:59 INFO - 268 INFO TEST-OK | layout/base/tests/test_bug388019.html | took 397ms 11:35:59 INFO - ++DOMWINDOW == 55 (0x7f592537d000) [pid = 2587] [serial = 60] [outer = 0x7f5927291800] 11:35:59 INFO - 269 INFO TEST-START | layout/base/tests/test_bug394057.html 11:35:59 INFO - ++DOMWINDOW == 56 (0x7f592537d800) [pid = 2587] [serial = 61] [outer = 0x7f5927291800] 11:36:00 INFO - --DOCSHELL 0x7f592655a800 == 7 [pid = 2587] [id = 6] 11:36:00 INFO - --DOCSHELL 0x7f592655e800 == 6 [pid = 2587] [id = 7] 11:36:00 INFO - --DOCSHELL 0x7f5927d0a000 == 5 [pid = 2587] [id = 8] 11:36:00 INFO - --DOCSHELL 0x7f592803a000 == 4 [pid = 2587] [id = 9] 11:36:00 INFO - --DOCSHELL 0x7f592b684800 == 3 [pid = 2587] [id = 10] 11:36:00 INFO - --DOCSHELL 0x7f5925dd9800 == 2 [pid = 2587] [id = 11] 11:36:00 INFO - --DOMWINDOW == 55 (0x7f59261aa800) [pid = 2587] [serial = 35] [outer = 0x7f59268e1400] [url = about:blank] 11:36:00 INFO - MEMORY STAT | vsize 534MB | residentFast 105MB | heapAllocated 20MB 11:36:00 INFO - 270 INFO TEST-OK | layout/base/tests/test_bug394057.html | took 1086ms 11:36:00 INFO - ++DOMWINDOW == 56 (0x7f5925383800) [pid = 2587] [serial = 62] [outer = 0x7f5927291800] 11:36:00 INFO - 271 INFO TEST-START | layout/base/tests/test_bug399284.html 11:36:01 INFO - ++DOMWINDOW == 57 (0x7f5925383c00) [pid = 2587] [serial = 63] [outer = 0x7f5927291800] 11:36:01 INFO - ++DOCSHELL 0x7f59256e4000 == 3 [pid = 2587] [id = 12] 11:36:01 INFO - ++DOMWINDOW == 58 (0x7f592562c400) [pid = 2587] [serial = 64] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 59 (0x7f592588a400) [pid = 2587] [serial = 65] [outer = 0x7f592562c400] 11:36:01 INFO - ++DOCSHELL 0x7f59256ca800 == 4 [pid = 2587] [id = 13] 11:36:01 INFO - ++DOMWINDOW == 60 (0x7f5925894c00) [pid = 2587] [serial = 66] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 61 (0x7f592619c400) [pid = 2587] [serial = 67] [outer = 0x7f5925894c00] 11:36:01 INFO - ++DOCSHELL 0x7f59258e6800 == 5 [pid = 2587] [id = 14] 11:36:01 INFO - ++DOMWINDOW == 62 (0x7f592619ec00) [pid = 2587] [serial = 68] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 63 (0x7f59261a1000) [pid = 2587] [serial = 69] [outer = 0x7f592619ec00] 11:36:01 INFO - ++DOCSHELL 0x7f5925dcf000 == 6 [pid = 2587] [id = 15] 11:36:01 INFO - ++DOMWINDOW == 64 (0x7f59261a4c00) [pid = 2587] [serial = 70] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 65 (0x7f59261a6400) [pid = 2587] [serial = 71] [outer = 0x7f59261a4c00] 11:36:01 INFO - ++DOCSHELL 0x7f5925dd6000 == 7 [pid = 2587] [id = 16] 11:36:01 INFO - ++DOMWINDOW == 66 (0x7f592562c800) [pid = 2587] [serial = 72] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 67 (0x7f5925889400) [pid = 2587] [serial = 73] [outer = 0x7f592562c800] 11:36:01 INFO - ++DOCSHELL 0x7f59256d6000 == 8 [pid = 2587] [id = 17] 11:36:01 INFO - ++DOMWINDOW == 68 (0x7f5926202c00) [pid = 2587] [serial = 74] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 69 (0x7f5926203400) [pid = 2587] [serial = 75] [outer = 0x7f5926202c00] 11:36:01 INFO - ++DOCSHELL 0x7f5925de0800 == 9 [pid = 2587] [id = 18] 11:36:01 INFO - ++DOMWINDOW == 70 (0x7f5926204400) [pid = 2587] [serial = 76] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 71 (0x7f5926204c00) [pid = 2587] [serial = 77] [outer = 0x7f5926204400] 11:36:01 INFO - ++DOCSHELL 0x7f5925dd5000 == 10 [pid = 2587] [id = 19] 11:36:01 INFO - ++DOMWINDOW == 72 (0x7f5926205c00) [pid = 2587] [serial = 78] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 73 (0x7f5926206800) [pid = 2587] [serial = 79] [outer = 0x7f5926205c00] 11:36:01 INFO - ++DOCSHELL 0x7f5926164000 == 11 [pid = 2587] [id = 20] 11:36:01 INFO - ++DOMWINDOW == 74 (0x7f5926208000) [pid = 2587] [serial = 80] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 75 (0x7f5926208800) [pid = 2587] [serial = 81] [outer = 0x7f5926208000] 11:36:01 INFO - ++DOCSHELL 0x7f592616d800 == 12 [pid = 2587] [id = 21] 11:36:01 INFO - ++DOMWINDOW == 76 (0x7f5925630800) [pid = 2587] [serial = 82] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 77 (0x7f592620d400) [pid = 2587] [serial = 83] [outer = 0x7f5925630800] 11:36:01 INFO - ++DOCSHELL 0x7f59258e4000 == 13 [pid = 2587] [id = 22] 11:36:01 INFO - ++DOMWINDOW == 78 (0x7f59262b8000) [pid = 2587] [serial = 84] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 79 (0x7f59262bac00) [pid = 2587] [serial = 85] [outer = 0x7f59262b8000] 11:36:01 INFO - ++DOCSHELL 0x7f5926220000 == 14 [pid = 2587] [id = 23] 11:36:01 INFO - ++DOMWINDOW == 80 (0x7f59262c0800) [pid = 2587] [serial = 86] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 81 (0x7f59262c3400) [pid = 2587] [serial = 87] [outer = 0x7f59262c0800] 11:36:01 INFO - ++DOCSHELL 0x7f5926225800 == 15 [pid = 2587] [id = 24] 11:36:01 INFO - ++DOMWINDOW == 82 (0x7f59262c6000) [pid = 2587] [serial = 88] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 83 (0x7f59262c6c00) [pid = 2587] [serial = 89] [outer = 0x7f59262c6000] 11:36:01 INFO - ++DOCSHELL 0x7f592622d800 == 16 [pid = 2587] [id = 25] 11:36:01 INFO - ++DOMWINDOW == 84 (0x7f592640c000) [pid = 2587] [serial = 90] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 85 (0x7f592640d000) [pid = 2587] [serial = 91] [outer = 0x7f592640c000] 11:36:01 INFO - ++DOCSHELL 0x7f592655a000 == 17 [pid = 2587] [id = 26] 11:36:01 INFO - ++DOMWINDOW == 86 (0x7f592640fc00) [pid = 2587] [serial = 92] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 87 (0x7f5926411000) [pid = 2587] [serial = 93] [outer = 0x7f592640fc00] 11:36:01 INFO - ++DOCSHELL 0x7f5926563000 == 18 [pid = 2587] [id = 27] 11:36:01 INFO - ++DOMWINDOW == 88 (0x7f5926413400) [pid = 2587] [serial = 94] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 89 (0x7f59262c2400) [pid = 2587] [serial = 95] [outer = 0x7f5926413400] 11:36:01 INFO - ++DOCSHELL 0x7f592656a800 == 19 [pid = 2587] [id = 28] 11:36:01 INFO - ++DOMWINDOW == 90 (0x7f5926416000) [pid = 2587] [serial = 96] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 91 (0x7f5926416c00) [pid = 2587] [serial = 97] [outer = 0x7f5926416000] 11:36:01 INFO - ++DOCSHELL 0x7f5926571000 == 20 [pid = 2587] [id = 29] 11:36:01 INFO - ++DOMWINDOW == 92 (0x7f5926418000) [pid = 2587] [serial = 98] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 93 (0x7f5926418800) [pid = 2587] [serial = 99] [outer = 0x7f5926418000] 11:36:01 INFO - ++DOCSHELL 0x7f5926765800 == 21 [pid = 2587] [id = 30] 11:36:01 INFO - ++DOMWINDOW == 94 (0x7f5926419800) [pid = 2587] [serial = 100] [outer = (nil)] 11:36:01 INFO - ++DOMWINDOW == 95 (0x7f592678e800) [pid = 2587] [serial = 101] [outer = 0x7f5926419800] 11:36:02 INFO - ++DOCSHELL 0x7f5926772800 == 22 [pid = 2587] [id = 31] 11:36:02 INFO - ++DOMWINDOW == 96 (0x7f5926790400) [pid = 2587] [serial = 102] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 97 (0x7f5926790c00) [pid = 2587] [serial = 103] [outer = 0x7f5926790400] 11:36:02 INFO - ++DOCSHELL 0x7f592677a800 == 23 [pid = 2587] [id = 32] 11:36:02 INFO - ++DOMWINDOW == 98 (0x7f5926796000) [pid = 2587] [serial = 104] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 99 (0x7f5926797000) [pid = 2587] [serial = 105] [outer = 0x7f5926796000] 11:36:02 INFO - ++DOCSHELL 0x7f592616d000 == 24 [pid = 2587] [id = 33] 11:36:02 INFO - ++DOMWINDOW == 100 (0x7f592620c800) [pid = 2587] [serial = 106] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 101 (0x7f59268d4400) [pid = 2587] [serial = 107] [outer = 0x7f592620c800] 11:36:02 INFO - ++DOCSHELL 0x7f59272b3800 == 25 [pid = 2587] [id = 34] 11:36:02 INFO - ++DOMWINDOW == 102 (0x7f592620f000) [pid = 2587] [serial = 108] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 103 (0x7f59268d5000) [pid = 2587] [serial = 109] [outer = 0x7f592620f000] 11:36:02 INFO - ++DOCSHELL 0x7f5927d1a000 == 26 [pid = 2587] [id = 35] 11:36:02 INFO - ++DOMWINDOW == 104 (0x7f59262bf800) [pid = 2587] [serial = 110] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 105 (0x7f59268dd000) [pid = 2587] [serial = 111] [outer = 0x7f59262bf800] 11:36:02 INFO - ++DOCSHELL 0x7f5927d9e000 == 27 [pid = 2587] [id = 36] 11:36:02 INFO - ++DOMWINDOW == 106 (0x7f59268e1800) [pid = 2587] [serial = 112] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 107 (0x7f59262c6800) [pid = 2587] [serial = 113] [outer = 0x7f59268e1800] 11:36:02 INFO - ++DOCSHELL 0x7f5927db5800 == 28 [pid = 2587] [id = 37] 11:36:02 INFO - ++DOMWINDOW == 108 (0x7f5927291000) [pid = 2587] [serial = 114] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 109 (0x7f5927d4fc00) [pid = 2587] [serial = 115] [outer = 0x7f5927291000] 11:36:02 INFO - ++DOCSHELL 0x7f5928030800 == 29 [pid = 2587] [id = 38] 11:36:02 INFO - ++DOMWINDOW == 110 (0x7f5927d58800) [pid = 2587] [serial = 116] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 111 (0x7f5927d59000) [pid = 2587] [serial = 117] [outer = 0x7f5927d58800] 11:36:02 INFO - ++DOCSHELL 0x7f592823b800 == 30 [pid = 2587] [id = 39] 11:36:02 INFO - ++DOMWINDOW == 112 (0x7f5927d5b800) [pid = 2587] [serial = 118] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 113 (0x7f5927dcec00) [pid = 2587] [serial = 119] [outer = 0x7f5927d5b800] 11:36:02 INFO - ++DOCSHELL 0x7f5927da3800 == 31 [pid = 2587] [id = 40] 11:36:02 INFO - ++DOMWINDOW == 114 (0x7f5927dd3400) [pid = 2587] [serial = 120] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 115 (0x7f5927dd4000) [pid = 2587] [serial = 121] [outer = 0x7f5927dd3400] 11:36:02 INFO - ++DOCSHELL 0x7f592b67c800 == 32 [pid = 2587] [id = 41] 11:36:02 INFO - ++DOMWINDOW == 116 (0x7f5927f7a400) [pid = 2587] [serial = 122] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 117 (0x7f5927f7f800) [pid = 2587] [serial = 123] [outer = 0x7f5927f7a400] 11:36:02 INFO - ++DOCSHELL 0x7f592b984000 == 33 [pid = 2587] [id = 42] 11:36:02 INFO - ++DOMWINDOW == 118 (0x7f5927fcec00) [pid = 2587] [serial = 124] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 119 (0x7f5927fd1400) [pid = 2587] [serial = 125] [outer = 0x7f5927fcec00] 11:36:02 INFO - ++DOCSHELL 0x7f592eb90800 == 34 [pid = 2587] [id = 43] 11:36:02 INFO - ++DOMWINDOW == 120 (0x7f5927fd3c00) [pid = 2587] [serial = 126] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 121 (0x7f5927fd7c00) [pid = 2587] [serial = 127] [outer = 0x7f5927fd3c00] 11:36:02 INFO - ++DOCSHELL 0x7f592ed0d800 == 35 [pid = 2587] [id = 44] 11:36:02 INFO - ++DOMWINDOW == 122 (0x7f5928016800) [pid = 2587] [serial = 128] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 123 (0x7f5928e68800) [pid = 2587] [serial = 129] [outer = 0x7f5928016800] 11:36:02 INFO - ++DOCSHELL 0x7f5925567800 == 36 [pid = 2587] [id = 45] 11:36:02 INFO - ++DOMWINDOW == 124 (0x7f5928e6b400) [pid = 2587] [serial = 130] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 125 (0x7f5928e6bc00) [pid = 2587] [serial = 131] [outer = 0x7f5928e6b400] 11:36:02 INFO - ++DOCSHELL 0x7f592556c800 == 37 [pid = 2587] [id = 46] 11:36:02 INFO - ++DOMWINDOW == 126 (0x7f5928e6d400) [pid = 2587] [serial = 132] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 127 (0x7f5928e6ec00) [pid = 2587] [serial = 133] [outer = 0x7f5928e6d400] 11:36:02 INFO - ++DOCSHELL 0x7f5925571800 == 38 [pid = 2587] [id = 47] 11:36:02 INFO - ++DOMWINDOW == 128 (0x7f5928e70000) [pid = 2587] [serial = 134] [outer = (nil)] 11:36:02 INFO - ++DOMWINDOW == 129 (0x7f5928e72800) [pid = 2587] [serial = 135] [outer = 0x7f5928e70000] 11:36:05 INFO - MEMORY STAT | vsize 570MB | residentFast 124MB | heapAllocated 33MB 11:36:05 INFO - 272 INFO TEST-OK | layout/base/tests/test_bug399284.html | took 4919ms 11:36:05 INFO - ++DOMWINDOW == 130 (0x7f5924a8c400) [pid = 2587] [serial = 136] [outer = 0x7f5927291800] 11:36:06 INFO - 273 INFO TEST-START | layout/base/tests/test_bug399951.html 11:36:06 INFO - ++DOMWINDOW == 131 (0x7f5924a8c800) [pid = 2587] [serial = 137] [outer = 0x7f5927291800] 11:36:06 INFO - MEMORY STAT | vsize 572MB | residentFast 126MB | heapAllocated 32MB 11:36:06 INFO - 274 INFO TEST-OK | layout/base/tests/test_bug399951.html | took 869ms 11:36:07 INFO - ++DOMWINDOW == 132 (0x7f5924a87400) [pid = 2587] [serial = 138] [outer = 0x7f5927291800] 11:36:07 INFO - --DOMWINDOW == 131 (0x7f5925377000) [pid = 2587] [serial = 58] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 130 (0x7f5925377400) [pid = 2587] [serial = 59] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug388019.html] 11:36:07 INFO - --DOMWINDOW == 129 (0x7f5926206c00) [pid = 2587] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 128 (0x7f59262c4800) [pid = 2587] [serial = 30] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 127 (0x7f5926796400) [pid = 2587] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_after_paint_pref.html] 11:36:07 INFO - --DOMWINDOW == 126 (0x7f592640c800) [pid = 2587] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 125 (0x7f592640cc00) [pid = 2587] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_border_radius_hit_testing.html] 11:36:07 INFO - --DOMWINDOW == 124 (0x7f5926415800) [pid = 2587] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/border_radius_hit_testing_iframe.html] 11:36:07 INFO - --DOMWINDOW == 123 (0x7f592620a400) [pid = 2587] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 122 (0x7f592619d400) [pid = 2587] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 121 (0x7f59268e0800) [pid = 2587] [serial = 32] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 120 (0x7f5926414400) [pid = 2587] [serial = 33] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug114649.html] 11:36:07 INFO - --DOMWINDOW == 119 (0x7f5927d53400) [pid = 2587] [serial = 36] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 118 (0x7f5927d59400) [pid = 2587] [serial = 37] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 117 (0x7f592537d000) [pid = 2587] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 116 (0x7f5927f79c00) [pid = 2587] [serial = 40] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 115 (0x7f5928e70c00) [pid = 2587] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 114 (0x7f5928e77000) [pid = 2587] [serial = 45] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 113 (0x7f592b6bf800) [pid = 2587] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 112 (0x7f59261a2c00) [pid = 2587] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1080360_inner.html] 11:36:07 INFO - --DOMWINDOW == 111 (0x7f592620f400) [pid = 2587] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1078327_inner.html] 11:36:07 INFO - --DOMWINDOW == 110 (0x7f59268e0400) [pid = 2587] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1226904.html] 11:36:07 INFO - --DOMWINDOW == 109 (0x7f592b6e9800) [pid = 2587] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1226904.html] 11:36:07 INFO - --DOMWINDOW == 108 (0x7f5928e71800) [pid = 2587] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 107 (0x7f5925896c00) [pid = 2587] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 106 (0x7f592562d400) [pid = 2587] [serial = 56] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 105 (0x7f592619e400) [pid = 2587] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:07 INFO - --DOMWINDOW == 104 (0x7f592620dc00) [pid = 2587] [serial = 25] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 103 (0x7f592562d800) [pid = 2587] [serial = 57] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug386575.xhtml] 11:36:07 INFO - --DOMWINDOW == 102 (0x7f592620cc00) [pid = 2587] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1080361_inner.html] 11:36:07 INFO - --DOMWINDOW == 101 (0x7f592b6bfc00) [pid = 2587] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1226904.html] 11:36:07 INFO - --DOMWINDOW == 100 (0x7f5928e76000) [pid = 2587] [serial = 44] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1162990_inner_2.html] 11:36:07 INFO - --DOMWINDOW == 99 (0x7f5927f75000) [pid = 2587] [serial = 39] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1153130_inner.html] 11:36:07 INFO - --DOMWINDOW == 98 (0x7f59268e1400) [pid = 2587] [serial = 34] [outer = (nil)] [url = about:blank] 11:36:07 INFO - --DOMWINDOW == 97 (0x7f5926413800) [pid = 2587] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/border_radius_hit_testing_iframe.html] 11:36:07 INFO - --DOMWINDOW == 96 (0x7f59262c5000) [pid = 2587] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1093686_inner.html] 11:36:07 INFO - 275 INFO TEST-START | layout/base/tests/test_bug404209.xhtml 11:36:07 INFO - --DOMWINDOW == 95 (0x7f59261a6000) [pid = 2587] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1093686.html] 11:36:07 INFO - --DOMWINDOW == 94 (0x7f592620a800) [pid = 2587] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1078327.html] 11:36:07 INFO - --DOMWINDOW == 93 (0x7f592728c000) [pid = 2587] [serial = 38] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1153130.html] 11:36:07 INFO - --DOMWINDOW == 92 (0x7f5928e71400) [pid = 2587] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1162990.html] 11:36:07 INFO - --DOMWINDOW == 91 (0x7f59261a0000) [pid = 2587] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1080361.html] 11:36:07 INFO - --DOMWINDOW == 90 (0x7f592619e000) [pid = 2587] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug1080360.html] 11:36:07 INFO - ++DOMWINDOW == 91 (0x7f5922d29000) [pid = 2587] [serial = 139] [outer = 0x7f5927291800] 11:36:08 INFO - MEMORY STAT | vsize 573MB | residentFast 127MB | heapAllocated 30MB 11:36:08 INFO - 276 INFO TEST-OK | layout/base/tests/test_bug404209.xhtml | took 1606ms 11:36:08 INFO - ++DOMWINDOW == 92 (0x7f5924a9a800) [pid = 2587] [serial = 140] [outer = 0x7f5927291800] 11:36:09 INFO - 277 INFO TEST-START | layout/base/tests/test_bug416896.html 11:36:09 INFO - ++DOMWINDOW == 93 (0x7f5924a9b000) [pid = 2587] [serial = 141] [outer = 0x7f5927291800] 11:36:09 INFO - MEMORY STAT | vsize 573MB | residentFast 127MB | heapAllocated 31MB 11:36:09 INFO - 278 INFO TEST-OK | layout/base/tests/test_bug416896.html | took 367ms 11:36:09 INFO - ++DOMWINDOW == 94 (0x7f5924a96400) [pid = 2587] [serial = 142] [outer = 0x7f5927291800] 11:36:09 INFO - 279 INFO TEST-START | layout/base/tests/test_bug423523.html 11:36:09 INFO - ++DOMWINDOW == 95 (0x7f5924a98400) [pid = 2587] [serial = 143] [outer = 0x7f5927291800] 11:36:09 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:36:09 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:36:09 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:36:10 INFO - MEMORY STAT | vsize 574MB | residentFast 129MB | heapAllocated 31MB 11:36:10 INFO - 280 INFO TEST-OK | layout/base/tests/test_bug423523.html | took 850ms 11:36:10 INFO - ++DOMWINDOW == 96 (0x7f592619e400) [pid = 2587] [serial = 144] [outer = 0x7f5927291800] 11:36:10 INFO - 281 INFO TEST-START | layout/base/tests/test_bug435293-interaction.html 11:36:10 INFO - ++DOMWINDOW == 97 (0x7f592620a400) [pid = 2587] [serial = 145] [outer = 0x7f5927291800] 11:36:11 INFO - MEMORY STAT | vsize 574MB | residentFast 127MB | heapAllocated 29MB 11:36:11 INFO - 282 INFO TEST-OK | layout/base/tests/test_bug435293-interaction.html | took 794ms 11:36:11 INFO - ++DOMWINDOW == 98 (0x7f5922d24000) [pid = 2587] [serial = 146] [outer = 0x7f5927291800] 11:36:11 INFO - --DOCSHELL 0x7f59256e4000 == 37 [pid = 2587] [id = 12] 11:36:11 INFO - --DOCSHELL 0x7f59256ca800 == 36 [pid = 2587] [id = 13] 11:36:11 INFO - --DOCSHELL 0x7f59258e6800 == 35 [pid = 2587] [id = 14] 11:36:11 INFO - --DOCSHELL 0x7f5925dcf000 == 34 [pid = 2587] [id = 15] 11:36:11 INFO - --DOCSHELL 0x7f5925dd6000 == 33 [pid = 2587] [id = 16] 11:36:11 INFO - --DOCSHELL 0x7f59256d6000 == 32 [pid = 2587] [id = 17] 11:36:11 INFO - --DOCSHELL 0x7f5925de0800 == 31 [pid = 2587] [id = 18] 11:36:11 INFO - --DOCSHELL 0x7f5925dd5000 == 30 [pid = 2587] [id = 19] 11:36:11 INFO - --DOCSHELL 0x7f5926164000 == 29 [pid = 2587] [id = 20] 11:36:11 INFO - --DOCSHELL 0x7f592616d800 == 28 [pid = 2587] [id = 21] 11:36:11 INFO - --DOCSHELL 0x7f59258e4000 == 27 [pid = 2587] [id = 22] 11:36:11 INFO - --DOCSHELL 0x7f5926220000 == 26 [pid = 2587] [id = 23] 11:36:11 INFO - --DOCSHELL 0x7f5926225800 == 25 [pid = 2587] [id = 24] 11:36:11 INFO - --DOCSHELL 0x7f592622d800 == 24 [pid = 2587] [id = 25] 11:36:11 INFO - --DOCSHELL 0x7f592655a000 == 23 [pid = 2587] [id = 26] 11:36:11 INFO - --DOCSHELL 0x7f5926563000 == 22 [pid = 2587] [id = 27] 11:36:11 INFO - --DOCSHELL 0x7f592656a800 == 21 [pid = 2587] [id = 28] 11:36:11 INFO - --DOCSHELL 0x7f5926571000 == 20 [pid = 2587] [id = 29] 11:36:11 INFO - --DOCSHELL 0x7f5926765800 == 19 [pid = 2587] [id = 30] 11:36:11 INFO - --DOCSHELL 0x7f5926772800 == 18 [pid = 2587] [id = 31] 11:36:11 INFO - --DOCSHELL 0x7f592677a800 == 17 [pid = 2587] [id = 32] 11:36:11 INFO - --DOCSHELL 0x7f592616d000 == 16 [pid = 2587] [id = 33] 11:36:11 INFO - --DOCSHELL 0x7f59272b3800 == 15 [pid = 2587] [id = 34] 11:36:11 INFO - --DOCSHELL 0x7f5927d1a000 == 14 [pid = 2587] [id = 35] 11:36:11 INFO - --DOCSHELL 0x7f5927d9e000 == 13 [pid = 2587] [id = 36] 11:36:11 INFO - --DOCSHELL 0x7f5927db5800 == 12 [pid = 2587] [id = 37] 11:36:11 INFO - --DOCSHELL 0x7f5928030800 == 11 [pid = 2587] [id = 38] 11:36:11 INFO - --DOCSHELL 0x7f592823b800 == 10 [pid = 2587] [id = 39] 11:36:11 INFO - --DOCSHELL 0x7f5927da3800 == 9 [pid = 2587] [id = 40] 11:36:11 INFO - --DOCSHELL 0x7f592b67c800 == 8 [pid = 2587] [id = 41] 11:36:11 INFO - --DOCSHELL 0x7f592b984000 == 7 [pid = 2587] [id = 42] 11:36:11 INFO - --DOCSHELL 0x7f592eb90800 == 6 [pid = 2587] [id = 43] 11:36:11 INFO - --DOCSHELL 0x7f592ed0d800 == 5 [pid = 2587] [id = 44] 11:36:11 INFO - --DOCSHELL 0x7f5925567800 == 4 [pid = 2587] [id = 45] 11:36:11 INFO - --DOCSHELL 0x7f592556c800 == 3 [pid = 2587] [id = 46] 11:36:11 INFO - --DOCSHELL 0x7f5925571800 == 2 [pid = 2587] [id = 47] 11:36:11 INFO - --DOMWINDOW == 97 (0x7f59261a4800) [pid = 2587] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1080360_inner.html] 11:36:11 INFO - --DOMWINDOW == 96 (0x7f5928e77800) [pid = 2587] [serial = 47] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1162990_inner_2.html] 11:36:11 INFO - --DOMWINDOW == 95 (0x7f59261a0400) [pid = 2587] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1080361_inner.html] 11:36:11 INFO - --DOMWINDOW == 94 (0x7f5926211c00) [pid = 2587] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1093686_inner.html] 11:36:11 INFO - --DOMWINDOW == 93 (0x7f5927d55800) [pid = 2587] [serial = 41] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1153130_inner.html] 11:36:11 INFO - --DOMWINDOW == 92 (0x7f5927dd3000) [pid = 2587] [serial = 46] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1162990_inner_1.html] 11:36:11 INFO - --DOMWINDOW == 91 (0x7f59262ba000) [pid = 2587] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug1078327_inner.html] 11:36:12 INFO - 283 INFO TEST-START | layout/base/tests/test_bug435293-scale.html 11:36:12 INFO - ++DOMWINDOW == 92 (0x7f5922d1c400) [pid = 2587] [serial = 147] [outer = 0x7f5927291800] 11:36:12 INFO - MEMORY STAT | vsize 574MB | residentFast 110MB | heapAllocated 21MB 11:36:12 INFO - 284 INFO TEST-OK | layout/base/tests/test_bug435293-scale.html | took 318ms 11:36:12 INFO - ++DOMWINDOW == 93 (0x7f5924a92c00) [pid = 2587] [serial = 148] [outer = 0x7f5927291800] 11:36:12 INFO - 285 INFO TEST-START | layout/base/tests/test_bug435293-skew.html 11:36:12 INFO - ++DOMWINDOW == 94 (0x7f5924a93800) [pid = 2587] [serial = 149] [outer = 0x7f5927291800] 11:36:12 INFO - MEMORY STAT | vsize 574MB | residentFast 111MB | heapAllocated 22MB 11:36:12 INFO - 286 INFO TEST-OK | layout/base/tests/test_bug435293-skew.html | took 421ms 11:36:12 INFO - ++DOMWINDOW == 95 (0x7f5922d26c00) [pid = 2587] [serial = 150] [outer = 0x7f5927291800] 11:36:12 INFO - 287 INFO TEST-START | layout/base/tests/test_bug449781.html 11:36:13 INFO - ++DOMWINDOW == 96 (0x7f5924a86400) [pid = 2587] [serial = 151] [outer = 0x7f5927291800] 11:36:13 INFO - ++DOCSHELL 0x7f5923c38000 == 3 [pid = 2587] [id = 48] 11:36:13 INFO - ++DOMWINDOW == 97 (0x7f5924a98800) [pid = 2587] [serial = 152] [outer = (nil)] 11:36:13 INFO - ++DOMWINDOW == 98 (0x7f592562fc00) [pid = 2587] [serial = 153] [outer = 0x7f5924a98800] 11:36:13 INFO - MEMORY STAT | vsize 576MB | residentFast 111MB | heapAllocated 23MB 11:36:13 INFO - 288 INFO TEST-OK | layout/base/tests/test_bug449781.html | took 664ms 11:36:13 INFO - ++DOMWINDOW == 99 (0x7f5924a9d800) [pid = 2587] [serial = 154] [outer = 0x7f5927291800] 11:36:13 INFO - 289 INFO TEST-START | layout/base/tests/test_bug469170.html 11:36:13 INFO - ++DOMWINDOW == 100 (0x7f5924a94c00) [pid = 2587] [serial = 155] [outer = 0x7f5927291800] 11:36:14 INFO - ++DOCSHELL 0x7f59256d0000 == 4 [pid = 2587] [id = 49] 11:36:14 INFO - ++DOMWINDOW == 101 (0x7f5925376000) [pid = 2587] [serial = 156] [outer = (nil)] 11:36:14 INFO - ++DOMWINDOW == 102 (0x7f5926205800) [pid = 2587] [serial = 157] [outer = 0x7f5925376000] 11:36:14 INFO - MEMORY STAT | vsize 576MB | residentFast 113MB | heapAllocated 24MB 11:36:14 INFO - --DOMWINDOW == 101 (0x7f592537d800) [pid = 2587] [serial = 61] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug394057.html] 11:36:14 INFO - --DOMWINDOW == 100 (0x7f5925892400) [pid = 2587] [serial = 55] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug332655-2.html] 11:36:14 INFO - --DOMWINDOW == 99 (0x7f5928e72c00) [pid = 2587] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug332655-1.html] 11:36:14 INFO - --DOMWINDOW == 98 (0x7f5924a9b000) [pid = 2587] [serial = 141] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug416896.html] 11:36:14 INFO - --DOMWINDOW == 97 (0x7f5924a9a800) [pid = 2587] [serial = 140] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 96 (0x7f5922d29000) [pid = 2587] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug404209.xhtml] 11:36:14 INFO - --DOMWINDOW == 95 (0x7f5924a87400) [pid = 2587] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 94 (0x7f5924a8c800) [pid = 2587] [serial = 137] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug399951.html] 11:36:14 INFO - --DOMWINDOW == 93 (0x7f5924a8c400) [pid = 2587] [serial = 136] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 92 (0x7f5928e72800) [pid = 2587] [serial = 135] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 91 (0x7f5928e6ec00) [pid = 2587] [serial = 133] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 90 (0x7f5928e6bc00) [pid = 2587] [serial = 131] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 89 (0x7f5928e68800) [pid = 2587] [serial = 129] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 88 (0x7f5927fd7c00) [pid = 2587] [serial = 127] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 87 (0x7f5927fd1400) [pid = 2587] [serial = 125] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 86 (0x7f5927f7f800) [pid = 2587] [serial = 123] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 85 (0x7f5927dd4000) [pid = 2587] [serial = 121] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 84 (0x7f5927dcec00) [pid = 2587] [serial = 119] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 83 (0x7f5927d59000) [pid = 2587] [serial = 117] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 82 (0x7f5927d4fc00) [pid = 2587] [serial = 115] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 81 (0x7f59262c6800) [pid = 2587] [serial = 113] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 80 (0x7f59268dd000) [pid = 2587] [serial = 111] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 79 (0x7f59268d5000) [pid = 2587] [serial = 109] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 78 (0x7f59268d4400) [pid = 2587] [serial = 107] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 77 (0x7f5926797000) [pid = 2587] [serial = 105] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 76 (0x7f5926790c00) [pid = 2587] [serial = 103] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 75 (0x7f592678e800) [pid = 2587] [serial = 101] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 74 (0x7f5926418800) [pid = 2587] [serial = 99] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 73 (0x7f5926416c00) [pid = 2587] [serial = 97] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 72 (0x7f59262c2400) [pid = 2587] [serial = 95] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 71 (0x7f5926411000) [pid = 2587] [serial = 93] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 70 (0x7f592640d000) [pid = 2587] [serial = 91] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 69 (0x7f59262c6c00) [pid = 2587] [serial = 89] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 68 (0x7f59262c3400) [pid = 2587] [serial = 87] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 67 (0x7f59262bac00) [pid = 2587] [serial = 85] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 66 (0x7f592620d400) [pid = 2587] [serial = 83] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 65 (0x7f5926208800) [pid = 2587] [serial = 81] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 64 (0x7f5926206800) [pid = 2587] [serial = 79] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 63 (0x7f5926204c00) [pid = 2587] [serial = 77] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 62 (0x7f5926203400) [pid = 2587] [serial = 75] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 61 (0x7f5925889400) [pid = 2587] [serial = 73] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 60 (0x7f59261a6400) [pid = 2587] [serial = 71] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 59 (0x7f59261a1000) [pid = 2587] [serial = 69] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 58 (0x7f592619c400) [pid = 2587] [serial = 67] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 57 (0x7f592588a400) [pid = 2587] [serial = 65] [outer = (nil)] [url = about:blank] 11:36:14 INFO - --DOMWINDOW == 56 (0x7f5925383800) [pid = 2587] [serial = 62] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 55 (0x7f592619e400) [pid = 2587] [serial = 144] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 54 (0x7f5924a96400) [pid = 2587] [serial = 142] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:14 INFO - --DOMWINDOW == 53 (0x7f5928e70000) [pid = 2587] [serial = 134] [outer = (nil)] [url = data:text/html;charset=UTF-16LE,%3C%00p%00%20%00i%00d%00=%00'%00t%00e%00s%00t%00P%00a%00r%00a%00'%00%3E%00T%00h%00e%00%20%00q%00u%00i%00c%00k%00%20%00b%00r%00o%00w%00n%00%20%00f%00o%00x%00%20%00j%00u%00m%00p%00s%00%20%00o%00v%00e%00r%00%20%00t%00h%00e%00%20%00l%00a%00z%00y%00%20%00d%00o%00g%00] 11:36:14 INFO - --DOMWINDOW == 52 (0x7f5928e6d400) [pid = 2587] [serial = 132] [outer = (nil)] [url = data:text/html;charset=UTF-8,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 51 (0x7f5928e6b400) [pid = 2587] [serial = 130] [outer = (nil)] [url = data:text/html;charset=x-mac-cyrillic,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 50 (0x7f5928016800) [pid = 2587] [serial = 128] [outer = (nil)] [url = data:text/html;charset=windows-874,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 49 (0x7f5927fd3c00) [pid = 2587] [serial = 126] [outer = (nil)] [url = data:text/html;charset=windows-1258,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 48 (0x7f5927fcec00) [pid = 2587] [serial = 124] [outer = (nil)] [url = data:text/html;charset=windows-1257,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 47 (0x7f5927f7a400) [pid = 2587] [serial = 122] [outer = (nil)] [url = data:text/html;charset=windows-1256,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 46 (0x7f5927dd3400) [pid = 2587] [serial = 120] [outer = (nil)] [url = data:text/html;charset=windows-1255,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 45 (0x7f5927d5b800) [pid = 2587] [serial = 118] [outer = (nil)] [url = data:text/html;charset=windows-1254,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 44 (0x7f5927d58800) [pid = 2587] [serial = 116] [outer = (nil)] [url = data:text/html;charset=windows-1253,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 43 (0x7f5927291000) [pid = 2587] [serial = 114] [outer = (nil)] [url = data:text/html;charset=windows-1252,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 42 (0x7f59268e1800) [pid = 2587] [serial = 112] [outer = (nil)] [url = data:text/html;charset=windows-1251,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 41 (0x7f59262bf800) [pid = 2587] [serial = 110] [outer = (nil)] [url = data:text/html;charset=windows-1250,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 40 (0x7f592620f000) [pid = 2587] [serial = 108] [outer = (nil)] [url = data:text/html;charset=Shift_JIS,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 39 (0x7f592620c800) [pid = 2587] [serial = 106] [outer = (nil)] [url = data:text/html;charset=KOI8-U,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 38 (0x7f5926796000) [pid = 2587] [serial = 104] [outer = (nil)] [url = data:text/html;charset=KOI8-R,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 37 (0x7f5926790400) [pid = 2587] [serial = 102] [outer = (nil)] [url = data:text/html;charset=ISO-8859-2,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 36 (0x7f5926419800) [pid = 2587] [serial = 100] [outer = (nil)] [url = data:text/html;charset=ISO-8859-16,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 35 (0x7f5926418000) [pid = 2587] [serial = 98] [outer = (nil)] [url = data:text/html;charset=ISO-8859-15,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 34 (0x7f5926416000) [pid = 2587] [serial = 96] [outer = (nil)] [url = data:text/html;charset=ISO-8859-14,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 33 (0x7f5926413400) [pid = 2587] [serial = 94] [outer = (nil)] [url = data:text/html;charset=ISO-8859-13,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 32 (0x7f592640fc00) [pid = 2587] [serial = 92] [outer = (nil)] [url = data:text/html;charset=ISO-8859-10,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 31 (0x7f592640c000) [pid = 2587] [serial = 90] [outer = (nil)] [url = data:text/html;charset=ISO-8859-8-I,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 30 (0x7f59262c6000) [pid = 2587] [serial = 88] [outer = (nil)] [url = data:text/html;charset=ISO-8859-8,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 29 (0x7f59262c0800) [pid = 2587] [serial = 86] [outer = (nil)] [url = data:text/html;charset=ISO-8859-7,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 28 (0x7f59262b8000) [pid = 2587] [serial = 84] [outer = (nil)] [url = data:text/html;charset=ISO-8859-6,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 27 (0x7f5925630800) [pid = 2587] [serial = 82] [outer = (nil)] [url = data:text/html;charset=ISO-8859-5,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 26 (0x7f5926208000) [pid = 2587] [serial = 80] [outer = (nil)] [url = data:text/html;charset=ISO-8859-4,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 25 (0x7f5926205c00) [pid = 2587] [serial = 78] [outer = (nil)] [url = data:text/html;charset=ISO-8859-3,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 24 (0x7f5926204400) [pid = 2587] [serial = 76] [outer = (nil)] [url = data:text/html;charset=ISO-2022-JP,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 23 (0x7f5926202c00) [pid = 2587] [serial = 74] [outer = (nil)] [url = data:text/html;charset=IBM866,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 22 (0x7f592562c800) [pid = 2587] [serial = 72] [outer = (nil)] [url = data:text/html;charset=gb18030,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 21 (0x7f59261a4c00) [pid = 2587] [serial = 70] [outer = (nil)] [url = data:text/html;charset=EUC-KR,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 20 (0x7f592619ec00) [pid = 2587] [serial = 68] [outer = (nil)] [url = data:text/html;charset=EUC-JP,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 19 (0x7f5925894c00) [pid = 2587] [serial = 66] [outer = (nil)] [url = data:text/html;charset=Big5-HKSCS,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - --DOMWINDOW == 18 (0x7f592562c400) [pid = 2587] [serial = 64] [outer = (nil)] [url = data:text/html;charset=Big5,%3Cp%20id='testPara'%3EThe%20quick%20brown%20fox%20jumps%20over%20the%20lazy%20dog] 11:36:14 INFO - 290 INFO TEST-OK | layout/base/tests/test_bug469170.html | took 691ms 11:36:14 INFO - ++DOMWINDOW == 19 (0x7f5924a95800) [pid = 2587] [serial = 158] [outer = 0x7f5927291800] 11:36:14 INFO - 291 INFO TEST-START | layout/base/tests/test_bug471126.html 11:36:14 INFO - ++DOMWINDOW == 20 (0x7f5924a96400) [pid = 2587] [serial = 159] [outer = 0x7f5927291800] 11:36:14 INFO - MEMORY STAT | vsize 576MB | residentFast 112MB | heapAllocated 22MB 11:36:15 INFO - 292 INFO TEST-OK | layout/base/tests/test_bug471126.html | took 388ms 11:36:15 INFO - ++DOMWINDOW == 21 (0x7f592562d000) [pid = 2587] [serial = 160] [outer = 0x7f5927291800] 11:36:15 INFO - 293 INFO TEST-START | layout/base/tests/test_bug499538-1.html 11:36:15 INFO - ++DOMWINDOW == 22 (0x7f5926204800) [pid = 2587] [serial = 161] [outer = 0x7f5927291800] 11:36:15 INFO - MEMORY STAT | vsize 577MB | residentFast 113MB | heapAllocated 23MB 11:36:15 INFO - 294 INFO TEST-OK | layout/base/tests/test_bug499538-1.html | took 822ms 11:36:16 INFO - ++DOMWINDOW == 23 (0x7f592620d400) [pid = 2587] [serial = 162] [outer = 0x7f5927291800] 11:36:16 INFO - 295 INFO TEST-START | layout/base/tests/test_bug514127.html 11:36:16 INFO - ++DOMWINDOW == 24 (0x7f592620dc00) [pid = 2587] [serial = 163] [outer = 0x7f5927291800] 11:36:16 INFO - ++DOCSHELL 0x7f5925dcb000 == 5 [pid = 2587] [id = 50] 11:36:16 INFO - ++DOMWINDOW == 25 (0x7f59262c6400) [pid = 2587] [serial = 164] [outer = (nil)] 11:36:16 INFO - ++DOMWINDOW == 26 (0x7f5926412c00) [pid = 2587] [serial = 165] [outer = 0x7f59262c6400] 11:36:16 INFO - MEMORY STAT | vsize 577MB | residentFast 112MB | heapAllocated 24MB 11:36:16 INFO - 296 INFO TEST-OK | layout/base/tests/test_bug514127.html | took 491ms 11:36:16 INFO - ++DOMWINDOW == 27 (0x7f5926210800) [pid = 2587] [serial = 166] [outer = 0x7f5927291800] 11:36:16 INFO - 297 INFO TEST-START | layout/base/tests/test_bug518777.html 11:36:17 INFO - ++DOMWINDOW == 28 (0x7f5926211000) [pid = 2587] [serial = 167] [outer = 0x7f5927291800] 11:36:17 INFO - ++DOCSHELL 0x7f5925de5800 == 6 [pid = 2587] [id = 51] 11:36:17 INFO - ++DOMWINDOW == 29 (0x7f5922d29000) [pid = 2587] [serial = 168] [outer = (nil)] 11:36:17 INFO - ++DOMWINDOW == 30 (0x7f592678e800) [pid = 2587] [serial = 169] [outer = 0x7f5922d29000] 11:36:17 INFO - MEMORY STAT | vsize 577MB | residentFast 113MB | heapAllocated 25MB 11:36:17 INFO - 298 INFO TEST-OK | layout/base/tests/test_bug518777.html | took 555ms 11:36:17 INFO - ++DOMWINDOW == 31 (0x7f59262c6c00) [pid = 2587] [serial = 170] [outer = 0x7f5927291800] 11:36:17 INFO - 299 INFO TEST-START | layout/base/tests/test_bug548545.xhtml 11:36:17 INFO - ++DOMWINDOW == 32 (0x7f5922d1c800) [pid = 2587] [serial = 171] [outer = 0x7f5927291800] 11:36:18 INFO - MEMORY STAT | vsize 577MB | residentFast 114MB | heapAllocated 24MB 11:36:18 INFO - 300 INFO TEST-OK | layout/base/tests/test_bug548545.xhtml | took 1199ms 11:36:19 INFO - ++DOMWINDOW == 33 (0x7f592562a000) [pid = 2587] [serial = 172] [outer = 0x7f5927291800] 11:36:19 INFO - 301 INFO TEST-START | layout/base/tests/test_bug558663.html 11:36:19 INFO - ++DOMWINDOW == 34 (0x7f592562b000) [pid = 2587] [serial = 173] [outer = 0x7f5927291800] 11:36:19 INFO - ++DOCSHELL 0x7f592616d800 == 7 [pid = 2587] [id = 52] 11:36:19 INFO - ++DOMWINDOW == 35 (0x7f5926204c00) [pid = 2587] [serial = 174] [outer = (nil)] 11:36:19 INFO - [Child 2587] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9245 11:36:19 INFO - ++DOMWINDOW == 36 (0x7f5924a98c00) [pid = 2587] [serial = 175] [outer = 0x7f5926204c00] 11:36:20 INFO - ++DOCSHELL 0x7f5924a6e000 == 8 [pid = 2587] [id = 53] 11:36:20 INFO - ++DOMWINDOW == 37 (0x7f5924a8c400) [pid = 2587] [serial = 176] [outer = (nil)] 11:36:20 INFO - ++DOMWINDOW == 38 (0x7f5922d26400) [pid = 2587] [serial = 177] [outer = 0x7f5924a8c400] 11:36:20 INFO - --DOCSHELL 0x7f5923c38000 == 7 [pid = 2587] [id = 48] 11:36:20 INFO - --DOCSHELL 0x7f59256d0000 == 6 [pid = 2587] [id = 49] 11:36:20 INFO - --DOCSHELL 0x7f5925dcb000 == 5 [pid = 2587] [id = 50] 11:36:20 INFO - --DOCSHELL 0x7f5925de5800 == 4 [pid = 2587] [id = 51] 11:36:20 INFO - --DOMWINDOW == 37 (0x7f592620a400) [pid = 2587] [serial = 145] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug435293-interaction.html] 11:36:20 INFO - --DOMWINDOW == 36 (0x7f5925383c00) [pid = 2587] [serial = 63] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug399284.html] 11:36:20 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:36:20 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:36:20 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:36:20 INFO - MEMORY STAT | vsize 576MB | residentFast 109MB | heapAllocated 21MB 11:36:20 INFO - 302 INFO TEST-OK | layout/base/tests/test_bug558663.html | took 1602ms 11:36:20 INFO - ++DOMWINDOW == 37 (0x7f5925383400) [pid = 2587] [serial = 178] [outer = 0x7f5927291800] 11:36:20 INFO - 303 INFO TEST-START | layout/base/tests/test_bug559499.html 11:36:21 INFO - ++DOMWINDOW == 38 (0x7f59261a4400) [pid = 2587] [serial = 179] [outer = 0x7f5927291800] 11:36:21 INFO - MEMORY STAT | vsize 576MB | residentFast 110MB | heapAllocated 22MB 11:36:21 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0xC1F30001: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/extensions/spellcheck/src/mozInlineSpellChecker.cpp, line 1797 11:36:21 INFO - 304 INFO TEST-OK | layout/base/tests/test_bug559499.html | took 503ms 11:36:21 INFO - ++DOMWINDOW == 39 (0x7f5926205c00) [pid = 2587] [serial = 180] [outer = 0x7f5927291800] 11:36:21 INFO - 305 INFO TEST-START | layout/base/tests/test_bug569520.html 11:36:21 INFO - ++DOMWINDOW == 40 (0x7f5926205400) [pid = 2587] [serial = 181] [outer = 0x7f5927291800] 11:36:21 INFO - MEMORY STAT | vsize 576MB | residentFast 110MB | heapAllocated 23MB 11:36:21 INFO - 306 INFO TEST-OK | layout/base/tests/test_bug569520.html | took 475ms 11:36:22 INFO - ++DOMWINDOW == 41 (0x7f592620c000) [pid = 2587] [serial = 182] [outer = 0x7f5927291800] 11:36:22 INFO - 307 INFO TEST-START | layout/base/tests/test_bug582181-1.html 11:36:22 INFO - ++DOMWINDOW == 42 (0x7f592620c800) [pid = 2587] [serial = 183] [outer = 0x7f5927291800] 11:36:22 INFO - MEMORY STAT | vsize 576MB | residentFast 111MB | heapAllocated 23MB 11:36:22 INFO - 308 INFO TEST-OK | layout/base/tests/test_bug582181-1.html | took 678ms 11:36:22 INFO - ++DOMWINDOW == 43 (0x7f59262bac00) [pid = 2587] [serial = 184] [outer = 0x7f5927291800] 11:36:23 INFO - 309 INFO TEST-START | layout/base/tests/test_bug582181-2.html 11:36:23 INFO - --DOMWINDOW == 42 (0x7f592562a000) [pid = 2587] [serial = 172] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 41 (0x7f5922d1c800) [pid = 2587] [serial = 171] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug548545.xhtml] 11:36:23 INFO - --DOMWINDOW == 40 (0x7f5924a98400) [pid = 2587] [serial = 143] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug423523.html] 11:36:23 INFO - --DOMWINDOW == 39 (0x7f5926210800) [pid = 2587] [serial = 166] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 38 (0x7f5926412c00) [pid = 2587] [serial = 165] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3Cbody%20style%3D%27background%3A%20rgb%280%2C0%2C255%29%3B%20width%3A%20100px%3B%20height%3A%2050100px%3B%27%3E%3C%2Fbody%3E%3C%2Fhtml%3E] 11:36:23 INFO - --DOMWINDOW == 37 (0x7f592620d400) [pid = 2587] [serial = 162] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 36 (0x7f592562d000) [pid = 2587] [serial = 160] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 35 (0x7f5924a95800) [pid = 2587] [serial = 158] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 34 (0x7f5926205800) [pid = 2587] [serial = 157] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3C%2Fhtml%3E] 11:36:23 INFO - --DOMWINDOW == 33 (0x7f5924a9d800) [pid = 2587] [serial = 154] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 32 (0x7f592562fc00) [pid = 2587] [serial = 153] [outer = (nil)] [url = about:blank] 11:36:23 INFO - --DOMWINDOW == 31 (0x7f5924a86400) [pid = 2587] [serial = 151] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug449781.html] 11:36:23 INFO - --DOMWINDOW == 30 (0x7f5922d26c00) [pid = 2587] [serial = 150] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 29 (0x7f5924a93800) [pid = 2587] [serial = 149] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug435293-skew.html] 11:36:23 INFO - --DOMWINDOW == 28 (0x7f5924a92c00) [pid = 2587] [serial = 148] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 27 (0x7f5922d1c400) [pid = 2587] [serial = 147] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug435293-scale.html] 11:36:23 INFO - --DOMWINDOW == 26 (0x7f5922d24000) [pid = 2587] [serial = 146] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 25 (0x7f59262c6c00) [pid = 2587] [serial = 170] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:23 INFO - --DOMWINDOW == 24 (0x7f592678e800) [pid = 2587] [serial = 169] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3Cbody%20onload%3D%27window.scrollTo%280%2C99999999%29%3B%20document.documentElement.offsetWidth%3B%20window.parent.dotest%28%29%3B%27%20style%3D%27background%3A%20rgb%280%2C0%2C255%29%3B%20width%3A%20100px%3B%20height%3A%2050100px%3B%27%3E%3C%2Fbody%3E%3C%2Fhtml%3E] 11:36:23 INFO - --DOMWINDOW == 23 (0x7f59262c6400) [pid = 2587] [serial = 164] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3Cbody%20style%3D%27background%3A%20rgb%280%2C0%2C255%29%3B%20width%3A%20100px%3B%20height%3A%2050100px%3B%27%3E%3C%2Fbody%3E%3C%2Fhtml%3E] 11:36:23 INFO - --DOMWINDOW == 22 (0x7f5925376000) [pid = 2587] [serial = 156] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3C%2Fhtml%3E] 11:36:23 INFO - --DOMWINDOW == 21 (0x7f5924a98800) [pid = 2587] [serial = 152] [outer = (nil)] [url = about:blank] 11:36:23 INFO - --DOMWINDOW == 20 (0x7f5922d29000) [pid = 2587] [serial = 168] [outer = (nil)] [url = data:text/html,%3Chtml%3E%3Cbody%20onload%3D%27window.scrollTo%280%2C99999999%29%3B%20document.documentElement.offsetWidth%3B%20window.parent.dotest%28%29%3B%27%20style%3D%27background%3A%20rgb%280%2C0%2C255%29%3B%20width%3A%20100px%3B%20height%3A%2050100px%3B%27%3E%3C%2Fbody%3E%3C%2Fhtml%3E] 11:36:23 INFO - ++DOMWINDOW == 21 (0x7f5922d1c800) [pid = 2587] [serial = 185] [outer = 0x7f5927291800] 11:36:23 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:36:23 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:36:23 INFO - MEMORY STAT | vsize 576MB | residentFast 111MB | heapAllocated 24MB 11:36:23 INFO - 310 INFO TEST-OK | layout/base/tests/test_bug582181-2.html | took 888ms 11:36:24 INFO - ++DOMWINDOW == 22 (0x7f5926411000) [pid = 2587] [serial = 186] [outer = 0x7f5927291800] 11:36:24 INFO - 311 INFO TEST-START | layout/base/tests/test_bug582771.html 11:36:24 INFO - ++DOMWINDOW == 23 (0x7f5926414000) [pid = 2587] [serial = 187] [outer = 0x7f5927291800] 11:36:24 INFO - MEMORY STAT | vsize 576MB | residentFast 111MB | heapAllocated 24MB 11:36:24 INFO - 312 INFO TEST-OK | layout/base/tests/test_bug582771.html | took 422ms 11:36:24 INFO - ++DOMWINDOW == 24 (0x7f59268d5800) [pid = 2587] [serial = 188] [outer = 0x7f5927291800] 11:36:24 INFO - 313 INFO TEST-START | layout/base/tests/test_bug583889.html 11:36:24 INFO - ++DOMWINDOW == 25 (0x7f5926796000) [pid = 2587] [serial = 189] [outer = 0x7f5927291800] 11:36:24 INFO - ++DOCSHELL 0x7f5925dd3000 == 5 [pid = 2587] [id = 54] 11:36:24 INFO - ++DOMWINDOW == 26 (0x7f5927297000) [pid = 2587] [serial = 190] [outer = (nil)] 11:36:24 INFO - ++DOMWINDOW == 27 (0x7f5927d55400) [pid = 2587] [serial = 191] [outer = 0x7f5927297000] 11:36:25 INFO - ++DOMWINDOW == 28 (0x7f5926209000) [pid = 2587] [serial = 192] [outer = 0x7f5927297000] 11:36:25 INFO - ++DOCSHELL 0x7f5925dea000 == 6 [pid = 2587] [id = 55] 11:36:25 INFO - ++DOMWINDOW == 29 (0x7f5922d26000) [pid = 2587] [serial = 193] [outer = (nil)] 11:36:25 INFO - ++DOMWINDOW == 30 (0x7f5926796400) [pid = 2587] [serial = 194] [outer = 0x7f5922d26000] 11:36:25 INFO - ++DOMWINDOW == 31 (0x7f592678f800) [pid = 2587] [serial = 195] [outer = 0x7f5922d26000] 11:36:25 INFO - hi 11:36:25 INFO - MEMORY STAT | vsize 576MB | residentFast 112MB | heapAllocated 25MB 11:36:25 INFO - 314 INFO TEST-OK | layout/base/tests/test_bug583889.html | took 996ms 11:36:25 INFO - ++DOMWINDOW == 32 (0x7f5927d5b400) [pid = 2587] [serial = 196] [outer = 0x7f5927291800] 11:36:25 INFO - 315 INFO TEST-START | layout/base/tests/test_bug588174.html 11:36:26 INFO - ++DOMWINDOW == 33 (0x7f5922d1cc00) [pid = 2587] [serial = 197] [outer = 0x7f5927291800] 11:36:26 INFO - MEMORY STAT | vsize 576MB | residentFast 113MB | heapAllocated 25MB 11:36:26 INFO - 316 INFO TEST-OK | layout/base/tests/test_bug588174.html | took 971ms 11:36:27 INFO - ++DOMWINDOW == 34 (0x7f59261a0c00) [pid = 2587] [serial = 198] [outer = 0x7f5927291800] 11:36:27 INFO - 317 INFO TEST-START | layout/base/tests/test_bug603550.html 11:36:27 INFO - --DOCSHELL 0x7f592616d800 == 5 [pid = 2587] [id = 52] 11:36:27 INFO - --DOCSHELL 0x7f5924a6e000 == 4 [pid = 2587] [id = 53] 11:36:27 INFO - --DOCSHELL 0x7f5925dd3000 == 3 [pid = 2587] [id = 54] 11:36:27 INFO - --DOCSHELL 0x7f5925dea000 == 2 [pid = 2587] [id = 55] 11:36:27 INFO - ++DOMWINDOW == 35 (0x7f5922d1b400) [pid = 2587] [serial = 199] [outer = 0x7f5927291800] 11:36:28 INFO - --DOMWINDOW == 34 (0x7f592620dc00) [pid = 2587] [serial = 163] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug514127.html] 11:36:28 INFO - --DOMWINDOW == 33 (0x7f5924a96400) [pid = 2587] [serial = 159] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug471126.html] 11:36:28 INFO - --DOMWINDOW == 32 (0x7f5924a94c00) [pid = 2587] [serial = 155] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug469170.html] 11:36:28 INFO - --DOMWINDOW == 31 (0x7f5926211000) [pid = 2587] [serial = 167] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug518777.html] 11:36:28 INFO - MEMORY STAT | vsize 576MB | residentFast 108MB | heapAllocated 21MB 11:36:28 INFO - 318 INFO TEST-OK | layout/base/tests/test_bug603550.html | took 963ms 11:36:28 INFO - ++DOMWINDOW == 32 (0x7f5925632800) [pid = 2587] [serial = 200] [outer = 0x7f5927291800] 11:36:28 INFO - 319 INFO TEST-START | layout/base/tests/test_bug607529.html 11:36:28 INFO - ++DOMWINDOW == 33 (0x7f5922d24c00) [pid = 2587] [serial = 201] [outer = 0x7f5927291800] 11:36:28 INFO - ++DOCSHELL 0x7f5925566000 == 3 [pid = 2587] [id = 56] 11:36:28 INFO - ++DOMWINDOW == 34 (0x7f592619e400) [pid = 2587] [serial = 202] [outer = (nil)] 11:36:29 INFO - ++DOMWINDOW == 35 (0x7f5926206400) [pid = 2587] [serial = 203] [outer = 0x7f592619e400] 11:36:29 INFO - ++DOCSHELL 0x7f9721181000 == 7 [pid = 2532] [id = 8] 11:36:29 INFO - ++DOMWINDOW == 13 (0x7f971d7a6000) [pid = 2532] [serial = 18] [outer = (nil)] 11:36:29 INFO - ++DOMWINDOW == 14 (0x7f972b072400) [pid = 2532] [serial = 19] [outer = 0x7f971d7a6000] 11:36:29 INFO - ++DOMWINDOW == 15 (0x7f972b260800) [pid = 2532] [serial = 20] [outer = 0x7f971d7a6000] 11:36:29 INFO - ++DOMWINDOW == 36 (0x7f5924a96800) [pid = 2587] [serial = 204] [outer = 0x7f592619e400] 11:36:30 INFO - [Parent 2532] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 11:36:30 INFO - ++DOMWINDOW == 37 (0x7f5926795800) [pid = 2587] [serial = 205] [outer = 0x7f592619e400] 11:36:31 INFO - MEMORY STAT | vsize 576MB | residentFast 111MB | heapAllocated 24MB 11:36:31 INFO - --DOMWINDOW == 36 (0x7f592562b000) [pid = 2587] [serial = 173] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug558663.html] 11:36:31 INFO - --DOMWINDOW == 35 (0x7f5922d26400) [pid = 2587] [serial = 177] [outer = (nil)] [url = data:text/html,] 11:36:31 INFO - --DOMWINDOW == 34 (0x7f5924a98c00) [pid = 2587] [serial = 175] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug558663.html] 11:36:31 INFO - --DOMWINDOW == 33 (0x7f5927d55400) [pid = 2587] [serial = 191] [outer = (nil)] [url = about:blank] 11:36:31 INFO - --DOMWINDOW == 32 (0x7f5926204800) [pid = 2587] [serial = 161] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug499538-1.html] 11:36:31 INFO - --DOMWINDOW == 31 (0x7f59268d5800) [pid = 2587] [serial = 188] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 30 (0x7f5926411000) [pid = 2587] [serial = 186] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 29 (0x7f59262bac00) [pid = 2587] [serial = 184] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 28 (0x7f592620c000) [pid = 2587] [serial = 182] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 27 (0x7f5926205400) [pid = 2587] [serial = 181] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug569520.html] 11:36:31 INFO - --DOMWINDOW == 26 (0x7f5926205c00) [pid = 2587] [serial = 180] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 25 (0x7f59261a4400) [pid = 2587] [serial = 179] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug559499.html] 11:36:31 INFO - --DOMWINDOW == 24 (0x7f5925383400) [pid = 2587] [serial = 178] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 23 (0x7f5926796400) [pid = 2587] [serial = 194] [outer = (nil)] [url = about:blank] 11:36:31 INFO - --DOMWINDOW == 22 (0x7f5927d5b400) [pid = 2587] [serial = 196] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:31 INFO - --DOMWINDOW == 21 (0x7f5926796000) [pid = 2587] [serial = 189] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug583889.html] 11:36:31 INFO - --DOMWINDOW == 20 (0x7f5926209000) [pid = 2587] [serial = 192] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug583889_inner1.html] 11:36:31 INFO - --DOMWINDOW == 19 (0x7f592678f800) [pid = 2587] [serial = 195] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug583889_inner2.html#id1] 11:36:31 INFO - --DOMWINDOW == 18 (0x7f5927297000) [pid = 2587] [serial = 190] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug583889_inner1.html] 11:36:31 INFO - --DOMWINDOW == 17 (0x7f5924a8c400) [pid = 2587] [serial = 176] [outer = (nil)] [url = data:text/html,] 11:36:31 INFO - --DOMWINDOW == 16 (0x7f5926204c00) [pid = 2587] [serial = 174] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug558663.html] 11:36:31 INFO - --DOMWINDOW == 15 (0x7f5922d26000) [pid = 2587] [serial = 193] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug583889_inner2.html#id1] 11:36:31 INFO - 320 INFO TEST-OK | layout/base/tests/test_bug607529.html | took 3306ms 11:36:32 INFO - ++DOMWINDOW == 16 (0x7f592588cc00) [pid = 2587] [serial = 206] [outer = 0x7f5927291800] 11:36:32 INFO - 321 INFO TEST-START | layout/base/tests/test_bug629838.html 11:36:32 INFO - ++DOMWINDOW == 17 (0x7f592619dc00) [pid = 2587] [serial = 207] [outer = 0x7f5927291800] 11:36:32 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:36:32 INFO - For application/x-test found plugin libnptest.so 11:36:32 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp1UCf5s.mozrunner/runtests_leaks_plugin_pid2620.log 11:36:32 INFO - Xlib: extension "RANDR" missing on display ":0". 11:36:32 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnptest.so returned 7fcecdb76310 11:36:32 INFO - [NPAPI 2620] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:36:32 INFO - [NPAPI 2620] WARNING: NS_ENSURE_TRUE(InitStaticMembers()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/modules/libpref/Preferences.cpp, line 1352 11:36:32 INFO - [NPAPI 2620] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:36:34 INFO - MEMORY STAT | vsize 574MB | residentFast 111MB | heapAllocated 24MB 11:36:34 INFO - 322 INFO TEST-OK | layout/base/tests/test_bug629838.html | took 2333ms 11:36:34 INFO - ++DOMWINDOW == 18 (0x7f592537dc00) [pid = 2587] [serial = 208] [outer = 0x7f5927291800] 11:36:34 INFO - 323 INFO TEST-START | layout/base/tests/test_bug644768.html 11:36:35 INFO - ++DOMWINDOW == 19 (0x7f5927f79c00) [pid = 2587] [serial = 209] [outer = 0x7f5927291800] 11:36:35 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:35 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:35 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:35 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:35 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:35 INFO - MEMORY STAT | vsize 574MB | residentFast 112MB | heapAllocated 25MB 11:36:36 INFO - [Child 2587] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:36:36 INFO - 324 INFO TEST-OK | layout/base/tests/test_bug644768.html | took 1570ms 11:36:36 INFO - ++DOMWINDOW == 20 (0x7f5925379c00) [pid = 2587] [serial = 210] [outer = 0x7f5927291800] 11:36:36 INFO - 325 INFO TEST-START | layout/base/tests/test_bug646757.html 11:36:36 INFO - ++DOMWINDOW == 21 (0x7f5925633400) [pid = 2587] [serial = 211] [outer = 0x7f5927291800] 11:36:37 INFO - MEMORY STAT | vsize 575MB | residentFast 113MB | heapAllocated 25MB 11:36:37 INFO - 326 INFO TEST-OK | layout/base/tests/test_bug646757.html | took 1069ms 11:36:37 INFO - ++DOMWINDOW == 22 (0x7f5926418400) [pid = 2587] [serial = 212] [outer = 0x7f5927291800] 11:36:37 INFO - 327 INFO TEST-START | layout/base/tests/test_bug66619.html 11:36:38 INFO - ++DOMWINDOW == 23 (0x7f5925892400) [pid = 2587] [serial = 213] [outer = 0x7f5927291800] 11:36:38 INFO - --DOCSHELL 0x7f5925566000 == 2 [pid = 2587] [id = 56] 11:36:39 INFO - --DOMWINDOW == 22 (0x7f5926414000) [pid = 2587] [serial = 187] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug582771.html] 11:36:39 INFO - MEMORY STAT | vsize 574MB | residentFast 109MB | heapAllocated 21MB 11:36:39 INFO - 328 INFO TEST-OK | layout/base/tests/test_bug66619.html | took 1372ms 11:36:39 INFO - ++DOMWINDOW == 23 (0x7f592537a800) [pid = 2587] [serial = 214] [outer = 0x7f5927291800] 11:36:39 INFO - 329 INFO TEST-START | layout/base/tests/test_bug667512.html 11:36:39 INFO - ++DOMWINDOW == 24 (0x7f592537ac00) [pid = 2587] [serial = 215] [outer = 0x7f5927291800] 11:36:39 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:36:39 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:36:39 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:36:39 INFO - [Child 2587] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:36:39 INFO - MEMORY STAT | vsize 574MB | residentFast 110MB | heapAllocated 22MB 11:36:39 INFO - 330 INFO TEST-OK | layout/base/tests/test_bug667512.html | took 489ms 11:36:39 INFO - ++DOMWINDOW == 25 (0x7f5925630800) [pid = 2587] [serial = 216] [outer = 0x7f5927291800] 11:36:40 INFO - 331 INFO TEST-START | layout/base/tests/test_bug677878.html 11:36:40 INFO - ++DOMWINDOW == 26 (0x7f5922d1fc00) [pid = 2587] [serial = 217] [outer = 0x7f5927291800] 11:36:40 INFO - MEMORY STAT | vsize 560MB | residentFast 110MB | heapAllocated 22MB 11:36:40 INFO - 332 INFO TEST-OK | layout/base/tests/test_bug677878.html | took 713ms 11:36:40 INFO - ++DOMWINDOW == 27 (0x7f5924aa0800) [pid = 2587] [serial = 218] [outer = 0x7f5927291800] 11:36:40 INFO - 333 INFO TEST-START | layout/base/tests/test_bug687297.html 11:36:41 INFO - ++DOMWINDOW == 28 (0x7f5924aa1800) [pid = 2587] [serial = 219] [outer = 0x7f5927291800] 11:36:41 INFO - ++DOCSHELL 0x7f5925582000 == 3 [pid = 2587] [id = 57] 11:36:41 INFO - ++DOMWINDOW == 29 (0x7f5925632c00) [pid = 2587] [serial = 220] [outer = (nil)] 11:36:41 INFO - ++DOMWINDOW == 30 (0x7f59262c6c00) [pid = 2587] [serial = 221] [outer = 0x7f5925632c00] 11:36:41 INFO - ++DOMWINDOW == 31 (0x7f5926418800) [pid = 2587] [serial = 222] [outer = 0x7f5925632c00] 11:36:42 INFO - --DOMWINDOW == 30 (0x7f5925633400) [pid = 2587] [serial = 211] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug646757.html] 11:36:42 INFO - --DOMWINDOW == 29 (0x7f5925379c00) [pid = 2587] [serial = 210] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:42 INFO - --DOMWINDOW == 28 (0x7f592537dc00) [pid = 2587] [serial = 208] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:42 INFO - --DOMWINDOW == 27 (0x7f59261a0c00) [pid = 2587] [serial = 198] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:42 INFO - --DOMWINDOW == 26 (0x7f5922d1cc00) [pid = 2587] [serial = 197] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug588174.html] 11:36:42 INFO - --DOMWINDOW == 25 (0x7f5926795800) [pid = 2587] [serial = 205] [outer = (nil)] [url = data:text/html,] 11:36:42 INFO - --DOMWINDOW == 24 (0x7f5926206400) [pid = 2587] [serial = 203] [outer = (nil)] [url = about:blank] 11:36:42 INFO - --DOMWINDOW == 23 (0x7f592588cc00) [pid = 2587] [serial = 206] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:42 INFO - --DOMWINDOW == 22 (0x7f5922d24c00) [pid = 2587] [serial = 201] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug607529.html] 11:36:42 INFO - --DOMWINDOW == 21 (0x7f5925632800) [pid = 2587] [serial = 200] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:42 INFO - --DOMWINDOW == 20 (0x7f592619e400) [pid = 2587] [serial = 202] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug607529.html] 11:36:42 INFO - --DOMWINDOW == 19 (0x7f5922d1c800) [pid = 2587] [serial = 185] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug582181-2.html] 11:36:42 INFO - --DOMWINDOW == 18 (0x7f592620c800) [pid = 2587] [serial = 183] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug582181-1.html] 11:36:42 INFO - ++DOMWINDOW == 19 (0x7f592640b000) [pid = 2587] [serial = 223] [outer = 0x7f5925632c00] 11:36:43 INFO - ++DOMWINDOW == 20 (0x7f592679d800) [pid = 2587] [serial = 224] [outer = 0x7f5925632c00] 11:36:43 INFO - MEMORY STAT | vsize 564MB | residentFast 111MB | heapAllocated 23MB 11:36:44 INFO - 334 INFO TEST-OK | layout/base/tests/test_bug687297.html | took 3153ms 11:36:44 INFO - ++DOMWINDOW == 21 (0x7f5927290400) [pid = 2587] [serial = 225] [outer = 0x7f5927291800] 11:36:44 INFO - 335 INFO TEST-START | layout/base/tests/test_bug696020.html 11:36:44 INFO - ++DOMWINDOW == 22 (0x7f5927d4f000) [pid = 2587] [serial = 226] [outer = 0x7f5927291800] 11:36:44 INFO - ++DOCSHELL 0x7f5925ddf000 == 4 [pid = 2587] [id = 58] 11:36:44 INFO - ++DOMWINDOW == 23 (0x7f5927dcec00) [pid = 2587] [serial = 227] [outer = (nil)] 11:36:44 INFO - ++DOMWINDOW == 24 (0x7f5927d5ac00) [pid = 2587] [serial = 228] [outer = 0x7f5927dcec00] 11:36:44 INFO - [Child 2587] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:36:44 INFO - MEMORY STAT | vsize 564MB | residentFast 112MB | heapAllocated 24MB 11:36:44 INFO - 336 INFO TEST-OK | layout/base/tests/test_bug696020.html | took 525ms 11:36:44 INFO - ++DOMWINDOW == 25 (0x7f5927dd4000) [pid = 2587] [serial = 229] [outer = 0x7f5927291800] 11:36:44 INFO - 337 INFO TEST-START | layout/base/tests/test_bug718809.html 11:36:45 INFO - ++DOMWINDOW == 26 (0x7f5922d20800) [pid = 2587] [serial = 230] [outer = 0x7f5927291800] 11:36:45 INFO - MEMORY STAT | vsize 564MB | residentFast 113MB | heapAllocated 24MB 11:36:45 INFO - 338 INFO TEST-OK | layout/base/tests/test_bug718809.html | took 645ms 11:36:45 INFO - ++DOMWINDOW == 27 (0x7f592537b400) [pid = 2587] [serial = 231] [outer = 0x7f5927291800] 11:36:45 INFO - 339 INFO TEST-START | layout/base/tests/test_bug725426.html 11:36:46 INFO - ++DOMWINDOW == 28 (0x7f5922d23800) [pid = 2587] [serial = 232] [outer = 0x7f5927291800] 11:36:46 INFO - MEMORY STAT | vsize 564MB | residentFast 113MB | heapAllocated 25MB 11:36:46 INFO - 340 INFO TEST-OK | layout/base/tests/test_bug725426.html | took 504ms 11:36:46 INFO - ++DOMWINDOW == 29 (0x7f592640a400) [pid = 2587] [serial = 233] [outer = 0x7f5927291800] 11:36:46 INFO - 341 INFO TEST-START | layout/base/tests/test_bug731777.html 11:36:47 INFO - ++DOMWINDOW == 30 (0x7f5926206c00) [pid = 2587] [serial = 234] [outer = 0x7f5927291800] 11:36:48 INFO - MEMORY STAT | vsize 564MB | residentFast 113MB | heapAllocated 24MB 11:36:48 INFO - --DOCSHELL 0x7f5925582000 == 3 [pid = 2587] [id = 57] 11:36:48 INFO - --DOCSHELL 0x7f5925ddf000 == 2 [pid = 2587] [id = 58] 11:36:48 INFO - --DOMWINDOW == 29 (0x7f5922d1b400) [pid = 2587] [serial = 199] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug603550.html] 11:36:48 INFO - --DOMWINDOW == 28 (0x7f592619dc00) [pid = 2587] [serial = 207] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug629838.html] 11:36:48 INFO - --DOMWINDOW == 27 (0x7f5924a96800) [pid = 2587] [serial = 204] [outer = (nil)] [url = about:blank] 11:36:48 INFO - 342 INFO TEST-OK | layout/base/tests/test_bug731777.html | took 1767ms 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - ++DOMWINDOW == 28 (0x7f5922d1e400) [pid = 2587] [serial = 235] [outer = 0x7f5927291800] 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - 343 INFO TEST-START | layout/base/tests/test_bug761572.html 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX3-]: Surface width or height <= 0! 11:36:48 INFO - [GFX1-]: Failed to allocate a surface due to invalid size Size(0,0) 11:36:48 INFO - [Parent 2532] WARNING: '!temp', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/layers/basic/BasicCompositor.cpp, line 481 11:36:48 INFO - ++DOMWINDOW == 29 (0x7f5922d20c00) [pid = 2587] [serial = 236] [outer = 0x7f5927291800] 11:36:49 INFO - MEMORY STAT | vsize 564MB | residentFast 111MB | heapAllocated 22MB 11:36:49 INFO - 344 INFO TEST-OK | layout/base/tests/test_bug761572.html | took 660ms 11:36:49 INFO - ++DOMWINDOW == 30 (0x7f592562bc00) [pid = 2587] [serial = 237] [outer = 0x7f5927291800] 11:36:49 INFO - 345 INFO TEST-START | layout/base/tests/test_bug770106.html 11:36:49 INFO - ++DOMWINDOW == 31 (0x7f592537a000) [pid = 2587] [serial = 238] [outer = 0x7f5927291800] 11:36:49 INFO - MEMORY STAT | vsize 564MB | residentFast 111MB | heapAllocated 22MB 11:36:49 INFO - 346 INFO TEST-OK | layout/base/tests/test_bug770106.html | took 339ms 11:36:49 INFO - ++DOMWINDOW == 32 (0x7f5926204800) [pid = 2587] [serial = 239] [outer = 0x7f5927291800] 11:36:49 INFO - 347 INFO TEST-START | layout/base/tests/test_bug842853-2.html 11:36:50 INFO - ++DOMWINDOW == 33 (0x7f5926204c00) [pid = 2587] [serial = 240] [outer = 0x7f5927291800] 11:36:50 INFO - ++DOCSHELL 0x7f5923c1d000 == 3 [pid = 2587] [id = 59] 11:36:50 INFO - ++DOMWINDOW == 34 (0x7f59262c5000) [pid = 2587] [serial = 241] [outer = (nil)] 11:36:50 INFO - ++DOMWINDOW == 35 (0x7f5924a95800) [pid = 2587] [serial = 242] [outer = 0x7f59262c5000] 11:36:50 INFO - --DOMWINDOW == 14 (0x7f972b072400) [pid = 2532] [serial = 19] [outer = (nil)] [url = about:blank] 11:36:50 INFO - ++DOMWINDOW == 36 (0x7f5924a94800) [pid = 2587] [serial = 243] [outer = 0x7f59262c5000] 11:36:50 INFO - MEMORY STAT | vsize 564MB | residentFast 112MB | heapAllocated 24MB 11:36:50 INFO - 348 INFO TEST-OK | layout/base/tests/test_bug842853-2.html | took 1067ms 11:36:51 INFO - --DOMWINDOW == 35 (0x7f5922d23800) [pid = 2587] [serial = 232] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug725426.html] 11:36:51 INFO - --DOMWINDOW == 34 (0x7f5922d20800) [pid = 2587] [serial = 230] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug718809.html] 11:36:51 INFO - --DOMWINDOW == 33 (0x7f592537b400) [pid = 2587] [serial = 231] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 32 (0x7f5926418400) [pid = 2587] [serial = 212] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 31 (0x7f5925892400) [pid = 2587] [serial = 213] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug66619.html] 11:36:51 INFO - --DOMWINDOW == 30 (0x7f5927f79c00) [pid = 2587] [serial = 209] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug644768.html] 11:36:51 INFO - --DOMWINDOW == 29 (0x7f59262c6c00) [pid = 2587] [serial = 221] [outer = (nil)] [url = about:blank] 11:36:51 INFO - --DOMWINDOW == 28 (0x7f5927290400) [pid = 2587] [serial = 225] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 27 (0x7f5924aa0800) [pid = 2587] [serial = 218] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 26 (0x7f5925630800) [pid = 2587] [serial = 216] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 25 (0x7f592537a800) [pid = 2587] [serial = 214] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 24 (0x7f592640a400) [pid = 2587] [serial = 233] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 23 (0x7f5927dd4000) [pid = 2587] [serial = 229] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:51 INFO - --DOMWINDOW == 22 (0x7f5927d5ac00) [pid = 2587] [serial = 228] [outer = (nil)] [url = about:blank] 11:36:51 INFO - --DOMWINDOW == 21 (0x7f5925632c00) [pid = 2587] [serial = 220] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug687297_c.html] 11:36:51 INFO - --DOMWINDOW == 20 (0x7f5927dcec00) [pid = 2587] [serial = 227] [outer = (nil)] [url = about:blank] 11:36:51 INFO - --DOMWINDOW == 19 (0x7f592679d800) [pid = 2587] [serial = 224] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug687297_c.html] 11:36:51 INFO - --DOMWINDOW == 18 (0x7f592640b000) [pid = 2587] [serial = 223] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug687297_b.html] 11:36:51 INFO - --DOMWINDOW == 17 (0x7f5926418800) [pid = 2587] [serial = 222] [outer = (nil)] [url = about:blank] 11:36:51 INFO - --DOMWINDOW == 16 (0x7f5924aa1800) [pid = 2587] [serial = 219] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug687297.html] 11:36:51 INFO - ++DOMWINDOW == 17 (0x7f5924a8bc00) [pid = 2587] [serial = 244] [outer = 0x7f5927291800] 11:36:51 INFO - 349 INFO TEST-START | layout/base/tests/test_bug842853.html 11:36:51 INFO - ++DOMWINDOW == 18 (0x7f5922d22c00) [pid = 2587] [serial = 245] [outer = 0x7f5927291800] 11:36:51 INFO - ++DOCSHELL 0x7f5924a60000 == 4 [pid = 2587] [id = 60] 11:36:51 INFO - ++DOMWINDOW == 19 (0x7f5922d29c00) [pid = 2587] [serial = 246] [outer = (nil)] 11:36:51 INFO - ++DOMWINDOW == 20 (0x7f5924a98c00) [pid = 2587] [serial = 247] [outer = 0x7f5922d29c00] 11:36:51 INFO - ++DOMWINDOW == 21 (0x7f5925375c00) [pid = 2587] [serial = 248] [outer = 0x7f5922d29c00] 11:36:51 INFO - MEMORY STAT | vsize 564MB | residentFast 112MB | heapAllocated 23MB 11:36:51 INFO - 350 INFO TEST-OK | layout/base/tests/test_bug842853.html | took 720ms 11:36:51 INFO - ++DOMWINDOW == 22 (0x7f5924a93000) [pid = 2587] [serial = 249] [outer = 0x7f5927291800] 11:36:52 INFO - 351 INFO TEST-START | layout/base/tests/test_bug849219.html 11:36:52 INFO - ++DOMWINDOW == 23 (0x7f5924a86800) [pid = 2587] [serial = 250] [outer = 0x7f5927291800] 11:36:52 INFO - ++DOCSHELL 0x7f59258f1800 == 5 [pid = 2587] [id = 61] 11:36:52 INFO - ++DOMWINDOW == 24 (0x7f5924a90c00) [pid = 2587] [serial = 251] [outer = (nil)] 11:36:52 INFO - [Child 2587] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9245 11:36:52 INFO - ++DOMWINDOW == 25 (0x7f5922d26400) [pid = 2587] [serial = 252] [outer = 0x7f5924a90c00] 11:36:52 INFO - ++DOMWINDOW == 26 (0x7f5922d23400) [pid = 2587] [serial = 253] [outer = 0x7f5924a90c00] 11:36:53 INFO - --DOCSHELL 0x7f5923c1d000 == 4 [pid = 2587] [id = 59] 11:36:53 INFO - --DOCSHELL 0x7f5924a60000 == 3 [pid = 2587] [id = 60] 11:36:53 INFO - --DOMWINDOW == 25 (0x7f5922d1fc00) [pid = 2587] [serial = 217] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug677878.html] 11:36:53 INFO - --DOMWINDOW == 24 (0x7f5927d4f000) [pid = 2587] [serial = 226] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug696020.html] 11:36:53 INFO - MEMORY STAT | vsize 562MB | residentFast 107MB | heapAllocated 20MB 11:36:53 INFO - 352 INFO TEST-OK | layout/base/tests/test_bug849219.html | took 1321ms 11:36:53 INFO - ++DOMWINDOW == 25 (0x7f5924a9a800) [pid = 2587] [serial = 254] [outer = 0x7f5927291800] 11:36:53 INFO - 353 INFO TEST-START | layout/base/tests/test_bug851445.html 11:36:53 INFO - ++DOMWINDOW == 26 (0x7f5924a9e400) [pid = 2587] [serial = 255] [outer = 0x7f5927291800] 11:36:53 INFO - ++DOCSHELL 0x7f5925564000 == 4 [pid = 2587] [id = 62] 11:36:53 INFO - ++DOMWINDOW == 27 (0x7f5924aa1800) [pid = 2587] [serial = 256] [outer = (nil)] 11:36:53 INFO - ++DOMWINDOW == 28 (0x7f5925627000) [pid = 2587] [serial = 257] [outer = 0x7f5924aa1800] 11:36:53 INFO - ++DOMWINDOW == 29 (0x7f5925633000) [pid = 2587] [serial = 258] [outer = 0x7f5924aa1800] 11:36:54 INFO - ++DOMWINDOW == 30 (0x7f5924a94400) [pid = 2587] [serial = 259] [outer = 0x7f5924aa1800] 11:36:54 INFO - MEMORY STAT | vsize 563MB | residentFast 108MB | heapAllocated 21MB 11:36:54 INFO - 354 INFO TEST-OK | layout/base/tests/test_bug851445.html | took 734ms 11:36:54 INFO - ++DOMWINDOW == 31 (0x7f5924a96800) [pid = 2587] [serial = 260] [outer = 0x7f5927291800] 11:36:54 INFO - 355 INFO TEST-START | layout/base/tests/test_bug851485.html 11:36:54 INFO - ++DOMWINDOW == 32 (0x7f5924a97800) [pid = 2587] [serial = 261] [outer = 0x7f5927291800] 11:36:54 INFO - ++DOCSHELL 0x7f59256dd800 == 5 [pid = 2587] [id = 63] 11:36:54 INFO - ++DOMWINDOW == 33 (0x7f59261a4400) [pid = 2587] [serial = 262] [outer = (nil)] 11:36:54 INFO - ++DOMWINDOW == 34 (0x7f5926204000) [pid = 2587] [serial = 263] [outer = 0x7f59261a4400] 11:36:55 INFO - ++DOMWINDOW == 35 (0x7f5924aa5800) [pid = 2587] [serial = 264] [outer = 0x7f59261a4400] 11:36:55 INFO - --DOMWINDOW == 34 (0x7f5926206c00) [pid = 2587] [serial = 234] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug731777.html] 11:36:55 INFO - --DOMWINDOW == 33 (0x7f5926204800) [pid = 2587] [serial = 239] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:55 INFO - --DOMWINDOW == 32 (0x7f592537a000) [pid = 2587] [serial = 238] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug770106.html] 11:36:55 INFO - --DOMWINDOW == 31 (0x7f592562bc00) [pid = 2587] [serial = 237] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:55 INFO - --DOMWINDOW == 30 (0x7f5922d1e400) [pid = 2587] [serial = 235] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:55 INFO - --DOMWINDOW == 29 (0x7f5924a8bc00) [pid = 2587] [serial = 244] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:55 INFO - --DOMWINDOW == 28 (0x7f5924a93000) [pid = 2587] [serial = 249] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:36:55 INFO - --DOMWINDOW == 27 (0x7f5924a98c00) [pid = 2587] [serial = 247] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL] 11:36:55 INFO - --DOMWINDOW == 26 (0x7f5925375c00) [pid = 2587] [serial = 248] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL#anchor] 11:36:55 INFO - --DOMWINDOW == 25 (0x7f592537ac00) [pid = 2587] [serial = 215] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug667512.html] 11:36:55 INFO - --DOMWINDOW == 24 (0x7f59262c5000) [pid = 2587] [serial = 241] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html#anchor] 11:36:55 INFO - --DOMWINDOW == 23 (0x7f5922d29c00) [pid = 2587] [serial = 246] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL#anchor] 11:36:55 INFO - --DOMWINDOW == 22 (0x7f5924a95800) [pid = 2587] [serial = 242] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html] 11:36:55 INFO - --DOMWINDOW == 21 (0x7f5924a94800) [pid = 2587] [serial = 243] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html#anchor] 11:36:56 INFO - MEMORY STAT | vsize 563MB | residentFast 110MB | heapAllocated 22MB 11:36:56 INFO - 356 INFO TEST-OK | layout/base/tests/test_bug851485.html | took 1809ms 11:36:56 INFO - [Child 2587] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:36:57 INFO - ++DOMWINDOW == 22 (0x7f5926206800) [pid = 2587] [serial = 265] [outer = 0x7f5927291800] 11:36:57 INFO - 357 INFO TEST-START | layout/base/tests/test_bug858459.html 11:36:57 INFO - ++DOMWINDOW == 23 (0x7f5926205400) [pid = 2587] [serial = 266] [outer = 0x7f5927291800] 11:36:59 INFO - --DOCSHELL 0x7f59256dd800 == 4 [pid = 2587] [id = 63] 11:36:59 INFO - --DOCSHELL 0x7f5925564000 == 3 [pid = 2587] [id = 62] 11:36:59 INFO - --DOCSHELL 0x7f59258f1800 == 2 [pid = 2587] [id = 61] 11:36:59 INFO - --DOMWINDOW == 22 (0x7f5926204c00) [pid = 2587] [serial = 240] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug842853-2.html] 11:36:59 INFO - --DOMWINDOW == 21 (0x7f5922d22c00) [pid = 2587] [serial = 245] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug842853.html] 11:36:59 INFO - --DOMWINDOW == 20 (0x7f5922d20c00) [pid = 2587] [serial = 236] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug761572.html] 11:37:02 INFO - --DOMWINDOW == 19 (0x7f5926206800) [pid = 2587] [serial = 265] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:02 INFO - --DOMWINDOW == 18 (0x7f5924a96800) [pid = 2587] [serial = 260] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:02 INFO - --DOMWINDOW == 17 (0x7f5924a94400) [pid = 2587] [serial = 259] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug851445_helper.html?0.6283979129491538] 11:37:02 INFO - --DOMWINDOW == 16 (0x7f5925633000) [pid = 2587] [serial = 258] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug851445_helper.html?0.6283979129491538] 11:37:02 INFO - --DOMWINDOW == 15 (0x7f5925627000) [pid = 2587] [serial = 257] [outer = (nil)] [url = about:blank] 11:37:02 INFO - --DOMWINDOW == 14 (0x7f5924a9a800) [pid = 2587] [serial = 254] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:02 INFO - --DOMWINDOW == 13 (0x7f5922d23400) [pid = 2587] [serial = 253] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL#anchor] 11:37:02 INFO - --DOMWINDOW == 12 (0x7f5922d26400) [pid = 2587] [serial = 252] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL] 11:37:02 INFO - --DOMWINDOW == 11 (0x7f59261a4400) [pid = 2587] [serial = 262] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html#anchor] 11:37:02 INFO - --DOMWINDOW == 10 (0x7f5924aa1800) [pid = 2587] [serial = 256] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug851445_helper.html?0.6283979129491538] 11:37:02 INFO - --DOMWINDOW == 9 (0x7f5924a90c00) [pid = 2587] [serial = 251] [outer = (nil)] [url = data:text/html,Click%20to%20scroll%20to%20anchorFAIL#anchor] 11:37:02 INFO - --DOMWINDOW == 8 (0x7f5924aa5800) [pid = 2587] [serial = 264] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html#anchor] 11:37:02 INFO - --DOMWINDOW == 7 (0x7f5926204000) [pid = 2587] [serial = 263] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/file_bug842853.html] 11:37:03 INFO - MEMORY STAT | vsize 562MB | residentFast 107MB | heapAllocated 19MB 11:37:03 INFO - 358 INFO TEST-OK | layout/base/tests/test_bug858459.html | took 5578ms 11:37:03 INFO - ++DOMWINDOW == 8 (0x7f5922d25c00) [pid = 2587] [serial = 267] [outer = 0x7f5927291800] 11:37:03 INFO - 359 INFO TEST-START | layout/base/tests/test_bug93077-1.html 11:37:03 INFO - ++DOMWINDOW == 9 (0x7f5922d26400) [pid = 2587] [serial = 268] [outer = 0x7f5927291800] 11:37:03 INFO - MEMORY STAT | vsize 562MB | residentFast 108MB | heapAllocated 20MB 11:37:03 INFO - 360 INFO TEST-OK | layout/base/tests/test_bug93077-1.html | took 471ms 11:37:03 INFO - ++DOMWINDOW == 10 (0x7f5924a9d000) [pid = 2587] [serial = 269] [outer = 0x7f5927291800] 11:37:03 INFO - 361 INFO TEST-START | layout/base/tests/test_bug93077-2.html 11:37:04 INFO - ++DOMWINDOW == 11 (0x7f5924a9d400) [pid = 2587] [serial = 270] [outer = 0x7f5927291800] 11:37:04 INFO - MEMORY STAT | vsize 563MB | residentFast 107MB | heapAllocated 21MB 11:37:04 INFO - nsStringStats 11:37:04 INFO - => mAllocCount: 187 11:37:04 INFO - => mReallocCount: 1 11:37:04 INFO - => mFreeCount: 187 11:37:04 INFO - => mShareCount: 358 11:37:04 INFO - => mAdoptCount: 0 11:37:04 INFO - => mAdoptFreeCount: 0 11:37:04 INFO - => Process ID: 2620, Thread ID: 140526542101056 11:37:04 INFO - [Parent 2532] WARNING: '!aObserver', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/ds/nsObserverService.cpp, line 261 11:37:04 INFO - 362 INFO TEST-OK | layout/base/tests/test_bug93077-2.html | took 773ms 11:37:04 INFO - ++DOMWINDOW == 12 (0x7f5924a95800) [pid = 2587] [serial = 271] [outer = 0x7f5927291800] 11:37:04 INFO - 363 INFO TEST-START | layout/base/tests/test_bug93077-3.html 11:37:05 INFO - ++DOMWINDOW == 13 (0x7f5922d20800) [pid = 2587] [serial = 272] [outer = 0x7f5927291800] 11:37:05 INFO - MEMORY STAT | vsize 563MB | residentFast 107MB | heapAllocated 21MB 11:37:05 INFO - 364 INFO TEST-OK | layout/base/tests/test_bug93077-3.html | took 979ms 11:37:06 INFO - ++DOMWINDOW == 14 (0x7f5924aa1400) [pid = 2587] [serial = 273] [outer = 0x7f5927291800] 11:37:06 INFO - 365 INFO TEST-START | layout/base/tests/test_bug93077-4.html 11:37:06 INFO - ++DOMWINDOW == 15 (0x7f5922d24c00) [pid = 2587] [serial = 274] [outer = 0x7f5927291800] 11:37:06 INFO - MEMORY STAT | vsize 563MB | residentFast 108MB | heapAllocated 22MB 11:37:06 INFO - 366 INFO TEST-OK | layout/base/tests/test_bug93077-4.html | took 612ms 11:37:07 INFO - ++DOMWINDOW == 16 (0x7f5924a90c00) [pid = 2587] [serial = 275] [outer = 0x7f5927291800] 11:37:07 INFO - --DOMWINDOW == 15 (0x7f5924a86800) [pid = 2587] [serial = 250] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug849219.html] 11:37:07 INFO - --DOMWINDOW == 14 (0x7f5924a9e400) [pid = 2587] [serial = 255] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug851445.html] 11:37:07 INFO - --DOMWINDOW == 13 (0x7f5924a97800) [pid = 2587] [serial = 261] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug851485.html] 11:37:07 INFO - 367 INFO TEST-START | layout/base/tests/test_bug93077-5.html 11:37:07 INFO - ++DOMWINDOW == 14 (0x7f5922d21800) [pid = 2587] [serial = 276] [outer = 0x7f5927291800] 11:37:08 INFO - MEMORY STAT | vsize 563MB | residentFast 107MB | heapAllocated 19MB 11:37:08 INFO - 368 INFO TEST-OK | layout/base/tests/test_bug93077-5.html | took 575ms 11:37:08 INFO - ++DOMWINDOW == 15 (0x7f5924a96400) [pid = 2587] [serial = 277] [outer = 0x7f5927291800] 11:37:08 INFO - 369 INFO TEST-START | layout/base/tests/test_bug93077-6.html 11:37:08 INFO - ++DOMWINDOW == 16 (0x7f5924a97000) [pid = 2587] [serial = 278] [outer = 0x7f5927291800] 11:37:09 INFO - MEMORY STAT | vsize 563MB | residentFast 108MB | heapAllocated 20MB 11:37:09 INFO - 370 INFO TEST-OK | layout/base/tests/test_bug93077-6.html | took 1047ms 11:37:09 INFO - ++DOMWINDOW == 17 (0x7f5924aa1800) [pid = 2587] [serial = 279] [outer = 0x7f5927291800] 11:37:09 INFO - 371 INFO TEST-START | layout/base/tests/test_bug968148.html 11:37:09 INFO - ++DOMWINDOW == 18 (0x7f5925376400) [pid = 2587] [serial = 280] [outer = 0x7f5927291800] 11:37:10 INFO - ++DOCSHELL 0x7f5924a74800 == 3 [pid = 2587] [id = 64] 11:37:10 INFO - ++DOMWINDOW == 19 (0x7f5925624800) [pid = 2587] [serial = 281] [outer = (nil)] 11:37:10 INFO - ++DOMWINDOW == 20 (0x7f5925625c00) [pid = 2587] [serial = 282] [outer = 0x7f5925624800] 11:37:10 INFO - --DOMWINDOW == 19 (0x7f5922d20800) [pid = 2587] [serial = 272] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-3.html] 11:37:10 INFO - --DOMWINDOW == 18 (0x7f5924a95800) [pid = 2587] [serial = 271] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:10 INFO - --DOMWINDOW == 17 (0x7f5924a9d400) [pid = 2587] [serial = 270] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-2.html] 11:37:10 INFO - --DOMWINDOW == 16 (0x7f5924a9d000) [pid = 2587] [serial = 269] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:10 INFO - --DOMWINDOW == 15 (0x7f5922d25c00) [pid = 2587] [serial = 267] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:10 INFO - --DOMWINDOW == 14 (0x7f5924aa1400) [pid = 2587] [serial = 273] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:10 INFO - --DOMWINDOW == 13 (0x7f5922d26400) [pid = 2587] [serial = 268] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-1.html] 11:37:10 INFO - ++DOMWINDOW == 14 (0x7f5922d22800) [pid = 2587] [serial = 283] [outer = 0x7f5925624800] 11:37:10 INFO - MEMORY STAT | vsize 559MB | residentFast 109MB | heapAllocated 21MB 11:37:10 INFO - 372 INFO TEST-OK | layout/base/tests/test_bug968148.html | took 1261ms 11:37:10 INFO - ++DOMWINDOW == 15 (0x7f5925379800) [pid = 2587] [serial = 284] [outer = 0x7f5927291800] 11:37:11 INFO - 373 INFO TEST-START | layout/base/tests/test_bug970964.html 11:37:11 INFO - ++DOMWINDOW == 16 (0x7f5925888c00) [pid = 2587] [serial = 285] [outer = 0x7f5927291800] 11:37:11 INFO - ++DOCSHELL 0x7f5925583000 == 4 [pid = 2587] [id = 65] 11:37:11 INFO - ++DOMWINDOW == 17 (0x7f592588c400) [pid = 2587] [serial = 286] [outer = (nil)] 11:37:11 INFO - ++DOMWINDOW == 18 (0x7f5925889400) [pid = 2587] [serial = 287] [outer = 0x7f592588c400] 11:37:11 INFO - ++DOMWINDOW == 19 (0x7f5924a95800) [pid = 2587] [serial = 288] [outer = 0x7f592588c400] 11:37:12 INFO - MEMORY STAT | vsize 560MB | residentFast 109MB | heapAllocated 22MB 11:37:12 INFO - 374 INFO TEST-OK | layout/base/tests/test_bug970964.html | took 1078ms 11:37:12 INFO - ++DOMWINDOW == 20 (0x7f5922d23800) [pid = 2587] [serial = 289] [outer = 0x7f5927291800] 11:37:12 INFO - 375 INFO TEST-START | layout/base/tests/test_bug976963.html 11:37:12 INFO - ++DOMWINDOW == 21 (0x7f5924a96800) [pid = 2587] [serial = 290] [outer = 0x7f5927291800] 11:37:12 INFO - ++DOCSHELL 0x7f59258e3000 == 5 [pid = 2587] [id = 66] 11:37:12 INFO - ++DOMWINDOW == 22 (0x7f59262bbc00) [pid = 2587] [serial = 291] [outer = (nil)] 11:37:12 INFO - ++DOMWINDOW == 23 (0x7f59262b8000) [pid = 2587] [serial = 292] [outer = 0x7f59262bbc00] 11:37:12 INFO - ++DOMWINDOW == 24 (0x7f592537c400) [pid = 2587] [serial = 293] [outer = 0x7f59262bbc00] 11:37:14 INFO - MEMORY STAT | vsize 560MB | residentFast 111MB | heapAllocated 23MB 11:37:14 INFO - 376 INFO TEST-OK | layout/base/tests/test_bug976963.html | took 1976ms 11:37:14 INFO - ++DOMWINDOW == 25 (0x7f5924aa1400) [pid = 2587] [serial = 294] [outer = 0x7f5927291800] 11:37:14 INFO - 377 INFO TEST-START | layout/base/tests/test_bug977003.html 11:37:14 INFO - ++DOMWINDOW == 26 (0x7f5922d21000) [pid = 2587] [serial = 295] [outer = 0x7f5927291800] 11:37:14 INFO - ++DOCSHELL 0x7f5924a60000 == 6 [pid = 2587] [id = 67] 11:37:14 INFO - ++DOMWINDOW == 27 (0x7f5924a9c400) [pid = 2587] [serial = 296] [outer = (nil)] 11:37:14 INFO - ++DOMWINDOW == 28 (0x7f5924a9d400) [pid = 2587] [serial = 297] [outer = 0x7f5924a9c400] 11:37:15 INFO - --DOCSHELL 0x7f5924a74800 == 5 [pid = 2587] [id = 64] 11:37:15 INFO - --DOCSHELL 0x7f5925583000 == 4 [pid = 2587] [id = 65] 11:37:15 INFO - --DOCSHELL 0x7f59258e3000 == 3 [pid = 2587] [id = 66] 11:37:15 INFO - --DOMWINDOW == 27 (0x7f5926205400) [pid = 2587] [serial = 266] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug858459.html] 11:37:15 INFO - --DOMWINDOW == 26 (0x7f5922d24c00) [pid = 2587] [serial = 274] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-4.html] 11:37:15 INFO - ++DOMWINDOW == 27 (0x7f5922d26400) [pid = 2587] [serial = 298] [outer = 0x7f5924a9c400] 11:37:16 INFO - ++DOMWINDOW == 28 (0x7f5924aa0400) [pid = 2587] [serial = 299] [outer = 0x7f5924a9c400] 11:37:16 INFO - ++DOMWINDOW == 29 (0x7f5922d25c00) [pid = 2587] [serial = 300] [outer = 0x7f5924a9c400] 11:37:16 INFO - ++DOMWINDOW == 30 (0x7f592537b000) [pid = 2587] [serial = 301] [outer = 0x7f5924a9c400] 11:37:17 INFO - ++DOMWINDOW == 31 (0x7f592619bc00) [pid = 2587] [serial = 302] [outer = 0x7f5924a9c400] 11:37:17 INFO - ++DOMWINDOW == 32 (0x7f59261a4400) [pid = 2587] [serial = 303] [outer = 0x7f5924a9c400] 11:37:18 INFO - --DOMWINDOW == 31 (0x7f5924a90c00) [pid = 2587] [serial = 275] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:18 INFO - --DOMWINDOW == 30 (0x7f5922d23800) [pid = 2587] [serial = 289] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:18 INFO - --DOMWINDOW == 29 (0x7f5925889400) [pid = 2587] [serial = 287] [outer = (nil)] [url = about:blank] 11:37:18 INFO - --DOMWINDOW == 28 (0x7f5925888c00) [pid = 2587] [serial = 285] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug970964.html] 11:37:18 INFO - --DOMWINDOW == 27 (0x7f5925379800) [pid = 2587] [serial = 284] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:18 INFO - --DOMWINDOW == 26 (0x7f5925625c00) [pid = 2587] [serial = 282] [outer = (nil)] [url = about:blank] 11:37:18 INFO - --DOMWINDOW == 25 (0x7f5925376400) [pid = 2587] [serial = 280] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug968148.html] 11:37:18 INFO - --DOMWINDOW == 24 (0x7f5924aa1800) [pid = 2587] [serial = 279] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:18 INFO - --DOMWINDOW == 23 (0x7f5924a97000) [pid = 2587] [serial = 278] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-6.html] 11:37:18 INFO - --DOMWINDOW == 22 (0x7f5924a96400) [pid = 2587] [serial = 277] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:18 INFO - --DOMWINDOW == 21 (0x7f5922d21800) [pid = 2587] [serial = 276] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug93077-5.html] 11:37:18 INFO - --DOMWINDOW == 20 (0x7f59262b8000) [pid = 2587] [serial = 292] [outer = (nil)] [url = about:blank] 11:37:18 INFO - --DOMWINDOW == 19 (0x7f592588c400) [pid = 2587] [serial = 286] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug970964_inner.html] 11:37:18 INFO - --DOMWINDOW == 18 (0x7f5925624800) [pid = 2587] [serial = 281] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug968148_inner.html] 11:37:18 INFO - --DOMWINDOW == 17 (0x7f59262bbc00) [pid = 2587] [serial = 291] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug976963_inner.html] 11:37:18 INFO - --DOMWINDOW == 16 (0x7f5924a96800) [pid = 2587] [serial = 290] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug976963.html] 11:37:22 INFO - MEMORY STAT | vsize 597MB | residentFast 157MB | heapAllocated 72MB 11:37:23 INFO - 378 INFO TEST-OK | layout/base/tests/test_bug977003.html | took 8562ms 11:37:23 INFO - ++DOMWINDOW == 17 (0x7f5922d27800) [pid = 2587] [serial = 304] [outer = 0x7f5927291800] 11:37:23 INFO - 379 INFO TEST-START | layout/base/tests/test_bug990340.html 11:37:23 INFO - ++DOMWINDOW == 18 (0x7f5924a8b400) [pid = 2587] [serial = 305] [outer = 0x7f5927291800] 11:37:23 INFO - MEMORY STAT | vsize 601MB | residentFast 134MB | heapAllocated 46MB 11:37:24 INFO - 380 INFO TEST-OK | layout/base/tests/test_bug990340.html | took 609ms 11:37:24 INFO - ++DOMWINDOW == 19 (0x7f5922d21800) [pid = 2587] [serial = 306] [outer = 0x7f5927291800] 11:37:24 INFO - 381 INFO TEST-START | layout/base/tests/test_emulateMedium.html 11:37:24 INFO - ++DOMWINDOW == 20 (0x7f5924a97c00) [pid = 2587] [serial = 307] [outer = 0x7f5927291800] 11:37:25 INFO - --DOCSHELL 0x7f5924a60000 == 2 [pid = 2587] [id = 67] 11:37:25 INFO - MEMORY STAT | vsize 600MB | residentFast 116MB | heapAllocated 26MB 11:37:25 INFO - --DOMWINDOW == 19 (0x7f5922d22800) [pid = 2587] [serial = 283] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug968148_inner.html] 11:37:25 INFO - --DOMWINDOW == 18 (0x7f5924a95800) [pid = 2587] [serial = 288] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug970964_inner.html] 11:37:25 INFO - --DOMWINDOW == 17 (0x7f592537c400) [pid = 2587] [serial = 293] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug976963_inner.html] 11:37:25 INFO - 382 INFO TEST-OK | layout/base/tests/test_emulateMedium.html | took 851ms 11:37:25 INFO - ++DOMWINDOW == 18 (0x7f5922d1c400) [pid = 2587] [serial = 308] [outer = 0x7f5927291800] 11:37:25 INFO - 383 INFO TEST-START | layout/base/tests/test_event_target_radius.html 11:37:26 INFO - ++DOMWINDOW == 19 (0x7f5924a9bc00) [pid = 2587] [serial = 309] [outer = 0x7f5927291800] 11:37:26 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:37:26 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:37:26 INFO - [Child 2587] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:37:26 INFO - JavaScript error: resource://gre/modules/SelectParentHelper.jsm, line 26: TypeError: menulist.selectedItem is null 11:37:27 INFO - MEMORY STAT | vsize 601MB | residentFast 118MB | heapAllocated 28MB 11:37:27 INFO - 384 INFO TEST-OK | layout/base/tests/test_event_target_radius.html | took 1986ms 11:37:27 INFO - ++DOMWINDOW == 20 (0x7f592619d000) [pid = 2587] [serial = 310] [outer = 0x7f5927291800] 11:37:27 INFO - 385 INFO TEST-START | layout/base/tests/test_frame_reconstruction_for_pseudo_elements.html 11:37:27 INFO - ++DOMWINDOW == 21 (0x7f592ab85400) [pid = 2587] [serial = 311] [outer = 0x7f5927291800] 11:37:28 INFO - MEMORY STAT | vsize 601MB | residentFast 118MB | heapAllocated 29MB 11:37:28 INFO - 386 INFO TEST-OK | layout/base/tests/test_frame_reconstruction_for_pseudo_elements.html | took 338ms 11:37:28 INFO - ++DOMWINDOW == 22 (0x7f5928e6bc00) [pid = 2587] [serial = 312] [outer = 0x7f5927291800] 11:37:28 INFO - 387 INFO TEST-START | layout/base/tests/test_getBoxQuads_convertPointRectQuad.html 11:37:28 INFO - ++DOMWINDOW == 23 (0x7f592ab82800) [pid = 2587] [serial = 313] [outer = 0x7f5927291800] 11:37:28 INFO - ++DOCSHELL 0x7f59258d9000 == 3 [pid = 2587] [id = 68] 11:37:28 INFO - ++DOMWINDOW == 24 (0x7f592b942400) [pid = 2587] [serial = 314] [outer = (nil)] 11:37:28 INFO - ++DOMWINDOW == 25 (0x7f592bb8e400) [pid = 2587] [serial = 315] [outer = 0x7f592b942400] 11:37:28 INFO - ++DOCSHELL 0x7f5925dd7800 == 4 [pid = 2587] [id = 69] 11:37:28 INFO - ++DOMWINDOW == 26 (0x7f5924a9a800) [pid = 2587] [serial = 316] [outer = (nil)] 11:37:28 INFO - ++DOMWINDOW == 27 (0x7f592abeb000) [pid = 2587] [serial = 317] [outer = 0x7f5924a9a800] 11:37:32 INFO - ++DOCSHELL 0x7f59256e9800 == 5 [pid = 2587] [id = 70] 11:37:32 INFO - ++DOMWINDOW == 28 (0x7f59214e4400) [pid = 2587] [serial = 318] [outer = (nil)] 11:37:32 INFO - ++DOMWINDOW == 29 (0x7f59214e8000) [pid = 2587] [serial = 319] [outer = 0x7f59214e4400] 11:37:32 INFO - ++DOMWINDOW == 30 (0x7f5921b03400) [pid = 2587] [serial = 320] [outer = 0x7f59214e4400] 11:37:32 INFO - --DOMWINDOW == 29 (0x7f5924aa1400) [pid = 2587] [serial = 294] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:32 INFO - --DOMWINDOW == 28 (0x7f5924a9d400) [pid = 2587] [serial = 297] [outer = (nil)] [url = about:blank] 11:37:32 INFO - --DOMWINDOW == 27 (0x7f5922d27800) [pid = 2587] [serial = 304] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:32 INFO - --DOMWINDOW == 26 (0x7f5924a9c400) [pid = 2587] [serial = 296] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_6.html] 11:37:32 INFO - --DOMWINDOW == 25 (0x7f5924a8b400) [pid = 2587] [serial = 305] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug990340.html] 11:37:32 INFO - --DOMWINDOW == 24 (0x7f5922d21000) [pid = 2587] [serial = 295] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_bug977003.html] 11:37:33 INFO - MEMORY STAT | vsize 601MB | residentFast 123MB | heapAllocated 32MB 11:37:33 INFO - 388 INFO TEST-OK | layout/base/tests/test_getBoxQuads_convertPointRectQuad.html | took 5216ms 11:37:33 INFO - ++DOMWINDOW == 25 (0x7f5921b08000) [pid = 2587] [serial = 321] [outer = 0x7f5927291800] 11:37:33 INFO - 389 INFO TEST-START | layout/base/tests/test_getClientRects_emptytext.html 11:37:33 INFO - ++DOMWINDOW == 26 (0x7f5921b08400) [pid = 2587] [serial = 322] [outer = 0x7f5927291800] 11:37:34 INFO - MEMORY STAT | vsize 601MB | residentFast 125MB | heapAllocated 33MB 11:37:34 INFO - 390 INFO TEST-OK | layout/base/tests/test_getClientRects_emptytext.html | took 376ms 11:37:34 INFO - ++DOMWINDOW == 27 (0x7f59208af400) [pid = 2587] [serial = 323] [outer = 0x7f5927291800] 11:37:34 INFO - 391 INFO TEST-START | layout/base/tests/test_mozPaintCount.html 11:37:34 INFO - ++DOMWINDOW == 28 (0x7f59208af800) [pid = 2587] [serial = 324] [outer = 0x7f5927291800] 11:37:34 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:37:34 INFO - For application/x-test found plugin libnptest.so 11:37:34 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp1UCf5s.mozrunner/runtests_leaks_plugin_pid2642.log 11:37:34 INFO - Xlib: extension "RANDR" missing on display ":0". 11:37:34 INFO - LoadPlugin() /tmp/tmp1UCf5s.mozrunner/plugins/libnptest.so returned 7f4bd8576310 11:37:34 INFO - [NPAPI 2642] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:37:34 INFO - [NPAPI 2642] WARNING: NS_ENSURE_TRUE(InitStaticMembers()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/modules/libpref/Preferences.cpp, line 1352 11:37:34 INFO - [NPAPI 2642] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:37:35 INFO - --DOCSHELL 0x7f59256e9800 == 4 [pid = 2587] [id = 70] 11:37:35 INFO - --DOCSHELL 0x7f5925dd7800 == 3 [pid = 2587] [id = 69] 11:37:35 INFO - --DOCSHELL 0x7f59258d9000 == 2 [pid = 2587] [id = 68] 11:37:35 INFO - --DOMWINDOW == 27 (0x7f5922d26400) [pid = 2587] [serial = 298] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_1.html] 11:37:35 INFO - --DOMWINDOW == 26 (0x7f5924aa0400) [pid = 2587] [serial = 299] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_2.html] 11:37:35 INFO - --DOMWINDOW == 25 (0x7f5922d25c00) [pid = 2587] [serial = 300] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_3.html] 11:37:35 INFO - --DOMWINDOW == 24 (0x7f592537b000) [pid = 2587] [serial = 301] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_4.html] 11:37:35 INFO - --DOMWINDOW == 23 (0x7f592619bc00) [pid = 2587] [serial = 302] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_5.html] 11:37:35 INFO - --DOMWINDOW == 22 (0x7f59261a4400) [pid = 2587] [serial = 303] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/bug977003_inner_6.html] 11:37:36 INFO - MEMORY STAT | vsize 600MB | residentFast 116MB | heapAllocated 22MB 11:37:36 INFO - 392 INFO TEST-OK | layout/base/tests/test_mozPaintCount.html | took 1923ms 11:37:36 INFO - ++DOMWINDOW == 23 (0x7f59214e2400) [pid = 2587] [serial = 325] [outer = 0x7f5927291800] 11:37:36 INFO - 393 INFO TEST-START | layout/base/tests/test_preserve3d_sorting_hit_testing.html 11:37:36 INFO - ++DOMWINDOW == 24 (0x7f59208ae400) [pid = 2587] [serial = 326] [outer = 0x7f5927291800] 11:37:36 INFO - ++DOCSHELL 0x7f5924a6d800 == 3 [pid = 2587] [id = 71] 11:37:36 INFO - ++DOMWINDOW == 25 (0x7f59214e5400) [pid = 2587] [serial = 327] [outer = (nil)] 11:37:36 INFO - ++DOMWINDOW == 26 (0x7f5921b04800) [pid = 2587] [serial = 328] [outer = 0x7f59214e5400] 11:37:36 INFO - depth 0x7f5921b07820 207.999939 11:37:36 INFO - depth 0x7f5921b06c20 350.000000 11:37:36 INFO - depth 0x7f5921b079e8 0.000000 11:37:36 INFO - depth 0x7f5921b09020 207.999939 11:37:36 INFO - depth 0x7f5921b091e8 0.000000 11:37:36 INFO - depth 0x7f5921b09820 207.999939 11:37:36 INFO - depth 0x7f5921b099e8 0.000000 11:37:36 INFO - depth 0x7f5921b0a020 250.999908 11:37:36 INFO - depth 0x7f5921b0a1e8 0.000000 11:37:36 INFO - depth 0x7f5921b0ac20 149.999939 11:37:36 INFO - depth 0x7f5921b0ade8 0.000000 11:37:36 INFO - MEMORY STAT | vsize 600MB | residentFast 116MB | heapAllocated 23MB 11:37:36 INFO - 394 INFO TEST-OK | layout/base/tests/test_preserve3d_sorting_hit_testing.html | took 484ms 11:37:36 INFO - ++DOMWINDOW == 27 (0x7f5921b0c800) [pid = 2587] [serial = 329] [outer = 0x7f5927291800] 11:37:37 INFO - 395 INFO TEST-START | layout/base/tests/test_remote_frame.html 11:37:37 INFO - ++DOMWINDOW == 28 (0x7f59208b7c00) [pid = 2587] [serial = 330] [outer = 0x7f5927291800] 11:37:37 INFO - ++DOCSHELL 0x7f5923c2a800 == 4 [pid = 2587] [id = 72] 11:37:37 INFO - ++DOMWINDOW == 29 (0x7f59208b3c00) [pid = 2587] [serial = 331] [outer = (nil)] 11:37:37 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:37 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:37 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:37 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(XRE_IsParentProcess()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameMessageManager.cpp, line 1600 11:37:37 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:37 INFO - ###################################### BrowserElementCopyPaste.js loaded 11:37:37 INFO - ############################### browserElementPanning.js loaded 11:37:37 INFO - ######################## BrowserElementChildPreload.js loaded 11:37:37 INFO - ++DOMWINDOW == 30 (0x7f5922d0e800) [pid = 2587] [serial = 332] [outer = 0x7f59208b3c00] 11:37:37 INFO - ######################## extensions.js loaded 11:37:37 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:37 INFO - ++DOMWINDOW == 31 (0x7f5922d1c800) [pid = 2587] [serial = 333] [outer = 0x7f59208b3c00] 11:37:38 INFO - MEMORY STAT | vsize 600MB | residentFast 117MB | heapAllocated 27MB 11:37:38 INFO - --DOMWINDOW == 30 (0x7f59214e8000) [pid = 2587] [serial = 319] [outer = (nil)] [url = about:blank] 11:37:38 INFO - --DOMWINDOW == 29 (0x7f5922d21800) [pid = 2587] [serial = 306] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 28 (0x7f5921b08000) [pid = 2587] [serial = 321] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 27 (0x7f5928e6bc00) [pid = 2587] [serial = 312] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 26 (0x7f592619d000) [pid = 2587] [serial = 310] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 25 (0x7f5922d1c400) [pid = 2587] [serial = 308] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 24 (0x7f5924a9a800) [pid = 2587] [serial = 316] [outer = (nil)] [url = about:blank] 11:37:38 INFO - --DOMWINDOW == 23 (0x7f592b942400) [pid = 2587] [serial = 314] [outer = (nil)] [url = data:text/html,] 11:37:38 INFO - --DOMWINDOW == 22 (0x7f59208af400) [pid = 2587] [serial = 323] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:38 INFO - --DOMWINDOW == 21 (0x7f59214e4400) [pid = 2587] [serial = 318] [outer = (nil)] [url = data:text/html,] 11:37:38 INFO - --DOMWINDOW == 20 (0x7f5921b08400) [pid = 2587] [serial = 322] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_getClientRects_emptytext.html] 11:37:38 INFO - --DOMWINDOW == 19 (0x7f592ab85400) [pid = 2587] [serial = 311] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_frame_reconstruction_for_pseudo_elements.html] 11:37:38 INFO - --DOMWINDOW == 18 (0x7f5924a97c00) [pid = 2587] [serial = 307] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_emulateMedium.html] 11:37:38 INFO - 396 INFO TEST-OK | layout/base/tests/test_remote_frame.html | took 1462ms 11:37:38 INFO - ++DOMWINDOW == 19 (0x7f5921b08400) [pid = 2587] [serial = 334] [outer = 0x7f5927291800] 11:37:38 INFO - 397 INFO TEST-START | layout/base/tests/test_remote_passpointerevents.html 11:37:38 INFO - ++DOMWINDOW == 20 (0x7f5922d10000) [pid = 2587] [serial = 335] [outer = 0x7f5927291800] 11:37:38 INFO - ++DOCSHELL 0x7f5926173800 == 5 [pid = 2587] [id = 73] 11:37:38 INFO - ++DOMWINDOW == 21 (0x7f59224d3000) [pid = 2587] [serial = 336] [outer = (nil)] 11:37:38 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:38 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:38 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:38 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(XRE_IsParentProcess()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameMessageManager.cpp, line 1600 11:37:38 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:39 INFO - ###################################### BrowserElementCopyPaste.js loaded 11:37:39 INFO - ############################### browserElementPanning.js loaded 11:37:39 INFO - ######################## BrowserElementChildPreload.js loaded 11:37:39 INFO - ++DOMWINDOW == 22 (0x7f5924a94000) [pid = 2587] [serial = 337] [outer = 0x7f59224d3000] 11:37:39 INFO - ######################## extensions.js loaded 11:37:39 INFO - [Child 2587] WARNING: Can't embed-apps. Embed-apps is restricted to in-proc apps or content processes with nested pref enabled, see bug 1097479: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 647 11:37:39 INFO - ++DOMWINDOW == 23 (0x7f5921b03000) [pid = 2587] [serial = 338] [outer = 0x7f59224d3000] 11:37:39 INFO - MEMORY STAT | vsize 600MB | residentFast 118MB | heapAllocated 26MB 11:37:39 INFO - 398 INFO TEST-OK | layout/base/tests/test_remote_passpointerevents.html | took 871ms 11:37:39 INFO - ++DOMWINDOW == 24 (0x7f5922d23400) [pid = 2587] [serial = 339] [outer = 0x7f5927291800] 11:37:39 INFO - 399 INFO TEST-START | layout/base/tests/test_scroll_event_ordering.html 11:37:39 INFO - ++DOMWINDOW == 25 (0x7f5924aa3400) [pid = 2587] [serial = 340] [outer = 0x7f5927291800] 11:37:40 INFO - MEMORY STAT | vsize 601MB | residentFast 118MB | heapAllocated 26MB 11:37:40 INFO - 400 INFO TEST-OK | layout/base/tests/test_scroll_event_ordering.html | took 528ms 11:37:40 INFO - ++DOMWINDOW == 26 (0x7f5926208000) [pid = 2587] [serial = 341] [outer = 0x7f5927291800] 11:37:40 INFO - 401 INFO TEST-START | layout/base/tests/test_scroll_snapping.html 11:37:40 INFO - ++DOMWINDOW == 27 (0x7f592562bc00) [pid = 2587] [serial = 342] [outer = 0x7f5927291800] 11:37:43 INFO - --DOCSHELL 0x7f5924a6d800 == 4 [pid = 2587] [id = 71] 11:37:43 INFO - --DOCSHELL 0x7f5923c2a800 == 3 [pid = 2587] [id = 72] 11:37:43 INFO - --DOCSHELL 0x7f5926173800 == 2 [pid = 2587] [id = 73] 11:37:43 INFO - --DOMWINDOW == 26 (0x7f5921b03400) [pid = 2587] [serial = 320] [outer = (nil)] [url = about:blank] 11:37:43 INFO - --DOMWINDOW == 25 (0x7f592abeb000) [pid = 2587] [serial = 317] [outer = (nil)] [url = about:blank] 11:37:43 INFO - --DOMWINDOW == 24 (0x7f5924a9bc00) [pid = 2587] [serial = 309] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_event_target_radius.html] 11:37:43 INFO - --DOMWINDOW == 23 (0x7f592ab82800) [pid = 2587] [serial = 313] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_getBoxQuads_convertPointRectQuad.html] 11:37:43 INFO - --DOMWINDOW == 22 (0x7f592bb8e400) [pid = 2587] [serial = 315] [outer = (nil)] [url = data:text/html,] 11:37:45 INFO - --DOMWINDOW == 21 (0x7f59208af800) [pid = 2587] [serial = 324] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_mozPaintCount.html] 11:37:45 INFO - --DOMWINDOW == 20 (0x7f5926208000) [pid = 2587] [serial = 341] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:45 INFO - --DOMWINDOW == 19 (0x7f5922d23400) [pid = 2587] [serial = 339] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:45 INFO - --DOMWINDOW == 18 (0x7f5921b03000) [pid = 2587] [serial = 338] [outer = (nil)] [url = data:text/html,] 11:37:45 INFO - --DOMWINDOW == 17 (0x7f5924a94000) [pid = 2587] [serial = 337] [outer = (nil)] [url = about:blank] 11:37:45 INFO - --DOMWINDOW == 16 (0x7f5921b08400) [pid = 2587] [serial = 334] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:45 INFO - --DOMWINDOW == 15 (0x7f5922d1c800) [pid = 2587] [serial = 333] [outer = (nil)] [url = data:text/html,] 11:37:45 INFO - --DOMWINDOW == 14 (0x7f5922d0e800) [pid = 2587] [serial = 332] [outer = (nil)] [url = about:blank] 11:37:45 INFO - --DOMWINDOW == 13 (0x7f5921b0c800) [pid = 2587] [serial = 329] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:45 INFO - --DOMWINDOW == 12 (0x7f5921b04800) [pid = 2587] [serial = 328] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/preserve3d_sorting_hit_testing_iframe.html] 11:37:45 INFO - --DOMWINDOW == 11 (0x7f59208ae400) [pid = 2587] [serial = 326] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_preserve3d_sorting_hit_testing.html] 11:37:45 INFO - --DOMWINDOW == 10 (0x7f59214e2400) [pid = 2587] [serial = 325] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:37:45 INFO - --DOMWINDOW == 9 (0x7f59224d3000) [pid = 2587] [serial = 336] [outer = (nil)] [url = data:text/html,] 11:37:45 INFO - --DOMWINDOW == 8 (0x7f59208b3c00) [pid = 2587] [serial = 331] [outer = (nil)] [url = data:text/html,] 11:37:45 INFO - --DOMWINDOW == 7 (0x7f59214e5400) [pid = 2587] [serial = 327] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/preserve3d_sorting_hit_testing_iframe.html] 11:37:49 INFO - --DOMWINDOW == 6 (0x7f5922d10000) [pid = 2587] [serial = 335] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_remote_passpointerevents.html] 11:37:49 INFO - --DOMWINDOW == 5 (0x7f59208b7c00) [pid = 2587] [serial = 330] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_remote_frame.html] 11:38:06 INFO - [Parent 2532] WARNING: '!aObserver', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/ds/nsObserverService.cpp, line 261 11:38:06 INFO - nsStringStats 11:38:06 INFO - => mAllocCount: 279 11:38:06 INFO - => mReallocCount: 1 11:38:06 INFO - => mFreeCount: 279 11:38:06 INFO - => mShareCount: 473 11:38:06 INFO - => mAdoptCount: 0 11:38:06 INFO - => mAdoptFreeCount: 0 11:38:06 INFO - => Process ID: 2642, Thread ID: 139964079491648 11:39:34 INFO - MEMORY STAT | vsize 600MB | residentFast 111MB | heapAllocated 22MB 11:39:34 INFO - 402 INFO TEST-OK | layout/base/tests/test_scroll_snapping.html | took 114386ms 11:39:34 INFO - ++DOMWINDOW == 6 (0x7f5922d24c00) [pid = 2587] [serial = 343] [outer = 0x7f5927291800] 11:39:34 INFO - 403 INFO TEST-START | layout/base/tests/test_scroll_snapping_scrollbars.html 11:39:35 INFO - ++DOMWINDOW == 7 (0x7f5922d25000) [pid = 2587] [serial = 344] [outer = 0x7f5927291800] 11:39:41 INFO - MEMORY STAT | vsize 600MB | residentFast 111MB | heapAllocated 21MB 11:39:41 INFO - 404 INFO TEST-OK | layout/base/tests/test_scroll_snapping_scrollbars.html | took 6243ms 11:39:41 INFO - ++DOMWINDOW == 8 (0x7f59208b2000) [pid = 2587] [serial = 345] [outer = 0x7f5927291800] 11:39:41 INFO - ++DOMWINDOW == 9 (0x7f59208b2800) [pid = 2587] [serial = 346] [outer = 0x7f5927291800] 11:39:41 INFO - --DOCSHELL 0x7f971e131000 == 6 [pid = 2532] [id = 6] 11:39:41 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:39:42 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:39:42 INFO - --DOCSHELL 0x7f9730781000 == 5 [pid = 2532] [id = 1] 11:39:42 INFO - [Child 2587] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:39:42 INFO - --DOCSHELL 0x7f5928e2e800 == 1 [pid = 2587] [id = 1] 11:39:43 INFO - --DOCSHELL 0x7f59272a1800 == 0 [pid = 2587] [id = 2] 11:39:43 INFO - --DOMWINDOW == 8 (0x7f5922d25000) [pid = 2587] [serial = 344] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_scroll_snapping_scrollbars.html] 11:39:43 INFO - --DOMWINDOW == 7 (0x7f5922d24c00) [pid = 2587] [serial = 343] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:39:43 INFO - --DOMWINDOW == 6 (0x7f5924aa3400) [pid = 2587] [serial = 340] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_scroll_event_ordering.html] 11:39:43 INFO - --DOMWINDOW == 5 (0x7f59208b2000) [pid = 2587] [serial = 345] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:39:43 INFO - --DOMWINDOW == 4 (0x7f592562bc00) [pid = 2587] [serial = 342] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/base/tests/test_scroll_snapping.html] 11:39:43 INFO - --DOMWINDOW == 3 (0x7f59208b2800) [pid = 2587] [serial = 346] [outer = (nil)] [url = about:blank] 11:39:43 INFO - --DOMWINDOW == 2 (0x7f5928e7b000) [pid = 2587] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:39:43 INFO - --DOMWINDOW == 1 (0x7f5927dd5400) [pid = 2587] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:39:43 INFO - --DOMWINDOW == 0 (0x7f5927291800) [pid = 2587] [serial = 4] [outer = (nil)] [url = about:blank] 11:39:43 INFO - nsStringStats 11:39:43 INFO - => mAllocCount: 163819 11:39:43 INFO - => mReallocCount: 10184 11:39:43 INFO - => mFreeCount: 163819 11:39:43 INFO - => mShareCount: 210543 11:39:43 INFO - => mAdoptCount: 15766 11:39:43 INFO - => mAdoptFreeCount: 15766 11:39:43 INFO - => Process ID: 2587, Thread ID: 140021408705088 11:39:43 INFO - --DOCSHELL 0x7f971edad000 == 4 [pid = 2532] [id = 7] 11:39:43 INFO - --DOCSHELL 0x7f971fe1b800 == 3 [pid = 2532] [id = 3] 11:39:43 INFO - --DOCSHELL 0x7f971fe1c000 == 2 [pid = 2532] [id = 4] 11:39:43 INFO - --DOCSHELL 0x7f9721181000 == 1 [pid = 2532] [id = 8] 11:39:43 INFO - --DOCSHELL 0x7f972ae5e800 == 0 [pid = 2532] [id = 2] 11:39:43 INFO - ]: 11:39:43 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:39:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:39:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:39:44 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:39:44 INFO - [Parent 2532] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:39:44 INFO - [Parent 2532] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:39:45 INFO - --DOMWINDOW == 13 (0x7f971dcb6c00) [pid = 2532] [serial = 10] [outer = 0x7f971fe4e400] [url = about:blank] 11:39:45 INFO - --DOMWINDOW == 12 (0x7f971dcb7400) [pid = 2532] [serial = 11] [outer = 0x7f971fe4ec00] [url = about:blank] 11:39:45 INFO - --DOMWINDOW == 11 (0x7f971fe4e400) [pid = 2532] [serial = 6] [outer = (nil)] [url = about:blank] 11:39:45 INFO - --DOMWINDOW == 10 (0x7f971fe4ec00) [pid = 2532] [serial = 7] [outer = (nil)] [url = about:blank] 11:39:46 INFO - --DOMWINDOW == 9 (0x7f972ad08400) [pid = 2532] [serial = 4] [outer = (nil)] [url = about:blank] 11:39:46 INFO - --DOMWINDOW == 8 (0x7f972ade2c00) [pid = 2532] [serial = 17] [outer = (nil)] [url = about:blank] 11:39:46 INFO - --DOMWINDOW == 7 (0x7f971d79d800) [pid = 2532] [serial = 16] [outer = (nil)] [url = about:blank] 11:39:46 INFO - --DOMWINDOW == 6 (0x7f971d7c2400) [pid = 2532] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:39:46 INFO - --DOMWINDOW == 5 (0x7f9729e8b800) [pid = 2532] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:39:46 INFO - --DOMWINDOW == 4 (0x7f972ad07800) [pid = 2532] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:39:46 INFO - --DOMWINDOW == 3 (0x7f97307ab800) [pid = 2532] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:39:46 INFO - --DOMWINDOW == 2 (0x7f971d7a6000) [pid = 2532] [serial = 18] [outer = (nil)] [url = about:newtab] 11:39:46 INFO - --DOMWINDOW == 1 (0x7f972b260800) [pid = 2532] [serial = 20] [outer = (nil)] [url = about:newtab] 11:39:46 INFO - --DOMWINDOW == 0 (0x7f9729e8a800) [pid = 2532] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:39:46 INFO - nsStringStats 11:39:46 INFO - => mAllocCount: 191757 11:39:46 INFO - => mReallocCount: 24699 11:39:46 INFO - => mFreeCount: 191757 11:39:46 INFO - => mShareCount: 177340 11:39:46 INFO - => mAdoptCount: 7493 11:39:46 INFO - => mAdoptFreeCount: 7493 11:39:46 INFO - => Process ID: 2532, Thread ID: 140287912671040 11:39:46 INFO - TEST-INFO | Main app process: exit 0 11:39:46 INFO - runtests.py | Application ran for: 0:04:23.934123 11:39:46 INFO - zombiecheck | Reading PID log: /tmp/tmprpTi9dpidlog 11:39:46 INFO - ==> process 2532 launched child process 2587 11:39:46 INFO - ==> process 2532 launched child process 2620 11:39:46 INFO - ==> process 2532 launched child process 2642 11:39:46 INFO - zombiecheck | Checking for orphan process with PID: 2587 11:39:46 INFO - zombiecheck | Checking for orphan process with PID: 2620 11:39:46 INFO - zombiecheck | Checking for orphan process with PID: 2642 11:39:46 INFO - Stopping web server 11:39:46 INFO - Stopping web socket server 11:39:46 INFO - Stopping ssltunnel 11:39:46 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:39:46 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:39:46 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:39:46 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, plugin process 2642 11:39:46 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:39:46 INFO - | | Per-Inst Leaked| Total Rem| 11:39:46 INFO - 0 |TOTAL | 42 0| 1654 0| 11:39:46 INFO - nsTraceRefcnt::DumpStatistics: 31 entries 11:39:46 INFO - TEST-PASS | leakcheck | plugin process: no leaks detected! 11:39:46 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, plugin process 2620 11:39:46 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:39:46 INFO - | | Per-Inst Leaked| Total Rem| 11:39:46 INFO - 0 |TOTAL | 45 0| 1033 0| 11:39:46 INFO - nsTraceRefcnt::DumpStatistics: 31 entries 11:39:46 INFO - TEST-PASS | leakcheck | plugin process: no leaks detected! 11:39:46 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2532 11:39:46 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:39:46 INFO - | | Per-Inst Leaked| Total Rem| 11:39:46 INFO - 0 |TOTAL | 23 0|10002497 0| 11:39:46 INFO - nsTraceRefcnt::DumpStatistics: 1410 entries 11:39:46 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:39:46 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2587 11:39:46 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:39:46 INFO - | | Per-Inst Leaked| Total Rem| 11:39:46 INFO - 0 |TOTAL | 23 4640|14316752 33| 11:39:46 INFO - 17 |AsyncTransactionTrackersHolder | 72 72| 195 1| 11:39:46 INFO - 65 |CompositorChild | 880 880| 1 1| 11:39:46 INFO - 67 |CondVar | 40 120| 448 3| 11:39:46 INFO - 201 |IPC::Channel | 16 32| 9 2| 11:39:46 INFO - 238 |MessagePump | 16 16| 11 1| 11:39:46 INFO - 242 |Mutex | 32 96| 2079 3| 11:39:46 INFO - 255 |PCompositorChild | 776 776| 1 1| 11:39:46 INFO - 262 |PImageBridgeChild | 920 920| 1 1| 11:39:46 INFO - 325 |RefCountedMonitor | 80 160| 8 2| 11:39:46 INFO - 326 |RefCountedTask | 16 64| 16 4| 11:39:46 INFO - 367 |StoreRef | 16 32| 11 2| 11:39:46 INFO - 413 |WaitableEventKernel | 72 72| 14 1| 11:39:46 INFO - 418 |WeakReference | 16 32| 4850 2| 11:39:46 INFO - 451 |base::Thread | 48 48| 3 1| 11:39:46 INFO - 476 |ipc::MessageChannel | 512 1024| 8 2| 11:39:46 INFO - 896 |nsTArray_base | 8 40| 2998969 5| 11:39:46 INFO - 907 |nsThread | 256 256| 10 1| 11:39:46 INFO - nsTraceRefcnt::DumpStatistics: 990 entries 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:39:46 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:39:46 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:39:46 INFO - runtests.py | Running tests: end. 11:39:46 INFO - 405 INFO TEST-START | Shutdown 11:39:46 INFO - 406 INFO Passed: 2765 11:39:46 INFO - 407 INFO Failed: 0 11:39:46 INFO - 408 INFO Todo: 17 11:39:46 INFO - 409 INFO Slowest: 114385ms - /tests/layout/base/tests/test_scroll_snapping.html 11:39:46 INFO - 410 INFO SimpleTest FINISHED 11:39:46 INFO - 411 INFO TEST-INFO | Ran 1 Loops 11:39:46 INFO - 412 INFO SimpleTest FINISHED 11:39:46 INFO - dir: layout/forms/test 11:39:47 INFO - Setting pipeline to PAUSED ... 11:39:47 INFO - Pipeline is PREROLLING ... 11:39:47 INFO - Pipeline is PREROLLED ... 11:39:47 INFO - Setting pipeline to PLAYING ... 11:39:47 INFO - New clock: GstSystemClock 11:39:47 INFO - Got EOS from element "pipeline0". 11:39:47 INFO - Execution ended after 32768162 ns. 11:39:47 INFO - Setting pipeline to PAUSED ... 11:39:47 INFO - Setting pipeline to READY ... 11:39:47 INFO - Setting pipeline to NULL ... 11:39:47 INFO - Freeing pipeline ... 11:39:47 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:39:47 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpobpjIy.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:39:47 INFO - runtests.py | Server pid: 2680 11:39:47 INFO - runtests.py | Websocket server pid: 2683 11:39:47 INFO - runtests.py | SSL tunnel pid: 2687 11:39:48 INFO - runtests.py | Running tests: start. 11:39:48 INFO - runtests.py | Application pid: 2708 11:39:48 INFO - TEST-INFO | started process Main app process 11:39:48 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpobpjIy.mozrunner/runtests_leaks.log 11:39:52 INFO - ++DOCSHELL 0x7fb2c1481000 == 1 [pid = 2708] [id = 1] 11:39:52 INFO - ++DOMWINDOW == 1 (0x7fb2c14ab800) [pid = 2708] [serial = 1] [outer = (nil)] 11:39:52 INFO - [2708] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:39:52 INFO - ++DOMWINDOW == 2 (0x7fb2c0669800) [pid = 2708] [serial = 2] [outer = 0x7fb2c14ab800] 11:39:53 INFO - ++DOCSHELL 0x7fb2bbb5f800 == 2 [pid = 2708] [id = 2] 11:39:53 INFO - ++DOMWINDOW == 3 (0x7fb2bba0c800) [pid = 2708] [serial = 3] [outer = (nil)] 11:39:53 INFO - ++DOMWINDOW == 4 (0x7fb2bba0d400) [pid = 2708] [serial = 4] [outer = 0x7fb2bba0c800] 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnptestjava.so returned 7fb2bbac61f0 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnpsecondtest.so returned 7fb2bbac65e0 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnptest.so returned 7fb2bbac6910 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnpctrltest.so returned 7fb2bbac6a00 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnpswftest.so returned 7fb2bbac6d30 11:39:53 INFO - LoadPlugin() /tmp/tmpobpjIy.mozrunner/plugins/libnpthirdtest.so returned 7fb2badff040 11:39:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7fb2badff3a0 11:39:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7fb2badf95b0 11:39:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7fb2bbaf0700 11:39:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7fb2bbaf0a00 11:39:53 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7fb2bbaf0d30 11:39:53 INFO - ++DOMWINDOW == 5 (0x7fb2bad83800) [pid = 2708] [serial = 5] [outer = 0x7fb2c14ab800] 11:39:54 INFO - [2708] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:39:55 INFO - ++DOCSHELL 0x7fb2b0a16000 == 3 [pid = 2708] [id = 3] 11:39:55 INFO - ++DOMWINDOW == 6 (0x7fb2b0b9e000) [pid = 2708] [serial = 6] [outer = (nil)] 11:39:55 INFO - ++DOCSHELL 0x7fb2b0a21800 == 4 [pid = 2708] [id = 4] 11:39:55 INFO - ++DOMWINDOW == 7 (0x7fb2b0b9e800) [pid = 2708] [serial = 7] [outer = (nil)] 11:39:56 INFO - [2708] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:39:56 INFO - ++DOCSHELL 0x7fb2aeedc800 == 5 [pid = 2708] [id = 5] 11:39:56 INFO - ++DOMWINDOW == 8 (0x7fb2aee9cc00) [pid = 2708] [serial = 8] [outer = (nil)] 11:39:56 INFO - [2708] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:39:57 INFO - ++DOMWINDOW == 9 (0x7fb2aec06800) [pid = 2708] [serial = 9] [outer = 0x7fb2aee9cc00] 11:39:57 INFO - ++DOMWINDOW == 10 (0x7fb2ae70e800) [pid = 2708] [serial = 10] [outer = 0x7fb2b0b9e000] 11:39:57 INFO - ++DOMWINDOW == 11 (0x7fb2ae70f000) [pid = 2708] [serial = 11] [outer = 0x7fb2b0b9e800] 11:39:57 INFO - ++DOMWINDOW == 12 (0x7fb2ae710c00) [pid = 2708] [serial = 12] [outer = 0x7fb2aee9cc00] 11:39:59 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpobpjIy.mozrunner/runtests_leaks_tab_pid2764.log 11:40:00 INFO - [Child 2764] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:40:01 INFO - ++DOCSHELL 0x7f30d422e800 == 1 [pid = 2764] [id = 1] 11:40:01 INFO - ++DOMWINDOW == 1 (0x7f30d427b000) [pid = 2764] [serial = 1] [outer = (nil)] 11:40:01 INFO - ++DOMWINDOW == 2 (0x7f30d3417000) [pid = 2764] [serial = 2] [outer = 0x7f30d427b000] 11:40:01 INFO - [Parent 2708] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:40:02 INFO - [Parent 2708] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:40:02 INFO - ++DOMWINDOW == 3 (0x7f30d31d6400) [pid = 2764] [serial = 3] [outer = 0x7f30d427b000] 11:40:03 INFO - ++DOCSHELL 0x7fb2aeedf000 == 6 [pid = 2708] [id = 6] 11:40:03 INFO - ++DOMWINDOW == 13 (0x7fb2affb3400) [pid = 2708] [serial = 13] [outer = (nil)] 11:40:03 INFO - ++DOMWINDOW == 14 (0x7fb2b0ee9400) [pid = 2708] [serial = 14] [outer = 0x7fb2affb3400] 11:40:04 INFO - ++DOMWINDOW == 15 (0x7fb2aa28cc00) [pid = 2708] [serial = 15] [outer = 0x7fb2affb3400] 11:40:04 INFO - ++DOCSHELL 0x7fb2afa1f800 == 7 [pid = 2708] [id = 7] 11:40:04 INFO - ++DOMWINDOW == 16 (0x7fb2ae3d5c00) [pid = 2708] [serial = 16] [outer = (nil)] 11:40:04 INFO - ++DOMWINDOW == 17 (0x7fb2bad86800) [pid = 2708] [serial = 17] [outer = 0x7fb2ae3d5c00] 11:40:04 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:40:04 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:40:04 INFO - ++DOCSHELL 0x7f30d26a1800 == 2 [pid = 2764] [id = 2] 11:40:04 INFO - ++DOMWINDOW == 4 (0x7f30d2691800) [pid = 2764] [serial = 4] [outer = (nil)] 11:40:04 INFO - ++DOMWINDOW == 5 (0x7f30d31d4800) [pid = 2764] [serial = 5] [outer = 0x7f30d2691800] 11:40:04 INFO - 413 INFO TEST-START | layout/forms/test/test_bug1111995.html 11:40:04 INFO - [Child 2764] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:40:04 INFO - ++DOMWINDOW == 6 (0x7f30d1cec400) [pid = 2764] [serial = 6] [outer = 0x7f30d2691800] 11:40:05 INFO - [Parent 2708] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:40:06 INFO - ++DOMWINDOW == 7 (0x7f30d1b95800) [pid = 2764] [serial = 7] [outer = 0x7f30d2691800] 11:40:07 INFO - --DOCSHELL 0x7fb2aeedc800 == 6 [pid = 2708] [id = 5] 11:40:07 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:40:07 INFO - MEMORY STAT | vsize 509MB | residentFast 88MB | heapAllocated 19MB 11:40:07 INFO - 414 INFO TEST-OK | layout/forms/test/test_bug1111995.html | took 2993ms 11:40:08 INFO - ++DOMWINDOW == 8 (0x7f30d19bd800) [pid = 2764] [serial = 8] [outer = 0x7f30d2691800] 11:40:08 INFO - 415 INFO TEST-START | layout/forms/test/test_bug231389.html 11:40:08 INFO - ++DOMWINDOW == 9 (0x7f30d19bdc00) [pid = 2764] [serial = 9] [outer = 0x7f30d2691800] 11:40:08 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:40:08 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:40:08 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:40:08 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:40:08 INFO - MEMORY STAT | vsize 516MB | residentFast 92MB | heapAllocated 20MB 11:40:08 INFO - 416 INFO TEST-OK | layout/forms/test/test_bug231389.html | took 544ms 11:40:08 INFO - ++DOMWINDOW == 10 (0x7f30d1650000) [pid = 2764] [serial = 10] [outer = 0x7f30d2691800] 11:40:08 INFO - 417 INFO TEST-START | layout/forms/test/test_bug287446.html 11:40:08 INFO - ++DOMWINDOW == 11 (0x7f30d164cc00) [pid = 2764] [serial = 11] [outer = 0x7f30d2691800] 11:40:09 INFO - ++DOCSHELL 0x7f30d18cf800 == 3 [pid = 2764] [id = 3] 11:40:09 INFO - ++DOMWINDOW == 12 (0x7f30d1659800) [pid = 2764] [serial = 12] [outer = (nil)] 11:40:09 INFO - ++DOMWINDOW == 13 (0x7f30d165b800) [pid = 2764] [serial = 13] [outer = 0x7f30d1659800] 11:40:09 INFO - ++DOMWINDOW == 14 (0x7f30d1005c00) [pid = 2764] [serial = 14] [outer = 0x7f30d1659800] 11:40:09 INFO - [Child 2764] WARNING: '!sPresContext', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/IMEStateManager.cpp, line 773 11:40:09 INFO - [Child 2764] WARNING: '!sPresContext', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/IMEStateManager.cpp, line 773 11:40:09 INFO - [Child 2764] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80530012: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/forms/nsTextControlFrame.cpp, line 755 11:40:09 INFO - MEMORY STAT | vsize 518MB | residentFast 96MB | heapAllocated 21MB 11:40:09 INFO - 418 INFO TEST-OK | layout/forms/test/test_bug287446.html | took 906ms 11:40:09 INFO - ++DOMWINDOW == 15 (0x7f30d1656800) [pid = 2764] [serial = 15] [outer = 0x7f30d2691800] 11:40:10 INFO - 419 INFO TEST-START | layout/forms/test/test_bug346043.html 11:40:10 INFO - ++DOMWINDOW == 16 (0x7f30d0e3a000) [pid = 2764] [serial = 16] [outer = 0x7f30d2691800] 11:40:10 INFO - JavaScript error: resource://gre/modules/SelectParentHelper.jsm, line 26: TypeError: menulist.selectedItem is null 11:40:10 INFO - JavaScript error: resource://gre/modules/SelectParentHelper.jsm, line 26: TypeError: menulist.selectedItem is null 11:40:10 INFO - MEMORY STAT | vsize 521MB | residentFast 98MB | heapAllocated 22MB 11:40:10 INFO - 420 INFO TEST-OK | layout/forms/test/test_bug346043.html | took 754ms 11:40:10 INFO - ++DOMWINDOW == 17 (0x7f30d0e45400) [pid = 2764] [serial = 17] [outer = 0x7f30d2691800] 11:40:10 INFO - 421 INFO TEST-START | layout/forms/test/test_bug353539.html 11:40:11 INFO - ++DOMWINDOW == 18 (0x7f30d0e45800) [pid = 2764] [serial = 18] [outer = 0x7f30d2691800] 11:40:11 INFO - MEMORY STAT | vsize 521MB | residentFast 100MB | heapAllocated 23MB 11:40:11 INFO - 422 INFO TEST-OK | layout/forms/test/test_bug353539.html | took 494ms 11:40:11 INFO - ++DOMWINDOW == 19 (0x7f30d0d9f000) [pid = 2764] [serial = 19] [outer = 0x7f30d2691800] 11:40:11 INFO - 423 INFO TEST-START | layout/forms/test/test_bug365410.html 11:40:11 INFO - ++DOMWINDOW == 20 (0x7f30d0d93400) [pid = 2764] [serial = 20] [outer = 0x7f30d2691800] 11:40:12 INFO - MEMORY STAT | vsize 523MB | residentFast 102MB | heapAllocated 23MB 11:40:12 INFO - 424 INFO TEST-OK | layout/forms/test/test_bug365410.html | took 1208ms 11:40:12 INFO - ++DOMWINDOW == 21 (0x7f30d0e43c00) [pid = 2764] [serial = 21] [outer = 0x7f30d2691800] 11:40:13 INFO - 425 INFO TEST-START | layout/forms/test/test_bug378670.html 11:40:13 INFO - ++DOMWINDOW == 22 (0x7f30d0dbdc00) [pid = 2764] [serial = 22] [outer = 0x7f30d2691800] 11:40:13 INFO - --DOCSHELL 0x7f30d18cf800 == 2 [pid = 2764] [id = 3] 11:40:14 INFO - MEMORY STAT | vsize 524MB | residentFast 103MB | heapAllocated 20MB 11:40:14 INFO - 426 INFO TEST-OK | layout/forms/test/test_bug378670.html | took 1001ms 11:40:14 INFO - ++DOMWINDOW == 23 (0x7f30d1014800) [pid = 2764] [serial = 23] [outer = 0x7f30d2691800] 11:40:14 INFO - 427 INFO TEST-START | layout/forms/test/test_bug402198.html 11:40:14 INFO - ++DOMWINDOW == 24 (0x7f30d0e3a800) [pid = 2764] [serial = 24] [outer = 0x7f30d2691800] 11:40:15 INFO - MEMORY STAT | vsize 525MB | residentFast 104MB | heapAllocated 21MB 11:40:15 INFO - 428 INFO TEST-OK | layout/forms/test/test_bug402198.html | took 1313ms 11:40:15 INFO - ++DOMWINDOW == 25 (0x7f30d19c2c00) [pid = 2764] [serial = 25] [outer = 0x7f30d2691800] 11:40:15 INFO - 429 INFO TEST-START | layout/forms/test/test_bug411236.html 11:40:15 INFO - ++DOMWINDOW == 26 (0x7f30d165bc00) [pid = 2764] [serial = 26] [outer = 0x7f30d2691800] 11:40:16 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:40:16 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:40:16 INFO - [Child 2764] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:40:16 INFO - MEMORY STAT | vsize 525MB | residentFast 104MB | heapAllocated 22MB 11:40:17 INFO - 430 INFO TEST-OK | layout/forms/test/test_bug411236.html | took 1217ms 11:40:17 INFO - ++DOMWINDOW == 27 (0x7f30d1ceb000) [pid = 2764] [serial = 27] [outer = 0x7f30d2691800] 11:40:17 INFO - 431 INFO TEST-START | layout/forms/test/test_bug446663.html 11:40:17 INFO - ++DOMWINDOW == 28 (0x7f30d1b8e800) [pid = 2764] [serial = 28] [outer = 0x7f30d2691800] 11:40:17 INFO - MEMORY STAT | vsize 526MB | residentFast 105MB | heapAllocated 22MB 11:40:17 INFO - 432 INFO TEST-OK | layout/forms/test/test_bug446663.html | took 652ms 11:40:17 INFO - ++DOMWINDOW == 29 (0x7f30d1b90400) [pid = 2764] [serial = 29] [outer = 0x7f30d2691800] 11:40:18 INFO - 433 INFO TEST-START | layout/forms/test/test_bug476308.html 11:40:18 INFO - ++DOMWINDOW == 30 (0x7f30d0e46800) [pid = 2764] [serial = 30] [outer = 0x7f30d2691800] 11:40:18 INFO - MEMORY STAT | vsize 526MB | residentFast 105MB | heapAllocated 23MB 11:40:18 INFO - 434 INFO TEST-OK | layout/forms/test/test_bug476308.html | took 357ms 11:40:18 INFO - ++DOMWINDOW == 31 (0x7f30d3150400) [pid = 2764] [serial = 31] [outer = 0x7f30d2691800] 11:40:18 INFO - 435 INFO TEST-START | layout/forms/test/test_bug477531.html 11:40:18 INFO - ++DOMWINDOW == 32 (0x7f30d3154c00) [pid = 2764] [serial = 32] [outer = 0x7f30d2691800] 11:40:18 INFO - MEMORY STAT | vsize 528MB | residentFast 106MB | heapAllocated 24MB 11:40:18 INFO - 436 INFO TEST-OK | layout/forms/test/test_bug477531.html | took 375ms 11:40:18 INFO - ++DOMWINDOW == 33 (0x7f30d31d1800) [pid = 2764] [serial = 33] [outer = 0x7f30d2691800] 11:40:18 INFO - 437 INFO TEST-START | layout/forms/test/test_bug477700.html 11:40:19 INFO - ++DOMWINDOW == 34 (0x7f30d337ac00) [pid = 2764] [serial = 34] [outer = 0x7f30d2691800] 11:40:19 INFO - ++DOCSHELL 0x7f30d0dd8800 == 3 [pid = 2764] [id = 4] 11:40:19 INFO - ++DOMWINDOW == 35 (0x7f30d6abe800) [pid = 2764] [serial = 35] [outer = (nil)] 11:40:19 INFO - ++DOMWINDOW == 36 (0x7f30d6a69400) [pid = 2764] [serial = 36] [outer = 0x7f30d6abe800] 11:40:19 INFO - --DOMWINDOW == 16 (0x7fb2aee9cc00) [pid = 2708] [serial = 8] [outer = (nil)] [url = about:blank] 11:40:19 INFO - --DOMWINDOW == 15 (0x7fb2ae710c00) [pid = 2708] [serial = 12] [outer = (nil)] [url = about:blank] 11:40:19 INFO - --DOMWINDOW == 14 (0x7fb2aec06800) [pid = 2708] [serial = 9] [outer = (nil)] [url = about:blank] 11:40:19 INFO - --DOMWINDOW == 13 (0x7fb2c0669800) [pid = 2708] [serial = 2] [outer = (nil)] [url = about:blank] 11:40:19 INFO - --DOMWINDOW == 12 (0x7fb2b0ee9400) [pid = 2708] [serial = 14] [outer = (nil)] [url = about:blank] 11:40:19 INFO - MEMORY STAT | vsize 528MB | residentFast 107MB | heapAllocated 24MB 11:40:19 INFO - 438 INFO TEST-OK | layout/forms/test/test_bug477700.html | took 761ms 11:40:19 INFO - ++DOMWINDOW == 37 (0x7f30d6ae4c00) [pid = 2764] [serial = 37] [outer = 0x7f30d2691800] 11:40:19 INFO - 439 INFO TEST-START | layout/forms/test/test_bug478219.xhtml 11:40:20 INFO - ++DOMWINDOW == 38 (0x7f30d0e47400) [pid = 2764] [serial = 38] [outer = 0x7f30d2691800] 11:40:20 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:40:20 INFO - [Child 2764] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:40:20 INFO - [Child 2764] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:40:20 INFO - ++DOCSHELL 0x7f30d9f8e800 == 4 [pid = 2764] [id = 5] 11:40:20 INFO - ++DOMWINDOW == 39 (0x7f30d0423c00) [pid = 2764] [serial = 39] [outer = (nil)] 11:40:20 INFO - ++DOCSHELL 0x7fb2ada9b000 == 7 [pid = 2708] [id = 8] 11:40:20 INFO - ++DOMWINDOW == 13 (0x7fb2bc165400) [pid = 2708] [serial = 18] [outer = (nil)] 11:40:20 INFO - ++DOMWINDOW == 14 (0x7fb2bcb55000) [pid = 2708] [serial = 19] [outer = 0x7fb2bc165400] 11:40:20 INFO - ++DOCSHELL 0x7fb2aff38000 == 8 [pid = 2708] [id = 9] 11:40:20 INFO - ++DOMWINDOW == 15 (0x7fb2c257f400) [pid = 2708] [serial = 20] [outer = (nil)] 11:40:20 INFO - ++DOCSHELL 0x7fb2aff38800 == 9 [pid = 2708] [id = 10] 11:40:20 INFO - ++DOMWINDOW == 16 (0x7fb2c2580400) [pid = 2708] [serial = 21] [outer = (nil)] 11:40:20 INFO - ++DOCSHELL 0x7fb2b0a1c000 == 10 [pid = 2708] [id = 11] 11:40:20 INFO - ++DOMWINDOW == 17 (0x7fb2c3f0b400) [pid = 2708] [serial = 22] [outer = (nil)] 11:40:20 INFO - ++DOMWINDOW == 18 (0x7fb2c64dc000) [pid = 2708] [serial = 23] [outer = 0x7fb2c3f0b400] 11:40:20 INFO - ++DOMWINDOW == 19 (0x7fb2c64e0400) [pid = 2708] [serial = 24] [outer = 0x7fb2c257f400] 11:40:20 INFO - ++DOMWINDOW == 20 (0x7fb2c64e1400) [pid = 2708] [serial = 25] [outer = 0x7fb2c2580400] 11:40:20 INFO - ++DOMWINDOW == 21 (0x7fb2c64e3c00) [pid = 2708] [serial = 26] [outer = 0x7fb2c3f0b400] 11:40:21 INFO - ++DOMWINDOW == 22 (0x7fb2c6cc6800) [pid = 2708] [serial = 27] [outer = 0x7fb2c3f0b400] 11:40:21 INFO - ++DOMWINDOW == 40 (0x7f30d0427400) [pid = 2764] [serial = 40] [outer = 0x7f30d0423c00] 11:40:21 INFO - ++DOMWINDOW == 41 (0x7f30d337b400) [pid = 2764] [serial = 41] [outer = 0x7f30d0423c00] 11:40:22 INFO - MEMORY STAT | vsize 533MB | residentFast 111MB | heapAllocated 27MB 11:40:22 INFO - 440 INFO TEST-OK | layout/forms/test/test_bug478219.xhtml | took 2852ms 11:40:22 INFO - ++DOMWINDOW == 42 (0x7f30d04e6800) [pid = 2764] [serial = 42] [outer = 0x7f30d2691800] 11:40:22 INFO - 441 INFO TEST-START | layout/forms/test/test_bug534785.html 11:40:23 INFO - --DOMWINDOW == 41 (0x7f30d3417000) [pid = 2764] [serial = 2] [outer = (nil)] [url = about:blank] 11:40:23 INFO - --DOMWINDOW == 40 (0x7f30d165b800) [pid = 2764] [serial = 13] [outer = (nil)] [url = about:blank] 11:40:23 INFO - --DOMWINDOW == 39 (0x7f30d31d4800) [pid = 2764] [serial = 5] [outer = (nil)] [url = about:blank] 11:40:23 INFO - --DOMWINDOW == 38 (0x7f30d1cec400) [pid = 2764] [serial = 6] [outer = (nil)] [url = about:blank] 11:40:23 INFO - --DOMWINDOW == 37 (0x7f30d1659800) [pid = 2764] [serial = 12] [outer = (nil)] [url = http://example.com/tests/layout/forms/test/bug287446_subframe.html] 11:40:23 INFO - ++DOMWINDOW == 38 (0x7f30d04e0000) [pid = 2764] [serial = 43] [outer = 0x7f30d2691800] 11:40:23 INFO - MEMORY STAT | vsize 535MB | residentFast 112MB | heapAllocated 27MB 11:40:23 INFO - 442 INFO TEST-OK | layout/forms/test/test_bug534785.html | took 714ms 11:40:23 INFO - ++DOMWINDOW == 39 (0x7f30d04e4800) [pid = 2764] [serial = 44] [outer = 0x7f30d2691800] 11:40:23 INFO - 443 INFO TEST-START | layout/forms/test/test_bug542914.html 11:40:24 INFO - ++DOMWINDOW == 40 (0x7f30d04e4c00) [pid = 2764] [serial = 45] [outer = 0x7f30d2691800] 11:40:24 INFO - MEMORY STAT | vsize 536MB | residentFast 114MB | heapAllocated 28MB 11:40:24 INFO - 444 INFO TEST-OK | layout/forms/test/test_bug542914.html | took 1126ms 11:40:25 INFO - ++DOMWINDOW == 41 (0x7f30d017e400) [pid = 2764] [serial = 46] [outer = 0x7f30d2691800] 11:40:25 INFO - 445 INFO TEST-START | layout/forms/test/test_bug549170.html 11:40:25 INFO - ++DOMWINDOW == 42 (0x7f30d017e800) [pid = 2764] [serial = 47] [outer = 0x7f30d2691800] 11:40:27 INFO - MEMORY STAT | vsize 538MB | residentFast 116MB | heapAllocated 29MB 11:40:27 INFO - --DOCSHELL 0x7fb2aff38000 == 9 [pid = 2708] [id = 9] 11:40:27 INFO - --DOCSHELL 0x7fb2aff38800 == 8 [pid = 2708] [id = 10] 11:40:27 INFO - --DOCSHELL 0x7fb2ada9b000 == 7 [pid = 2708] [id = 8] 11:40:27 INFO - --DOCSHELL 0x7fb2b0a1c000 == 6 [pid = 2708] [id = 11] 11:40:27 INFO - --DOMWINDOW == 21 (0x7fb2c64e0400) [pid = 2708] [serial = 24] [outer = 0x7fb2c257f400] [url = about:blank] 11:40:27 INFO - --DOMWINDOW == 20 (0x7fb2c257f400) [pid = 2708] [serial = 20] [outer = (nil)] [url = about:blank] 11:40:27 INFO - --DOMWINDOW == 19 (0x7fb2c64e1400) [pid = 2708] [serial = 25] [outer = 0x7fb2c2580400] [url = about:blank] 11:40:27 INFO - ]: --DOMWINDOW == 18 (0x7fb2c2580400) [pid = 2708] [serial = 21] [outer = (nil)] [url = about:blank] 11:40:27 INFO - 446 INFO TEST-OK | layout/forms/test/test_bug549170.html | took 2139ms 11:40:27 INFO - ++DOMWINDOW == 43 (0x7f30cff4d000) [pid = 2764] [serial = 48] [outer = 0x7f30d2691800] 11:40:27 INFO - 447 INFO TEST-START | layout/forms/test/test_bug562447.html 11:40:27 INFO - ++DOMWINDOW == 44 (0x7f30cff56000) [pid = 2764] [serial = 49] [outer = 0x7f30d2691800] 11:40:28 INFO - MEMORY STAT | vsize 539MB | residentFast 117MB | heapAllocated 28MB 11:40:28 INFO - 448 INFO TEST-OK | layout/forms/test/test_bug562447.html | took 643ms 11:40:28 INFO - ++DOMWINDOW == 45 (0x7f30d017f800) [pid = 2764] [serial = 50] [outer = 0x7f30d2691800] 11:40:28 INFO - 449 INFO TEST-START | layout/forms/test/test_bug563642.html 11:40:28 INFO - ++DOMWINDOW == 46 (0x7f30cff59c00) [pid = 2764] [serial = 51] [outer = 0x7f30d2691800] 11:40:29 INFO - MEMORY STAT | vsize 540MB | residentFast 118MB | heapAllocated 27MB 11:40:29 INFO - 450 INFO TEST-OK | layout/forms/test/test_bug563642.html | took 1343ms 11:40:30 INFO - ++DOMWINDOW == 47 (0x7f30d164c800) [pid = 2764] [serial = 52] [outer = 0x7f30d2691800] 11:40:30 INFO - 451 INFO TEST-START | layout/forms/test/test_bug564115.html 11:40:30 INFO - ++DOMWINDOW == 48 (0x7f30cff4f400) [pid = 2764] [serial = 53] [outer = 0x7f30d2691800] 11:40:30 INFO - --DOMWINDOW == 17 (0x7fb2c6cc6800) [pid = 2708] [serial = 27] [outer = (nil)] [url = about:blank] 11:40:30 INFO - --DOMWINDOW == 16 (0x7fb2c64e3c00) [pid = 2708] [serial = 26] [outer = (nil)] [url = about:blank] 11:40:30 INFO - --DOMWINDOW == 15 (0x7fb2c64dc000) [pid = 2708] [serial = 23] [outer = (nil)] [url = about:blank] 11:40:30 INFO - --DOMWINDOW == 14 (0x7fb2bc165400) [pid = 2708] [serial = 18] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:40:30 INFO - --DOMWINDOW == 13 (0x7fb2c3f0b400) [pid = 2708] [serial = 22] [outer = (nil)] [url = about:blank] 11:40:30 INFO - --DOCSHELL 0x7f30d0dd8800 == 3 [pid = 2764] [id = 4] 11:40:30 INFO - --DOCSHELL 0x7f30d9f8e800 == 2 [pid = 2764] [id = 5] 11:40:30 INFO - --DOMWINDOW == 47 (0x7f30d1005c00) [pid = 2764] [serial = 14] [outer = (nil)] [url = http://example.com/tests/layout/forms/test/bug287446_subframe.html] 11:40:30 INFO - ++DOCSHELL 0x7f30cff19000 == 3 [pid = 2764] [id = 6] 11:40:30 INFO - ++DOMWINDOW == 48 (0x7f30cff57400) [pid = 2764] [serial = 54] [outer = (nil)] 11:40:30 INFO - ++DOCSHELL 0x7fb2ae7d5000 == 7 [pid = 2708] [id = 12] 11:40:30 INFO - ++DOMWINDOW == 14 (0x7fb2b1283c00) [pid = 2708] [serial = 28] [outer = (nil)] 11:40:30 INFO - ++DOMWINDOW == 15 (0x7fb2b1299400) [pid = 2708] [serial = 29] [outer = 0x7fb2b1283c00] 11:40:31 INFO - ++DOCSHELL 0x7fb2aeef3000 == 8 [pid = 2708] [id = 13] 11:40:31 INFO - ++DOMWINDOW == 16 (0x7fb2bbf0f000) [pid = 2708] [serial = 30] [outer = (nil)] 11:40:31 INFO - ++DOCSHELL 0x7fb2afa1c000 == 9 [pid = 2708] [id = 14] 11:40:31 INFO - ++DOMWINDOW == 17 (0x7fb2bbf10c00) [pid = 2708] [serial = 31] [outer = (nil)] 11:40:31 INFO - ++DOCSHELL 0x7fb2b19c3800 == 10 [pid = 2708] [id = 15] 11:40:31 INFO - ++DOMWINDOW == 18 (0x7fb2c6c25c00) [pid = 2708] [serial = 32] [outer = (nil)] 11:40:31 INFO - ++DOMWINDOW == 19 (0x7fb2c6cccc00) [pid = 2708] [serial = 33] [outer = 0x7fb2c6c25c00] 11:40:31 INFO - ++DOMWINDOW == 20 (0x7fb2c6cd1800) [pid = 2708] [serial = 34] [outer = 0x7fb2bbf0f000] 11:40:31 INFO - ++DOMWINDOW == 21 (0x7fb2c766bc00) [pid = 2708] [serial = 35] [outer = 0x7fb2bbf10c00] 11:40:31 INFO - ++DOMWINDOW == 22 (0x7fb2c7845800) [pid = 2708] [serial = 36] [outer = 0x7fb2c6c25c00] 11:40:31 INFO - ++DOMWINDOW == 23 (0x7fb2c7a0dc00) [pid = 2708] [serial = 37] [outer = 0x7fb2c6c25c00] 11:40:32 INFO - ++DOMWINDOW == 49 (0x7f30d0174c00) [pid = 2764] [serial = 55] [outer = 0x7f30cff57400] 11:40:32 INFO - ++DOMWINDOW == 50 (0x7f30d017b000) [pid = 2764] [serial = 56] [outer = 0x7f30cff57400] 11:40:32 INFO - [Child 2764] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:40:33 INFO - [Child 2764] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:40:33 INFO - [Child 2764] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:40:33 INFO - MEMORY STAT | vsize 539MB | residentFast 114MB | heapAllocated 24MB 11:40:34 INFO - 452 INFO TEST-OK | layout/forms/test/test_bug564115.html | took 4095ms 11:40:34 INFO - ++DOMWINDOW == 51 (0x7f30d0426400) [pid = 2764] [serial = 57] [outer = 0x7f30d2691800] 11:40:34 INFO - 453 INFO TEST-START | layout/forms/test/test_bug571352.html 11:40:34 INFO - ++DOMWINDOW == 52 (0x7f30cff50c00) [pid = 2764] [serial = 58] [outer = 0x7f30d2691800] 11:40:35 INFO - MEMORY STAT | vsize 540MB | residentFast 113MB | heapAllocated 25MB 11:40:35 INFO - 454 INFO TEST-OK | layout/forms/test/test_bug571352.html | took 689ms 11:40:35 INFO - ++DOMWINDOW == 53 (0x7f30d0dbc000) [pid = 2764] [serial = 59] [outer = 0x7f30d2691800] 11:40:35 INFO - 455 INFO TEST-START | layout/forms/test/test_bug572406.html 11:40:35 INFO - ++DOMWINDOW == 54 (0x7f30cff55c00) [pid = 2764] [serial = 60] [outer = 0x7f30d2691800] 11:40:35 INFO - MEMORY STAT | vsize 541MB | residentFast 115MB | heapAllocated 27MB 11:40:35 INFO - 456 INFO TEST-OK | layout/forms/test/test_bug572406.html | took 528ms 11:40:35 INFO - ++DOMWINDOW == 55 (0x7f30d0e47000) [pid = 2764] [serial = 61] [outer = 0x7f30d2691800] 11:40:36 INFO - 457 INFO TEST-START | layout/forms/test/test_bug572649.html 11:40:36 INFO - --DOMWINDOW == 54 (0x7f30d0e43c00) [pid = 2764] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 53 (0x7f30d0d9f000) [pid = 2764] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 52 (0x7f30d0e45800) [pid = 2764] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug353539.html] 11:40:36 INFO - --DOMWINDOW == 51 (0x7f30d0e45400) [pid = 2764] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 50 (0x7f30d1656800) [pid = 2764] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 49 (0x7f30d337b400) [pid = 2764] [serial = 41] [outer = (nil)] [url = about:blank] 11:40:36 INFO - --DOMWINDOW == 48 (0x7f30d0427400) [pid = 2764] [serial = 40] [outer = (nil)] [url = about:blank] 11:40:36 INFO - --DOMWINDOW == 47 (0x7f30d1650000) [pid = 2764] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 46 (0x7f30d19bdc00) [pid = 2764] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug231389.html] 11:40:36 INFO - --DOMWINDOW == 45 (0x7f30d19bd800) [pid = 2764] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 44 (0x7f30d017e400) [pid = 2764] [serial = 46] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 43 (0x7f30d04e4800) [pid = 2764] [serial = 44] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 42 (0x7f30d04e6800) [pid = 2764] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 41 (0x7f30d0e47400) [pid = 2764] [serial = 38] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug478219.xhtml] 11:40:36 INFO - --DOMWINDOW == 40 (0x7f30d6ae4c00) [pid = 2764] [serial = 37] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 39 (0x7f30d337ac00) [pid = 2764] [serial = 34] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug477700.html] 11:40:36 INFO - --DOMWINDOW == 38 (0x7f30d31d1800) [pid = 2764] [serial = 33] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 37 (0x7f30d3154c00) [pid = 2764] [serial = 32] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug477531.html] 11:40:36 INFO - --DOMWINDOW == 36 (0x7f30d3150400) [pid = 2764] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 35 (0x7f30d0e46800) [pid = 2764] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug476308.html] 11:40:36 INFO - --DOMWINDOW == 34 (0x7f30d1b90400) [pid = 2764] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 33 (0x7f30d1ceb000) [pid = 2764] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 32 (0x7f30d19c2c00) [pid = 2764] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 31 (0x7f30d1014800) [pid = 2764] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 30 (0x7f30d164cc00) [pid = 2764] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug287446.html] 11:40:36 INFO - --DOMWINDOW == 29 (0x7f30d017f800) [pid = 2764] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 28 (0x7f30cff56000) [pid = 2764] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug562447.html] 11:40:36 INFO - --DOMWINDOW == 27 (0x7f30cff4d000) [pid = 2764] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:36 INFO - --DOMWINDOW == 26 (0x7f30d0423c00) [pid = 2764] [serial = 39] [outer = (nil)] [url = about:blank] 11:40:36 INFO - --DOMWINDOW == 25 (0x7f30d6abe800) [pid = 2764] [serial = 35] [outer = (nil)] [url = http://example.com/tests/layout/forms/test/bug477700_subframe.html] 11:40:36 INFO - --DOMWINDOW == 24 (0x7f30d0e3a000) [pid = 2764] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug346043.html] 11:40:36 INFO - ++DOMWINDOW == 25 (0x7f30cff56000) [pid = 2764] [serial = 62] [outer = 0x7f30d2691800] 11:40:36 INFO - MEMORY STAT | vsize 541MB | residentFast 115MB | heapAllocated 25MB 11:40:36 INFO - 458 INFO TEST-OK | layout/forms/test/test_bug572649.html | took 594ms 11:40:36 INFO - ++DOMWINDOW == 26 (0x7f30d1008000) [pid = 2764] [serial = 63] [outer = 0x7f30d2691800] 11:40:36 INFO - 459 INFO TEST-START | layout/forms/test/test_bug595310.html 11:40:37 INFO - ++DOMWINDOW == 27 (0x7f30d0e46800) [pid = 2764] [serial = 64] [outer = 0x7f30d2691800] 11:40:37 INFO - MEMORY STAT | vsize 543MB | residentFast 116MB | heapAllocated 26MB 11:40:37 INFO - 460 INFO TEST-OK | layout/forms/test/test_bug595310.html | took 598ms 11:40:37 INFO - ++DOMWINDOW == 28 (0x7f30d0e45400) [pid = 2764] [serial = 65] [outer = 0x7f30d2691800] 11:40:37 INFO - 461 INFO TEST-START | layout/forms/test/test_bug620936.html 11:40:37 INFO - ++DOMWINDOW == 29 (0x7f30d0e47400) [pid = 2764] [serial = 66] [outer = 0x7f30d2691800] 11:40:38 INFO - MEMORY STAT | vsize 543MB | residentFast 116MB | heapAllocated 27MB 11:40:38 INFO - 462 INFO TEST-OK | layout/forms/test/test_bug620936.html | took 441ms 11:40:38 INFO - ++DOMWINDOW == 30 (0x7f30d19c1800) [pid = 2764] [serial = 67] [outer = 0x7f30d2691800] 11:40:38 INFO - 463 INFO TEST-START | layout/forms/test/test_bug644542.html 11:40:39 INFO - ++DOMWINDOW == 31 (0x7f30cff56400) [pid = 2764] [serial = 68] [outer = 0x7f30d2691800] 11:40:39 INFO - --DOCSHELL 0x7fb2b19c3800 == 9 [pid = 2708] [id = 15] 11:40:40 INFO - --DOCSHELL 0x7f30cff19000 == 2 [pid = 2764] [id = 6] 11:40:40 INFO - --DOMWINDOW == 30 (0x7f30d164c800) [pid = 2764] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:40 INFO - --DOMWINDOW == 29 (0x7f30d0dbdc00) [pid = 2764] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug378670.html] 11:40:40 INFO - --DOMWINDOW == 28 (0x7f30d165bc00) [pid = 2764] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug411236.html] 11:40:40 INFO - --DOMWINDOW == 27 (0x7f30d6a69400) [pid = 2764] [serial = 36] [outer = (nil)] [url = http://example.com/tests/layout/forms/test/bug477700_subframe.html] 11:40:40 INFO - --DOMWINDOW == 26 (0x7f30d017e800) [pid = 2764] [serial = 47] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug549170.html] 11:40:40 INFO - --DOMWINDOW == 25 (0x7f30d1b95800) [pid = 2764] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug1111995.html] 11:40:41 INFO - --DOMWINDOW == 22 (0x7fb2c6cccc00) [pid = 2708] [serial = 33] [outer = (nil)] [url = about:blank] 11:40:41 INFO - --DOMWINDOW == 21 (0x7fb2c7845800) [pid = 2708] [serial = 36] [outer = (nil)] [url = about:blank] 11:40:41 INFO - --DOMWINDOW == 20 (0x7fb2c7a0dc00) [pid = 2708] [serial = 37] [outer = (nil)] [url = about:blank] 11:40:41 INFO - --DOMWINDOW == 19 (0x7fb2c6c25c00) [pid = 2708] [serial = 32] [outer = (nil)] [url = about:blank] 11:40:42 INFO - MEMORY STAT | vsize 542MB | residentFast 111MB | heapAllocated 20MB 11:40:42 INFO - 464 INFO TEST-OK | layout/forms/test/test_bug644542.html | took 3215ms 11:40:42 INFO - ++DOMWINDOW == 26 (0x7f30d0175c00) [pid = 2764] [serial = 69] [outer = 0x7f30d2691800] 11:40:42 INFO - 465 INFO TEST-START | layout/forms/test/test_bug672810.html 11:40:42 INFO - ++DOMWINDOW == 27 (0x7f30d0176400) [pid = 2764] [serial = 70] [outer = 0x7f30d2691800] 11:40:43 INFO - MEMORY STAT | vsize 542MB | residentFast 113MB | heapAllocated 22MB 11:40:43 INFO - 466 INFO TEST-OK | layout/forms/test/test_bug672810.html | took 805ms 11:40:43 INFO - --DOMWINDOW == 26 (0x7f30cff59c00) [pid = 2764] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug563642.html] 11:40:43 INFO - --DOMWINDOW == 25 (0x7f30d0d93400) [pid = 2764] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug365410.html] 11:40:43 INFO - --DOMWINDOW == 24 (0x7f30d04e4c00) [pid = 2764] [serial = 45] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug542914.html] 11:40:43 INFO - --DOMWINDOW == 23 (0x7f30d1b8e800) [pid = 2764] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug446663.html] 11:40:43 INFO - --DOMWINDOW == 22 (0x7f30d0e3a800) [pid = 2764] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug402198.html] 11:40:43 INFO - --DOMWINDOW == 21 (0x7f30d017b000) [pid = 2764] [serial = 56] [outer = (nil)] [url = about:blank] 11:40:43 INFO - --DOMWINDOW == 20 (0x7f30d0174c00) [pid = 2764] [serial = 55] [outer = (nil)] [url = about:blank] 11:40:43 INFO - --DOMWINDOW == 19 (0x7f30cff4f400) [pid = 2764] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug564115.html] 11:40:43 INFO - --DOMWINDOW == 18 (0x7f30d0e45400) [pid = 2764] [serial = 65] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 17 (0x7f30d0e46800) [pid = 2764] [serial = 64] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug595310.html] 11:40:43 INFO - --DOMWINDOW == 16 (0x7f30d1008000) [pid = 2764] [serial = 63] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 15 (0x7f30cff56000) [pid = 2764] [serial = 62] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug572649.html] 11:40:43 INFO - --DOMWINDOW == 14 (0x7f30d0e47000) [pid = 2764] [serial = 61] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 13 (0x7f30cff55c00) [pid = 2764] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug572406.html] 11:40:43 INFO - --DOMWINDOW == 12 (0x7f30d0dbc000) [pid = 2764] [serial = 59] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 11 (0x7f30d0426400) [pid = 2764] [serial = 57] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 10 (0x7f30d19c1800) [pid = 2764] [serial = 67] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:43 INFO - --DOMWINDOW == 9 (0x7f30d0e47400) [pid = 2764] [serial = 66] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug620936.html] 11:40:43 INFO - --DOMWINDOW == 8 (0x7f30cff57400) [pid = 2764] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/bug564115_window.html] 11:40:43 INFO - ++DOMWINDOW == 9 (0x7f30cff54c00) [pid = 2764] [serial = 71] [outer = 0x7f30d2691800] 11:40:43 INFO - 467 INFO TEST-START | layout/forms/test/test_bug704049.html 11:40:43 INFO - ++DOMWINDOW == 10 (0x7f30cff55c00) [pid = 2764] [serial = 72] [outer = 0x7f30d2691800] 11:40:43 INFO - MEMORY STAT | vsize 542MB | residentFast 111MB | heapAllocated 21MB 11:40:43 INFO - 468 INFO TEST-OK | layout/forms/test/test_bug704049.html | took 408ms 11:40:43 INFO - ++DOMWINDOW == 11 (0x7f30d04e0c00) [pid = 2764] [serial = 73] [outer = 0x7f30d2691800] 11:40:44 INFO - 469 INFO TEST-START | layout/forms/test/test_bug717878_input_scroll.html 11:40:44 INFO - ++DOMWINDOW == 12 (0x7f30d042c000) [pid = 2764] [serial = 74] [outer = 0x7f30d2691800] 11:40:44 INFO - MEMORY STAT | vsize 542MB | residentFast 112MB | heapAllocated 22MB 11:40:44 INFO - 470 INFO TEST-OK | layout/forms/test/test_bug717878_input_scroll.html | took 334ms 11:40:44 INFO - ++DOMWINDOW == 13 (0x7f30d0429800) [pid = 2764] [serial = 75] [outer = 0x7f30d2691800] 11:40:44 INFO - 471 INFO TEST-START | layout/forms/test/test_bug869314.html 11:40:44 INFO - ++DOMWINDOW == 14 (0x7f30d04dec00) [pid = 2764] [serial = 76] [outer = 0x7f30d2691800] 11:40:44 INFO - MEMORY STAT | vsize 542MB | residentFast 112MB | heapAllocated 22MB 11:40:44 INFO - 472 INFO TEST-OK | layout/forms/test/test_bug869314.html | took 296ms 11:40:44 INFO - ++DOMWINDOW == 15 (0x7f30d04e5800) [pid = 2764] [serial = 77] [outer = 0x7f30d2691800] 11:40:45 INFO - 473 INFO TEST-START | layout/forms/test/test_bug935876.html 11:40:45 INFO - ++DOMWINDOW == 16 (0x7f30d04ec000) [pid = 2764] [serial = 78] [outer = 0x7f30d2691800] 11:40:48 INFO - --DOCSHELL 0x7fb2aeef3000 == 8 [pid = 2708] [id = 13] 11:40:48 INFO - --DOMWINDOW == 18 (0x7fb2c6cd1800) [pid = 2708] [serial = 34] [outer = 0x7fb2bbf0f000] [url = about:blank] 11:40:48 INFO - --DOMWINDOW == 17 (0x7fb2c766bc00) [pid = 2708] [serial = 35] [outer = 0x7fb2bbf10c00] [url = about:blank] 11:40:48 INFO - ]: --DOMWINDOW == 16 (0x7fb2bbf0f000) [pid = 2708] [serial = 30] [outer = (nil)] [url = about:blank] 11:40:48 INFO - --DOMWINDOW == 15 (0x7fb2bbf10c00) [pid = 2708] [serial = 31] [outer = (nil)] [url = about:blank] 11:40:49 INFO - MEMORY STAT | vsize 543MB | residentFast 111MB | heapAllocated 26MB 11:40:49 INFO - 474 INFO TEST-OK | layout/forms/test/test_bug935876.html | took 4406ms 11:40:49 INFO - ++DOMWINDOW == 17 (0x7f30cff57800) [pid = 2764] [serial = 79] [outer = 0x7f30d2691800] 11:40:49 INFO - 475 INFO TEST-START | layout/forms/test/test_bug957562.html 11:40:49 INFO - ++DOMWINDOW == 18 (0x7f30cff58000) [pid = 2764] [serial = 80] [outer = 0x7f30d2691800] 11:40:50 INFO - MEMORY STAT | vsize 543MB | residentFast 113MB | heapAllocated 26MB 11:40:50 INFO - 476 INFO TEST-OK | layout/forms/test/test_bug957562.html | took 537ms 11:40:50 INFO - ++DOMWINDOW == 19 (0x7f30cff91400) [pid = 2764] [serial = 81] [outer = 0x7f30d2691800] 11:40:50 INFO - 477 INFO TEST-START | layout/forms/test/test_bug960277.html 11:40:51 INFO - ++DOMWINDOW == 20 (0x7f30cff4c400) [pid = 2764] [serial = 82] [outer = 0x7f30d2691800] 11:40:51 INFO - MEMORY STAT | vsize 541MB | residentFast 108MB | heapAllocated 21MB 11:40:51 INFO - 478 INFO TEST-OK | layout/forms/test/test_bug960277.html | took 685ms 11:40:51 INFO - ++DOMWINDOW == 21 (0x7f30cff8ac00) [pid = 2764] [serial = 83] [outer = 0x7f30d2691800] 11:40:51 INFO - 479 INFO TEST-START | layout/forms/test/test_bug961363.html 11:40:51 INFO - ++DOMWINDOW == 22 (0x7f30cff8b000) [pid = 2764] [serial = 84] [outer = 0x7f30d2691800] 11:40:52 INFO - MEMORY STAT | vsize 542MB | residentFast 108MB | heapAllocated 22MB 11:40:52 INFO - 480 INFO TEST-OK | layout/forms/test/test_bug961363.html | took 1255ms 11:40:52 INFO - ++DOMWINDOW == 23 (0x7f30d04ec400) [pid = 2764] [serial = 85] [outer = 0x7f30d2691800] 11:40:52 INFO - 481 INFO TEST-START | layout/forms/test/test_listcontrol_search.html 11:40:52 INFO - ++DOMWINDOW == 24 (0x7f30d04ec800) [pid = 2764] [serial = 86] [outer = 0x7f30d2691800] 11:40:53 INFO - MEMORY STAT | vsize 542MB | residentFast 109MB | heapAllocated 23MB 11:40:53 INFO - 482 INFO TEST-OK | layout/forms/test/test_listcontrol_search.html | took 384ms 11:40:53 INFO - ++DOMWINDOW == 25 (0x7f30cff8ec00) [pid = 2764] [serial = 87] [outer = 0x7f30d2691800] 11:40:53 INFO - 483 INFO TEST-START | layout/forms/test/test_select_prevent_default.html 11:40:53 INFO - ++DOMWINDOW == 26 (0x7f30cff8d000) [pid = 2764] [serial = 88] [outer = 0x7f30d2691800] 11:40:53 INFO - --DOMWINDOW == 25 (0x7f30cff56400) [pid = 2764] [serial = 68] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug644542.html] 11:40:53 INFO - --DOMWINDOW == 24 (0x7f30cff50c00) [pid = 2764] [serial = 58] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug571352.html] 11:40:53 INFO - --DOMWINDOW == 23 (0x7f30d04e5800) [pid = 2764] [serial = 77] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:53 INFO - --DOMWINDOW == 22 (0x7f30d0429800) [pid = 2764] [serial = 75] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:53 INFO - --DOMWINDOW == 21 (0x7f30d04e0c00) [pid = 2764] [serial = 73] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:53 INFO - --DOMWINDOW == 20 (0x7f30cff55c00) [pid = 2764] [serial = 72] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug704049.html] 11:40:53 INFO - --DOMWINDOW == 19 (0x7f30cff54c00) [pid = 2764] [serial = 71] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:53 INFO - --DOMWINDOW == 18 (0x7f30d0175c00) [pid = 2764] [serial = 69] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:53 INFO - --DOMWINDOW == 17 (0x7f30cff57800) [pid = 2764] [serial = 79] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:40:54 INFO - MEMORY STAT | vsize 542MB | residentFast 111MB | heapAllocated 24MB 11:40:54 INFO - --DOMWINDOW == 16 (0x7f30d04dec00) [pid = 2764] [serial = 76] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug869314.html] 11:40:54 INFO - --DOMWINDOW == 15 (0x7f30d042c000) [pid = 2764] [serial = 74] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug717878_input_scroll.html] 11:40:54 INFO - 484 INFO TEST-OK | layout/forms/test/test_select_prevent_default.html | took 934ms 11:40:54 INFO - ++DOMWINDOW == 16 (0x7f30d1658400) [pid = 2764] [serial = 89] [outer = 0x7f30d2691800] 11:40:54 INFO - 485 INFO TEST-START | layout/forms/test/test_textarea_resize.html 11:40:54 INFO - ++DOMWINDOW == 17 (0x7f30d04dec00) [pid = 2764] [serial = 90] [outer = 0x7f30d2691800] 11:40:57 INFO - MEMORY STAT | vsize 542MB | residentFast 112MB | heapAllocated 26MB 11:40:57 INFO - 486 INFO TEST-OK | layout/forms/test/test_textarea_resize.html | took 2864ms 11:40:57 INFO - ++DOMWINDOW == 18 (0x7f30cff66c00) [pid = 2764] [serial = 91] [outer = 0x7f30d2691800] 11:40:58 INFO - ++DOMWINDOW == 19 (0x7f30cff66400) [pid = 2764] [serial = 92] [outer = 0x7f30d2691800] 11:40:58 INFO - --DOCSHELL 0x7fb2aeedf000 == 7 [pid = 2708] [id = 6] 11:40:58 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:40:59 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:40:59 INFO - --DOCSHELL 0x7fb2c1481000 == 6 [pid = 2708] [id = 1] 11:40:59 INFO - --DOCSHELL 0x7fb2ae7d5000 == 5 [pid = 2708] [id = 12] 11:40:59 INFO - --DOCSHELL 0x7fb2afa1c000 == 4 [pid = 2708] [id = 14] 11:41:00 INFO - --DOCSHELL 0x7fb2afa1f800 == 3 [pid = 2708] [id = 7] 11:41:00 INFO - --DOCSHELL 0x7fb2bbb5f800 == 2 [pid = 2708] [id = 2] 11:41:00 INFO - --DOCSHELL 0x7fb2b0a16000 == 1 [pid = 2708] [id = 3] 11:41:00 INFO - --DOCSHELL 0x7fb2b0a21800 == 0 [pid = 2708] [id = 4] 11:41:00 INFO - --DOMWINDOW == 14 (0x7fb2bcb55000) [pid = 2708] [serial = 19] [outer = (nil)] [url = about:blank] 11:41:00 INFO - --DOCSHELL 0x7f30d26a1800 == 1 [pid = 2764] [id = 2] 11:41:00 INFO - --DOCSHELL 0x7f30d422e800 == 0 [pid = 2764] [id = 1] 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - ###!!! [Child][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:00 INFO - [Child 2764] WARNING: MsgDropped in ContentChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/ContentChild.cpp, line 2221 11:41:00 INFO - --DOMWINDOW == 18 (0x7f30cff58000) [pid = 2764] [serial = 80] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug957562.html] 11:41:00 INFO - [Child 2764] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:41:00 INFO - ]: 11:41:00 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:01 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:01 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:01 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:41:01 INFO - --DOMWINDOW == 17 (0x7f30d04e0000) [pid = 2764] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug534785.html] 11:41:01 INFO - --DOMWINDOW == 16 (0x7f30d0176400) [pid = 2764] [serial = 70] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug672810.html] 11:41:01 INFO - --DOMWINDOW == 15 (0x7f30cff91400) [pid = 2764] [serial = 81] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 14 (0x7f30cff8ac00) [pid = 2764] [serial = 83] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 13 (0x7f30d04ec400) [pid = 2764] [serial = 85] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 12 (0x7f30cff8ec00) [pid = 2764] [serial = 87] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 11 (0x7f30d1658400) [pid = 2764] [serial = 89] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 10 (0x7f30cff66400) [pid = 2764] [serial = 92] [outer = (nil)] [url = about:blank] 11:41:01 INFO - --DOMWINDOW == 9 (0x7f30d04dec00) [pid = 2764] [serial = 90] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_textarea_resize.html] 11:41:01 INFO - --DOMWINDOW == 8 (0x7f30d2691800) [pid = 2764] [serial = 4] [outer = (nil)] [url = about:blank] 11:41:01 INFO - --DOMWINDOW == 7 (0x7f30cff66c00) [pid = 2764] [serial = 91] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:01 INFO - --DOMWINDOW == 6 (0x7f30d31d6400) [pid = 2764] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:41:01 INFO - --DOMWINDOW == 5 (0x7f30d427b000) [pid = 2764] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:41:01 INFO - --DOMWINDOW == 4 (0x7f30d04ec000) [pid = 2764] [serial = 78] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug935876.html] 11:41:01 INFO - --DOMWINDOW == 3 (0x7f30cff4c400) [pid = 2764] [serial = 82] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug960277.html] 11:41:01 INFO - --DOMWINDOW == 2 (0x7f30cff8b000) [pid = 2764] [serial = 84] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_bug961363.html] 11:41:01 INFO - --DOMWINDOW == 1 (0x7f30d04ec800) [pid = 2764] [serial = 86] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_listcontrol_search.html] 11:41:01 INFO - --DOMWINDOW == 0 (0x7f30cff8d000) [pid = 2764] [serial = 88] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/forms/test/test_select_prevent_default.html] 11:41:01 INFO - nsStringStats 11:41:01 INFO - => mAllocCount: 80538 11:41:01 INFO - => mReallocCount: 2622 11:41:01 INFO - => mFreeCount: 80538 11:41:01 INFO - => mShareCount: 86815 11:41:01 INFO - => mAdoptCount: 6912 11:41:01 INFO - => mAdoptFreeCount: 6912 11:41:01 INFO - => Process ID: 2764, Thread ID: 139848188181056 11:41:01 INFO - [Parent 2708] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:41:01 INFO - [Parent 2708] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:41:03 INFO - --DOMWINDOW == 13 (0x7fb2ae70e800) [pid = 2708] [serial = 10] [outer = 0x7fb2b0b9e000] [url = about:blank] 11:41:03 INFO - --DOMWINDOW == 12 (0x7fb2ae70f000) [pid = 2708] [serial = 11] [outer = 0x7fb2b0b9e800] [url = about:blank] 11:41:03 INFO - --DOMWINDOW == 11 (0x7fb2b0b9e000) [pid = 2708] [serial = 6] [outer = (nil)] [url = about:blank] 11:41:03 INFO - --DOMWINDOW == 10 (0x7fb2b0b9e800) [pid = 2708] [serial = 7] [outer = (nil)] [url = about:blank] 11:41:04 INFO - --DOMWINDOW == 9 (0x7fb2bba0d400) [pid = 2708] [serial = 4] [outer = (nil)] [url = about:blank] 11:41:04 INFO - --DOMWINDOW == 8 (0x7fb2b1299400) [pid = 2708] [serial = 29] [outer = (nil)] [url = about:blank] 11:41:04 INFO - --DOMWINDOW == 7 (0x7fb2bba0c800) [pid = 2708] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:41:04 INFO - --DOMWINDOW == 6 (0x7fb2c14ab800) [pid = 2708] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:41:04 INFO - --DOMWINDOW == 5 (0x7fb2b1283c00) [pid = 2708] [serial = 28] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:41:04 INFO - --DOMWINDOW == 4 (0x7fb2affb3400) [pid = 2708] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:41:04 INFO - --DOMWINDOW == 3 (0x7fb2bad86800) [pid = 2708] [serial = 17] [outer = (nil)] [url = about:blank] 11:41:04 INFO - --DOMWINDOW == 2 (0x7fb2ae3d5c00) [pid = 2708] [serial = 16] [outer = (nil)] [url = about:blank] 11:41:04 INFO - --DOMWINDOW == 1 (0x7fb2aa28cc00) [pid = 2708] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:41:04 INFO - --DOMWINDOW == 0 (0x7fb2bad83800) [pid = 2708] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:41:04 INFO - nsStringStats 11:41:04 INFO - => mAllocCount: 143120 11:41:04 INFO - => mReallocCount: 15094 11:41:04 INFO - => mFreeCount: 143120 11:41:04 INFO - => mShareCount: 149417 11:41:04 INFO - => mAdoptCount: 5800 11:41:04 INFO - => mAdoptFreeCount: 5800 11:41:04 INFO - => Process ID: 2708, Thread ID: 140406306588480 11:41:04 INFO - TEST-INFO | Main app process: exit 0 11:41:04 INFO - runtests.py | Application ran for: 0:01:15.943135 11:41:04 INFO - zombiecheck | Reading PID log: /tmp/tmp9JzDtNpidlog 11:41:04 INFO - ==> process 2708 launched child process 2764 11:41:04 INFO - zombiecheck | Checking for orphan process with PID: 2764 11:41:04 INFO - Stopping web server 11:41:04 INFO - Stopping web socket server 11:41:04 INFO - Stopping ssltunnel 11:41:04 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:41:04 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:41:04 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:41:04 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2708 11:41:04 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:41:04 INFO - | | Per-Inst Leaked| Total Rem| 11:41:04 INFO - 0 |TOTAL | 24 0| 4271663 0| 11:41:04 INFO - nsTraceRefcnt::DumpStatistics: 1335 entries 11:41:04 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:41:04 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2764 11:41:04 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:41:04 INFO - | | Per-Inst Leaked| Total Rem| 11:41:04 INFO - 0 |TOTAL | 22 4640| 3311196 33| 11:41:04 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 44 1| 11:41:04 INFO - 54 |CompositorChild | 880 880| 1 1| 11:41:04 INFO - 56 |CondVar | 40 120| 122 3| 11:41:04 INFO - 172 |IPC::Channel | 16 32| 7 2| 11:41:04 INFO - 204 |MessagePump | 16 16| 10 1| 11:41:04 INFO - 209 |Mutex | 32 96| 717 3| 11:41:04 INFO - 222 |PCompositorChild | 776 776| 1 1| 11:41:04 INFO - 229 |PImageBridgeChild | 920 920| 1 1| 11:41:04 INFO - 285 |RefCountedMonitor | 80 160| 6 2| 11:41:04 INFO - 286 |RefCountedTask | 16 64| 12 4| 11:41:04 INFO - 328 |StoreRef | 16 32| 7 2| 11:41:04 INFO - 373 |WaitableEventKernel | 72 72| 13 1| 11:41:04 INFO - 378 |WeakReference | 16 32| 819 2| 11:41:04 INFO - 410 |base::Thread | 48 48| 3 1| 11:41:04 INFO - 435 |ipc::MessageChannel | 512 1024| 6 2| 11:41:04 INFO - 837 |nsTArray_base | 8 40| 885320 5| 11:41:04 INFO - 846 |nsThread | 256 256| 9 1| 11:41:04 INFO - nsTraceRefcnt::DumpStatistics: 929 entries 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:41:04 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:41:04 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:41:04 INFO - runtests.py | Running tests: end. 11:41:04 INFO - 487 INFO TEST-START | Shutdown 11:41:04 INFO - 488 INFO Passed: 1549 11:41:04 INFO - 489 INFO Failed: 0 11:41:04 INFO - 490 INFO Todo: 7 11:41:04 INFO - 491 INFO Slowest: 4406ms - /tests/layout/forms/test/test_bug935876.html 11:41:04 INFO - 492 INFO SimpleTest FINISHED 11:41:04 INFO - 493 INFO TEST-INFO | Ran 1 Loops 11:41:04 INFO - 494 INFO SimpleTest FINISHED 11:41:04 INFO - dir: layout/generic/test 11:41:04 INFO - Setting pipeline to PAUSED ... 11:41:04 INFO - Pipeline is PREROLLING ... 11:41:04 INFO - Pipeline is PREROLLED ... 11:41:04 INFO - Setting pipeline to PLAYING ... 11:41:04 INFO - New clock: GstSystemClock 11:41:04 INFO - Got EOS from element "pipeline0". 11:41:04 INFO - Execution ended after 32759015 ns. 11:41:04 INFO - Setting pipeline to PAUSED ... 11:41:04 INFO - Setting pipeline to READY ... 11:41:04 INFO - Setting pipeline to NULL ... 11:41:04 INFO - Freeing pipeline ... 11:41:05 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:41:05 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpYluOsJ.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:41:05 INFO - runtests.py | Server pid: 2824 11:41:05 INFO - runtests.py | Websocket server pid: 2827 11:41:05 INFO - runtests.py | SSL tunnel pid: 2830 11:41:05 INFO - runtests.py | Running tests: start. 11:41:06 INFO - runtests.py | Application pid: 2852 11:41:06 INFO - TEST-INFO | started process Main app process 11:41:06 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpYluOsJ.mozrunner/runtests_leaks.log 11:41:09 INFO - ++DOCSHELL 0x7f54f1d81800 == 1 [pid = 2852] [id = 1] 11:41:09 INFO - ++DOMWINDOW == 1 (0x7f54f1dabc00) [pid = 2852] [serial = 1] [outer = (nil)] 11:41:09 INFO - [2852] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:41:09 INFO - ++DOMWINDOW == 2 (0x7f54f0f6a800) [pid = 2852] [serial = 2] [outer = 0x7f54f1dabc00] 11:41:10 INFO - ++DOCSHELL 0x7f54ec45f800 == 2 [pid = 2852] [id = 2] 11:41:10 INFO - ++DOMWINDOW == 3 (0x7f54ec309400) [pid = 2852] [serial = 3] [outer = (nil)] 11:41:10 INFO - ++DOMWINDOW == 4 (0x7f54ec30a000) [pid = 2852] [serial = 4] [outer = 0x7f54ec309400] 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnptestjava.so returned 7f54ec3c61f0 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnpsecondtest.so returned 7f54ec3c65e0 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnptest.so returned 7f54ec3c6910 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnpctrltest.so returned 7f54ec3c6a00 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnpswftest.so returned 7f54ec3c6d30 11:41:11 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnpthirdtest.so returned 7f54eb4ff040 11:41:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f54eb4ff3a0 11:41:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f54eb4f95b0 11:41:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f54eb413700 11:41:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f54eb413a00 11:41:11 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f54eb413d30 11:41:11 INFO - ++DOMWINDOW == 5 (0x7f54eb484400) [pid = 2852] [serial = 5] [outer = 0x7f54f1dabc00] 11:41:12 INFO - [2852] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:41:14 INFO - ++DOCSHELL 0x7f54e2440800 == 3 [pid = 2852] [id = 3] 11:41:14 INFO - ++DOMWINDOW == 6 (0x7f54e26f2c00) [pid = 2852] [serial = 6] [outer = (nil)] 11:41:14 INFO - ++DOCSHELL 0x7f54e2444800 == 4 [pid = 2852] [id = 4] 11:41:14 INFO - ++DOMWINDOW == 7 (0x7f54e26f3400) [pid = 2852] [serial = 7] [outer = (nil)] 11:41:14 INFO - [2852] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:41:14 INFO - ++DOCSHELL 0x7f54e0806800 == 5 [pid = 2852] [id = 5] 11:41:14 INFO - ++DOMWINDOW == 8 (0x7f54e14a9400) [pid = 2852] [serial = 8] [outer = (nil)] 11:41:14 INFO - [2852] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:41:15 INFO - ++DOMWINDOW == 9 (0x7f54e0712400) [pid = 2852] [serial = 9] [outer = 0x7f54e14a9400] 11:41:15 INFO - ++DOMWINDOW == 10 (0x7f54e0217000) [pid = 2852] [serial = 10] [outer = 0x7f54e26f2c00] 11:41:15 INFO - ++DOMWINDOW == 11 (0x7f54e0217800) [pid = 2852] [serial = 11] [outer = 0x7f54e26f3400] 11:41:15 INFO - ++DOMWINDOW == 12 (0x7f54e0219400) [pid = 2852] [serial = 12] [outer = 0x7f54e14a9400] 11:41:17 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpYluOsJ.mozrunner/runtests_leaks_tab_pid2905.log 11:41:18 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:41:19 INFO - ++DOCSHELL 0x7f85fe82e800 == 1 [pid = 2905] [id = 1] 11:41:19 INFO - ++DOMWINDOW == 1 (0x7f85fe87b000) [pid = 2905] [serial = 1] [outer = (nil)] 11:41:19 INFO - ++DOMWINDOW == 2 (0x7f85fda17000) [pid = 2905] [serial = 2] [outer = 0x7f85fe87b000] 11:41:19 INFO - [Parent 2852] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:41:20 INFO - [Parent 2852] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:41:20 INFO - ++DOMWINDOW == 3 (0x7f85fd7d5400) [pid = 2905] [serial = 3] [outer = 0x7f85fe87b000] 11:41:21 INFO - ++DOCSHELL 0x7f54e0808800 == 6 [pid = 2852] [id = 6] 11:41:21 INFO - ++DOMWINDOW == 13 (0x7f54e2d7f800) [pid = 2852] [serial = 13] [outer = (nil)] 11:41:21 INFO - ++DOMWINDOW == 14 (0x7f54e3665c00) [pid = 2852] [serial = 14] [outer = 0x7f54e2d7f800] 11:41:21 INFO - ++DOMWINDOW == 15 (0x7f54dfedc800) [pid = 2852] [serial = 15] [outer = 0x7f54e2d7f800] 11:41:21 INFO - ++DOCSHELL 0x7f54e165c000 == 7 [pid = 2852] [id = 7] 11:41:21 INFO - ++DOMWINDOW == 16 (0x7f54e0161000) [pid = 2852] [serial = 16] [outer = (nil)] 11:41:22 INFO - ++DOMWINDOW == 17 (0x7f54eb491c00) [pid = 2852] [serial = 17] [outer = 0x7f54e0161000] 11:41:22 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:41:22 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:41:22 INFO - ++DOCSHELL 0x7f85fcca1800 == 2 [pid = 2905] [id = 2] 11:41:22 INFO - ++DOMWINDOW == 4 (0x7f85fcc91c00) [pid = 2905] [serial = 4] [outer = (nil)] 11:41:22 INFO - ++DOMWINDOW == 5 (0x7f85fc2d5c00) [pid = 2905] [serial = 5] [outer = 0x7f85fcc91c00] 11:41:22 INFO - 495 INFO TEST-START | layout/generic/test/test_bug1062406.html 11:41:22 INFO - [Child 2905] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:41:23 INFO - ++DOMWINDOW == 6 (0x7f85fc2e4000) [pid = 2905] [serial = 6] [outer = 0x7f85fcc91c00] 11:41:23 INFO - [Parent 2852] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:41:24 INFO - ++DOMWINDOW == 7 (0x7f85fc196000) [pid = 2905] [serial = 7] [outer = 0x7f85fcc91c00] 11:41:25 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:41:25 INFO - MEMORY STAT | vsize 508MB | residentFast 87MB | heapAllocated 18MB 11:41:25 INFO - --DOCSHELL 0x7f54e0806800 == 6 [pid = 2852] [id = 5] 11:41:25 INFO - 496 INFO TEST-OK | layout/generic/test/test_bug1062406.html | took 2672ms 11:41:25 INFO - ++DOMWINDOW == 8 (0x7f85fe874400) [pid = 2905] [serial = 8] [outer = 0x7f85fcc91c00] 11:41:25 INFO - 497 INFO TEST-START | layout/generic/test/test_bug1174521.html 11:41:26 INFO - ++DOMWINDOW == 9 (0x7f85fbf92c00) [pid = 2905] [serial = 9] [outer = 0x7f85fcc91c00] 11:41:26 INFO - ++DOCSHELL 0x7f85fbf66800 == 3 [pid = 2905] [id = 3] 11:41:26 INFO - ++DOMWINDOW == 10 (0x7f85fbf99800) [pid = 2905] [serial = 10] [outer = (nil)] 11:41:26 INFO - ++DOMWINDOW == 11 (0x7f85fbf93c00) [pid = 2905] [serial = 11] [outer = 0x7f85fbf99800] 11:41:26 INFO - [Child 2905] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:41:26 INFO - MEMORY STAT | vsize 511MB | residentFast 90MB | heapAllocated 19MB 11:41:26 INFO - 498 INFO TEST-OK | layout/generic/test/test_bug1174521.html | took 895ms 11:41:26 INFO - ++DOMWINDOW == 12 (0x7f85fe874c00) [pid = 2905] [serial = 12] [outer = 0x7f85fcc91c00] 11:41:26 INFO - 499 INFO TEST-START | layout/generic/test/test_bug240933.html 11:41:27 INFO - ++DOMWINDOW == 13 (0x7f85fbc29400) [pid = 2905] [serial = 13] [outer = 0x7f85fcc91c00] 11:41:28 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:41:28 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:41:28 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:41:28 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:41:29 INFO - MEMORY STAT | vsize 518MB | residentFast 95MB | heapAllocated 22MB 11:41:29 INFO - 500 INFO TEST-OK | layout/generic/test/test_bug240933.html | took 2268ms 11:41:29 INFO - ++DOMWINDOW == 14 (0x7f85fba8b800) [pid = 2905] [serial = 14] [outer = 0x7f85fcc91c00] 11:41:29 INFO - 501 INFO TEST-START | layout/generic/test/test_bug263683.html 11:41:29 INFO - ++DOMWINDOW == 15 (0x7f85fba8bc00) [pid = 2905] [serial = 15] [outer = 0x7f85fcc91c00] 11:41:30 INFO - MEMORY STAT | vsize 525MB | residentFast 101MB | heapAllocated 23MB 11:41:30 INFO - 502 INFO TEST-OK | layout/generic/test/test_bug263683.html | took 972ms 11:41:30 INFO - ++DOMWINDOW == 16 (0x7f85fbabe800) [pid = 2905] [serial = 16] [outer = 0x7f85fcc91c00] 11:41:30 INFO - 503 INFO TEST-START | layout/generic/test/test_bug288789.html 11:41:30 INFO - --DOCSHELL 0x7f85fbf66800 == 2 [pid = 2905] [id = 3] 11:41:30 INFO - ++DOMWINDOW == 17 (0x7f85fba89800) [pid = 2905] [serial = 17] [outer = 0x7f85fcc91c00] 11:41:31 INFO - [Child 2905] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:41:31 INFO - [Child 2905] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:41:31 INFO - [Child 2905] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:41:31 INFO - MEMORY STAT | vsize 525MB | residentFast 101MB | heapAllocated 21MB 11:41:31 INFO - 504 INFO TEST-OK | layout/generic/test/test_bug288789.html | took 1123ms 11:41:31 INFO - ++DOMWINDOW == 18 (0x7f85fd7d0000) [pid = 2905] [serial = 18] [outer = 0x7f85fcc91c00] 11:41:31 INFO - 505 INFO TEST-START | layout/generic/test/test_bug290397.html 11:41:32 INFO - ++DOMWINDOW == 19 (0x7f85fbf92400) [pid = 2905] [serial = 19] [outer = 0x7f85fcc91c00] 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - MEMORY STAT | vsize 526MB | residentFast 102MB | heapAllocated 22MB 11:41:32 INFO - 506 INFO TEST-OK | layout/generic/test/test_bug290397.html | took 594ms 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - ++DOMWINDOW == 20 (0x7f85fbf91400) [pid = 2905] [serial = 20] [outer = 0x7f85fcc91c00] 11:41:32 INFO - 507 INFO TEST-START | layout/generic/test/test_bug323656.html 11:41:32 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:41:32 INFO - ++DOMWINDOW == 21 (0x7f85fd7d4800) [pid = 2905] [serial = 21] [outer = 0x7f85fcc91c00] 11:41:33 INFO - MEMORY STAT | vsize 527MB | residentFast 103MB | heapAllocated 23MB 11:41:33 INFO - 508 INFO TEST-OK | layout/generic/test/test_bug323656.html | took 450ms 11:41:33 INFO - ++DOMWINDOW == 22 (0x7f85fd973800) [pid = 2905] [serial = 22] [outer = 0x7f85fcc91c00] 11:41:33 INFO - 509 INFO TEST-START | layout/generic/test/test_bug344830.html 11:41:33 INFO - ++DOMWINDOW == 23 (0x7f85fd7cec00) [pid = 2905] [serial = 23] [outer = 0x7f85fcc91c00] 11:41:33 INFO - ++DOCSHELL 0x7f85fd716000 == 3 [pid = 2905] [id = 4] 11:41:33 INFO - ++DOMWINDOW == 24 (0x7f85fbf92800) [pid = 2905] [serial = 24] [outer = (nil)] 11:41:33 INFO - ++DOMWINDOW == 25 (0x7f85fe877800) [pid = 2905] [serial = 25] [outer = 0x7f85fbf92800] 11:41:33 INFO - MEMORY STAT | vsize 528MB | residentFast 104MB | heapAllocated 23MB 11:41:34 INFO - 510 INFO TEST-OK | layout/generic/test/test_bug344830.html | took 1030ms 11:41:34 INFO - ++DOMWINDOW == 26 (0x7f85fe86bc00) [pid = 2905] [serial = 26] [outer = 0x7f85fcc91c00] 11:41:34 INFO - 511 INFO TEST-START | layout/generic/test/test_bug382429.html 11:41:34 INFO - ++DOMWINDOW == 27 (0x7f85fe86c400) [pid = 2905] [serial = 27] [outer = 0x7f85fcc91c00] 11:41:35 INFO - MEMORY STAT | vsize 528MB | residentFast 105MB | heapAllocated 24MB 11:41:35 INFO - 512 INFO TEST-OK | layout/generic/test/test_bug382429.html | took 869ms 11:41:35 INFO - ++DOMWINDOW == 28 (0x7f860134a800) [pid = 2905] [serial = 28] [outer = 0x7f85fcc91c00] 11:41:35 INFO - 513 INFO TEST-START | layout/generic/test/test_bug384527.html 11:41:35 INFO - ++DOMWINDOW == 29 (0x7f8601391400) [pid = 2905] [serial = 29] [outer = 0x7f85fcc91c00] 11:41:36 INFO - MEMORY STAT | vsize 528MB | residentFast 105MB | heapAllocated 24MB 11:41:36 INFO - 514 INFO TEST-OK | layout/generic/test/test_bug384527.html | took 766ms 11:41:36 INFO - ++DOMWINDOW == 30 (0x7f860148a000) [pid = 2905] [serial = 30] [outer = 0x7f85fcc91c00] 11:41:36 INFO - 515 INFO TEST-START | layout/generic/test/test_bug385751.html 11:41:36 INFO - ++DOMWINDOW == 31 (0x7f85fd7d3c00) [pid = 2905] [serial = 31] [outer = 0x7f85fcc91c00] 11:41:37 INFO - MEMORY STAT | vsize 528MB | residentFast 105MB | heapAllocated 24MB 11:41:37 INFO - 516 INFO TEST-OK | layout/generic/test/test_bug385751.html | took 802ms 11:41:37 INFO - ++DOMWINDOW == 32 (0x7f85fae32c00) [pid = 2905] [serial = 32] [outer = 0x7f85fcc91c00] 11:41:37 INFO - 517 INFO TEST-START | layout/generic/test/test_bug389630.html 11:41:37 INFO - ++DOMWINDOW == 33 (0x7f85fae33000) [pid = 2905] [serial = 33] [outer = 0x7f85fcc91c00] 11:41:38 INFO - --DOMWINDOW == 16 (0x7f54e14a9400) [pid = 2852] [serial = 8] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 15 (0x7f54e0219400) [pid = 2852] [serial = 12] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 14 (0x7f54e0712400) [pid = 2852] [serial = 9] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 13 (0x7f54f0f6a800) [pid = 2852] [serial = 2] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 12 (0x7f54e3665c00) [pid = 2852] [serial = 14] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 32 (0x7f85fda17000) [pid = 2905] [serial = 2] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 31 (0x7f85fc2d5c00) [pid = 2905] [serial = 5] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 30 (0x7f85fc2e4000) [pid = 2905] [serial = 6] [outer = (nil)] [url = about:blank] 11:41:38 INFO - --DOMWINDOW == 29 (0x7f85fbf99800) [pid = 2905] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug1174521.html] 11:41:38 INFO - MEMORY STAT | vsize 529MB | residentFast 107MB | heapAllocated 25MB 11:41:38 INFO - 518 INFO TEST-OK | layout/generic/test/test_bug389630.html | took 771ms 11:41:38 INFO - ++DOMWINDOW == 30 (0x7f85fae35400) [pid = 2905] [serial = 34] [outer = 0x7f85fcc91c00] 11:41:38 INFO - 519 INFO TEST-START | layout/generic/test/test_bug391747.html 11:41:38 INFO - ++DOMWINDOW == 31 (0x7f85fae35800) [pid = 2905] [serial = 35] [outer = 0x7f85fcc91c00] 11:41:38 INFO - ++DOCSHELL 0x7f8604591800 == 4 [pid = 2905] [id = 5] 11:41:38 INFO - ++DOMWINDOW == 32 (0x7f85fae39800) [pid = 2905] [serial = 36] [outer = (nil)] 11:41:38 INFO - ++DOMWINDOW == 33 (0x7f85fae3a800) [pid = 2905] [serial = 37] [outer = 0x7f85fae39800] 11:41:38 INFO - MEMORY STAT | vsize 529MB | residentFast 107MB | heapAllocated 25MB 11:41:38 INFO - 520 INFO TEST-OK | layout/generic/test/test_bug391747.html | took 512ms 11:41:38 INFO - ++DOMWINDOW == 34 (0x7f85fae36400) [pid = 2905] [serial = 38] [outer = 0x7f85fcc91c00] 11:41:39 INFO - 521 INFO TEST-START | layout/generic/test/test_bug392746.html 11:41:39 INFO - ++DOMWINDOW == 35 (0x7f85fae37000) [pid = 2905] [serial = 39] [outer = 0x7f85fcc91c00] 11:41:39 INFO - MEMORY STAT | vsize 530MB | residentFast 108MB | heapAllocated 25MB 11:41:39 INFO - 522 INFO TEST-OK | layout/generic/test/test_bug392746.html | took 623ms 11:41:39 INFO - ++DOMWINDOW == 36 (0x7f85fc2e4c00) [pid = 2905] [serial = 40] [outer = 0x7f85fcc91c00] 11:41:39 INFO - 523 INFO TEST-START | layout/generic/test/test_bug392923.html 11:41:39 INFO - ++DOMWINDOW == 37 (0x7f85fcc8b400) [pid = 2905] [serial = 41] [outer = 0x7f85fcc91c00] 11:41:40 INFO - MEMORY STAT | vsize 530MB | residentFast 109MB | heapAllocated 24MB 11:41:40 INFO - --DOCSHELL 0x7f85fd716000 == 3 [pid = 2905] [id = 4] 11:41:40 INFO - --DOCSHELL 0x7f8604591800 == 2 [pid = 2905] [id = 5] 11:41:40 INFO - 524 INFO TEST-OK | layout/generic/test/test_bug392923.html | took 1033ms 11:41:40 INFO - --DOMWINDOW == 36 (0x7f85fbf93c00) [pid = 2905] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug1174521.html] 11:41:40 INFO - ++DOMWINDOW == 37 (0x7f85fae3c000) [pid = 2905] [serial = 42] [outer = 0x7f85fcc91c00] 11:41:40 INFO - 525 INFO TEST-START | layout/generic/test/test_bug394173.html 11:41:41 INFO - ++DOMWINDOW == 38 (0x7f85fae38000) [pid = 2905] [serial = 43] [outer = 0x7f85fcc91c00] 11:41:41 INFO - ++DOCSHELL 0x7f85faee2800 == 3 [pid = 2905] [id = 6] 11:41:41 INFO - ++DOMWINDOW == 39 (0x7f85fae3e000) [pid = 2905] [serial = 44] [outer = (nil)] 11:41:41 INFO - ++DOMWINDOW == 40 (0x7f85fba8b400) [pid = 2905] [serial = 45] [outer = 0x7f85fae3e000] 11:41:41 INFO - MEMORY STAT | vsize 529MB | residentFast 104MB | heapAllocated 19MB 11:41:41 INFO - 526 INFO TEST-OK | layout/generic/test/test_bug394173.html | took 771ms 11:41:41 INFO - ++DOMWINDOW == 41 (0x7f85fbac0400) [pid = 2905] [serial = 46] [outer = 0x7f85fcc91c00] 11:41:42 INFO - 527 INFO TEST-START | layout/generic/test/test_bug394239.html 11:41:42 INFO - ++DOMWINDOW == 42 (0x7f85fba86800) [pid = 2905] [serial = 47] [outer = 0x7f85fcc91c00] 11:41:42 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:41:42 INFO - [Child 2905] WARNING: Out-of-flow frame got reflowed before its placeholder: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsPlaceholderFrame.cpp, line 137 11:41:42 INFO - --DOMWINDOW == 41 (0x7f85fc2e4c00) [pid = 2905] [serial = 40] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 40 (0x7f85fae36400) [pid = 2905] [serial = 38] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 39 (0x7f85fae33000) [pid = 2905] [serial = 33] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug389630.html] 11:41:42 INFO - --DOMWINDOW == 38 (0x7f85fae3a800) [pid = 2905] [serial = 37] [outer = (nil)] [url = data:text/html,x] 11:41:42 INFO - --DOMWINDOW == 37 (0x7f85fbf92c00) [pid = 2905] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug1174521.html] 11:41:42 INFO - --DOMWINDOW == 36 (0x7f85fbabe800) [pid = 2905] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 35 (0x7f85fd7d0000) [pid = 2905] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 34 (0x7f85fbf92400) [pid = 2905] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug290397.html] 11:41:42 INFO - --DOMWINDOW == 33 (0x7f85fbf91400) [pid = 2905] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 32 (0x7f85fd7d4800) [pid = 2905] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug323656.html] 11:41:42 INFO - --DOMWINDOW == 31 (0x7f85fd973800) [pid = 2905] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 30 (0x7f85fd7cec00) [pid = 2905] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug344830.html] 11:41:42 INFO - --DOMWINDOW == 29 (0x7f85fe877800) [pid = 2905] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug344830_testembed.svg] 11:41:42 INFO - --DOMWINDOW == 28 (0x7f85fe86bc00) [pid = 2905] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 27 (0x7f85fe86c400) [pid = 2905] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug382429.html] 11:41:42 INFO - --DOMWINDOW == 26 (0x7f860134a800) [pid = 2905] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 25 (0x7f8601391400) [pid = 2905] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug384527.html] 11:41:42 INFO - --DOMWINDOW == 24 (0x7f860148a000) [pid = 2905] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 23 (0x7f85fd7d3c00) [pid = 2905] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug385751.html] 11:41:42 INFO - --DOMWINDOW == 22 (0x7f85fae32c00) [pid = 2905] [serial = 32] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 21 (0x7f85fae35400) [pid = 2905] [serial = 34] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 20 (0x7f85fc196000) [pid = 2905] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug1062406.html] 11:41:42 INFO - --DOMWINDOW == 19 (0x7f85fe874400) [pid = 2905] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 18 (0x7f85fe874c00) [pid = 2905] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 17 (0x7f85fbc29400) [pid = 2905] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug240933.html] 11:41:42 INFO - --DOMWINDOW == 16 (0x7f85fba8b800) [pid = 2905] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:41:42 INFO - --DOMWINDOW == 15 (0x7f85fba8bc00) [pid = 2905] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug263683.html] 11:41:42 INFO - --DOMWINDOW == 14 (0x7f85fae39800) [pid = 2905] [serial = 36] [outer = (nil)] [url = data:text/html,
x] 11:41:42 INFO - --DOMWINDOW == 13 (0x7f85fbf92800) [pid = 2905] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug344830_testembed.svg] 11:41:42 INFO - --DOMWINDOW == 12 (0x7f85fae35800) [pid = 2905] [serial = 35] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug391747.html] 11:41:43 INFO - MEMORY STAT | vsize 530MB | residentFast 103MB | heapAllocated 19MB 11:41:43 INFO - [Child 2905] ###!!! ASSERTION: Placeholder relationship should have been torn down already; this might mean we have a stray placeholder in the tree.: '!placeholder || nsLayoutUtils::IsProperAncestorFrame(aDestructRoot, placeholder)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsFrame.cpp, line 633 11:42:35 INFO - #01: nsFrameList::DestroyFramesFrom(nsIFrame*) [layout/generic/nsFrameList.cpp:56] 11:42:35 INFO - #02: nsContainerFrame::DestroyAbsoluteFrames(nsIFrame*) [layout/generic/nsContainerFrame.cpp:158] 11:42:35 INFO - #03: nsContainerFrame::DestroyFrom(nsIFrame*) [layout/generic/nsContainerFrame.cpp:195] 11:42:35 INFO - #04: nsBlockFrame::DoRemoveFrame(nsIFrame*, unsigned int) [layout/generic/nsBlockFrame.cpp:5761] 11:42:35 INFO - #05: nsBlockFrame::RemoveFrame(mozilla::layout::FrameChildListID, nsIFrame*) [layout/generic/nsBlockFrame.cpp:5126] 11:42:35 INFO - #06: nsFrameManager::RemoveFrame(mozilla::layout::FrameChildListID, nsIFrame*) [layout/base/nsFrameManager.cpp:509] 11:42:35 INFO - #07: nsCSSFrameConstructor::ContentRemoved(nsIContent*, nsIContent*, nsIContent*, nsCSSFrameConstructor::RemoveFlags, bool*, nsIContent**) [layout/base/nsCSSFrameConstructor.cpp:8202] 11:42:35 INFO - #08: nsCSSFrameConstructor::RecreateFramesForContent(nsIContent*, bool, nsCSSFrameConstructor::RemoveFlags, nsIContent**) [layout/base/nsCSSFrameConstructor.cpp:9359] 11:42:35 INFO - #09: mozilla::RestyleManager::ProcessRestyledFrames(nsStyleChangeList&) [layout/base/RestyleManager.cpp:820] 11:42:35 INFO - #10: mozilla::RestyleManager::ComputeAndProcessStyleChange(nsIFrame*, nsChangeHint, mozilla::RestyleTracker&, nsRestyleHint, mozilla::RestyleHintData const&) [layout/base/RestyleManager.cpp:4942] 11:42:35 INFO - #11: mozilla::RestyleManager::RestyleElement(mozilla::dom::Element*, nsIFrame*, nsChangeHint, mozilla::RestyleTracker&, nsRestyleHint, mozilla::RestyleHintData const&) [layout/base/RestyleManager.cpp:1055] 11:42:35 INFO - #12: mozilla::RestyleTracker::ProcessOneRestyle(mozilla::dom::Element*, nsRestyleHint, nsChangeHint, mozilla::RestyleHintData const&) [layout/base/RestyleTracker.cpp:195] 11:42:35 INFO - #13: mozilla::RestyleTracker::DoProcessRestyles() [layout/base/RestyleTracker.cpp:354] 11:42:35 INFO - #14: mozilla::RestyleManager::ProcessPendingRestyles() [layout/base/RestyleManager.cpp:1781] 11:42:35 INFO - #15: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:3982] 11:42:35 INFO - #16: nsRefreshDriver::Tick(long, mozilla::TimeStamp) [mfbt/RefPtr.h:240] 11:42:35 INFO - #17: mozilla::RefreshDriverTimer::TickRefreshDrivers(long, mozilla::TimeStamp, nsTArray >&) [layout/base/nsRefreshDriver.cpp:237] 11:42:35 INFO - #18: mozilla::RefreshDriverTimer::Tick(long, mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:258] 11:42:35 INFO - #19: mozilla::VsyncRefreshDriverTimer::RefreshDriverVsyncObserver::TickRefreshDriver(mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:489] 11:42:35 INFO - #20: mozilla::VsyncRefreshDriverTimer::RefreshDriverVsyncObserver::NotifyVsync(mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:420] 11:42:35 INFO - #21: mozilla::layout::VsyncChild::RecvNotify(mozilla::TimeStamp const&) [layout/ipc/VsyncChild.cpp:67] 11:42:35 INFO - #22: mozilla::layout::PVsyncChild::OnMessageReceived(IPC::Message const&) [obj-firefox/ipc/ipdl/PVsyncChild.cpp:240] 11:42:35 INFO - #23: mozilla::ipc::MessageChannel::DispatchAsyncMessage(IPC::Message const&) [ipc/glue/MessageChannel.h:533] 11:42:35 INFO - #24: mozilla::ipc::MessageChannel::DispatchMessage(IPC::Message const&) [ipc/glue/MessageChannel.cpp:1304] 11:42:35 INFO - #25: mozilla::ipc::MessageChannel::OnMaybeDequeueOne() [ipc/glue/MessageChannel.cpp:1275] 11:42:35 INFO - #26: MessageLoop::RunTask(Task*) [ipc/chromium/src/base/message_loop.cc:365] 11:42:35 INFO - #27: MessageLoop::DeferOrRunPendingTask(MessageLoop::PendingTask const&) [ipc/chromium/src/base/message_loop.cc:375] 11:42:35 INFO - #28: MessageLoop::DoWork() [ipc/chromium/src/base/message_loop.cc:459] 11:42:35 INFO - #29: mozilla::ipc::DoWorkRunnable::Run() [ipc/glue/MessagePump.cpp:221] 11:42:35 INFO - #30: nsThread::ProcessNextEvent(bool, bool*) [xpcom/threads/nsThread.cpp:989] 11:42:35 INFO - #31: NS_ProcessNextEvent(nsIThread*, bool) [xpcom/glue/nsThreadUtils.cpp:297] 11:42:35 INFO - #32: mozilla::ipc::MessagePump::Run(base::MessagePump::Delegate*) [ipc/glue/MessagePump.cpp:96] 11:42:35 INFO - #33: MessageLoop::RunInternal() [ipc/chromium/src/base/message_loop.cc:235] 11:42:35 INFO - #34: MessageLoop::Run() [ipc/chromium/src/base/message_loop.cc:520] 11:42:35 INFO - #35: nsBaseAppShell::Run() [widget/nsBaseAppShell.cpp:158] 11:42:35 INFO - #36: XRE_RunAppShell [toolkit/xre/nsEmbedFunctions.cpp:789] 11:42:35 INFO - #37: mozilla::ipc::MessagePumpForChildProcess::Run(base::MessagePump::Delegate*) [ipc/glue/MessagePump.cpp:259] 11:42:35 INFO - #38: MessageLoop::RunInternal() [ipc/chromium/src/base/message_loop.cc:235] 11:42:35 INFO - #39: MessageLoop::Run() [ipc/chromium/src/base/message_loop.cc:520] 11:42:35 INFO - #40: XRE_InitChildProcess [toolkit/xre/nsEmbedFunctions.cpp:629] 11:42:35 INFO - #41: content_process_main(int, char**) [ipc/contentproc/plugin-container.cpp:240] 11:42:35 INFO - #42: libc.so.6 + 0x2176d 11:42:35 INFO - #43: _start 11:42:35 INFO - [Child 2905] WARNING: Out-of-flow frame got reflowed before its placeholder: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsPlaceholderFrame.cpp, line 137 11:42:35 INFO - 528 INFO TEST-OK | layout/generic/test/test_bug394239.html | took 982ms 11:42:35 INFO - ++DOMWINDOW == 13 (0x7f85fbc2d000) [pid = 2905] [serial = 48] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 529 INFO TEST-ERROR | layout/generic/test/test_bug394239.html | 11:42:35 INFO - 530 INFO TEST-START | layout/generic/test/test_bug402380.html 11:42:35 INFO - ++DOMWINDOW == 14 (0x7f85fba88800) [pid = 2905] [serial = 49] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 530MB | residentFast 104MB | heapAllocated 19MB 11:42:35 INFO - 531 INFO TEST-OK | layout/generic/test/test_bug402380.html | took 1082ms 11:42:35 INFO - ++DOMWINDOW == 15 (0x7f85fbc34000) [pid = 2905] [serial = 50] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 532 INFO TEST-START | layout/generic/test/test_bug404872.html 11:42:35 INFO - ++DOMWINDOW == 16 (0x7f85fbabec00) [pid = 2905] [serial = 51] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 530MB | residentFast 103MB | heapAllocated 20MB 11:42:35 INFO - 533 INFO TEST-OK | layout/generic/test/test_bug404872.html | took 609ms 11:42:35 INFO - ++DOMWINDOW == 17 (0x7f85fbc57c00) [pid = 2905] [serial = 52] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 534 INFO TEST-START | layout/generic/test/test_bug405178.html 11:42:35 INFO - ++DOMWINDOW == 18 (0x7f85fae36800) [pid = 2905] [serial = 53] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 537MB | residentFast 105MB | heapAllocated 21MB 11:42:35 INFO - 535 INFO TEST-OK | layout/generic/test/test_bug405178.html | took 1262ms 11:42:35 INFO - ++DOMWINDOW == 19 (0x7f85fbc5e800) [pid = 2905] [serial = 54] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 536 INFO TEST-START | layout/generic/test/test_bug416168.html 11:42:35 INFO - ++DOMWINDOW == 20 (0x7f85fbc5ec00) [pid = 2905] [serial = 55] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 538MB | residentFast 105MB | heapAllocated 21MB 11:42:35 INFO - 537 INFO TEST-OK | layout/generic/test/test_bug416168.html | took 808ms 11:42:35 INFO - ++DOMWINDOW == 21 (0x7f85fbac6000) [pid = 2905] [serial = 56] [outer = 0x7f85fcc91c00] 11:42:35 INFO - --DOCSHELL 0x7f85faee2800 == 2 [pid = 2905] [id = 6] 11:42:35 INFO - --DOMWINDOW == 20 (0x7f85fae37000) [pid = 2905] [serial = 39] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug392746.html] 11:42:35 INFO - 538 INFO TEST-START | layout/generic/test/test_bug421436.html 11:42:35 INFO - ++DOMWINDOW == 21 (0x7f85fae36000) [pid = 2905] [serial = 57] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 537MB | residentFast 102MB | heapAllocated 19MB 11:42:35 INFO - 539 INFO TEST-OK | layout/generic/test/test_bug421436.html | took 770ms 11:42:35 INFO - ++DOMWINDOW == 22 (0x7f85fbab9800) [pid = 2905] [serial = 58] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 540 INFO TEST-START | layout/generic/test/test_bug421839-2.html 11:42:35 INFO - ++DOMWINDOW == 23 (0x7f85fbab9c00) [pid = 2905] [serial = 59] [outer = 0x7f85fcc91c00] 11:42:35 INFO - --DOMWINDOW == 22 (0x7f85fba89800) [pid = 2905] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug288789.html] 11:42:35 INFO - --DOMWINDOW == 21 (0x7f85fcc8b400) [pid = 2905] [serial = 41] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug392923.html] 11:42:35 INFO - --DOMWINDOW == 20 (0x7f85fbc34000) [pid = 2905] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 19 (0x7f85fba88800) [pid = 2905] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug402380.html] 11:42:35 INFO - --DOMWINDOW == 18 (0x7f85fbc2d000) [pid = 2905] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 17 (0x7f85fba86800) [pid = 2905] [serial = 47] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug394239.html] 11:42:35 INFO - --DOMWINDOW == 16 (0x7f85fbac0400) [pid = 2905] [serial = 46] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 15 (0x7f85fba8b400) [pid = 2905] [serial = 45] [outer = (nil)] [url = data:text/html;charset=utf-8,%3Chtml%3E%0A%3Chead%3E%0A%3Cstyle%3E%0Adiv%3A%3Afirst-letter%20%7B%20%7D%0Aspan%3A%3Aafter%20%7B%20content%3A%22before%20text%22%3B%20%7D%0A%3C/style%3E%0A%3C/head%3E%0A%3Cbody%3E%0A%3Cdiv%20style%3D%22position%3A%20fixed%3B%20direction%3A%20rtl%3B%22%3E%0A%20%20%3Cspan%20style%3D%22%20direction%3A%20ltr%3B%20unicode-bidi%3A%20bidi-override%3B%20font-size%3A%2070px%3B%20%22%3E%0A%20%20%20%20%3Cspan%20style%3D%22display%3A%20table%3B%20position%3A%20fixed%3B%22%3E%3C/span%3E%0A%20%20%3C/span%3E%0A%3C/div%3E%0A%3Cscript%3E%0Afunction%20doe%28i%29%7B%0Adocument.documentElement.setAttribute%28%27style%27%2C%20%27%27%29%3B%0A%7D%0AsetTimeout%28doe%2C100%29%3B%0A%3C/script%3E%0A%3C/body%3E%0A%3C/html%3E] 11:42:35 INFO - --DOMWINDOW == 14 (0x7f85fae38000) [pid = 2905] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug394173.html] 11:42:35 INFO - --DOMWINDOW == 13 (0x7f85fae3c000) [pid = 2905] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 12 (0x7f85fbc5e800) [pid = 2905] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 11 (0x7f85fae36800) [pid = 2905] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug405178.html] 11:42:35 INFO - --DOMWINDOW == 10 (0x7f85fbc57c00) [pid = 2905] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 9 (0x7f85fae3e000) [pid = 2905] [serial = 44] [outer = (nil)] [url = data:text/html;charset=utf-8,%3Chtml%3E%0A%3Chead%3E%0A%3Cstyle%3E%0Adiv%3A%3Afirst-letter%20%7B%20%7D%0Aspan%3A%3Aafter%20%7B%20content%3A%22before%20text%22%3B%20%7D%0A%3C/style%3E%0A%3C/head%3E%0A%3Cbody%3E%0A%3Cdiv%20style%3D%22position%3A%20fixed%3B%20direction%3A%20rtl%3B%22%3E%0A%20%20%3Cspan%20style%3D%22%20direction%3A%20ltr%3B%20unicode-bidi%3A%20bidi-override%3B%20font-size%3A%2070px%3B%20%22%3E%0A%20%20%20%20%3Cspan%20style%3D%22display%3A%20table%3B%20position%3A%20fixed%3B%22%3E%3C/span%3E%0A%20%20%3C/span%3E%0A%3C/div%3E%0A%3Cscript%3E%0Afunction%20doe%28i%29%7B%0Adocument.documentElement.setAttribute%28%27style%27%2C%20%27%27%29%3B%0A%7D%0AsetTimeout%28doe%2C100%29%3B%0A%3C/script%3E%0A%3C/body%3E%0A%3C/html%3E] 11:42:35 INFO - MEMORY STAT | vsize 537MB | residentFast 101MB | heapAllocated 18MB 11:42:35 INFO - --DOMWINDOW == 8 (0x7f85fbc5ec00) [pid = 2905] [serial = 55] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug416168.html] 11:42:35 INFO - 541 INFO TEST-OK | layout/generic/test/test_bug421839-2.html | took 6226ms 11:42:35 INFO - ++DOMWINDOW == 9 (0x7f85fae36c00) [pid = 2905] [serial = 60] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 542 INFO TEST-START | layout/generic/test/test_bug424627.html 11:42:35 INFO - ++DOMWINDOW == 10 (0x7f85fae38800) [pid = 2905] [serial = 61] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 536MB | residentFast 99MB | heapAllocated 18MB 11:42:35 INFO - 543 INFO TEST-OK | layout/generic/test/test_bug424627.html | took 1384ms 11:42:35 INFO - ++DOMWINDOW == 11 (0x7f85fbc29400) [pid = 2905] [serial = 62] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 544 INFO TEST-START | layout/generic/test/test_bug438840.html 11:42:35 INFO - ++DOMWINDOW == 12 (0x7f85fbc2a800) [pid = 2905] [serial = 63] [outer = 0x7f85fcc91c00] 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:42:35 INFO - MEMORY STAT | vsize 536MB | residentFast 100MB | heapAllocated 20MB 11:42:35 INFO - --DOMWINDOW == 11 (0x7f85fbac6000) [pid = 2905] [serial = 56] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 10 (0x7f85fae36000) [pid = 2905] [serial = 57] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug421436.html] 11:42:35 INFO - --DOMWINDOW == 9 (0x7f85fbab9800) [pid = 2905] [serial = 58] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 8 (0x7f85fbabec00) [pid = 2905] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug404872.html] 11:42:35 INFO - 545 INFO TEST-OK | layout/generic/test/test_bug438840.html | took 660ms 11:42:35 INFO - ++DOMWINDOW == 9 (0x7f85fbc58400) [pid = 2905] [serial = 64] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 546 INFO TEST-START | layout/generic/test/test_bug448860.html 11:42:35 INFO - ++DOMWINDOW == 10 (0x7f85fbc5ec00) [pid = 2905] [serial = 65] [outer = 0x7f85fcc91c00] 11:42:35 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:42:35 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:42:35 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:42:35 INFO - MEMORY STAT | vsize 537MB | residentFast 102MB | heapAllocated 20MB 11:42:35 INFO - 547 INFO TEST-OK | layout/generic/test/test_bug448860.html | took 1050ms 11:42:35 INFO - ++DOMWINDOW == 11 (0x7f85fbf96400) [pid = 2905] [serial = 66] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 548 INFO TEST-START | layout/generic/test/test_bug449653.html 11:42:35 INFO - ++DOMWINDOW == 12 (0x7f85fbac6c00) [pid = 2905] [serial = 67] [outer = 0x7f85fcc91c00] 11:42:35 INFO - ++DOCSHELL 0x7f85fbec9000 == 3 [pid = 2905] [id = 7] 11:42:35 INFO - ++DOMWINDOW == 13 (0x7f85fbf95400) [pid = 2905] [serial = 68] [outer = (nil)] 11:42:35 INFO - ++DOCSHELL 0x7f85fbecd800 == 4 [pid = 2905] [id = 8] 11:42:35 INFO - ++DOMWINDOW == 14 (0x7f85fbf9cc00) [pid = 2905] [serial = 69] [outer = (nil)] 11:42:35 INFO - ++DOMWINDOW == 15 (0x7f85fbf99400) [pid = 2905] [serial = 70] [outer = 0x7f85fbf95400] 11:42:35 INFO - ++DOMWINDOW == 16 (0x7f85fc196c00) [pid = 2905] [serial = 71] [outer = 0x7f85fbf9cc00] 11:42:35 INFO - MEMORY STAT | vsize 540MB | residentFast 103MB | heapAllocated 21MB 11:42:35 INFO - 549 INFO TEST-OK | layout/generic/test/test_bug449653.html | took 806ms 11:42:35 INFO - ++DOMWINDOW == 17 (0x7f85fc2d8400) [pid = 2905] [serial = 72] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 550 INFO TEST-START | layout/generic/test/test_bug460532.html 11:42:35 INFO - ++DOMWINDOW == 18 (0x7f85fae3b800) [pid = 2905] [serial = 73] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 540MB | residentFast 104MB | heapAllocated 21MB 11:42:35 INFO - 551 INFO TEST-OK | layout/generic/test/test_bug460532.html | took 683ms 11:42:35 INFO - ++DOMWINDOW == 19 (0x7f85fba8e000) [pid = 2905] [serial = 74] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 552 INFO TEST-START | layout/generic/test/test_bug468167.html 11:42:35 INFO - ++DOMWINDOW == 20 (0x7f85fc2d9c00) [pid = 2905] [serial = 75] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 540MB | residentFast 105MB | heapAllocated 21MB 11:42:35 INFO - --DOCSHELL 0x7f85fbec9000 == 3 [pid = 2905] [id = 7] 11:42:35 INFO - --DOCSHELL 0x7f85fbecd800 == 2 [pid = 2905] [id = 8] 11:42:35 INFO - 553 INFO TEST-OK | layout/generic/test/test_bug468167.html | took 1904ms 11:42:35 INFO - ++DOMWINDOW == 21 (0x7f85fae39c00) [pid = 2905] [serial = 76] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 554 INFO TEST-START | layout/generic/test/test_bug470212.html 11:42:35 INFO - ++DOMWINDOW == 22 (0x7f85fae3dc00) [pid = 2905] [serial = 77] [outer = 0x7f85fcc91c00] 11:42:35 INFO - MEMORY STAT | vsize 540MB | residentFast 106MB | heapAllocated 21MB 11:42:35 INFO - 555 INFO TEST-OK | layout/generic/test/test_bug470212.html | took 1425ms 11:42:35 INFO - ++DOMWINDOW == 23 (0x7f85fbc58c00) [pid = 2905] [serial = 78] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 556 INFO TEST-START | layout/generic/test/test_bug496275.html 11:42:35 INFO - ++DOMWINDOW == 24 (0x7f85fbf97000) [pid = 2905] [serial = 79] [outer = 0x7f85fcc91c00] 11:42:35 INFO - --DOMWINDOW == 23 (0x7f85fbab9c00) [pid = 2905] [serial = 59] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug421839-2.html] 11:42:35 INFO - --DOMWINDOW == 22 (0x7f85fbc29400) [pid = 2905] [serial = 62] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 21 (0x7f85fae36c00) [pid = 2905] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 20 (0x7f85fbf96400) [pid = 2905] [serial = 66] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 19 (0x7f85fbc58400) [pid = 2905] [serial = 64] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:42:35 INFO - MEMORY STAT | vsize 540MB | residentFast 107MB | heapAllocated 24MB 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:42:35 INFO - 557 INFO TEST-OK | layout/generic/test/test_bug496275.html | took 4285ms 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:42:35 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:42:35 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:42:35 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:42:35 INFO - ++DOMWINDOW == 20 (0x7f85fb15dc00) [pid = 2905] [serial = 80] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 558 INFO TEST-START | layout/generic/test/test_bug503813.html 11:42:35 INFO - ++DOMWINDOW == 21 (0x7f85fae3bc00) [pid = 2905] [serial = 81] [outer = 0x7f85fcc91c00] 11:42:35 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:42:35 INFO - [Child 2905] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:42:35 INFO - MEMORY STAT | vsize 536MB | residentFast 107MB | heapAllocated 23MB 11:42:35 INFO - 559 INFO TEST-OK | layout/generic/test/test_bug503813.html | took 1047ms 11:42:35 INFO - ++DOMWINDOW == 22 (0x7f85fb165800) [pid = 2905] [serial = 82] [outer = 0x7f85fcc91c00] 11:42:35 INFO - 560 INFO TEST-START | layout/generic/test/test_bug514732.html 11:42:35 INFO - ++DOMWINDOW == 23 (0x7f85fb165c00) [pid = 2905] [serial = 83] [outer = 0x7f85fcc91c00] 11:42:35 INFO - ++DOCSHELL 0x7f85fbf5a800 == 3 [pid = 2905] [id = 9] 11:42:35 INFO - ++DOMWINDOW == 24 (0x7f85fbc5e800) [pid = 2905] [serial = 84] [outer = (nil)] 11:42:35 INFO - ++DOCSHELL 0x7f54df5bb000 == 7 [pid = 2852] [id = 8] 11:42:35 INFO - ++DOMWINDOW == 13 (0x7f54eca47800) [pid = 2852] [serial = 18] [outer = (nil)] 11:42:35 INFO - ++DOMWINDOW == 14 (0x7f54eca4cc00) [pid = 2852] [serial = 19] [outer = 0x7f54eca47800] 11:42:35 INFO - ++DOCSHELL 0x7f54e2dbf000 == 8 [pid = 2852] [id = 9] 11:42:35 INFO - ++DOMWINDOW == 15 (0x7f54f2d17800) [pid = 2852] [serial = 20] [outer = (nil)] 11:42:35 INFO - ++DOCSHELL 0x7f54e2dc2800 == 9 [pid = 2852] [id = 10] 11:42:35 INFO - ++DOMWINDOW == 16 (0x7f54f2d1b000) [pid = 2852] [serial = 21] [outer = (nil)] 11:42:35 INFO - ++DOCSHELL 0x7f54e34b3800 == 10 [pid = 2852] [id = 11] 11:42:35 INFO - ++DOMWINDOW == 17 (0x7f54f2fa4c00) [pid = 2852] [serial = 22] [outer = (nil)] 11:42:35 INFO - ++DOMWINDOW == 18 (0x7f54f484e000) [pid = 2852] [serial = 23] [outer = 0x7f54f2fa4c00] 11:42:35 INFO - ++DOMWINDOW == 19 (0x7f54f4853000) [pid = 2852] [serial = 24] [outer = 0x7f54f2d17800] 11:42:35 INFO - ++DOMWINDOW == 20 (0x7f54f4853800) [pid = 2852] [serial = 25] [outer = 0x7f54f2d1b000] 11:42:35 INFO - ++DOMWINDOW == 21 (0x7f54f4855800) [pid = 2852] [serial = 26] [outer = 0x7f54f2fa4c00] 11:42:35 INFO - ++DOMWINDOW == 22 (0x7f54f7529800) [pid = 2852] [serial = 27] [outer = 0x7f54f2fa4c00] 11:42:35 INFO - ++DOMWINDOW == 25 (0x7f85fd753800) [pid = 2905] [serial = 85] [outer = 0x7f85fbc5e800] 11:42:35 INFO - ++DOMWINDOW == 26 (0x7f85fb3efc00) [pid = 2905] [serial = 86] [outer = 0x7f85fbc5e800] 11:42:35 INFO - ++DOCSHELL 0x7f85fcc9d800 == 4 [pid = 2905] [id = 10] 11:42:35 INFO - ++DOMWINDOW == 27 (0x7f85fb3f3c00) [pid = 2905] [serial = 87] [outer = (nil)] 11:42:35 INFO - ++DOMWINDOW == 28 (0x7f85fb3f5000) [pid = 2905] [serial = 88] [outer = 0x7f85fb3f3c00] 11:42:35 INFO - --DOMWINDOW == 27 (0x7f85fba8e000) [pid = 2905] [serial = 74] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 26 (0x7f85fc2d8400) [pid = 2905] [serial = 72] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 25 (0x7f85fc196c00) [pid = 2905] [serial = 71] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug449653_1_ref.html] 11:42:35 INFO - --DOMWINDOW == 24 (0x7f85fbf99400) [pid = 2905] [serial = 70] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug449653_1.html] 11:42:35 INFO - --DOMWINDOW == 23 (0x7f85fbac6c00) [pid = 2905] [serial = 67] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug449653.html] 11:42:35 INFO - --DOMWINDOW == 22 (0x7f85fbc2a800) [pid = 2905] [serial = 63] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug438840.html] 11:42:35 INFO - --DOMWINDOW == 21 (0x7f85fbc58c00) [pid = 2905] [serial = 78] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 20 (0x7f85fae38800) [pid = 2905] [serial = 61] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug424627.html] 11:42:35 INFO - --DOMWINDOW == 19 (0x7f85fae39c00) [pid = 2905] [serial = 76] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 18 (0x7f85fb165800) [pid = 2905] [serial = 82] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 17 (0x7f85fae3bc00) [pid = 2905] [serial = 81] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug503813.html] 11:42:35 INFO - --DOMWINDOW == 16 (0x7f85fb15dc00) [pid = 2905] [serial = 80] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:42:35 INFO - --DOMWINDOW == 15 (0x7f85fbf9cc00) [pid = 2905] [serial = 69] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug449653_1_ref.html] 11:42:35 INFO - --DOMWINDOW == 14 (0x7f85fbf95400) [pid = 2905] [serial = 68] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug449653_1.html] 11:42:35 INFO - --DOMWINDOW == 13 (0x7f85fae3b800) [pid = 2905] [serial = 73] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug460532.html] 11:42:35 INFO - --DOMWINDOW == 12 (0x7f85fbf97000) [pid = 2905] [serial = 79] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug496275.html] 11:42:35 INFO - --DOCSHELL 0x7f54e34b3800 == 9 [pid = 2852] [id = 11] 11:42:35 INFO - --DOMWINDOW == 21 (0x7f54f7529800) [pid = 2852] [serial = 27] [outer = (nil)] [url = about:blank] 11:42:35 INFO - --DOMWINDOW == 20 (0x7f54f4855800) [pid = 2852] [serial = 26] [outer = (nil)] [url = about:blank] 11:42:35 INFO - --DOMWINDOW == 19 (0x7f54f484e000) [pid = 2852] [serial = 23] [outer = (nil)] [url = about:blank] 11:42:35 INFO - --DOMWINDOW == 18 (0x7f54f2fa4c00) [pid = 2852] [serial = 22] [outer = (nil)] [url = about:blank] 11:42:41 INFO - --DOMWINDOW == 11 (0x7f85fd753800) [pid = 2905] [serial = 85] [outer = (nil)] [url = about:blank] 11:42:41 INFO - --DOMWINDOW == 10 (0x7f85fc2d9c00) [pid = 2905] [serial = 75] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug468167.html] 11:42:49 INFO - MEMORY STAT | vsize 535MB | residentFast 101MB | heapAllocated 18MB 11:42:50 INFO - --DOCSHELL 0x7f85fcc9d800 == 3 [pid = 2905] [id = 10] 11:42:50 INFO - 561 INFO TEST-OK | layout/generic/test/test_bug514732.html | took 36515ms 11:42:50 INFO - ++DOMWINDOW == 11 (0x7f85fae3e800) [pid = 2905] [serial = 89] [outer = 0x7f85fcc91c00] 11:42:50 INFO - 562 INFO TEST-START | layout/generic/test/test_bug522632.html 11:42:50 INFO - ++DOMWINDOW == 12 (0x7f85fae40800) [pid = 2905] [serial = 90] [outer = 0x7f85fcc91c00] 11:42:50 INFO - MEMORY STAT | vsize 535MB | residentFast 102MB | heapAllocated 19MB 11:42:50 INFO - 563 INFO TEST-OK | layout/generic/test/test_bug522632.html | took 341ms 11:42:50 INFO - ++DOMWINDOW == 13 (0x7f85fafe1800) [pid = 2905] [serial = 91] [outer = 0x7f85fcc91c00] 11:42:50 INFO - 564 INFO TEST-START | layout/generic/test/test_bug524925.html 11:42:50 INFO - ++DOMWINDOW == 14 (0x7f85fafe2400) [pid = 2905] [serial = 92] [outer = 0x7f85fcc91c00] 11:42:51 INFO - MEMORY STAT | vsize 535MB | residentFast 104MB | heapAllocated 21MB 11:42:51 INFO - 565 INFO TEST-OK | layout/generic/test/test_bug524925.html | took 662ms 11:42:51 INFO - ++DOMWINDOW == 15 (0x7f85fb3ed000) [pid = 2905] [serial = 93] [outer = 0x7f85fcc91c00] 11:42:51 INFO - 566 INFO TEST-START | layout/generic/test/test_bug527306.html 11:42:51 INFO - ++DOMWINDOW == 16 (0x7f85fafdf400) [pid = 2905] [serial = 94] [outer = 0x7f85fcc91c00] 11:42:52 INFO - MEMORY STAT | vsize 536MB | residentFast 106MB | heapAllocated 21MB 11:42:52 INFO - 567 INFO TEST-OK | layout/generic/test/test_bug527306.html | took 578ms 11:42:52 INFO - ++DOMWINDOW == 17 (0x7f85fb3e9800) [pid = 2905] [serial = 95] [outer = 0x7f85fcc91c00] 11:42:52 INFO - 568 INFO TEST-START | layout/generic/test/test_bug579767.html 11:42:52 INFO - ++DOMWINDOW == 18 (0x7f85fb3eb800) [pid = 2905] [serial = 96] [outer = 0x7f85fcc91c00] 11:42:52 INFO - ++DOCSHELL 0x7f85fbf56800 == 4 [pid = 2905] [id = 11] 11:42:52 INFO - ++DOMWINDOW == 19 (0x7f85fae3e400) [pid = 2905] [serial = 97] [outer = (nil)] 11:42:52 INFO - ++DOCSHELL 0x7f85fbf57000 == 5 [pid = 2905] [id = 12] 11:42:52 INFO - ++DOMWINDOW == 20 (0x7f85fb3f4000) [pid = 2905] [serial = 98] [outer = (nil)] 11:42:52 INFO - ++DOMWINDOW == 21 (0x7f85fbac1400) [pid = 2905] [serial = 99] [outer = 0x7f85fae3e400] 11:42:52 INFO - ++DOCSHELL 0x7f85fbf62800 == 6 [pid = 2905] [id = 13] 11:42:52 INFO - ++DOMWINDOW == 22 (0x7f85fbac5000) [pid = 2905] [serial = 100] [outer = (nil)] 11:42:52 INFO - ++DOCSHELL 0x7f85fbf63000 == 7 [pid = 2905] [id = 14] 11:42:52 INFO - ++DOMWINDOW == 23 (0x7f85fbac6800) [pid = 2905] [serial = 101] [outer = (nil)] 11:42:52 INFO - ++DOCSHELL 0x7f85fbf64000 == 8 [pid = 2905] [id = 15] 11:42:52 INFO - ++DOMWINDOW == 24 (0x7f85fae32000) [pid = 2905] [serial = 102] [outer = (nil)] 11:42:52 INFO - ++DOMWINDOW == 25 (0x7f85fbc29000) [pid = 2905] [serial = 103] [outer = 0x7f85fbac5000] 11:42:53 INFO - ++DOMWINDOW == 26 (0x7f85fbc2a800) [pid = 2905] [serial = 104] [outer = 0x7f85fbac6800] 11:42:53 INFO - ++DOMWINDOW == 27 (0x7f85fbc2f000) [pid = 2905] [serial = 105] [outer = 0x7f85fae32000] 11:42:53 INFO - ++DOMWINDOW == 28 (0x7f85fbc31000) [pid = 2905] [serial = 106] [outer = 0x7f85fb3f4000] 11:42:53 INFO - ++DOCSHELL 0x7f85fcca0000 == 9 [pid = 2905] [id = 16] 11:42:53 INFO - ++DOMWINDOW == 29 (0x7f85fbc32c00) [pid = 2905] [serial = 107] [outer = (nil)] 11:42:53 INFO - ++DOCSHELL 0x7f85fcca7800 == 10 [pid = 2905] [id = 17] 11:42:53 INFO - ++DOMWINDOW == 30 (0x7f85fbc33400) [pid = 2905] [serial = 108] [outer = (nil)] 11:42:53 INFO - ++DOCSHELL 0x7f85fccaf800 == 11 [pid = 2905] [id = 18] 11:42:53 INFO - ++DOMWINDOW == 31 (0x7f85fbc33c00) [pid = 2905] [serial = 109] [outer = (nil)] 11:42:53 INFO - ++DOMWINDOW == 32 (0x7f85fb3f4800) [pid = 2905] [serial = 110] [outer = 0x7f85fbc32c00] 11:42:53 INFO - ++DOMWINDOW == 33 (0x7f85fbc34400) [pid = 2905] [serial = 111] [outer = 0x7f85fbc33400] 11:42:53 INFO - ++DOMWINDOW == 34 (0x7f85fbc35800) [pid = 2905] [serial = 112] [outer = 0x7f85fbc33c00] 11:42:53 INFO - MEMORY STAT | vsize 544MB | residentFast 108MB | heapAllocated 23MB 11:42:53 INFO - 569 INFO TEST-OK | layout/generic/test/test_bug579767.html | took 1160ms 11:42:53 INFO - ++DOMWINDOW == 35 (0x7f85fbc30c00) [pid = 2905] [serial = 113] [outer = 0x7f85fcc91c00] 11:42:53 INFO - 570 INFO TEST-START | layout/generic/test/test_bug589621.html 11:42:53 INFO - ++DOMWINDOW == 36 (0x7f85fbabdc00) [pid = 2905] [serial = 114] [outer = 0x7f85fcc91c00] 11:42:53 INFO - MEMORY STAT | vsize 544MB | residentFast 108MB | heapAllocated 24MB 11:42:54 INFO - 571 INFO TEST-OK | layout/generic/test/test_bug589621.html | took 379ms 11:42:54 INFO - ++DOMWINDOW == 37 (0x7f85fbc36000) [pid = 2905] [serial = 115] [outer = 0x7f85fcc91c00] 11:42:54 INFO - 572 INFO TEST-START | layout/generic/test/test_bug589623.html 11:42:54 INFO - ++DOMWINDOW == 38 (0x7f85fafe6000) [pid = 2905] [serial = 116] [outer = 0x7f85fcc91c00] 11:42:54 INFO - MEMORY STAT | vsize 544MB | residentFast 108MB | heapAllocated 24MB 11:42:54 INFO - 573 INFO TEST-OK | layout/generic/test/test_bug589623.html | took 280ms 11:42:54 INFO - ++DOMWINDOW == 39 (0x7f85fb3f4400) [pid = 2905] [serial = 117] [outer = 0x7f85fcc91c00] 11:42:54 INFO - 574 INFO TEST-START | layout/generic/test/test_bug597333.html 11:42:54 INFO - ++DOMWINDOW == 40 (0x7f85fbc32800) [pid = 2905] [serial = 118] [outer = 0x7f85fcc91c00] 11:42:54 INFO - [Child 2905] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:42:54 INFO - [Child 2905] WARNING: '!aCharRect.width', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 294 11:42:54 INFO - MEMORY STAT | vsize 544MB | residentFast 110MB | heapAllocated 24MB 11:42:55 INFO - 575 INFO TEST-OK | layout/generic/test/test_bug597333.html | took 486ms 11:42:55 INFO - ++DOMWINDOW == 41 (0x7f85fbf97000) [pid = 2905] [serial = 119] [outer = 0x7f85fcc91c00] 11:42:55 INFO - 576 INFO TEST-START | layout/generic/test/test_bug633762.html 11:42:55 INFO - ++DOMWINDOW == 42 (0x7f85fbc57c00) [pid = 2905] [serial = 120] [outer = 0x7f85fcc91c00] 11:42:55 INFO - ++DOCSHELL 0x7f8601383800 == 12 [pid = 2905] [id = 19] 11:42:55 INFO - ++DOMWINDOW == 43 (0x7f85fafe4800) [pid = 2905] [serial = 121] [outer = (nil)] 11:42:55 INFO - ++DOMWINDOW == 44 (0x7f85fc18e800) [pid = 2905] [serial = 122] [outer = 0x7f85fafe4800] 11:42:55 INFO - [Child 2905] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:42:55 INFO - MEMORY STAT | vsize 544MB | residentFast 111MB | heapAllocated 25MB 11:42:55 INFO - 577 INFO TEST-OK | layout/generic/test/test_bug633762.html | took 761ms 11:42:56 INFO - ++DOMWINDOW == 45 (0x7f85fc2de400) [pid = 2905] [serial = 123] [outer = 0x7f85fcc91c00] 11:42:56 INFO - 578 INFO TEST-START | layout/generic/test/test_bug666225.html 11:42:56 INFO - ++DOMWINDOW == 46 (0x7f85fafdb000) [pid = 2905] [serial = 124] [outer = 0x7f85fcc91c00] 11:42:56 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:42:56 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:42:56 INFO - MEMORY STAT | vsize 545MB | residentFast 111MB | heapAllocated 26MB 11:42:56 INFO - 579 INFO TEST-OK | layout/generic/test/test_bug666225.html | took 748ms 11:42:56 INFO - ++DOMWINDOW == 47 (0x7f85fbc28800) [pid = 2905] [serial = 125] [outer = 0x7f85fcc91c00] 11:42:56 INFO - 580 INFO TEST-START | layout/generic/test/test_bug719503.html 11:42:57 INFO - ++DOMWINDOW == 48 (0x7f85fbc2d000) [pid = 2905] [serial = 126] [outer = 0x7f85fcc91c00] 11:42:57 INFO - MEMORY STAT | vsize 545MB | residentFast 112MB | heapAllocated 26MB 11:42:57 INFO - 581 INFO TEST-OK | layout/generic/test/test_bug719503.html | took 547ms 11:42:57 INFO - ++DOMWINDOW == 49 (0x7f85fd753400) [pid = 2905] [serial = 127] [outer = 0x7f85fcc91c00] 11:42:57 INFO - 582 INFO TEST-START | layout/generic/test/test_bug719515.html 11:42:58 INFO - ++DOMWINDOW == 50 (0x7f85fae3ac00) [pid = 2905] [serial = 128] [outer = 0x7f85fcc91c00] 11:42:58 INFO - --DOCSHELL 0x7f8601383800 == 11 [pid = 2905] [id = 19] 11:42:58 INFO - --DOCSHELL 0x7f85fccaf800 == 10 [pid = 2905] [id = 18] 11:42:58 INFO - --DOCSHELL 0x7f85fbf57000 == 9 [pid = 2905] [id = 12] 11:42:58 INFO - --DOCSHELL 0x7f85fbf62800 == 8 [pid = 2905] [id = 13] 11:42:58 INFO - --DOCSHELL 0x7f85fbf63000 == 7 [pid = 2905] [id = 14] 11:42:58 INFO - --DOCSHELL 0x7f85fbf64000 == 6 [pid = 2905] [id = 15] 11:42:58 INFO - --DOCSHELL 0x7f85fcca0000 == 5 [pid = 2905] [id = 16] 11:42:58 INFO - --DOCSHELL 0x7f85fcca7800 == 4 [pid = 2905] [id = 17] 11:42:58 INFO - --DOCSHELL 0x7f85fbf56800 == 3 [pid = 2905] [id = 11] 11:42:58 INFO - --DOCSHELL 0x7f85fbf5a800 == 2 [pid = 2905] [id = 9] 11:42:58 INFO - MEMORY STAT | vsize 545MB | residentFast 112MB | heapAllocated 22MB 11:42:58 INFO - 583 INFO TEST-OK | layout/generic/test/test_bug719515.html | took 445ms 11:42:58 INFO - ++DOMWINDOW == 51 (0x7f85fafe3000) [pid = 2905] [serial = 129] [outer = 0x7f85fcc91c00] 11:42:58 INFO - 584 INFO TEST-START | layout/generic/test/test_bug719518.html 11:42:58 INFO - ++DOMWINDOW == 52 (0x7f85fafe4400) [pid = 2905] [serial = 130] [outer = 0x7f85fcc91c00] 11:42:58 INFO - MEMORY STAT | vsize 545MB | residentFast 113MB | heapAllocated 22MB 11:42:59 INFO - 585 INFO TEST-OK | layout/generic/test/test_bug719518.html | took 495ms 11:42:59 INFO - ++DOMWINDOW == 53 (0x7f85fae3ec00) [pid = 2905] [serial = 131] [outer = 0x7f85fcc91c00] 11:42:59 INFO - 586 INFO TEST-START | layout/generic/test/test_bug719523.html 11:42:59 INFO - ++DOMWINDOW == 54 (0x7f85fafde000) [pid = 2905] [serial = 132] [outer = 0x7f85fcc91c00] 11:42:59 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(content) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocumentEncoder.cpp, line 836 11:42:59 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocumentEncoder.cpp, line 1076 11:42:59 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocumentEncoder.cpp, line 1184 11:42:59 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsCopySupport.cpp, line 123 11:42:59 INFO - MEMORY STAT | vsize 546MB | residentFast 113MB | heapAllocated 23MB 11:42:59 INFO - 587 INFO TEST-OK | layout/generic/test/test_bug719523.html | took 349ms 11:42:59 INFO - ++DOMWINDOW == 55 (0x7f85fb158800) [pid = 2905] [serial = 133] [outer = 0x7f85fcc91c00] 11:42:59 INFO - 588 INFO TEST-START | layout/generic/test/test_bug735641.html 11:42:59 INFO - ++DOMWINDOW == 56 (0x7f85fb163c00) [pid = 2905] [serial = 134] [outer = 0x7f85fcc91c00] 11:43:00 INFO - ++DOCSHELL 0x7f85fb31a800 == 3 [pid = 2905] [id = 20] 11:43:00 INFO - ++DOMWINDOW == 57 (0x7f85fb3eb000) [pid = 2905] [serial = 135] [outer = (nil)] 11:43:00 INFO - ++DOMWINDOW == 58 (0x7f85fb3f2400) [pid = 2905] [serial = 136] [outer = 0x7f85fb3eb000] 11:43:00 INFO - ++DOCSHELL 0x7f54dffbb000 == 10 [pid = 2852] [id = 12] 11:43:00 INFO - ++DOMWINDOW == 19 (0x7f54e2bcac00) [pid = 2852] [serial = 28] [outer = (nil)] 11:43:00 INFO - ++DOMWINDOW == 20 (0x7f54e3a15c00) [pid = 2852] [serial = 29] [outer = 0x7f54e2bcac00] 11:43:00 INFO - ++DOMWINDOW == 21 (0x7f54eaa86400) [pid = 2852] [serial = 30] [outer = 0x7f54e2bcac00] 11:43:00 INFO - ++DOMWINDOW == 59 (0x7f85fbc5c400) [pid = 2905] [serial = 137] [outer = 0x7f85fb3eb000] 11:43:01 INFO - --DOMWINDOW == 58 (0x7f85fb3f5000) [pid = 2905] [serial = 88] [outer = (nil)] [url = about:blank] 11:43:01 INFO - --DOMWINDOW == 57 (0x7f85fb3efc00) [pid = 2905] [serial = 86] [outer = (nil)] [url = about:blank] 11:43:01 INFO - --DOMWINDOW == 56 (0x7f85fbf97000) [pid = 2905] [serial = 119] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 55 (0x7f85fb3f4400) [pid = 2905] [serial = 117] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 54 (0x7f85fbc36000) [pid = 2905] [serial = 115] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 53 (0x7f85fbc30c00) [pid = 2905] [serial = 113] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 52 (0x7f85fbc35800) [pid = 2905] [serial = 112] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 51 (0x7f85fbc34400) [pid = 2905] [serial = 111] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 50 (0x7f85fb3f4800) [pid = 2905] [serial = 110] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 49 (0x7f85fbc31000) [pid = 2905] [serial = 106] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug579767_2.html] 11:43:01 INFO - --DOMWINDOW == 48 (0x7f85fbc2f000) [pid = 2905] [serial = 105] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 47 (0x7f85fbc2a800) [pid = 2905] [serial = 104] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 46 (0x7f85fbc29000) [pid = 2905] [serial = 103] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 45 (0x7f85fbac1400) [pid = 2905] [serial = 99] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug579767_1.html] 11:43:01 INFO - --DOMWINDOW == 44 (0x7f85fb3eb800) [pid = 2905] [serial = 96] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug579767.html] 11:43:01 INFO - --DOMWINDOW == 43 (0x7f85fb3e9800) [pid = 2905] [serial = 95] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 42 (0x7f85fafdf400) [pid = 2905] [serial = 94] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug527306.html] 11:43:01 INFO - --DOMWINDOW == 41 (0x7f85fb3ed000) [pid = 2905] [serial = 93] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 40 (0x7f85fb165c00) [pid = 2905] [serial = 83] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug514732.html] 11:43:01 INFO - --DOMWINDOW == 39 (0x7f85fafe2400) [pid = 2905] [serial = 92] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug524925.html] 11:43:01 INFO - --DOMWINDOW == 38 (0x7f85fafe1800) [pid = 2905] [serial = 91] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 37 (0x7f85fae40800) [pid = 2905] [serial = 90] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug522632.html] 11:43:01 INFO - --DOMWINDOW == 36 (0x7f85fae3e800) [pid = 2905] [serial = 89] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:01 INFO - --DOMWINDOW == 35 (0x7f85fb3f3c00) [pid = 2905] [serial = 87] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug514732_1.html] 11:43:01 INFO - --DOMWINDOW == 34 (0x7f85fbc5e800) [pid = 2905] [serial = 84] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug514732_helper.html] 11:43:01 INFO - --DOMWINDOW == 33 (0x7f85fbc33c00) [pid = 2905] [serial = 109] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 32 (0x7f85fbc33400) [pid = 2905] [serial = 108] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 31 (0x7f85fbc32c00) [pid = 2905] [serial = 107] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 30 (0x7f85fb3f4000) [pid = 2905] [serial = 98] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug579767_2.html] 11:43:01 INFO - --DOMWINDOW == 29 (0x7f85fae32000) [pid = 2905] [serial = 102] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 28 (0x7f85fbac6800) [pid = 2905] [serial = 101] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 27 (0x7f85fbac5000) [pid = 2905] [serial = 100] [outer = (nil)] [url = data:text/html,] 11:43:01 INFO - --DOMWINDOW == 26 (0x7f85fae3e400) [pid = 2905] [serial = 97] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_bug579767_1.html] 11:43:02 INFO - [Parent 2852] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 11:43:02 INFO - MEMORY STAT | vsize 546MB | residentFast 113MB | heapAllocated 24MB 11:43:02 INFO - 589 INFO TEST-OK | layout/generic/test/test_bug735641.html | took 2954ms 11:43:02 INFO - ++DOMWINDOW == 27 (0x7f85fb3efc00) [pid = 2905] [serial = 138] [outer = 0x7f85fcc91c00] 11:43:02 INFO - 590 INFO TEST-START | layout/generic/test/test_bug748961.html 11:43:03 INFO - ++DOMWINDOW == 28 (0x7f85fb3f3400) [pid = 2905] [serial = 139] [outer = 0x7f85fcc91c00] 11:43:03 INFO - ++DOCSHELL 0x7f85fbedb000 == 4 [pid = 2905] [id = 21] 11:43:03 INFO - ++DOMWINDOW == 29 (0x7f85fbc35800) [pid = 2905] [serial = 140] [outer = (nil)] 11:43:03 INFO - ++DOMWINDOW == 30 (0x7f85fbf92c00) [pid = 2905] [serial = 141] [outer = 0x7f85fbc35800] 11:43:03 INFO - MEMORY STAT | vsize 546MB | residentFast 111MB | heapAllocated 25MB 11:43:03 INFO - 591 INFO TEST-OK | layout/generic/test/test_bug748961.html | took 525ms 11:43:03 INFO - ++DOMWINDOW == 31 (0x7f85fc2d9c00) [pid = 2905] [serial = 142] [outer = 0x7f85fcc91c00] 11:43:03 INFO - 592 INFO TEST-START | layout/generic/test/test_bug756984.html 11:43:03 INFO - ++DOMWINDOW == 32 (0x7f85fb3e8400) [pid = 2905] [serial = 143] [outer = 0x7f85fcc91c00] 11:43:04 INFO - MEMORY STAT | vsize 546MB | residentFast 112MB | heapAllocated 26MB 11:43:04 INFO - 593 INFO TEST-OK | layout/generic/test/test_bug756984.html | took 998ms 11:43:04 INFO - ++DOMWINDOW == 33 (0x7f85fbf99400) [pid = 2905] [serial = 144] [outer = 0x7f85fcc91c00] 11:43:04 INFO - 594 INFO TEST-START | layout/generic/test/test_bug784410.html 11:43:04 INFO - ++DOMWINDOW == 34 (0x7f85fae33400) [pid = 2905] [serial = 145] [outer = 0x7f85fcc91c00] 11:43:05 INFO - --DOCSHELL 0x7f54e2dbf000 == 9 [pid = 2852] [id = 9] 11:43:05 INFO - --DOMWINDOW == 20 (0x7f54f4853000) [pid = 2852] [serial = 24] [outer = 0x7f54f2d17800] [url = about:blank] 11:43:05 INFO - --DOCSHELL 0x7f54df5bb000 == 8 [pid = 2852] [id = 8] 11:43:05 INFO - --DOCSHELL 0x7f54e2dc2800 == 7 [pid = 2852] [id = 10] 11:43:05 INFO - --DOMWINDOW == 19 (0x7f54f2d17800) [pid = 2852] [serial = 20] [outer = (nil)] [url = about:blank] 11:43:05 INFO - --DOMWINDOW == 18 (0x7f54f4853800) [pid = 2852] [serial = 25] [outer = 0x7f54f2d1b000] [url = about:blank] 11:43:05 INFO - ]: --DOMWINDOW == 17 (0x7f54f2d1b000) [pid = 2852] [serial = 21] [outer = (nil)] [url = about:blank] 11:43:05 INFO - MEMORY STAT | vsize 546MB | residentFast 113MB | heapAllocated 26MB 11:43:05 INFO - 595 INFO TEST-OK | layout/generic/test/test_bug784410.html | took 1271ms 11:43:06 INFO - ++DOMWINDOW == 35 (0x7f85fbc33c00) [pid = 2905] [serial = 146] [outer = 0x7f85fcc91c00] 11:43:06 INFO - 596 INFO TEST-START | layout/generic/test/test_bug785324.html 11:43:06 INFO - ++DOMWINDOW == 36 (0x7f85fafdcc00) [pid = 2905] [serial = 147] [outer = 0x7f85fcc91c00] 11:43:06 INFO - --DOCSHELL 0x7f85fb31a800 == 3 [pid = 2905] [id = 20] 11:43:06 INFO - --DOCSHELL 0x7f85fbedb000 == 2 [pid = 2905] [id = 21] 11:43:06 INFO - --DOMWINDOW == 35 (0x7f85fafe6000) [pid = 2905] [serial = 116] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug589623.html] 11:43:06 INFO - --DOMWINDOW == 34 (0x7f85fbabdc00) [pid = 2905] [serial = 114] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug589621.html] 11:43:07 INFO - MEMORY STAT | vsize 544MB | residentFast 108MB | heapAllocated 21MB 11:43:07 INFO - 597 INFO TEST-OK | layout/generic/test/test_bug785324.html | took 1116ms 11:43:07 INFO - ++DOMWINDOW == 35 (0x7f85fafe1c00) [pid = 2905] [serial = 148] [outer = 0x7f85fcc91c00] 11:43:07 INFO - 598 INFO TEST-START | layout/generic/test/test_bug791616.html 11:43:07 INFO - ++DOMWINDOW == 36 (0x7f85fafdac00) [pid = 2905] [serial = 149] [outer = 0x7f85fcc91c00] 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:07 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:07 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:07 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:07 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:07 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:07 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:07 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:07 INFO - MEMORY STAT | vsize 545MB | residentFast 109MB | heapAllocated 22MB 11:43:07 INFO - 599 INFO TEST-OK | layout/generic/test/test_bug791616.html | took 651ms 11:43:08 INFO - ++DOMWINDOW == 37 (0x7f85fb160800) [pid = 2905] [serial = 150] [outer = 0x7f85fcc91c00] 11:43:08 INFO - 600 INFO TEST-START | layout/generic/test/test_bug831780.html 11:43:08 INFO - ++DOMWINDOW == 38 (0x7f85fb3e9400) [pid = 2905] [serial = 151] [outer = 0x7f85fcc91c00] 11:43:08 INFO - MEMORY STAT | vsize 545MB | residentFast 109MB | heapAllocated 23MB 11:43:08 INFO - 601 INFO TEST-OK | layout/generic/test/test_bug831780.html | took 367ms 11:43:08 INFO - ++DOMWINDOW == 39 (0x7f85fb3f4c00) [pid = 2905] [serial = 152] [outer = 0x7f85fcc91c00] 11:43:08 INFO - 602 INFO TEST-START | layout/generic/test/test_bug841361.html 11:43:08 INFO - ++DOMWINDOW == 40 (0x7f85fb3f5800) [pid = 2905] [serial = 153] [outer = 0x7f85fcc91c00] 11:43:08 INFO - MEMORY STAT | vsize 545MB | residentFast 110MB | heapAllocated 24MB 11:43:09 INFO - 603 INFO TEST-OK | layout/generic/test/test_bug841361.html | took 472ms 11:43:09 INFO - ++DOMWINDOW == 41 (0x7f85fba8a000) [pid = 2905] [serial = 154] [outer = 0x7f85fcc91c00] 11:43:09 INFO - 604 INFO TEST-START | layout/generic/test/test_bug904810.html 11:43:09 INFO - --DOMWINDOW == 40 (0x7f85fd753400) [pid = 2905] [serial = 127] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 39 (0x7f85fbc2d000) [pid = 2905] [serial = 126] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug719503.html] 11:43:09 INFO - --DOMWINDOW == 38 (0x7f85fbc28800) [pid = 2905] [serial = 125] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 37 (0x7f85fc2de400) [pid = 2905] [serial = 123] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 36 (0x7f85fc18e800) [pid = 2905] [serial = 122] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug633762_iframe.html#a] 11:43:09 INFO - --DOMWINDOW == 35 (0x7f85fbc57c00) [pid = 2905] [serial = 120] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug633762.html] 11:43:09 INFO - --DOMWINDOW == 34 (0x7f85fbc32800) [pid = 2905] [serial = 118] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug597333.html] 11:43:09 INFO - --DOMWINDOW == 33 (0x7f85fb3f2400) [pid = 2905] [serial = 136] [outer = (nil)] [url = about:blank] 11:43:09 INFO - --DOMWINDOW == 32 (0x7f85fc2d9c00) [pid = 2905] [serial = 142] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 31 (0x7f85fb3efc00) [pid = 2905] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 30 (0x7f85fb158800) [pid = 2905] [serial = 133] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 29 (0x7f85fafde000) [pid = 2905] [serial = 132] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug719523.html] 11:43:09 INFO - --DOMWINDOW == 28 (0x7f85fae3ec00) [pid = 2905] [serial = 131] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 27 (0x7f85fafe3000) [pid = 2905] [serial = 129] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 26 (0x7f85fae3ac00) [pid = 2905] [serial = 128] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug719515.html] 11:43:09 INFO - --DOMWINDOW == 25 (0x7f85fbc33c00) [pid = 2905] [serial = 146] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 24 (0x7f85fbf99400) [pid = 2905] [serial = 144] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:09 INFO - --DOMWINDOW == 23 (0x7f85fb3eb000) [pid = 2905] [serial = 135] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_Dolske.png] 11:43:09 INFO - --DOMWINDOW == 22 (0x7f85fafe4800) [pid = 2905] [serial = 121] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/bug633762_iframe.html#a] 11:43:09 INFO - --DOMWINDOW == 21 (0x7f85fbc35800) [pid = 2905] [serial = 140] [outer = (nil)] [url = data:text/html,Selection

] 11:43:09 INFO - --DOMWINDOW == 20 (0x7f85fbc5c400) [pid = 2905] [serial = 137] [outer = (nil)] [url = about:blank] 11:43:09 INFO - --DOMWINDOW == 19 (0x7f85fbf92c00) [pid = 2905] [serial = 141] [outer = (nil)] [url = about:blank] 11:43:09 INFO - --DOMWINDOW == 18 (0x7f85fb3f3400) [pid = 2905] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug748961.html] 11:43:09 INFO - --DOMWINDOW == 17 (0x7f85fb163c00) [pid = 2905] [serial = 134] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug735641.html] 11:43:09 INFO - --DOMWINDOW == 16 (0x7f85fb3e8400) [pid = 2905] [serial = 143] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug756984.html] 11:43:09 INFO - ++DOMWINDOW == 17 (0x7f85fb3ea400) [pid = 2905] [serial = 155] [outer = 0x7f85fcc91c00] 11:43:10 INFO - MEMORY STAT | vsize 541MB | residentFast 110MB | heapAllocated 24MB 11:43:10 INFO - 605 INFO TEST-OK | layout/generic/test/test_bug904810.html | took 1309ms 11:43:10 INFO - ++DOMWINDOW == 18 (0x7f85fbc61800) [pid = 2905] [serial = 156] [outer = 0x7f85fcc91c00] 11:43:10 INFO - 606 INFO TEST-START | layout/generic/test/test_bug938772.html 11:43:10 INFO - ++DOMWINDOW == 19 (0x7f85fb3e8400) [pid = 2905] [serial = 157] [outer = 0x7f85fcc91c00] 11:43:11 INFO - ++DOCSHELL 0x7f85fbed6000 == 3 [pid = 2905] [id = 22] 11:43:11 INFO - ++DOMWINDOW == 20 (0x7f85fbf99400) [pid = 2905] [serial = 158] [outer = (nil)] 11:43:11 INFO - ++DOMWINDOW == 21 (0x7f85fbf9cc00) [pid = 2905] [serial = 159] [outer = 0x7f85fbf99400] 11:43:11 INFO - ++DOMWINDOW == 22 (0x7f85fbf9fc00) [pid = 2905] [serial = 160] [outer = 0x7f85fbf99400] 11:43:11 INFO - MEMORY STAT | vsize 542MB | residentFast 109MB | heapAllocated 25MB 11:43:11 INFO - 607 INFO TEST-OK | layout/generic/test/test_bug938772.html | took 494ms 11:43:11 INFO - ++DOMWINDOW == 23 (0x7f85fb3ec800) [pid = 2905] [serial = 161] [outer = 0x7f85fcc91c00] 11:43:11 INFO - 608 INFO TEST-START | layout/generic/test/test_bug970363.html 11:43:11 INFO - ++DOMWINDOW == 24 (0x7f85fb3ed000) [pid = 2905] [serial = 162] [outer = 0x7f85fcc91c00] 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, mSelection.mAnchor, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 348 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(frame) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1112 11:43:11 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/ContentEventHandler.cpp, line 1294 11:43:11 INFO - [Child 2905] WARNING: '!textRect.mSucceeded', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 285 11:43:11 INFO - [Child 2905] WARNING: '!QueryCharRect(aWidget, 0, charRect)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/widget/ContentCache.cpp, line 395 11:43:11 INFO - MEMORY STAT | vsize 542MB | residentFast 110MB | heapAllocated 25MB 11:43:11 INFO - 609 INFO TEST-OK | layout/generic/test/test_bug970363.html | took 540ms 11:43:12 INFO - ++DOMWINDOW == 25 (0x7f85fbc5f800) [pid = 2905] [serial = 163] [outer = 0x7f85fcc91c00] 11:43:12 INFO - 610 INFO TEST-START | layout/generic/test/test_contained_plugin_transplant.html 11:43:12 INFO - ++DOMWINDOW == 26 (0x7f85fae39000) [pid = 2905] [serial = 164] [outer = 0x7f85fcc91c00] 11:43:12 INFO - ++DOCSHELL 0x7f85fb04c800 == 4 [pid = 2905] [id = 23] 11:43:12 INFO - ++DOMWINDOW == 27 (0x7f85fae3b800) [pid = 2905] [serial = 165] [outer = (nil)] 11:43:12 INFO - ++DOCSHELL 0x7f85fb052000 == 5 [pid = 2905] [id = 24] 11:43:12 INFO - ++DOMWINDOW == 28 (0x7f85fafde400) [pid = 2905] [serial = 166] [outer = (nil)] 11:43:12 INFO - ++DOMWINDOW == 29 (0x7f85fafe1400) [pid = 2905] [serial = 167] [outer = 0x7f85fae3b800] 11:43:12 INFO - ++DOMWINDOW == 30 (0x7f85fb164800) [pid = 2905] [serial = 168] [outer = 0x7f85fafde400] 11:43:12 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:12 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:43:12 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:43:13 INFO - ++DOCSHELL 0x7f85fb04d800 == 6 [pid = 2905] [id = 25] 11:43:13 INFO - ++DOMWINDOW == 31 (0x7f85fbf9e800) [pid = 2905] [serial = 169] [outer = (nil)] 11:43:13 INFO - ++DOMWINDOW == 32 (0x7f85fc191400) [pid = 2905] [serial = 170] [outer = 0x7f85fbf9e800] 11:43:13 INFO - MEMORY STAT | vsize 542MB | residentFast 112MB | heapAllocated 26MB 11:43:13 INFO - [Parent 2852] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 11:43:13 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:13 INFO - 611 INFO TEST-OK | layout/generic/test/test_contained_plugin_transplant.html | took 1426ms 11:43:14 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aChild) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/shistory/nsSHEntry.cpp, line 731 11:43:14 INFO - ++DOMWINDOW == 33 (0x7f85fcc8f400) [pid = 2905] [serial = 171] [outer = 0x7f85fcc91c00] 11:43:14 INFO - 612 INFO TEST-START | layout/generic/test/test_image_selection.html 11:43:14 INFO - ++DOMWINDOW == 34 (0x7f85fb3e7800) [pid = 2905] [serial = 172] [outer = 0x7f85fcc91c00] 11:43:14 INFO - ++DOCSHELL 0x7f85fb04f000 == 7 [pid = 2905] [id = 26] 11:43:14 INFO - ++DOMWINDOW == 35 (0x7f85fae3ec00) [pid = 2905] [serial = 173] [outer = (nil)] 11:43:14 INFO - ++DOMWINDOW == 36 (0x7f85fb159400) [pid = 2905] [serial = 174] [outer = 0x7f85fae3ec00] 11:43:14 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:43:14 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:43:14 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:43:15 INFO - --DOCSHELL 0x7f85fbed6000 == 6 [pid = 2905] [id = 22] 11:43:15 INFO - --DOCSHELL 0x7f85fb052000 == 5 [pid = 2905] [id = 24] 11:43:15 INFO - --DOCSHELL 0x7f85fb04c800 == 4 [pid = 2905] [id = 23] 11:43:15 INFO - --DOCSHELL 0x7f85fb04d800 == 3 [pid = 2905] [id = 25] 11:43:15 INFO - --DOMWINDOW == 35 (0x7f85fafdb000) [pid = 2905] [serial = 124] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug666225.html] 11:43:15 INFO - --DOMWINDOW == 34 (0x7f85fafe4400) [pid = 2905] [serial = 130] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug719518.html] 11:43:15 INFO - MEMORY STAT | vsize 541MB | residentFast 111MB | heapAllocated 23MB 11:43:15 INFO - 613 INFO TEST-OK | layout/generic/test/test_image_selection.html | took 1465ms 11:43:15 INFO - ++DOMWINDOW == 35 (0x7f85fb15f800) [pid = 2905] [serial = 175] [outer = 0x7f85fcc91c00] 11:43:15 INFO - 614 INFO TEST-START | layout/generic/test/test_image_selection_2.html 11:43:16 INFO - ++DOMWINDOW == 36 (0x7f85fb165000) [pid = 2905] [serial = 176] [outer = 0x7f85fcc91c00] 11:43:16 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0xC1F30001: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/extensions/spellcheck/src/mozInlineSpellChecker.cpp, line 1797 11:43:16 INFO - MEMORY STAT | vsize 542MB | residentFast 111MB | heapAllocated 24MB 11:43:16 INFO - 615 INFO TEST-OK | layout/generic/test/test_image_selection_2.html | took 1093ms 11:43:16 INFO - ++DOMWINDOW == 37 (0x7f85fbc2fc00) [pid = 2905] [serial = 177] [outer = 0x7f85fcc91c00] 11:43:16 INFO - 616 INFO TEST-START | layout/generic/test/test_invalidate_during_plugin_paint.html 11:43:17 INFO - ++DOMWINDOW == 38 (0x7f85fbc5c400) [pid = 2905] [serial = 178] [outer = 0x7f85fcc91c00] 11:43:17 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:17 INFO - For application/x-test found plugin libnptest.so 11:43:17 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpYluOsJ.mozrunner/runtests_leaks_plugin_pid2943.log 11:43:17 INFO - Xlib: extension "RANDR" missing on display ":0". 11:43:17 INFO - LoadPlugin() /tmp/tmpYluOsJ.mozrunner/plugins/libnptest.so returned 7f6a25b76310 11:43:17 INFO - [NPAPI 2943] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:43:17 INFO - [NPAPI 2943] WARNING: NS_ENSURE_TRUE(InitStaticMembers()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/modules/libpref/Preferences.cpp, line 1352 11:43:17 INFO - [NPAPI 2943] WARNING: '!compMgr', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/glue/nsComponentManagerUtils.cpp, line 63 11:43:18 INFO - --DOMWINDOW == 37 (0x7f85fcc8f400) [pid = 2905] [serial = 171] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 36 (0x7f85fb3ec800) [pid = 2905] [serial = 161] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 35 (0x7f85fbf9fc00) [pid = 2905] [serial = 160] [outer = (nil)] [url = data:text/html,] 11:43:18 INFO - --DOMWINDOW == 34 (0x7f85fbf9cc00) [pid = 2905] [serial = 159] [outer = (nil)] [url = about:blank] 11:43:18 INFO - --DOMWINDOW == 33 (0x7f85fbc61800) [pid = 2905] [serial = 156] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 32 (0x7f85fba8a000) [pid = 2905] [serial = 154] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 31 (0x7f85fb3f5800) [pid = 2905] [serial = 153] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug841361.html] 11:43:18 INFO - --DOMWINDOW == 30 (0x7f85fb3f4c00) [pid = 2905] [serial = 152] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 29 (0x7f85fb160800) [pid = 2905] [serial = 150] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 28 (0x7f85fafe1c00) [pid = 2905] [serial = 148] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 27 (0x7f85fafe1400) [pid = 2905] [serial = 167] [outer = (nil)] [url = data:text/html,] 11:43:18 INFO - --DOMWINDOW == 26 (0x7f85fbc5f800) [pid = 2905] [serial = 163] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:18 INFO - --DOMWINDOW == 25 (0x7f85fbf99400) [pid = 2905] [serial = 158] [outer = (nil)] [url = data:text/html,] 11:43:18 INFO - --DOMWINDOW == 24 (0x7f85fafde400) [pid = 2905] [serial = 166] [outer = (nil)] [url = about:blank] 11:43:18 INFO - --DOMWINDOW == 23 (0x7f85fae3b800) [pid = 2905] [serial = 165] [outer = (nil)] [url = data:text/html,] 11:43:18 INFO - --DOMWINDOW == 22 (0x7f85fb3e9400) [pid = 2905] [serial = 151] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug831780.html] 11:43:18 INFO - --DOMWINDOW == 21 (0x7f85fae39000) [pid = 2905] [serial = 164] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_contained_plugin_transplant.html] 11:43:18 INFO - MEMORY STAT | vsize 552MB | residentFast 111MB | heapAllocated 25MB 11:43:18 INFO - 617 INFO TEST-OK | layout/generic/test/test_invalidate_during_plugin_paint.html | took 1672ms 11:43:18 INFO - ++DOMWINDOW == 22 (0x7f85fbc2d800) [pid = 2905] [serial = 179] [outer = 0x7f85fcc91c00] 11:43:18 INFO - 618 INFO TEST-START | layout/generic/test/test_movement_by_characters.html 11:43:19 INFO - ++DOMWINDOW == 23 (0x7f85fae3d800) [pid = 2905] [serial = 180] [outer = 0x7f85fcc91c00] 11:43:19 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aSelection->RangeCount()) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3698 11:43:19 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsEditor.cpp, line 3677 11:43:19 INFO - [Child 2905] WARNING: NS_ENSURE_SUCCESS(res, res) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/editor/libeditor/nsHTMLEditRules.cpp, line 8098 11:43:19 INFO - [Child 2905] WARNING: offset after this frame's content: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 7114 11:43:19 INFO - [Child 2905] WARNING: offset after this frame's content: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 7114 11:43:19 INFO - MEMORY STAT | vsize 552MB | residentFast 111MB | heapAllocated 26MB 11:43:20 INFO - 619 INFO TEST-OK | layout/generic/test/test_movement_by_characters.html | took 1044ms 11:43:20 INFO - ++DOMWINDOW == 24 (0x7f85fc193000) [pid = 2905] [serial = 181] [outer = 0x7f85fcc91c00] 11:43:20 INFO - --DOMWINDOW == 16 (0x7f54e3a15c00) [pid = 2852] [serial = 29] [outer = (nil)] [url = about:blank] 11:43:20 INFO - 620 INFO TEST-START | layout/generic/test/test_overflow_event.html 11:43:20 INFO - ++DOMWINDOW == 25 (0x7f85fae3ac00) [pid = 2905] [serial = 182] [outer = 0x7f85fcc91c00] 11:43:20 INFO - MEMORY STAT | vsize 552MB | residentFast 112MB | heapAllocated 26MB 11:43:20 INFO - 621 INFO TEST-OK | layout/generic/test/test_overflow_event.html | took 421ms 11:43:20 INFO - ++DOMWINDOW == 26 (0x7f860106ac00) [pid = 2905] [serial = 183] [outer = 0x7f85fcc91c00] 11:43:20 INFO - 622 INFO TEST-START | layout/generic/test/test_page_scroll_with_fixed_pos.html 11:43:21 INFO - ++DOMWINDOW == 27 (0x7f86010bac00) [pid = 2905] [serial = 184] [outer = 0x7f85fcc91c00] 11:43:21 INFO - ++DOCSHELL 0x7f85fd799000 == 4 [pid = 2905] [id = 27] 11:43:21 INFO - ++DOMWINDOW == 28 (0x7f86010efc00) [pid = 2905] [serial = 185] [outer = (nil)] 11:43:21 INFO - ++DOCSHELL 0x7f54e29a1800 == 8 [pid = 2852] [id = 13] 11:43:21 INFO - ++DOMWINDOW == 17 (0x7f54e3a17c00) [pid = 2852] [serial = 31] [outer = (nil)] 11:43:21 INFO - ++DOMWINDOW == 18 (0x7f54eaa91400) [pid = 2852] [serial = 32] [outer = 0x7f54e3a17c00] 11:43:21 INFO - ++DOCSHELL 0x7f54e3616800 == 9 [pid = 2852] [id = 14] 11:43:21 INFO - ++DOMWINDOW == 19 (0x7f54f4855800) [pid = 2852] [serial = 33] [outer = (nil)] 11:43:21 INFO - ++DOCSHELL 0x7f54e3619000 == 10 [pid = 2852] [id = 15] 11:43:21 INFO - ++DOMWINDOW == 20 (0x7f54f6dee400) [pid = 2852] [serial = 34] [outer = (nil)] 11:43:21 INFO - ++DOCSHELL 0x7f54ec626800 == 11 [pid = 2852] [id = 16] 11:43:21 INFO - ++DOMWINDOW == 21 (0x7f54f75cb800) [pid = 2852] [serial = 35] [outer = (nil)] 11:43:21 INFO - ++DOMWINDOW == 22 (0x7f54f8144800) [pid = 2852] [serial = 36] [outer = 0x7f54f75cb800] 11:43:21 INFO - ++DOMWINDOW == 23 (0x7f54f814c800) [pid = 2852] [serial = 37] [outer = 0x7f54f4855800] 11:43:21 INFO - ++DOMWINDOW == 24 (0x7f54f814fc00) [pid = 2852] [serial = 38] [outer = 0x7f54f6dee400] 11:43:21 INFO - ++DOMWINDOW == 25 (0x7f54f81cdc00) [pid = 2852] [serial = 39] [outer = 0x7f54f75cb800] 11:43:22 INFO - ++DOMWINDOW == 26 (0x7f54f7077c00) [pid = 2852] [serial = 40] [outer = 0x7f54f75cb800] 11:43:22 INFO - ++DOMWINDOW == 29 (0x7f8601394000) [pid = 2905] [serial = 186] [outer = 0x7f86010efc00] 11:43:23 INFO - ++DOMWINDOW == 30 (0x7f8601469c00) [pid = 2905] [serial = 187] [outer = 0x7f86010efc00] 11:43:24 INFO - MEMORY STAT | vsize 552MB | residentFast 114MB | heapAllocated 27MB 11:43:25 INFO - 623 INFO TEST-OK | layout/generic/test/test_page_scroll_with_fixed_pos.html | took 4796ms 11:43:25 INFO - ++DOMWINDOW == 31 (0x7f85fc2d5c00) [pid = 2905] [serial = 188] [outer = 0x7f85fcc91c00] 11:43:26 INFO - 624 INFO TEST-START | layout/generic/test/test_plugin_focus.html 11:43:26 INFO - ++DOMWINDOW == 32 (0x7f85fd921000) [pid = 2905] [serial = 189] [outer = 0x7f85fcc91c00] 11:43:26 INFO - ++DOCSHELL 0x7f86005a8000 == 5 [pid = 2905] [id = 28] 11:43:26 INFO - ++DOMWINDOW == 33 (0x7f860148e800) [pid = 2905] [serial = 190] [outer = (nil)] 11:43:26 INFO - ++DOCSHELL 0x7f54f6f24800 == 12 [pid = 2852] [id = 17] 11:43:26 INFO - ++DOMWINDOW == 27 (0x7f54e183a000) [pid = 2852] [serial = 41] [outer = (nil)] 11:43:26 INFO - ++DOMWINDOW == 28 (0x7f54e183b000) [pid = 2852] [serial = 42] [outer = 0x7f54e183a000] 11:43:26 INFO - ++DOCSHELL 0x7f54f7105000 == 13 [pid = 2852] [id = 18] 11:43:26 INFO - ++DOMWINDOW == 29 (0x7f54e38a0000) [pid = 2852] [serial = 43] [outer = (nil)] 11:43:26 INFO - ++DOCSHELL 0x7f54f7570800 == 14 [pid = 2852] [id = 19] 11:43:26 INFO - ++DOMWINDOW == 30 (0x7f54e38a0c00) [pid = 2852] [serial = 44] [outer = (nil)] 11:43:27 INFO - ++DOCSHELL 0x7f54f8105000 == 15 [pid = 2852] [id = 20] 11:43:27 INFO - ++DOMWINDOW == 31 (0x7f54f707c800) [pid = 2852] [serial = 45] [outer = (nil)] 11:43:27 INFO - ++DOMWINDOW == 32 (0x7f54f7081400) [pid = 2852] [serial = 46] [outer = 0x7f54f707c800] 11:43:27 INFO - ++DOMWINDOW == 33 (0x7f54e3898000) [pid = 2852] [serial = 47] [outer = 0x7f54e38a0000] 11:43:27 INFO - ++DOMWINDOW == 34 (0x7f54f7083800) [pid = 2852] [serial = 48] [outer = 0x7f54e38a0c00] 11:43:27 INFO - ++DOMWINDOW == 35 (0x7f54f7085c00) [pid = 2852] [serial = 49] [outer = 0x7f54f707c800] 11:43:27 INFO - ++DOMWINDOW == 36 (0x7f54f75c6000) [pid = 2852] [serial = 50] [outer = 0x7f54f707c800] 11:43:28 INFO - ++DOMWINDOW == 34 (0x7f85fa41f800) [pid = 2905] [serial = 191] [outer = 0x7f860148e800] 11:43:28 INFO - ++DOMWINDOW == 35 (0x7f85fa424400) [pid = 2905] [serial = 192] [outer = 0x7f860148e800] 11:43:29 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:29 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:29 INFO - For application/x-test found plugin libnptest.so 11:43:29 INFO - For application/x-test found plugin libnptest.so 11:43:30 INFO - --DOCSHELL 0x7f85fb04f000 == 4 [pid = 2905] [id = 26] 11:43:30 INFO - --DOCSHELL 0x7f85fd799000 == 3 [pid = 2905] [id = 27] 11:43:30 INFO - --DOMWINDOW == 34 (0x7f85fb164800) [pid = 2905] [serial = 168] [outer = (nil)] [url = about:blank] 11:43:30 INFO - --DOMWINDOW == 33 (0x7f85fb3e8400) [pid = 2905] [serial = 157] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug938772.html] 11:43:30 INFO - --DOMWINDOW == 32 (0x7f85fafdcc00) [pid = 2905] [serial = 147] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug785324.html] 11:43:30 INFO - [Child 2905] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:43:31 INFO - MEMORY STAT | vsize 553MB | residentFast 113MB | heapAllocated 23MB 11:43:31 INFO - 625 INFO TEST-OK | layout/generic/test/test_plugin_focus.html | took 5387ms 11:43:31 INFO - ++DOMWINDOW == 33 (0x7f85fa42c400) [pid = 2905] [serial = 193] [outer = 0x7f85fcc91c00] 11:43:31 INFO - 626 INFO TEST-START | layout/generic/test/test_plugin_mouse_coords.html 11:43:32 INFO - ++DOMWINDOW == 34 (0x7f85fae32800) [pid = 2905] [serial = 194] [outer = 0x7f85fcc91c00] 11:43:32 INFO - ++DOCSHELL 0x7f85fb051800 == 4 [pid = 2905] [id = 29] 11:43:32 INFO - ++DOMWINDOW == 35 (0x7f85fafdc800) [pid = 2905] [serial = 195] [outer = (nil)] 11:43:32 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:32 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:32 INFO - For application/x-test found plugin libnptest.so 11:43:32 INFO - For application/x-test found plugin libnptest.so 11:43:33 INFO - ++DOMWINDOW == 36 (0x7f85fafdfc00) [pid = 2905] [serial = 196] [outer = 0x7f85fafdc800] 11:43:33 INFO - --DOCSHELL 0x7f54ec626800 == 14 [pid = 2852] [id = 16] 11:43:33 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(aURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/dns/nsEffectiveTLDService.cpp, line 161 11:43:33 INFO - For application/x-test found plugin libnptest.so 11:43:33 INFO - --DOMWINDOW == 35 (0x7f85fb3ea400) [pid = 2905] [serial = 155] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug904810.html] 11:43:33 INFO - --DOMWINDOW == 34 (0x7f85fafdac00) [pid = 2905] [serial = 149] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug791616.html] 11:43:33 INFO - --DOMWINDOW == 33 (0x7f85fb159400) [pid = 2905] [serial = 174] [outer = (nil)] [url = about:blank] 11:43:33 INFO - --DOMWINDOW == 32 (0x7f85fb3e7800) [pid = 2905] [serial = 172] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_image_selection.html] 11:43:33 INFO - --DOMWINDOW == 31 (0x7f860106ac00) [pid = 2905] [serial = 183] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 30 (0x7f85fc193000) [pid = 2905] [serial = 181] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 29 (0x7f85fbc2d800) [pid = 2905] [serial = 179] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 28 (0x7f85fbc5c400) [pid = 2905] [serial = 178] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_invalidate_during_plugin_paint.html] 11:43:33 INFO - --DOMWINDOW == 27 (0x7f85fbc2fc00) [pid = 2905] [serial = 177] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 26 (0x7f85fb15f800) [pid = 2905] [serial = 175] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 25 (0x7f85fc191400) [pid = 2905] [serial = 170] [outer = (nil)] [url = about:blank] 11:43:33 INFO - --DOMWINDOW == 24 (0x7f85fc2d5c00) [pid = 2905] [serial = 188] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:33 INFO - --DOMWINDOW == 23 (0x7f8601394000) [pid = 2905] [serial = 186] [outer = (nil)] [url = about:blank] 11:43:33 INFO - --DOMWINDOW == 22 (0x7f85fae3ec00) [pid = 2905] [serial = 173] [outer = (nil)] [url = about:blank] 11:43:33 INFO - --DOMWINDOW == 21 (0x7f85fbf9e800) [pid = 2905] [serial = 169] [outer = (nil)] [url = data:text/html,] 11:43:33 INFO - --DOMWINDOW == 20 (0x7f86010efc00) [pid = 2905] [serial = 185] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/page_scroll_with_fixed_pos_window.html] 11:43:33 INFO - --DOMWINDOW == 19 (0x7f85fb3ed000) [pid = 2905] [serial = 162] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug970363.html] 11:43:33 INFO - --DOMWINDOW == 18 (0x7f86010bac00) [pid = 2905] [serial = 184] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_page_scroll_with_fixed_pos.html] 11:43:33 INFO - --DOMWINDOW == 17 (0x7f8601469c00) [pid = 2905] [serial = 187] [outer = (nil)] [url = about:blank] 11:43:34 INFO - MEMORY STAT | vsize 553MB | residentFast 114MB | heapAllocated 24MB 11:43:34 INFO - 627 INFO TEST-OK | layout/generic/test/test_plugin_mouse_coords.html | took 3022ms 11:43:34 INFO - ++DOMWINDOW == 18 (0x7f85fb3e7800) [pid = 2905] [serial = 197] [outer = 0x7f85fcc91c00] 11:43:34 INFO - 628 INFO TEST-START | layout/generic/test/test_scroll_behavior.html 11:43:35 INFO - --DOMWINDOW == 35 (0x7f54f7077c00) [pid = 2852] [serial = 40] [outer = (nil)] [url = about:blank] 11:43:35 INFO - --DOMWINDOW == 34 (0x7f54f81cdc00) [pid = 2852] [serial = 39] [outer = (nil)] [url = about:blank] 11:43:35 INFO - --DOMWINDOW == 33 (0x7f54f8144800) [pid = 2852] [serial = 36] [outer = (nil)] [url = about:blank] 11:43:35 INFO - --DOMWINDOW == 32 (0x7f54f75cb800) [pid = 2852] [serial = 35] [outer = (nil)] [url = about:blank] 11:43:35 INFO - ++DOMWINDOW == 19 (0x7f85fafdac00) [pid = 2905] [serial = 198] [outer = 0x7f85fcc91c00] 11:43:35 INFO - MEMORY STAT | vsize 553MB | residentFast 114MB | heapAllocated 25MB 11:43:35 INFO - 629 INFO TEST-OK | layout/generic/test/test_scroll_behavior.html | took 463ms 11:43:35 INFO - ++DOMWINDOW == 20 (0x7f85fb163c00) [pid = 2905] [serial = 199] [outer = 0x7f85fcc91c00] 11:43:35 INFO - 630 INFO TEST-START | layout/generic/test/test_selection_expanding.html 11:43:35 INFO - ++DOMWINDOW == 21 (0x7f85fafddc00) [pid = 2905] [serial = 200] [outer = 0x7f85fcc91c00] 11:43:35 INFO - ++DOCSHELL 0x7f85fbec2800 == 5 [pid = 2905] [id = 30] 11:43:35 INFO - ++DOMWINDOW == 22 (0x7f85fa427c00) [pid = 2905] [serial = 201] [outer = (nil)] 11:43:36 INFO - ++DOMWINDOW == 23 (0x7f85fba86000) [pid = 2905] [serial = 202] [outer = 0x7f85fa427c00] 11:43:40 INFO - MEMORY STAT | vsize 553MB | residentFast 121MB | heapAllocated 33MB 11:43:40 INFO - 631 INFO TEST-OK | layout/generic/test/test_selection_expanding.html | took 4834ms 11:43:40 INFO - ++DOMWINDOW == 24 (0x7f85f905e000) [pid = 2905] [serial = 203] [outer = 0x7f85fcc91c00] 11:43:40 INFO - 632 INFO TEST-START | layout/generic/test/test_selection_splitText-normalize.html 11:43:41 INFO - ++DOMWINDOW == 25 (0x7f85f9060c00) [pid = 2905] [serial = 204] [outer = 0x7f85fcc91c00] 11:43:42 INFO - MEMORY STAT | vsize 558MB | residentFast 120MB | heapAllocated 30MB 11:43:42 INFO - 633 INFO TEST-OK | layout/generic/test/test_selection_splitText-normalize.html | took 1489ms 11:43:42 INFO - ++DOMWINDOW == 26 (0x7f85f9086c00) [pid = 2905] [serial = 205] [outer = 0x7f85fcc91c00] 11:43:42 INFO - 634 INFO TEST-START | layout/generic/test/test_selection_touchevents.html 11:43:42 INFO - ++DOMWINDOW == 27 (0x7f85f9087000) [pid = 2905] [serial = 206] [outer = 0x7f85fcc91c00] 11:43:43 INFO - MEMORY STAT | vsize 559MB | residentFast 121MB | heapAllocated 31MB 11:43:43 INFO - 635 INFO TEST-OK | layout/generic/test/test_selection_touchevents.html | took 672ms 11:43:43 INFO - ++DOMWINDOW == 28 (0x7f85f908fc00) [pid = 2905] [serial = 207] [outer = 0x7f85fcc91c00] 11:43:43 INFO - 636 INFO TEST-START | layout/generic/test/test_taintedfilters.html 11:43:44 INFO - --DOCSHELL 0x7f86005a8000 == 4 [pid = 2905] [id = 28] 11:43:44 INFO - --DOCSHELL 0x7f85fb051800 == 3 [pid = 2905] [id = 29] 11:43:44 INFO - --DOCSHELL 0x7f85fbec2800 == 2 [pid = 2905] [id = 30] 11:43:44 INFO - ++DOMWINDOW == 29 (0x7f85f8f12000) [pid = 2905] [serial = 208] [outer = 0x7f85fcc91c00] 11:43:44 INFO - --DOMWINDOW == 28 (0x7f85fb165000) [pid = 2905] [serial = 176] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_image_selection_2.html] 11:43:44 INFO - --DOMWINDOW == 27 (0x7f85fae3ac00) [pid = 2905] [serial = 182] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_overflow_event.html] 11:43:45 INFO - ++DOCSHELL 0x7f85f8f9a800 == 3 [pid = 2905] [id = 31] 11:43:45 INFO - ++DOMWINDOW == 28 (0x7f85f8f16c00) [pid = 2905] [serial = 209] [outer = (nil)] 11:43:45 INFO - ++DOCSHELL 0x7f85f8f9c800 == 4 [pid = 2905] [id = 32] 11:43:45 INFO - ++DOMWINDOW == 29 (0x7f85f8f18000) [pid = 2905] [serial = 210] [outer = (nil)] 11:43:45 INFO - ++DOMWINDOW == 30 (0x7f85f8f1a400) [pid = 2905] [serial = 211] [outer = 0x7f85f8f16c00] 11:43:45 INFO - ++DOMWINDOW == 31 (0x7f85f8f1bc00) [pid = 2905] [serial = 212] [outer = 0x7f85f8f18000] 11:43:45 INFO - ++DOMWINDOW == 32 (0x7f85f8f14800) [pid = 2905] [serial = 213] [outer = 0x7f85f8f16c00] 11:43:46 INFO - ++DOMWINDOW == 33 (0x7f85f8f1ec00) [pid = 2905] [serial = 214] [outer = 0x7f85f8f18000] 11:43:46 INFO - ++DOMWINDOW == 34 (0x7f85f8f1b400) [pid = 2905] [serial = 215] [outer = 0x7f85f8f16c00] 11:43:46 INFO - --DOCSHELL 0x7f54e3616800 == 13 [pid = 2852] [id = 14] 11:43:46 INFO - --DOCSHELL 0x7f54f7105000 == 12 [pid = 2852] [id = 18] 11:43:46 INFO - --DOMWINDOW == 31 (0x7f54f814c800) [pid = 2852] [serial = 37] [outer = 0x7f54f4855800] [url = about:blank] 11:43:46 INFO - --DOMWINDOW == 30 (0x7f54e3898000) [pid = 2852] [serial = 47] [outer = 0x7f54e38a0000] [url = about:blank] 11:43:46 INFO - --DOCSHELL 0x7f54e3619000 == 11 [pid = 2852] [id = 15] 11:43:46 INFO - --DOCSHELL 0x7f54e29a1800 == 10 [pid = 2852] [id = 13] 11:43:46 INFO - --DOMWINDOW == 29 (0x7f54e38a0000) [pid = 2852] [serial = 43] [outer = (nil)] [url = about:blank] 11:43:46 INFO - ]: --DOMWINDOW == 28 (0x7f54f4855800) [pid = 2852] [serial = 33] [outer = (nil)] [url = about:blank] 11:43:46 INFO - --DOCSHELL 0x7f54f7570800 == 9 [pid = 2852] [id = 19] 11:43:46 INFO - --DOCSHELL 0x7f54f6f24800 == 8 [pid = 2852] [id = 17] 11:43:46 INFO - --DOCSHELL 0x7f54f8105000 == 7 [pid = 2852] [id = 20] 11:43:46 INFO - ++DOMWINDOW == 35 (0x7f85f8f1c400) [pid = 2905] [serial = 216] [outer = 0x7f85f8f18000] 11:43:46 INFO - --DOMWINDOW == 27 (0x7f54f814fc00) [pid = 2852] [serial = 38] [outer = 0x7f54f6dee400] [url = about:blank] 11:43:46 INFO - --DOMWINDOW == 26 (0x7f54f7083800) [pid = 2852] [serial = 48] [outer = 0x7f54e38a0c00] [url = about:blank] 11:43:46 INFO - ]: --DOMWINDOW == 25 (0x7f54e38a0c00) [pid = 2852] [serial = 44] [outer = (nil)] [url = about:blank] 11:43:46 INFO - --DOMWINDOW == 24 (0x7f54f6dee400) [pid = 2852] [serial = 34] [outer = (nil)] [url = about:blank] 11:43:46 INFO - ++DOMWINDOW == 36 (0x7f85f904a400) [pid = 2905] [serial = 217] [outer = 0x7f85f8f18000] 11:43:46 INFO - ++DOMWINDOW == 37 (0x7f85f8f1dc00) [pid = 2905] [serial = 218] [outer = 0x7f85f8f16c00] 11:43:47 INFO - ++DOMWINDOW == 38 (0x7f85f9056c00) [pid = 2905] [serial = 219] [outer = 0x7f85f8f18000] 11:43:47 INFO - ++DOMWINDOW == 39 (0x7f85f8f1f400) [pid = 2905] [serial = 220] [outer = 0x7f85f8f16c00] 11:43:47 INFO - MEMORY STAT | vsize 562MB | residentFast 116MB | heapAllocated 25MB 11:43:47 INFO - 637 INFO TEST-OK | layout/generic/test/test_taintedfilters.html | took 3489ms 11:43:47 INFO - ++DOMWINDOW == 40 (0x7f85f9064800) [pid = 2905] [serial = 221] [outer = 0x7f85fcc91c00] 11:43:47 INFO - --DOMWINDOW == 39 (0x7f85f9060c00) [pid = 2905] [serial = 204] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_selection_splitText-normalize.html] 11:43:47 INFO - --DOMWINDOW == 38 (0x7f85f9086c00) [pid = 2905] [serial = 205] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:47 INFO - --DOMWINDOW == 37 (0x7f85fae3d800) [pid = 2905] [serial = 180] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_movement_by_characters.html] 11:43:47 INFO - --DOMWINDOW == 36 (0x7f85f905e000) [pid = 2905] [serial = 203] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:47 INFO - --DOMWINDOW == 35 (0x7f85fb163c00) [pid = 2905] [serial = 199] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:47 INFO - --DOMWINDOW == 34 (0x7f85fb3e7800) [pid = 2905] [serial = 197] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:47 INFO - --DOMWINDOW == 33 (0x7f85fafdfc00) [pid = 2905] [serial = 196] [outer = (nil)] [url = data:text/html,] 11:43:47 INFO - --DOMWINDOW == 32 (0x7f85fae32800) [pid = 2905] [serial = 194] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_plugin_mouse_coords.html] 11:43:47 INFO - --DOMWINDOW == 31 (0x7f85fa42c400) [pid = 2905] [serial = 193] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:47 INFO - --DOMWINDOW == 30 (0x7f85fa41f800) [pid = 2905] [serial = 191] [outer = (nil)] [url = about:blank] 11:43:47 INFO - --DOMWINDOW == 29 (0x7f85f9087000) [pid = 2905] [serial = 206] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_selection_touchevents.html] 11:43:47 INFO - --DOMWINDOW == 28 (0x7f85fba86000) [pid = 2905] [serial = 202] [outer = (nil)] [url = data:text/html,*{margin:%200;%20padding:%200;%20font-size:%2016px;}
ffffff%20ffffff%20ffffff%20ffffff
] 11:43:47 INFO - --DOMWINDOW == 27 (0x7f85fafddc00) [pid = 2905] [serial = 200] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_selection_expanding.html] 11:43:47 INFO - --DOMWINDOW == 26 (0x7f85fafdc800) [pid = 2905] [serial = 195] [outer = (nil)] [url = data:text/html,] 11:43:47 INFO - --DOMWINDOW == 25 (0x7f860148e800) [pid = 2905] [serial = 190] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/plugin_focus_helper.html] 11:43:47 INFO - --DOMWINDOW == 24 (0x7f85fa427c00) [pid = 2905] [serial = 201] [outer = (nil)] [url = data:text/html,*{margin:%200;%20padding:%200;%20font-size:%2016px;}
ffffff%20ffffff%20ffffff%20ffffff
] 11:43:47 INFO - --DOMWINDOW == 23 (0x7f85fafdac00) [pid = 2905] [serial = 198] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_scroll_behavior.html] 11:43:47 INFO - ++DOMWINDOW == 24 (0x7f85f9065400) [pid = 2905] [serial = 222] [outer = 0x7f85fcc91c00] 11:43:48 INFO - --DOCSHELL 0x7f54e0808800 == 6 [pid = 2852] [id = 6] 11:43:48 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:43:48 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:43:48 INFO - --DOCSHELL 0x7f54f1d81800 == 5 [pid = 2852] [id = 1] 11:43:49 INFO - [Child 2905] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:43:49 INFO - nsStringStats 11:43:49 INFO - => mAllocCount: 303 11:43:49 INFO - => mReallocCount: 1 11:43:49 INFO - => mFreeCount: 303 11:43:49 INFO - => mShareCount: 584 11:43:49 INFO - => mAdoptCount: 0 11:43:49 INFO - => mAdoptFreeCount: 0 11:43:49 INFO - => Process ID: 2943, Thread ID: 140094226176576 11:43:49 INFO - [Parent 2852] WARNING: '!aObserver', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/ds/nsObserverService.cpp, line 261 11:43:49 INFO - --DOCSHELL 0x7f85f8f9c800 == 3 [pid = 2905] [id = 32] 11:43:49 INFO - --DOCSHELL 0x7f85fe82e800 == 2 [pid = 2905] [id = 1] 11:43:49 INFO - --DOCSHELL 0x7f85fcca1800 == 1 [pid = 2905] [id = 2] 11:43:49 INFO - --DOCSHELL 0x7f85f8f9a800 == 0 [pid = 2905] [id = 31] 11:43:49 INFO - --DOMWINDOW == 23 (0x7f85fa424400) [pid = 2905] [serial = 192] [outer = (nil)] [url = about:blank] 11:43:49 INFO - --DOMWINDOW == 22 (0x7f85fd921000) [pid = 2905] [serial = 189] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_plugin_focus.html] 11:43:50 INFO - --DOMWINDOW == 21 (0x7f85f8f1f400) [pid = 2905] [serial = 220] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-3.svg] 11:43:50 INFO - --DOMWINDOW == 20 (0x7f85f9056c00) [pid = 2905] [serial = 219] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-ref.svg] 11:43:50 INFO - --DOMWINDOW == 19 (0x7f85f8f1dc00) [pid = 2905] [serial = 218] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-2.svg] 11:43:50 INFO - --DOMWINDOW == 18 (0x7f85f904a400) [pid = 2905] [serial = 217] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-ref.svg] 11:43:50 INFO - --DOMWINDOW == 17 (0x7f85f8f1c400) [pid = 2905] [serial = 216] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-ref.svg] 11:43:50 INFO - --DOMWINDOW == 16 (0x7f85f8f1b400) [pid = 2905] [serial = 215] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-1.svg] 11:43:50 INFO - --DOMWINDOW == 15 (0x7f85f8f1ec00) [pid = 2905] [serial = 214] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-untainted-ref.svg] 11:43:50 INFO - --DOMWINDOW == 14 (0x7f85f8f14800) [pid = 2905] [serial = 213] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-untainted-1.svg] 11:43:50 INFO - --DOMWINDOW == 13 (0x7f85f8f1bc00) [pid = 2905] [serial = 212] [outer = (nil)] [url = about:blank] 11:43:50 INFO - --DOMWINDOW == 12 (0x7f85f8f1a400) [pid = 2905] [serial = 211] [outer = (nil)] [url = about:blank] 11:43:50 INFO - --DOMWINDOW == 11 (0x7f85fae3dc00) [pid = 2905] [serial = 77] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug470212.html] 11:43:50 INFO - --DOMWINDOW == 10 (0x7f85fbc5ec00) [pid = 2905] [serial = 65] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug448860.html] 11:43:50 INFO - --DOMWINDOW == 9 (0x7f85fae33400) [pid = 2905] [serial = 145] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_bug784410.html] 11:43:50 INFO - --DOMWINDOW == 8 (0x7f85f908fc00) [pid = 2905] [serial = 207] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:50 INFO - --DOMWINDOW == 7 (0x7f85f8f12000) [pid = 2905] [serial = 208] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/test_taintedfilters.html] 11:43:50 INFO - --DOMWINDOW == 6 (0x7f85f9064800) [pid = 2905] [serial = 221] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:43:50 INFO - --DOMWINDOW == 5 (0x7f85f9065400) [pid = 2905] [serial = 222] [outer = (nil)] [url = about:blank] 11:43:50 INFO - --DOMWINDOW == 4 (0x7f85fd7d5400) [pid = 2905] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:43:50 INFO - --DOMWINDOW == 3 (0x7f85fe87b000) [pid = 2905] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:43:50 INFO - --DOMWINDOW == 2 (0x7f85fcc91c00) [pid = 2905] [serial = 4] [outer = (nil)] [url = about:blank] 11:43:50 INFO - --DOMWINDOW == 1 (0x7f85f8f16c00) [pid = 2905] [serial = 209] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-3.svg] 11:43:50 INFO - --DOMWINDOW == 0 (0x7f85f8f18000) [pid = 2905] [serial = 210] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/generic/test/file_taintedfilters_feDisplacementMap-tainted-ref.svg] 11:43:50 INFO - nsStringStats 11:43:50 INFO - => mAllocCount: 123287 11:43:50 INFO - => mReallocCount: 9549 11:43:50 INFO - => mFreeCount: 123287 11:43:50 INFO - => mShareCount: 152920 11:43:50 INFO - => mAdoptCount: 11613 11:43:50 INFO - => mAdoptFreeCount: 11613 11:43:50 INFO - => Process ID: 2905, Thread ID: 140213971188288 11:43:50 INFO - --DOCSHELL 0x7f54e165c000 == 4 [pid = 2852] [id = 7] 11:43:50 INFO - --DOCSHELL 0x7f54ec45f800 == 3 [pid = 2852] [id = 2] 11:43:50 INFO - --DOCSHELL 0x7f54e2440800 == 2 [pid = 2852] [id = 3] 11:43:50 INFO - --DOCSHELL 0x7f54e2444800 == 1 [pid = 2852] [id = 4] 11:43:50 INFO - --DOCSHELL 0x7f54dffbb000 == 0 [pid = 2852] [id = 12] 11:43:50 INFO - ]: 11:43:50 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:43:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:43:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:43:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:43:51 INFO - [Parent 2852] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:43:51 INFO - [Parent 2852] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:43:53 INFO - --DOMWINDOW == 23 (0x7f54e0217800) [pid = 2852] [serial = 11] [outer = 0x7f54e26f3400] [url = about:blank] 11:43:53 INFO - --DOMWINDOW == 22 (0x7f54e0217000) [pid = 2852] [serial = 10] [outer = 0x7f54e26f2c00] [url = about:blank] 11:43:53 INFO - --DOMWINDOW == 21 (0x7f54e26f3400) [pid = 2852] [serial = 7] [outer = (nil)] [url = about:blank] 11:43:53 INFO - --DOMWINDOW == 20 (0x7f54e26f2c00) [pid = 2852] [serial = 6] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 19 (0x7f54ec30a000) [pid = 2852] [serial = 4] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 18 (0x7f54eca4cc00) [pid = 2852] [serial = 19] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 17 (0x7f54e183b000) [pid = 2852] [serial = 42] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 16 (0x7f54eaa91400) [pid = 2852] [serial = 32] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 15 (0x7f54f707c800) [pid = 2852] [serial = 45] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 14 (0x7f54eca47800) [pid = 2852] [serial = 18] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:43:54 INFO - --DOMWINDOW == 13 (0x7f54e183a000) [pid = 2852] [serial = 41] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:43:54 INFO - --DOMWINDOW == 12 (0x7f54e3a17c00) [pid = 2852] [serial = 31] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:43:54 INFO - --DOMWINDOW == 11 (0x7f54eaa86400) [pid = 2852] [serial = 30] [outer = (nil)] [url = about:newtab] 11:43:54 INFO - --DOMWINDOW == 10 (0x7f54e2bcac00) [pid = 2852] [serial = 28] [outer = (nil)] [url = about:newtab] 11:43:54 INFO - --DOMWINDOW == 9 (0x7f54f1dabc00) [pid = 2852] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:43:54 INFO - --DOMWINDOW == 8 (0x7f54e2d7f800) [pid = 2852] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:43:54 INFO - --DOMWINDOW == 7 (0x7f54eb491c00) [pid = 2852] [serial = 17] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 6 (0x7f54f75c6000) [pid = 2852] [serial = 50] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 5 (0x7f54f7085c00) [pid = 2852] [serial = 49] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 4 (0x7f54f7081400) [pid = 2852] [serial = 46] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 3 (0x7f54e0161000) [pid = 2852] [serial = 16] [outer = (nil)] [url = about:blank] 11:43:54 INFO - --DOMWINDOW == 2 (0x7f54dfedc800) [pid = 2852] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:43:54 INFO - --DOMWINDOW == 1 (0x7f54ec309400) [pid = 2852] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:43:54 INFO - --DOMWINDOW == 0 (0x7f54eb484400) [pid = 2852] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:43:54 INFO - nsStringStats 11:43:54 INFO - => mAllocCount: 202147 11:43:54 INFO - => mReallocCount: 22190 11:43:54 INFO - => mFreeCount: 202147 11:43:54 INFO - => mShareCount: 207654 11:43:54 INFO - => mAdoptCount: 8788 11:43:54 INFO - => mAdoptFreeCount: 8788 11:43:54 INFO - => Process ID: 2852, Thread ID: 140003393963840 11:43:54 INFO - TEST-INFO | Main app process: exit 0 11:43:54 INFO - runtests.py | Application ran for: 0:02:48.767285 11:43:54 INFO - zombiecheck | Reading PID log: /tmp/tmpsKF63Wpidlog 11:43:54 INFO - ==> process 2852 launched child process 2905 11:43:54 INFO - ==> process 2852 launched child process 2943 11:43:54 INFO - zombiecheck | Checking for orphan process with PID: 2905 11:43:54 INFO - zombiecheck | Checking for orphan process with PID: 2943 11:43:54 INFO - Stopping web server 11:43:54 INFO - Stopping web socket server 11:43:54 INFO - Stopping ssltunnel 11:43:54 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:43:54 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:43:54 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:43:54 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, plugin process 2943 11:43:54 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:43:54 INFO - | | Per-Inst Leaked| Total Rem| 11:43:54 INFO - 0 |TOTAL | 47 0| 13020 0| 11:43:54 INFO - nsTraceRefcnt::DumpStatistics: 31 entries 11:43:54 INFO - TEST-PASS | leakcheck | plugin process: no leaks detected! 11:43:54 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2852 11:43:54 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:43:54 INFO - | | Per-Inst Leaked| Total Rem| 11:43:54 INFO - 0 |TOTAL | 23 0| 7123360 0| 11:43:54 INFO - nsTraceRefcnt::DumpStatistics: 1413 entries 11:43:54 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:43:54 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 2905 11:43:54 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:43:54 INFO - | | Per-Inst Leaked| Total Rem| 11:43:54 INFO - 0 |TOTAL | 23 4640| 4351002 33| 11:43:54 INFO - 14 |AsyncTransactionTrackersHolder | 72 72| 93 1| 11:43:54 INFO - 61 |CompositorChild | 880 880| 1 1| 11:43:54 INFO - 63 |CondVar | 40 120| 221 3| 11:43:54 INFO - 201 |IPC::Channel | 16 32| 8 2| 11:43:54 INFO - 240 |MessagePump | 16 16| 12 1| 11:43:54 INFO - 245 |Mutex | 32 96| 1483 3| 11:43:54 INFO - 260 |PCompositorChild | 776 776| 1 1| 11:43:54 INFO - 267 |PImageBridgeChild | 920 920| 1 1| 11:43:54 INFO - 332 |RefCountedMonitor | 80 160| 7 2| 11:43:54 INFO - 333 |RefCountedTask | 16 64| 14 4| 11:43:54 INFO - 380 |StoreRef | 16 32| 9 2| 11:43:54 INFO - 430 |WaitableEventKernel | 72 72| 15 1| 11:43:54 INFO - 435 |WeakReference | 16 32| 1563 2| 11:43:54 INFO - 468 |base::Thread | 48 48| 3 1| 11:43:54 INFO - 495 |ipc::MessageChannel | 512 1024| 7 2| 11:43:54 INFO - 934 |nsTArray_base | 8 40| 1250327 5| 11:43:54 INFO - 944 |nsThread | 256 256| 11 1| 11:43:54 INFO - nsTraceRefcnt::DumpStatistics: 1030 entries 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:43:54 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:43:54 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:43:54 INFO - runtests.py | Running tests: end. 11:43:54 INFO - 638 INFO TEST-START | Shutdown 11:43:54 INFO - 639 INFO Passed: 1936 11:43:54 INFO - 640 INFO Failed: 0 11:43:54 INFO - 641 INFO Todo: 28 11:43:54 INFO - 642 INFO Slowest: 36514ms - /tests/layout/generic/test/test_bug514732.html 11:43:54 INFO - 643 INFO SimpleTest FINISHED 11:43:54 INFO - 644 INFO TEST-INFO | Ran 1 Loops 11:43:54 INFO - 645 INFO SimpleTest FINISHED 11:43:54 INFO - dir: layout/inspector/tests 11:43:55 INFO - Setting pipeline to PAUSED ... 11:43:55 INFO - Pipeline is PREROLLING ... 11:43:55 INFO - Pipeline is PREROLLED ... 11:43:55 INFO - Setting pipeline to PLAYING ... 11:43:55 INFO - New clock: GstSystemClock 11:43:55 INFO - Got EOS from element "pipeline0". 11:43:55 INFO - Execution ended after 32807548 ns. 11:43:55 INFO - Setting pipeline to PAUSED ... 11:43:55 INFO - Setting pipeline to READY ... 11:43:55 INFO - Setting pipeline to NULL ... 11:43:55 INFO - Freeing pipeline ... 11:43:59 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:44:00 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpKJpkC0.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:44:00 INFO - runtests.py | Server pid: 2981 11:44:01 INFO - runtests.py | Websocket server pid: 2999 11:44:02 INFO - runtests.py | SSL tunnel pid: 3003 11:44:02 INFO - runtests.py | Running tests: start. 11:44:02 INFO - runtests.py | Application pid: 3010 11:44:02 INFO - TEST-INFO | started process Main app process 11:44:03 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpKJpkC0.mozrunner/runtests_leaks.log 11:44:07 INFO - ++DOCSHELL 0x7fc7a0781000 == 1 [pid = 3010] [id = 1] 11:44:07 INFO - ++DOMWINDOW == 1 (0x7fc7a07ab800) [pid = 3010] [serial = 1] [outer = (nil)] 11:44:07 INFO - [3010] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:44:07 INFO - ++DOMWINDOW == 2 (0x7fc79f969800) [pid = 3010] [serial = 2] [outer = 0x7fc7a07ab800] 11:44:07 INFO - ++DOCSHELL 0x7fc79ae61000 == 2 [pid = 3010] [id = 2] 11:44:07 INFO - ++DOMWINDOW == 3 (0x7fc79ad0a000) [pid = 3010] [serial = 3] [outer = (nil)] 11:44:07 INFO - ++DOMWINDOW == 4 (0x7fc79ad0ac00) [pid = 3010] [serial = 4] [outer = 0x7fc79ad0a000] 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnptestjava.so returned 7fc79adc61f0 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnpsecondtest.so returned 7fc79adc65e0 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnptest.so returned 7fc79adc6910 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnpctrltest.so returned 7fc79adc6a00 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnpswftest.so returned 7fc79adc6d30 11:44:08 INFO - LoadPlugin() /tmp/tmpKJpkC0.mozrunner/plugins/libnpthirdtest.so returned 7fc799eff040 11:44:08 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7fc799eff3a0 11:44:08 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7fc799ef95b0 11:44:08 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7fc799e13700 11:44:08 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7fc799e13a00 11:44:08 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7fc799e13d30 11:44:08 INFO - ++DOMWINDOW == 5 (0x7fc7a5fc2800) [pid = 3010] [serial = 5] [outer = 0x7fc7a07ab800] 11:44:09 INFO - [3010] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:44:11 INFO - ++DOCSHELL 0x7fc78fd47000 == 3 [pid = 3010] [id = 3] 11:44:11 INFO - ++DOMWINDOW == 6 (0x7fc78ffab000) [pid = 3010] [serial = 6] [outer = (nil)] 11:44:11 INFO - ++DOCSHELL 0x7fc78fd4b000 == 4 [pid = 3010] [id = 4] 11:44:11 INFO - ++DOMWINDOW == 7 (0x7fc78ffab800) [pid = 3010] [serial = 7] [outer = (nil)] 11:44:12 INFO - [3010] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:44:12 INFO - ++DOCSHELL 0x7fc78e13f800 == 5 [pid = 3010] [id = 5] 11:44:12 INFO - ++DOMWINDOW == 8 (0x7fc78ed89800) [pid = 3010] [serial = 8] [outer = (nil)] 11:44:12 INFO - [3010] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:44:12 INFO - ++DOMWINDOW == 9 (0x7fc78e00a000) [pid = 3010] [serial = 9] [outer = 0x7fc78ed89800] 11:44:13 INFO - ++DOMWINDOW == 10 (0x7fc78dce7c00) [pid = 3010] [serial = 10] [outer = 0x7fc78ffab000] 11:44:13 INFO - ++DOMWINDOW == 11 (0x7fc78dce8400) [pid = 3010] [serial = 11] [outer = 0x7fc78ffab800] 11:44:13 INFO - ++DOMWINDOW == 12 (0x7fc78dcea000) [pid = 3010] [serial = 12] [outer = 0x7fc78ed89800] 11:44:15 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpKJpkC0.mozrunner/runtests_leaks_tab_pid3065.log 11:44:16 INFO - [Child 3065] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:44:17 INFO - ++DOCSHELL 0x7f2b8982e800 == 1 [pid = 3065] [id = 1] 11:44:17 INFO - ++DOMWINDOW == 1 (0x7f2b8987b000) [pid = 3065] [serial = 1] [outer = (nil)] 11:44:17 INFO - ++DOMWINDOW == 2 (0x7f2b88a17000) [pid = 3065] [serial = 2] [outer = 0x7f2b8987b000] 11:44:17 INFO - [Parent 3010] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:44:18 INFO - [Parent 3010] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:44:18 INFO - ++DOMWINDOW == 3 (0x7f2b887d5400) [pid = 3065] [serial = 3] [outer = 0x7f2b8987b000] 11:44:19 INFO - ++DOCSHELL 0x7fc78f167000 == 6 [pid = 3010] [id = 6] 11:44:19 INFO - ++DOMWINDOW == 13 (0x7fc799403000) [pid = 3010] [serial = 13] [outer = (nil)] 11:44:19 INFO - ++DOMWINDOW == 14 (0x7fc790624800) [pid = 3010] [serial = 14] [outer = 0x7fc799403000] 11:44:19 INFO - ++DOMWINDOW == 15 (0x7fc78d7c2400) [pid = 3010] [serial = 15] [outer = 0x7fc799403000] 11:44:20 INFO - ++DOCSHELL 0x7fc78f304800 == 7 [pid = 3010] [id = 7] 11:44:20 INFO - ++DOMWINDOW == 16 (0x7fc78ff7ac00) [pid = 3010] [serial = 16] [outer = (nil)] 11:44:20 INFO - ++DOMWINDOW == 17 (0x7fc7a18eb400) [pid = 3010] [serial = 17] [outer = 0x7fc78ff7ac00] 11:44:20 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:44:20 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:44:20 INFO - ++DOCSHELL 0x7f2b87ca1000 == 2 [pid = 3065] [id = 2] 11:44:20 INFO - ++DOMWINDOW == 4 (0x7f2b87c91800) [pid = 3065] [serial = 4] [outer = (nil)] 11:44:20 INFO - ++DOMWINDOW == 5 (0x7f2b887d3800) [pid = 3065] [serial = 5] [outer = 0x7f2b87c91800] 11:44:20 INFO - 646 INFO TEST-START | layout/inspector/tests/test_bug1006595.html 11:44:20 INFO - [Child 3065] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:44:20 INFO - [Parent 3010] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:44:20 INFO - ++DOMWINDOW == 6 (0x7f2b872e0000) [pid = 3065] [serial = 6] [outer = 0x7f2b87c91800] 11:44:21 INFO - [Parent 3010] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:44:22 INFO - ++DOMWINDOW == 7 (0x7f2b87199400) [pid = 3065] [serial = 7] [outer = 0x7f2b87c91800] 11:44:22 INFO - --DOCSHELL 0x7fc78e13f800 == 6 [pid = 3010] [id = 5] 11:44:23 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:44:23 INFO - MEMORY STAT | vsize 507MB | residentFast 87MB | heapAllocated 18MB 11:44:23 INFO - 647 INFO TEST-OK | layout/inspector/tests/test_bug1006595.html | took 2393ms 11:44:23 INFO - ++DOMWINDOW == 8 (0x7f2b872e1800) [pid = 3065] [serial = 8] [outer = 0x7f2b87c91800] 11:44:23 INFO - 648 INFO TEST-START | layout/inspector/tests/test_bug462787.html 11:44:23 INFO - ++DOMWINDOW == 9 (0x7f2b86e3e800) [pid = 3065] [serial = 9] [outer = 0x7f2b87c91800] 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aElement) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 217 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aRule) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 284 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aDataNode) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 131 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aNode) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 162 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aElement) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 1061 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(content) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 1108 11:44:23 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(aElement) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 1087 11:44:23 INFO - MEMORY STAT | vsize 510MB | residentFast 90MB | heapAllocated 19MB 11:44:23 INFO - 649 INFO TEST-OK | layout/inspector/tests/test_bug462787.html | took 375ms 11:44:23 INFO - ++DOMWINDOW == 10 (0x7f2b86e46800) [pid = 3065] [serial = 10] [outer = 0x7f2b87c91800] 11:44:23 INFO - 650 INFO TEST-START | layout/inspector/tests/test_bug462789.html 11:44:24 INFO - ++DOMWINDOW == 11 (0x7f2b86e47000) [pid = 3065] [serial = 11] [outer = 0x7f2b87c91800] 11:44:24 INFO - ++DOCSHELL 0x7f2b86ee0000 == 3 [pid = 3065] [id = 3] 11:44:24 INFO - ++DOMWINDOW == 12 (0x7f2b86e4b400) [pid = 3065] [serial = 12] [outer = (nil)] 11:44:24 INFO - ++DOMWINDOW == 13 (0x7f2b86e4c800) [pid = 3065] [serial = 13] [outer = 0x7f2b86e4b400] 11:44:24 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(presShell) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 1131 11:44:24 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(presShell) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/inspector/inDOMUtils.cpp, line 1131 11:44:24 INFO - MEMORY STAT | vsize 511MB | residentFast 91MB | heapAllocated 20MB 11:44:24 INFO - 651 INFO TEST-OK | layout/inspector/tests/test_bug462789.html | took 365ms 11:44:24 INFO - ++DOMWINDOW == 14 (0x7f2b8875c400) [pid = 3065] [serial = 14] [outer = 0x7f2b87c91800] 11:44:24 INFO - 652 INFO TEST-START | layout/inspector/tests/test_bug522601.xhtml 11:44:24 INFO - ++DOMWINDOW == 15 (0x7f2b86c89400) [pid = 3065] [serial = 15] [outer = 0x7f2b87c91800] 11:44:24 INFO - ++DOCSHELL 0x7f2b86ef6800 == 4 [pid = 3065] [id = 4] 11:44:24 INFO - ++DOMWINDOW == 16 (0x7f2b86c8c800) [pid = 3065] [serial = 16] [outer = (nil)] 11:44:24 INFO - [Child 3065] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:44:24 INFO - [Child 3065] WARNING: failed to load URL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/html/nsGenericHTMLFrameElement.cpp, line 250 11:44:24 INFO - ++DOMWINDOW == 17 (0x7f2b86b51800) [pid = 3065] [serial = 17] [outer = 0x7f2b86c8c800] 11:44:25 INFO - MEMORY STAT | vsize 516MB | residentFast 95MB | heapAllocated 22MB 11:44:25 INFO - 653 INFO TEST-OK | layout/inspector/tests/test_bug522601.xhtml | took 1114ms 11:44:25 INFO - ++DOMWINDOW == 18 (0x7f2b8697d800) [pid = 3065] [serial = 18] [outer = 0x7f2b87c91800] 11:44:25 INFO - 654 INFO TEST-START | layout/inspector/tests/test_bug536379-2.html 11:44:25 INFO - ++DOMWINDOW == 19 (0x7f2b8697dc00) [pid = 3065] [serial = 19] [outer = 0x7f2b87c91800] 11:44:26 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 22MB 11:44:26 INFO - 655 INFO TEST-OK | layout/inspector/tests/test_bug536379-2.html | took 296ms 11:44:26 INFO - ++DOMWINDOW == 20 (0x7f2b869d8000) [pid = 3065] [serial = 20] [outer = 0x7f2b87c91800] 11:44:26 INFO - 656 INFO TEST-START | layout/inspector/tests/test_bug536379.html 11:44:26 INFO - ++DOMWINDOW == 21 (0x7f2b869d7400) [pid = 3065] [serial = 21] [outer = 0x7f2b87c91800] 11:44:26 INFO - MEMORY STAT | vsize 517MB | residentFast 97MB | heapAllocated 23MB 11:44:26 INFO - 657 INFO TEST-OK | layout/inspector/tests/test_bug536379.html | took 300ms 11:44:26 INFO - ++DOMWINDOW == 22 (0x7f2b869ddc00) [pid = 3065] [serial = 22] [outer = 0x7f2b87c91800] 11:44:26 INFO - 658 INFO TEST-START | layout/inspector/tests/test_bug557726.html 11:44:26 INFO - ++DOMWINDOW == 23 (0x7f2b8697d400) [pid = 3065] [serial = 23] [outer = 0x7f2b87c91800] 11:44:27 INFO - MEMORY STAT | vsize 519MB | residentFast 99MB | heapAllocated 22MB 11:44:27 INFO - 659 INFO TEST-OK | layout/inspector/tests/test_bug557726.html | took 615ms 11:44:27 INFO - ++DOMWINDOW == 24 (0x7f2b869dc400) [pid = 3065] [serial = 24] [outer = 0x7f2b87c91800] 11:44:27 INFO - 660 INFO TEST-START | layout/inspector/tests/test_bug609549.xhtml 11:44:27 INFO - ++DOMWINDOW == 25 (0x7f2b869d6c00) [pid = 3065] [serial = 25] [outer = 0x7f2b87c91800] 11:44:27 INFO - --DOCSHELL 0x7f2b86ef6800 == 3 [pid = 3065] [id = 4] 11:44:27 INFO - --DOCSHELL 0x7f2b86ee0000 == 2 [pid = 3065] [id = 3] 11:44:28 INFO - MEMORY STAT | vsize 519MB | residentFast 99MB | heapAllocated 19MB 11:44:28 INFO - 661 INFO TEST-OK | layout/inspector/tests/test_bug609549.xhtml | took 691ms 11:44:28 INFO - ++DOMWINDOW == 26 (0x7f2b8690d000) [pid = 3065] [serial = 26] [outer = 0x7f2b87c91800] 11:44:28 INFO - 662 INFO TEST-START | layout/inspector/tests/test_bug806192.html 11:44:28 INFO - ++DOMWINDOW == 27 (0x7f2b8690d400) [pid = 3065] [serial = 27] [outer = 0x7f2b87c91800] 11:44:28 INFO - MEMORY STAT | vsize 520MB | residentFast 99MB | heapAllocated 20MB 11:44:28 INFO - 663 INFO TEST-OK | layout/inspector/tests/test_bug806192.html | took 324ms 11:44:28 INFO - ++DOMWINDOW == 28 (0x7f2b8691b000) [pid = 3065] [serial = 28] [outer = 0x7f2b87c91800] 11:44:28 INFO - 664 INFO TEST-START | layout/inspector/tests/test_bug856317.html 11:44:29 INFO - ++DOMWINDOW == 29 (0x7f2b8690f400) [pid = 3065] [serial = 29] [outer = 0x7f2b87c91800] 11:44:29 INFO - MEMORY STAT | vsize 520MB | residentFast 99MB | heapAllocated 21MB 11:44:29 INFO - 665 INFO TEST-OK | layout/inspector/tests/test_bug856317.html | took 889ms 11:44:29 INFO - ++DOMWINDOW == 30 (0x7f2b86923000) [pid = 3065] [serial = 30] [outer = 0x7f2b87c91800] 11:44:29 INFO - 666 INFO TEST-START | layout/inspector/tests/test_bug877690.html 11:44:29 INFO - ++DOMWINDOW == 31 (0x7f2b86922c00) [pid = 3065] [serial = 31] [outer = 0x7f2b87c91800] 11:44:31 INFO - MEMORY STAT | vsize 521MB | residentFast 100MB | heapAllocated 22MB 11:44:32 INFO - 667 INFO TEST-OK | layout/inspector/tests/test_bug877690.html | took 2435ms 11:44:32 INFO - ++DOMWINDOW == 32 (0x7f2b86929400) [pid = 3065] [serial = 32] [outer = 0x7f2b87c91800] 11:44:32 INFO - 668 INFO TEST-START | layout/inspector/tests/test_color_to_rgba.html 11:44:32 INFO - ++DOMWINDOW == 33 (0x7f2b86929800) [pid = 3065] [serial = 33] [outer = 0x7f2b87c91800] 11:44:32 INFO - MEMORY STAT | vsize 521MB | residentFast 101MB | heapAllocated 22MB 11:44:33 INFO - 669 INFO TEST-OK | layout/inspector/tests/test_color_to_rgba.html | took 765ms 11:44:33 INFO - ++DOMWINDOW == 34 (0x7f2b86971000) [pid = 3065] [serial = 34] [outer = 0x7f2b87c91800] 11:44:33 INFO - 670 INFO TEST-START | layout/inspector/tests/test_css_property_is_shorthand.html 11:44:33 INFO - ++DOMWINDOW == 35 (0x7f2b86972800) [pid = 3065] [serial = 35] [outer = 0x7f2b87c91800] 11:44:33 INFO - MEMORY STAT | vsize 521MB | residentFast 101MB | heapAllocated 23MB 11:44:33 INFO - 671 INFO TEST-OK | layout/inspector/tests/test_css_property_is_shorthand.html | took 455ms 11:44:33 INFO - ++DOMWINDOW == 36 (0x7f2b86e49400) [pid = 3065] [serial = 36] [outer = 0x7f2b87c91800] 11:44:33 INFO - 672 INFO TEST-START | layout/inspector/tests/test_css_property_is_valid.html 11:44:33 INFO - ++DOMWINDOW == 37 (0x7f2b86e41800) [pid = 3065] [serial = 37] [outer = 0x7f2b87c91800] 11:44:34 INFO - MEMORY STAT | vsize 522MB | residentFast 102MB | heapAllocated 23MB 11:44:34 INFO - 673 INFO TEST-OK | layout/inspector/tests/test_css_property_is_valid.html | took 364ms 11:44:34 INFO - ++DOMWINDOW == 38 (0x7f2b86c8a800) [pid = 3065] [serial = 38] [outer = 0x7f2b87c91800] 11:44:34 INFO - 674 INFO TEST-START | layout/inspector/tests/test_getCSSPseudoElementNames.html 11:44:34 INFO - ++DOMWINDOW == 39 (0x7f2b87196000) [pid = 3065] [serial = 39] [outer = 0x7f2b87c91800] 11:44:34 INFO - MEMORY STAT | vsize 522MB | residentFast 103MB | heapAllocated 24MB 11:44:34 INFO - 675 INFO TEST-OK | layout/inspector/tests/test_getCSSPseudoElementNames.html | took 375ms 11:44:34 INFO - ++DOMWINDOW == 40 (0x7f2b871ed800) [pid = 3065] [serial = 40] [outer = 0x7f2b87c91800] 11:44:34 INFO - 676 INFO TEST-START | layout/inspector/tests/test_getRelativeRuleLine.html 11:44:34 INFO - ++DOMWINDOW == 41 (0x7f2b871ee000) [pid = 3065] [serial = 41] [outer = 0x7f2b87c91800] 11:44:35 INFO - MEMORY STAT | vsize 523MB | residentFast 103MB | heapAllocated 24MB 11:44:35 INFO - 677 INFO TEST-OK | layout/inspector/tests/test_getRelativeRuleLine.html | took 296ms 11:44:35 INFO - ++DOMWINDOW == 42 (0x7f2b88756800) [pid = 3065] [serial = 42] [outer = 0x7f2b87c91800] 11:44:35 INFO - 678 INFO TEST-START | layout/inspector/tests/test_get_all_style_sheets.html 11:44:35 INFO - ++DOMWINDOW == 43 (0x7f2b872d6c00) [pid = 3065] [serial = 43] [outer = 0x7f2b87c91800] 11:44:35 INFO - MEMORY STAT | vsize 524MB | residentFast 104MB | heapAllocated 25MB 11:44:35 INFO - 679 INFO TEST-OK | layout/inspector/tests/test_get_all_style_sheets.html | took 313ms 11:44:35 INFO - ++DOMWINDOW == 44 (0x7f2b872e0400) [pid = 3065] [serial = 44] [outer = 0x7f2b87c91800] 11:44:35 INFO - 680 INFO TEST-START | layout/inspector/tests/test_is_valid_css_color.html 11:44:35 INFO - --DOMWINDOW == 16 (0x7fc78ed89800) [pid = 3010] [serial = 8] [outer = (nil)] [url = about:blank] 11:44:35 INFO - --DOMWINDOW == 15 (0x7fc78dcea000) [pid = 3010] [serial = 12] [outer = (nil)] [url = about:blank] 11:44:35 INFO - --DOMWINDOW == 14 (0x7fc78e00a000) [pid = 3010] [serial = 9] [outer = (nil)] [url = about:blank] 11:44:35 INFO - --DOMWINDOW == 13 (0x7fc790624800) [pid = 3010] [serial = 14] [outer = (nil)] [url = about:blank] 11:44:35 INFO - --DOMWINDOW == 12 (0x7fc79f969800) [pid = 3010] [serial = 2] [outer = (nil)] [url = about:blank] 11:44:35 INFO - ++DOMWINDOW == 45 (0x7f2b87c8fc00) [pid = 3065] [serial = 45] [outer = 0x7f2b87c91800] 11:44:45 INFO - MEMORY STAT | vsize 540MB | residentFast 120MB | heapAllocated 34MB 11:44:45 INFO - 681 INFO TEST-OK | layout/inspector/tests/test_is_valid_css_color.html | took 9495ms 11:44:45 INFO - ++DOMWINDOW == 46 (0x7f2b854b4c00) [pid = 3065] [serial = 46] [outer = 0x7f2b87c91800] 11:44:45 INFO - 682 INFO TEST-START | layout/inspector/tests/test_isinheritableproperty.html 11:44:45 INFO - ++DOMWINDOW == 47 (0x7f2b854b5400) [pid = 3065] [serial = 47] [outer = 0x7f2b87c91800] 11:44:45 INFO - MEMORY STAT | vsize 541MB | residentFast 121MB | heapAllocated 35MB 11:44:45 INFO - 683 INFO TEST-OK | layout/inspector/tests/test_isinheritableproperty.html | took 413ms 11:44:45 INFO - ++DOMWINDOW == 48 (0x7f2b85e0e800) [pid = 3065] [serial = 48] [outer = 0x7f2b87c91800] 11:44:46 INFO - 684 INFO TEST-START | layout/inspector/tests/test_parseStyleSheet.html 11:44:46 INFO - ++DOMWINDOW == 49 (0x7f2b86903c00) [pid = 3065] [serial = 49] [outer = 0x7f2b87c91800] 11:44:46 INFO - MEMORY STAT | vsize 542MB | residentFast 122MB | heapAllocated 35MB 11:44:46 INFO - 685 INFO TEST-OK | layout/inspector/tests/test_parseStyleSheet.html | took 456ms 11:44:46 INFO - ++DOMWINDOW == 50 (0x7f2b86911400) [pid = 3065] [serial = 50] [outer = 0x7f2b87c91800] 11:44:46 INFO - 686 INFO TEST-START | layout/inspector/tests/test_parseStyleSheetImport.html 11:44:46 INFO - ++DOMWINDOW == 51 (0x7f2b854b3000) [pid = 3065] [serial = 51] [outer = 0x7f2b87c91800] 11:44:47 INFO - MEMORY STAT | vsize 542MB | residentFast 114MB | heapAllocated 22MB 11:44:47 INFO - --DOMWINDOW == 50 (0x7f2b86e4c800) [pid = 3065] [serial = 13] [outer = 0x7f2b86e4b400] [url = data:text/html,xxx] 11:44:47 INFO - --DOMWINDOW == 49 (0x7f2b86e4b400) [pid = 3065] [serial = 12] [outer = (nil)] [url = data:text/html,xxx] 11:44:47 INFO - 687 INFO TEST-OK | layout/inspector/tests/test_parseStyleSheetImport.html | took 1287ms 11:44:48 INFO - ++DOMWINDOW == 50 (0x7f2b8543f800) [pid = 3065] [serial = 52] [outer = 0x7f2b87c91800] 11:44:48 INFO - 688 INFO TEST-START | layout/inspector/tests/test_selectormatcheselement.html 11:44:48 INFO - ++DOMWINDOW == 51 (0x7f2b85440400) [pid = 3065] [serial = 53] [outer = 0x7f2b87c91800] 11:44:48 INFO - MEMORY STAT | vsize 537MB | residentFast 97MB | heapAllocated 18MB 11:44:48 INFO - 689 INFO TEST-OK | layout/inspector/tests/test_selectormatcheselement.html | took 376ms 11:44:48 INFO - ++DOMWINDOW == 52 (0x7f2b85445c00) [pid = 3065] [serial = 54] [outer = 0x7f2b87c91800] 11:44:48 INFO - ++DOMWINDOW == 53 (0x7f2b854b3400) [pid = 3065] [serial = 55] [outer = 0x7f2b87c91800] 11:44:48 INFO - --DOCSHELL 0x7fc78f167000 == 5 [pid = 3010] [id = 6] 11:44:49 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:44:49 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:44:49 INFO - --DOCSHELL 0x7fc7a0781000 == 4 [pid = 3010] [id = 1] 11:44:49 INFO - --DOMWINDOW == 52 (0x7f2b86b51800) [pid = 3065] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/file_bug522601.html] 11:44:49 INFO - --DOMWINDOW == 51 (0x7f2b86c8c800) [pid = 3065] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/file_bug522601.html] 11:44:50 INFO - --DOCSHELL 0x7fc78f304800 == 3 [pid = 3010] [id = 7] 11:44:50 INFO - --DOCSHELL 0x7fc78fd47000 == 2 [pid = 3010] [id = 3] 11:44:50 INFO - --DOCSHELL 0x7fc78fd4b000 == 1 [pid = 3010] [id = 4] 11:44:50 INFO - --DOCSHELL 0x7fc79ae61000 == 0 [pid = 3010] [id = 2] 11:44:50 INFO - [Child 3065] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:44:50 INFO - ]: --DOCSHELL 0x7f2b87ca1000 == 1 [pid = 3065] [id = 2] 11:44:50 INFO - --DOCSHELL 0x7f2b8982e800 == 0 [pid = 3065] [id = 1] 11:44:50 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:44:50 INFO - --DOMWINDOW == 50 (0x7f2b86911400) [pid = 3065] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 49 (0x7f2b86903c00) [pid = 3065] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_parseStyleSheet.html] 11:44:50 INFO - --DOMWINDOW == 48 (0x7f2b85e0e800) [pid = 3065] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 47 (0x7f2b854b5400) [pid = 3065] [serial = 47] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_isinheritableproperty.html] 11:44:50 INFO - --DOMWINDOW == 46 (0x7f2b854b4c00) [pid = 3065] [serial = 46] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 45 (0x7f2b872e0400) [pid = 3065] [serial = 44] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 44 (0x7f2b88756800) [pid = 3065] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 43 (0x7f2b871ed800) [pid = 3065] [serial = 40] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 42 (0x7f2b86c8a800) [pid = 3065] [serial = 38] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 41 (0x7f2b86e49400) [pid = 3065] [serial = 36] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 40 (0x7f2b86971000) [pid = 3065] [serial = 34] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 39 (0x7f2b86929400) [pid = 3065] [serial = 32] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 38 (0x7f2b86923000) [pid = 3065] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 37 (0x7f2b8690f400) [pid = 3065] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug856317.html] 11:44:50 INFO - --DOMWINDOW == 36 (0x7f2b8691b000) [pid = 3065] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 35 (0x7f2b8690d400) [pid = 3065] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug806192.html] 11:44:50 INFO - --DOMWINDOW == 34 (0x7f2b8690d000) [pid = 3065] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 33 (0x7f2b869d6c00) [pid = 3065] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug609549.xhtml] 11:44:50 INFO - --DOMWINDOW == 32 (0x7f2b869dc400) [pid = 3065] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 31 (0x7f2b8697d400) [pid = 3065] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug557726.html] 11:44:50 INFO - --DOMWINDOW == 30 (0x7f2b869ddc00) [pid = 3065] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 29 (0x7f2b869d7400) [pid = 3065] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug536379.html] 11:44:50 INFO - --DOMWINDOW == 28 (0x7f2b869d8000) [pid = 3065] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 27 (0x7f2b8697dc00) [pid = 3065] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug536379-2.html] 11:44:50 INFO - --DOMWINDOW == 26 (0x7f2b8697d800) [pid = 3065] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 25 (0x7f2b86c89400) [pid = 3065] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug522601.xhtml] 11:44:50 INFO - --DOMWINDOW == 24 (0x7f2b8875c400) [pid = 3065] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 23 (0x7f2b86e47000) [pid = 3065] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug462789.html] 11:44:50 INFO - --DOMWINDOW == 22 (0x7f2b86e46800) [pid = 3065] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 21 (0x7f2b86e3e800) [pid = 3065] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug462787.html] 11:44:50 INFO - --DOMWINDOW == 20 (0x7f2b872e1800) [pid = 3065] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 19 (0x7f2b872e0000) [pid = 3065] [serial = 6] [outer = (nil)] [url = about:blank] 11:44:50 INFO - --DOMWINDOW == 18 (0x7f2b887d3800) [pid = 3065] [serial = 5] [outer = (nil)] [url = about:blank] 11:44:50 INFO - --DOMWINDOW == 17 (0x7f2b88a17000) [pid = 3065] [serial = 2] [outer = (nil)] [url = about:blank] 11:44:50 INFO - --DOMWINDOW == 16 (0x7f2b854b3400) [pid = 3065] [serial = 55] [outer = (nil)] [url = about:blank] 11:44:50 INFO - --DOMWINDOW == 15 (0x7f2b85445c00) [pid = 3065] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 14 (0x7f2b85440400) [pid = 3065] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_selectormatcheselement.html] 11:44:50 INFO - --DOMWINDOW == 13 (0x7f2b8543f800) [pid = 3065] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:44:50 INFO - --DOMWINDOW == 12 (0x7f2b854b3000) [pid = 3065] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_parseStyleSheetImport.html] 11:44:50 INFO - --DOMWINDOW == 11 (0x7f2b887d5400) [pid = 3065] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:44:50 INFO - --DOMWINDOW == 10 (0x7f2b87c91800) [pid = 3065] [serial = 4] [outer = (nil)] [url = about:blank] 11:44:50 INFO - --DOMWINDOW == 9 (0x7f2b8987b000) [pid = 3065] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:44:50 INFO - --DOMWINDOW == 8 (0x7f2b87c8fc00) [pid = 3065] [serial = 45] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_is_valid_css_color.html] 11:44:50 INFO - --DOMWINDOW == 7 (0x7f2b872d6c00) [pid = 3065] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_get_all_style_sheets.html] 11:44:50 INFO - --DOMWINDOW == 6 (0x7f2b871ee000) [pid = 3065] [serial = 41] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_getRelativeRuleLine.html] 11:44:50 INFO - --DOMWINDOW == 5 (0x7f2b87196000) [pid = 3065] [serial = 39] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_getCSSPseudoElementNames.html] 11:44:50 INFO - --DOMWINDOW == 4 (0x7f2b86e41800) [pid = 3065] [serial = 37] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_css_property_is_valid.html] 11:44:50 INFO - --DOMWINDOW == 3 (0x7f2b86972800) [pid = 3065] [serial = 35] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_css_property_is_shorthand.html] 11:44:50 INFO - --DOMWINDOW == 2 (0x7f2b86929800) [pid = 3065] [serial = 33] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_color_to_rgba.html] 11:44:50 INFO - --DOMWINDOW == 1 (0x7f2b86922c00) [pid = 3065] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug877690.html] 11:44:50 INFO - --DOMWINDOW == 0 (0x7f2b87199400) [pid = 3065] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/inspector/tests/test_bug1006595.html] 11:44:51 INFO - nsStringStats 11:44:51 INFO - => mAllocCount: 50062 11:44:51 INFO - => mReallocCount: 1704 11:44:51 INFO - => mFreeCount: 50062 11:44:51 INFO - => mShareCount: 42554 11:44:51 INFO - => mAdoptCount: 3098 11:44:51 INFO - => mAdoptFreeCount: 3098 11:44:51 INFO - => Process ID: 3065, Thread ID: 139825461406272 11:44:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:44:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:44:51 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:44:51 INFO - [Parent 3010] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:44:51 INFO - [Parent 3010] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:44:52 INFO - --DOMWINDOW == 11 (0x7fc78dce7c00) [pid = 3010] [serial = 10] [outer = 0x7fc78ffab000] [url = about:blank] 11:44:52 INFO - --DOMWINDOW == 10 (0x7fc78dce8400) [pid = 3010] [serial = 11] [outer = 0x7fc78ffab800] [url = about:blank] 11:44:52 INFO - --DOMWINDOW == 9 (0x7fc78ffab000) [pid = 3010] [serial = 6] [outer = (nil)] [url = about:blank] 11:44:52 INFO - --DOMWINDOW == 8 (0x7fc78ffab800) [pid = 3010] [serial = 7] [outer = (nil)] [url = about:blank] 11:44:53 INFO - --DOMWINDOW == 7 (0x7fc79ad0ac00) [pid = 3010] [serial = 4] [outer = (nil)] [url = about:blank] 11:44:53 INFO - --DOMWINDOW == 6 (0x7fc79ad0a000) [pid = 3010] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:44:53 INFO - --DOMWINDOW == 5 (0x7fc78d7c2400) [pid = 3010] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:44:53 INFO - --DOMWINDOW == 4 (0x7fc78ff7ac00) [pid = 3010] [serial = 16] [outer = (nil)] [url = about:blank] 11:44:53 INFO - --DOMWINDOW == 3 (0x7fc7a18eb400) [pid = 3010] [serial = 17] [outer = (nil)] [url = about:blank] 11:44:53 INFO - --DOMWINDOW == 2 (0x7fc799403000) [pid = 3010] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:44:53 INFO - --DOMWINDOW == 1 (0x7fc7a07ab800) [pid = 3010] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:44:53 INFO - --DOMWINDOW == 0 (0x7fc7a5fc2800) [pid = 3010] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:44:53 INFO - nsStringStats 11:44:53 INFO - => mAllocCount: 97028 11:44:53 INFO - => mReallocCount: 11378 11:44:53 INFO - => mFreeCount: 97028 11:44:53 INFO - => mShareCount: 97687 11:44:53 INFO - => mAdoptCount: 4005 11:44:53 INFO - => mAdoptFreeCount: 4005 11:44:53 INFO - => Process ID: 3010, Thread ID: 140495950178112 11:44:53 INFO - TEST-INFO | Main app process: exit 0 11:44:53 INFO - runtests.py | Application ran for: 0:00:51.131040 11:44:53 INFO - zombiecheck | Reading PID log: /tmp/tmpBFlFTGpidlog 11:44:53 INFO - ==> process 3010 launched child process 3065 11:44:53 INFO - zombiecheck | Checking for orphan process with PID: 3065 11:44:53 INFO - Stopping web server 11:44:53 INFO - Stopping web socket server 11:44:53 INFO - Stopping ssltunnel 11:44:53 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:44:53 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:44:53 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:44:53 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 3065 11:44:53 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:44:53 INFO - | | Per-Inst Leaked| Total Rem| 11:44:53 INFO - 0 |TOTAL | 25 4640| 854728 33| 11:44:53 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 3 1| 11:44:53 INFO - 48 |CompositorChild | 880 880| 1 1| 11:44:53 INFO - 50 |CondVar | 40 120| 29 3| 11:44:53 INFO - 144 |IPC::Channel | 16 32| 7 2| 11:44:53 INFO - 169 |MessagePump | 16 16| 10 1| 11:44:53 INFO - 172 |Mutex | 32 96| 398 3| 11:44:53 INFO - 183 |PCompositorChild | 776 776| 1 1| 11:44:53 INFO - 190 |PImageBridgeChild | 920 920| 1 1| 11:44:53 INFO - 239 |RefCountedMonitor | 80 160| 6 2| 11:44:53 INFO - 240 |RefCountedTask | 16 64| 12 4| 11:44:53 INFO - 273 |StoreRef | 16 32| 7 2| 11:44:53 INFO - 309 |WaitableEventKernel | 72 72| 13 1| 11:44:53 INFO - 314 |WeakReference | 16 32| 246 2| 11:44:53 INFO - 341 |base::Thread | 48 48| 3 1| 11:44:53 INFO - 366 |ipc::MessageChannel | 512 1024| 6 2| 11:44:53 INFO - 708 |nsTArray_base | 8 40| 260934 5| 11:44:53 INFO - 712 |nsThread | 256 256| 9 1| 11:44:53 INFO - nsTraceRefcnt::DumpStatistics: 776 entries 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:44:53 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:44:53 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:44:53 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 3010 11:44:53 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:44:53 INFO - | | Per-Inst Leaked| Total Rem| 11:44:53 INFO - 0 |TOTAL | 26 0| 2393125 0| 11:44:53 INFO - nsTraceRefcnt::DumpStatistics: 1317 entries 11:44:53 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:44:53 INFO - runtests.py | Running tests: end. 11:44:53 INFO - 690 INFO TEST-START | Shutdown 11:44:53 INFO - 691 INFO Passed: 5870 11:44:53 INFO - 692 INFO Failed: 0 11:44:53 INFO - 693 INFO Todo: 0 11:44:53 INFO - 694 INFO Slowest: 9495ms - /tests/layout/inspector/tests/test_is_valid_css_color.html 11:44:53 INFO - 695 INFO SimpleTest FINISHED 11:44:53 INFO - 696 INFO TEST-INFO | Ran 1 Loops 11:44:53 INFO - 697 INFO SimpleTest FINISHED 11:44:53 INFO - dir: layout/mathml/tests 11:44:54 INFO - Setting pipeline to PAUSED ... 11:44:54 INFO - Pipeline is PREROLLING ... 11:44:54 INFO - Pipeline is PREROLLED ... 11:44:54 INFO - Setting pipeline to PLAYING ... 11:44:54 INFO - New clock: GstSystemClock 11:44:54 INFO - Got EOS from element "pipeline0". 11:44:54 INFO - Execution ended after 32774514 ns. 11:44:54 INFO - Setting pipeline to PAUSED ... 11:44:54 INFO - Setting pipeline to READY ... 11:44:54 INFO - Setting pipeline to NULL ... 11:44:54 INFO - Freeing pipeline ... 11:44:57 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:44:59 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmp6Yk6ii.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:44:59 INFO - runtests.py | Server pid: 3124 11:44:59 INFO - runtests.py | Websocket server pid: 3142 11:45:00 INFO - runtests.py | SSL tunnel pid: 3145 11:45:00 INFO - runtests.py | Running tests: start. 11:45:01 INFO - runtests.py | Application pid: 3152 11:45:01 INFO - TEST-INFO | started process Main app process 11:45:01 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp6Yk6ii.mozrunner/runtests_leaks.log 11:45:05 INFO - ++DOCSHELL 0x7f49ff980800 == 1 [pid = 3152] [id = 1] 11:45:05 INFO - ++DOMWINDOW == 1 (0x7f49ff9ac800) [pid = 3152] [serial = 1] [outer = (nil)] 11:45:05 INFO - [3152] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:45:05 INFO - ++DOMWINDOW == 2 (0x7f49feb6a800) [pid = 3152] [serial = 2] [outer = 0x7f49ff9ac800] 11:45:05 INFO - ++DOCSHELL 0x7f49fa068800 == 2 [pid = 3152] [id = 2] 11:45:05 INFO - ++DOMWINDOW == 3 (0x7f49f9f10000) [pid = 3152] [serial = 3] [outer = (nil)] 11:45:05 INFO - ++DOMWINDOW == 4 (0x7f49f9f10c00) [pid = 3152] [serial = 4] [outer = 0x7f49f9f10000] 11:45:05 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnptestjava.so returned 7f49f9fc81f0 11:45:06 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnpsecondtest.so returned 7f49f9fc85e0 11:45:06 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnptest.so returned 7f49f9fc8910 11:45:06 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnpctrltest.so returned 7f49f9fc8a00 11:45:06 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnpswftest.so returned 7f49f9fc8d30 11:45:06 INFO - LoadPlugin() /tmp/tmp6Yk6ii.mozrunner/plugins/libnpthirdtest.so returned 7f49f9aff040 11:45:06 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f49f9aff3a0 11:45:06 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f49f9ff65b0 11:45:06 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f49f9ffa700 11:45:06 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f49f9ffaa00 11:45:06 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f49f9ffad30 11:45:06 INFO - ++DOMWINDOW == 5 (0x7f49f9a8a800) [pid = 3152] [serial = 5] [outer = 0x7f49ff9ac800] 11:45:07 INFO - [3152] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:45:08 INFO - ++DOCSHELL 0x7f49eee3d000 == 3 [pid = 3152] [id = 3] 11:45:08 INFO - ++DOMWINDOW == 6 (0x7f49eee6c800) [pid = 3152] [serial = 6] [outer = (nil)] 11:45:08 INFO - ++DOCSHELL 0x7f49eee40800 == 4 [pid = 3152] [id = 4] 11:45:08 INFO - ++DOMWINDOW == 7 (0x7f49eee6d000) [pid = 3152] [serial = 7] [outer = (nil)] 11:45:09 INFO - [3152] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:45:09 INFO - ++DOCSHELL 0x7f49ed241800 == 5 [pid = 3152] [id = 5] 11:45:09 INFO - ++DOMWINDOW == 8 (0x7f49ede87000) [pid = 3152] [serial = 8] [outer = (nil)] 11:45:09 INFO - [3152] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:45:09 INFO - ++DOMWINDOW == 9 (0x7f49ed10a000) [pid = 3152] [serial = 9] [outer = 0x7f49ede87000] 11:45:09 INFO - ++DOMWINDOW == 10 (0x7f49ecfe0800) [pid = 3152] [serial = 10] [outer = 0x7f49eee6c800] 11:45:09 INFO - ++DOMWINDOW == 11 (0x7f49ecfe1000) [pid = 3152] [serial = 11] [outer = 0x7f49eee6d000] 11:45:09 INFO - ++DOMWINDOW == 12 (0x7f49ecfe2c00) [pid = 3152] [serial = 12] [outer = 0x7f49ede87000] 11:45:11 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp6Yk6ii.mozrunner/runtests_leaks_tab_pid3207.log 11:45:12 INFO - [Child 3207] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:45:13 INFO - ++DOCSHELL 0x7f8a7c32e800 == 1 [pid = 3207] [id = 1] 11:45:13 INFO - ++DOMWINDOW == 1 (0x7f8a7c37b000) [pid = 3207] [serial = 1] [outer = (nil)] 11:45:13 INFO - ++DOMWINDOW == 2 (0x7f8a7b517000) [pid = 3207] [serial = 2] [outer = 0x7f8a7c37b000] 11:45:13 INFO - [Parent 3152] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:45:14 INFO - [Parent 3152] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:45:14 INFO - ++DOMWINDOW == 3 (0x7f8a7b2d5400) [pid = 3207] [serial = 3] [outer = 0x7f8a7c37b000] 11:45:16 INFO - [Child 3207] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:45:16 INFO - [Child 3207] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:45:16 INFO - ++DOCSHELL 0x7f8a7a7a1000 == 2 [pid = 3207] [id = 2] 11:45:16 INFO - ++DOMWINDOW == 4 (0x7f8a7a791800) [pid = 3207] [serial = 4] [outer = (nil)] 11:45:16 INFO - ++DOMWINDOW == 5 (0x7f8a7a792400) [pid = 3207] [serial = 5] [outer = 0x7f8a7a791800] 11:45:16 INFO - ++DOCSHELL 0x7f49e5f58800 == 6 [pid = 3152] [id = 6] 11:45:16 INFO - ++DOMWINDOW == 13 (0x7f49e6b49000) [pid = 3152] [serial = 13] [outer = (nil)] 11:45:16 INFO - ++DOMWINDOW == 14 (0x7f49e6b4c800) [pid = 3152] [serial = 14] [outer = 0x7f49e6b49000] 11:45:16 INFO - ++DOMWINDOW == 15 (0x7f49e69ef000) [pid = 3152] [serial = 15] [outer = 0x7f49e6b49000] 11:45:16 INFO - ++DOCSHELL 0x7f49e5f60000 == 7 [pid = 3152] [id = 7] 11:45:16 INFO - ++DOMWINDOW == 16 (0x7f49e6b4e400) [pid = 3152] [serial = 16] [outer = (nil)] 11:45:16 INFO - ++DOMWINDOW == 17 (0x7f49ebe4d000) [pid = 3152] [serial = 17] [outer = 0x7f49e6b4e400] 11:45:16 INFO - 698 INFO TEST-START | layout/mathml/tests/test_bug330964.html 11:45:16 INFO - [Child 3207] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:45:16 INFO - ++DOMWINDOW == 6 (0x7f8a79d7d000) [pid = 3207] [serial = 6] [outer = 0x7f8a7a791800] 11:45:17 INFO - [Parent 3152] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:45:18 INFO - ++DOMWINDOW == 7 (0x7f8a79c91000) [pid = 3207] [serial = 7] [outer = 0x7f8a7a791800] 11:45:19 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:45:19 INFO - MEMORY STAT | vsize 510MB | residentFast 88MB | heapAllocated 19MB 11:45:19 INFO - 699 INFO TEST-OK | layout/mathml/tests/test_bug330964.html | took 2545ms 11:45:19 INFO - ++DOMWINDOW == 8 (0x7f8a7992c800) [pid = 3207] [serial = 8] [outer = 0x7f8a7a791800] 11:45:19 INFO - 700 INFO TEST-START | layout/mathml/tests/test_bug553917.html 11:45:19 INFO - ++DOMWINDOW == 9 (0x7f8a7992cc00) [pid = 3207] [serial = 9] [outer = 0x7f8a7a791800] 11:45:20 INFO - --DOCSHELL 0x7f49ed241800 == 6 [pid = 3152] [id = 5] 11:45:21 INFO - MEMORY STAT | vsize 513MB | residentFast 93MB | heapAllocated 21MB 11:45:21 INFO - 701 INFO TEST-OK | layout/mathml/tests/test_bug553917.html | took 1813ms 11:45:21 INFO - ++DOMWINDOW == 10 (0x7f8a7967f400) [pid = 3207] [serial = 10] [outer = 0x7f8a7a791800] 11:45:21 INFO - 702 INFO TEST-START | layout/mathml/tests/test_bug706406.html 11:45:21 INFO - ++DOMWINDOW == 11 (0x7f8a7967f800) [pid = 3207] [serial = 11] [outer = 0x7f8a7a791800] 11:45:21 INFO - MEMORY STAT | vsize 515MB | residentFast 95MB | heapAllocated 21MB 11:45:21 INFO - 703 INFO TEST-OK | layout/mathml/tests/test_bug706406.html | took 371ms 11:45:21 INFO - ++DOMWINDOW == 12 (0x7f8a79688800) [pid = 3207] [serial = 12] [outer = 0x7f8a7a791800] 11:45:22 INFO - 704 INFO TEST-START | layout/mathml/tests/test_bug827713-2.html 11:45:22 INFO - ++DOMWINDOW == 13 (0x7f8a79688c00) [pid = 3207] [serial = 13] [outer = 0x7f8a7a791800] 11:45:22 INFO - MEMORY STAT | vsize 516MB | residentFast 96MB | heapAllocated 22MB 11:45:22 INFO - 705 INFO TEST-OK | layout/mathml/tests/test_bug827713-2.html | took 415ms 11:45:22 INFO - ++DOMWINDOW == 14 (0x7f8a79476800) [pid = 3207] [serial = 14] [outer = 0x7f8a7a791800] 11:45:22 INFO - 706 INFO TEST-START | layout/mathml/tests/test_bug827713.html 11:45:22 INFO - ++DOMWINDOW == 15 (0x7f8a79476c00) [pid = 3207] [serial = 15] [outer = 0x7f8a7a791800] 11:45:22 INFO - MEMORY STAT | vsize 517MB | residentFast 97MB | heapAllocated 23MB 11:45:22 INFO - 707 INFO TEST-OK | layout/mathml/tests/test_bug827713.html | took 269ms 11:45:22 INFO - ++DOMWINDOW == 16 (0x7f8a7935e800) [pid = 3207] [serial = 16] [outer = 0x7f8a7a791800] 11:45:22 INFO - 708 INFO TEST-START | layout/mathml/tests/test_bug975681.html 11:45:23 INFO - ++DOMWINDOW == 17 (0x7f8a7935ec00) [pid = 3207] [serial = 17] [outer = 0x7f8a7a791800] 11:45:23 INFO - MEMORY STAT | vsize 518MB | residentFast 98MB | heapAllocated 24MB 11:45:23 INFO - 709 INFO TEST-OK | layout/mathml/tests/test_bug975681.html | took 309ms 11:45:23 INFO - ++DOMWINDOW == 18 (0x7f8a79366c00) [pid = 3207] [serial = 18] [outer = 0x7f8a7a791800] 11:45:23 INFO - 710 INFO TEST-START | layout/mathml/tests/test_opentype-axis-height.html 11:45:23 INFO - ++DOMWINDOW == 19 (0x7f8a79367000) [pid = 3207] [serial = 19] [outer = 0x7f8a7a791800] 11:45:23 INFO - MEMORY STAT | vsize 520MB | residentFast 100MB | heapAllocated 23MB 11:45:24 INFO - 711 INFO TEST-OK | layout/mathml/tests/test_opentype-axis-height.html | took 840ms 11:45:24 INFO - ++DOMWINDOW == 20 (0x7f8a79365800) [pid = 3207] [serial = 20] [outer = 0x7f8a7a791800] 11:45:24 INFO - 712 INFO TEST-START | layout/mathml/tests/test_opentype-fraction.html 11:45:24 INFO - ++DOMWINDOW == 21 (0x7f8a79361400) [pid = 3207] [serial = 21] [outer = 0x7f8a7a791800] 11:45:25 INFO - MEMORY STAT | vsize 519MB | residentFast 100MB | heapAllocated 20MB 11:45:25 INFO - 713 INFO TEST-OK | layout/mathml/tests/test_opentype-fraction.html | took 959ms 11:45:25 INFO - ++DOMWINDOW == 22 (0x7f8a79686400) [pid = 3207] [serial = 22] [outer = 0x7f8a7a791800] 11:45:25 INFO - 714 INFO TEST-START | layout/mathml/tests/test_opentype-limits.html 11:45:25 INFO - ++DOMWINDOW == 23 (0x7f8a798df800) [pid = 3207] [serial = 23] [outer = 0x7f8a7a791800] 11:45:25 INFO - Loading resource://gre/res/fonts/mathfontSTIXGeneral.properties ... Done 11:45:26 INFO - MEMORY STAT | vsize 520MB | residentFast 101MB | heapAllocated 21MB 11:45:26 INFO - 715 INFO TEST-OK | layout/mathml/tests/test_opentype-limits.html | took 972ms 11:45:26 INFO - ++DOMWINDOW == 24 (0x7f8a7992ec00) [pid = 3207] [serial = 24] [outer = 0x7f8a7a791800] 11:45:26 INFO - 716 INFO TEST-START | layout/mathml/tests/test_opentype-radical.html 11:45:26 INFO - ++DOMWINDOW == 25 (0x7f8a7992f000) [pid = 3207] [serial = 25] [outer = 0x7f8a7a791800] 11:45:26 INFO - Loading resource://gre/res/fonts/mathfontUnicode.properties ... Done 11:45:27 INFO - MEMORY STAT | vsize 520MB | residentFast 101MB | heapAllocated 23MB 11:45:27 INFO - 717 INFO TEST-OK | layout/mathml/tests/test_opentype-radical.html | took 1050ms 11:45:27 INFO - ++DOMWINDOW == 26 (0x7f8a7a78c000) [pid = 3207] [serial = 26] [outer = 0x7f8a7a791800] 11:45:27 INFO - 718 INFO TEST-START | layout/mathml/tests/test_opentype-scripts.html 11:45:27 INFO - ++DOMWINDOW == 27 (0x7f8a79d7dc00) [pid = 3207] [serial = 27] [outer = 0x7f8a7a791800] 11:45:28 INFO - MEMORY STAT | vsize 520MB | residentFast 101MB | heapAllocated 24MB 11:45:28 INFO - 719 INFO TEST-OK | layout/mathml/tests/test_opentype-scripts.html | took 1149ms 11:45:28 INFO - ++DOMWINDOW == 28 (0x7f8a7b25a000) [pid = 3207] [serial = 28] [outer = 0x7f8a7a791800] 11:45:29 INFO - 720 INFO TEST-START | layout/mathml/tests/test_opentype-stack.html 11:45:29 INFO - ++DOMWINDOW == 29 (0x7f8a7a795800) [pid = 3207] [serial = 29] [outer = 0x7f8a7a791800] 11:45:30 INFO - MEMORY STAT | vsize 520MB | residentFast 102MB | heapAllocated 25MB 11:45:30 INFO - 721 INFO TEST-OK | layout/mathml/tests/test_opentype-stack.html | took 1684ms 11:45:30 INFO - ++DOMWINDOW == 30 (0x7f8a7b4d2400) [pid = 3207] [serial = 30] [outer = 0x7f8a7a791800] 11:45:31 INFO - ++DOMWINDOW == 31 (0x7f8a7b4d2c00) [pid = 3207] [serial = 31] [outer = 0x7f8a7a791800] 11:45:31 INFO - --DOCSHELL 0x7f49e5f58800 == 5 [pid = 3152] [id = 6] 11:45:31 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 211: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 11:45:31 INFO - --DOMWINDOW == 30 (0x7f8a7b517000) [pid = 3207] [serial = 2] [outer = (nil)] [url = about:blank] 11:45:31 INFO - --DOMWINDOW == 29 (0x7f8a7a792400) [pid = 3207] [serial = 5] [outer = (nil)] [url = about:blank] 11:45:31 INFO - --DOMWINDOW == 28 (0x7f8a79d7d000) [pid = 3207] [serial = 6] [outer = (nil)] [url = about:blank] 11:45:31 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:45:32 INFO - --DOCSHELL 0x7f49ff980800 == 4 [pid = 3152] [id = 1] 11:45:32 INFO - --DOCSHELL 0x7f49e5f60000 == 3 [pid = 3152] [id = 7] 11:45:32 INFO - --DOCSHELL 0x7f49fa068800 == 2 [pid = 3152] [id = 2] 11:45:32 INFO - --DOCSHELL 0x7f49eee3d000 == 1 [pid = 3152] [id = 3] 11:45:32 INFO - --DOCSHELL 0x7f49eee40800 == 0 [pid = 3152] [id = 4] 11:45:32 INFO - [Child 3207] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:45:33 INFO - ]: 11:45:33 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:45:33 INFO - --DOCSHELL 0x7f8a7c32e800 == 1 [pid = 3207] [id = 1] 11:45:33 INFO - --DOCSHELL 0x7f8a7a7a1000 == 0 [pid = 3207] [id = 2] 11:45:33 INFO - --DOMWINDOW == 27 (0x7f8a7935ec00) [pid = 3207] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug975681.html] 11:45:33 INFO - --DOMWINDOW == 26 (0x7f8a7967f800) [pid = 3207] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug706406.html] 11:45:33 INFO - --DOMWINDOW == 25 (0x7f8a79c91000) [pid = 3207] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug330964.html] 11:45:33 INFO - --DOMWINDOW == 24 (0x7f8a7992c800) [pid = 3207] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 23 (0x7f8a7992cc00) [pid = 3207] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug553917.html] 11:45:33 INFO - --DOMWINDOW == 22 (0x7f8a7967f400) [pid = 3207] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 21 (0x7f8a79688800) [pid = 3207] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 20 (0x7f8a79688c00) [pid = 3207] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug827713-2.html] 11:45:33 INFO - --DOMWINDOW == 19 (0x7f8a79476800) [pid = 3207] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 18 (0x7f8a79476c00) [pid = 3207] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_bug827713.html] 11:45:33 INFO - --DOMWINDOW == 17 (0x7f8a7935e800) [pid = 3207] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 16 (0x7f8a7b2d5400) [pid = 3207] [serial = 3] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:45:33 INFO - --DOMWINDOW == 15 (0x7f8a79365800) [pid = 3207] [serial = 20] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 14 (0x7f8a79686400) [pid = 3207] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 13 (0x7f8a7992ec00) [pid = 3207] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 12 (0x7f8a7a78c000) [pid = 3207] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 11 (0x7f8a7b25a000) [pid = 3207] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 10 (0x7f8a7b4d2400) [pid = 3207] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 9 (0x7f8a79366c00) [pid = 3207] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:45:33 INFO - --DOMWINDOW == 8 (0x7f8a7b4d2c00) [pid = 3207] [serial = 31] [outer = (nil)] [url = about:blank] 11:45:33 INFO - --DOMWINDOW == 7 (0x7f8a7c37b000) [pid = 3207] [serial = 1] [outer = (nil)] [url = http://mochi.test:8888/tests?autorun=1&closeWhenDone=1&consoleLevel=INFO&hideResultsTable=1&manifestFile=tests.json&dumpOutputDirectory=%2Ftmp] 11:45:33 INFO - --DOMWINDOW == 6 (0x7f8a7a791800) [pid = 3207] [serial = 4] [outer = (nil)] [url = about:blank] 11:45:33 INFO - --DOMWINDOW == 5 (0x7f8a7a795800) [pid = 3207] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-stack.html] 11:45:33 INFO - --DOMWINDOW == 4 (0x7f8a79d7dc00) [pid = 3207] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-scripts.html] 11:45:33 INFO - --DOMWINDOW == 3 (0x7f8a7992f000) [pid = 3207] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-radical.html] 11:45:33 INFO - --DOMWINDOW == 2 (0x7f8a798df800) [pid = 3207] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-limits.html] 11:45:33 INFO - --DOMWINDOW == 1 (0x7f8a79361400) [pid = 3207] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-fraction.html] 11:45:33 INFO - --DOMWINDOW == 0 (0x7f8a79367000) [pid = 3207] [serial = 19] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/mathml/tests/test_opentype-axis-height.html] 11:45:33 INFO - nsStringStats 11:45:33 INFO - => mAllocCount: 51167 11:45:33 INFO - => mReallocCount: 1236 11:45:33 INFO - => mFreeCount: 51167 11:45:33 INFO - => mShareCount: 78459 11:45:33 INFO - => mAdoptCount: 3457 11:45:33 INFO - => mAdoptFreeCount: 3457 11:45:33 INFO - => Process ID: 3207, Thread ID: 140233259633216 11:45:33 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:45:33 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:45:33 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 11:45:34 INFO - [Parent 3152] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 794 11:45:34 INFO - [Parent 3152] WARNING: 'NS_FAILED(RemovePermissionChangeObserver())', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/notification/Notification.cpp, line 675 11:45:35 INFO - --DOMWINDOW == 16 (0x7f49ecfe1000) [pid = 3152] [serial = 11] [outer = 0x7f49eee6d000] [url = about:blank] 11:45:35 INFO - --DOMWINDOW == 15 (0x7f49ecfe0800) [pid = 3152] [serial = 10] [outer = 0x7f49eee6c800] [url = about:blank] 11:45:35 INFO - --DOMWINDOW == 14 (0x7f49eee6d000) [pid = 3152] [serial = 7] [outer = (nil)] [url = about:blank] 11:45:35 INFO - --DOMWINDOW == 13 (0x7f49eee6c800) [pid = 3152] [serial = 6] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 12 (0x7f49f9f10c00) [pid = 3152] [serial = 4] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 11 (0x7f49f9f10000) [pid = 3152] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 11:45:36 INFO - --DOMWINDOW == 10 (0x7f49e69ef000) [pid = 3152] [serial = 15] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:45:36 INFO - --DOMWINDOW == 9 (0x7f49ebe4d000) [pid = 3152] [serial = 17] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 8 (0x7f49feb6a800) [pid = 3152] [serial = 2] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 7 (0x7f49e6b4c800) [pid = 3152] [serial = 14] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 6 (0x7f49ff9ac800) [pid = 3152] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:45:36 INFO - --DOMWINDOW == 5 (0x7f49e6b49000) [pid = 3152] [serial = 13] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 11:45:36 INFO - --DOMWINDOW == 4 (0x7f49e6b4e400) [pid = 3152] [serial = 16] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 3 (0x7f49ecfe2c00) [pid = 3152] [serial = 12] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 2 (0x7f49ed10a000) [pid = 3152] [serial = 9] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 1 (0x7f49ede87000) [pid = 3152] [serial = 8] [outer = (nil)] [url = about:blank] 11:45:36 INFO - --DOMWINDOW == 0 (0x7f49f9a8a800) [pid = 3152] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 11:45:36 INFO - nsStringStats 11:45:36 INFO - => mAllocCount: 93073 11:45:36 INFO - => mReallocCount: 10918 11:45:36 INFO - => mFreeCount: 93073 11:45:36 INFO - => mShareCount: 93883 11:45:36 INFO - => mAdoptCount: 3872 11:45:36 INFO - => mAdoptFreeCount: 3872 11:45:36 INFO - => Process ID: 3152, Thread ID: 139956380157760 11:45:36 INFO - TEST-INFO | Main app process: exit 0 11:45:36 INFO - runtests.py | Application ran for: 0:00:35.670978 11:45:36 INFO - zombiecheck | Reading PID log: /tmp/tmplYp35Npidlog 11:45:36 INFO - ==> process 3152 launched child process 3207 11:45:36 INFO - zombiecheck | Checking for orphan process with PID: 3207 11:45:36 INFO - Stopping web server 11:45:36 INFO - Stopping web socket server 11:45:36 INFO - Stopping ssltunnel 11:45:36 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 11:45:36 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 11:45:36 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 11:45:36 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 3152 11:45:36 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:45:36 INFO - | | Per-Inst Leaked| Total Rem| 11:45:36 INFO - 0 |TOTAL | 28 0| 1772276 0| 11:45:36 INFO - nsTraceRefcnt::DumpStatistics: 1316 entries 11:45:36 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 11:45:36 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, tab process 3207 11:45:36 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 11:45:36 INFO - | | Per-Inst Leaked| Total Rem| 11:45:36 INFO - 0 |TOTAL | 22 4640| 1034417 33| 11:45:36 INFO - 11 |AsyncTransactionTrackersHolder | 72 72| 3 1| 11:45:36 INFO - 47 |CompositorChild | 880 880| 1 1| 11:45:36 INFO - 49 |CondVar | 40 120| 28 3| 11:45:36 INFO - 142 |IPC::Channel | 16 32| 7 2| 11:45:36 INFO - 166 |MessagePump | 16 16| 10 1| 11:45:36 INFO - 170 |Mutex | 32 96| 345 3| 11:45:36 INFO - 181 |PCompositorChild | 776 776| 1 1| 11:45:36 INFO - 187 |PImageBridgeChild | 920 920| 1 1| 11:45:36 INFO - 235 |RefCountedMonitor | 80 160| 6 2| 11:45:36 INFO - 236 |RefCountedTask | 16 64| 12 4| 11:45:36 INFO - 268 |StoreRef | 16 32| 7 2| 11:45:36 INFO - 305 |WaitableEventKernel | 72 72| 13 1| 11:45:36 INFO - 310 |WeakReference | 16 32| 257 2| 11:45:36 INFO - 336 |base::Thread | 48 48| 3 1| 11:45:36 INFO - 362 |ipc::MessageChannel | 512 1024| 6 2| 11:45:36 INFO - 718 |nsTArray_base | 8 40| 254512 5| 11:45:36 INFO - 722 |nsThread | 256 256| 9 1| 11:45:36 INFO - nsTraceRefcnt::DumpStatistics: 785 entries 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 AsyncTransactionTrackersHolder 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 CompositorChild 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 3 CondVar 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 2 IPC::Channel 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 MessagePump 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 3 Mutex 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PCompositorChild 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 PImageBridgeChild 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 2 RefCountedMonitor 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 4 RefCountedTask 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 2 StoreRef 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 WaitableEventKernel 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 2 WeakReference 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 base::Thread 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 2 ipc::MessageChannel 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 5 nsTArray_base 11:45:36 INFO - TEST-INFO | leakcheck | tab process: leaked 1 nsThread 11:45:36 INFO - WARNING | leakcheck | tab process: 4640 bytes leaked () 11:45:36 INFO - runtests.py | Running tests: end. 11:45:36 INFO - 722 INFO TEST-START | Shutdown 11:45:36 INFO - 723 INFO Passed: 109 11:45:36 INFO - 724 INFO Failed: 0 11:45:36 INFO - 725 INFO Todo: 0 11:45:36 INFO - 726 INFO Slowest: 2544ms - /tests/layout/mathml/tests/test_bug330964.html 11:45:36 INFO - 727 INFO SimpleTest FINISHED 11:45:36 INFO - 728 INFO TEST-INFO | Ran 1 Loops 11:45:36 INFO - 729 INFO SimpleTest FINISHED 11:45:36 INFO - dir: layout/style/test 11:45:37 INFO - Setting pipeline to PAUSED ... 11:45:37 INFO - Pipeline is PREROLLING ... 11:45:37 INFO - Pipeline is PREROLLED ... 11:45:37 INFO - Setting pipeline to PLAYING ... 11:45:37 INFO - New clock: GstSystemClock 11:45:37 INFO - Got EOS from element "pipeline0". 11:45:37 INFO - Execution ended after 32644803 ns. 11:45:37 INFO - Setting pipeline to PAUSED ... 11:45:37 INFO - Setting pipeline to READY ... 11:45:37 INFO - Setting pipeline to NULL ... 11:45:37 INFO - Freeing pipeline ... 11:45:40 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 11:45:41 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpL1R4Zj.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 11:45:41 INFO - runtests.py | Server pid: 3264 11:45:42 INFO - runtests.py | Websocket server pid: 3282 11:45:43 INFO - runtests.py | SSL tunnel pid: 3285 11:45:43 INFO - runtests.py | Running tests: start. 11:45:44 INFO - runtests.py | Application pid: 3292 11:45:44 INFO - TEST-INFO | started process Main app process 11:45:44 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpL1R4Zj.mozrunner/runtests_leaks.log 11:45:47 INFO - ++DOCSHELL 0x7ff699f80000 == 1 [pid = 3292] [id = 1] 11:45:47 INFO - ++DOMWINDOW == 1 (0x7ff699fab800) [pid = 3292] [serial = 1] [outer = (nil)] 11:45:47 INFO - [3292] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2107 11:45:47 INFO - ++DOMWINDOW == 2 (0x7ff699169800) [pid = 3292] [serial = 2] [outer = 0x7ff699fab800] 11:45:48 INFO - ++DOCSHELL 0x7ff69465f000 == 2 [pid = 3292] [id = 2] 11:45:48 INFO - ++DOMWINDOW == 3 (0x7ff694507800) [pid = 3292] [serial = 3] [outer = (nil)] 11:45:48 INFO - ++DOMWINDOW == 4 (0x7ff694508400) [pid = 3292] [serial = 4] [outer = 0x7ff694507800] 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnptestjava.so returned 7ff6945c61f0 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnpsecondtest.so returned 7ff6945c65e0 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnptest.so returned 7ff6945c6910 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnpctrltest.so returned 7ff6945c6a00 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnpswftest.so returned 7ff6945c6d30 11:45:48 INFO - LoadPlugin() /tmp/tmpL1R4Zj.mozrunner/plugins/libnpthirdtest.so returned 7ff6936ff040 11:45:48 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7ff6936ff3a0 11:45:48 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7ff6945fe5b0 11:45:48 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7ff69a50d700 11:45:48 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7ff69a50da00 11:45:48 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7ff69a50dd30 11:45:48 INFO - ++DOMWINDOW == 5 (0x7ff69368a800) [pid = 3292] [serial = 5] [outer = 0x7ff699fab800] 11:45:50 INFO - [3292] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 967 11:45:51 INFO - ++DOCSHELL 0x7ff68962b800 == 3 [pid = 3292] [id = 3] 11:45:51 INFO - ++DOMWINDOW == 6 (0x7ff6897d2c00) [pid = 3292] [serial = 6] [outer = (nil)] 11:45:51 INFO - ++DOCSHELL 0x7ff68962f000 == 4 [pid = 3292] [id = 4] 11:45:51 INFO - ++DOMWINDOW == 7 (0x7ff6897d3400) [pid = 3292] [serial = 7] [outer = (nil)] 11:45:52 INFO - [3292] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:45:52 INFO - ++DOCSHELL 0x7ff687906800 == 5 [pid = 3292] [id = 5] 11:45:52 INFO - ++DOMWINDOW == 8 (0x7ff6885a1800) [pid = 3292] [serial = 8] [outer = (nil)] 11:45:52 INFO - [3292] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 11:45:52 INFO - ++DOMWINDOW == 9 (0x7ff68780a000) [pid = 3292] [serial = 9] [outer = 0x7ff6885a1800] 11:45:52 INFO - ++DOMWINDOW == 10 (0x7ff6876d7c00) [pid = 3292] [serial = 10] [outer = 0x7ff6897d2c00] 11:45:52 INFO - ++DOMWINDOW == 11 (0x7ff6876d8400) [pid = 3292] [serial = 11] [outer = 0x7ff6897d3400] 11:45:52 INFO - ++DOMWINDOW == 12 (0x7ff6876da000) [pid = 3292] [serial = 12] [outer = 0x7ff6885a1800] 11:45:54 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpL1R4Zj.mozrunner/runtests_leaks_tab_pid3347.log 11:45:55 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsXREDirProvider.cpp, line 1412 11:45:56 INFO - ++DOCSHELL 0x7f628312e800 == 1 [pid = 3347] [id = 1] 11:45:56 INFO - ++DOMWINDOW == 1 (0x7f628317b000) [pid = 3347] [serial = 1] [outer = (nil)] 11:45:56 INFO - ++DOMWINDOW == 2 (0x7f6282317000) [pid = 3347] [serial = 2] [outer = 0x7f628317b000] 11:45:56 INFO - [Parent 3292] WARNING: Could not get disk information from DiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/storage/DOMStorageIPC.cpp, line 320 11:45:57 INFO - [Parent 3292] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 11:45:57 INFO - ++DOMWINDOW == 3 (0x7f62820d5400) [pid = 3347] [serial = 3] [outer = 0x7f628317b000] 11:45:59 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:45:59 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:45:59 INFO - ++DOCSHELL 0x7f62815a1800 == 2 [pid = 3347] [id = 2] 11:45:59 INFO - ++DOMWINDOW == 4 (0x7f6281591800) [pid = 3347] [serial = 4] [outer = (nil)] 11:45:59 INFO - ++DOCSHELL 0x7ff68064c800 == 6 [pid = 3292] [id = 6] 11:45:59 INFO - ++DOMWINDOW == 13 (0x7ff680628000) [pid = 3292] [serial = 13] [outer = (nil)] 11:45:59 INFO - ++DOMWINDOW == 14 (0x7ff68062e000) [pid = 3292] [serial = 14] [outer = 0x7ff680628000] 11:45:59 INFO - ++DOMWINDOW == 5 (0x7f62820d3800) [pid = 3347] [serial = 5] [outer = 0x7f6281591800] 11:45:59 INFO - ++DOMWINDOW == 15 (0x7ff68062a400) [pid = 3292] [serial = 15] [outer = 0x7ff680628000] 11:45:59 INFO - ++DOCSHELL 0x7ff680654000 == 7 [pid = 3292] [id = 7] 11:45:59 INFO - ++DOMWINDOW == 16 (0x7ff68062e800) [pid = 3292] [serial = 16] [outer = (nil)] 11:45:59 INFO - ++DOMWINDOW == 17 (0x7ff686422c00) [pid = 3292] [serial = 17] [outer = 0x7ff68062e800] 11:45:59 INFO - 730 INFO TEST-START | layout/style/test/test_acid3_test46.html 11:45:59 INFO - [Child 3347] WARNING: TabChild::SetFocus not supported in TabChild: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/ipc/TabChild.cpp, line 982 11:45:59 INFO - ++DOMWINDOW == 6 (0x7f6280be0000) [pid = 3347] [serial = 6] [outer = 0x7f6281591800] 11:46:00 INFO - [Parent 3292] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:46:01 INFO - ++DOMWINDOW == 7 (0x7f6280aa6800) [pid = 3347] [serial = 7] [outer = 0x7f6281591800] 11:46:02 INFO - ++DOCSHELL 0x7f6280a7f000 == 3 [pid = 3347] [id = 3] 11:46:02 INFO - ++DOMWINDOW == 8 (0x7f6280804000) [pid = 3347] [serial = 8] [outer = (nil)] 11:46:02 INFO - --DOCSHELL 0x7ff687906800 == 6 [pid = 3292] [id = 5] 11:46:02 INFO - ++DOMWINDOW == 9 (0x7f6280809400) [pid = 3347] [serial = 9] [outer = 0x7f6280804000] 11:46:02 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 11:46:02 INFO - MEMORY STAT | vsize 509MB | residentFast 88MB | heapAllocated 19MB 11:46:02 INFO - 731 INFO TEST-OK | layout/style/test/test_acid3_test46.html | took 2810ms 11:46:02 INFO - ++DOMWINDOW == 10 (0x7f62808f1800) [pid = 3347] [serial = 10] [outer = 0x7f6281591800] 11:46:02 INFO - 732 INFO TEST-START | layout/style/test/test_align_justify_computed_values.html 11:46:02 INFO - ++DOMWINDOW == 11 (0x7f62808f2000) [pid = 3347] [serial = 11] [outer = 0x7f6281591800] 11:46:03 INFO - MEMORY STAT | vsize 512MB | residentFast 92MB | heapAllocated 21MB 11:46:03 INFO - 733 INFO TEST-OK | layout/style/test/test_align_justify_computed_values.html | took 798ms 11:46:03 INFO - ++DOMWINDOW == 12 (0x7f6280469c00) [pid = 3347] [serial = 12] [outer = 0x7f6281591800] 11:46:03 INFO - 734 INFO TEST-START | layout/style/test/test_all_shorthand.html 11:46:03 INFO - ++DOMWINDOW == 13 (0x7f628046d000) [pid = 3347] [serial = 13] [outer = 0x7f6281591800] 11:46:07 INFO - MEMORY STAT | vsize 529MB | residentFast 109MB | heapAllocated 35MB 11:46:07 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:46:07 INFO - 735 INFO TEST-OK | layout/style/test/test_all_shorthand.html | took 3371ms 11:46:07 INFO - ++DOMWINDOW == 14 (0x7f627f40b400) [pid = 3347] [serial = 14] [outer = 0x7f6281591800] 11:46:07 INFO - 736 INFO TEST-START | layout/style/test/test_animations.html 11:46:07 INFO - ++DOMWINDOW == 15 (0x7f627f40e000) [pid = 3347] [serial = 15] [outer = 0x7f6281591800] 11:46:11 INFO - --DOCSHELL 0x7f6280a7f000 == 2 [pid = 3347] [id = 3] 11:46:11 INFO - MEMORY STAT | vsize 530MB | residentFast 101MB | heapAllocated 22MB 11:46:11 INFO - 737 INFO TEST-OK | layout/style/test/test_animations.html | took 4282ms 11:46:11 INFO - ++DOMWINDOW == 16 (0x7f6288ebc000) [pid = 3347] [serial = 16] [outer = 0x7f6281591800] 11:46:11 INFO - 738 INFO TEST-START | layout/style/test/test_animations_async_tests.html 11:46:11 INFO - ++DOMWINDOW == 17 (0x7f627f40d800) [pid = 3347] [serial = 17] [outer = 0x7f6281591800] 11:46:12 INFO - ++DOCSHELL 0x7f627f5d2800 == 3 [pid = 3347] [id = 4] 11:46:12 INFO - ++DOMWINDOW == 18 (0x7f6288ebf000) [pid = 3347] [serial = 18] [outer = (nil)] 11:46:12 INFO - ++DOCSHELL 0x7ff682e4b000 == 7 [pid = 3292] [id = 8] 11:46:12 INFO - ++DOMWINDOW == 18 (0x7ff686ed9400) [pid = 3292] [serial = 18] [outer = (nil)] 11:46:12 INFO - ++DOMWINDOW == 19 (0x7f627f80e800) [pid = 3347] [serial = 19] [outer = 0x7f6288ebf000] 11:46:12 INFO - ++DOMWINDOW == 19 (0x7ff689240400) [pid = 3292] [serial = 19] [outer = 0x7ff686ed9400] 11:46:12 INFO - ++DOMWINDOW == 20 (0x7ff688a4bc00) [pid = 3292] [serial = 20] [outer = 0x7ff686ed9400] 11:46:13 INFO - ++DOMWINDOW == 20 (0x7f627f819c00) [pid = 3347] [serial = 20] [outer = 0x7f6288ebf000] 11:46:13 INFO - [Parent 3292] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 11:46:14 INFO - MEMORY STAT | vsize 530MB | residentFast 103MB | heapAllocated 24MB 11:46:14 INFO - 739 INFO TEST-OK | layout/style/test/test_animations_async_tests.html | took 2880ms 11:46:14 INFO - ++DOMWINDOW == 21 (0x7f62803f0400) [pid = 3347] [serial = 21] [outer = 0x7f6281591800] 11:46:14 INFO - 740 INFO TEST-START | layout/style/test/test_animations_dynamic_changes.html 11:46:14 INFO - ++DOMWINDOW == 22 (0x7f62803f1000) [pid = 3347] [serial = 22] [outer = 0x7f6281591800] 11:46:15 INFO - MEMORY STAT | vsize 531MB | residentFast 104MB | heapAllocated 24MB 11:46:15 INFO - 741 INFO TEST-OK | layout/style/test/test_animations_dynamic_changes.html | took 330ms 11:46:15 INFO - ++DOMWINDOW == 23 (0x7f6280bd8800) [pid = 3347] [serial = 23] [outer = 0x7f6281591800] 11:46:15 INFO - 742 INFO TEST-START | layout/style/test/test_animations_event_order.html 11:46:15 INFO - ++DOMWINDOW == 24 (0x7f6282277400) [pid = 3347] [serial = 24] [outer = 0x7f6281591800] 11:46:15 INFO - MEMORY STAT | vsize 531MB | residentFast 105MB | heapAllocated 25MB 11:46:15 INFO - --DOMWINDOW == 19 (0x7ff6885a1800) [pid = 3292] [serial = 8] [outer = (nil)] [url = about:blank] 11:46:15 INFO - --DOMWINDOW == 18 (0x7ff6876da000) [pid = 3292] [serial = 12] [outer = (nil)] [url = about:blank] 11:46:15 INFO - --DOMWINDOW == 17 (0x7ff68780a000) [pid = 3292] [serial = 9] [outer = (nil)] [url = about:blank] 11:46:15 INFO - --DOMWINDOW == 16 (0x7ff68062e000) [pid = 3292] [serial = 14] [outer = (nil)] [url = about:blank] 11:46:15 INFO - --DOMWINDOW == 15 (0x7ff699169800) [pid = 3292] [serial = 2] [outer = (nil)] [url = about:blank] 11:46:15 INFO - 743 INFO TEST-OK | layout/style/test/test_animations_event_order.html | took 660ms 11:46:15 INFO - ++DOMWINDOW == 25 (0x7f62800d5400) [pid = 3347] [serial = 25] [outer = 0x7f6281591800] 11:46:15 INFO - 744 INFO TEST-START | layout/style/test/test_animations_omta.html 11:46:16 INFO - ++DOMWINDOW == 26 (0x7f62800d5800) [pid = 3347] [serial = 26] [outer = 0x7f6281591800] 11:46:18 INFO - --DOCSHELL 0x7f627f5d2800 == 2 [pid = 3347] [id = 4] 11:46:20 INFO - --DOMWINDOW == 25 (0x7f628046d000) [pid = 3347] [serial = 13] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_all_shorthand.html] 11:46:20 INFO - --DOMWINDOW == 24 (0x7f6282317000) [pid = 3347] [serial = 2] [outer = (nil)] [url = about:blank] 11:46:20 INFO - --DOMWINDOW == 23 (0x7f627f80e800) [pid = 3347] [serial = 19] [outer = (nil)] [url = about:blank] 11:46:20 INFO - --DOMWINDOW == 22 (0x7f627f40b400) [pid = 3347] [serial = 14] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 21 (0x7f62800d5400) [pid = 3347] [serial = 25] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 20 (0x7f6280bd8800) [pid = 3347] [serial = 23] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 19 (0x7f62803f1000) [pid = 3347] [serial = 22] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_dynamic_changes.html] 11:46:20 INFO - --DOMWINDOW == 18 (0x7f62803f0400) [pid = 3347] [serial = 21] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 17 (0x7f6288ebc000) [pid = 3347] [serial = 16] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 16 (0x7f6280804000) [pid = 3347] [serial = 8] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/empty.html] 11:46:20 INFO - --DOMWINDOW == 15 (0x7f6280469c00) [pid = 3347] [serial = 12] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 14 (0x7f62820d3800) [pid = 3347] [serial = 5] [outer = (nil)] [url = about:blank] 11:46:20 INFO - --DOMWINDOW == 13 (0x7f6280be0000) [pid = 3347] [serial = 6] [outer = (nil)] [url = about:blank] 11:46:20 INFO - --DOMWINDOW == 12 (0x7f6280809400) [pid = 3347] [serial = 9] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/empty.html] 11:46:20 INFO - --DOMWINDOW == 11 (0x7f62808f1800) [pid = 3347] [serial = 10] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:20 INFO - --DOMWINDOW == 10 (0x7f6288ebf000) [pid = 3347] [serial = 18] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_animations_async_tests.html] 11:46:20 INFO - --DOMWINDOW == 9 (0x7f62808f2000) [pid = 3347] [serial = 11] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_align_justify_computed_values.html] 11:46:23 INFO - MEMORY STAT | vsize 532MB | residentFast 104MB | heapAllocated 22MB 11:46:23 INFO - 745 INFO TEST-OK | layout/style/test/test_animations_omta.html | took 7962ms 11:46:24 INFO - ++DOMWINDOW == 10 (0x7f6280570c00) [pid = 3347] [serial = 27] [outer = 0x7f6281591800] 11:46:24 INFO - 746 INFO TEST-START | layout/style/test/test_animations_omta_start.html 11:46:24 INFO - ++DOMWINDOW == 11 (0x7f627f40ac00) [pid = 3347] [serial = 28] [outer = 0x7f6281591800] 11:46:25 INFO - MEMORY STAT | vsize 532MB | residentFast 101MB | heapAllocated 18MB 11:46:25 INFO - --DOMWINDOW == 10 (0x7f6280aa6800) [pid = 3347] [serial = 7] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_acid3_test46.html] 11:46:25 INFO - --DOMWINDOW == 9 (0x7f627f819c00) [pid = 3347] [serial = 20] [outer = (nil)] [url = about:blank] 11:46:25 INFO - --DOMWINDOW == 8 (0x7f627f40e000) [pid = 3347] [serial = 15] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations.html] 11:46:25 INFO - --DOMWINDOW == 7 (0x7f627f40d800) [pid = 3347] [serial = 17] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_async_tests.html] 11:46:25 INFO - --DOMWINDOW == 6 (0x7f6282277400) [pid = 3347] [serial = 24] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_event_order.html] 11:46:25 INFO - 747 INFO TEST-OK | layout/style/test/test_animations_omta_start.html | took 1176ms 11:46:25 INFO - ++DOMWINDOW == 7 (0x7f627f585000) [pid = 3347] [serial = 29] [outer = 0x7f6281591800] 11:46:25 INFO - 748 INFO TEST-START | layout/style/test/test_animations_pausing.html 11:46:25 INFO - ++DOMWINDOW == 8 (0x7f627f411400) [pid = 3347] [serial = 30] [outer = 0x7f6281591800] 11:46:25 INFO - ++DOCSHELL 0x7f627f9dc000 == 3 [pid = 3347] [id = 5] 11:46:25 INFO - ++DOMWINDOW == 9 (0x7f627f58d000) [pid = 3347] [serial = 31] [outer = (nil)] 11:46:25 INFO - ++DOMWINDOW == 10 (0x7f627f591800) [pid = 3347] [serial = 32] [outer = 0x7f627f58d000] 11:46:26 INFO - ++DOMWINDOW == 11 (0x7f627f605400) [pid = 3347] [serial = 33] [outer = 0x7f627f58d000] 11:46:26 INFO - --DOMWINDOW == 14 (0x7ff689240400) [pid = 3292] [serial = 19] [outer = (nil)] [url = about:blank] 11:46:27 INFO - MEMORY STAT | vsize 532MB | residentFast 102MB | heapAllocated 20MB 11:46:27 INFO - 749 INFO TEST-OK | layout/style/test/test_animations_pausing.html | took 1840ms 11:46:27 INFO - ++DOMWINDOW == 12 (0x7f627f60a400) [pid = 3347] [serial = 34] [outer = 0x7f6281591800] 11:46:27 INFO - 750 INFO TEST-START | layout/style/test/test_animations_playbackrate.html 11:46:27 INFO - ++DOMWINDOW == 13 (0x7f627f60dc00) [pid = 3347] [serial = 35] [outer = 0x7f6281591800] 11:46:27 INFO - ++DOCSHELL 0x7f6280519000 == 4 [pid = 3347] [id = 6] 11:46:27 INFO - ++DOMWINDOW == 14 (0x7f627f6ae400) [pid = 3347] [serial = 36] [outer = (nil)] 11:46:27 INFO - ++DOMWINDOW == 15 (0x7f627f6b3000) [pid = 3347] [serial = 37] [outer = 0x7f627f6ae400] 11:46:28 INFO - ++DOMWINDOW == 16 (0x7f627f6b7400) [pid = 3347] [serial = 38] [outer = 0x7f627f6ae400] 11:46:28 INFO - --DOMWINDOW == 15 (0x7f6280570c00) [pid = 3347] [serial = 27] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:28 INFO - MEMORY STAT | vsize 533MB | residentFast 105MB | heapAllocated 21MB 11:46:29 INFO - 751 INFO TEST-OK | layout/style/test/test_animations_playbackrate.html | took 1852ms 11:46:29 INFO - ++DOMWINDOW == 16 (0x7f627f80c800) [pid = 3347] [serial = 39] [outer = 0x7f6281591800] 11:46:29 INFO - 752 INFO TEST-START | layout/style/test/test_any_dynamic.html 11:46:29 INFO - ++DOMWINDOW == 17 (0x7f627f80cc00) [pid = 3347] [serial = 40] [outer = 0x7f6281591800] 11:46:29 INFO - MEMORY STAT | vsize 533MB | residentFast 105MB | heapAllocated 21MB 11:46:29 INFO - 753 INFO TEST-OK | layout/style/test/test_any_dynamic.html | took 334ms 11:46:29 INFO - ++DOMWINDOW == 18 (0x7f627f824c00) [pid = 3347] [serial = 41] [outer = 0x7f6281591800] 11:46:29 INFO - 754 INFO TEST-START | layout/style/test/test_at_rule_parse_serialize.html 11:46:29 INFO - ++DOMWINDOW == 19 (0x7f627f824400) [pid = 3347] [serial = 42] [outer = 0x7f6281591800] 11:46:30 INFO - MEMORY STAT | vsize 533MB | residentFast 105MB | heapAllocated 22MB 11:46:30 INFO - 755 INFO TEST-OK | layout/style/test/test_at_rule_parse_serialize.html | took 336ms 11:46:30 INFO - ++DOMWINDOW == 20 (0x7f627f849c00) [pid = 3347] [serial = 43] [outer = 0x7f6281591800] 11:46:30 INFO - 756 INFO TEST-START | layout/style/test/test_attribute_selector_eof_behavior.html 11:46:30 INFO - ++DOMWINDOW == 21 (0x7f627f40b000) [pid = 3347] [serial = 44] [outer = 0x7f6281591800] 11:46:31 INFO - MEMORY STAT | vsize 533MB | residentFast 106MB | heapAllocated 22MB 11:46:31 INFO - 757 INFO TEST-OK | layout/style/test/test_attribute_selector_eof_behavior.html | took 956ms 11:46:31 INFO - ++DOMWINDOW == 22 (0x7f627f609800) [pid = 3347] [serial = 45] [outer = 0x7f6281591800] 11:46:31 INFO - 758 INFO TEST-START | layout/style/test/test_background_blend_mode.html 11:46:31 INFO - ++DOMWINDOW == 23 (0x7f627f589800) [pid = 3347] [serial = 46] [outer = 0x7f6281591800] 11:46:32 INFO - --DOCSHELL 0x7f627f9dc000 == 3 [pid = 3347] [id = 5] 11:46:32 INFO - --DOCSHELL 0x7f6280519000 == 2 [pid = 3347] [id = 6] 11:46:32 INFO - --DOMWINDOW == 22 (0x7f62800d5800) [pid = 3347] [serial = 26] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_omta.html] 11:46:32 INFO - MEMORY STAT | vsize 532MB | residentFast 103MB | heapAllocated 19MB 11:46:32 INFO - 759 INFO TEST-OK | layout/style/test/test_background_blend_mode.html | took 895ms 11:46:32 INFO - ++DOMWINDOW == 23 (0x7f627f591000) [pid = 3347] [serial = 47] [outer = 0x7f6281591800] 11:46:32 INFO - 760 INFO TEST-START | layout/style/test/test_box_size_keywords.html 11:46:32 INFO - ++DOMWINDOW == 24 (0x7f627f584c00) [pid = 3347] [serial = 48] [outer = 0x7f6281591800] 11:46:33 INFO - MEMORY STAT | vsize 532MB | residentFast 106MB | heapAllocated 22MB 11:46:33 INFO - 761 INFO TEST-OK | layout/style/test/test_box_size_keywords.html | took 905ms 11:46:33 INFO - ++DOMWINDOW == 25 (0x7f627f81dc00) [pid = 3347] [serial = 49] [outer = 0x7f6281591800] 11:46:33 INFO - 762 INFO TEST-START | layout/style/test/test_bug1055933.html 11:46:34 INFO - ++DOMWINDOW == 26 (0x7f627f60bc00) [pid = 3347] [serial = 50] [outer = 0x7f6281591800] 11:46:34 INFO - [Child 3347] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:46:34 INFO - [Child 3347] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:46:34 INFO - [Child 3347] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:46:34 INFO - MEMORY STAT | vsize 532MB | residentFast 108MB | heapAllocated 25MB 11:46:34 INFO - --DOMWINDOW == 25 (0x7f627f6b3000) [pid = 3347] [serial = 37] [outer = (nil)] [url = about:blank] 11:46:34 INFO - --DOMWINDOW == 24 (0x7f627f609800) [pid = 3347] [serial = 45] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 23 (0x7f627f849c00) [pid = 3347] [serial = 43] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 22 (0x7f627f591800) [pid = 3347] [serial = 32] [outer = (nil)] [url = about:blank] 11:46:34 INFO - --DOMWINDOW == 21 (0x7f627f80cc00) [pid = 3347] [serial = 40] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_any_dynamic.html] 11:46:34 INFO - --DOMWINDOW == 20 (0x7f627f80c800) [pid = 3347] [serial = 39] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 19 (0x7f627f60a400) [pid = 3347] [serial = 34] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 18 (0x7f627f585000) [pid = 3347] [serial = 29] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 17 (0x7f627f824c00) [pid = 3347] [serial = 41] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:34 INFO - --DOMWINDOW == 16 (0x7f627f824400) [pid = 3347] [serial = 42] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_at_rule_parse_serialize.html] 11:46:34 INFO - --DOMWINDOW == 15 (0x7f627f6ae400) [pid = 3347] [serial = 36] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_animations_playbackrate.html] 11:46:34 INFO - --DOMWINDOW == 14 (0x7f627f58d000) [pid = 3347] [serial = 31] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_animations_pausing.html] 11:46:34 INFO - 763 INFO TEST-OK | layout/style/test/test_bug1055933.html | took 1017ms 11:46:34 INFO - [Child 3347] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:46:34 INFO - ++DOMWINDOW == 15 (0x7f627f609800) [pid = 3347] [serial = 51] [outer = 0x7f6281591800] 11:46:34 INFO - 764 INFO TEST-START | layout/style/test/test_bug1089417.html 11:46:35 INFO - [Child 3347] WARNING: aTargetFrame should be related with aTargetContent: '!aTargetFrame || !aTargetFrame->GetContent() || aTargetFrame->GetContent() == aTargetContent || aTargetFrame->GetContent()->GetFlattenedTreeParent() == aTargetContent', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventStateManager.cpp, line 529 11:46:35 INFO - ++DOMWINDOW == 16 (0x7f627f6ae400) [pid = 3347] [serial = 52] [outer = 0x7f6281591800] 11:46:35 INFO - ++DOCSHELL 0x7f6280521000 == 3 [pid = 3347] [id = 7] 11:46:35 INFO - ++DOMWINDOW == 17 (0x7f627f82b800) [pid = 3347] [serial = 53] [outer = (nil)] 11:46:35 INFO - ++DOMWINDOW == 18 (0x7f627f82c000) [pid = 3347] [serial = 54] [outer = 0x7f627f82b800] 11:46:35 INFO - MEMORY STAT | vsize 532MB | residentFast 108MB | heapAllocated 24MB 11:46:35 INFO - 765 INFO TEST-OK | layout/style/test/test_bug1089417.html | took 457ms 11:46:35 INFO - ++DOMWINDOW == 19 (0x7f627f81d400) [pid = 3347] [serial = 55] [outer = 0x7f6281591800] 11:46:35 INFO - 766 INFO TEST-START | layout/style/test/test_bug1112014.html 11:46:35 INFO - ++DOMWINDOW == 20 (0x7f627f81e400) [pid = 3347] [serial = 56] [outer = 0x7f6281591800] 11:46:46 INFO - MEMORY STAT | vsize 540MB | residentFast 121MB | heapAllocated 32MB 11:46:46 INFO - 767 INFO TEST-OK | layout/style/test/test_bug1112014.html | took 11345ms 11:46:47 INFO - ++DOMWINDOW == 21 (0x7f627f587000) [pid = 3347] [serial = 57] [outer = 0x7f6281591800] 11:46:47 INFO - 768 INFO TEST-START | layout/style/test/test_bug1203766.html 11:46:47 INFO - ++DOMWINDOW == 22 (0x7f627f58a400) [pid = 3347] [serial = 58] [outer = 0x7f6281591800] 11:46:47 INFO - MEMORY STAT | vsize 541MB | residentFast 122MB | heapAllocated 33MB 11:46:47 INFO - 769 INFO TEST-OK | layout/style/test/test_bug1203766.html | took 462ms 11:46:47 INFO - ++DOMWINDOW == 23 (0x7f627f643400) [pid = 3347] [serial = 59] [outer = 0x7f6281591800] 11:46:47 INFO - 770 INFO TEST-START | layout/style/test/test_bug1232829.html 11:46:48 INFO - ++DOMWINDOW == 24 (0x7f627f604800) [pid = 3347] [serial = 60] [outer = 0x7f6281591800] 11:46:48 INFO - ++DOCSHELL 0x7f6280a7d800 == 4 [pid = 3347] [id = 8] 11:46:48 INFO - ++DOMWINDOW == 25 (0x7f627f821800) [pid = 3347] [serial = 61] [outer = (nil)] 11:46:48 INFO - ++DOMWINDOW == 26 (0x7f627f819800) [pid = 3347] [serial = 62] [outer = 0x7f627f821800] 11:46:48 INFO - ++DOCSHELL 0x7f62815b6800 == 5 [pid = 3347] [id = 9] 11:46:48 INFO - ++DOMWINDOW == 27 (0x7f627f82a400) [pid = 3347] [serial = 63] [outer = (nil)] 11:46:48 INFO - ++DOMWINDOW == 28 (0x7f6285d69c00) [pid = 3347] [serial = 64] [outer = 0x7f627f82a400] 11:46:48 INFO - ++DOMWINDOW == 29 (0x7f62805c4800) [pid = 3347] [serial = 65] [outer = 0x7f627f82a400] 11:46:49 INFO - ++DOMWINDOW == 30 (0x7f627f811000) [pid = 3347] [serial = 66] [outer = 0x7f627f821800] 11:46:49 INFO - MEMORY STAT | vsize 542MB | residentFast 124MB | heapAllocated 33MB 11:46:49 INFO - ++DOMWINDOW == 31 (0x7f627f40f800) [pid = 3347] [serial = 67] [outer = 0x7f627f821800] 11:46:50 INFO - --DOCSHELL 0x7f6280521000 == 4 [pid = 3347] [id = 7] 11:46:50 INFO - --DOMWINDOW == 30 (0x7f627f40ac00) [pid = 3347] [serial = 28] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_omta_start.html] 11:46:50 INFO - --DOMWINDOW == 29 (0x7f627f411400) [pid = 3347] [serial = 30] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_pausing.html] 11:46:50 INFO - --DOMWINDOW == 28 (0x7f627f60dc00) [pid = 3347] [serial = 35] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_animations_playbackrate.html] 11:46:50 INFO - --DOMWINDOW == 27 (0x7f627f605400) [pid = 3347] [serial = 33] [outer = (nil)] [url = about:blank] 11:46:50 INFO - --DOMWINDOW == 26 (0x7f627f6b7400) [pid = 3347] [serial = 38] [outer = (nil)] [url = about:blank] 11:46:50 INFO - 771 INFO TEST-OK | layout/style/test/test_bug1232829.html | took 2277ms 11:46:50 INFO - ++DOMWINDOW == 27 (0x7f627f40dc00) [pid = 3347] [serial = 68] [outer = 0x7f6281591800] 11:46:50 INFO - 772 INFO TEST-START | layout/style/test/test_bug160403.html 11:46:50 INFO - ++DOMWINDOW == 28 (0x7f627f411400) [pid = 3347] [serial = 69] [outer = 0x7f6281591800] 11:46:50 INFO - MEMORY STAT | vsize 540MB | residentFast 106MB | heapAllocated 19MB 11:46:50 INFO - 773 INFO TEST-OK | layout/style/test/test_bug160403.html | took 427ms 11:46:50 INFO - ++DOMWINDOW == 29 (0x7f627f607800) [pid = 3347] [serial = 70] [outer = 0x7f6281591800] 11:46:50 INFO - 774 INFO TEST-START | layout/style/test/test_bug200089.html 11:46:51 INFO - ++DOMWINDOW == 30 (0x7f627f58a000) [pid = 3347] [serial = 71] [outer = 0x7f6281591800] 11:46:51 INFO - MEMORY STAT | vsize 540MB | residentFast 106MB | heapAllocated 19MB 11:46:51 INFO - 775 INFO TEST-OK | layout/style/test/test_bug200089.html | took 330ms 11:46:51 INFO - ++DOMWINDOW == 31 (0x7f627f610000) [pid = 3347] [serial = 72] [outer = 0x7f6281591800] 11:46:51 INFO - 776 INFO TEST-START | layout/style/test/test_bug221428.html 11:46:51 INFO - ++DOMWINDOW == 32 (0x7f627f608000) [pid = 3347] [serial = 73] [outer = 0x7f6281591800] 11:46:51 INFO - MEMORY STAT | vsize 540MB | residentFast 107MB | heapAllocated 20MB 11:46:51 INFO - 777 INFO TEST-OK | layout/style/test/test_bug221428.html | took 365ms 11:46:51 INFO - ++DOMWINDOW == 33 (0x7f627f607c00) [pid = 3347] [serial = 74] [outer = 0x7f6281591800] 11:46:51 INFO - 778 INFO TEST-START | layout/style/test/test_bug229915.html 11:46:52 INFO - --DOMWINDOW == 32 (0x7f627f587000) [pid = 3347] [serial = 57] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 31 (0x7f627f643400) [pid = 3347] [serial = 59] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 30 (0x7f627f589800) [pid = 3347] [serial = 46] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_background_blend_mode.html] 11:46:52 INFO - --DOMWINDOW == 29 (0x7f627f82c000) [pid = 3347] [serial = 54] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_bug1089417_iframe.html] 11:46:52 INFO - --DOMWINDOW == 28 (0x7f627f81dc00) [pid = 3347] [serial = 49] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 27 (0x7f627f609800) [pid = 3347] [serial = 51] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 26 (0x7f627f591000) [pid = 3347] [serial = 47] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 25 (0x7f627f81d400) [pid = 3347] [serial = 55] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:46:52 INFO - --DOMWINDOW == 24 (0x7f627f584c00) [pid = 3347] [serial = 48] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_box_size_keywords.html] 11:46:52 INFO - --DOMWINDOW == 23 (0x7f627f82b800) [pid = 3347] [serial = 53] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_bug1089417_iframe.html] 11:46:52 INFO - --DOMWINDOW == 22 (0x7f627f58a400) [pid = 3347] [serial = 58] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug1203766.html] 11:46:52 INFO - --DOMWINDOW == 21 (0x7f627f40b000) [pid = 3347] [serial = 44] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_attribute_selector_eof_behavior.html] 11:46:52 INFO - --DOMWINDOW == 20 (0x7f627f6ae400) [pid = 3347] [serial = 52] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug1089417.html] 11:46:52 INFO - --DOMWINDOW == 19 (0x7f627f81e400) [pid = 3347] [serial = 56] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug1112014.html] 11:46:52 INFO - ++DOMWINDOW == 20 (0x7f627f587000) [pid = 3347] [serial = 75] [outer = 0x7f6281591800] 11:46:52 INFO - MEMORY STAT | vsize 540MB | residentFast 108MB | heapAllocated 20MB 11:46:52 INFO - 779 INFO TEST-OK | layout/style/test/test_bug229915.html | took 446ms 11:46:52 INFO - ++DOMWINDOW == 21 (0x7f627f610400) [pid = 3347] [serial = 76] [outer = 0x7f6281591800] 11:46:52 INFO - 780 INFO TEST-START | layout/style/test/test_bug302186.html 11:46:52 INFO - ++DOMWINDOW == 22 (0x7f627f406400) [pid = 3347] [serial = 77] [outer = 0x7f6281591800] 11:46:53 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:46:53 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:46:53 INFO - MEMORY STAT | vsize 541MB | residentFast 109MB | heapAllocated 22MB 11:46:53 INFO - 781 INFO TEST-OK | layout/style/test/test_bug302186.html | took 1390ms 11:46:54 INFO - ++DOMWINDOW == 23 (0x7f627f821c00) [pid = 3347] [serial = 78] [outer = 0x7f6281591800] 11:46:54 INFO - 782 INFO TEST-START | layout/style/test/test_bug319381.html 11:46:54 INFO - ++DOMWINDOW == 24 (0x7f627f80d400) [pid = 3347] [serial = 79] [outer = 0x7f6281591800] 11:46:55 INFO - MEMORY STAT | vsize 541MB | residentFast 109MB | heapAllocated 22MB 11:46:55 INFO - 783 INFO TEST-OK | layout/style/test/test_bug319381.html | took 1221ms 11:46:55 INFO - ++DOMWINDOW == 25 (0x7f627fd2ec00) [pid = 3347] [serial = 80] [outer = 0x7f6281591800] 11:46:55 INFO - 784 INFO TEST-START | layout/style/test/test_bug357614.html 11:46:56 INFO - ++DOMWINDOW == 26 (0x7f627f40c000) [pid = 3347] [serial = 81] [outer = 0x7f6281591800] 11:46:56 INFO - MEMORY STAT | vsize 541MB | residentFast 108MB | heapAllocated 22MB 11:46:57 INFO - 785 INFO TEST-OK | layout/style/test/test_bug357614.html | took 1650ms 11:46:57 INFO - ++DOMWINDOW == 27 (0x7f627f636c00) [pid = 3347] [serial = 82] [outer = 0x7f6281591800] 11:46:57 INFO - 786 INFO TEST-START | layout/style/test/test_bug363146.html 11:46:57 INFO - ++DOMWINDOW == 28 (0x7f627f63d800) [pid = 3347] [serial = 83] [outer = 0x7f6281591800] 11:46:58 INFO - MEMORY STAT | vsize 541MB | residentFast 109MB | heapAllocated 23MB 11:46:58 INFO - 787 INFO TEST-OK | layout/style/test/test_bug363146.html | took 1029ms 11:46:58 INFO - ++DOMWINDOW == 29 (0x7f627f589800) [pid = 3347] [serial = 84] [outer = 0x7f6281591800] 11:46:58 INFO - 788 INFO TEST-START | layout/style/test/test_bug365932.html 11:46:59 INFO - --DOCSHELL 0x7f6280a7d800 == 3 [pid = 3347] [id = 8] 11:46:59 INFO - --DOCSHELL 0x7f62815b6800 == 2 [pid = 3347] [id = 9] 11:46:59 INFO - --DOMWINDOW == 28 (0x7f627f60bc00) [pid = 3347] [serial = 50] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug1055933.html] 11:46:59 INFO - --DOMWINDOW == 27 (0x7f627f819800) [pid = 3347] [serial = 62] [outer = 0x7f627f821800] [url = about:srcdoc] 11:46:59 INFO - ++DOMWINDOW == 28 (0x7f627f40b000) [pid = 3347] [serial = 85] [outer = 0x7f6281591800] 11:47:00 INFO - MEMORY STAT | vsize 538MB | residentFast 104MB | heapAllocated 20MB 11:47:00 INFO - 789 INFO TEST-OK | layout/style/test/test_bug365932.html | took 2026ms 11:47:00 INFO - ++DOMWINDOW == 29 (0x7f627f63f000) [pid = 3347] [serial = 86] [outer = 0x7f6281591800] 11:47:00 INFO - 790 INFO TEST-START | layout/style/test/test_bug372770.html 11:47:01 INFO - ++DOMWINDOW == 30 (0x7f627f63f400) [pid = 3347] [serial = 87] [outer = 0x7f6281591800] 11:47:01 INFO - MEMORY STAT | vsize 539MB | residentFast 105MB | heapAllocated 21MB 11:47:01 INFO - 791 INFO TEST-OK | layout/style/test/test_bug372770.html | took 756ms 11:47:01 INFO - ++DOMWINDOW == 31 (0x7f6282278000) [pid = 3347] [serial = 88] [outer = 0x7f6281591800] 11:47:01 INFO - 792 INFO TEST-START | layout/style/test/test_bug373293.html 11:47:02 INFO - ++DOMWINDOW == 32 (0x7f627f588800) [pid = 3347] [serial = 89] [outer = 0x7f6281591800] 11:47:02 INFO - MEMORY STAT | vsize 539MB | residentFast 106MB | heapAllocated 22MB 11:47:02 INFO - 793 INFO TEST-OK | layout/style/test/test_bug373293.html | took 340ms 11:47:02 INFO - ++DOMWINDOW == 33 (0x7f6282227000) [pid = 3347] [serial = 90] [outer = 0x7f6281591800] 11:47:02 INFO - 794 INFO TEST-START | layout/style/test/test_bug377947.html 11:47:02 INFO - --DOMWINDOW == 32 (0x7f627f40c000) [pid = 3347] [serial = 81] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug357614.html] 11:47:02 INFO - --DOMWINDOW == 31 (0x7f627f636c00) [pid = 3347] [serial = 82] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 30 (0x7f627fd2ec00) [pid = 3347] [serial = 80] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 29 (0x7f627f80d400) [pid = 3347] [serial = 79] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug319381.html] 11:47:02 INFO - --DOMWINDOW == 28 (0x7f627f40dc00) [pid = 3347] [serial = 68] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 27 (0x7f627f411400) [pid = 3347] [serial = 69] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug160403.html] 11:47:02 INFO - --DOMWINDOW == 26 (0x7f627f607800) [pid = 3347] [serial = 70] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 25 (0x7f627f58a000) [pid = 3347] [serial = 71] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug200089.html] 11:47:02 INFO - --DOMWINDOW == 24 (0x7f627f610000) [pid = 3347] [serial = 72] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 23 (0x7f627f811000) [pid = 3347] [serial = 66] [outer = (nil)] [url = about:srcdoc] 11:47:02 INFO - --DOMWINDOW == 22 (0x7f627f608000) [pid = 3347] [serial = 73] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug221428.html] 11:47:02 INFO - --DOMWINDOW == 21 (0x7f627f607c00) [pid = 3347] [serial = 74] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 20 (0x7f627f587000) [pid = 3347] [serial = 75] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug229915.html] 11:47:02 INFO - --DOMWINDOW == 19 (0x7f627f610400) [pid = 3347] [serial = 76] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 18 (0x7f627f406400) [pid = 3347] [serial = 77] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug302186.html] 11:47:02 INFO - --DOMWINDOW == 17 (0x7f627f821c00) [pid = 3347] [serial = 78] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:02 INFO - --DOMWINDOW == 16 (0x7f6285d69c00) [pid = 3347] [serial = 64] [outer = (nil)] [url = about:blank] 11:47:02 INFO - --DOMWINDOW == 15 (0x7f62805c4800) [pid = 3347] [serial = 65] [outer = (nil)] [url = about:blank] 11:47:02 INFO - --DOMWINDOW == 14 (0x7f627f40f800) [pid = 3347] [serial = 67] [outer = (nil)] [url = about:srcdoc] 11:47:02 INFO - --DOMWINDOW == 13 (0x7f627f821800) [pid = 3347] [serial = 61] [outer = (nil)] [url = about:srcdoc] 11:47:02 INFO - --DOMWINDOW == 12 (0x7f627f82a400) [pid = 3347] [serial = 63] [outer = (nil)] [url = data:text/html,2] 11:47:02 INFO - --DOMWINDOW == 11 (0x7f627f604800) [pid = 3347] [serial = 60] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug1232829.html] 11:47:02 INFO - ++DOMWINDOW == 12 (0x7f627f587000) [pid = 3347] [serial = 91] [outer = 0x7f6281591800] 11:47:02 INFO - MEMORY STAT | vsize 539MB | residentFast 105MB | heapAllocated 22MB 11:47:02 INFO - 795 INFO TEST-OK | layout/style/test/test_bug377947.html | took 396ms 11:47:02 INFO - ++DOMWINDOW == 13 (0x7f627f607c00) [pid = 3347] [serial = 92] [outer = 0x7f6281591800] 11:47:02 INFO - 796 INFO TEST-START | layout/style/test/test_bug379440.html 11:47:02 INFO - ++DOMWINDOW == 14 (0x7f627f60ac00) [pid = 3347] [serial = 93] [outer = 0x7f6281591800] 11:47:03 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:03 INFO - MEMORY STAT | vsize 539MB | residentFast 104MB | heapAllocated 22MB 11:47:03 INFO - 797 INFO TEST-OK | layout/style/test/test_bug379440.html | took 534ms 11:47:03 INFO - ++DOMWINDOW == 15 (0x7f627f636c00) [pid = 3347] [serial = 94] [outer = 0x7f6281591800] 11:47:03 INFO - 798 INFO TEST-START | layout/style/test/test_bug379741.html 11:47:03 INFO - ++DOMWINDOW == 16 (0x7f627f642000) [pid = 3347] [serial = 95] [outer = 0x7f6281591800] 11:47:03 INFO - MEMORY STAT | vsize 539MB | residentFast 105MB | heapAllocated 23MB 11:47:03 INFO - 799 INFO TEST-OK | layout/style/test/test_bug379741.html | took 389ms 11:47:03 INFO - ++DOMWINDOW == 17 (0x7f6285966800) [pid = 3347] [serial = 96] [outer = 0x7f6281591800] 11:47:04 INFO - 800 INFO TEST-START | layout/style/test/test_bug382027.html 11:47:04 INFO - ++DOMWINDOW == 18 (0x7f6285964000) [pid = 3347] [serial = 97] [outer = 0x7f6281591800] 11:47:04 INFO - MEMORY STAT | vsize 539MB | residentFast 106MB | heapAllocated 23MB 11:47:04 INFO - 801 INFO TEST-OK | layout/style/test/test_bug382027.html | took 373ms 11:47:04 INFO - ++DOMWINDOW == 19 (0x7f6285960000) [pid = 3347] [serial = 98] [outer = 0x7f6281591800] 11:47:04 INFO - 802 INFO TEST-START | layout/style/test/test_bug383075.html 11:47:04 INFO - ++DOMWINDOW == 20 (0x7f6284e86800) [pid = 3347] [serial = 99] [outer = 0x7f6281591800] 11:47:05 INFO - MEMORY STAT | vsize 539MB | residentFast 107MB | heapAllocated 24MB 11:47:05 INFO - 803 INFO TEST-OK | layout/style/test/test_bug383075.html | took 435ms 11:47:05 INFO - ++DOMWINDOW == 21 (0x7f6285968000) [pid = 3347] [serial = 100] [outer = 0x7f6281591800] 11:47:05 INFO - 804 INFO TEST-START | layout/style/test/test_bug387615.html 11:47:05 INFO - ++DOMWINDOW == 22 (0x7f6285968c00) [pid = 3347] [serial = 101] [outer = 0x7f6281591800] 11:47:05 INFO - MEMORY STAT | vsize 539MB | residentFast 107MB | heapAllocated 24MB 11:47:05 INFO - 805 INFO TEST-OK | layout/style/test/test_bug387615.html | took 456ms 11:47:05 INFO - ++DOMWINDOW == 23 (0x7f62859e9000) [pid = 3347] [serial = 102] [outer = 0x7f6281591800] 11:47:05 INFO - 806 INFO TEST-START | layout/style/test/test_bug389464.html 11:47:06 INFO - ++DOMWINDOW == 24 (0x7f627f40f800) [pid = 3347] [serial = 103] [outer = 0x7f6281591800] 11:47:06 INFO - MEMORY STAT | vsize 539MB | residentFast 108MB | heapAllocated 24MB 11:47:06 INFO - 807 INFO TEST-OK | layout/style/test/test_bug389464.html | took 581ms 11:47:06 INFO - ++DOMWINDOW == 25 (0x7f627f412400) [pid = 3347] [serial = 104] [outer = 0x7f6281591800] 11:47:06 INFO - 808 INFO TEST-START | layout/style/test/test_bug391034.html 11:47:06 INFO - ++DOMWINDOW == 26 (0x7f6282275000) [pid = 3347] [serial = 105] [outer = 0x7f6281591800] 11:47:07 INFO - MEMORY STAT | vsize 540MB | residentFast 109MB | heapAllocated 23MB 11:47:07 INFO - 809 INFO TEST-OK | layout/style/test/test_bug391034.html | took 1256ms 11:47:07 INFO - ++DOMWINDOW == 27 (0x7f627f410c00) [pid = 3347] [serial = 106] [outer = 0x7f6281591800] 11:47:08 INFO - 810 INFO TEST-START | layout/style/test/test_bug391221.html 11:47:08 INFO - --DOMWINDOW == 26 (0x7f627f63d800) [pid = 3347] [serial = 83] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug363146.html] 11:47:08 INFO - ++DOMWINDOW == 27 (0x7f627f40d400) [pid = 3347] [serial = 107] [outer = 0x7f6281591800] 11:47:08 INFO - MEMORY STAT | vsize 539MB | residentFast 107MB | heapAllocated 20MB 11:47:08 INFO - 811 INFO TEST-OK | layout/style/test/test_bug391221.html | took 570ms 11:47:08 INFO - ++DOMWINDOW == 28 (0x7f627f602c00) [pid = 3347] [serial = 108] [outer = 0x7f6281591800] 11:47:08 INFO - 812 INFO TEST-START | layout/style/test/test_bug397427.html 11:47:08 INFO - ++DOMWINDOW == 29 (0x7f627f592800) [pid = 3347] [serial = 109] [outer = 0x7f6281591800] 11:47:09 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:09 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:09 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:09 INFO - MEMORY STAT | vsize 539MB | residentFast 107MB | heapAllocated 20MB 11:47:09 INFO - 813 INFO TEST-OK | layout/style/test/test_bug397427.html | took 1029ms 11:47:09 INFO - ++DOMWINDOW == 30 (0x7f627f60d000) [pid = 3347] [serial = 110] [outer = 0x7f6281591800] 11:47:09 INFO - 814 INFO TEST-START | layout/style/test/test_bug399349.html 11:47:10 INFO - ++DOMWINDOW == 31 (0x7f627f60d400) [pid = 3347] [serial = 111] [outer = 0x7f6281591800] 11:47:10 INFO - --DOMWINDOW == 30 (0x7f6284e86800) [pid = 3347] [serial = 99] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug383075.html] 11:47:10 INFO - --DOMWINDOW == 29 (0x7f6285960000) [pid = 3347] [serial = 98] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 28 (0x7f6285964000) [pid = 3347] [serial = 97] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug382027.html] 11:47:10 INFO - --DOMWINDOW == 27 (0x7f6285966800) [pid = 3347] [serial = 96] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 26 (0x7f627f642000) [pid = 3347] [serial = 95] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug379741.html] 11:47:10 INFO - --DOMWINDOW == 25 (0x7f627f636c00) [pid = 3347] [serial = 94] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 24 (0x7f627f60ac00) [pid = 3347] [serial = 93] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug379440.html] 11:47:10 INFO - --DOMWINDOW == 23 (0x7f627f607c00) [pid = 3347] [serial = 92] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 22 (0x7f627f587000) [pid = 3347] [serial = 91] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug377947.html] 11:47:10 INFO - --DOMWINDOW == 21 (0x7f6282227000) [pid = 3347] [serial = 90] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 20 (0x7f627f588800) [pid = 3347] [serial = 89] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug373293.html] 11:47:10 INFO - --DOMWINDOW == 19 (0x7f6282278000) [pid = 3347] [serial = 88] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 18 (0x7f627f63f400) [pid = 3347] [serial = 87] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug372770.html] 11:47:10 INFO - --DOMWINDOW == 17 (0x7f627f589800) [pid = 3347] [serial = 84] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 16 (0x7f627f63f000) [pid = 3347] [serial = 86] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:10 INFO - --DOMWINDOW == 15 (0x7f627f40b000) [pid = 3347] [serial = 85] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug365932.html] 11:47:10 INFO - --DOMWINDOW == 14 (0x7f6285968000) [pid = 3347] [serial = 100] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:11 INFO - MEMORY STAT | vsize 539MB | residentFast 109MB | heapAllocated 21MB 11:47:11 INFO - 815 INFO TEST-OK | layout/style/test/test_bug399349.html | took 1463ms 11:47:11 INFO - ++DOMWINDOW == 15 (0x7f627f603800) [pid = 3347] [serial = 112] [outer = 0x7f6281591800] 11:47:11 INFO - 816 INFO TEST-START | layout/style/test/test_bug405818.html 11:47:11 INFO - ++DOMWINDOW == 16 (0x7f627f607800) [pid = 3347] [serial = 113] [outer = 0x7f6281591800] 11:47:11 INFO - MEMORY STAT | vsize 539MB | residentFast 110MB | heapAllocated 22MB 11:47:11 INFO - 817 INFO TEST-OK | layout/style/test/test_bug405818.html | took 283ms 11:47:11 INFO - ++DOMWINDOW == 17 (0x7f627f80ec00) [pid = 3347] [serial = 114] [outer = 0x7f6281591800] 11:47:11 INFO - 818 INFO TEST-START | layout/style/test/test_bug412901.html 11:47:11 INFO - ++DOMWINDOW == 18 (0x7f627f6ae400) [pid = 3347] [serial = 115] [outer = 0x7f6281591800] 11:47:12 INFO - MEMORY STAT | vsize 539MB | residentFast 110MB | heapAllocated 22MB 11:47:12 INFO - 819 INFO TEST-OK | layout/style/test/test_bug412901.html | took 276ms 11:47:12 INFO - ++DOMWINDOW == 19 (0x7f627f81f000) [pid = 3347] [serial = 116] [outer = 0x7f6281591800] 11:47:12 INFO - 820 INFO TEST-START | layout/style/test/test_bug413958.html 11:47:12 INFO - ++DOMWINDOW == 20 (0x7f627f6b5400) [pid = 3347] [serial = 117] [outer = 0x7f6281591800] 11:47:12 INFO - MEMORY STAT | vsize 540MB | residentFast 109MB | heapAllocated 23MB 11:47:12 INFO - 821 INFO TEST-OK | layout/style/test/test_bug413958.html | took 561ms 11:47:12 INFO - ++DOMWINDOW == 21 (0x7f627f825800) [pid = 3347] [serial = 118] [outer = 0x7f6281591800] 11:47:13 INFO - 822 INFO TEST-START | layout/style/test/test_bug418986-2.html 11:47:13 INFO - ++DOMWINDOW == 22 (0x7f627f40ac00) [pid = 3347] [serial = 119] [outer = 0x7f6281591800] 11:47:14 INFO - MEMORY STAT | vsize 540MB | residentFast 110MB | heapAllocated 24MB 11:47:14 INFO - 823 INFO TEST-OK | layout/style/test/test_bug418986-2.html | took 1095ms 11:47:14 INFO - ++DOMWINDOW == 23 (0x7f627f828800) [pid = 3347] [serial = 120] [outer = 0x7f6281591800] 11:47:14 INFO - 824 INFO TEST-START | layout/style/test/test_bug437915.html 11:47:14 INFO - ++DOMWINDOW == 24 (0x7f627f58a400) [pid = 3347] [serial = 121] [outer = 0x7f6281591800] 11:47:15 INFO - MEMORY STAT | vsize 539MB | residentFast 103MB | heapAllocated 18MB 11:47:15 INFO - 825 INFO TEST-OK | layout/style/test/test_bug437915.html | took 1050ms 11:47:15 INFO - ++DOMWINDOW == 25 (0x7f627f58b000) [pid = 3347] [serial = 122] [outer = 0x7f6281591800] 11:47:15 INFO - 826 INFO TEST-START | layout/style/test/test_bug450191.html 11:47:15 INFO - ++DOMWINDOW == 26 (0x7f627f587000) [pid = 3347] [serial = 123] [outer = 0x7f6281591800] 11:47:15 INFO - ++DOCSHELL 0x7f627f9dd800 == 3 [pid = 3347] [id = 10] 11:47:15 INFO - ++DOMWINDOW == 27 (0x7f627f58e400) [pid = 3347] [serial = 124] [outer = (nil)] 11:47:15 INFO - ++DOMWINDOW == 28 (0x7f627f604800) [pid = 3347] [serial = 125] [outer = 0x7f627f58e400] 11:47:15 INFO - ++DOMWINDOW == 29 (0x7f627f608c00) [pid = 3347] [serial = 126] [outer = 0x7f627f58e400] 11:47:15 INFO - ++DOMWINDOW == 30 (0x7f627f60b400) [pid = 3347] [serial = 127] [outer = 0x7f627f58e400] 11:47:16 INFO - ++DOMWINDOW == 31 (0x7f627f40b800) [pid = 3347] [serial = 128] [outer = 0x7f627f58e400] 11:47:16 INFO - MEMORY STAT | vsize 539MB | residentFast 104MB | heapAllocated 20MB 11:47:16 INFO - 827 INFO TEST-OK | layout/style/test/test_bug450191.html | took 803ms 11:47:16 INFO - ++DOMWINDOW == 32 (0x7f627f60a400) [pid = 3347] [serial = 129] [outer = 0x7f6281591800] 11:47:16 INFO - 828 INFO TEST-START | layout/style/test/test_bug453896_deck.html 11:47:16 INFO - ++DOMWINDOW == 33 (0x7f627f590800) [pid = 3347] [serial = 130] [outer = 0x7f6281591800] 11:47:16 INFO - ++DOCSHELL 0x7f6280516000 == 4 [pid = 3347] [id = 11] 11:47:16 INFO - ++DOMWINDOW == 34 (0x7f627f60c400) [pid = 3347] [serial = 131] [outer = (nil)] 11:47:16 INFO - ++DOCSHELL 0x7f6280519800 == 5 [pid = 3347] [id = 12] 11:47:16 INFO - ++DOMWINDOW == 35 (0x7f627f636c00) [pid = 3347] [serial = 132] [outer = (nil)] 11:47:16 INFO - ++DOCSHELL 0x7f6280522000 == 6 [pid = 3347] [id = 13] 11:47:16 INFO - ++DOMWINDOW == 36 (0x7f627f637800) [pid = 3347] [serial = 133] [outer = (nil)] 11:47:16 INFO - ++DOMWINDOW == 37 (0x7f627f603400) [pid = 3347] [serial = 134] [outer = 0x7f627f60c400] 11:47:16 INFO - ++DOMWINDOW == 38 (0x7f627f638400) [pid = 3347] [serial = 135] [outer = 0x7f627f637800] 11:47:16 INFO - ++DOMWINDOW == 39 (0x7f627f635c00) [pid = 3347] [serial = 136] [outer = 0x7f627f636c00] 11:47:17 INFO - ++DOCSHELL 0x7f628087d000 == 7 [pid = 3347] [id = 14] 11:47:17 INFO - ++DOMWINDOW == 40 (0x7f627f63e400) [pid = 3347] [serial = 137] [outer = (nil)] 11:47:17 INFO - ++DOMWINDOW == 41 (0x7f627f58d000) [pid = 3347] [serial = 138] [outer = 0x7f627f63e400] 11:47:17 INFO - MEMORY STAT | vsize 539MB | residentFast 105MB | heapAllocated 21MB 11:47:17 INFO - 829 INFO TEST-OK | layout/style/test/test_bug453896_deck.html | took 860ms 11:47:17 INFO - ++DOMWINDOW == 42 (0x7f627f58dc00) [pid = 3347] [serial = 139] [outer = 0x7f6281591800] 11:47:17 INFO - 830 INFO TEST-START | layout/style/test/test_bug470769.html 11:47:17 INFO - --DOMWINDOW == 41 (0x7f627f825800) [pid = 3347] [serial = 118] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 40 (0x7f627f81f000) [pid = 3347] [serial = 116] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 39 (0x7f627f828800) [pid = 3347] [serial = 120] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 38 (0x7f627f410c00) [pid = 3347] [serial = 106] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 37 (0x7f627f40d400) [pid = 3347] [serial = 107] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug391221.html] 11:47:17 INFO - --DOMWINDOW == 36 (0x7f627f602c00) [pid = 3347] [serial = 108] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 35 (0x7f627f592800) [pid = 3347] [serial = 109] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug397427.html] 11:47:17 INFO - --DOMWINDOW == 34 (0x7f627f60d000) [pid = 3347] [serial = 110] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 33 (0x7f627f60d400) [pid = 3347] [serial = 111] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug399349.html] 11:47:17 INFO - --DOMWINDOW == 32 (0x7f627f603800) [pid = 3347] [serial = 112] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 31 (0x7f627f607800) [pid = 3347] [serial = 113] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug405818.html] 11:47:17 INFO - --DOMWINDOW == 30 (0x7f627f80ec00) [pid = 3347] [serial = 114] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 29 (0x7f627f6ae400) [pid = 3347] [serial = 115] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug412901.html] 11:47:17 INFO - --DOMWINDOW == 28 (0x7f62859e9000) [pid = 3347] [serial = 102] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 27 (0x7f627f412400) [pid = 3347] [serial = 104] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:17 INFO - --DOMWINDOW == 26 (0x7f6282275000) [pid = 3347] [serial = 105] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug391034.html] 11:47:17 INFO - --DOMWINDOW == 25 (0x7f6285968c00) [pid = 3347] [serial = 101] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug387615.html] 11:47:17 INFO - --DOMWINDOW == 24 (0x7f627f6b5400) [pid = 3347] [serial = 117] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug413958.html] 11:47:17 INFO - --DOMWINDOW == 23 (0x7f627f40f800) [pid = 3347] [serial = 103] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug389464.html] 11:47:17 INFO - ++DOMWINDOW == 24 (0x7f627f589400) [pid = 3347] [serial = 140] [outer = 0x7f6281591800] 11:47:18 INFO - MEMORY STAT | vsize 539MB | residentFast 106MB | heapAllocated 20MB 11:47:18 INFO - 831 INFO TEST-OK | layout/style/test/test_bug470769.html | took 418ms 11:47:18 INFO - ++DOMWINDOW == 25 (0x7f627f637c00) [pid = 3347] [serial = 141] [outer = 0x7f6281591800] 11:47:18 INFO - 832 INFO TEST-START | layout/style/test/test_bug499655.html 11:47:18 INFO - ++DOMWINDOW == 26 (0x7f627f635400) [pid = 3347] [serial = 142] [outer = 0x7f6281591800] 11:47:18 INFO - MEMORY STAT | vsize 539MB | residentFast 106MB | heapAllocated 21MB 11:47:18 INFO - 833 INFO TEST-OK | layout/style/test/test_bug499655.html | took 349ms 11:47:18 INFO - ++DOMWINDOW == 27 (0x7f627f6aac00) [pid = 3347] [serial = 143] [outer = 0x7f6281591800] 11:47:18 INFO - 834 INFO TEST-START | layout/style/test/test_bug499655.xhtml 11:47:18 INFO - ++DOMWINDOW == 28 (0x7f627f604c00) [pid = 3347] [serial = 144] [outer = 0x7f6281591800] 11:47:18 INFO - MEMORY STAT | vsize 539MB | residentFast 107MB | heapAllocated 21MB 11:47:19 INFO - 835 INFO TEST-OK | layout/style/test/test_bug499655.xhtml | took 377ms 11:47:19 INFO - ++DOMWINDOW == 29 (0x7f627f636000) [pid = 3347] [serial = 145] [outer = 0x7f6281591800] 11:47:19 INFO - 836 INFO TEST-START | layout/style/test/test_bug511909.html 11:47:19 INFO - ++DOMWINDOW == 30 (0x7f627f63ec00) [pid = 3347] [serial = 146] [outer = 0x7f6281591800] 11:47:20 INFO - MEMORY STAT | vsize 538MB | residentFast 107MB | heapAllocated 22MB 11:47:20 INFO - 837 INFO TEST-OK | layout/style/test/test_bug511909.html | took 403ms 11:47:20 INFO - ++DOMWINDOW == 31 (0x7f627f6af000) [pid = 3347] [serial = 147] [outer = 0x7f6281591800] 11:47:20 INFO - 838 INFO TEST-START | layout/style/test/test_bug517224.html 11:47:20 INFO - ++DOMWINDOW == 32 (0x7f627f407c00) [pid = 3347] [serial = 148] [outer = 0x7f6281591800] 11:47:20 INFO - MEMORY STAT | vsize 539MB | residentFast 108MB | heapAllocated 22MB 11:47:20 INFO - 839 INFO TEST-OK | layout/style/test/test_bug517224.html | took 768ms 11:47:21 INFO - ++DOMWINDOW == 33 (0x7f627f602c00) [pid = 3347] [serial = 149] [outer = 0x7f6281591800] 11:47:21 INFO - 840 INFO TEST-START | layout/style/test/test_bug524175.html 11:47:21 INFO - ++DOMWINDOW == 34 (0x7f627f60f400) [pid = 3347] [serial = 150] [outer = 0x7f6281591800] 11:47:21 INFO - MEMORY STAT | vsize 539MB | residentFast 108MB | heapAllocated 22MB 11:47:21 INFO - 841 INFO TEST-OK | layout/style/test/test_bug524175.html | took 485ms 11:47:21 INFO - ++DOMWINDOW == 35 (0x7f627f592800) [pid = 3347] [serial = 151] [outer = 0x7f6281591800] 11:47:21 INFO - 842 INFO TEST-START | layout/style/test/test_bug525952.html 11:47:22 INFO - --DOCSHELL 0x7f627f9dd800 == 6 [pid = 3347] [id = 10] 11:47:22 INFO - --DOCSHELL 0x7f6280516000 == 5 [pid = 3347] [id = 11] 11:47:22 INFO - --DOCSHELL 0x7f6280519800 == 4 [pid = 3347] [id = 12] 11:47:22 INFO - --DOCSHELL 0x7f6280522000 == 3 [pid = 3347] [id = 13] 11:47:22 INFO - --DOCSHELL 0x7f628087d000 == 2 [pid = 3347] [id = 14] 11:47:22 INFO - --DOMWINDOW == 34 (0x7f627f40ac00) [pid = 3347] [serial = 119] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug418986-2.html] 11:47:22 INFO - ++DOMWINDOW == 35 (0x7f627f406800) [pid = 3347] [serial = 152] [outer = 0x7f6281591800] 11:47:22 INFO - --DOMWINDOW == 34 (0x7f627f60b400) [pid = 3347] [serial = 127] [outer = 0x7f627f58e400] [url = http://mochi.test:8888/tests/layout/style/test/test_bug450191.html] 11:47:22 INFO - --DOMWINDOW == 33 (0x7f627f608c00) [pid = 3347] [serial = 126] [outer = 0x7f627f58e400] [url = about:blank] 11:47:22 INFO - --DOMWINDOW == 32 (0x7f627f604800) [pid = 3347] [serial = 125] [outer = 0x7f627f58e400] [url = about:blank] 11:47:22 INFO - MEMORY STAT | vsize 538MB | residentFast 103MB | heapAllocated 18MB 11:47:22 INFO - 843 INFO TEST-OK | layout/style/test/test_bug525952.html | took 518ms 11:47:22 INFO - ++DOMWINDOW == 33 (0x7f627f591400) [pid = 3347] [serial = 153] [outer = 0x7f6281591800] 11:47:22 INFO - 844 INFO TEST-START | layout/style/test/test_bug534804.html 11:47:22 INFO - ++DOMWINDOW == 34 (0x7f627f592000) [pid = 3347] [serial = 154] [outer = 0x7f6281591800] 11:47:23 INFO - MEMORY STAT | vsize 538MB | residentFast 104MB | heapAllocated 19MB 11:47:23 INFO - 845 INFO TEST-OK | layout/style/test/test_bug534804.html | took 635ms 11:47:23 INFO - ++DOMWINDOW == 35 (0x7f627f609800) [pid = 3347] [serial = 155] [outer = 0x7f6281591800] 11:47:23 INFO - 846 INFO TEST-START | layout/style/test/test_bug573255.html 11:47:23 INFO - ++DOMWINDOW == 36 (0x7f627f609c00) [pid = 3347] [serial = 156] [outer = 0x7f6281591800] 11:47:23 INFO - MEMORY STAT | vsize 538MB | residentFast 104MB | heapAllocated 20MB 11:47:23 INFO - 847 INFO TEST-OK | layout/style/test/test_bug573255.html | took 424ms 11:47:23 INFO - ++DOMWINDOW == 37 (0x7f627f606400) [pid = 3347] [serial = 157] [outer = 0x7f6281591800] 11:47:23 INFO - 848 INFO TEST-START | layout/style/test/test_bug580685.html 11:47:23 INFO - ++DOMWINDOW == 38 (0x7f627f592c00) [pid = 3347] [serial = 158] [outer = 0x7f6281591800] 11:47:24 INFO - ++DOCSHELL 0x7f628050c000 == 3 [pid = 3347] [id = 15] 11:47:24 INFO - ++DOMWINDOW == 39 (0x7f627f6b8000) [pid = 3347] [serial = 159] [outer = (nil)] 11:47:24 INFO - ++DOMWINDOW == 40 (0x7f627f6b4000) [pid = 3347] [serial = 160] [outer = 0x7f627f6b8000] 11:47:24 INFO - MEMORY STAT | vsize 538MB | residentFast 105MB | heapAllocated 21MB 11:47:24 INFO - 849 INFO TEST-OK | layout/style/test/test_bug580685.html | took 336ms 11:47:24 INFO - ++DOMWINDOW == 41 (0x7f627f603c00) [pid = 3347] [serial = 161] [outer = 0x7f6281591800] 11:47:24 INFO - 850 INFO TEST-START | layout/style/test/test_bug621351.html 11:47:24 INFO - ++DOMWINDOW == 42 (0x7f627f608800) [pid = 3347] [serial = 162] [outer = 0x7f6281591800] 11:47:24 INFO - MEMORY STAT | vsize 538MB | residentFast 105MB | heapAllocated 21MB 11:47:24 INFO - 851 INFO TEST-OK | layout/style/test/test_bug621351.html | took 419ms 11:47:24 INFO - ++DOMWINDOW == 43 (0x7f627f6b3000) [pid = 3347] [serial = 163] [outer = 0x7f6281591800] 11:47:24 INFO - 852 INFO TEST-START | layout/style/test/test_bug635286.html 11:47:25 INFO - --DOMWINDOW == 42 (0x7f627f58a400) [pid = 3347] [serial = 121] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug437915.html] 11:47:25 INFO - --DOMWINDOW == 41 (0x7f627f604c00) [pid = 3347] [serial = 144] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug499655.xhtml] 11:47:25 INFO - --DOMWINDOW == 40 (0x7f627f6aac00) [pid = 3347] [serial = 143] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 39 (0x7f627f635400) [pid = 3347] [serial = 142] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug499655.html] 11:47:25 INFO - --DOMWINDOW == 38 (0x7f627f637c00) [pid = 3347] [serial = 141] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 37 (0x7f627f589400) [pid = 3347] [serial = 140] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug470769.html] 11:47:25 INFO - --DOMWINDOW == 36 (0x7f627f58dc00) [pid = 3347] [serial = 139] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 35 (0x7f627f638400) [pid = 3347] [serial = 135] [outer = (nil)] [url = about:blank] 11:47:25 INFO - --DOMWINDOW == 34 (0x7f627f603400) [pid = 3347] [serial = 134] [outer = (nil)] [url = about:blank] 11:47:25 INFO - --DOMWINDOW == 33 (0x7f627f590800) [pid = 3347] [serial = 130] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug453896_deck.html] 11:47:25 INFO - --DOMWINDOW == 32 (0x7f627f60a400) [pid = 3347] [serial = 129] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 31 (0x7f627f40b800) [pid = 3347] [serial = 128] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug450191.html] 11:47:25 INFO - --DOMWINDOW == 30 (0x7f627f587000) [pid = 3347] [serial = 123] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug450191.html] 11:47:25 INFO - --DOMWINDOW == 29 (0x7f627f58b000) [pid = 3347] [serial = 122] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 28 (0x7f627f407c00) [pid = 3347] [serial = 148] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug517224.html] 11:47:25 INFO - --DOMWINDOW == 27 (0x7f627f602c00) [pid = 3347] [serial = 149] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 26 (0x7f627f6af000) [pid = 3347] [serial = 147] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 25 (0x7f627f636000) [pid = 3347] [serial = 145] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:25 INFO - --DOMWINDOW == 24 (0x7f627f63e400) [pid = 3347] [serial = 137] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/media_queries_iframe.html] 11:47:25 INFO - --DOMWINDOW == 23 (0x7f627f636c00) [pid = 3347] [serial = 132] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/bug453896_iframe.html] 11:47:25 INFO - --DOMWINDOW == 22 (0x7f627f637800) [pid = 3347] [serial = 133] [outer = (nil)] [url = about:blank] 11:47:25 INFO - --DOMWINDOW == 21 (0x7f627f60c400) [pid = 3347] [serial = 131] [outer = (nil)] [url = about:blank] 11:47:25 INFO - --DOMWINDOW == 20 (0x7f627f58e400) [pid = 3347] [serial = 124] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug450191.html] 11:47:25 INFO - --DOMWINDOW == 19 (0x7f627f58d000) [pid = 3347] [serial = 138] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/media_queries_iframe.html] 11:47:25 INFO - --DOMWINDOW == 18 (0x7f627f635c00) [pid = 3347] [serial = 136] [outer = (nil)] [url = about:blank] 11:47:25 INFO - --DOMWINDOW == 17 (0x7f627f63ec00) [pid = 3347] [serial = 146] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug511909.html] 11:47:25 INFO - ++DOMWINDOW == 18 (0x7f627f588400) [pid = 3347] [serial = 164] [outer = 0x7f6281591800] 11:47:25 INFO - MEMORY STAT | vsize 538MB | residentFast 107MB | heapAllocated 22MB 11:47:25 INFO - 853 INFO TEST-OK | layout/style/test/test_bug635286.html | took 688ms 11:47:25 INFO - ++DOMWINDOW == 19 (0x7f627fd3d400) [pid = 3347] [serial = 165] [outer = 0x7f6281591800] 11:47:25 INFO - 854 INFO TEST-START | layout/style/test/test_bug645998.html 11:47:25 INFO - ++DOMWINDOW == 20 (0x7f627f591800) [pid = 3347] [serial = 166] [outer = 0x7f6281591800] 11:47:26 INFO - MEMORY STAT | vsize 538MB | residentFast 107MB | heapAllocated 23MB 11:47:26 INFO - 855 INFO TEST-OK | layout/style/test/test_bug645998.html | took 524ms 11:47:26 INFO - ++DOMWINDOW == 21 (0x7f627fd3a400) [pid = 3347] [serial = 167] [outer = 0x7f6281591800] 11:47:26 INFO - 856 INFO TEST-START | layout/style/test/test_bug652486.html 11:47:26 INFO - ++DOMWINDOW == 22 (0x7f627f40b000) [pid = 3347] [serial = 168] [outer = 0x7f6281591800] 11:47:27 INFO - MEMORY STAT | vsize 538MB | residentFast 108MB | heapAllocated 23MB 11:47:27 INFO - 857 INFO TEST-OK | layout/style/test/test_bug652486.html | took 1295ms 11:47:27 INFO - ++DOMWINDOW == 23 (0x7f62808f4c00) [pid = 3347] [serial = 169] [outer = 0x7f6281591800] 11:47:27 INFO - 858 INFO TEST-START | layout/style/test/test_bug657143.html 11:47:28 INFO - ++DOMWINDOW == 24 (0x7f62808f5400) [pid = 3347] [serial = 170] [outer = 0x7f6281591800] 11:47:28 INFO - MEMORY STAT | vsize 539MB | residentFast 108MB | heapAllocated 23MB 11:47:29 INFO - 859 INFO TEST-OK | layout/style/test/test_bug657143.html | took 1128ms 11:47:29 INFO - ++DOMWINDOW == 25 (0x7f627f410c00) [pid = 3347] [serial = 171] [outer = 0x7f6281591800] 11:47:29 INFO - --DOCSHELL 0x7f628050c000 == 2 [pid = 3347] [id = 15] 11:47:29 INFO - 860 INFO TEST-START | layout/style/test/test_bug664955.html 11:47:29 INFO - ++DOMWINDOW == 26 (0x7f627f40e800) [pid = 3347] [serial = 172] [outer = 0x7f6281591800] 11:47:29 INFO - nsBlockReflowContext: Block(body)(3)@7f627fc3cb38 metrics=29040,1073743864! 11:47:29 INFO - MEMORY STAT | vsize 539MB | residentFast 109MB | heapAllocated 22MB 11:47:30 INFO - 861 INFO TEST-OK | layout/style/test/test_bug664955.html | took 683ms 11:47:30 INFO - ++DOMWINDOW == 27 (0x7f627f63c800) [pid = 3347] [serial = 173] [outer = 0x7f6281591800] 11:47:30 INFO - 862 INFO TEST-START | layout/style/test/test_bug667520.html 11:47:30 INFO - ++DOMWINDOW == 28 (0x7f627f58f000) [pid = 3347] [serial = 174] [outer = 0x7f6281591800] 11:47:30 INFO - MEMORY STAT | vsize 539MB | residentFast 109MB | heapAllocated 23MB 11:47:30 INFO - 863 INFO TEST-OK | layout/style/test/test_bug667520.html | took 454ms 11:47:31 INFO - ++DOMWINDOW == 29 (0x7f627f640800) [pid = 3347] [serial = 175] [outer = 0x7f6281591800] 11:47:31 INFO - 864 INFO TEST-START | layout/style/test/test_bug716226.html 11:47:31 INFO - ++DOMWINDOW == 30 (0x7f627f6ac400) [pid = 3347] [serial = 176] [outer = 0x7f6281591800] 11:47:31 INFO - MEMORY STAT | vsize 539MB | residentFast 110MB | heapAllocated 24MB 11:47:31 INFO - --DOMWINDOW == 29 (0x7f627fd3d400) [pid = 3347] [serial = 165] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 28 (0x7f627f588400) [pid = 3347] [serial = 164] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug635286.html] 11:47:31 INFO - --DOMWINDOW == 27 (0x7f627f6b3000) [pid = 3347] [serial = 163] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 26 (0x7f627f608800) [pid = 3347] [serial = 162] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug621351.html] 11:47:31 INFO - --DOMWINDOW == 25 (0x7f627f603c00) [pid = 3347] [serial = 161] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 24 (0x7f627f6b4000) [pid = 3347] [serial = 160] [outer = (nil)] [url = data:text/html,] 11:47:31 INFO - --DOMWINDOW == 23 (0x7f627f592c00) [pid = 3347] [serial = 158] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug580685.html] 11:47:31 INFO - --DOMWINDOW == 22 (0x7f627f606400) [pid = 3347] [serial = 157] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 21 (0x7f627f609c00) [pid = 3347] [serial = 156] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug573255.html] 11:47:31 INFO - --DOMWINDOW == 20 (0x7f627f609800) [pid = 3347] [serial = 155] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 19 (0x7f627f592800) [pid = 3347] [serial = 151] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 18 (0x7f627f592000) [pid = 3347] [serial = 154] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug534804.html] 11:47:31 INFO - --DOMWINDOW == 17 (0x7f627f591400) [pid = 3347] [serial = 153] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:31 INFO - --DOMWINDOW == 16 (0x7f627f406800) [pid = 3347] [serial = 152] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug525952.html] 11:47:31 INFO - --DOMWINDOW == 15 (0x7f627f6b8000) [pid = 3347] [serial = 159] [outer = (nil)] [url = data:text/html,] 11:47:31 INFO - 865 INFO TEST-OK | layout/style/test/test_bug716226.html | took 506ms 11:47:31 INFO - ++DOMWINDOW == 16 (0x7f627f603c00) [pid = 3347] [serial = 177] [outer = 0x7f6281591800] 11:47:31 INFO - 866 INFO TEST-START | layout/style/test/test_bug732153.html 11:47:32 INFO - ++DOMWINDOW == 17 (0x7f627f642400) [pid = 3347] [serial = 178] [outer = 0x7f6281591800] 11:47:32 INFO - MEMORY STAT | vsize 539MB | residentFast 110MB | heapAllocated 23MB 11:47:32 INFO - 867 INFO TEST-OK | layout/style/test/test_bug732153.html | took 429ms 11:47:32 INFO - ++DOMWINDOW == 18 (0x7f627f80fc00) [pid = 3347] [serial = 179] [outer = 0x7f6281591800] 11:47:32 INFO - 868 INFO TEST-START | layout/style/test/test_bug732209.html 11:47:32 INFO - ++DOMWINDOW == 19 (0x7f627f811800) [pid = 3347] [serial = 180] [outer = 0x7f6281591800] 11:47:33 INFO - aaa 11:47:33 INFO - MEMORY STAT | vsize 539MB | residentFast 109MB | heapAllocated 24MB 11:47:33 INFO - 869 INFO TEST-OK | layout/style/test/test_bug732209.html | took 1181ms 11:47:33 INFO - ++DOMWINDOW == 20 (0x7f627f81fc00) [pid = 3347] [serial = 181] [outer = 0x7f6281591800] 11:47:33 INFO - 870 INFO TEST-START | layout/style/test/test_bug73586.html 11:47:34 INFO - ++DOMWINDOW == 21 (0x7f627f40d400) [pid = 3347] [serial = 182] [outer = 0x7f6281591800] 11:47:34 INFO - MEMORY STAT | vsize 539MB | residentFast 110MB | heapAllocated 25MB 11:47:34 INFO - 871 INFO TEST-OK | layout/style/test/test_bug73586.html | took 975ms 11:47:34 INFO - ++DOMWINDOW == 22 (0x7f627f609400) [pid = 3347] [serial = 183] [outer = 0x7f6281591800] 11:47:34 INFO - 872 INFO TEST-START | layout/style/test/test_bug74880.html 11:47:35 INFO - ++DOMWINDOW == 23 (0x7f627f60c400) [pid = 3347] [serial = 184] [outer = 0x7f6281591800] 11:47:36 INFO - MEMORY STAT | vsize 540MB | residentFast 112MB | heapAllocated 27MB 11:47:36 INFO - 873 INFO TEST-OK | layout/style/test/test_bug74880.html | took 1473ms 11:47:36 INFO - ++DOMWINDOW == 24 (0x7f627fd12800) [pid = 3347] [serial = 185] [outer = 0x7f6281591800] 11:47:36 INFO - 874 INFO TEST-START | layout/style/test/test_bug765590.html 11:47:36 INFO - ++DOMWINDOW == 25 (0x7f627fd13000) [pid = 3347] [serial = 186] [outer = 0x7f6281591800] 11:47:36 INFO - MEMORY STAT | vsize 540MB | residentFast 113MB | heapAllocated 27MB 11:47:37 INFO - 875 INFO TEST-OK | layout/style/test/test_bug765590.html | took 402ms 11:47:37 INFO - ++DOMWINDOW == 26 (0x7f627f813400) [pid = 3347] [serial = 187] [outer = 0x7f6281591800] 11:47:37 INFO - 876 INFO TEST-START | layout/style/test/test_bug771043.html 11:47:37 INFO - ++DOMWINDOW == 27 (0x7f627f58b000) [pid = 3347] [serial = 188] [outer = 0x7f6281591800] 11:47:37 INFO - ++DOCSHELL 0x7f627f5e9000 == 3 [pid = 3347] [id = 16] 11:47:37 INFO - ++DOMWINDOW == 28 (0x7f627f58d800) [pid = 3347] [serial = 189] [outer = (nil)] 11:47:37 INFO - ++DOMWINDOW == 29 (0x7f627f58fc00) [pid = 3347] [serial = 190] [outer = 0x7f627f58d800] 11:47:38 INFO - --DOMWINDOW == 28 (0x7f627f60f400) [pid = 3347] [serial = 150] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug524175.html] 11:47:38 INFO - MEMORY STAT | vsize 538MB | residentFast 106MB | heapAllocated 18MB 11:47:38 INFO - 877 INFO TEST-OK | layout/style/test/test_bug771043.html | took 805ms 11:47:38 INFO - ++DOMWINDOW == 29 (0x7f627f40ec00) [pid = 3347] [serial = 191] [outer = 0x7f6281591800] 11:47:38 INFO - 878 INFO TEST-START | layout/style/test/test_bug795520.html 11:47:38 INFO - ++DOMWINDOW == 30 (0x7f627f586800) [pid = 3347] [serial = 192] [outer = 0x7f6281591800] 11:47:38 INFO - ++DOCSHELL 0x7f627f9e0000 == 4 [pid = 3347] [id = 17] 11:47:38 INFO - ++DOMWINDOW == 31 (0x7f627f606800) [pid = 3347] [serial = 193] [outer = (nil)] 11:47:38 INFO - ++DOMWINDOW == 32 (0x7f627f607800) [pid = 3347] [serial = 194] [outer = 0x7f627f606800] 11:47:38 INFO - MEMORY STAT | vsize 538MB | residentFast 106MB | heapAllocated 19MB 11:47:38 INFO - 879 INFO TEST-OK | layout/style/test/test_bug795520.html | took 696ms 11:47:39 INFO - ++DOMWINDOW == 33 (0x7f627f411800) [pid = 3347] [serial = 195] [outer = 0x7f6281591800] 11:47:39 INFO - 880 INFO TEST-START | layout/style/test/test_bug798567.html 11:47:39 INFO - ++DOMWINDOW == 34 (0x7f627f588400) [pid = 3347] [serial = 196] [outer = 0x7f6281591800] 11:47:39 INFO - MEMORY STAT | vsize 538MB | residentFast 106MB | heapAllocated 20MB 11:47:39 INFO - 881 INFO TEST-OK | layout/style/test/test_bug798567.html | took 354ms 11:47:39 INFO - ++DOMWINDOW == 35 (0x7f627f604800) [pid = 3347] [serial = 197] [outer = 0x7f6281591800] 11:47:39 INFO - 882 INFO TEST-START | layout/style/test/test_bug798843_pref.html 11:47:39 INFO - ++DOMWINDOW == 36 (0x7f627f602c00) [pid = 3347] [serial = 198] [outer = 0x7f6281591800] 11:47:40 INFO - MEMORY STAT | vsize 538MB | residentFast 108MB | heapAllocated 20MB 11:47:40 INFO - --DOMWINDOW == 35 (0x7f627f40d400) [pid = 3347] [serial = 182] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug73586.html] 11:47:40 INFO - --DOMWINDOW == 34 (0x7f627f81fc00) [pid = 3347] [serial = 181] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 33 (0x7f627f591800) [pid = 3347] [serial = 166] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug645998.html] 11:47:40 INFO - --DOMWINDOW == 32 (0x7f627fd12800) [pid = 3347] [serial = 185] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 31 (0x7f627fd13000) [pid = 3347] [serial = 186] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug765590.html] 11:47:40 INFO - --DOMWINDOW == 30 (0x7f62808f5400) [pid = 3347] [serial = 170] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug657143.html] 11:47:40 INFO - --DOMWINDOW == 29 (0x7f62808f4c00) [pid = 3347] [serial = 169] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 28 (0x7f627f40b000) [pid = 3347] [serial = 168] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug652486.html] 11:47:40 INFO - --DOMWINDOW == 27 (0x7f627fd3a400) [pid = 3347] [serial = 167] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 26 (0x7f627f80fc00) [pid = 3347] [serial = 179] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 25 (0x7f627f642400) [pid = 3347] [serial = 178] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug732153.html] 11:47:40 INFO - --DOMWINDOW == 24 (0x7f627f603c00) [pid = 3347] [serial = 177] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 23 (0x7f627f640800) [pid = 3347] [serial = 175] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 22 (0x7f627f58f000) [pid = 3347] [serial = 174] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug667520.html] 11:47:40 INFO - --DOMWINDOW == 21 (0x7f627f63c800) [pid = 3347] [serial = 173] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 20 (0x7f627f40e800) [pid = 3347] [serial = 172] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug664955.html] 11:47:40 INFO - --DOMWINDOW == 19 (0x7f627f410c00) [pid = 3347] [serial = 171] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 18 (0x7f627f60c400) [pid = 3347] [serial = 184] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug74880.html] 11:47:40 INFO - --DOMWINDOW == 17 (0x7f627f609400) [pid = 3347] [serial = 183] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:40 INFO - --DOMWINDOW == 16 (0x7f627f811800) [pid = 3347] [serial = 180] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug732209.html] 11:47:40 INFO - --DOMWINDOW == 15 (0x7f627f6ac400) [pid = 3347] [serial = 176] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug716226.html] 11:47:40 INFO - 883 INFO TEST-OK | layout/style/test/test_bug798843_pref.html | took 696ms 11:47:40 INFO - ++DOMWINDOW == 16 (0x7f627f590400) [pid = 3347] [serial = 199] [outer = 0x7f6281591800] 11:47:40 INFO - 884 INFO TEST-START | layout/style/test/test_bug829816.html 11:47:40 INFO - ++DOMWINDOW == 17 (0x7f627f591800) [pid = 3347] [serial = 200] [outer = 0x7f6281591800] 11:47:40 INFO - MEMORY STAT | vsize 538MB | residentFast 108MB | heapAllocated 20MB 11:47:40 INFO - 885 INFO TEST-OK | layout/style/test/test_bug829816.html | took 463ms 11:47:41 INFO - ++DOMWINDOW == 18 (0x7f627f6ad400) [pid = 3347] [serial = 201] [outer = 0x7f6281591800] 11:47:41 INFO - 886 INFO TEST-START | layout/style/test/test_bug874919.html 11:47:41 INFO - ++DOMWINDOW == 19 (0x7f627f6adc00) [pid = 3347] [serial = 202] [outer = 0x7f6281591800] 11:47:41 INFO - MEMORY STAT | vsize 538MB | residentFast 109MB | heapAllocated 22MB 11:47:41 INFO - 887 INFO TEST-OK | layout/style/test/test_bug874919.html | took 708ms 11:47:41 INFO - ++DOMWINDOW == 20 (0x7f627f642c00) [pid = 3347] [serial = 203] [outer = 0x7f6281591800] 11:47:41 INFO - 888 INFO TEST-START | layout/style/test/test_bug887741_at-rules_in_declaration_lists.html 11:47:42 INFO - ++DOMWINDOW == 21 (0x7f627f40dc00) [pid = 3347] [serial = 204] [outer = 0x7f6281591800] 11:47:42 INFO - MEMORY STAT | vsize 538MB | residentFast 109MB | heapAllocated 23MB 11:47:43 INFO - 889 INFO TEST-OK | layout/style/test/test_bug887741_at-rules_in_declaration_lists.html | took 1559ms 11:47:43 INFO - ++DOMWINDOW == 22 (0x7f627fd13000) [pid = 3347] [serial = 205] [outer = 0x7f6281591800] 11:47:43 INFO - 890 INFO TEST-START | layout/style/test/test_bug892929.html 11:47:44 INFO - ++DOMWINDOW == 23 (0x7f627f6a9800) [pid = 3347] [serial = 206] [outer = 0x7f6281591800] 11:47:44 INFO - MEMORY STAT | vsize 538MB | residentFast 110MB | heapAllocated 24MB 11:47:44 INFO - 891 INFO TEST-OK | layout/style/test/test_bug892929.html | took 851ms 11:47:44 INFO - ++DOMWINDOW == 24 (0x7f627f589400) [pid = 3347] [serial = 207] [outer = 0x7f6281591800] 11:47:44 INFO - 892 INFO TEST-START | layout/style/test/test_bug98997.html 11:47:45 INFO - --DOCSHELL 0x7f627f9e0000 == 3 [pid = 3347] [id = 17] 11:47:45 INFO - --DOCSHELL 0x7f627f5e9000 == 2 [pid = 3347] [id = 16] 11:47:45 INFO - ++DOMWINDOW == 25 (0x7f627f40bc00) [pid = 3347] [serial = 208] [outer = 0x7f6281591800] 11:47:45 INFO - MEMORY STAT | vsize 538MB | residentFast 109MB | heapAllocated 22MB 11:47:45 INFO - 893 INFO TEST-OK | layout/style/test/test_bug98997.html | took 573ms 11:47:45 INFO - ++DOMWINDOW == 26 (0x7f627f60a000) [pid = 3347] [serial = 209] [outer = 0x7f6281591800] 11:47:45 INFO - 894 INFO TEST-START | layout/style/test/test_cascade.html 11:47:45 INFO - ++DOMWINDOW == 27 (0x7f627f603400) [pid = 3347] [serial = 210] [outer = 0x7f6281591800] 11:47:45 INFO - MEMORY STAT | vsize 539MB | residentFast 109MB | heapAllocated 23MB 11:47:46 INFO - 895 INFO TEST-OK | layout/style/test/test_cascade.html | took 417ms 11:47:46 INFO - ++DOMWINDOW == 28 (0x7f627f58f000) [pid = 3347] [serial = 211] [outer = 0x7f6281591800] 11:47:46 INFO - 896 INFO TEST-START | layout/style/test/test_ch_ex_no_infloops.html 11:47:46 INFO - ++DOMWINDOW == 29 (0x7f627f592000) [pid = 3347] [serial = 212] [outer = 0x7f6281591800] 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:47 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:49 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:50 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:51 INFO - [Child 3347] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80070057: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/data/nsDataChannel.cpp, line 74 11:47:57 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:47:57 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:57 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:47:57 INFO - MEMORY STAT | vsize 550MB | residentFast 132MB | heapAllocated 43MB 11:47:58 INFO - --DOMWINDOW == 28 (0x7f627f6ad400) [pid = 3347] [serial = 201] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 27 (0x7f627f590400) [pid = 3347] [serial = 199] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 26 (0x7f627f602c00) [pid = 3347] [serial = 198] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug798843_pref.html] 11:47:58 INFO - --DOMWINDOW == 25 (0x7f627f813400) [pid = 3347] [serial = 187] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 24 (0x7f627f604800) [pid = 3347] [serial = 197] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 23 (0x7f627f588400) [pid = 3347] [serial = 196] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug798567.html] 11:47:58 INFO - --DOMWINDOW == 22 (0x7f627f411800) [pid = 3347] [serial = 195] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 21 (0x7f627f607800) [pid = 3347] [serial = 194] [outer = (nil)] [url = about:blank] 11:47:58 INFO - --DOMWINDOW == 20 (0x7f627f40ec00) [pid = 3347] [serial = 191] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:47:58 INFO - --DOMWINDOW == 19 (0x7f627f606800) [pid = 3347] [serial = 193] [outer = (nil)] [url = about:blank] 11:47:58 INFO - --DOMWINDOW == 18 (0x7f627f58d800) [pid = 3347] [serial = 189] [outer = (nil)] [url = about:blank] 11:47:58 INFO - 897 INFO TEST-OK | layout/style/test/test_ch_ex_no_infloops.html | took 11932ms 11:47:58 INFO - --DOMWINDOW == 17 (0x7f627f591800) [pid = 3347] [serial = 200] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug829816.html] 11:47:58 INFO - --DOMWINDOW == 16 (0x7f627f586800) [pid = 3347] [serial = 192] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug795520.html] 11:47:58 INFO - ++DOMWINDOW == 17 (0x7f627e2af800) [pid = 3347] [serial = 213] [outer = 0x7f6281591800] 11:47:58 INFO - 898 INFO TEST-START | layout/style/test/test_compute_data_with_start_struct.html 11:47:58 INFO - ++DOMWINDOW == 18 (0x7f627e2afc00) [pid = 3347] [serial = 214] [outer = 0x7f6281591800] 11:48:01 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:48:01 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:48:01 INFO - MEMORY STAT | vsize 557MB | residentFast 139MB | heapAllocated 47MB 11:48:01 INFO - 899 INFO TEST-OK | layout/style/test/test_compute_data_with_start_struct.html | took 2995ms 11:48:01 INFO - ++DOMWINDOW == 19 (0x7f627dd6c800) [pid = 3347] [serial = 215] [outer = 0x7f6281591800] 11:48:01 INFO - 900 INFO TEST-START | layout/style/test/test_computed_style.html 11:48:01 INFO - ++DOMWINDOW == 20 (0x7f627dd6d000) [pid = 3347] [serial = 216] [outer = 0x7f6281591800] 11:48:01 INFO - MEMORY STAT | vsize 557MB | residentFast 140MB | heapAllocated 45MB 11:48:01 INFO - 901 INFO TEST-OK | layout/style/test/test_computed_style.html | took 430ms 11:48:02 INFO - ++DOMWINDOW == 21 (0x7f627dc03800) [pid = 3347] [serial = 217] [outer = 0x7f6281591800] 11:48:02 INFO - 902 INFO TEST-START | layout/style/test/test_computed_style_no_pseudo.html 11:48:02 INFO - ++DOMWINDOW == 22 (0x7f627dc07800) [pid = 3347] [serial = 218] [outer = 0x7f6281591800] 11:48:02 INFO - MEMORY STAT | vsize 558MB | residentFast 139MB | heapAllocated 45MB 11:48:02 INFO - 903 INFO TEST-OK | layout/style/test/test_computed_style_no_pseudo.html | took 656ms 11:48:02 INFO - ++DOMWINDOW == 23 (0x7f627dd63000) [pid = 3347] [serial = 219] [outer = 0x7f6281591800] 11:48:02 INFO - 904 INFO TEST-START | layout/style/test/test_computed_style_prefs.html 11:48:03 INFO - ++DOMWINDOW == 24 (0x7f627dd6b400) [pid = 3347] [serial = 220] [outer = 0x7f6281591800] 11:48:04 INFO - MEMORY STAT | vsize 557MB | residentFast 121MB | heapAllocated 25MB 11:48:04 INFO - 905 INFO TEST-OK | layout/style/test/test_computed_style_prefs.html | took 1437ms 11:48:04 INFO - ++DOMWINDOW == 25 (0x7f627dc03400) [pid = 3347] [serial = 221] [outer = 0x7f6281591800] 11:48:04 INFO - --DOMWINDOW == 24 (0x7f627f58fc00) [pid = 3347] [serial = 190] [outer = (nil)] [url = about:blank] 11:48:04 INFO - --DOMWINDOW == 23 (0x7f627f58b000) [pid = 3347] [serial = 188] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug771043.html] 11:48:04 INFO - 906 INFO TEST-START | layout/style/test/test_condition_text.html 11:48:05 INFO - ++DOMWINDOW == 24 (0x7f627dc04000) [pid = 3347] [serial = 222] [outer = 0x7f6281591800] 11:48:05 INFO - MEMORY STAT | vsize 557MB | residentFast 111MB | heapAllocated 19MB 11:48:05 INFO - 907 INFO TEST-OK | layout/style/test/test_condition_text.html | took 469ms 11:48:05 INFO - ++DOMWINDOW == 25 (0x7f627dd2e800) [pid = 3347] [serial = 223] [outer = 0x7f6281591800] 11:48:05 INFO - 908 INFO TEST-START | layout/style/test/test_condition_text_assignment.html 11:48:05 INFO - ++DOMWINDOW == 26 (0x7f627dc0c000) [pid = 3347] [serial = 224] [outer = 0x7f6281591800] 11:48:05 INFO - MEMORY STAT | vsize 557MB | residentFast 111MB | heapAllocated 20MB 11:48:06 INFO - 909 INFO TEST-OK | layout/style/test/test_condition_text_assignment.html | took 935ms 11:48:06 INFO - ++DOMWINDOW == 27 (0x7f627dd31800) [pid = 3347] [serial = 225] [outer = 0x7f6281591800] 11:48:06 INFO - 910 INFO TEST-START | layout/style/test/test_contain_formatting_context.html 11:48:06 INFO - ++DOMWINDOW == 28 (0x7f627dd36800) [pid = 3347] [serial = 226] [outer = 0x7f6281591800] 11:48:07 INFO - MEMORY STAT | vsize 557MB | residentFast 114MB | heapAllocated 24MB 11:48:07 INFO - 911 INFO TEST-OK | layout/style/test/test_contain_formatting_context.html | took 609ms 11:48:07 INFO - ++DOMWINDOW == 29 (0x7f627dd34000) [pid = 3347] [serial = 227] [outer = 0x7f6281591800] 11:48:07 INFO - 912 INFO TEST-START | layout/style/test/test_counter_descriptor_storage.html 11:48:07 INFO - --DOMWINDOW == 28 (0x7f627f642c00) [pid = 3347] [serial = 203] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 27 (0x7f627f6adc00) [pid = 3347] [serial = 202] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug874919.html] 11:48:07 INFO - --DOMWINDOW == 26 (0x7f627e2afc00) [pid = 3347] [serial = 214] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_compute_data_with_start_struct.html] 11:48:07 INFO - --DOMWINDOW == 25 (0x7f627fd13000) [pid = 3347] [serial = 205] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 24 (0x7f627e2af800) [pid = 3347] [serial = 213] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 23 (0x7f627f592000) [pid = 3347] [serial = 212] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_ch_ex_no_infloops.html] 11:48:07 INFO - --DOMWINDOW == 22 (0x7f627f58f000) [pid = 3347] [serial = 211] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 21 (0x7f627f603400) [pid = 3347] [serial = 210] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_cascade.html] 11:48:07 INFO - --DOMWINDOW == 20 (0x7f627f60a000) [pid = 3347] [serial = 209] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 19 (0x7f627f589400) [pid = 3347] [serial = 207] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 18 (0x7f627dc07800) [pid = 3347] [serial = 218] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_computed_style_no_pseudo.html] 11:48:07 INFO - --DOMWINDOW == 17 (0x7f627dd63000) [pid = 3347] [serial = 219] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 16 (0x7f627dc03800) [pid = 3347] [serial = 217] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 15 (0x7f627dd6d000) [pid = 3347] [serial = 216] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_computed_style.html] 11:48:07 INFO - --DOMWINDOW == 14 (0x7f627dd6c800) [pid = 3347] [serial = 215] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:07 INFO - --DOMWINDOW == 13 (0x7f627f6a9800) [pid = 3347] [serial = 206] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug892929.html] 11:48:07 INFO - --DOMWINDOW == 12 (0x7f627f40dc00) [pid = 3347] [serial = 204] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug887741_at-rules_in_declaration_lists.html] 11:48:07 INFO - ++DOMWINDOW == 13 (0x7f627dd2ec00) [pid = 3347] [serial = 228] [outer = 0x7f6281591800] 11:48:07 INFO - MEMORY STAT | vsize 557MB | residentFast 113MB | heapAllocated 24MB 11:48:07 INFO - 913 INFO TEST-OK | layout/style/test/test_counter_descriptor_storage.html | took 647ms 11:48:07 INFO - ++DOMWINDOW == 14 (0x7f627dd3d000) [pid = 3347] [serial = 229] [outer = 0x7f6281591800] 11:48:08 INFO - 914 INFO TEST-START | layout/style/test/test_counter_style.html 11:48:08 INFO - ++DOMWINDOW == 15 (0x7f627dc0c400) [pid = 3347] [serial = 230] [outer = 0x7f6281591800] 11:48:08 INFO - MEMORY STAT | vsize 564MB | residentFast 115MB | heapAllocated 24MB 11:48:08 INFO - 915 INFO TEST-OK | layout/style/test/test_counter_style.html | took 514ms 11:48:08 INFO - ++DOMWINDOW == 16 (0x7f627e0d4800) [pid = 3347] [serial = 231] [outer = 0x7f6281591800] 11:48:08 INFO - 916 INFO TEST-START | layout/style/test/test_css_cross_domain.html 11:48:08 INFO - ++DOMWINDOW == 17 (0x7f627e0d4c00) [pid = 3347] [serial = 232] [outer = 0x7f6281591800] 11:48:09 INFO - ++DOCSHELL 0x7f6280a76800 == 3 [pid = 3347] [id = 18] 11:48:09 INFO - ++DOMWINDOW == 18 (0x7f627e0dcc00) [pid = 3347] [serial = 233] [outer = (nil)] 11:48:09 INFO - ++DOCSHELL 0x7f6280a7e000 == 4 [pid = 3347] [id = 19] 11:48:09 INFO - ++DOMWINDOW == 19 (0x7f627e0ddc00) [pid = 3347] [serial = 234] [outer = (nil)] 11:48:09 INFO - ++DOMWINDOW == 20 (0x7f627e0d6c00) [pid = 3347] [serial = 235] [outer = 0x7f627e0dcc00] 11:48:09 INFO - ++DOMWINDOW == 21 (0x7f627dfb4400) [pid = 3347] [serial = 236] [outer = 0x7f627e0ddc00] 11:48:12 INFO - --DOMWINDOW == 20 (0x7f627f40bc00) [pid = 3347] [serial = 208] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_bug98997.html] 11:48:14 INFO - --DOMWINDOW == 19 (0x7f627e0d4800) [pid = 3347] [serial = 231] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 18 (0x7f627dd3d000) [pid = 3347] [serial = 229] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 17 (0x7f627dd2ec00) [pid = 3347] [serial = 228] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_counter_descriptor_storage.html] 11:48:14 INFO - --DOMWINDOW == 16 (0x7f627dd34000) [pid = 3347] [serial = 227] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 15 (0x7f627dd6b400) [pid = 3347] [serial = 220] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_computed_style_prefs.html] 11:48:14 INFO - --DOMWINDOW == 14 (0x7f627dd31800) [pid = 3347] [serial = 225] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 13 (0x7f627dc0c000) [pid = 3347] [serial = 224] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_condition_text_assignment.html] 11:48:14 INFO - --DOMWINDOW == 12 (0x7f627dd2e800) [pid = 3347] [serial = 223] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 11 (0x7f627dc04000) [pid = 3347] [serial = 222] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_condition_text.html] 11:48:14 INFO - --DOMWINDOW == 10 (0x7f627dc03400) [pid = 3347] [serial = 221] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:14 INFO - --DOMWINDOW == 9 (0x7f627dc0c400) [pid = 3347] [serial = 230] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_counter_style.html] 11:48:14 INFO - --DOMWINDOW == 8 (0x7f627dd36800) [pid = 3347] [serial = 226] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_contain_formatting_context.html] 11:48:19 INFO - MEMORY STAT | vsize 563MB | residentFast 105MB | heapAllocated 19MB 11:48:19 INFO - 917 INFO TEST-OK | layout/style/test/test_css_cross_domain.html | took 10823ms 11:48:19 INFO - ++DOMWINDOW == 9 (0x7f627dc11800) [pid = 3347] [serial = 237] [outer = 0x7f6281591800] 11:48:19 INFO - 918 INFO TEST-START | layout/style/test/test_css_eof_handling.html 11:48:20 INFO - ++DOMWINDOW == 10 (0x7f627dd2f800) [pid = 3347] [serial = 238] [outer = 0x7f6281591800] 11:48:20 INFO - ++DOCSHELL 0x7f627ebb0800 == 5 [pid = 3347] [id = 20] 11:48:20 INFO - ++DOMWINDOW == 11 (0x7f627dc04000) [pid = 3347] [serial = 239] [outer = (nil)] 11:48:20 INFO - ++DOMWINDOW == 12 (0x7f627dd32400) [pid = 3347] [serial = 240] [outer = 0x7f627dc04000] 11:48:20 INFO - ++DOMWINDOW == 13 (0x7f627dd30800) [pid = 3347] [serial = 241] [outer = 0x7f627dc04000] 11:48:20 INFO - ++DOMWINDOW == 14 (0x7f627dd30400) [pid = 3347] [serial = 242] [outer = 0x7f627dc04000] 11:48:20 INFO - ++DOMWINDOW == 15 (0x7f627dd34000) [pid = 3347] [serial = 243] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 16 (0x7f627dc03400) [pid = 3347] [serial = 244] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 17 (0x7f627dd34800) [pid = 3347] [serial = 245] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 18 (0x7f627dd36c00) [pid = 3347] [serial = 246] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 19 (0x7f627dc04c00) [pid = 3347] [serial = 247] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 20 (0x7f627dd37c00) [pid = 3347] [serial = 248] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 21 (0x7f627dd2e400) [pid = 3347] [serial = 249] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 22 (0x7f627dd3cc00) [pid = 3347] [serial = 250] [outer = 0x7f627dc04000] 11:48:21 INFO - ++DOMWINDOW == 23 (0x7f627dd5ac00) [pid = 3347] [serial = 251] [outer = 0x7f627dc04000] 11:48:22 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:48:22 INFO - ++DOMWINDOW == 24 (0x7f627dd5cc00) [pid = 3347] [serial = 252] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 25 (0x7f627dd60000) [pid = 3347] [serial = 253] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 26 (0x7f627dd30c00) [pid = 3347] [serial = 254] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 27 (0x7f627dd62c00) [pid = 3347] [serial = 255] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 28 (0x7f627dd60400) [pid = 3347] [serial = 256] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 29 (0x7f627dd63c00) [pid = 3347] [serial = 257] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 30 (0x7f627dd39400) [pid = 3347] [serial = 258] [outer = 0x7f627dc04000] 11:48:22 INFO - ++DOMWINDOW == 31 (0x7f627dd33000) [pid = 3347] [serial = 259] [outer = 0x7f627dc04000] 11:48:23 INFO - ++DOMWINDOW == 32 (0x7f627dd65000) [pid = 3347] [serial = 260] [outer = 0x7f627dc04000] 11:48:23 INFO - ++DOMWINDOW == 33 (0x7f627dd61400) [pid = 3347] [serial = 261] [outer = 0x7f627dc04000] 11:48:23 INFO - ++DOMWINDOW == 34 (0x7f627dd67c00) [pid = 3347] [serial = 262] [outer = 0x7f627dc04000] 11:48:23 INFO - ++DOMWINDOW == 35 (0x7f627dd66000) [pid = 3347] [serial = 263] [outer = 0x7f627dc04000] 11:48:23 INFO - ++DOMWINDOW == 36 (0x7f627dd5e800) [pid = 3347] [serial = 264] [outer = 0x7f627dc04000] 11:48:24 INFO - ++DOMWINDOW == 37 (0x7f627dd66400) [pid = 3347] [serial = 265] [outer = 0x7f627dc04000] 11:48:24 INFO - ++DOMWINDOW == 38 (0x7f627dd63400) [pid = 3347] [serial = 266] [outer = 0x7f627dc04000] 11:48:24 INFO - ++DOMWINDOW == 39 (0x7f627dd67400) [pid = 3347] [serial = 267] [outer = 0x7f627dc04000] 11:48:24 INFO - ++DOMWINDOW == 40 (0x7f627dfa8400) [pid = 3347] [serial = 268] [outer = 0x7f627dc04000] 11:48:24 INFO - ++DOMWINDOW == 41 (0x7f627dfac400) [pid = 3347] [serial = 269] [outer = 0x7f627dc04000] 11:48:24 INFO - MEMORY STAT | vsize 563MB | residentFast 112MB | heapAllocated 23MB 11:48:24 INFO - 919 INFO TEST-OK | layout/style/test/test_css_eof_handling.html | took 4741ms 11:48:24 INFO - ++DOMWINDOW == 42 (0x7f627dfab800) [pid = 3347] [serial = 270] [outer = 0x7f6281591800] 11:48:24 INFO - 920 INFO TEST-START | layout/style/test/test_css_escape_api.html 11:48:24 INFO - ++DOMWINDOW == 43 (0x7f627dfac800) [pid = 3347] [serial = 271] [outer = 0x7f6281591800] 11:48:25 INFO - MEMORY STAT | vsize 563MB | residentFast 113MB | heapAllocated 23MB 11:48:25 INFO - 921 INFO TEST-OK | layout/style/test/test_css_escape_api.html | took 350ms 11:48:25 INFO - ++DOMWINDOW == 44 (0x7f627dd2f400) [pid = 3347] [serial = 272] [outer = 0x7f6281591800] 11:48:25 INFO - 922 INFO TEST-START | layout/style/test/test_css_function_mismatched_parenthesis.html 11:48:25 INFO - ++DOMWINDOW == 45 (0x7f627dc02c00) [pid = 3347] [serial = 273] [outer = 0x7f6281591800] 11:48:26 INFO - MEMORY STAT | vsize 564MB | residentFast 115MB | heapAllocated 25MB 11:48:26 INFO - 923 INFO TEST-OK | layout/style/test/test_css_function_mismatched_parenthesis.html | took 840ms 11:48:26 INFO - ++DOMWINDOW == 46 (0x7f627e0d9000) [pid = 3347] [serial = 274] [outer = 0x7f6281591800] 11:48:26 INFO - 924 INFO TEST-START | layout/style/test/test_css_loader_crossorigin_data_url.html 11:48:26 INFO - ++DOMWINDOW == 47 (0x7f627dc0b400) [pid = 3347] [serial = 275] [outer = 0x7f6281591800] 11:48:26 INFO - MEMORY STAT | vsize 564MB | residentFast 116MB | heapAllocated 24MB 11:48:26 INFO - 925 INFO TEST-OK | layout/style/test/test_css_loader_crossorigin_data_url.html | took 503ms 11:48:26 INFO - ++DOMWINDOW == 48 (0x7f627dd62400) [pid = 3347] [serial = 276] [outer = 0x7f6281591800] 11:48:26 INFO - 926 INFO TEST-START | layout/style/test/test_css_supports.html 11:48:27 INFO - ++DOMWINDOW == 49 (0x7f627dd5a400) [pid = 3347] [serial = 277] [outer = 0x7f6281591800] 11:48:27 INFO - --DOCSHELL 0x7f627ebb0800 == 4 [pid = 3347] [id = 20] 11:48:27 INFO - --DOCSHELL 0x7f6280a76800 == 3 [pid = 3347] [id = 18] 11:48:27 INFO - --DOCSHELL 0x7f6280a7e000 == 2 [pid = 3347] [id = 19] 11:48:27 INFO - --DOMWINDOW == 48 (0x7f627dfa8400) [pid = 3347] [serial = 268] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 47 (0x7f627dd67400) [pid = 3347] [serial = 267] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 46 (0x7f627dd63400) [pid = 3347] [serial = 266] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 45 (0x7f627dd66400) [pid = 3347] [serial = 265] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 44 (0x7f627dd5e800) [pid = 3347] [serial = 264] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 43 (0x7f627dd66000) [pid = 3347] [serial = 263] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 42 (0x7f627dd67c00) [pid = 3347] [serial = 262] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 41 (0x7f627dd61400) [pid = 3347] [serial = 261] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 40 (0x7f627dd65000) [pid = 3347] [serial = 260] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 39 (0x7f627dd33000) [pid = 3347] [serial = 259] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 38 (0x7f627dd39400) [pid = 3347] [serial = 258] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 37 (0x7f627dd63c00) [pid = 3347] [serial = 257] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 36 (0x7f627dd60400) [pid = 3347] [serial = 256] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 35 (0x7f627dd62c00) [pid = 3347] [serial = 255] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 34 (0x7f627dd30c00) [pid = 3347] [serial = 254] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 33 (0x7f627dd60000) [pid = 3347] [serial = 253] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 32 (0x7f627dd5cc00) [pid = 3347] [serial = 252] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 31 (0x7f627dd5ac00) [pid = 3347] [serial = 251] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 30 (0x7f627dd3cc00) [pid = 3347] [serial = 250] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 29 (0x7f627dd2e400) [pid = 3347] [serial = 249] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 28 (0x7f627dd37c00) [pid = 3347] [serial = 248] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 27 (0x7f627dc04c00) [pid = 3347] [serial = 247] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 26 (0x7f627dd36c00) [pid = 3347] [serial = 246] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 25 (0x7f627dd34800) [pid = 3347] [serial = 245] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 24 (0x7f627dc03400) [pid = 3347] [serial = 244] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 23 (0x7f627dd34000) [pid = 3347] [serial = 243] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 22 (0x7f627dd30400) [pid = 3347] [serial = 242] [outer = 0x7f627dc04000] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:27 INFO - --DOMWINDOW == 21 (0x7f627dd30800) [pid = 3347] [serial = 241] [outer = 0x7f627dc04000] [url = about:blank] 11:48:27 INFO - --DOMWINDOW == 20 (0x7f627dd32400) [pid = 3347] [serial = 240] [outer = 0x7f627dc04000] [url = about:blank] 11:48:27 INFO - MEMORY STAT | vsize 564MB | residentFast 115MB | heapAllocated 22MB 11:48:27 INFO - 927 INFO TEST-OK | layout/style/test/test_css_supports.html | took 538ms 11:48:27 INFO - ++DOMWINDOW == 21 (0x7f627e1ab000) [pid = 3347] [serial = 278] [outer = 0x7f6281591800] 11:48:27 INFO - 928 INFO TEST-START | layout/style/test/test_css_supports_variables.html 11:48:27 INFO - ++DOMWINDOW == 22 (0x7f627e1ac400) [pid = 3347] [serial = 279] [outer = 0x7f6281591800] 11:48:27 INFO - [Child 3347] WARNING: got a high Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 616 11:48:27 INFO - [Child 3347] WARNING: got a High Surrogate but no low surrogate: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/string/nsUTF8Utils.h, line 527 11:48:27 INFO - MEMORY STAT | vsize 564MB | residentFast 116MB | heapAllocated 23MB 11:48:27 INFO - 929 INFO TEST-OK | layout/style/test/test_css_supports_variables.html | took 484ms 11:48:28 INFO - ++DOMWINDOW == 23 (0x7f627dd5b000) [pid = 3347] [serial = 280] [outer = 0x7f6281591800] 11:48:28 INFO - 930 INFO TEST-START | layout/style/test/test_default_bidi_css.html 11:48:28 INFO - ++DOMWINDOW == 24 (0x7f627e1acc00) [pid = 3347] [serial = 281] [outer = 0x7f6281591800] 11:48:28 INFO - MEMORY STAT | vsize 564MB | residentFast 116MB | heapAllocated 24MB 11:48:28 INFO - 931 INFO TEST-OK | layout/style/test/test_default_bidi_css.html | took 561ms 11:48:28 INFO - ++DOMWINDOW == 25 (0x7f627e1ad800) [pid = 3347] [serial = 282] [outer = 0x7f6281591800] 11:48:28 INFO - 932 INFO TEST-START | layout/style/test/test_default_computed_style.html 11:48:28 INFO - ++DOMWINDOW == 26 (0x7f627e39a800) [pid = 3347] [serial = 283] [outer = 0x7f6281591800] 11:48:29 INFO - MEMORY STAT | vsize 564MB | residentFast 117MB | heapAllocated 24MB 11:48:29 INFO - 933 INFO TEST-OK | layout/style/test/test_default_computed_style.html | took 289ms 11:48:29 INFO - ++DOMWINDOW == 27 (0x7f627f913800) [pid = 3347] [serial = 284] [outer = 0x7f6281591800] 11:48:29 INFO - 934 INFO TEST-START | layout/style/test/test_descriptor_storage.html 11:48:29 INFO - ++DOMWINDOW == 28 (0x7f627f909400) [pid = 3347] [serial = 285] [outer = 0x7f6281591800] 11:48:29 INFO - --DOMWINDOW == 27 (0x7f627dfab800) [pid = 3347] [serial = 270] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:29 INFO - --DOMWINDOW == 26 (0x7f627dfac400) [pid = 3347] [serial = 269] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:29 INFO - --DOMWINDOW == 25 (0x7f627dc11800) [pid = 3347] [serial = 237] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:48:29 INFO - --DOMWINDOW == 24 (0x7f627dc04000) [pid = 3347] [serial = 239] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:29 INFO - MEMORY STAT | vsize 564MB | residentFast 116MB | heapAllocated 25MB 11:48:29 INFO - 935 INFO TEST-OK | layout/style/test/test_descriptor_storage.html | took 638ms 11:48:29 INFO - ++DOMWINDOW == 25 (0x7f62800d3400) [pid = 3347] [serial = 286] [outer = 0x7f6281591800] 11:48:29 INFO - 936 INFO TEST-START | layout/style/test/test_descriptor_syntax_errors.html 11:48:30 INFO - ++DOMWINDOW == 26 (0x7f627fd16000) [pid = 3347] [serial = 287] [outer = 0x7f6281591800] 11:48:30 INFO - MEMORY STAT | vsize 564MB | residentFast 117MB | heapAllocated 26MB 11:48:30 INFO - 937 INFO TEST-OK | layout/style/test/test_descriptor_syntax_errors.html | took 381ms 11:48:30 INFO - ++DOMWINDOW == 27 (0x7f627f910800) [pid = 3347] [serial = 288] [outer = 0x7f6281591800] 11:48:30 INFO - 938 INFO TEST-START | layout/style/test/test_dont_use_document_colors.html 11:48:30 INFO - ++DOMWINDOW == 28 (0x7f627e0da800) [pid = 3347] [serial = 289] [outer = 0x7f6281591800] 11:48:31 INFO - MEMORY STAT | vsize 569MB | residentFast 118MB | heapAllocated 26MB 11:48:31 INFO - 939 INFO TEST-OK | layout/style/test/test_dont_use_document_colors.html | took 795ms 11:48:31 INFO - ++DOMWINDOW == 29 (0x7f6280465000) [pid = 3347] [serial = 290] [outer = 0x7f6281591800] 11:48:31 INFO - 940 INFO TEST-START | layout/style/test/test_dynamic_change_causing_reflow.html 11:48:31 INFO - ++DOMWINDOW == 30 (0x7f627dc06000) [pid = 3347] [serial = 291] [outer = 0x7f6281591800] 11:48:31 INFO - MEMORY STAT | vsize 569MB | residentFast 116MB | heapAllocated 26MB 11:48:31 INFO - 941 INFO TEST-OK | layout/style/test/test_dynamic_change_causing_reflow.html | took 490ms 11:48:31 INFO - ++DOMWINDOW == 31 (0x7f6280468400) [pid = 3347] [serial = 292] [outer = 0x7f6281591800] 11:48:31 INFO - 942 INFO TEST-START | layout/style/test/test_exposed_prop_accessors.html 11:48:32 INFO - ++DOMWINDOW == 32 (0x7f6280468c00) [pid = 3347] [serial = 293] [outer = 0x7f6281591800] 11:48:34 INFO - MEMORY STAT | vsize 570MB | residentFast 122MB | heapAllocated 33MB 11:48:34 INFO - 943 INFO TEST-OK | layout/style/test/test_exposed_prop_accessors.html | took 2460ms 11:48:34 INFO - ++DOMWINDOW == 33 (0x7f627dd5f000) [pid = 3347] [serial = 294] [outer = 0x7f6281591800] 11:48:34 INFO - 944 INFO TEST-START | layout/style/test/test_extra_inherit_initial.html 11:48:35 INFO - ++DOMWINDOW == 34 (0x7f627dc02400) [pid = 3347] [serial = 295] [outer = 0x7f6281591800] 11:48:35 INFO - --DOMWINDOW == 33 (0x7f627dd2f800) [pid = 3347] [serial = 238] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_eof_handling.html] 11:48:35 INFO - --DOMWINDOW == 32 (0x7f627dfac800) [pid = 3347] [serial = 271] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_escape_api.html] 11:49:09 INFO - MEMORY STAT | vsize 617MB | residentFast 190MB | heapAllocated 95MB 11:49:09 INFO - 945 INFO TEST-OK | layout/style/test/test_extra_inherit_initial.html | took 34644ms 11:49:10 INFO - ++DOMWINDOW == 33 (0x7f6279d97800) [pid = 3347] [serial = 296] [outer = 0x7f6281591800] 11:49:10 INFO - 946 INFO TEST-START | layout/style/test/test_flexbox_child_display_values.xhtml 11:49:10 INFO - ++DOMWINDOW == 34 (0x7f6279d99400) [pid = 3347] [serial = 297] [outer = 0x7f6281591800] 11:49:11 INFO - MEMORY STAT | vsize 618MB | residentFast 125MB | heapAllocated 29MB 11:49:11 INFO - 947 INFO TEST-OK | layout/style/test/test_flexbox_child_display_values.xhtml | took 629ms 11:49:11 INFO - ++DOMWINDOW == 35 (0x7f627e1a3000) [pid = 3347] [serial = 298] [outer = 0x7f6281591800] 11:49:11 INFO - 948 INFO TEST-START | layout/style/test/test_flexbox_flex_grow_and_shrink.html 11:49:11 INFO - ++DOMWINDOW == 36 (0x7f627e1a3400) [pid = 3347] [serial = 299] [outer = 0x7f6281591800] 11:49:11 INFO - MEMORY STAT | vsize 618MB | residentFast 127MB | heapAllocated 31MB 11:49:11 INFO - --DOMWINDOW == 35 (0x7f6280468400) [pid = 3347] [serial = 292] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 34 (0x7f627f910800) [pid = 3347] [serial = 288] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 33 (0x7f62800d3400) [pid = 3347] [serial = 286] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 32 (0x7f627f913800) [pid = 3347] [serial = 284] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 31 (0x7f627e1ad800) [pid = 3347] [serial = 282] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 30 (0x7f627dd5b000) [pid = 3347] [serial = 280] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 29 (0x7f627e1ac400) [pid = 3347] [serial = 279] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_supports_variables.html] 11:49:11 INFO - --DOMWINDOW == 28 (0x7f627e1ab000) [pid = 3347] [serial = 278] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 27 (0x7f627dd5a400) [pid = 3347] [serial = 277] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_supports.html] 11:49:11 INFO - --DOMWINDOW == 26 (0x7f627dd62400) [pid = 3347] [serial = 276] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 25 (0x7f6280468c00) [pid = 3347] [serial = 293] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_exposed_prop_accessors.html] 11:49:11 INFO - --DOMWINDOW == 24 (0x7f627dd5f000) [pid = 3347] [serial = 294] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 23 (0x7f627e0d4c00) [pid = 3347] [serial = 232] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_cross_domain.html] 11:49:11 INFO - --DOMWINDOW == 22 (0x7f627e0d6c00) [pid = 3347] [serial = 235] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/ccd-quirks.html] 11:49:11 INFO - --DOMWINDOW == 21 (0x7f627dfb4400) [pid = 3347] [serial = 236] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/ccd-standards.html] 11:49:11 INFO - --DOMWINDOW == 20 (0x7f627dd2f400) [pid = 3347] [serial = 272] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 19 (0x7f627dc02c00) [pid = 3347] [serial = 273] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_function_mismatched_parenthesis.html] 11:49:11 INFO - --DOMWINDOW == 18 (0x7f627e0d9000) [pid = 3347] [serial = 274] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 17 (0x7f6280465000) [pid = 3347] [serial = 290] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:11 INFO - --DOMWINDOW == 16 (0x7f627e0da800) [pid = 3347] [serial = 289] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_dont_use_document_colors.html] 11:49:11 INFO - --DOMWINDOW == 15 (0x7f627e0dcc00) [pid = 3347] [serial = 233] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/ccd-quirks.html] 11:49:11 INFO - --DOMWINDOW == 14 (0x7f627e0ddc00) [pid = 3347] [serial = 234] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/ccd-standards.html] 11:49:11 INFO - 949 INFO TEST-OK | layout/style/test/test_flexbox_flex_grow_and_shrink.html | took 702ms 11:49:11 INFO - --DOMWINDOW == 13 (0x7f627e39a800) [pid = 3347] [serial = 283] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_default_computed_style.html] 11:49:11 INFO - --DOMWINDOW == 12 (0x7f627e1acc00) [pid = 3347] [serial = 281] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_default_bidi_css.html] 11:49:11 INFO - --DOMWINDOW == 11 (0x7f627dc0b400) [pid = 3347] [serial = 275] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_css_loader_crossorigin_data_url.html] 11:49:11 INFO - --DOMWINDOW == 10 (0x7f627dc06000) [pid = 3347] [serial = 291] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_dynamic_change_causing_reflow.html] 11:49:11 INFO - ++DOMWINDOW == 11 (0x7f627dd5f000) [pid = 3347] [serial = 300] [outer = 0x7f6281591800] 11:49:12 INFO - 950 INFO TEST-START | layout/style/test/test_flexbox_flex_shorthand.html 11:49:12 INFO - ++DOMWINDOW == 12 (0x7f627dd62400) [pid = 3347] [serial = 301] [outer = 0x7f6281591800] 11:49:12 INFO - MEMORY STAT | vsize 618MB | residentFast 130MB | heapAllocated 32MB 11:49:12 INFO - 951 INFO TEST-OK | layout/style/test/test_flexbox_flex_shorthand.html | took 619ms 11:49:12 INFO - ++DOMWINDOW == 13 (0x7f627e1a6800) [pid = 3347] [serial = 302] [outer = 0x7f6281591800] 11:49:12 INFO - 952 INFO TEST-START | layout/style/test/test_flexbox_layout.html 11:49:12 INFO - ++DOMWINDOW == 14 (0x7f627e0ddc00) [pid = 3347] [serial = 303] [outer = 0x7f6281591800] 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:13 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:13 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=540000000,0! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:14 INFO - nsBlockReflowContext: FlexContainer(div)(1)@7f627bbfe2b8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(1)@7f627bbfd9d8 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(div)(3)@7f627bbfd7e0 metrics=29040,540000000! 11:49:14 INFO - nsBlockReflowContext: Block(body)(3)@7f627b8fcd18 metrics=29040,540001140! 11:49:16 INFO - MEMORY STAT | vsize 619MB | residentFast 135MB | heapAllocated 37MB 11:49:16 INFO - 953 INFO TEST-OK | layout/style/test/test_flexbox_layout.html | took 3439ms 11:49:16 INFO - ++DOMWINDOW == 15 (0x7f6279d9c000) [pid = 3347] [serial = 304] [outer = 0x7f6281591800] 11:49:16 INFO - 954 INFO TEST-START | layout/style/test/test_flexbox_min_size_auto.html 11:49:16 INFO - ++DOMWINDOW == 16 (0x7f6279da3400) [pid = 3347] [serial = 305] [outer = 0x7f6281591800] 11:49:16 INFO - MEMORY STAT | vsize 619MB | residentFast 136MB | heapAllocated 38MB 11:49:16 INFO - 955 INFO TEST-OK | layout/style/test/test_flexbox_min_size_auto.html | took 477ms 11:49:16 INFO - ++DOMWINDOW == 17 (0x7f627e3a1000) [pid = 3347] [serial = 306] [outer = 0x7f6281591800] 11:49:17 INFO - 956 INFO TEST-START | layout/style/test/test_flexbox_order.html 11:49:17 INFO - ++DOMWINDOW == 18 (0x7f627f588000) [pid = 3347] [serial = 307] [outer = 0x7f6281591800] 11:49:17 INFO - MEMORY STAT | vsize 620MB | residentFast 136MB | heapAllocated 39MB 11:49:18 INFO - 957 INFO TEST-OK | layout/style/test/test_flexbox_order.html | took 976ms 11:49:18 INFO - ++DOMWINDOW == 19 (0x7f627ac6cc00) [pid = 3347] [serial = 308] [outer = 0x7f6281591800] 11:49:18 INFO - 958 INFO TEST-START | layout/style/test/test_flexbox_order_table.html 11:49:18 INFO - ++DOMWINDOW == 20 (0x7f6279d99800) [pid = 3347] [serial = 309] [outer = 0x7f6281591800] 11:49:18 INFO - MEMORY STAT | vsize 620MB | residentFast 128MB | heapAllocated 28MB 11:49:18 INFO - 959 INFO TEST-OK | layout/style/test/test_flexbox_order_table.html | took 665ms 11:49:18 INFO - ++DOMWINDOW == 21 (0x7f627a8ab400) [pid = 3347] [serial = 310] [outer = 0x7f6281591800] 11:49:18 INFO - 960 INFO TEST-START | layout/style/test/test_flexbox_reflow_counts.html 11:49:19 INFO - ++DOMWINDOW == 22 (0x7f627a8ab800) [pid = 3347] [serial = 311] [outer = 0x7f6281591800] 11:49:19 INFO - MEMORY STAT | vsize 620MB | residentFast 129MB | heapAllocated 29MB 11:49:19 INFO - 961 INFO TEST-OK | layout/style/test/test_flexbox_reflow_counts.html | took 370ms 11:49:19 INFO - ++DOMWINDOW == 23 (0x7f627a8af000) [pid = 3347] [serial = 312] [outer = 0x7f6281591800] 11:49:19 INFO - 962 INFO TEST-START | layout/style/test/test_font_face_parser.html 11:49:19 INFO - ++DOMWINDOW == 24 (0x7f6279d96800) [pid = 3347] [serial = 313] [outer = 0x7f6281591800] 11:49:20 INFO - MEMORY STAT | vsize 620MB | residentFast 130MB | heapAllocated 31MB 11:49:20 INFO - 963 INFO TEST-OK | layout/style/test/test_font_face_parser.html | took 1053ms 11:49:20 INFO - ++DOMWINDOW == 25 (0x7f627ac63c00) [pid = 3347] [serial = 314] [outer = 0x7f6281591800] 11:49:20 INFO - 964 INFO TEST-START | layout/style/test/test_font_family_parsing.html 11:49:20 INFO - ++DOMWINDOW == 26 (0x7f627dd33000) [pid = 3347] [serial = 315] [outer = 0x7f6281591800] 11:49:26 INFO - --DOMWINDOW == 25 (0x7f627e1a6800) [pid = 3347] [serial = 302] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:26 INFO - --DOMWINDOW == 24 (0x7f627dd5f000) [pid = 3347] [serial = 300] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:26 INFO - --DOMWINDOW == 23 (0x7f627e1a3000) [pid = 3347] [serial = 298] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:26 INFO - --DOMWINDOW == 22 (0x7f6279d97800) [pid = 3347] [serial = 296] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:26 INFO - --DOMWINDOW == 21 (0x7f627dd62400) [pid = 3347] [serial = 301] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_flex_shorthand.html] 11:49:26 INFO - --DOMWINDOW == 20 (0x7f627e1a3400) [pid = 3347] [serial = 299] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_flex_grow_and_shrink.html] 11:49:26 INFO - --DOMWINDOW == 19 (0x7f6279d99400) [pid = 3347] [serial = 297] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_child_display_values.xhtml] 11:49:27 INFO - MEMORY STAT | vsize 626MB | residentFast 146MB | heapAllocated 42MB 11:49:27 INFO - 965 INFO TEST-OK | layout/style/test/test_font_family_parsing.html | took 7356ms 11:49:28 INFO - ++DOMWINDOW == 20 (0x7f6279d9d800) [pid = 3347] [serial = 316] [outer = 0x7f6281591800] 11:49:28 INFO - 966 INFO TEST-START | layout/style/test/test_font_feature_values_parsing.html 11:49:28 INFO - ++DOMWINDOW == 21 (0x7f6279d9e400) [pid = 3347] [serial = 317] [outer = 0x7f6281591800] 11:49:29 INFO - MEMORY STAT | vsize 627MB | residentFast 148MB | heapAllocated 43MB 11:49:29 INFO - 967 INFO TEST-OK | layout/style/test/test_font_feature_values_parsing.html | took 1483ms 11:49:29 INFO - ++DOMWINDOW == 22 (0x7f627dc0c000) [pid = 3347] [serial = 318] [outer = 0x7f6281591800] 11:49:29 INFO - 968 INFO TEST-START | layout/style/test/test_font_loading_api.html 11:49:30 INFO - ++DOMWINDOW == 23 (0x7f627dc03800) [pid = 3347] [serial = 319] [outer = 0x7f6281591800] 11:49:30 INFO - ++DOCSHELL 0x7f628233c000 == 3 [pid = 3347] [id = 21] 11:49:30 INFO - ++DOMWINDOW == 24 (0x7f62803f9800) [pid = 3347] [serial = 320] [outer = (nil)] 11:49:30 INFO - ++DOCSHELL 0x7f628233d800 == 4 [pid = 3347] [id = 22] 11:49:30 INFO - ++DOMWINDOW == 25 (0x7f62803fb000) [pid = 3347] [serial = 321] [outer = (nil)] 11:49:30 INFO - JavaScript warning: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 409: unreachable code after return statement 11:49:30 INFO - ++DOMWINDOW == 26 (0x7f62803fbc00) [pid = 3347] [serial = 322] [outer = 0x7f62803fb000] 11:49:30 INFO - ++DOMWINDOW == 27 (0x7f62805cb000) [pid = 3347] [serial = 323] [outer = 0x7f62803f9800] 11:49:43 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 256: SyntaxError: An invalid or illegal string was specified 11:49:43 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 256: SyntaxError: An invalid or illegal string was specified 11:49:43 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:43 INFO - --DOMWINDOW == 26 (0x7f627e3a1000) [pid = 3347] [serial = 306] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 25 (0x7f627dc02400) [pid = 3347] [serial = 295] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_extra_inherit_initial.html] 11:49:43 INFO - --DOMWINDOW == 24 (0x7f6279d9c000) [pid = 3347] [serial = 304] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 23 (0x7f627ac63c00) [pid = 3347] [serial = 314] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 22 (0x7f627a8af000) [pid = 3347] [serial = 312] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 21 (0x7f627a8ab400) [pid = 3347] [serial = 310] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 20 (0x7f627ac6cc00) [pid = 3347] [serial = 308] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 19 (0x7f627dc0c000) [pid = 3347] [serial = 318] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 18 (0x7f6279d9d800) [pid = 3347] [serial = 316] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:49:43 INFO - --DOMWINDOW == 17 (0x7f627f588000) [pid = 3347] [serial = 307] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_order.html] 11:49:43 INFO - --DOMWINDOW == 16 (0x7f6279da3400) [pid = 3347] [serial = 305] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_min_size_auto.html] 11:49:43 INFO - --DOMWINDOW == 15 (0x7f627e0ddc00) [pid = 3347] [serial = 303] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_layout.html] 11:49:43 INFO - --DOMWINDOW == 14 (0x7f627a8ab800) [pid = 3347] [serial = 311] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_reflow_counts.html] 11:49:43 INFO - --DOMWINDOW == 13 (0x7f6279d99800) [pid = 3347] [serial = 309] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_flexbox_order_table.html] 11:49:43 INFO - --DOMWINDOW == 12 (0x7f627dd33000) [pid = 3347] [serial = 315] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_font_family_parsing.html] 11:49:48 INFO - --DOMWINDOW == 11 (0x7f627fd16000) [pid = 3347] [serial = 287] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_descriptor_syntax_errors.html] 11:49:48 INFO - --DOMWINDOW == 10 (0x7f627f909400) [pid = 3347] [serial = 285] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_descriptor_storage.html] 11:49:48 INFO - --DOMWINDOW == 9 (0x7f6279d96800) [pid = 3347] [serial = 313] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_font_face_parser.html] 11:49:48 INFO - --DOMWINDOW == 8 (0x7f6279d9e400) [pid = 3347] [serial = 317] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_font_feature_values_parsing.html] 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1517: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:51 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:49:56 INFO - MEMORY STAT | vsize 688MB | residentFast 242MB | heapAllocated 156MB 11:49:56 INFO - 969 INFO TEST-OK | layout/style/test/test_font_loading_api.html | took 26487ms 11:49:56 INFO - ++DOMWINDOW == 9 (0x7f627f639c00) [pid = 3347] [serial = 324] [outer = 0x7f6281591800] 11:49:56 INFO - 970 INFO TEST-START | layout/style/test/test_garbage_at_end_of_declarations.html 11:49:56 INFO - ++DOMWINDOW == 10 (0x7f62767d5c00) [pid = 3347] [serial = 325] [outer = 0x7f6281591800] 11:49:58 INFO - --DOCSHELL 0x7f628233c000 == 3 [pid = 3347] [id = 21] 11:49:58 INFO - --DOCSHELL 0x7f628233d800 == 2 [pid = 3347] [id = 22] 11:50:01 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:50:01 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:50:01 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:50:01 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:50:01 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html, line 1678: SyntaxError: An invalid or illegal string was specified 11:50:08 INFO - JavaScript error: , line 0: SyntaxError: An invalid or illegal string was specified 11:50:08 INFO - --DOMWINDOW == 9 (0x7f627f639c00) [pid = 3347] [serial = 324] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:50:15 INFO - MEMORY STAT | vsize 689MB | residentFast 120MB | heapAllocated 25MB 11:50:15 INFO - 971 INFO TEST-OK | layout/style/test/test_garbage_at_end_of_declarations.html | took 18811ms 11:50:15 INFO - ++DOMWINDOW == 10 (0x7f627b04d000) [pid = 3347] [serial = 326] [outer = 0x7f6281591800] 11:50:15 INFO - 972 INFO TEST-START | layout/style/test/test_grid_computed_values.html 11:50:16 INFO - ++DOMWINDOW == 11 (0x7f627b04d800) [pid = 3347] [serial = 327] [outer = 0x7f6281591800] 11:50:16 INFO - MEMORY STAT | vsize 691MB | residentFast 122MB | heapAllocated 27MB 11:50:16 INFO - 973 INFO TEST-OK | layout/style/test/test_grid_computed_values.html | took 407ms 11:50:16 INFO - ++DOMWINDOW == 12 (0x7f627b059c00) [pid = 3347] [serial = 328] [outer = 0x7f6281591800] 11:50:16 INFO - 974 INFO TEST-START | layout/style/test/test_grid_container_shorthands.html 11:50:16 INFO - ++DOMWINDOW == 13 (0x7f627b059400) [pid = 3347] [serial = 329] [outer = 0x7f6281591800] 11:50:17 INFO - MEMORY STAT | vsize 691MB | residentFast 124MB | heapAllocated 29MB 11:50:17 INFO - 975 INFO TEST-OK | layout/style/test/test_grid_container_shorthands.html | took 774ms 11:50:17 INFO - ++DOMWINDOW == 14 (0x7f627b051400) [pid = 3347] [serial = 330] [outer = 0x7f6281591800] 11:50:17 INFO - 976 INFO TEST-START | layout/style/test/test_grid_item_shorthands.html 11:50:17 INFO - ++DOMWINDOW == 15 (0x7f627c077400) [pid = 3347] [serial = 331] [outer = 0x7f6281591800] 11:50:17 INFO - MEMORY STAT | vsize 691MB | residentFast 124MB | heapAllocated 29MB 11:50:17 INFO - 977 INFO TEST-OK | layout/style/test/test_grid_item_shorthands.html | took 414ms 11:50:17 INFO - ++DOMWINDOW == 16 (0x7f627c083400) [pid = 3347] [serial = 332] [outer = 0x7f6281591800] 11:50:17 INFO - 978 INFO TEST-START | layout/style/test/test_grid_shorthand_serialization.html 11:50:18 INFO - ++DOMWINDOW == 17 (0x7f627c076800) [pid = 3347] [serial = 333] [outer = 0x7f6281591800] 11:50:18 INFO - MEMORY STAT | vsize 692MB | residentFast 125MB | heapAllocated 30MB 11:50:18 INFO - 979 INFO TEST-OK | layout/style/test/test_grid_shorthand_serialization.html | took 501ms 11:50:18 INFO - ++DOMWINDOW == 18 (0x7f627dc07000) [pid = 3347] [serial = 334] [outer = 0x7f6281591800] 11:50:18 INFO - 980 INFO TEST-START | layout/style/test/test_group_insertRule.html 11:50:18 INFO - ++DOMWINDOW == 19 (0x7f627826a000) [pid = 3347] [serial = 335] [outer = 0x7f6281591800] 11:50:19 INFO - MEMORY STAT | vsize 692MB | residentFast 128MB | heapAllocated 31MB 11:50:19 INFO - JavaScript error: http://mochi.test:8888/tests/layout/style/test/test_group_insertRule.html, line 1: ReferenceError: run is not defined 11:50:19 INFO - 981 INFO TEST-OK | layout/style/test/test_group_insertRule.html | took 702ms 11:50:19 INFO - ++DOMWINDOW == 20 (0x7f627c07d800) [pid = 3347] [serial = 336] [outer = 0x7f6281591800] 11:50:19 INFO - 982 INFO TEST-START | layout/style/test/test_hover_quirk.html 11:50:19 INFO - ++DOMWINDOW == 21 (0x7f627c07dc00) [pid = 3347] [serial = 337] [outer = 0x7f6281591800] 11:50:19 INFO - MEMORY STAT | vsize 692MB | residentFast 129MB | heapAllocated 32MB 11:50:19 INFO - 983 INFO TEST-OK | layout/style/test/test_hover_quirk.html | took 534ms 11:50:20 INFO - ++DOMWINDOW == 22 (0x7f627c73bc00) [pid = 3347] [serial = 338] [outer = 0x7f6281591800] 11:50:20 INFO - 984 INFO TEST-START | layout/style/test/test_html_attribute_computed_values.html 11:50:20 INFO - ++DOMWINDOW == 23 (0x7f627a8b4800) [pid = 3347] [serial = 339] [outer = 0x7f6281591800] 11:50:20 INFO - MEMORY STAT | vsize 691MB | residentFast 122MB | heapAllocated 25MB 11:50:20 INFO - 985 INFO TEST-OK | layout/style/test/test_html_attribute_computed_values.html | took 550ms 11:50:20 INFO - ++DOMWINDOW == 24 (0x7f627556e800) [pid = 3347] [serial = 340] [outer = 0x7f6281591800] 11:50:20 INFO - 986 INFO TEST-START | layout/style/test/test_ident_escaping.html 11:50:21 INFO - ++DOMWINDOW == 25 (0x7f627556ec00) [pid = 3347] [serial = 341] [outer = 0x7f6281591800] 11:50:21 INFO - MEMORY STAT | vsize 691MB | residentFast 123MB | heapAllocated 26MB 11:50:21 INFO - 987 INFO TEST-OK | layout/style/test/test_ident_escaping.html | took 271ms 11:50:21 INFO - ++DOMWINDOW == 26 (0x7f6275609400) [pid = 3347] [serial = 342] [outer = 0x7f6281591800] 11:50:21 INFO - 988 INFO TEST-START | layout/style/test/test_inherit_computation.html 11:50:21 INFO - ++DOMWINDOW == 27 (0x7f627556dc00) [pid = 3347] [serial = 343] [outer = 0x7f6281591800] 11:50:26 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:50:26 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:50:26 INFO - MEMORY STAT | vsize 692MB | residentFast 136MB | heapAllocated 42MB 11:50:27 INFO - 989 INFO TEST-OK | layout/style/test/test_inherit_computation.html | took 5757ms 11:50:27 INFO - ++DOMWINDOW == 28 (0x7f6276e04000) [pid = 3347] [serial = 344] [outer = 0x7f6281591800] 11:50:27 INFO - 990 INFO TEST-START | layout/style/test/test_inherit_storage.html 11:50:27 INFO - ++DOMWINDOW == 29 (0x7f627560b400) [pid = 3347] [serial = 345] [outer = 0x7f6281591800] 11:50:33 INFO - MEMORY STAT | vsize 694MB | residentFast 148MB | heapAllocated 51MB 11:50:33 INFO - 991 INFO TEST-OK | layout/style/test/test_inherit_storage.html | took 6539ms 11:50:33 INFO - --DOMWINDOW == 28 (0x7f627b051400) [pid = 3347] [serial = 330] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:50:33 INFO - --DOMWINDOW == 27 (0x7f627b059c00) [pid = 3347] [serial = 328] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:50:33 INFO - --DOMWINDOW == 26 (0x7f627b04d000) [pid = 3347] [serial = 326] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:50:33 INFO - --DOMWINDOW == 25 (0x7f627c083400) [pid = 3347] [serial = 332] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:50:33 INFO - --DOMWINDOW == 24 (0x7f627c077400) [pid = 3347] [serial = 331] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_grid_item_shorthands.html] 11:50:33 INFO - --DOMWINDOW == 23 (0x7f627b059400) [pid = 3347] [serial = 329] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_grid_container_shorthands.html] 11:50:33 INFO - --DOMWINDOW == 22 (0x7f627b04d800) [pid = 3347] [serial = 327] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_grid_computed_values.html] 11:50:34 INFO - ++DOMWINDOW == 23 (0x7f6276e07400) [pid = 3347] [serial = 346] [outer = 0x7f6281591800] 11:50:34 INFO - 992 INFO TEST-START | layout/style/test/test_initial_computation.html 11:50:34 INFO - ++DOMWINDOW == 24 (0x7f6276e07000) [pid = 3347] [serial = 347] [outer = 0x7f6281591800] 11:50:34 INFO - ++DOCSHELL 0x7f627550c800 == 3 [pid = 3347] [id = 23] 11:50:34 INFO - ++DOMWINDOW == 25 (0x7f627b059400) [pid = 3347] [serial = 348] [outer = (nil)] 11:50:34 INFO - ++DOCSHELL 0x7f6275518000 == 4 [pid = 3347] [id = 24] 11:50:34 INFO - ++DOMWINDOW == 26 (0x7f627e572800) [pid = 3347] [serial = 349] [outer = (nil)] 11:50:34 INFO - ++DOMWINDOW == 27 (0x7f6276e05400) [pid = 3347] [serial = 350] [outer = 0x7f627b059400] 11:50:34 INFO - ++DOMWINDOW == 28 (0x7f627e573c00) [pid = 3347] [serial = 351] [outer = 0x7f627e572800] 11:50:36 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 199 11:50:36 INFO - [Child 3347] WARNING: NS_ENSURE_TRUE(startupCache) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLDocumentInfo.cpp, line 267 11:50:42 INFO - MEMORY STAT | vsize 694MB | residentFast 165MB | heapAllocated 66MB 11:50:42 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:50:42 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:50:42 INFO - 993 INFO TEST-OK | layout/style/test/test_initial_computation.html | took 8662ms 11:50:42 INFO - ++DOMWINDOW == 29 (0x7f627556b400) [pid = 3347] [serial = 352] [outer = 0x7f6281591800] 11:50:42 INFO - 994 INFO TEST-START | layout/style/test/test_initial_storage.html 11:50:43 INFO - ++DOMWINDOW == 30 (0x7f6275599c00) [pid = 3347] [serial = 353] [outer = 0x7f6281591800] 11:50:53 INFO - MEMORY STAT | vsize 697MB | residentFast 188MB | heapAllocated 81MB 11:50:53 INFO - 995 INFO TEST-OK | layout/style/test/test_initial_storage.html | took 10311ms 11:50:53 INFO - ++DOMWINDOW == 31 (0x7f6275607800) [pid = 3347] [serial = 354] [outer = 0x7f6281591800] 11:50:53 INFO - 996 INFO TEST-START | layout/style/test/test_keyframes_rules.html 11:50:53 INFO - ++DOMWINDOW == 32 (0x7f627fc80800) [pid = 3347] [serial = 355] [outer = 0x7f6281591800] 11:50:54 INFO - MEMORY STAT | vsize 698MB | residentFast 191MB | heapAllocated 82MB 11:50:54 INFO - 997 INFO TEST-OK | layout/style/test/test_keyframes_rules.html | took 434ms 11:50:54 INFO - ++DOMWINDOW == 33 (0x7f62767dfc00) [pid = 3347] [serial = 356] [outer = 0x7f6281591800] 11:50:54 INFO - 998 INFO TEST-START | layout/style/test/test_load_events_on_stylesheets.html 11:50:54 INFO - ++DOMWINDOW == 34 (0x7f627fc81c00) [pid = 3347] [serial = 357] [outer = 0x7f6281591800] 11:50:55 INFO - --DOCSHELL 0x7f627550c800 == 3 [pid = 3347] [id = 23] 11:50:55 INFO - --DOCSHELL 0x7f6275518000 == 2 [pid = 3347] [id = 24] 11:50:55 INFO - MEMORY STAT | vsize 690MB | residentFast 128MB | heapAllocated 24MB 11:50:55 INFO - --DOMWINDOW == 33 (0x7f627dc03800) [pid = 3347] [serial = 319] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_font_loading_api.html] 11:50:55 INFO - 999 INFO TEST-OK | layout/style/test/test_load_events_on_stylesheets.html | took 1152ms 11:50:55 INFO - ++DOMWINDOW == 34 (0x7f62754cd800) [pid = 3347] [serial = 358] [outer = 0x7f6281591800] 11:50:55 INFO - 1000 INFO TEST-START | layout/style/test/test_logical_properties.html 11:50:55 INFO - ++DOMWINDOW == 35 (0x7f62754cdc00) [pid = 3347] [serial = 359] [outer = 0x7f6281591800] 11:51:02 INFO - MEMORY STAT | vsize 690MB | residentFast 138MB | heapAllocated 47MB 11:51:02 INFO - 1001 INFO TEST-OK | layout/style/test/test_logical_properties.html | took 7304ms 11:51:03 INFO - ++DOMWINDOW == 36 (0x7f62754ce000) [pid = 3347] [serial = 360] [outer = 0x7f6281591800] 11:51:03 INFO - 1002 INFO TEST-START | layout/style/test/test_media_queries.html 11:51:03 INFO - ++DOMWINDOW == 37 (0x7f6275560c00) [pid = 3347] [serial = 361] [outer = 0x7f6281591800] 11:51:03 INFO - ++DOCSHELL 0x7f6278ddb000 == 3 [pid = 3347] [id = 25] 11:51:03 INFO - ++DOMWINDOW == 38 (0x7f627559f400) [pid = 3347] [serial = 362] [outer = (nil)] 11:51:03 INFO - ++DOMWINDOW == 39 (0x7f62755aa400) [pid = 3347] [serial = 363] [outer = 0x7f627559f400] 11:51:05 INFO - ++DOMWINDOW == 40 (0x7f62754d1800) [pid = 3347] [serial = 364] [outer = 0x7f627559f400] 11:51:05 INFO - ++DOMWINDOW == 41 (0x7f6275560400) [pid = 3347] [serial = 365] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 42 (0x7f62754d0400) [pid = 3347] [serial = 366] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 43 (0x7f6275562800) [pid = 3347] [serial = 367] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 44 (0x7f62754ca000) [pid = 3347] [serial = 368] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 45 (0x7f6275561000) [pid = 3347] [serial = 369] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 46 (0x7f62756ed000) [pid = 3347] [serial = 370] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 47 (0x7f627596cc00) [pid = 3347] [serial = 371] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 48 (0x7f6275cfe400) [pid = 3347] [serial = 372] [outer = 0x7f627559f400] 11:51:06 INFO - --DOMWINDOW == 47 (0x7f627dc07000) [pid = 3347] [serial = 334] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 46 (0x7f6275609400) [pid = 3347] [serial = 342] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 45 (0x7f627560b400) [pid = 3347] [serial = 345] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_inherit_storage.html] 11:51:06 INFO - --DOMWINDOW == 44 (0x7f627556e800) [pid = 3347] [serial = 340] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 43 (0x7f627556dc00) [pid = 3347] [serial = 343] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_inherit_computation.html] 11:51:06 INFO - --DOMWINDOW == 42 (0x7f627c73bc00) [pid = 3347] [serial = 338] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 41 (0x7f62767d5c00) [pid = 3347] [serial = 325] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_garbage_at_end_of_declarations.html] 11:51:06 INFO - --DOMWINDOW == 40 (0x7f6276e07400) [pid = 3347] [serial = 346] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 39 (0x7f627c07d800) [pid = 3347] [serial = 336] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 38 (0x7f6276e04000) [pid = 3347] [serial = 344] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 37 (0x7f627a8b4800) [pid = 3347] [serial = 339] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_html_attribute_computed_values.html] 11:51:06 INFO - --DOMWINDOW == 36 (0x7f62767dfc00) [pid = 3347] [serial = 356] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 35 (0x7f6275607800) [pid = 3347] [serial = 354] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 34 (0x7f627556b400) [pid = 3347] [serial = 352] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:06 INFO - --DOMWINDOW == 33 (0x7f6275599c00) [pid = 3347] [serial = 353] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_initial_storage.html] 11:51:06 INFO - --DOMWINDOW == 32 (0x7f62803fb000) [pid = 3347] [serial = 321] [outer = (nil)] [url = about:blank] 11:51:06 INFO - --DOMWINDOW == 31 (0x7f62803f9800) [pid = 3347] [serial = 320] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_font_loading_api_vframe.html] 11:51:06 INFO - --DOMWINDOW == 30 (0x7f627b059400) [pid = 3347] [serial = 348] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/unstyled.xml] 11:51:06 INFO - --DOMWINDOW == 29 (0x7f627e572800) [pid = 3347] [serial = 349] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/unstyled-frame.xml] 11:51:06 INFO - --DOMWINDOW == 28 (0x7f627c07dc00) [pid = 3347] [serial = 337] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_hover_quirk.html] 11:51:06 INFO - --DOMWINDOW == 27 (0x7f627c076800) [pid = 3347] [serial = 333] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_grid_shorthand_serialization.html] 11:51:06 INFO - ++DOMWINDOW == 28 (0x7f627556f000) [pid = 3347] [serial = 373] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 29 (0x7f6275607800) [pid = 3347] [serial = 374] [outer = 0x7f627559f400] 11:51:06 INFO - ++DOMWINDOW == 30 (0x7f627610e800) [pid = 3347] [serial = 375] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 31 (0x7f62763d5000) [pid = 3347] [serial = 376] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 32 (0x7f62763da800) [pid = 3347] [serial = 377] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 33 (0x7f62754ce800) [pid = 3347] [serial = 378] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 34 (0x7f627556b400) [pid = 3347] [serial = 379] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 35 (0x7f62767d9000) [pid = 3347] [serial = 380] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 36 (0x7f6276105c00) [pid = 3347] [serial = 381] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 37 (0x7f62765f0400) [pid = 3347] [serial = 382] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 38 (0x7f62767e1400) [pid = 3347] [serial = 383] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 39 (0x7f6276969400) [pid = 3347] [serial = 384] [outer = 0x7f627559f400] 11:51:07 INFO - ++DOMWINDOW == 40 (0x7f62767dfc00) [pid = 3347] [serial = 385] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 41 (0x7f627680bc00) [pid = 3347] [serial = 386] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 42 (0x7f6276811800) [pid = 3347] [serial = 387] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 43 (0x7f6276967800) [pid = 3347] [serial = 388] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 44 (0x7f6276dc7400) [pid = 3347] [serial = 389] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 45 (0x7f6276cdc000) [pid = 3347] [serial = 390] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 46 (0x7f6276e0bc00) [pid = 3347] [serial = 391] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 47 (0x7f627710e800) [pid = 3347] [serial = 392] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 48 (0x7f6276dc2800) [pid = 3347] [serial = 393] [outer = 0x7f627559f400] 11:51:08 INFO - ++DOMWINDOW == 49 (0x7f6276f02400) [pid = 3347] [serial = 394] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 50 (0x7f62772f1800) [pid = 3347] [serial = 395] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 51 (0x7f6276f4e400) [pid = 3347] [serial = 396] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 52 (0x7f62772e7c00) [pid = 3347] [serial = 397] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 53 (0x7f62772ecc00) [pid = 3347] [serial = 398] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 54 (0x7f6277617000) [pid = 3347] [serial = 399] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 55 (0x7f62779f1400) [pid = 3347] [serial = 400] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 56 (0x7f62776df000) [pid = 3347] [serial = 401] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 57 (0x7f62754d1000) [pid = 3347] [serial = 402] [outer = 0x7f627559f400] 11:51:09 INFO - ++DOMWINDOW == 58 (0x7f62754d3c00) [pid = 3347] [serial = 403] [outer = 0x7f627559f400] 11:51:10 INFO - ++DOMWINDOW == 59 (0x7f6275567400) [pid = 3347] [serial = 404] [outer = 0x7f627559f400] 11:51:10 INFO - ++DOMWINDOW == 60 (0x7f62755b0400) [pid = 3347] [serial = 405] [outer = 0x7f627559f400] 11:51:10 INFO - ++DOMWINDOW == 61 (0x7f6275975c00) [pid = 3347] [serial = 406] [outer = 0x7f627559f400] 11:51:10 INFO - ++DOMWINDOW == 62 (0x7f6275599800) [pid = 3347] [serial = 407] [outer = 0x7f627559f400] 11:51:10 INFO - ++DOMWINDOW == 63 (0x7f62754d4c00) [pid = 3347] [serial = 408] [outer = 0x7f627559f400] 11:51:11 INFO - --DOMWINDOW == 62 (0x7f62803fbc00) [pid = 3347] [serial = 322] [outer = (nil)] [url = about:blank] 11:51:11 INFO - --DOMWINDOW == 61 (0x7f62805cb000) [pid = 3347] [serial = 323] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_font_loading_api_vframe.html] 11:51:11 INFO - --DOMWINDOW == 60 (0x7f627826a000) [pid = 3347] [serial = 335] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_group_insertRule.html] 11:51:11 INFO - --DOMWINDOW == 59 (0x7f627556ec00) [pid = 3347] [serial = 341] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_ident_escaping.html] 11:51:11 INFO - --DOMWINDOW == 58 (0x7f627fc80800) [pid = 3347] [serial = 355] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_keyframes_rules.html] 11:51:11 INFO - --DOMWINDOW == 57 (0x7f6276e05400) [pid = 3347] [serial = 350] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/unstyled.xml] 11:51:11 INFO - --DOMWINDOW == 56 (0x7f6276e07000) [pid = 3347] [serial = 347] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_initial_computation.html] 11:51:11 INFO - --DOMWINDOW == 55 (0x7f627e573c00) [pid = 3347] [serial = 351] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/unstyled-frame.xml] 11:51:11 INFO - ++DOMWINDOW == 56 (0x7f62754cc400) [pid = 3347] [serial = 409] [outer = 0x7f627559f400] 11:51:11 INFO - ++DOMWINDOW == 57 (0x7f62754ce400) [pid = 3347] [serial = 410] [outer = 0x7f627559f400] 11:51:11 INFO - ++DOMWINDOW == 58 (0x7f62754cf400) [pid = 3347] [serial = 411] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 59 (0x7f6275568c00) [pid = 3347] [serial = 412] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 60 (0x7f6275564000) [pid = 3347] [serial = 413] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 61 (0x7f627556bc00) [pid = 3347] [serial = 414] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 62 (0x7f6275567c00) [pid = 3347] [serial = 415] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 63 (0x7f627556e400) [pid = 3347] [serial = 416] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 64 (0x7f627559c800) [pid = 3347] [serial = 417] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 65 (0x7f627556ec00) [pid = 3347] [serial = 418] [outer = 0x7f627559f400] 11:51:12 INFO - ++DOMWINDOW == 66 (0x7f627559a800) [pid = 3347] [serial = 419] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 67 (0x7f627559fc00) [pid = 3347] [serial = 420] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 68 (0x7f62755a6800) [pid = 3347] [serial = 421] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 69 (0x7f62755af800) [pid = 3347] [serial = 422] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 70 (0x7f62755a0000) [pid = 3347] [serial = 423] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 71 (0x7f62755a1800) [pid = 3347] [serial = 424] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 72 (0x7f62754c8400) [pid = 3347] [serial = 425] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 73 (0x7f6275561400) [pid = 3347] [serial = 426] [outer = 0x7f627559f400] 11:51:13 INFO - ++DOMWINDOW == 74 (0x7f6275569400) [pid = 3347] [serial = 427] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 75 (0x7f627556e800) [pid = 3347] [serial = 428] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 76 (0x7f62755b2000) [pid = 3347] [serial = 429] [outer = 0x7f627559f400] 11:51:14 INFO - --DOMWINDOW == 75 (0x7f62754cd800) [pid = 3347] [serial = 358] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:14 INFO - --DOMWINDOW == 74 (0x7f62754ce000) [pid = 3347] [serial = 360] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:51:14 INFO - --DOMWINDOW == 73 (0x7f62754d1800) [pid = 3347] [serial = 364] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 72 (0x7f6275560400) [pid = 3347] [serial = 365] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 71 (0x7f62754d0400) [pid = 3347] [serial = 366] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 70 (0x7f6275562800) [pid = 3347] [serial = 367] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 69 (0x7f62754ca000) [pid = 3347] [serial = 368] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 68 (0x7f6275561000) [pid = 3347] [serial = 369] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 67 (0x7f62756ed000) [pid = 3347] [serial = 370] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 66 (0x7f627596cc00) [pid = 3347] [serial = 371] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 65 (0x7f6275cfe400) [pid = 3347] [serial = 372] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 64 (0x7f627556f000) [pid = 3347] [serial = 373] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 63 (0x7f6275607800) [pid = 3347] [serial = 374] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520unknowntype%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 62 (0x7f627610e800) [pid = 3347] [serial = 375] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 61 (0x7f62763d5000) [pid = 3347] [serial = 376] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 60 (0x7f62763da800) [pid = 3347] [serial = 377] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520unknowntype%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 59 (0x7f62754ce800) [pid = 3347] [serial = 378] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 58 (0x7f627556b400) [pid = 3347] [serial = 379] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 57 (0x7f62767d9000) [pid = 3347] [serial = 380] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 56 (0x7f6276105c00) [pid = 3347] [serial = 381] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 55 (0x7f62765f0400) [pid = 3347] [serial = 382] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 54 (0x7f62767e1400) [pid = 3347] [serial = 383] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 53 (0x7f6276969400) [pid = 3347] [serial = 384] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 52 (0x7f62767dfc00) [pid = 3347] [serial = 385] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 51 (0x7f627680bc00) [pid = 3347] [serial = 386] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 50 (0x7f6276811800) [pid = 3347] [serial = 387] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 49 (0x7f6276967800) [pid = 3347] [serial = 388] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 48 (0x7f6276dc7400) [pid = 3347] [serial = 389] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 47 (0x7f6276cdc000) [pid = 3347] [serial = 390] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 46 (0x7f6276e0bc00) [pid = 3347] [serial = 391] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 45 (0x7f627710e800) [pid = 3347] [serial = 392] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 44 (0x7f6276dc2800) [pid = 3347] [serial = 393] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 43 (0x7f6276f02400) [pid = 3347] [serial = 394] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 42 (0x7f62772f1800) [pid = 3347] [serial = 395] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 41 (0x7f6276f4e400) [pid = 3347] [serial = 396] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 40 (0x7f6275975c00) [pid = 3347] [serial = 406] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 39 (0x7f62755b0400) [pid = 3347] [serial = 405] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 38 (0x7f6275567400) [pid = 3347] [serial = 404] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 37 (0x7f62754d3c00) [pid = 3347] [serial = 403] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 36 (0x7f62754d1000) [pid = 3347] [serial = 402] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 35 (0x7f62776df000) [pid = 3347] [serial = 401] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 34 (0x7f6275599800) [pid = 3347] [serial = 407] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 33 (0x7f62772ecc00) [pid = 3347] [serial = 398] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 32 (0x7f62779f1400) [pid = 3347] [serial = 400] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 31 (0x7f62772e7c00) [pid = 3347] [serial = 397] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - --DOMWINDOW == 30 (0x7f6277617000) [pid = 3347] [serial = 399] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:14 INFO - ++DOMWINDOW == 31 (0x7f62754ce000) [pid = 3347] [serial = 430] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 32 (0x7f6275560400) [pid = 3347] [serial = 431] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 33 (0x7f627556f000) [pid = 3347] [serial = 432] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 34 (0x7f6275603c00) [pid = 3347] [serial = 433] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 35 (0x7f6275605800) [pid = 3347] [serial = 434] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 36 (0x7f627560a400) [pid = 3347] [serial = 435] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 37 (0x7f627560d800) [pid = 3347] [serial = 436] [outer = 0x7f627559f400] 11:51:14 INFO - ++DOMWINDOW == 38 (0x7f6275606c00) [pid = 3347] [serial = 437] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 39 (0x7f6275608800) [pid = 3347] [serial = 438] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 40 (0x7f62754cd800) [pid = 3347] [serial = 439] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 41 (0x7f62754d0400) [pid = 3347] [serial = 440] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 42 (0x7f6275610c00) [pid = 3347] [serial = 441] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 43 (0x7f627556b400) [pid = 3347] [serial = 442] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 44 (0x7f6275611400) [pid = 3347] [serial = 443] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 45 (0x7f62756eec00) [pid = 3347] [serial = 444] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 46 (0x7f62756ed400) [pid = 3347] [serial = 445] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 47 (0x7f6275611000) [pid = 3347] [serial = 446] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 48 (0x7f62756f6000) [pid = 3347] [serial = 447] [outer = 0x7f627559f400] 11:51:15 INFO - ++DOMWINDOW == 49 (0x7f6276103c00) [pid = 3347] [serial = 448] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 50 (0x7f62756ef800) [pid = 3347] [serial = 449] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 51 (0x7f62756f1000) [pid = 3347] [serial = 450] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 52 (0x7f62755abc00) [pid = 3347] [serial = 451] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 53 (0x7f62756f6c00) [pid = 3347] [serial = 452] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 54 (0x7f627560e800) [pid = 3347] [serial = 453] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 55 (0x7f62756e9400) [pid = 3347] [serial = 454] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 56 (0x7f627610ac00) [pid = 3347] [serial = 455] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 57 (0x7f62755b1c00) [pid = 3347] [serial = 456] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 58 (0x7f62756f0000) [pid = 3347] [serial = 457] [outer = 0x7f627559f400] 11:51:16 INFO - ++DOMWINDOW == 59 (0x7f627610d400) [pid = 3347] [serial = 458] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 60 (0x7f62754d1800) [pid = 3347] [serial = 459] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 61 (0x7f6276110800) [pid = 3347] [serial = 460] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 62 (0x7f6276105000) [pid = 3347] [serial = 461] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 63 (0x7f627610b400) [pid = 3347] [serial = 462] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 64 (0x7f62754d3800) [pid = 3347] [serial = 463] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 65 (0x7f627556b800) [pid = 3347] [serial = 464] [outer = 0x7f627559f400] 11:51:17 INFO - ++DOMWINDOW == 66 (0x7f627559c000) [pid = 3347] [serial = 465] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 67 (0x7f62755a2800) [pid = 3347] [serial = 466] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 68 (0x7f62754cfc00) [pid = 3347] [serial = 467] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 69 (0x7f6278263000) [pid = 3347] [serial = 468] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 70 (0x7f627825e800) [pid = 3347] [serial = 469] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 71 (0x7f6275599400) [pid = 3347] [serial = 470] [outer = 0x7f627559f400] 11:51:18 INFO - ++DOMWINDOW == 72 (0x7f62754c8000) [pid = 3347] [serial = 471] [outer = 0x7f627559f400] 11:51:19 INFO - ++DOMWINDOW == 73 (0x7f62754c8c00) [pid = 3347] [serial = 472] [outer = 0x7f627559f400] 11:51:19 INFO - ++DOMWINDOW == 74 (0x7f62754c9400) [pid = 3347] [serial = 473] [outer = 0x7f627559f400] 11:51:19 INFO - --DOMWINDOW == 73 (0x7f627fc81c00) [pid = 3347] [serial = 357] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_load_events_on_stylesheets.html] 11:51:19 INFO - --DOMWINDOW == 72 (0x7f62754cdc00) [pid = 3347] [serial = 359] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_logical_properties.html] 11:51:19 INFO - ++DOMWINDOW == 73 (0x7f62754c7000) [pid = 3347] [serial = 474] [outer = 0x7f627559f400] 11:51:19 INFO - ++DOMWINDOW == 74 (0x7f62754c7800) [pid = 3347] [serial = 475] [outer = 0x7f627559f400] 11:51:19 INFO - ++DOMWINDOW == 75 (0x7f62754cc800) [pid = 3347] [serial = 476] [outer = 0x7f627559f400] 11:51:19 INFO - ++DOMWINDOW == 76 (0x7f6275565000) [pid = 3347] [serial = 477] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 77 (0x7f6275564400) [pid = 3347] [serial = 478] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 78 (0x7f627556a800) [pid = 3347] [serial = 479] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 79 (0x7f62754c5800) [pid = 3347] [serial = 480] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 80 (0x7f62754c6800) [pid = 3347] [serial = 481] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 81 (0x7f62754c9c00) [pid = 3347] [serial = 482] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 82 (0x7f62754d1000) [pid = 3347] [serial = 483] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 83 (0x7f627559e400) [pid = 3347] [serial = 484] [outer = 0x7f627559f400] 11:51:20 INFO - ++DOMWINDOW == 84 (0x7f62755a9800) [pid = 3347] [serial = 485] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 85 (0x7f62755ac000) [pid = 3347] [serial = 486] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 86 (0x7f62755b5c00) [pid = 3347] [serial = 487] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 87 (0x7f62755b5000) [pid = 3347] [serial = 488] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 88 (0x7f62755b7000) [pid = 3347] [serial = 489] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 89 (0x7f6275604800) [pid = 3347] [serial = 490] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 90 (0x7f62755b7c00) [pid = 3347] [serial = 491] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 91 (0x7f62755b8400) [pid = 3347] [serial = 492] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 92 (0x7f627560b800) [pid = 3347] [serial = 493] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 93 (0x7f62754c6400) [pid = 3347] [serial = 494] [outer = 0x7f627559f400] 11:51:21 INFO - ++DOMWINDOW == 94 (0x7f62754c6c00) [pid = 3347] [serial = 495] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 95 (0x7f62754cac00) [pid = 3347] [serial = 496] [outer = 0x7f627559f400] 11:51:22 INFO - --DOMWINDOW == 94 (0x7f62756f1000) [pid = 3347] [serial = 450] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 93 (0x7f62755abc00) [pid = 3347] [serial = 451] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25203em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25203em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 92 (0x7f62756f6c00) [pid = 3347] [serial = 452] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 91 (0x7f627560e800) [pid = 3347] [serial = 453] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25203rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25203rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 90 (0x7f62756e9400) [pid = 3347] [serial = 454] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 89 (0x7f627610ac00) [pid = 3347] [serial = 455] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25203rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%25203rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 88 (0x7f62755b1c00) [pid = 3347] [serial = 456] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 87 (0x7f62756f0000) [pid = 3347] [serial = 457] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 86 (0x7f62756ef800) [pid = 3347] [serial = 449] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25203em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25203em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 85 (0x7f6276103c00) [pid = 3347] [serial = 448] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 84 (0x7f62756f6000) [pid = 3347] [serial = 447] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 83 (0x7f6275611000) [pid = 3347] [serial = 446] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 82 (0x7f62756ed400) [pid = 3347] [serial = 445] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 81 (0x7f62756eec00) [pid = 3347] [serial = 444] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 80 (0x7f6275611400) [pid = 3347] [serial = 443] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 79 (0x7f627556b400) [pid = 3347] [serial = 442] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 78 (0x7f6275610c00) [pid = 3347] [serial = 441] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252075px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 77 (0x7f62754d0400) [pid = 3347] [serial = 440] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252077px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 76 (0x7f62754cd800) [pid = 3347] [serial = 439] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%253A%252076px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 75 (0x7f6275608800) [pid = 3347] [serial = 438] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 74 (0x7f6275606c00) [pid = 3347] [serial = 437] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25209rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25209rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 73 (0x7f627560d800) [pid = 3347] [serial = 436] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25206rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 72 (0x7f627560a400) [pid = 3347] [serial = 435] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25209rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25209rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 71 (0x7f6275605800) [pid = 3347] [serial = 434] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 70 (0x7f6275603c00) [pid = 3347] [serial = 433] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25209em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%25209em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 69 (0x7f627556f000) [pid = 3347] [serial = 432] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25206em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 68 (0x7f62754d4c00) [pid = 3347] [serial = 408] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 67 (0x7f6275560400) [pid = 3347] [serial = 431] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25209em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%25209em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 66 (0x7f62754ce000) [pid = 3347] [serial = 430] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 65 (0x7f62755b2000) [pid = 3347] [serial = 429] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 64 (0x7f627556e800) [pid = 3347] [serial = 428] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 63 (0x7f6275569400) [pid = 3347] [serial = 427] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 62 (0x7f6275561400) [pid = 3347] [serial = 426] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 61 (0x7f62754c8400) [pid = 3347] [serial = 425] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 60 (0x7f62755a1800) [pid = 3347] [serial = 424] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520116px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 59 (0x7f62755a0000) [pid = 3347] [serial = 423] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520118px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 58 (0x7f62755af800) [pid = 3347] [serial = 422] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%253A%2520117px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 57 (0x7f62755a6800) [pid = 3347] [serial = 421] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 56 (0x7f627559fc00) [pid = 3347] [serial = 420] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 55 (0x7f627559a800) [pid = 3347] [serial = 419] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 54 (0x7f627556ec00) [pid = 3347] [serial = 418] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520-0cm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 53 (0x7f627559c800) [pid = 3347] [serial = 417] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 52 (0x7f627556e400) [pid = 3347] [serial = 416] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 51 (0x7f6275567c00) [pid = 3347] [serial = 415] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%2520-0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 50 (0x7f627556bc00) [pid = 3347] [serial = 414] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 49 (0x7f6275564000) [pid = 3347] [serial = 413] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 48 (0x7f6275568c00) [pid = 3347] [serial = 412] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 47 (0x7f62754cf400) [pid = 3347] [serial = 411] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 46 (0x7f62754ce400) [pid = 3347] [serial = 410] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%2520100000px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 45 (0x7f62754cc400) [pid = 3347] [serial = 409] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25200.001mm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 44 (0x7f627556b800) [pid = 3347] [serial = 464] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 43 (0x7f62754c8000) [pid = 3347] [serial = 471] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520101rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520101rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 42 (0x7f627825e800) [pid = 3347] [serial = 469] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520101rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520101rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 41 (0x7f6278263000) [pid = 3347] [serial = 468] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%252099em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%252099em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 40 (0x7f62754cfc00) [pid = 3347] [serial = 467] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520101em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%2520101em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 39 (0x7f62755a2800) [pid = 3347] [serial = 466] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%252099em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%252099em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 38 (0x7f627559c000) [pid = 3347] [serial = 465] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520101em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%2520101em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 37 (0x7f62754d3800) [pid = 3347] [serial = 463] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 36 (0x7f627610b400) [pid = 3347] [serial = 462] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 35 (0x7f6275599400) [pid = 3347] [serial = 470] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%252099rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%252099rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 34 (0x7f62754c8c00) [pid = 3347] [serial = 472] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%252099rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-width%253A%252099rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 33 (0x7f6276105000) [pid = 3347] [serial = 461] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 32 (0x7f627610d400) [pid = 3347] [serial = 458] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%253A%25201599px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 31 (0x7f62754d1800) [pid = 3347] [serial = 459] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201600px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - --DOMWINDOW == 30 (0x7f6276110800) [pid = 3347] [serial = 460] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-width%253A%25201601px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:22 INFO - ++DOMWINDOW == 31 (0x7f62754c8400) [pid = 3347] [serial = 497] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 32 (0x7f62754ce400) [pid = 3347] [serial = 498] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 33 (0x7f62754ce000) [pid = 3347] [serial = 499] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 34 (0x7f6275567c00) [pid = 3347] [serial = 500] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 35 (0x7f62755a1800) [pid = 3347] [serial = 501] [outer = 0x7f627559f400] 11:51:22 INFO - ++DOMWINDOW == 36 (0x7f6275605800) [pid = 3347] [serial = 502] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 37 (0x7f627560f800) [pid = 3347] [serial = 503] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 38 (0x7f62755b0800) [pid = 3347] [serial = 504] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 39 (0x7f6275603c00) [pid = 3347] [serial = 505] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 40 (0x7f62755b2400) [pid = 3347] [serial = 506] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 41 (0x7f62756e9400) [pid = 3347] [serial = 507] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 42 (0x7f62754c8c00) [pid = 3347] [serial = 508] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 43 (0x7f62754cf400) [pid = 3347] [serial = 509] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 44 (0x7f62756ef400) [pid = 3347] [serial = 510] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 45 (0x7f62756f7000) [pid = 3347] [serial = 511] [outer = 0x7f627559f400] 11:51:23 INFO - ++DOMWINDOW == 46 (0x7f62756f6800) [pid = 3347] [serial = 512] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 47 (0x7f6276104c00) [pid = 3347] [serial = 513] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 48 (0x7f6276108000) [pid = 3347] [serial = 514] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 49 (0x7f62756f0400) [pid = 3347] [serial = 515] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 50 (0x7f62756f0800) [pid = 3347] [serial = 516] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 51 (0x7f627556e400) [pid = 3347] [serial = 517] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 52 (0x7f62755ac800) [pid = 3347] [serial = 518] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 53 (0x7f6276105400) [pid = 3347] [serial = 519] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 54 (0x7f6276106c00) [pid = 3347] [serial = 520] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 55 (0x7f627610bc00) [pid = 3347] [serial = 521] [outer = 0x7f627559f400] 11:51:24 INFO - ++DOMWINDOW == 56 (0x7f62763d6000) [pid = 3347] [serial = 522] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 57 (0x7f6276107c00) [pid = 3347] [serial = 523] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 58 (0x7f62763d5800) [pid = 3347] [serial = 524] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 59 (0x7f62756f4000) [pid = 3347] [serial = 525] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 60 (0x7f627610b800) [pid = 3347] [serial = 526] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 61 (0x7f62763dbc00) [pid = 3347] [serial = 527] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 62 (0x7f62763d9400) [pid = 3347] [serial = 528] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 63 (0x7f62763dac00) [pid = 3347] [serial = 529] [outer = 0x7f627559f400] 11:51:25 INFO - ++DOMWINDOW == 64 (0x7f62754ca000) [pid = 3347] [serial = 530] [outer = 0x7f627559f400] 11:51:26 INFO - ++DOMWINDOW == 65 (0x7f62754cb800) [pid = 3347] [serial = 531] [outer = 0x7f627559f400] 11:51:26 INFO - ++DOMWINDOW == 66 (0x7f627559c400) [pid = 3347] [serial = 532] [outer = 0x7f627559f400] 11:51:26 INFO - ++DOMWINDOW == 67 (0x7f62755ae800) [pid = 3347] [serial = 533] [outer = 0x7f627559f400] 11:51:26 INFO - ++DOMWINDOW == 68 (0x7f627559b800) [pid = 3347] [serial = 534] [outer = 0x7f627559f400] 11:51:26 INFO - ++DOMWINDOW == 69 (0x7f627559bc00) [pid = 3347] [serial = 535] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 70 (0x7f62754cfc00) [pid = 3347] [serial = 536] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 71 (0x7f62754ce800) [pid = 3347] [serial = 537] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 72 (0x7f6275562800) [pid = 3347] [serial = 538] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 73 (0x7f62754cdc00) [pid = 3347] [serial = 539] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 74 (0x7f6275567400) [pid = 3347] [serial = 540] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 75 (0x7f6275569400) [pid = 3347] [serial = 541] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 76 (0x7f627556d000) [pid = 3347] [serial = 542] [outer = 0x7f627559f400] 11:51:27 INFO - ++DOMWINDOW == 77 (0x7f627559c000) [pid = 3347] [serial = 543] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 78 (0x7f62754c9800) [pid = 3347] [serial = 544] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 79 (0x7f627556c400) [pid = 3347] [serial = 545] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 80 (0x7f6275568800) [pid = 3347] [serial = 546] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 81 (0x7f627559b000) [pid = 3347] [serial = 547] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 82 (0x7f6275606400) [pid = 3347] [serial = 548] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 83 (0x7f62755a3c00) [pid = 3347] [serial = 549] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 84 (0x7f62755afc00) [pid = 3347] [serial = 550] [outer = 0x7f627559f400] 11:51:28 INFO - ++DOMWINDOW == 85 (0x7f627560e800) [pid = 3347] [serial = 551] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 86 (0x7f6275610000) [pid = 3347] [serial = 552] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 87 (0x7f62754cc400) [pid = 3347] [serial = 553] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 88 (0x7f627559f000) [pid = 3347] [serial = 554] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 89 (0x7f6276102c00) [pid = 3347] [serial = 555] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 90 (0x7f62754ccc00) [pid = 3347] [serial = 556] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 91 (0x7f62755a2000) [pid = 3347] [serial = 557] [outer = 0x7f627559f400] 11:51:29 INFO - --DOMWINDOW == 90 (0x7f62763d9400) [pid = 3347] [serial = 528] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/8001%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/8001%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 89 (0x7f62763d5800) [pid = 3347] [serial = 524] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%2520413/560%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%2520413/560%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 88 (0x7f6276107c00) [pid = 3347] [serial = 523] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%2520177/240%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%2520177/240%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 87 (0x7f62763d6000) [pid = 3347] [serial = 522] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 86 (0x7f627610bc00) [pid = 3347] [serial = 521] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 85 (0x7f6276106c00) [pid = 3347] [serial = 520] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 84 (0x7f6276105400) [pid = 3347] [serial = 519] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 83 (0x7f62755ac800) [pid = 3347] [serial = 518] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 82 (0x7f627556e400) [pid = 3347] [serial = 517] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 81 (0x7f62756f0800) [pid = 3347] [serial = 516] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 80 (0x7f62756f0400) [pid = 3347] [serial = 515] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 79 (0x7f6276108000) [pid = 3347] [serial = 514] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 78 (0x7f6276104c00) [pid = 3347] [serial = 513] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 77 (0x7f62756f6800) [pid = 3347] [serial = 512] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 76 (0x7f62756f7000) [pid = 3347] [serial = 511] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-device-orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 75 (0x7f62756ef400) [pid = 3347] [serial = 510] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 74 (0x7f62754cf400) [pid = 3347] [serial = 509] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 73 (0x7f62754c8c00) [pid = 3347] [serial = 508] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 72 (0x7f62756e9400) [pid = 3347] [serial = 507] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 71 (0x7f62755b2400) [pid = 3347] [serial = 506] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 70 (0x7f6275603c00) [pid = 3347] [serial = 505] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 69 (0x7f62755b0800) [pid = 3347] [serial = 504] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 68 (0x7f627560f800) [pid = 3347] [serial = 503] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 67 (0x7f6275605800) [pid = 3347] [serial = 502] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%253A%2520landscape%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 66 (0x7f62755a1800) [pid = 3347] [serial = 501] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%253A%2520portrait%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 65 (0x7f6275567c00) [pid = 3347] [serial = 500] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528orientation%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 64 (0x7f62754c9400) [pid = 3347] [serial = 473] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 63 (0x7f62754ce000) [pid = 3347] [serial = 499] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 62 (0x7f62754ce400) [pid = 3347] [serial = 498] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 61 (0x7f62754c8400) [pid = 3347] [serial = 497] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 60 (0x7f62754cac00) [pid = 3347] [serial = 496] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 59 (0x7f62754c6c00) [pid = 3347] [serial = 495] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 58 (0x7f62754c6400) [pid = 3347] [serial = 494] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 57 (0x7f627560b800) [pid = 3347] [serial = 493] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 56 (0x7f62755b8400) [pid = 3347] [serial = 492] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 55 (0x7f62755b7c00) [pid = 3347] [serial = 491] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528width%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 54 (0x7f6275604800) [pid = 3347] [serial = 490] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528height%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 53 (0x7f62755b7000) [pid = 3347] [serial = 489] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252074rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252074rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 52 (0x7f62755b5000) [pid = 3347] [serial = 488] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252076rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252076rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 51 (0x7f62755b5c00) [pid = 3347] [serial = 487] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252074rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252074rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 50 (0x7f62755ac000) [pid = 3347] [serial = 486] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252076rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252076rem%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 49 (0x7f62755a9800) [pid = 3347] [serial = 485] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252074em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252074em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 48 (0x7f627559e400) [pid = 3347] [serial = 484] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252076em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%252076em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 47 (0x7f62754d1000) [pid = 3347] [serial = 483] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252074em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252074em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 46 (0x7f62754c9c00) [pid = 3347] [serial = 482] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252076em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%252076em%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 45 (0x7f62754c6800) [pid = 3347] [serial = 481] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 44 (0x7f62754c5800) [pid = 3347] [serial = 480] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 43 (0x7f627556a800) [pid = 3347] [serial = 479] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 42 (0x7f6275564400) [pid = 3347] [serial = 478] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 41 (0x7f6275565000) [pid = 3347] [serial = 477] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 40 (0x7f62754cc800) [pid = 3347] [serial = 476] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-height%253A%25201200px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 39 (0x7f62754c7800) [pid = 3347] [serial = 475] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201199px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 38 (0x7f62754c7000) [pid = 3347] [serial = 474] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-height%253A%25201201px%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 37 (0x7f62763dbc00) [pid = 3347] [serial = 527] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205899/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205899/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 36 (0x7f62756f4000) [pid = 3347] [serial = 525] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - --DOMWINDOW == 35 (0x7f627610b800) [pid = 3347] [serial = 526] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205901/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205901/8000%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:29 INFO - ++DOMWINDOW == 36 (0x7f62754c8400) [pid = 3347] [serial = 558] [outer = 0x7f627559f400] 11:51:29 INFO - ++DOMWINDOW == 37 (0x7f62754c8c00) [pid = 3347] [serial = 559] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 38 (0x7f62754c6800) [pid = 3347] [serial = 560] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 39 (0x7f62754c7800) [pid = 3347] [serial = 561] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 40 (0x7f62755a1800) [pid = 3347] [serial = 562] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 41 (0x7f62754d1000) [pid = 3347] [serial = 563] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 42 (0x7f62755ac800) [pid = 3347] [serial = 564] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 43 (0x7f627610f000) [pid = 3347] [serial = 565] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 44 (0x7f62763d9000) [pid = 3347] [serial = 566] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 45 (0x7f627610f400) [pid = 3347] [serial = 567] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 46 (0x7f62763d1000) [pid = 3347] [serial = 568] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 47 (0x7f62763dc000) [pid = 3347] [serial = 569] [outer = 0x7f627559f400] 11:51:30 INFO - ++DOMWINDOW == 48 (0x7f62754c7000) [pid = 3347] [serial = 570] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 49 (0x7f62755a9800) [pid = 3347] [serial = 571] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 50 (0x7f627825ec00) [pid = 3347] [serial = 572] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 51 (0x7f62763de400) [pid = 3347] [serial = 573] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 52 (0x7f6279d95c00) [pid = 3347] [serial = 574] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 53 (0x7f6279d9e000) [pid = 3347] [serial = 575] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 54 (0x7f62756ed000) [pid = 3347] [serial = 576] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 55 (0x7f6278267800) [pid = 3347] [serial = 577] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 56 (0x7f627a666400) [pid = 3347] [serial = 578] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 57 (0x7f6279d98c00) [pid = 3347] [serial = 579] [outer = 0x7f627559f400] 11:51:31 INFO - ++DOMWINDOW == 58 (0x7f627a665c00) [pid = 3347] [serial = 580] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 59 (0x7f627a66f400) [pid = 3347] [serial = 581] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 60 (0x7f627a666800) [pid = 3347] [serial = 582] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 61 (0x7f627a667000) [pid = 3347] [serial = 583] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 62 (0x7f6279d9f000) [pid = 3347] [serial = 584] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 63 (0x7f627a671000) [pid = 3347] [serial = 585] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 64 (0x7f627a70c000) [pid = 3347] [serial = 586] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 65 (0x7f627a70e400) [pid = 3347] [serial = 587] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 66 (0x7f627a711c00) [pid = 3347] [serial = 588] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 67 (0x7f627a714400) [pid = 3347] [serial = 589] [outer = 0x7f627559f400] 11:51:32 INFO - ++DOMWINDOW == 68 (0x7f627a740400) [pid = 3347] [serial = 590] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 69 (0x7f627a742c00) [pid = 3347] [serial = 591] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 70 (0x7f627a747400) [pid = 3347] [serial = 592] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 71 (0x7f627a743c00) [pid = 3347] [serial = 593] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 72 (0x7f627a746400) [pid = 3347] [serial = 594] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 73 (0x7f62754d2800) [pid = 3347] [serial = 595] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 74 (0x7f6275566c00) [pid = 3347] [serial = 596] [outer = 0x7f627559f400] 11:51:33 INFO - ++DOMWINDOW == 75 (0x7f627556e800) [pid = 3347] [serial = 597] [outer = 0x7f627559f400] 11:51:34 INFO - ++DOMWINDOW == 76 (0x7f6275603000) [pid = 3347] [serial = 598] [outer = 0x7f627559f400] 11:51:34 INFO - ++DOMWINDOW == 77 (0x7f62756e9800) [pid = 3347] [serial = 599] [outer = 0x7f627559f400] 11:51:34 INFO - ++DOMWINDOW == 78 (0x7f6278268400) [pid = 3347] [serial = 600] [outer = 0x7f627559f400] 11:51:34 INFO - ++DOMWINDOW == 79 (0x7f627556b400) [pid = 3347] [serial = 601] [outer = 0x7f627559f400] 11:51:34 INFO - ++DOMWINDOW == 80 (0x7f627559c800) [pid = 3347] [serial = 602] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 81 (0x7f62754cbc00) [pid = 3347] [serial = 603] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 82 (0x7f62754cac00) [pid = 3347] [serial = 604] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 83 (0x7f62754cf000) [pid = 3347] [serial = 605] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 84 (0x7f62754d2c00) [pid = 3347] [serial = 606] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 85 (0x7f627556a800) [pid = 3347] [serial = 607] [outer = 0x7f627559f400] 11:51:35 INFO - ++DOMWINDOW == 86 (0x7f627556b800) [pid = 3347] [serial = 608] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 87 (0x7f62754ca400) [pid = 3347] [serial = 609] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 88 (0x7f62754ce400) [pid = 3347] [serial = 610] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 89 (0x7f6275560800) [pid = 3347] [serial = 611] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 90 (0x7f6275568000) [pid = 3347] [serial = 612] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 91 (0x7f6275568400) [pid = 3347] [serial = 613] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 92 (0x7f62755a0c00) [pid = 3347] [serial = 614] [outer = 0x7f627559f400] 11:51:36 INFO - ++DOMWINDOW == 93 (0x7f62755b6400) [pid = 3347] [serial = 615] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 94 (0x7f62755b7c00) [pid = 3347] [serial = 616] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 95 (0x7f6275606000) [pid = 3347] [serial = 617] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 96 (0x7f6275603400) [pid = 3347] [serial = 618] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 97 (0x7f6275603c00) [pid = 3347] [serial = 619] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 98 (0x7f62754c8000) [pid = 3347] [serial = 620] [outer = 0x7f627559f400] 11:51:37 INFO - ++DOMWINDOW == 99 (0x7f6275560400) [pid = 3347] [serial = 621] [outer = 0x7f627559f400] 11:51:37 INFO - --DOMWINDOW == 98 (0x7f627a743c00) [pid = 3347] [serial = 593] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201%2520%2520/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201%2520%2520/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 97 (0x7f627a711c00) [pid = 3347] [serial = 588] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 96 (0x7f627a70e400) [pid = 3347] [serial = 587] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 95 (0x7f627a70c000) [pid = 3347] [serial = 586] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 94 (0x7f627a671000) [pid = 3347] [serial = 585] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-device-pixel-ratio%253A%25201.0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 93 (0x7f6279d9f000) [pid = 3347] [serial = 584] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 92 (0x7f627a667000) [pid = 3347] [serial = 583] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 91 (0x7f627a666800) [pid = 3347] [serial = 582] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 90 (0x7f627a66f400) [pid = 3347] [serial = 581] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-webkit-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 89 (0x7f627a665c00) [pid = 3347] [serial = 580] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 88 (0x7f6279d98c00) [pid = 3347] [serial = 579] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 87 (0x7f627a666400) [pid = 3347] [serial = 578] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 86 (0x7f6278267800) [pid = 3347] [serial = 577] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 85 (0x7f62756ed000) [pid = 3347] [serial = 576] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 84 (0x7f6279d9e000) [pid = 3347] [serial = 575] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 83 (0x7f6279d95c00) [pid = 3347] [serial = 574] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 82 (0x7f62763de400) [pid = 3347] [serial = 573] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 81 (0x7f627825ec00) [pid = 3347] [serial = 572] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-min-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 80 (0x7f62755a9800) [pid = 3347] [serial = 571] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-webkit-max-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 79 (0x7f62754c7000) [pid = 3347] [serial = 570] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 78 (0x7f62763dc000) [pid = 3347] [serial = 569] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 77 (0x7f62763d1000) [pid = 3347] [serial = 568] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 76 (0x7f627610f400) [pid = 3347] [serial = 567] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 75 (0x7f62763d9000) [pid = 3347] [serial = 566] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 74 (0x7f627610f000) [pid = 3347] [serial = 565] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 73 (0x7f62755ac800) [pid = 3347] [serial = 564] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 72 (0x7f62754d1000) [pid = 3347] [serial = 563] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 71 (0x7f62755a1800) [pid = 3347] [serial = 562] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201.1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 70 (0x7f62754c7800) [pid = 3347] [serial = 561] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25200.9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 69 (0x7f62754c6800) [pid = 3347] [serial = 560] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 68 (0x7f62754c8c00) [pid = 3347] [serial = 559] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 67 (0x7f62754c8400) [pid = 3347] [serial = 558] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 66 (0x7f62755a2000) [pid = 3347] [serial = 557] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max--moz-device-pixel-ratio%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 65 (0x7f62754ccc00) [pid = 3347] [serial = 556] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 64 (0x7f6276102c00) [pid = 3347] [serial = 555] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 63 (0x7f627559f000) [pid = 3347] [serial = 554] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 62 (0x7f62754cc400) [pid = 3347] [serial = 553] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 61 (0x7f6275610000) [pid = 3347] [serial = 552] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 60 (0x7f627560e800) [pid = 3347] [serial = 551] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 59 (0x7f62755afc00) [pid = 3347] [serial = 550] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 58 (0x7f62755a3c00) [pid = 3347] [serial = 549] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 57 (0x7f6275606400) [pid = 3347] [serial = 548] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 56 (0x7f627559b000) [pid = 3347] [serial = 547] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 55 (0x7f6275568800) [pid = 3347] [serial = 546] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528device-aspect-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528device-aspect-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 54 (0x7f627556c400) [pid = 3347] [serial = 545] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528device-aspect-ratio%253A%25201600/1201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 53 (0x7f62754c9800) [pid = 3347] [serial = 544] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201599/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 52 (0x7f627559c000) [pid = 3347] [serial = 543] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201600/1199%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 51 (0x7f627556d000) [pid = 3347] [serial = 542] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528device-aspect-ratio%253A%25201601/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 50 (0x7f6275569400) [pid = 3347] [serial = 541] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528device-aspect-ratio%253A%25201600/1200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 49 (0x7f6275567400) [pid = 3347] [serial = 540] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 48 (0x7f62754cdc00) [pid = 3347] [serial = 539] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 47 (0x7f6275562800) [pid = 3347] [serial = 538] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 46 (0x7f62754ce800) [pid = 3347] [serial = 537] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 45 (0x7f62754cfc00) [pid = 3347] [serial = 536] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 44 (0x7f627559bc00) [pid = 3347] [serial = 535] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/79%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 43 (0x7f627a747400) [pid = 3347] [serial = 592] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 42 (0x7f627a714400) [pid = 3347] [serial = 589] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201%2520%2520/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201%2520%2520/1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 41 (0x7f627a740400) [pid = 3347] [serial = 590] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201%2520%2520/%2520%2509%250A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201%2520%2520/%2520%2509%250A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - --DOMWINDOW == 40 (0x7f627a742c00) [pid = 3347] [serial = 591] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201/%250D1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-aspect-ratio%253A%25201/%250D1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:37 INFO - ++DOMWINDOW == 41 (0x7f62754c7800) [pid = 3347] [serial = 622] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 42 (0x7f62754c8c00) [pid = 3347] [serial = 623] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 43 (0x7f62754cc400) [pid = 3347] [serial = 624] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 44 (0x7f6275562c00) [pid = 3347] [serial = 625] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 45 (0x7f6275565000) [pid = 3347] [serial = 626] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 46 (0x7f6275606400) [pid = 3347] [serial = 627] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 47 (0x7f62754c7000) [pid = 3347] [serial = 628] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 48 (0x7f6275563400) [pid = 3347] [serial = 629] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 49 (0x7f62755a8800) [pid = 3347] [serial = 630] [outer = 0x7f627559f400] 11:51:38 INFO - ++DOMWINDOW == 50 (0x7f627560f000) [pid = 3347] [serial = 631] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 51 (0x7f62756e8400) [pid = 3347] [serial = 632] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 52 (0x7f62756e8800) [pid = 3347] [serial = 633] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 53 (0x7f62756eb400) [pid = 3347] [serial = 634] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 54 (0x7f62756ec000) [pid = 3347] [serial = 635] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 55 (0x7f62756ec400) [pid = 3347] [serial = 636] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 56 (0x7f62756f1000) [pid = 3347] [serial = 637] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 57 (0x7f62756f0c00) [pid = 3347] [serial = 638] [outer = 0x7f627559f400] 11:51:39 INFO - ++DOMWINDOW == 58 (0x7f62756f1400) [pid = 3347] [serial = 639] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 59 (0x7f62756f5400) [pid = 3347] [serial = 640] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 60 (0x7f62756efc00) [pid = 3347] [serial = 641] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 61 (0x7f62756f3400) [pid = 3347] [serial = 642] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 62 (0x7f62756f3800) [pid = 3347] [serial = 643] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 63 (0x7f62756f4000) [pid = 3347] [serial = 644] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 64 (0x7f6276105400) [pid = 3347] [serial = 645] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 65 (0x7f6276103000) [pid = 3347] [serial = 646] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 66 (0x7f6276105000) [pid = 3347] [serial = 647] [outer = 0x7f627559f400] 11:51:40 INFO - ++DOMWINDOW == 67 (0x7f6276109400) [pid = 3347] [serial = 648] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 68 (0x7f6276107400) [pid = 3347] [serial = 649] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 69 (0x7f6276107c00) [pid = 3347] [serial = 650] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 70 (0x7f62755b0000) [pid = 3347] [serial = 651] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 71 (0x7f6275606800) [pid = 3347] [serial = 652] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 72 (0x7f62754d4800) [pid = 3347] [serial = 653] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 73 (0x7f6275564400) [pid = 3347] [serial = 654] [outer = 0x7f627559f400] 11:51:41 INFO - ++DOMWINDOW == 74 (0x7f627556f800) [pid = 3347] [serial = 655] [outer = 0x7f627559f400] 11:51:42 INFO - ++DOMWINDOW == 75 (0x7f62755a1c00) [pid = 3347] [serial = 656] [outer = 0x7f627559f400] 11:51:42 INFO - ++DOMWINDOW == 76 (0x7f62755b6c00) [pid = 3347] [serial = 657] [outer = 0x7f627559f400] 11:51:42 INFO - ++DOMWINDOW == 77 (0x7f627559e400) [pid = 3347] [serial = 658] [outer = 0x7f627559f400] 11:51:42 INFO - ++DOMWINDOW == 78 (0x7f6275602800) [pid = 3347] [serial = 659] [outer = 0x7f627559f400] 11:51:42 INFO - ++DOMWINDOW == 79 (0x7f62763d3400) [pid = 3347] [serial = 660] [outer = 0x7f627559f400] 11:51:43 INFO - ++DOMWINDOW == 80 (0x7f627610b000) [pid = 3347] [serial = 661] [outer = 0x7f627559f400] 11:51:43 INFO - ++DOMWINDOW == 81 (0x7f62754d4400) [pid = 3347] [serial = 662] [outer = 0x7f627559f400] 11:51:44 INFO - ++DOMWINDOW == 82 (0x7f62754c8400) [pid = 3347] [serial = 663] [outer = 0x7f627559f400] 11:51:44 INFO - ++DOMWINDOW == 83 (0x7f62754c8800) [pid = 3347] [serial = 664] [outer = 0x7f627559f400] 11:51:44 INFO - ++DOMWINDOW == 84 (0x7f62754cf400) [pid = 3347] [serial = 665] [outer = 0x7f627559f400] 11:51:44 INFO - ++DOMWINDOW == 85 (0x7f62754d1800) [pid = 3347] [serial = 666] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 86 (0x7f6275561000) [pid = 3347] [serial = 667] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 87 (0x7f627556c800) [pid = 3347] [serial = 668] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 88 (0x7f627556d000) [pid = 3347] [serial = 669] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 89 (0x7f627556cc00) [pid = 3347] [serial = 670] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 90 (0x7f62754c6800) [pid = 3347] [serial = 671] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 91 (0x7f62754d1000) [pid = 3347] [serial = 672] [outer = 0x7f627559f400] 11:51:45 INFO - ++DOMWINDOW == 92 (0x7f62755a2000) [pid = 3347] [serial = 673] [outer = 0x7f627559f400] 11:51:46 INFO - ++DOMWINDOW == 93 (0x7f62755ab000) [pid = 3347] [serial = 674] [outer = 0x7f627559f400] 11:51:46 INFO - ++DOMWINDOW == 94 (0x7f627559d400) [pid = 3347] [serial = 675] [outer = 0x7f627559f400] 11:51:46 INFO - ++DOMWINDOW == 95 (0x7f62754c5c00) [pid = 3347] [serial = 676] [outer = 0x7f627559f400] 11:51:46 INFO - --DOMWINDOW == 94 (0x7f62763d3400) [pid = 3347] [serial = 660] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-resolution%253A%252037dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-resolution%253A%252037dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 93 (0x7f6275602800) [pid = 3347] [serial = 659] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-resolution%253A%252039dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-resolution%253A%252039dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 92 (0x7f62755b6c00) [pid = 3347] [serial = 657] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 91 (0x7f627559e400) [pid = 3347] [serial = 658] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-resolution%253A%252037dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-resolution%253A%252037dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 90 (0x7f62755a1c00) [pid = 3347] [serial = 656] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 89 (0x7f627556f800) [pid = 3347] [serial = 655] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 88 (0x7f6275564400) [pid = 3347] [serial = 654] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 87 (0x7f62754d4800) [pid = 3347] [serial = 653] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252095dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 86 (0x7f6275606800) [pid = 3347] [serial = 652] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252097dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 85 (0x7f627610b000) [pid = 3347] [serial = 661] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252039dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528min-resolution%253A%252039dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 84 (0x7f627556b400) [pid = 3347] [serial = 601] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 83 (0x7f627559c800) [pid = 3347] [serial = 602] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 82 (0x7f62754cbc00) [pid = 3347] [serial = 603] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color%253A9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 81 (0x7f62754cac00) [pid = 3347] [serial = 604] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 80 (0x7f62754cf000) [pid = 3347] [serial = 605] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 79 (0x7f62754d2c00) [pid = 3347] [serial = 606] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 78 (0x7f627556a800) [pid = 3347] [serial = 607] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 77 (0x7f627556b800) [pid = 3347] [serial = 608] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528color%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 76 (0x7f62754ca400) [pid = 3347] [serial = 609] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528monochrome%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 75 (0x7f62754ce400) [pid = 3347] [serial = 610] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 74 (0x7f6275560800) [pid = 3347] [serial = 611] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 73 (0x7f6275568000) [pid = 3347] [serial = 612] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 72 (0x7f6275568400) [pid = 3347] [serial = 613] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 71 (0x7f62755a0c00) [pid = 3347] [serial = 614] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 70 (0x7f62755b6400) [pid = 3347] [serial = 615] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 69 (0x7f62755b7c00) [pid = 3347] [serial = 616] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 68 (0x7f6275606000) [pid = 3347] [serial = 617] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%2520327%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 67 (0x7f6275603400) [pid = 3347] [serial = 618] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 66 (0x7f6275603c00) [pid = 3347] [serial = 619] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 65 (0x7f62754c8000) [pid = 3347] [serial = 620] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 64 (0x7f6275560400) [pid = 3347] [serial = 621] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 63 (0x7f62754c7800) [pid = 3347] [serial = 622] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 62 (0x7f62754c8c00) [pid = 3347] [serial = 623] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 61 (0x7f62754cc400) [pid = 3347] [serial = 624] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 60 (0x7f6275562c00) [pid = 3347] [serial = 625] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%2520157%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528max-color-index%253A%2520157%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 59 (0x7f6275565000) [pid = 3347] [serial = 626] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 58 (0x7f6275606400) [pid = 3347] [serial = 627] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 57 (0x7f62754c7000) [pid = 3347] [serial = 628] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 56 (0x7f6275563400) [pid = 3347] [serial = 629] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 55 (0x7f62755a8800) [pid = 3347] [serial = 630] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 54 (0x7f627560f000) [pid = 3347] [serial = 631] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 53 (0x7f62756e8400) [pid = 3347] [serial = 632] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 52 (0x7f62756e8800) [pid = 3347] [serial = 633] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 51 (0x7f62756eb400) [pid = 3347] [serial = 634] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 50 (0x7f62756ec000) [pid = 3347] [serial = 635] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 49 (0x7f62756ec400) [pid = 3347] [serial = 636] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 48 (0x7f62756f1000) [pid = 3347] [serial = 637] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 47 (0x7f62756f0c00) [pid = 3347] [serial = 638] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 46 (0x7f62756f1400) [pid = 3347] [serial = 639] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 45 (0x7f62756f5400) [pid = 3347] [serial = 640] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 44 (0x7f62756efc00) [pid = 3347] [serial = 641] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 43 (0x7f62756f3400) [pid = 3347] [serial = 642] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 42 (0x7f62754ca000) [pid = 3347] [serial = 530] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 41 (0x7f62754cb800) [pid = 3347] [serial = 531] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 40 (0x7f627559c400) [pid = 3347] [serial = 532] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252058/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 39 (0x7f62755ae800) [pid = 3347] [serial = 533] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252059/81%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 38 (0x7f62756f3800) [pid = 3347] [serial = 643] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A3dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 37 (0x7f62756f4000) [pid = 3347] [serial = 644] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203.0dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 36 (0x7f6276105400) [pid = 3347] [serial = 645] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25203.4dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 35 (0x7f6276103000) [pid = 3347] [serial = 646] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%2509%253A%2520120dpcm%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 34 (0x7f6276105000) [pid = 3347] [serial = 647] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 33 (0x7f627a746400) [pid = 3347] [serial = 594] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201%2520%2520/%2520%2509%250A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201%2520%2520/%2520%2509%250A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 32 (0x7f62754d2800) [pid = 3347] [serial = 595] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201/%250D1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528device-aspect-ratio%253A%25201/%250D1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 31 (0x7f6275566c00) [pid = 3347] [serial = 596] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-monochrome%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 30 (0x7f627556e800) [pid = 3347] [serial = 597] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-color%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528min-color%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 29 (0x7f6275603000) [pid = 3347] [serial = 598] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 28 (0x7f62756e9800) [pid = 3347] [serial = 599] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 27 (0x7f6278268400) [pid = 3347] [serial = 600] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528color%253A9%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 26 (0x7f62763dac00) [pid = 3347] [serial = 529] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/7999%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528aspect-ratio%253A%25205900/7999%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 25 (0x7f627559b800) [pid = 3347] [serial = 534] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528min-aspect-ratio%253A%252060/80%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 24 (0x7f62755b0000) [pid = 3347] [serial = 651] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%25201dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 23 (0x7f6276109400) [pid = 3347] [serial = 648] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25201.5dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 22 (0x7f6276107400) [pid = 3347] [serial = 649] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528max-resolution%253A%25202.0dppx%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:46 INFO - --DOMWINDOW == 21 (0x7f6276107c00) [pid = 3347] [serial = 650] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252096dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528resolution%253A%252096dpi%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:47 INFO - ++DOMWINDOW == 22 (0x7f62754cbc00) [pid = 3347] [serial = 677] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 23 (0x7f62754cb800) [pid = 3347] [serial = 678] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 24 (0x7f62754cc400) [pid = 3347] [serial = 679] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 25 (0x7f627556b800) [pid = 3347] [serial = 680] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 26 (0x7f627556c400) [pid = 3347] [serial = 681] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 27 (0x7f62754cac00) [pid = 3347] [serial = 682] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 28 (0x7f62754cf000) [pid = 3347] [serial = 683] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 29 (0x7f627559b800) [pid = 3347] [serial = 684] [outer = 0x7f627559f400] 11:51:47 INFO - ++DOMWINDOW == 30 (0x7f62755b0000) [pid = 3347] [serial = 685] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 31 (0x7f62755b6c00) [pid = 3347] [serial = 686] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 32 (0x7f62755b2800) [pid = 3347] [serial = 687] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 33 (0x7f62755b7800) [pid = 3347] [serial = 688] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 34 (0x7f62755a9800) [pid = 3347] [serial = 689] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 35 (0x7f62755b8800) [pid = 3347] [serial = 690] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 36 (0x7f62756ed800) [pid = 3347] [serial = 691] [outer = 0x7f627559f400] 11:51:48 INFO - ++DOMWINDOW == 37 (0x7f62756eb800) [pid = 3347] [serial = 692] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 38 (0x7f62756ee800) [pid = 3347] [serial = 693] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 39 (0x7f62756f2800) [pid = 3347] [serial = 694] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 40 (0x7f62756edc00) [pid = 3347] [serial = 695] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 41 (0x7f62756f1800) [pid = 3347] [serial = 696] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 42 (0x7f62756f2400) [pid = 3347] [serial = 697] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 43 (0x7f62756f4800) [pid = 3347] [serial = 698] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 44 (0x7f62756e9400) [pid = 3347] [serial = 699] [outer = 0x7f627559f400] 11:51:49 INFO - ++DOMWINDOW == 45 (0x7f62756ea000) [pid = 3347] [serial = 700] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 46 (0x7f6276107400) [pid = 3347] [serial = 701] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 47 (0x7f62756ec000) [pid = 3347] [serial = 702] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 48 (0x7f62756f5c00) [pid = 3347] [serial = 703] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 49 (0x7f6275566400) [pid = 3347] [serial = 704] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 50 (0x7f6275569400) [pid = 3347] [serial = 705] [outer = 0x7f627559f400] 11:51:50 INFO - ++DOMWINDOW == 51 (0x7f627559b400) [pid = 3347] [serial = 706] [outer = 0x7f627559f400] 11:51:51 INFO - ++DOMWINDOW == 52 (0x7f62755ac000) [pid = 3347] [serial = 707] [outer = 0x7f627559f400] 11:51:51 INFO - ++DOMWINDOW == 53 (0x7f62756e8800) [pid = 3347] [serial = 708] [outer = 0x7f627559f400] 11:51:51 INFO - ++DOMWINDOW == 54 (0x7f627610bc00) [pid = 3347] [serial = 709] [outer = 0x7f627559f400] 11:51:51 INFO - ++DOMWINDOW == 55 (0x7f627610f400) [pid = 3347] [serial = 710] [outer = 0x7f627559f400] 11:51:51 INFO - ++DOMWINDOW == 56 (0x7f62763d0800) [pid = 3347] [serial = 711] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 57 (0x7f62763d1800) [pid = 3347] [serial = 712] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 58 (0x7f62754d4800) [pid = 3347] [serial = 713] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 59 (0x7f62754d4c00) [pid = 3347] [serial = 714] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 60 (0x7f6275564800) [pid = 3347] [serial = 715] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 61 (0x7f6275569000) [pid = 3347] [serial = 716] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 62 (0x7f6275568000) [pid = 3347] [serial = 717] [outer = 0x7f627559f400] 11:51:52 INFO - ++DOMWINDOW == 63 (0x7f627556e800) [pid = 3347] [serial = 718] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 64 (0x7f62755a2400) [pid = 3347] [serial = 719] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 65 (0x7f6275569c00) [pid = 3347] [serial = 720] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 66 (0x7f627559bc00) [pid = 3347] [serial = 721] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 67 (0x7f627559c000) [pid = 3347] [serial = 722] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 68 (0x7f62755aa000) [pid = 3347] [serial = 723] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 69 (0x7f62755b0800) [pid = 3347] [serial = 724] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 70 (0x7f62755b2000) [pid = 3347] [serial = 725] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 71 (0x7f62755b4c00) [pid = 3347] [serial = 726] [outer = 0x7f627559f400] 11:51:53 INFO - ++DOMWINDOW == 72 (0x7f62755b2400) [pid = 3347] [serial = 727] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 73 (0x7f62756ee000) [pid = 3347] [serial = 728] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 74 (0x7f62756f3800) [pid = 3347] [serial = 729] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 75 (0x7f62756eec00) [pid = 3347] [serial = 730] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 76 (0x7f62756f1400) [pid = 3347] [serial = 731] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 77 (0x7f6275564400) [pid = 3347] [serial = 732] [outer = 0x7f627559f400] 11:51:54 INFO - --DOMWINDOW == 76 (0x7f62756f4800) [pid = 3347] [serial = 698] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 75 (0x7f62756f2400) [pid = 3347] [serial = 697] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 74 (0x7f62756f1800) [pid = 3347] [serial = 696] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 73 (0x7f62756edc00) [pid = 3347] [serial = 695] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 72 (0x7f62756f2800) [pid = 3347] [serial = 694] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 71 (0x7f62756ee800) [pid = 3347] [serial = 693] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 70 (0x7f62756eb800) [pid = 3347] [serial = 692] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 69 (0x7f62756ed800) [pid = 3347] [serial = 691] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 68 (0x7f62755b8800) [pid = 3347] [serial = 690] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 67 (0x7f62755a9800) [pid = 3347] [serial = 689] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 66 (0x7f62755b7800) [pid = 3347] [serial = 688] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 65 (0x7f62755b2800) [pid = 3347] [serial = 687] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 64 (0x7f62754d4400) [pid = 3347] [serial = 662] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 63 (0x7f62755b6c00) [pid = 3347] [serial = 686] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 62 (0x7f62755b0000) [pid = 3347] [serial = 685] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 61 (0x7f627559b800) [pid = 3347] [serial = 684] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 60 (0x7f62754cf000) [pid = 3347] [serial = 683] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 59 (0x7f62754cac00) [pid = 3347] [serial = 682] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 58 (0x7f627556c400) [pid = 3347] [serial = 681] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 57 (0x7f627556b800) [pid = 3347] [serial = 680] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 56 (0x7f62754cc400) [pid = 3347] [serial = 679] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%2520-1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%2520-1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 55 (0x7f62754cb800) [pid = 3347] [serial = 678] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25202%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25202%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 54 (0x7f62754cbc00) [pid = 3347] [serial = 677] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 53 (0x7f62754c5c00) [pid = 3347] [serial = 676] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 52 (0x7f627559d400) [pid = 3347] [serial = 675] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528grid%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 51 (0x7f62755ab000) [pid = 3347] [serial = 674] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 50 (0x7f62755a2000) [pid = 3347] [serial = 673] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 49 (0x7f62754d1000) [pid = 3347] [serial = 672] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 48 (0x7f62754c6800) [pid = 3347] [serial = 671] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528grid%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 47 (0x7f627556cc00) [pid = 3347] [serial = 670] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%253A%2520interlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%253A%2520interlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 46 (0x7f627556d000) [pid = 3347] [serial = 669] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 45 (0x7f627556c800) [pid = 3347] [serial = 668] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 44 (0x7f6275561000) [pid = 3347] [serial = 667] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%253A%2520interlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%253A%2520interlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 43 (0x7f62754d1800) [pid = 3347] [serial = 666] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 42 (0x7f62754cf400) [pid = 3347] [serial = 665] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528scan%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 41 (0x7f62754c8800) [pid = 3347] [serial = 664] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%253Ainterlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%253Ainterlace%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 40 (0x7f62754c8400) [pid = 3347] [serial = 663] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528scan%253A%2520progressive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 39 (0x7f62756e9400) [pid = 3347] [serial = 699] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 38 (0x7f6276107400) [pid = 3347] [serial = 701] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - --DOMWINDOW == 37 (0x7f62756ea000) [pid = 3347] [serial = 700] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:51:54 INFO - ++DOMWINDOW == 38 (0x7f62754c6000) [pid = 3347] [serial = 733] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 39 (0x7f62754c6800) [pid = 3347] [serial = 734] [outer = 0x7f627559f400] 11:51:54 INFO - ++DOMWINDOW == 40 (0x7f62754cf000) [pid = 3347] [serial = 735] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 41 (0x7f62754c8400) [pid = 3347] [serial = 736] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 42 (0x7f62754cac00) [pid = 3347] [serial = 737] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 43 (0x7f62755a6c00) [pid = 3347] [serial = 738] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 44 (0x7f62756f6c00) [pid = 3347] [serial = 739] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 45 (0x7f6276104800) [pid = 3347] [serial = 740] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 46 (0x7f62755b7800) [pid = 3347] [serial = 741] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 47 (0x7f62756f1c00) [pid = 3347] [serial = 742] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 48 (0x7f62754cdc00) [pid = 3347] [serial = 743] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 49 (0x7f6276109000) [pid = 3347] [serial = 744] [outer = 0x7f627559f400] 11:51:55 INFO - ++DOMWINDOW == 50 (0x7f6276109800) [pid = 3347] [serial = 745] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 51 (0x7f62763d5400) [pid = 3347] [serial = 746] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 52 (0x7f62763d9000) [pid = 3347] [serial = 747] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 53 (0x7f62763d2c00) [pid = 3347] [serial = 748] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 54 (0x7f62763d4000) [pid = 3347] [serial = 749] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 55 (0x7f62763d8400) [pid = 3347] [serial = 750] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 56 (0x7f62763df000) [pid = 3347] [serial = 751] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 57 (0x7f627610ec00) [pid = 3347] [serial = 752] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 58 (0x7f62754c5c00) [pid = 3347] [serial = 753] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 59 (0x7f62754cc400) [pid = 3347] [serial = 754] [outer = 0x7f627559f400] 11:51:56 INFO - ++DOMWINDOW == 60 (0x7f62763db800) [pid = 3347] [serial = 755] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 61 (0x7f6278261400) [pid = 3347] [serial = 756] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 62 (0x7f62763d8800) [pid = 3347] [serial = 757] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 63 (0x7f62763dac00) [pid = 3347] [serial = 758] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 64 (0x7f6278265800) [pid = 3347] [serial = 759] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 65 (0x7f627825ec00) [pid = 3347] [serial = 760] [outer = 0x7f627559f400] 11:51:57 INFO - ++DOMWINDOW == 66 (0x7f6278265000) [pid = 3347] [serial = 761] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 67 (0x7f6278266800) [pid = 3347] [serial = 762] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 68 (0x7f6278267800) [pid = 3347] [serial = 763] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 69 (0x7f6278268800) [pid = 3347] [serial = 764] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 70 (0x7f6279d96400) [pid = 3347] [serial = 765] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 71 (0x7f6275562c00) [pid = 3347] [serial = 766] [outer = 0x7f627559f400] 11:51:58 INFO - ++DOMWINDOW == 72 (0x7f6275565c00) [pid = 3347] [serial = 767] [outer = 0x7f627559f400] 11:51:59 INFO - ++DOMWINDOW == 73 (0x7f62754c7800) [pid = 3347] [serial = 768] [outer = 0x7f627559f400] 11:51:59 INFO - ++DOMWINDOW == 74 (0x7f62754d0000) [pid = 3347] [serial = 769] [outer = 0x7f627559f400] 11:51:59 INFO - ++DOMWINDOW == 75 (0x7f62755b4400) [pid = 3347] [serial = 770] [outer = 0x7f627559f400] 11:51:59 INFO - ++DOMWINDOW == 76 (0x7f62763df400) [pid = 3347] [serial = 771] [outer = 0x7f627559f400] 11:52:00 INFO - ++DOMWINDOW == 77 (0x7f6279d9a000) [pid = 3347] [serial = 772] [outer = 0x7f627559f400] 11:52:00 INFO - ++DOMWINDOW == 78 (0x7f62756eb400) [pid = 3347] [serial = 773] [outer = 0x7f627559f400] 11:52:00 INFO - ++DOMWINDOW == 79 (0x7f6279d9e400) [pid = 3347] [serial = 774] [outer = 0x7f627559f400] 11:52:00 INFO - ++DOMWINDOW == 80 (0x7f6279d9e800) [pid = 3347] [serial = 775] [outer = 0x7f627559f400] 11:52:00 INFO - ++DOMWINDOW == 81 (0x7f6279da0800) [pid = 3347] [serial = 776] [outer = 0x7f627559f400] 11:52:01 INFO - ++DOMWINDOW == 82 (0x7f6279d9d400) [pid = 3347] [serial = 777] [outer = 0x7f627559f400] 11:52:01 INFO - ++DOMWINDOW == 83 (0x7f62754c9400) [pid = 3347] [serial = 778] [outer = 0x7f627559f400] 11:52:02 INFO - MEMORY STAT | vsize 690MB | residentFast 117MB | heapAllocated 20MB 11:52:02 INFO - 1003 INFO TEST-OK | layout/style/test/test_media_queries.html | took 58937ms 11:52:02 INFO - ++DOMWINDOW == 84 (0x7f62754d4400) [pid = 3347] [serial = 779] [outer = 0x7f6281591800] 11:52:02 INFO - 1004 INFO TEST-START | layout/style/test/test_media_queries_dynamic.html 11:52:02 INFO - ++DOMWINDOW == 85 (0x7f62754cc800) [pid = 3347] [serial = 780] [outer = 0x7f6281591800] 11:52:02 INFO - ++DOCSHELL 0x7f6275519800 == 4 [pid = 3347] [id = 26] 11:52:02 INFO - ++DOMWINDOW == 86 (0x7f6275566800) [pid = 3347] [serial = 781] [outer = (nil)] 11:52:02 INFO - ++DOMWINDOW == 87 (0x7f627556c400) [pid = 3347] [serial = 782] [outer = 0x7f6275566800] 11:52:02 INFO - MEMORY STAT | vsize 690MB | residentFast 119MB | heapAllocated 22MB 11:52:03 INFO - 1005 INFO TEST-OK | layout/style/test/test_media_queries_dynamic.html | took 822ms 11:52:03 INFO - ++DOMWINDOW == 88 (0x7f627556d000) [pid = 3347] [serial = 783] [outer = 0x7f6281591800] 11:52:03 INFO - 1006 INFO TEST-START | layout/style/test/test_media_queries_dynamic_xbl.html 11:52:04 INFO - ++DOMWINDOW == 89 (0x7f627556cc00) [pid = 3347] [serial = 784] [outer = 0x7f6281591800] 11:52:04 INFO - ++DOCSHELL 0x7f6278dd1800 == 5 [pid = 3347] [id = 27] 11:52:04 INFO - ++DOMWINDOW == 90 (0x7f62755b0c00) [pid = 3347] [serial = 785] [outer = (nil)] 11:52:04 INFO - ++DOMWINDOW == 91 (0x7f62755b5000) [pid = 3347] [serial = 786] [outer = 0x7f62755b0c00] 11:52:04 INFO - --DOMWINDOW == 90 (0x7f6275562c00) [pid = 3347] [serial = 766] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 89 (0x7f6278268800) [pid = 3347] [serial = 764] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 88 (0x7f6278267800) [pid = 3347] [serial = 763] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 87 (0x7f62755b4400) [pid = 3347] [serial = 770] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Cbadmedium%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Cbadmedium%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 86 (0x7f62763df400) [pid = 3347] [serial = 771] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%2528badexpression%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%2528badexpression%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 85 (0x7f6279d9a000) [pid = 3347] [serial = 772] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528badexpression%2529%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528badexpression%2529%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 84 (0x7f62756eb400) [pid = 3347] [serial = 773] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528badexpression%2529%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528badexpression%2529%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 83 (0x7f6279d9e400) [pid = 3347] [serial = 774] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252C%2528badexpression%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252C%2528badexpression%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 82 (0x7f6279d9e800) [pid = 3347] [serial = 775] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%255Bbadsyntax%255D%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252C%255Bbadsyntax%255D%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 81 (0x7f6279da0800) [pid = 3347] [serial = 776] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 80 (0x7f6279d9d400) [pid = 3347] [serial = 777] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252C%255Bbadsyntax%255D%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252C%255Bbadsyntax%255D%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 79 (0x7f62763d1800) [pid = 3347] [serial = 712] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 78 (0x7f62754d4800) [pid = 3347] [serial = 713] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 77 (0x7f62754d4c00) [pid = 3347] [serial = 714] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-backward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 76 (0x7f6275564800) [pid = 3347] [serial = 715] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-start-forward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 75 (0x7f6275569000) [pid = 3347] [serial = 716] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-backward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 74 (0x7f6275568000) [pid = 3347] [serial = 717] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-end-forward%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 73 (0x7f627556e800) [pid = 3347] [serial = 718] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-scrollbar-thumb-proportional%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 72 (0x7f62755a2400) [pid = 3347] [serial = 719] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 71 (0x7f6275569c00) [pid = 3347] [serial = 720] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 70 (0x7f627559bc00) [pid = 3347] [serial = 721] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 69 (0x7f627559c000) [pid = 3347] [serial = 722] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 68 (0x7f62755aa000) [pid = 3347] [serial = 723] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 67 (0x7f62755b0800) [pid = 3347] [serial = 724] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 66 (0x7f62755b2000) [pid = 3347] [serial = 725] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 65 (0x7f62755b4c00) [pid = 3347] [serial = 726] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 64 (0x7f62755b2400) [pid = 3347] [serial = 727] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 63 (0x7f62756ee000) [pid = 3347] [serial = 728] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 62 (0x7f62756f3800) [pid = 3347] [serial = 729] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-touch-enabled%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 61 (0x7f62756eec00) [pid = 3347] [serial = 730] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-swipe-animation-enabled%253A%25201%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 60 (0x7f62756f1400) [pid = 3347] [serial = 731] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520aero%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520aero%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 59 (0x7f6275564400) [pid = 3347] [serial = 732] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520aero-lite%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520aero-lite%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 58 (0x7f62754c6000) [pid = 3347] [serial = 733] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-blue%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-blue%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 57 (0x7f62754c6800) [pid = 3347] [serial = 734] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-olive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-olive%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 56 (0x7f62754cf000) [pid = 3347] [serial = 735] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-silver%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520luna-silver%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 55 (0x7f62754c8400) [pid = 3347] [serial = 736] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520royale%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520royale%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 54 (0x7f62754cac00) [pid = 3347] [serial = 737] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520generic%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520generic%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 53 (0x7f62755a6c00) [pid = 3347] [serial = 738] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520zune%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520zune%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 52 (0x7f62756f6c00) [pid = 3347] [serial = 739] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520garbage%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-theme%253A%2520garbage%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 51 (0x7f6276104800) [pid = 3347] [serial = 740] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-xp%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-xp%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 50 (0x7f62755b7800) [pid = 3347] [serial = 741] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-vista%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-vista%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 49 (0x7f62756f1c00) [pid = 3347] [serial = 742] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win7%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 48 (0x7f62754cdc00) [pid = 3347] [serial = 743] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win8%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 47 (0x7f6276109000) [pid = 3347] [serial = 744] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win10%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-os-version%253A%2520windows-win10%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 46 (0x7f6276109800) [pid = 3347] [serial = 745] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 45 (0x7f62763d5400) [pid = 3347] [serial = 746] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 44 (0x7f62763d9000) [pid = 3347] [serial = 747] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 43 (0x7f62763d2c00) [pid = 3347] [serial = 748] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 42 (0x7f62763d4000) [pid = 3347] [serial = 749] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 41 (0x7f62763d8400) [pid = 3347] [serial = 750] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 40 (0x7f62763df000) [pid = 3347] [serial = 751] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 39 (0x7f627610ec00) [pid = 3347] [serial = 752] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 38 (0x7f62754c5c00) [pid = 3347] [serial = 753] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 37 (0x7f62754cc400) [pid = 3347] [serial = 754] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 36 (0x7f62763db800) [pid = 3347] [serial = 755] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 35 (0x7f6278261400) [pid = 3347] [serial = 756] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 34 (0x7f62763d8800) [pid = 3347] [serial = 757] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 33 (0x7f62763dac00) [pid = 3347] [serial = 758] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 32 (0x7f6278265800) [pid = 3347] [serial = 759] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520not%2520all%2520and%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 31 (0x7f62756ec000) [pid = 3347] [serial = 702] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-menus%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 30 (0x7f62756f5c00) [pid = 3347] [serial = 703] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-images-in-buttons%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 29 (0x7f6275566400) [pid = 3347] [serial = 704] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-overlay-scrollbars%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 28 (0x7f6275569400) [pid = 3347] [serial = 705] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-default-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 27 (0x7f627559b400) [pid = 3347] [serial = 706] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-graphite-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 26 (0x7f62755ac000) [pid = 3347] [serial = 707] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-lion-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 25 (0x7f62756e8800) [pid = 3347] [serial = 708] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-mac-yosemite-theme%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 24 (0x7f627610bc00) [pid = 3347] [serial = 709] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-compositor%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 23 (0x7f627610f400) [pid = 3347] [serial = 710] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-classic%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 22 (0x7f62763d0800) [pid = 3347] [serial = 711] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%2520and%2520%2528-moz-windows-glass%253A%25200%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 21 (0x7f627825ec00) [pid = 3347] [serial = 760] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520only%2520all%2520and%2520%2528-moz-is-glyph%253A0%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 20 (0x7f6278265000) [pid = 3347] [serial = 761] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 19 (0x7f6278266800) [pid = 3347] [serial = 762] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%2528-moz-is-glyph%253A1%2529%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 18 (0x7f6279d96400) [pid = 3347] [serial = 765] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 17 (0x7f6275565c00) [pid = 3347] [serial = 767] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Call%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%252Call%252C%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 16 (0x7f62754c7800) [pid = 3347] [serial = 768] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520all%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:04 INFO - --DOMWINDOW == 15 (0x7f62754d0000) [pid = 3347] [serial = 769] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520badmedium%252Call%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:05 INFO - MEMORY STAT | vsize 690MB | residentFast 118MB | heapAllocated 21MB 11:52:05 INFO - 1007 INFO TEST-OK | layout/style/test/test_media_queries_dynamic_xbl.html | took 2259ms 11:52:05 INFO - ++DOMWINDOW == 16 (0x7f6275566400) [pid = 3347] [serial = 787] [outer = 0x7f6281591800] 11:52:05 INFO - 1008 INFO TEST-START | layout/style/test/test_media_query_list.html 11:52:06 INFO - ++DOMWINDOW == 17 (0x7f6275564800) [pid = 3347] [serial = 788] [outer = 0x7f6281591800] 11:52:06 INFO - ++DOCSHELL 0x7f627bc7d000 == 6 [pid = 3347] [id = 28] 11:52:06 INFO - ++DOMWINDOW == 18 (0x7f6275569400) [pid = 3347] [serial = 789] [outer = (nil)] 11:52:06 INFO - ++DOMWINDOW == 19 (0x7f627559c000) [pid = 3347] [serial = 790] [outer = 0x7f6275569400] 11:52:06 INFO - ++DOCSHELL 0x7f627bc7d800 == 7 [pid = 3347] [id = 29] 11:52:06 INFO - ++DOMWINDOW == 20 (0x7f6276109800) [pid = 3347] [serial = 791] [outer = (nil)] 11:52:06 INFO - ++DOMWINDOW == 21 (0x7f627610c000) [pid = 3347] [serial = 792] [outer = 0x7f6276109800] 11:52:06 INFO - --DOCSHELL 0x7f6278ddb000 == 6 [pid = 3347] [id = 25] 11:52:06 INFO - MEMORY STAT | vsize 690MB | residentFast 115MB | heapAllocated 19MB 11:52:06 INFO - --DOMWINDOW == 20 (0x7f6276109800) [pid = 3347] [serial = 791] [outer = (nil)] [url = about:blank] 11:52:06 INFO - --DOMWINDOW == 19 (0x7f62754c9400) [pid = 3347] [serial = 778] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:06 INFO - --DOMWINDOW == 18 (0x7f627556d000) [pid = 3347] [serial = 783] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:06 INFO - --DOMWINDOW == 17 (0x7f62754cc800) [pid = 3347] [serial = 780] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_media_queries_dynamic.html] 11:52:06 INFO - --DOMWINDOW == 16 (0x7f62754d4400) [pid = 3347] [serial = 779] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:06 INFO - --DOMWINDOW == 15 (0x7f6275566400) [pid = 3347] [serial = 787] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:06 INFO - --DOMWINDOW == 14 (0x7f627559f400) [pid = 3347] [serial = 362] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@media%2520%255Bbadsyntax%255D%252Cbadmedium%2520%257B%2520body%2520%257B%2520text-decoration%253A%2520underline%2520%257D%2520%257D%27%3E%3Cbody%3E] 11:52:06 INFO - --DOMWINDOW == 13 (0x7f6275566800) [pid = 3347] [serial = 781] [outer = (nil)] [url = about:blank] 11:52:06 INFO - --DOMWINDOW == 12 (0x7f62755aa400) [pid = 3347] [serial = 363] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/media_queries_iframe.html] 11:52:06 INFO - 1009 INFO TEST-OK | layout/style/test/test_media_query_list.html | took 1138ms 11:52:07 INFO - ++DOMWINDOW == 13 (0x7f62754d1400) [pid = 3347] [serial = 793] [outer = 0x7f6281591800] 11:52:07 INFO - 1010 INFO TEST-START | layout/style/test/test_moz_device_pixel_ratio.html 11:52:07 INFO - ++DOMWINDOW == 14 (0x7f62754d1800) [pid = 3347] [serial = 794] [outer = 0x7f6281591800] 11:52:07 INFO - MEMORY STAT | vsize 690MB | residentFast 116MB | heapAllocated 20MB 11:52:07 INFO - 1011 INFO TEST-OK | layout/style/test/test_moz_device_pixel_ratio.html | took 393ms 11:52:07 INFO - ++DOMWINDOW == 15 (0x7f62755a7400) [pid = 3347] [serial = 795] [outer = 0x7f6281591800] 11:52:07 INFO - 1012 INFO TEST-START | layout/style/test/test_namespace_rule.html 11:52:07 INFO - ++DOMWINDOW == 16 (0x7f62755aa000) [pid = 3347] [serial = 796] [outer = 0x7f6281591800] 11:52:07 INFO - ++DOCSHELL 0x7f6278dd7800 == 7 [pid = 3347] [id = 30] 11:52:07 INFO - ++DOMWINDOW == 17 (0x7f62755ae400) [pid = 3347] [serial = 797] [outer = (nil)] 11:52:07 INFO - ++DOMWINDOW == 18 (0x7f62755ab400) [pid = 3347] [serial = 798] [outer = 0x7f62755ae400] 11:52:08 INFO - MEMORY STAT | vsize 691MB | residentFast 116MB | heapAllocated 22MB 11:52:08 INFO - 1013 INFO TEST-OK | layout/style/test/test_namespace_rule.html | took 804ms 11:52:08 INFO - ++DOMWINDOW == 19 (0x7f6275562c00) [pid = 3347] [serial = 799] [outer = 0x7f6281591800] 11:52:08 INFO - 1014 INFO TEST-START | layout/style/test/test_of_type_selectors.xhtml 11:52:08 INFO - ++DOMWINDOW == 20 (0x7f62754c8000) [pid = 3347] [serial = 800] [outer = 0x7f6281591800] 11:52:09 INFO - MEMORY STAT | vsize 691MB | residentFast 117MB | heapAllocated 22MB 11:52:09 INFO - 1015 INFO TEST-OK | layout/style/test/test_of_type_selectors.xhtml | took 581ms 11:52:09 INFO - ++DOMWINDOW == 21 (0x7f62754d2c00) [pid = 3347] [serial = 801] [outer = 0x7f6281591800] 11:52:09 INFO - 1016 INFO TEST-START | layout/style/test/test_page_parser.html 11:52:09 INFO - ++DOMWINDOW == 22 (0x7f62755ac800) [pid = 3347] [serial = 802] [outer = 0x7f6281591800] 11:52:10 INFO - MEMORY STAT | vsize 691MB | residentFast 118MB | heapAllocated 23MB 11:52:10 INFO - 1017 INFO TEST-OK | layout/style/test/test_page_parser.html | took 719ms 11:52:10 INFO - ++DOMWINDOW == 23 (0x7f627556b800) [pid = 3347] [serial = 803] [outer = 0x7f6281591800] 11:52:10 INFO - 1018 INFO TEST-START | layout/style/test/test_parse_eof.html 11:52:10 INFO - ++DOMWINDOW == 24 (0x7f6275563c00) [pid = 3347] [serial = 804] [outer = 0x7f6281591800] 11:52:10 INFO - --DOCSHELL 0x7f6275519800 == 6 [pid = 3347] [id = 26] 11:52:10 INFO - --DOCSHELL 0x7f6278dd1800 == 5 [pid = 3347] [id = 27] 11:52:10 INFO - --DOCSHELL 0x7f627bc7d000 == 4 [pid = 3347] [id = 28] 11:52:10 INFO - --DOCSHELL 0x7f627bc7d800 == 3 [pid = 3347] [id = 29] 11:52:10 INFO - --DOCSHELL 0x7f6278dd7800 == 2 [pid = 3347] [id = 30] 11:52:10 INFO - --DOMWINDOW == 23 (0x7f627610c000) [pid = 3347] [serial = 792] [outer = (nil)] [url = about:blank] 11:52:10 INFO - --DOMWINDOW == 22 (0x7f627556c400) [pid = 3347] [serial = 782] [outer = (nil)] [url = about:blank] 11:52:10 INFO - --DOMWINDOW == 21 (0x7f6275560c00) [pid = 3347] [serial = 361] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_media_queries.html] 11:52:10 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:52:10 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:52:11 INFO - MEMORY STAT | vsize 690MB | residentFast 114MB | heapAllocated 20MB 11:52:11 INFO - 1019 INFO TEST-OK | layout/style/test/test_parse_eof.html | took 905ms 11:52:11 INFO - ++DOMWINDOW == 22 (0x7f6275561400) [pid = 3347] [serial = 805] [outer = 0x7f6281591800] 11:52:11 INFO - 1020 INFO TEST-START | layout/style/test/test_parse_ident.html 11:52:11 INFO - ++DOMWINDOW == 23 (0x7f627556d400) [pid = 3347] [serial = 806] [outer = 0x7f6281591800] 11:52:11 INFO - MEMORY STAT | vsize 690MB | residentFast 115MB | heapAllocated 21MB 11:52:11 INFO - 1021 INFO TEST-OK | layout/style/test/test_parse_ident.html | took 676ms 11:52:11 INFO - ++DOMWINDOW == 24 (0x7f62755acc00) [pid = 3347] [serial = 807] [outer = 0x7f6281591800] 11:52:12 INFO - 1022 INFO TEST-START | layout/style/test/test_parse_rule.html 11:52:12 INFO - ++DOMWINDOW == 25 (0x7f62755afc00) [pid = 3347] [serial = 808] [outer = 0x7f6281591800] 11:52:12 INFO - ++DOCSHELL 0x7f6278dd7800 == 3 [pid = 3347] [id = 31] 11:52:12 INFO - ++DOMWINDOW == 26 (0x7f627559bc00) [pid = 3347] [serial = 809] [outer = (nil)] 11:52:12 INFO - ++DOMWINDOW == 27 (0x7f62755b2800) [pid = 3347] [serial = 810] [outer = 0x7f627559bc00] 11:52:12 INFO - ++DOMWINDOW == 28 (0x7f62755b6c00) [pid = 3347] [serial = 811] [outer = 0x7f627559bc00] 11:52:12 INFO - ++DOMWINDOW == 29 (0x7f6275560400) [pid = 3347] [serial = 812] [outer = 0x7f627559bc00] 11:52:13 INFO - ++DOMWINDOW == 30 (0x7f62755af000) [pid = 3347] [serial = 813] [outer = 0x7f627559bc00] 11:52:13 INFO - ++DOMWINDOW == 31 (0x7f627556c400) [pid = 3347] [serial = 814] [outer = 0x7f627559bc00] 11:52:13 INFO - ++DOMWINDOW == 32 (0x7f627556e800) [pid = 3347] [serial = 815] [outer = 0x7f627559bc00] 11:52:13 INFO - ++DOMWINDOW == 33 (0x7f62755b1000) [pid = 3347] [serial = 816] [outer = 0x7f627559bc00] 11:52:13 INFO - ++DOMWINDOW == 34 (0x7f62755b7c00) [pid = 3347] [serial = 817] [outer = 0x7f627559bc00] 11:52:14 INFO - --DOMWINDOW == 33 (0x7f62755b5000) [pid = 3347] [serial = 786] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/media_queries_dynamic_xbl_iframe.html] 11:52:14 INFO - --DOMWINDOW == 32 (0x7f62754d2c00) [pid = 3347] [serial = 801] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:14 INFO - --DOMWINDOW == 31 (0x7f62754c8000) [pid = 3347] [serial = 800] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_of_type_selectors.xhtml] 11:52:14 INFO - --DOMWINDOW == 30 (0x7f62755ab400) [pid = 3347] [serial = 798] [outer = (nil)] [url = data:application/xhtml+xml,] 11:52:14 INFO - --DOMWINDOW == 29 (0x7f62755aa000) [pid = 3347] [serial = 796] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_namespace_rule.html] 11:52:14 INFO - --DOMWINDOW == 28 (0x7f62755a7400) [pid = 3347] [serial = 795] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:14 INFO - --DOMWINDOW == 27 (0x7f62754d1800) [pid = 3347] [serial = 794] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_moz_device_pixel_ratio.html] 11:52:14 INFO - --DOMWINDOW == 26 (0x7f6275562c00) [pid = 3347] [serial = 799] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:14 INFO - --DOMWINDOW == 25 (0x7f62754d1400) [pid = 3347] [serial = 793] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:14 INFO - --DOMWINDOW == 24 (0x7f62755b0c00) [pid = 3347] [serial = 785] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/media_queries_dynamic_xbl_iframe.html] 11:52:14 INFO - --DOMWINDOW == 23 (0x7f62755ae400) [pid = 3347] [serial = 797] [outer = (nil)] [url = data:application/xhtml+xml,] 11:52:14 INFO - --DOMWINDOW == 22 (0x7f6275569400) [pid = 3347] [serial = 789] [outer = (nil)] [url = about:blank] 11:52:14 INFO - --DOMWINDOW == 21 (0x7f627556cc00) [pid = 3347] [serial = 784] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_media_queries_dynamic_xbl.html] 11:52:14 INFO - ++DOMWINDOW == 22 (0x7f62754c6800) [pid = 3347] [serial = 818] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 23 (0x7f62754c8000) [pid = 3347] [serial = 819] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 24 (0x7f6275562c00) [pid = 3347] [serial = 820] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 25 (0x7f62754d1800) [pid = 3347] [serial = 821] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 26 (0x7f62756eb000) [pid = 3347] [serial = 822] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 27 (0x7f62754d2c00) [pid = 3347] [serial = 823] [outer = 0x7f627559bc00] 11:52:14 INFO - ++DOMWINDOW == 28 (0x7f62756e9c00) [pid = 3347] [serial = 824] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 29 (0x7f6275569400) [pid = 3347] [serial = 825] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 30 (0x7f62756ef800) [pid = 3347] [serial = 826] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 31 (0x7f62756ee000) [pid = 3347] [serial = 827] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 32 (0x7f62755b6800) [pid = 3347] [serial = 828] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 33 (0x7f62756f3800) [pid = 3347] [serial = 829] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 34 (0x7f62756ec400) [pid = 3347] [serial = 830] [outer = 0x7f627559bc00] 11:52:15 INFO - ++DOMWINDOW == 35 (0x7f62756efc00) [pid = 3347] [serial = 831] [outer = 0x7f627559bc00] 11:52:16 INFO - ++DOMWINDOW == 36 (0x7f62754cac00) [pid = 3347] [serial = 832] [outer = 0x7f627559bc00] 11:52:16 INFO - ++DOMWINDOW == 37 (0x7f62756f1c00) [pid = 3347] [serial = 833] [outer = 0x7f627559bc00] 11:52:16 INFO - ++DOMWINDOW == 38 (0x7f62754d1400) [pid = 3347] [serial = 834] [outer = 0x7f627559bc00] 11:52:16 INFO - ++DOMWINDOW == 39 (0x7f62756f7400) [pid = 3347] [serial = 835] [outer = 0x7f627559bc00] 11:52:16 INFO - ++DOMWINDOW == 40 (0x7f62756ef000) [pid = 3347] [serial = 836] [outer = 0x7f627559bc00] 11:52:17 INFO - ++DOMWINDOW == 41 (0x7f62756f4c00) [pid = 3347] [serial = 837] [outer = 0x7f627559bc00] 11:52:17 INFO - ++DOMWINDOW == 42 (0x7f62756f7c00) [pid = 3347] [serial = 838] [outer = 0x7f627559bc00] 11:52:17 INFO - ++DOMWINDOW == 43 (0x7f62754c7000) [pid = 3347] [serial = 839] [outer = 0x7f627559bc00] 11:52:17 INFO - ++DOMWINDOW == 44 (0x7f6275565800) [pid = 3347] [serial = 840] [outer = 0x7f627559bc00] 11:52:17 INFO - ++DOMWINDOW == 45 (0x7f6275569000) [pid = 3347] [serial = 841] [outer = 0x7f627559bc00] 11:52:18 INFO - ++DOMWINDOW == 46 (0x7f62755a2400) [pid = 3347] [serial = 842] [outer = 0x7f627559bc00] 11:52:18 INFO - ++DOMWINDOW == 47 (0x7f62755a6c00) [pid = 3347] [serial = 843] [outer = 0x7f627559bc00] 11:52:18 INFO - ++DOMWINDOW == 48 (0x7f62755b3400) [pid = 3347] [serial = 844] [outer = 0x7f627559bc00] 11:52:18 INFO - ++DOMWINDOW == 49 (0x7f62755b7000) [pid = 3347] [serial = 845] [outer = 0x7f627559bc00] 11:52:18 INFO - ++DOMWINDOW == 50 (0x7f62756ea400) [pid = 3347] [serial = 846] [outer = 0x7f627559bc00] 11:52:19 INFO - ++DOMWINDOW == 51 (0x7f62756f3400) [pid = 3347] [serial = 847] [outer = 0x7f627559bc00] 11:52:19 INFO - ++DOMWINDOW == 52 (0x7f62756f4400) [pid = 3347] [serial = 848] [outer = 0x7f627559bc00] 11:52:19 INFO - ++DOMWINDOW == 53 (0x7f6276107000) [pid = 3347] [serial = 849] [outer = 0x7f627559bc00] 11:52:19 INFO - ++DOMWINDOW == 54 (0x7f6276102c00) [pid = 3347] [serial = 850] [outer = 0x7f627559bc00] 11:52:19 INFO - ++DOMWINDOW == 55 (0x7f6276108000) [pid = 3347] [serial = 851] [outer = 0x7f627559bc00] 11:52:20 INFO - ++DOMWINDOW == 56 (0x7f6276106400) [pid = 3347] [serial = 852] [outer = 0x7f627559bc00] 11:52:20 INFO - ++DOMWINDOW == 57 (0x7f62756eec00) [pid = 3347] [serial = 853] [outer = 0x7f627559bc00] 11:52:20 INFO - ++DOMWINDOW == 58 (0x7f62754c6400) [pid = 3347] [serial = 854] [outer = 0x7f627559bc00] 11:52:21 INFO - ++DOMWINDOW == 59 (0x7f62754cec00) [pid = 3347] [serial = 855] [outer = 0x7f627559bc00] 11:52:21 INFO - ++DOMWINDOW == 60 (0x7f62754cfc00) [pid = 3347] [serial = 856] [outer = 0x7f627559bc00] 11:52:21 INFO - --DOMWINDOW == 59 (0x7f62755ac800) [pid = 3347] [serial = 802] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_page_parser.html] 11:52:21 INFO - --DOMWINDOW == 58 (0x7f627556b800) [pid = 3347] [serial = 803] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:21 INFO - --DOMWINDOW == 57 (0x7f627559c000) [pid = 3347] [serial = 790] [outer = (nil)] [url = about:blank] 11:52:21 INFO - --DOMWINDOW == 56 (0x7f6275564800) [pid = 3347] [serial = 788] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_media_query_list.html] 11:52:21 INFO - --DOMWINDOW == 55 (0x7f62756eec00) [pid = 3347] [serial = 853] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 54 (0x7f62756f4400) [pid = 3347] [serial = 848] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 53 (0x7f62756f3400) [pid = 3347] [serial = 847] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 52 (0x7f62756ea400) [pid = 3347] [serial = 846] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 51 (0x7f62755b7000) [pid = 3347] [serial = 845] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 50 (0x7f62754c7000) [pid = 3347] [serial = 839] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 49 (0x7f6276106400) [pid = 3347] [serial = 852] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 48 (0x7f62755b3400) [pid = 3347] [serial = 844] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 47 (0x7f62755b6c00) [pid = 3347] [serial = 811] [outer = 0x7f627559bc00] [url = about:blank] 11:52:21 INFO - --DOMWINDOW == 46 (0x7f62756f7400) [pid = 3347] [serial = 835] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 45 (0x7f62754d1400) [pid = 3347] [serial = 834] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 44 (0x7f62756f1c00) [pid = 3347] [serial = 833] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 43 (0x7f62754cac00) [pid = 3347] [serial = 832] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 42 (0x7f62755a6c00) [pid = 3347] [serial = 843] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 41 (0x7f62756efc00) [pid = 3347] [serial = 831] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 40 (0x7f62756ec400) [pid = 3347] [serial = 830] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 39 (0x7f62756f3800) [pid = 3347] [serial = 829] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 38 (0x7f62755b6800) [pid = 3347] [serial = 828] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 37 (0x7f62756ee000) [pid = 3347] [serial = 827] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 36 (0x7f62756ef800) [pid = 3347] [serial = 826] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 35 (0x7f6275569400) [pid = 3347] [serial = 825] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 34 (0x7f62756e9c00) [pid = 3347] [serial = 824] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 33 (0x7f62754d2c00) [pid = 3347] [serial = 823] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 32 (0x7f62755a2400) [pid = 3347] [serial = 842] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 31 (0x7f62756eb000) [pid = 3347] [serial = 822] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 30 (0x7f62754d1800) [pid = 3347] [serial = 821] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 29 (0x7f6275562c00) [pid = 3347] [serial = 820] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 28 (0x7f62754c8000) [pid = 3347] [serial = 819] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 27 (0x7f62754c6800) [pid = 3347] [serial = 818] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 26 (0x7f62755b7c00) [pid = 3347] [serial = 817] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 25 (0x7f62755b1000) [pid = 3347] [serial = 816] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 24 (0x7f6275569000) [pid = 3347] [serial = 841] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 23 (0x7f627556e800) [pid = 3347] [serial = 815] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 22 (0x7f627556c400) [pid = 3347] [serial = 814] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 21 (0x7f62755af000) [pid = 3347] [serial = 813] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 20 (0x7f6275560400) [pid = 3347] [serial = 812] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 19 (0x7f6275565800) [pid = 3347] [serial = 840] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 18 (0x7f62756ef000) [pid = 3347] [serial = 836] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 17 (0x7f62756f4c00) [pid = 3347] [serial = 837] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 16 (0x7f62756f7c00) [pid = 3347] [serial = 838] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 15 (0x7f6276108000) [pid = 3347] [serial = 851] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 14 (0x7f6276102c00) [pid = 3347] [serial = 850] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - --DOMWINDOW == 13 (0x7f6276107000) [pid = 3347] [serial = 849] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:21 INFO - ++DOMWINDOW == 14 (0x7f62754c7000) [pid = 3347] [serial = 857] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 15 (0x7f62754c9c00) [pid = 3347] [serial = 858] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 16 (0x7f62754c9800) [pid = 3347] [serial = 859] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 17 (0x7f6275560400) [pid = 3347] [serial = 860] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 18 (0x7f62754d0400) [pid = 3347] [serial = 861] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 19 (0x7f62754c6000) [pid = 3347] [serial = 862] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 20 (0x7f6275561000) [pid = 3347] [serial = 863] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 21 (0x7f62754cc800) [pid = 3347] [serial = 864] [outer = 0x7f627559bc00] 11:52:22 INFO - ++DOMWINDOW == 22 (0x7f62754d2400) [pid = 3347] [serial = 865] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 23 (0x7f6275562800) [pid = 3347] [serial = 866] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 24 (0x7f627559ac00) [pid = 3347] [serial = 867] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 25 (0x7f627559c800) [pid = 3347] [serial = 868] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 26 (0x7f62754c6800) [pid = 3347] [serial = 869] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 27 (0x7f627559b800) [pid = 3347] [serial = 870] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 28 (0x7f62755a7400) [pid = 3347] [serial = 871] [outer = 0x7f627559bc00] 11:52:23 INFO - ++DOMWINDOW == 29 (0x7f62754c5c00) [pid = 3347] [serial = 872] [outer = 0x7f627559bc00] 11:52:24 INFO - ++DOMWINDOW == 30 (0x7f627559f000) [pid = 3347] [serial = 873] [outer = 0x7f627559bc00] 11:52:24 INFO - ++DOMWINDOW == 31 (0x7f62754d1800) [pid = 3347] [serial = 874] [outer = 0x7f627559bc00] 11:52:24 INFO - ++DOMWINDOW == 32 (0x7f6275564000) [pid = 3347] [serial = 875] [outer = 0x7f627559bc00] 11:52:24 INFO - --DOMWINDOW == 31 (0x7f62755acc00) [pid = 3347] [serial = 807] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:24 INFO - --DOMWINDOW == 30 (0x7f627556d400) [pid = 3347] [serial = 806] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_ident.html] 11:52:24 INFO - --DOMWINDOW == 29 (0x7f6275561400) [pid = 3347] [serial = 805] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:24 INFO - ++DOMWINDOW == 30 (0x7f6275561400) [pid = 3347] [serial = 876] [outer = 0x7f627559bc00] 11:52:24 INFO - --DOMWINDOW == 29 (0x7f6275563c00) [pid = 3347] [serial = 804] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_eof.html] 11:52:24 INFO - ++DOMWINDOW == 30 (0x7f6275563c00) [pid = 3347] [serial = 877] [outer = 0x7f627559bc00] 11:52:24 INFO - ++DOMWINDOW == 31 (0x7f6275562400) [pid = 3347] [serial = 878] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 32 (0x7f62755ad000) [pid = 3347] [serial = 879] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 33 (0x7f627556f800) [pid = 3347] [serial = 880] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 34 (0x7f62755af400) [pid = 3347] [serial = 881] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 35 (0x7f6275569400) [pid = 3347] [serial = 882] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 36 (0x7f62755b0000) [pid = 3347] [serial = 883] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 37 (0x7f62755b2c00) [pid = 3347] [serial = 884] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 38 (0x7f627559d000) [pid = 3347] [serial = 885] [outer = 0x7f627559bc00] 11:52:25 INFO - ++DOMWINDOW == 39 (0x7f62755b5000) [pid = 3347] [serial = 886] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 40 (0x7f62755b6000) [pid = 3347] [serial = 887] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 41 (0x7f62755af800) [pid = 3347] [serial = 888] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 42 (0x7f62755b7c00) [pid = 3347] [serial = 889] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 43 (0x7f62755b7800) [pid = 3347] [serial = 890] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 44 (0x7f62756e8800) [pid = 3347] [serial = 891] [outer = 0x7f627559bc00] 11:52:26 INFO - ++DOMWINDOW == 45 (0x7f62754d0000) [pid = 3347] [serial = 892] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 46 (0x7f62755a4400) [pid = 3347] [serial = 893] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 47 (0x7f62756ed400) [pid = 3347] [serial = 894] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 48 (0x7f62754d1000) [pid = 3347] [serial = 895] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 49 (0x7f62755abc00) [pid = 3347] [serial = 896] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 50 (0x7f62756ef000) [pid = 3347] [serial = 897] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 51 (0x7f62754c8800) [pid = 3347] [serial = 898] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 52 (0x7f62755b7400) [pid = 3347] [serial = 899] [outer = 0x7f627559bc00] 11:52:27 INFO - ++DOMWINDOW == 53 (0x7f62755b8800) [pid = 3347] [serial = 900] [outer = 0x7f627559bc00] 11:52:28 INFO - ++DOMWINDOW == 54 (0x7f62756edc00) [pid = 3347] [serial = 901] [outer = 0x7f627559bc00] 11:52:28 INFO - ++DOMWINDOW == 55 (0x7f62754c7800) [pid = 3347] [serial = 902] [outer = 0x7f627559bc00] 11:52:28 INFO - ++DOMWINDOW == 56 (0x7f62754ca400) [pid = 3347] [serial = 903] [outer = 0x7f627559bc00] 11:52:28 INFO - ++DOMWINDOW == 57 (0x7f6275561800) [pid = 3347] [serial = 904] [outer = 0x7f627559bc00] 11:52:28 INFO - ++DOMWINDOW == 58 (0x7f6275566400) [pid = 3347] [serial = 905] [outer = 0x7f627559bc00] 11:52:29 INFO - ++DOMWINDOW == 59 (0x7f627559f400) [pid = 3347] [serial = 906] [outer = 0x7f627559bc00] 11:52:29 INFO - ++DOMWINDOW == 60 (0x7f62756ecc00) [pid = 3347] [serial = 907] [outer = 0x7f627559bc00] 11:52:29 INFO - ++DOMWINDOW == 61 (0x7f62756f4400) [pid = 3347] [serial = 908] [outer = 0x7f627559bc00] 11:52:29 INFO - ++DOMWINDOW == 62 (0x7f6276102800) [pid = 3347] [serial = 909] [outer = 0x7f627559bc00] 11:52:29 INFO - ++DOMWINDOW == 63 (0x7f62756f1400) [pid = 3347] [serial = 910] [outer = 0x7f627559bc00] 11:52:30 INFO - ++DOMWINDOW == 64 (0x7f6276103000) [pid = 3347] [serial = 911] [outer = 0x7f627559bc00] 11:52:30 INFO - ++DOMWINDOW == 65 (0x7f6276103800) [pid = 3347] [serial = 912] [outer = 0x7f627559bc00] 11:52:30 INFO - ++DOMWINDOW == 66 (0x7f62756ef800) [pid = 3347] [serial = 913] [outer = 0x7f627559bc00] 11:52:30 INFO - ++DOMWINDOW == 67 (0x7f62756e9000) [pid = 3347] [serial = 914] [outer = 0x7f627559bc00] 11:52:31 INFO - ++DOMWINDOW == 68 (0x7f6276109800) [pid = 3347] [serial = 915] [outer = 0x7f627559bc00] 11:52:31 INFO - ++DOMWINDOW == 69 (0x7f627610b800) [pid = 3347] [serial = 916] [outer = 0x7f627559bc00] 11:52:31 INFO - ++DOMWINDOW == 70 (0x7f627610d800) [pid = 3347] [serial = 917] [outer = 0x7f627559bc00] 11:52:31 INFO - ++DOMWINDOW == 71 (0x7f627610e800) [pid = 3347] [serial = 918] [outer = 0x7f627559bc00] 11:52:32 INFO - ++DOMWINDOW == 72 (0x7f62754c8000) [pid = 3347] [serial = 919] [outer = 0x7f627559bc00] 11:52:32 INFO - ++DOMWINDOW == 73 (0x7f62754d1400) [pid = 3347] [serial = 920] [outer = 0x7f627559bc00] 11:52:32 INFO - ++DOMWINDOW == 74 (0x7f62754d3000) [pid = 3347] [serial = 921] [outer = 0x7f627559bc00] 11:52:32 INFO - ++DOMWINDOW == 75 (0x7f62754c5400) [pid = 3347] [serial = 922] [outer = 0x7f627559bc00] 11:52:33 INFO - --DOMWINDOW == 74 (0x7f62754cec00) [pid = 3347] [serial = 855] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 73 (0x7f62754c6400) [pid = 3347] [serial = 854] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 72 (0x7f62754c7800) [pid = 3347] [serial = 902] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 71 (0x7f62754cfc00) [pid = 3347] [serial = 856] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 70 (0x7f62754c8800) [pid = 3347] [serial = 898] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 69 (0x7f62756ef000) [pid = 3347] [serial = 897] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 68 (0x7f62755abc00) [pid = 3347] [serial = 896] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 67 (0x7f62754d1000) [pid = 3347] [serial = 895] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 66 (0x7f62756ed400) [pid = 3347] [serial = 894] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 65 (0x7f62755a4400) [pid = 3347] [serial = 893] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 64 (0x7f62754d0000) [pid = 3347] [serial = 892] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 63 (0x7f62756e8800) [pid = 3347] [serial = 891] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 62 (0x7f62755b7800) [pid = 3347] [serial = 890] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 61 (0x7f62755b7c00) [pid = 3347] [serial = 889] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 60 (0x7f62755af800) [pid = 3347] [serial = 888] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 59 (0x7f62755b6000) [pid = 3347] [serial = 887] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 58 (0x7f62755b5000) [pid = 3347] [serial = 886] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 57 (0x7f627559d000) [pid = 3347] [serial = 885] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 56 (0x7f62755b2c00) [pid = 3347] [serial = 884] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 55 (0x7f62755b0000) [pid = 3347] [serial = 883] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 54 (0x7f6275569400) [pid = 3347] [serial = 882] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 53 (0x7f62755af400) [pid = 3347] [serial = 881] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 52 (0x7f627556f800) [pid = 3347] [serial = 880] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 51 (0x7f62755ad000) [pid = 3347] [serial = 879] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 50 (0x7f6275562400) [pid = 3347] [serial = 878] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 49 (0x7f6275563c00) [pid = 3347] [serial = 877] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 48 (0x7f6275561400) [pid = 3347] [serial = 876] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 47 (0x7f6275564000) [pid = 3347] [serial = 875] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 46 (0x7f62754d1800) [pid = 3347] [serial = 874] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 45 (0x7f627559f000) [pid = 3347] [serial = 873] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 44 (0x7f62754c5c00) [pid = 3347] [serial = 872] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 43 (0x7f62755a7400) [pid = 3347] [serial = 871] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 42 (0x7f627559b800) [pid = 3347] [serial = 870] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 41 (0x7f62754c6800) [pid = 3347] [serial = 869] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 40 (0x7f627559c800) [pid = 3347] [serial = 868] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 39 (0x7f627559ac00) [pid = 3347] [serial = 867] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 38 (0x7f6275562800) [pid = 3347] [serial = 866] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 37 (0x7f62754d2400) [pid = 3347] [serial = 865] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 36 (0x7f62754cc800) [pid = 3347] [serial = 864] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 35 (0x7f6275561000) [pid = 3347] [serial = 863] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 34 (0x7f62754c6000) [pid = 3347] [serial = 862] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 33 (0x7f62754d0400) [pid = 3347] [serial = 861] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 32 (0x7f6275560400) [pid = 3347] [serial = 860] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 31 (0x7f62754c9800) [pid = 3347] [serial = 859] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 30 (0x7f62754c9c00) [pid = 3347] [serial = 858] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 29 (0x7f62754c7000) [pid = 3347] [serial = 857] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 28 (0x7f62756f4400) [pid = 3347] [serial = 908] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 27 (0x7f6275561800) [pid = 3347] [serial = 904] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 26 (0x7f62754ca400) [pid = 3347] [serial = 903] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 25 (0x7f6275566400) [pid = 3347] [serial = 905] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 24 (0x7f62756edc00) [pid = 3347] [serial = 901] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 23 (0x7f62755b7400) [pid = 3347] [serial = 899] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 22 (0x7f62755b8800) [pid = 3347] [serial = 900] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 21 (0x7f627559f400) [pid = 3347] [serial = 906] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 20 (0x7f62756ecc00) [pid = 3347] [serial = 907] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 19 (0x7f6276102800) [pid = 3347] [serial = 909] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 18 (0x7f62756f1400) [pid = 3347] [serial = 910] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 17 (0x7f6276103000) [pid = 3347] [serial = 911] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 16 (0x7f6276103800) [pid = 3347] [serial = 912] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 15 (0x7f62756e9000) [pid = 3347] [serial = 914] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 14 (0x7f6276109800) [pid = 3347] [serial = 915] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 13 (0x7f62756ef800) [pid = 3347] [serial = 913] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 12 (0x7f627610b800) [pid = 3347] [serial = 916] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 11 (0x7f627610d800) [pid = 3347] [serial = 917] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 10 (0x7f627610e800) [pid = 3347] [serial = 918] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - --DOMWINDOW == 9 (0x7f62754c8000) [pid = 3347] [serial = 919] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:33 INFO - ++DOMWINDOW == 10 (0x7f62754c7000) [pid = 3347] [serial = 923] [outer = 0x7f627559bc00] 11:52:33 INFO - ++DOMWINDOW == 11 (0x7f62754c8400) [pid = 3347] [serial = 924] [outer = 0x7f627559bc00] 11:52:33 INFO - ++DOMWINDOW == 12 (0x7f62754cbc00) [pid = 3347] [serial = 925] [outer = 0x7f627559bc00] 11:52:33 INFO - ++DOMWINDOW == 13 (0x7f62754d3c00) [pid = 3347] [serial = 926] [outer = 0x7f627559bc00] 11:52:33 INFO - ++DOMWINDOW == 14 (0x7f6275562800) [pid = 3347] [serial = 927] [outer = 0x7f627559bc00] 11:52:34 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:52:34 INFO - ++DOMWINDOW == 15 (0x7f62754d1000) [pid = 3347] [serial = 928] [outer = 0x7f627559bc00] 11:52:34 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:52:34 INFO - ++DOMWINDOW == 16 (0x7f6275564400) [pid = 3347] [serial = 929] [outer = 0x7f627559bc00] 11:52:34 INFO - ++DOMWINDOW == 17 (0x7f6275562400) [pid = 3347] [serial = 930] [outer = 0x7f627559bc00] 11:52:35 INFO - MEMORY STAT | vsize 689MB | residentFast 119MB | heapAllocated 20MB 11:52:35 INFO - 1023 INFO TEST-OK | layout/style/test/test_parse_rule.html | took 23049ms 11:52:35 INFO - ++DOMWINDOW == 18 (0x7f627559f400) [pid = 3347] [serial = 931] [outer = 0x7f6281591800] 11:52:35 INFO - 1024 INFO TEST-START | layout/style/test/test_parse_url.html 11:52:35 INFO - ++DOMWINDOW == 19 (0x7f6275566000) [pid = 3347] [serial = 932] [outer = 0x7f6281591800] 11:52:35 INFO - MEMORY STAT | vsize 689MB | residentFast 121MB | heapAllocated 21MB 11:52:35 INFO - 1025 INFO TEST-OK | layout/style/test/test_parse_url.html | took 643ms 11:52:36 INFO - ++DOMWINDOW == 20 (0x7f627559c400) [pid = 3347] [serial = 933] [outer = 0x7f6281591800] 11:52:36 INFO - 1026 INFO TEST-START | layout/style/test/test_parser_diagnostics_unprintables.html 11:52:36 INFO - ++DOMWINDOW == 21 (0x7f62755a4800) [pid = 3347] [serial = 934] [outer = 0x7f6281591800] 11:52:40 INFO - --DOMWINDOW == 20 (0x7f62755b2800) [pid = 3347] [serial = 810] [outer = 0x7f627559bc00] [url = about:blank] 11:52:40 INFO - --DOMWINDOW == 19 (0x7f62754d1400) [pid = 3347] [serial = 920] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 18 (0x7f62754d3000) [pid = 3347] [serial = 921] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOCSHELL 0x7f6278dd7800 == 2 [pid = 3347] [id = 31] 11:52:40 INFO - --DOMWINDOW == 17 (0x7f6275564400) [pid = 3347] [serial = 929] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 16 (0x7f62754d1000) [pid = 3347] [serial = 928] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 15 (0x7f6275562800) [pid = 3347] [serial = 927] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 14 (0x7f62754d3c00) [pid = 3347] [serial = 926] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 13 (0x7f62754cbc00) [pid = 3347] [serial = 925] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 12 (0x7f62754c8400) [pid = 3347] [serial = 924] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 11 (0x7f62754c7000) [pid = 3347] [serial = 923] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:40 INFO - --DOMWINDOW == 10 (0x7f62754c5400) [pid = 3347] [serial = 922] [outer = 0x7f627559bc00] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:42 INFO - --DOMWINDOW == 9 (0x7f627559c400) [pid = 3347] [serial = 933] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:42 INFO - --DOMWINDOW == 8 (0x7f6275566000) [pid = 3347] [serial = 932] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_url.html] 11:52:42 INFO - --DOMWINDOW == 7 (0x7f627559f400) [pid = 3347] [serial = 931] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:52:42 INFO - --DOMWINDOW == 6 (0x7f6275562400) [pid = 3347] [serial = 930] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:42 INFO - --DOMWINDOW == 5 (0x7f627559bc00) [pid = 3347] [serial = 809] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:52:43 INFO - MEMORY STAT | vsize 690MB | residentFast 119MB | heapAllocated 25MB 11:52:43 INFO - 1027 INFO TEST-OK | layout/style/test/test_parser_diagnostics_unprintables.html | took 7567ms 11:52:43 INFO - ++DOMWINDOW == 6 (0x7f627f40cc00) [pid = 3347] [serial = 935] [outer = 0x7f6281591800] 11:52:43 INFO - 1028 INFO TEST-START | layout/style/test/test_pixel_lengths.html 11:52:43 INFO - ++DOMWINDOW == 7 (0x7f627dc10800) [pid = 3347] [serial = 936] [outer = 0x7f6281591800] 11:52:44 INFO - MEMORY STAT | vsize 690MB | residentFast 117MB | heapAllocated 26MB 11:52:45 INFO - 1029 INFO TEST-OK | layout/style/test/test_pixel_lengths.html | took 1221ms 11:52:45 INFO - ++DOMWINDOW == 8 (0x7f627e0d7c00) [pid = 3347] [serial = 937] [outer = 0x7f6281591800] 11:52:45 INFO - 1030 INFO TEST-START | layout/style/test/test_pointer-events.html 11:52:45 INFO - ++DOMWINDOW == 9 (0x7f627e0d9400) [pid = 3347] [serial = 938] [outer = 0x7f6281591800] 11:52:45 INFO - ++DOCSHELL 0x7f627e58a800 == 3 [pid = 3347] [id = 32] 11:52:45 INFO - ++DOMWINDOW == 10 (0x7f627e0d9800) [pid = 3347] [serial = 939] [outer = (nil)] 11:52:45 INFO - ++DOMWINDOW == 11 (0x7f627e0d9c00) [pid = 3347] [serial = 940] [outer = 0x7f627e0d9800] 11:52:45 INFO - ++DOMWINDOW == 12 (0x7f627e1a6000) [pid = 3347] [serial = 941] [outer = 0x7f627e0d9800] 11:52:45 INFO - MEMORY STAT | vsize 691MB | residentFast 119MB | heapAllocated 27MB 11:52:45 INFO - 1031 INFO TEST-OK | layout/style/test/test_pointer-events.html | took 580ms 11:52:45 INFO - ++DOMWINDOW == 13 (0x7f627f411400) [pid = 3347] [serial = 942] [outer = 0x7f6281591800] 11:52:45 INFO - 1032 INFO TEST-START | layout/style/test/test_position_float_display.html 11:52:46 INFO - ++DOMWINDOW == 14 (0x7f6276110800) [pid = 3347] [serial = 943] [outer = 0x7f6281591800] 11:52:47 INFO - MEMORY STAT | vsize 691MB | residentFast 123MB | heapAllocated 32MB 11:52:47 INFO - 1033 INFO TEST-OK | layout/style/test/test_position_float_display.html | took 1404ms 11:52:47 INFO - ++DOMWINDOW == 15 (0x7f627f905400) [pid = 3347] [serial = 944] [outer = 0x7f6281591800] 11:52:47 INFO - 1034 INFO TEST-START | layout/style/test/test_position_sticky.html 11:52:47 INFO - ++DOMWINDOW == 16 (0x7f6275564000) [pid = 3347] [serial = 945] [outer = 0x7f6281591800] 11:52:47 INFO - ++DOCSHELL 0x7f62754f6800 == 4 [pid = 3347] [id = 33] 11:52:47 INFO - ++DOMWINDOW == 17 (0x7f627f909000) [pid = 3347] [serial = 946] [outer = (nil)] 11:52:47 INFO - ++DOMWINDOW == 18 (0x7f627f90ac00) [pid = 3347] [serial = 947] [outer = 0x7f627f909000] 11:52:48 INFO - ++DOMWINDOW == 19 (0x7f627f907800) [pid = 3347] [serial = 948] [outer = 0x7f627f909000] 11:52:48 INFO - MEMORY STAT | vsize 691MB | residentFast 125MB | heapAllocated 33MB 11:52:48 INFO - 1035 INFO TEST-OK | layout/style/test/test_position_sticky.html | took 687ms 11:52:48 INFO - ++DOMWINDOW == 20 (0x7f627f913400) [pid = 3347] [serial = 949] [outer = 0x7f6281591800] 11:52:48 INFO - 1036 INFO TEST-START | layout/style/test/test_priority_preservation.html 11:52:48 INFO - ++DOMWINDOW == 21 (0x7f627f908400) [pid = 3347] [serial = 950] [outer = 0x7f6281591800] 11:52:49 INFO - MEMORY STAT | vsize 691MB | residentFast 127MB | heapAllocated 33MB 11:52:49 INFO - 1037 INFO TEST-OK | layout/style/test/test_priority_preservation.html | took 1086ms 11:52:49 INFO - ++DOMWINDOW == 22 (0x7f627fd15400) [pid = 3347] [serial = 951] [outer = 0x7f6281591800] 11:52:49 INFO - 1038 INFO TEST-START | layout/style/test/test_property_database.html 11:52:50 INFO - ++DOMWINDOW == 23 (0x7f627fd17000) [pid = 3347] [serial = 952] [outer = 0x7f6281591800] 11:52:53 INFO - MEMORY STAT | vsize 692MB | residentFast 134MB | heapAllocated 41MB 11:52:53 INFO - 1039 INFO TEST-OK | layout/style/test/test_property_database.html | took 3585ms 11:52:53 INFO - ++DOMWINDOW == 24 (0x7f627a837800) [pid = 3347] [serial = 953] [outer = 0x7f6281591800] 11:52:53 INFO - 1040 INFO TEST-START | layout/style/test/test_property_syntax_errors.html 11:52:53 INFO - ++DOMWINDOW == 25 (0x7f62754c8400) [pid = 3347] [serial = 954] [outer = 0x7f6281591800] 11:52:53 INFO - ++DOCSHELL 0x7f62754f2000 == 5 [pid = 3347] [id = 34] 11:52:53 INFO - ++DOMWINDOW == 26 (0x7f6279d9ac00) [pid = 3347] [serial = 955] [outer = (nil)] 11:52:53 INFO - ++DOMWINDOW == 27 (0x7f627a837000) [pid = 3347] [serial = 956] [outer = 0x7f6279d9ac00] 11:53:16 INFO - MEMORY STAT | vsize 694MB | residentFast 187MB | heapAllocated 86MB 11:53:19 INFO - 1041 INFO TEST-OK | layout/style/test/test_property_syntax_errors.html | took 25772ms 11:53:19 INFO - ++DOMWINDOW == 28 (0x7f6275990800) [pid = 3347] [serial = 957] [outer = 0x7f6281591800] 11:53:19 INFO - 1042 INFO TEST-START | layout/style/test/test_pseudoelement_parsing.html 11:53:20 INFO - ++DOMWINDOW == 29 (0x7f6275992c00) [pid = 3347] [serial = 958] [outer = 0x7f6281591800] 11:53:20 INFO - MEMORY STAT | vsize 693MB | residentFast 174MB | heapAllocated 65MB 11:53:20 INFO - 1043 INFO TEST-OK | layout/style/test/test_pseudoelement_parsing.html | took 1068ms 11:53:21 INFO - --DOCSHELL 0x7f627e58a800 == 4 [pid = 3347] [id = 32] 11:53:21 INFO - --DOCSHELL 0x7f62754f6800 == 3 [pid = 3347] [id = 33] 11:53:21 INFO - --DOCSHELL 0x7f62754f2000 == 2 [pid = 3347] [id = 34] 11:53:21 INFO - ++DOMWINDOW == 30 (0x7f62754c9400) [pid = 3347] [serial = 959] [outer = 0x7f6281591800] 11:53:21 INFO - --DOMWINDOW == 29 (0x7f627e0d9c00) [pid = 3347] [serial = 940] [outer = 0x7f627e0d9800] [url = about:blank] 11:53:21 INFO - 1044 INFO TEST-START | layout/style/test/test_pseudoelement_state.html 11:53:21 INFO - ++DOMWINDOW == 30 (0x7f62754c8c00) [pid = 3347] [serial = 960] [outer = 0x7f6281591800] 11:53:21 INFO - ++DOCSHELL 0x7f62754f0800 == 3 [pid = 3347] [id = 35] 11:53:21 INFO - ++DOMWINDOW == 31 (0x7f627559c400) [pid = 3347] [serial = 961] [outer = (nil)] 11:53:21 INFO - ++DOMWINDOW == 32 (0x7f62755a2400) [pid = 3347] [serial = 962] [outer = 0x7f627559c400] 11:53:22 INFO - MEMORY STAT | vsize 690MB | residentFast 133MB | heapAllocated 29MB 11:53:22 INFO - 1045 INFO TEST-OK | layout/style/test/test_pseudoelement_state.html | took 1132ms 11:53:22 INFO - ++DOMWINDOW == 33 (0x7f62755ad000) [pid = 3347] [serial = 963] [outer = 0x7f6281591800] 11:53:22 INFO - 1046 INFO TEST-START | layout/style/test/test_redundant_font_download.html 11:53:22 INFO - ++DOMWINDOW == 34 (0x7f62755ad800) [pid = 3347] [serial = 964] [outer = 0x7f6281591800] 11:53:23 INFO - --DOMWINDOW == 33 (0x7f627a837800) [pid = 3347] [serial = 953] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 32 (0x7f627fd17000) [pid = 3347] [serial = 952] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_property_database.html] 11:53:23 INFO - --DOMWINDOW == 31 (0x7f62754c8400) [pid = 3347] [serial = 954] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_property_syntax_errors.html] 11:53:23 INFO - --DOMWINDOW == 30 (0x7f627a837000) [pid = 3347] [serial = 956] [outer = (nil)] [url = data:text/html,] 11:53:23 INFO - --DOMWINDOW == 29 (0x7f6275990800) [pid = 3347] [serial = 957] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 28 (0x7f627f913400) [pid = 3347] [serial = 949] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 27 (0x7f627fd15400) [pid = 3347] [serial = 951] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 26 (0x7f627dc10800) [pid = 3347] [serial = 936] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_pixel_lengths.html] 11:53:23 INFO - --DOMWINDOW == 25 (0x7f627f40cc00) [pid = 3347] [serial = 935] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 24 (0x7f627e0d7c00) [pid = 3347] [serial = 937] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 23 (0x7f627f908400) [pid = 3347] [serial = 950] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_priority_preservation.html] 11:53:23 INFO - --DOMWINDOW == 22 (0x7f627f411400) [pid = 3347] [serial = 942] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 21 (0x7f627f905400) [pid = 3347] [serial = 944] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:23 INFO - --DOMWINDOW == 20 (0x7f627f907800) [pid = 3347] [serial = 948] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_position_sticky.html] 11:53:23 INFO - --DOMWINDOW == 19 (0x7f627f90ac00) [pid = 3347] [serial = 947] [outer = (nil)] [url = about:blank] 11:53:23 INFO - --DOMWINDOW == 18 (0x7f6279d9ac00) [pid = 3347] [serial = 955] [outer = (nil)] [url = data:text/html,] 11:53:23 INFO - --DOMWINDOW == 17 (0x7f627e0d9800) [pid = 3347] [serial = 939] [outer = (nil)] [url = about:blank] 11:53:23 INFO - --DOMWINDOW == 16 (0x7f627f909000) [pid = 3347] [serial = 946] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/file_position_sticky.html] 11:53:23 INFO - --DOMWINDOW == 15 (0x7f62755afc00) [pid = 3347] [serial = 808] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parse_rule.html] 11:53:23 INFO - --DOMWINDOW == 14 (0x7f6276110800) [pid = 3347] [serial = 943] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_position_float_display.html] 11:53:23 INFO - --DOMWINDOW == 13 (0x7f6275564000) [pid = 3347] [serial = 945] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_position_sticky.html] 11:53:23 INFO - --DOMWINDOW == 12 (0x7f62755a4800) [pid = 3347] [serial = 934] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_parser_diagnostics_unprintables.html] 11:53:24 INFO - MEMORY STAT | vsize 690MB | residentFast 131MB | heapAllocated 28MB 11:53:24 INFO - 1047 INFO TEST-OK | layout/style/test/test_redundant_font_download.html | took 2145ms 11:53:24 INFO - ++DOMWINDOW == 13 (0x7f627597e000) [pid = 3347] [serial = 965] [outer = 0x7f6281591800] 11:53:24 INFO - 1048 INFO TEST-START | layout/style/test/test_rem_unit.html 11:53:25 INFO - ++DOMWINDOW == 14 (0x7f6275981000) [pid = 3347] [serial = 966] [outer = 0x7f6281591800] 11:53:25 INFO - MEMORY STAT | vsize 690MB | residentFast 131MB | heapAllocated 29MB 11:53:25 INFO - 1049 INFO TEST-OK | layout/style/test/test_rem_unit.html | took 295ms 11:53:25 INFO - ++DOMWINDOW == 15 (0x7f62755b2c00) [pid = 3347] [serial = 967] [outer = 0x7f6281591800] 11:53:25 INFO - 1050 INFO TEST-START | layout/style/test/test_root_node_display.html 11:53:25 INFO - ++DOMWINDOW == 16 (0x7f62755b3000) [pid = 3347] [serial = 968] [outer = 0x7f6281591800] 11:53:25 INFO - MEMORY STAT | vsize 690MB | residentFast 127MB | heapAllocated 32MB 11:53:26 INFO - 1051 INFO TEST-OK | layout/style/test/test_root_node_display.html | took 632ms 11:53:26 INFO - ++DOMWINDOW == 17 (0x7f6275987800) [pid = 3347] [serial = 969] [outer = 0x7f6281591800] 11:53:26 INFO - 1052 INFO TEST-START | layout/style/test/test_rule_insertion.html 11:53:26 INFO - ++DOMWINDOW == 18 (0x7f6275988400) [pid = 3347] [serial = 970] [outer = 0x7f6281591800] 11:53:28 INFO - MEMORY STAT | vsize 706MB | residentFast 133MB | heapAllocated 37MB 11:53:28 INFO - 1053 INFO TEST-OK | layout/style/test/test_rule_insertion.html | took 2476ms 11:53:28 INFO - ++DOMWINDOW == 19 (0x7f62754d3800) [pid = 3347] [serial = 971] [outer = 0x7f6281591800] 11:53:28 INFO - 1054 INFO TEST-START | layout/style/test/test_rule_serialization.html 11:53:29 INFO - ++DOMWINDOW == 20 (0x7f62754d4c00) [pid = 3347] [serial = 972] [outer = 0x7f6281591800] 11:53:29 INFO - MEMORY STAT | vsize 706MB | residentFast 134MB | heapAllocated 36MB 11:53:29 INFO - 1055 INFO TEST-OK | layout/style/test/test_rule_serialization.html | took 469ms 11:53:29 INFO - ++DOMWINDOW == 21 (0x7f6275564800) [pid = 3347] [serial = 973] [outer = 0x7f6281591800] 11:53:29 INFO - 1056 INFO TEST-START | layout/style/test/test_rules_out_of_sheets.html 11:53:29 INFO - ++DOMWINDOW == 22 (0x7f6275566c00) [pid = 3347] [serial = 974] [outer = 0x7f6281591800] 11:53:29 INFO - --DOCSHELL 0x7f62754f0800 == 2 [pid = 3347] [id = 35] 11:53:29 INFO - --DOMWINDOW == 21 (0x7f627e0d9400) [pid = 3347] [serial = 938] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_pointer-events.html] 11:53:29 INFO - --DOMWINDOW == 20 (0x7f627e1a6000) [pid = 3347] [serial = 941] [outer = (nil)] [url = about:blank] 11:53:30 INFO - --DOMWINDOW == 19 (0x7f62755b2c00) [pid = 3347] [serial = 967] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 18 (0x7f6275981000) [pid = 3347] [serial = 966] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_rem_unit.html] 11:53:30 INFO - --DOMWINDOW == 17 (0x7f627597e000) [pid = 3347] [serial = 965] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 16 (0x7f62755ad000) [pid = 3347] [serial = 963] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 15 (0x7f62755a2400) [pid = 3347] [serial = 962] [outer = (nil)] [url = data:text/html,
] 11:53:30 INFO - --DOMWINDOW == 14 (0x7f62754c9400) [pid = 3347] [serial = 959] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 13 (0x7f62754d3800) [pid = 3347] [serial = 971] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 12 (0x7f6275992c00) [pid = 3347] [serial = 958] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_pseudoelement_parsing.html] 11:53:30 INFO - --DOMWINDOW == 11 (0x7f627559c400) [pid = 3347] [serial = 961] [outer = (nil)] [url = data:text/html,
] 11:53:30 INFO - --DOMWINDOW == 10 (0x7f62754c8c00) [pid = 3347] [serial = 960] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_pseudoelement_state.html] 11:53:30 INFO - --DOMWINDOW == 9 (0x7f6275988400) [pid = 3347] [serial = 970] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_rule_insertion.html] 11:53:30 INFO - --DOMWINDOW == 8 (0x7f6275987800) [pid = 3347] [serial = 969] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 7 (0x7f6275564800) [pid = 3347] [serial = 973] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:30 INFO - --DOMWINDOW == 6 (0x7f62755b3000) [pid = 3347] [serial = 968] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_root_node_display.html] 11:53:30 INFO - --DOMWINDOW == 5 (0x7f62755ad800) [pid = 3347] [serial = 964] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_redundant_font_download.html] 11:53:30 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:53:30 INFO - JavaScript error: , line 0: NetworkError: A network error occurred. 11:53:31 INFO - MEMORY STAT | vsize 702MB | residentFast 115MB | heapAllocated 20MB 11:53:31 INFO - 1057 INFO TEST-OK | layout/style/test/test_rules_out_of_sheets.html | took 1606ms 11:53:31 INFO - ++DOMWINDOW == 6 (0x7f62754d2800) [pid = 3347] [serial = 975] [outer = 0x7f6281591800] 11:53:31 INFO - 1058 INFO TEST-START | layout/style/test/test_selectors.html 11:53:31 INFO - ++DOMWINDOW == 7 (0x7f62754d1400) [pid = 3347] [serial = 976] [outer = 0x7f6281591800] 11:53:31 INFO - ++DOCSHELL 0x7f62754f1000 == 3 [pid = 3347] [id = 36] 11:53:31 INFO - ++DOMWINDOW == 8 (0x7f62754c9c00) [pid = 3347] [serial = 977] [outer = (nil)] 11:53:31 INFO - ++DOCSHELL 0x7f62754f5000 == 4 [pid = 3347] [id = 37] 11:53:31 INFO - ++DOMWINDOW == 9 (0x7f6275561800) [pid = 3347] [serial = 978] [outer = (nil)] 11:53:31 INFO - ++DOMWINDOW == 10 (0x7f6275565000) [pid = 3347] [serial = 979] [outer = 0x7f62754c9c00] 11:53:31 INFO - ++DOMWINDOW == 11 (0x7f6275566400) [pid = 3347] [serial = 980] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 12 (0x7f62754c7400) [pid = 3347] [serial = 981] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 13 (0x7f62754c8000) [pid = 3347] [serial = 982] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 14 (0x7f627559a800) [pid = 3347] [serial = 983] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 15 (0x7f62755a0c00) [pid = 3347] [serial = 984] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 16 (0x7f62755ae800) [pid = 3347] [serial = 985] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 17 (0x7f62755b3c00) [pid = 3347] [serial = 986] [outer = 0x7f6275561800] 11:53:37 INFO - ++DOMWINDOW == 18 (0x7f62756ecc00) [pid = 3347] [serial = 987] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 19 (0x7f62756f2800) [pid = 3347] [serial = 988] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 20 (0x7f62755ad000) [pid = 3347] [serial = 989] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 21 (0x7f62757f1800) [pid = 3347] [serial = 990] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 22 (0x7f62757f7c00) [pid = 3347] [serial = 991] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 23 (0x7f62754d2c00) [pid = 3347] [serial = 992] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 24 (0x7f627559f400) [pid = 3347] [serial = 993] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 25 (0x7f62754c7000) [pid = 3347] [serial = 994] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 26 (0x7f62754cf400) [pid = 3347] [serial = 995] [outer = 0x7f6275561800] 11:53:38 INFO - ++DOMWINDOW == 27 (0x7f62754cdc00) [pid = 3347] [serial = 996] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 28 (0x7f62754d0400) [pid = 3347] [serial = 997] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 29 (0x7f62756edc00) [pid = 3347] [serial = 998] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 30 (0x7f62756f6800) [pid = 3347] [serial = 999] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 31 (0x7f62756eec00) [pid = 3347] [serial = 1000] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 32 (0x7f62757f4400) [pid = 3347] [serial = 1001] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 33 (0x7f6275989c00) [pid = 3347] [serial = 1002] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 34 (0x7f627597fc00) [pid = 3347] [serial = 1003] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 35 (0x7f62757f7800) [pid = 3347] [serial = 1004] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 36 (0x7f6275982c00) [pid = 3347] [serial = 1005] [outer = 0x7f6275561800] 11:53:39 INFO - ++DOMWINDOW == 37 (0x7f6275985c00) [pid = 3347] [serial = 1006] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 38 (0x7f6275988000) [pid = 3347] [serial = 1007] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 39 (0x7f627559b800) [pid = 3347] [serial = 1008] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 40 (0x7f62756ed000) [pid = 3347] [serial = 1009] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 41 (0x7f6275fe3000) [pid = 3347] [serial = 1010] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 42 (0x7f62755b4400) [pid = 3347] [serial = 1011] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 43 (0x7f6275fddc00) [pid = 3347] [serial = 1012] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 44 (0x7f6276109800) [pid = 3347] [serial = 1013] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 45 (0x7f6275fe4800) [pid = 3347] [serial = 1014] [outer = 0x7f6275561800] 11:53:40 INFO - ++DOMWINDOW == 46 (0x7f627610e000) [pid = 3347] [serial = 1015] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 47 (0x7f62763d3c00) [pid = 3347] [serial = 1016] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 48 (0x7f6276103800) [pid = 3347] [serial = 1017] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 49 (0x7f62763d2400) [pid = 3347] [serial = 1018] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 50 (0x7f627556cc00) [pid = 3347] [serial = 1019] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 51 (0x7f62757f1c00) [pid = 3347] [serial = 1020] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 52 (0x7f62763dac00) [pid = 3347] [serial = 1021] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 53 (0x7f6275982400) [pid = 3347] [serial = 1022] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 54 (0x7f6275c8c000) [pid = 3347] [serial = 1023] [outer = 0x7f6275561800] 11:53:41 INFO - ++DOMWINDOW == 55 (0x7f6276485000) [pid = 3347] [serial = 1024] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 56 (0x7f62763dd400) [pid = 3347] [serial = 1025] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 57 (0x7f62765c4000) [pid = 3347] [serial = 1026] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 58 (0x7f62765cdc00) [pid = 3347] [serial = 1027] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 59 (0x7f62763d4c00) [pid = 3347] [serial = 1028] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 60 (0x7f62765cd000) [pid = 3347] [serial = 1029] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 61 (0x7f62768e7400) [pid = 3347] [serial = 1030] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 62 (0x7f6275983800) [pid = 3347] [serial = 1031] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 63 (0x7f627610a000) [pid = 3347] [serial = 1032] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 64 (0x7f62768ea400) [pid = 3347] [serial = 1033] [outer = 0x7f6275561800] 11:53:42 INFO - ++DOMWINDOW == 65 (0x7f62754d1000) [pid = 3347] [serial = 1034] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 66 (0x7f6275569400) [pid = 3347] [serial = 1035] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 67 (0x7f627556f800) [pid = 3347] [serial = 1036] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 68 (0x7f62755b7800) [pid = 3347] [serial = 1037] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 69 (0x7f62756f4800) [pid = 3347] [serial = 1038] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 70 (0x7f62757ed400) [pid = 3347] [serial = 1039] [outer = 0x7f6275561800] 11:53:43 INFO - ++DOMWINDOW == 71 (0x7f62757f8000) [pid = 3347] [serial = 1040] [outer = 0x7f6275561800] 11:53:44 INFO - ++DOMWINDOW == 72 (0x7f62754cec00) [pid = 3347] [serial = 1041] [outer = 0x7f6275561800] 11:53:44 INFO - ++DOMWINDOW == 73 (0x7f62754c5800) [pid = 3347] [serial = 1042] [outer = 0x7f6275561800] 11:53:44 INFO - --DOMWINDOW == 72 (0x7f62754d4c00) [pid = 3347] [serial = 972] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_rule_serialization.html] 11:53:44 INFO - ++DOMWINDOW == 73 (0x7f62754c6000) [pid = 3347] [serial = 1043] [outer = 0x7f6275561800] 11:53:44 INFO - ++DOMWINDOW == 74 (0x7f62754cd400) [pid = 3347] [serial = 1044] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 75 (0x7f62754c8800) [pid = 3347] [serial = 1045] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 76 (0x7f6275566000) [pid = 3347] [serial = 1046] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 77 (0x7f62754d2000) [pid = 3347] [serial = 1047] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 78 (0x7f627559c800) [pid = 3347] [serial = 1048] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 79 (0x7f62755ac800) [pid = 3347] [serial = 1049] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 80 (0x7f62755acc00) [pid = 3347] [serial = 1050] [outer = 0x7f6275561800] 11:53:45 INFO - ++DOMWINDOW == 81 (0x7f62755b0800) [pid = 3347] [serial = 1051] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 82 (0x7f62755b6000) [pid = 3347] [serial = 1052] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 83 (0x7f62754cb800) [pid = 3347] [serial = 1053] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 84 (0x7f62754cc800) [pid = 3347] [serial = 1054] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 85 (0x7f62756ea800) [pid = 3347] [serial = 1055] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 86 (0x7f62756ea000) [pid = 3347] [serial = 1056] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 87 (0x7f62756ea400) [pid = 3347] [serial = 1057] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 88 (0x7f62754c5c00) [pid = 3347] [serial = 1058] [outer = 0x7f6275561800] 11:53:46 INFO - ++DOMWINDOW == 89 (0x7f62754c6c00) [pid = 3347] [serial = 1059] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 90 (0x7f627559e400) [pid = 3347] [serial = 1060] [outer = 0x7f6275561800] 11:53:47 INFO - --DOMWINDOW == 89 (0x7f62754d2800) [pid = 3347] [serial = 975] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:53:47 INFO - --DOMWINDOW == 88 (0x7f62754c7400) [pid = 3347] [serial = 981] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255D%257B%2520z-index%253A%25203%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255D%257B%2520z-index%253A%25203%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 87 (0x7f62754c8000) [pid = 3347] [serial = 982] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522x%2522%255D%257B%2520z-index%253A%25206%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522x%2522%255D%257B%2520z-index%253A%25206%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 86 (0x7f627559a800) [pid = 3347] [serial = 983] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2527x%2527%255D%257B%2520z-index%253A%25209%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2527x%2527%255D%257B%2520z-index%253A%25209%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 85 (0x7f62755a0c00) [pid = 3347] [serial = 984] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253Dx%255D%257B%2520z-index%253A%252012%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253Dx%255D%257B%2520z-index%253A%252012%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 84 (0x7f62755ae800) [pid = 3347] [serial = 985] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522%2522%255D%257B%2520z-index%253A%252015%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522%2522%255D%257B%2520z-index%253A%252015%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 83 (0x7f62755b3c00) [pid = 3347] [serial = 986] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2527%2527%255D%257B%2520z-index%253A%252018%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2527%2527%255D%257B%2520z-index%253A%252018%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 82 (0x7f62756ecc00) [pid = 3347] [serial = 987] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252021%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252021%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 81 (0x7f62756f2800) [pid = 3347] [serial = 988] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Btitle%253D%2522%2522%255D%257B%2520z-index%253A%252028%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Btitle%253D%2522%2522%255D%257B%2520z-index%253A%252028%2520%257D%27%3E%3Cbody%3E%3Cp%20title%3D%22%22%3E%3C/p%3E%3Cdiv%20lang%3D%22%20%22%3E%3C/div%3E%3Cdiv%20lang%3D%22%09%22%3E%3C/div%3E%3Cdiv%20lang%3D%22%0A%22%3E%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 80 (0x7f62755ad000) [pid = 3347] [serial = 989] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522x%2522%255D%257B%2520z-index%253A%252031%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522x%2522%255D%257B%2520z-index%253A%252031%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 79 (0x7f62757f1800) [pid = 3347] [serial = 990] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2527x%2527%255D%257B%2520z-index%253A%252034%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2527x%2527%255D%257B%2520z-index%253A%252034%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 78 (0x7f62757f7c00) [pid = 3347] [serial = 991] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253Dx%255D%257B%2520z-index%253A%252037%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253Dx%255D%257B%2520z-index%253A%252037%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 77 (0x7f62754d2c00) [pid = 3347] [serial = 992] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522%2522%255D%257B%2520z-index%253A%252040%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522%2522%255D%257B%2520z-index%253A%252040%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 76 (0x7f627559f400) [pid = 3347] [serial = 993] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2527%2527%255D%257B%2520z-index%253A%252043%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2527%2527%255D%257B%2520z-index%253A%252043%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 75 (0x7f62754c7000) [pid = 3347] [serial = 994] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252046%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257E%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252046%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 74 (0x7f62754cf400) [pid = 3347] [serial = 995] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%257E%253D%2522x%2520x%2522%255D%257B%2520z-index%253A%252053%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%257E%253D%2522x%2520x%2522%255D%257B%2520z-index%253A%252053%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22x%20x%22%3E%3C/div%3E%3Cdiv%20class%3D%22x%22%3E%3C/div%3E%3Cdiv%20class%3D%22x%09x%22%3E%3C/div%3Ediv%20class%3D%22x%0Ax%22%3E%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 73 (0x7f62754cdc00) [pid = 3347] [serial = 996] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2522x%2522%255D%257B%2520z-index%253A%252056%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2522x%2522%255D%257B%2520z-index%253A%252056%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 72 (0x7f62754d0400) [pid = 3347] [serial = 997] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2527x%2527%255D%257B%2520z-index%253A%252059%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2527x%2527%255D%257B%2520z-index%253A%252059%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 71 (0x7f62756edc00) [pid = 3347] [serial = 998] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253Dx%255D%257B%2520z-index%253A%252062%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253Dx%255D%257B%2520z-index%253A%252062%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 70 (0x7f62756f6800) [pid = 3347] [serial = 999] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2522%2522%255D%257B%2520z-index%253A%252065%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2522%2522%255D%257B%2520z-index%253A%252065%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 69 (0x7f62756eec00) [pid = 3347] [serial = 1000] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2527%2527%255D%257B%2520z-index%253A%252068%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%257C%253D%2527%2527%255D%257B%2520z-index%253A%252068%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 68 (0x7f62757f4400) [pid = 3347] [serial = 1001] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Blang%257C%253D%2522%2522%255D%257B%2520z-index%253A%252073%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Blang%257C%253D%2522%2522%255D%257B%2520z-index%253A%252073%2520%257D%27%3E%3Cbody%3E%3Cp%20lang%3D%22%22%3E%3C/p%3E%3Cp%20lang%3D%22-%22%3E%3C/p%3E%3Cp%20lang%3D%22-GB%22%3E%3C/p%3E%3Cdiv%20lang%3D%22en-GB%22%3E%3C/div%3E%3Cdiv%20lang%3D%22en-%22%3E%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 67 (0x7f6275989c00) [pid = 3347] [serial = 1002] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522x%2522%255D%257B%2520z-index%253A%252076%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522x%2522%255D%257B%2520z-index%253A%252076%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 66 (0x7f627597fc00) [pid = 3347] [serial = 1003] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2527x%2527%255D%257B%2520z-index%253A%252079%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2527x%2527%255D%257B%2520z-index%253A%252079%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 65 (0x7f62757f7800) [pid = 3347] [serial = 1004] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253Dx%255D%257B%2520z-index%253A%252082%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253Dx%255D%257B%2520z-index%253A%252082%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 64 (0x7f6275982c00) [pid = 3347] [serial = 1005] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522%2522%255D%257B%2520z-index%253A%252085%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522%2522%255D%257B%2520z-index%253A%252085%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 63 (0x7f6275985c00) [pid = 3347] [serial = 1006] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2527%2527%255D%257B%2520z-index%253A%252088%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2527%2527%255D%257B%2520z-index%253A%252088%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 62 (0x7f6275988000) [pid = 3347] [serial = 1007] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252091%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%2524%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%252091%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 61 (0x7f627559b800) [pid = 3347] [serial = 1008] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522x%2522%255D%257B%2520z-index%253A%252098%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522x%2522%255D%257B%2520z-index%253A%252098%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 60 (0x7f62756ed000) [pid = 3347] [serial = 1009] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2527x%2527%255D%257B%2520z-index%253A%2520101%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2527x%2527%255D%257B%2520z-index%253A%2520101%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 59 (0x7f6275fe3000) [pid = 3347] [serial = 1010] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253Dx%255D%257B%2520z-index%253A%2520104%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253Dx%255D%257B%2520z-index%253A%2520104%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 58 (0x7f62755b4400) [pid = 3347] [serial = 1011] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522%2522%255D%257B%2520z-index%253A%2520107%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522%2522%255D%257B%2520z-index%253A%2520107%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 57 (0x7f6275fddc00) [pid = 3347] [serial = 1012] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2527%2527%255D%257B%2520z-index%253A%2520110%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2527%2527%255D%257B%2520z-index%253A%2520110%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 56 (0x7f6276109800) [pid = 3347] [serial = 1013] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%2520113%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr%255E%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%2520113%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 55 (0x7f6275fe4800) [pid = 3347] [serial = 1014] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522x%2522%255D%257B%2520z-index%253A%2520120%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522x%2522%255D%257B%2520z-index%253A%2520120%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 54 (0x7f627610e000) [pid = 3347] [serial = 1015] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2527x%2527%255D%257B%2520z-index%253A%2520123%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2527x%2527%255D%257B%2520z-index%253A%2520123%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 53 (0x7f62763d3c00) [pid = 3347] [serial = 1016] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253Dx%255D%257B%2520z-index%253A%2520126%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253Dx%255D%257B%2520z-index%253A%2520126%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 52 (0x7f6276103800) [pid = 3347] [serial = 1017] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522%2522%255D%257B%2520z-index%253A%2520129%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522%2522%255D%257B%2520z-index%253A%2520129%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 51 (0x7f62763d2400) [pid = 3347] [serial = 1018] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2527%2527%255D%257B%2520z-index%253A%2520132%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2527%2527%255D%257B%2520z-index%253A%2520132%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 50 (0x7f627556cc00) [pid = 3347] [serial = 1019] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%2520135%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%255Battr*%253D%2522foo%2520bar%2522%255D%257B%2520z-index%253A%2520135%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 49 (0x7f62757f1c00) [pid = 3347] [serial = 1020] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%2520%257E%2520div%2520p%257B%2520z-index%253A%2520142%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%2520%257E%2520div%2520p%257B%2520z-index%253A%2520142%2520%257D%27%3E%3Cbody%3E%3Cdiv%3E%3C/div%3E%3Cdiv%3E%3Cdiv%3E%3Cp%3Ematch%3C/p%3E%3C/div%3E%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 48 (0x7f62763dac00) [pid = 3347] [serial = 1021] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%255Battr%2524%253D%2522%2522%255D%257B%2520z-index%253A%2520145%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%255Battr%2524%253D%2522%2522%255D%257B%2520z-index%253A%2520145%2520%257D%27%3E%3Cbody%3E%3Cp%20attr%3D%22foo%22%3EThis%20should%20not%20match%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 47 (0x7f6275982400) [pid = 3347] [serial = 1022] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%2520+%2520p%255Battr%257E%253D%2522%2522%255D%257B%2520z-index%253A%2520148%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%2520+%2520p%255Battr%257E%253D%2522%2522%255D%257B%2520z-index%253A%2520148%2520%257D%27%3E%3Cbody%3E%3Cdiv%3EDummy%3C/div%3E%3Cp%20attr%3D%22foo%22%3EThis%20should%20not%20match%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 46 (0x7f6275c8c000) [pid = 3347] [serial = 1023] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%255Battr%255E%253D%2522%2522%255D%257B%2520z-index%253A%2520151%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%255Battr%255E%253D%2522%2522%255D%257B%2520z-index%253A%2520151%2520%257D%27%3E%3Cbody%3E%3Cdiv%20attr%3D%22dummy1%22%3EDummy%3C/div%3E%3Cdiv%20attr%3D%22dummy2%22%3EDummy%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 45 (0x7f6276485000) [pid = 3347] [serial = 1024] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%255Battr*%253D%2522%2522%255D%257B%2520z-index%253A%2520154%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cdiv%255Battr*%253D%2522%2522%255D%257B%2520z-index%253A%2520154%2520%257D%27%3E%3Cbody%3E%3Cdiv%20attr%3D%22dummy1%22%3EDummy%3C/div%3E%3Cdiv%20attr%3D%22dummy2%22%3EDummy%3C/div%3E] 11:53:47 INFO - --DOMWINDOW == 44 (0x7f62763dd400) [pid = 3347] [serial = 1025] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528%2520odd%2529%257B%2520z-index%253A%2520161%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528%2520odd%2529%257B%2520z-index%253A%2520161%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 43 (0x7f62765c4000) [pid = 3347] [serial = 1026] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528even%2520%2529%257B%2520z-index%253A%2520164%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528even%2520%2529%257B%2520z-index%253A%2520164%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 42 (0x7f6275566c00) [pid = 3347] [serial = 974] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_rules_out_of_sheets.html] 11:53:47 INFO - --DOMWINDOW == 41 (0x7f62768ea400) [pid = 3347] [serial = 1033] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-n+%25206%2529%257B%2520z-index%253A%2520199%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-n+%25206%2529%257B%2520z-index%253A%2520199%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 40 (0x7f6275569400) [pid = 3347] [serial = 1035] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25283%2529%257B%2520z-index%253A%2520211%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25283%2529%257B%2520z-index%253A%2520211%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 39 (0x7f627556f800) [pid = 3347] [serial = 1036] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528-3%2529%257B%2520z-index%253A%2520214%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528-3%2529%257B%2520z-index%253A%2520214%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 38 (0x7f62755b7800) [pid = 3347] [serial = 1037] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528+3%2529%257B%2520z-index%253A%2520217%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528+3%2529%257B%2520z-index%253A%2520217%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 37 (0x7f62756f4800) [pid = 3347] [serial = 1038] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25280%2529%257B%2520z-index%253A%2520220%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25280%2529%257B%2520z-index%253A%2520220%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 36 (0x7f62757ed400) [pid = 3347] [serial = 1039] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0%2529%257B%2520z-index%253A%2520223%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0%2529%257B%2520z-index%253A%2520223%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 35 (0x7f62757f8000) [pid = 3347] [serial = 1040] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%25283n%2529%257B%2520z-index%253A%2520226%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%25283n%2529%257B%2520z-index%253A%2520226%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 34 (0x7f62754d1000) [pid = 3347] [serial = 1034] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+6%2520%2529%257B%2520z-index%253A%2520202%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+6%2520%2529%257B%2520z-index%253A%2520202%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 33 (0x7f627610a000) [pid = 3347] [serial = 1032] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+3n%2520-%25202%2520%2529%257B%2520z-index%253A%2520196%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+3n%2520-%25202%2520%2529%257B%2520z-index%253A%2520196%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 32 (0x7f6275983800) [pid = 3347] [serial = 1031] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%25203n%2520+%25201%2520%2529%257B%2520z-index%253A%2520193%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%25203n%2520+%25201%2520%2529%257B%2520z-index%253A%2520193%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 31 (0x7f62768e7400) [pid = 3347] [serial = 1030] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528-2n%2520%2529%257B%2520z-index%253A%2520176%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528-2n%2520%2529%257B%2520z-index%253A%2520176%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 30 (0x7f62765cdc00) [pid = 3347] [serial = 1027] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n%2520%2529%257B%2520z-index%253A%2520167%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n%2520%2529%257B%2520z-index%253A%2520167%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 29 (0x7f62763d4c00) [pid = 3347] [serial = 1028] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528%25202n%2529%257B%2520z-index%253A%2520170%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528%25202n%2529%257B%2520z-index%253A%2520170%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - --DOMWINDOW == 28 (0x7f62765cd000) [pid = 3347] [serial = 1029] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528%2520-n%2529%257B%2520z-index%253A%2520173%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528%2520-n%2529%257B%2520z-index%253A%2520173%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:47 INFO - ++DOMWINDOW == 29 (0x7f62754d0400) [pid = 3347] [serial = 1061] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 30 (0x7f62754d1000) [pid = 3347] [serial = 1062] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 31 (0x7f62754c8000) [pid = 3347] [serial = 1063] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 32 (0x7f62754cdc00) [pid = 3347] [serial = 1064] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 33 (0x7f62756eec00) [pid = 3347] [serial = 1065] [outer = 0x7f6275561800] 11:53:47 INFO - ++DOMWINDOW == 34 (0x7f62756ed000) [pid = 3347] [serial = 1066] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 35 (0x7f62757ef000) [pid = 3347] [serial = 1067] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 36 (0x7f62756ecc00) [pid = 3347] [serial = 1068] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 37 (0x7f62756f4400) [pid = 3347] [serial = 1069] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 38 (0x7f62754ce400) [pid = 3347] [serial = 1070] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 39 (0x7f6275560800) [pid = 3347] [serial = 1071] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 40 (0x7f62757f6400) [pid = 3347] [serial = 1072] [outer = 0x7f6275561800] 11:53:48 INFO - ++DOMWINDOW == 41 (0x7f62757f3c00) [pid = 3347] [serial = 1073] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 42 (0x7f62754c7000) [pid = 3347] [serial = 1074] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 43 (0x7f62755ad000) [pid = 3347] [serial = 1075] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 44 (0x7f62757f6000) [pid = 3347] [serial = 1076] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 45 (0x7f6275c8c800) [pid = 3347] [serial = 1077] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 46 (0x7f6275c8f000) [pid = 3347] [serial = 1078] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 47 (0x7f6275c8f400) [pid = 3347] [serial = 1079] [outer = 0x7f6275561800] 11:53:49 INFO - ++DOMWINDOW == 48 (0x7f62757fc000) [pid = 3347] [serial = 1080] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 49 (0x7f6275c8d000) [pid = 3347] [serial = 1081] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 50 (0x7f6275c8ec00) [pid = 3347] [serial = 1082] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 51 (0x7f62755ae800) [pid = 3347] [serial = 1083] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 52 (0x7f62757efc00) [pid = 3347] [serial = 1084] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 53 (0x7f6275c99800) [pid = 3347] [serial = 1085] [outer = 0x7f6275561800] 11:53:50 INFO - ++DOMWINDOW == 54 (0x7f62754c8c00) [pid = 3347] [serial = 1086] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 55 (0x7f62754ca800) [pid = 3347] [serial = 1087] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 56 (0x7f62755a0c00) [pid = 3347] [serial = 1088] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 57 (0x7f62755b2c00) [pid = 3347] [serial = 1089] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 58 (0x7f62756e9000) [pid = 3347] [serial = 1090] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 59 (0x7f6275c8c000) [pid = 3347] [serial = 1091] [outer = 0x7f6275561800] 11:53:51 INFO - ++DOMWINDOW == 60 (0x7f627559c000) [pid = 3347] [serial = 1092] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 61 (0x7f6275fda800) [pid = 3347] [serial = 1093] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 62 (0x7f62754cd800) [pid = 3347] [serial = 1094] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 63 (0x7f6275562000) [pid = 3347] [serial = 1095] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 64 (0x7f6275c99000) [pid = 3347] [serial = 1096] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 65 (0x7f6275599800) [pid = 3347] [serial = 1097] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 66 (0x7f6275fe4000) [pid = 3347] [serial = 1098] [outer = 0x7f6275561800] 11:53:52 INFO - ++DOMWINDOW == 67 (0x7f6276107400) [pid = 3347] [serial = 1099] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 68 (0x7f627559e000) [pid = 3347] [serial = 1100] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 69 (0x7f62754cbc00) [pid = 3347] [serial = 1101] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 70 (0x7f6275fdd000) [pid = 3347] [serial = 1102] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 71 (0x7f6275fe3800) [pid = 3347] [serial = 1103] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 72 (0x7f6276107000) [pid = 3347] [serial = 1104] [outer = 0x7f6275561800] 11:53:53 INFO - ++DOMWINDOW == 73 (0x7f6275fd8c00) [pid = 3347] [serial = 1105] [outer = 0x7f6275561800] 11:53:54 INFO - ++DOMWINDOW == 74 (0x7f62754d2800) [pid = 3347] [serial = 1106] [outer = 0x7f6275561800] 11:53:54 INFO - ++DOMWINDOW == 75 (0x7f62754ce800) [pid = 3347] [serial = 1107] [outer = 0x7f6275561800] 11:53:54 INFO - ++DOMWINDOW == 76 (0x7f6275565800) [pid = 3347] [serial = 1108] [outer = 0x7f6275561800] 11:53:54 INFO - ++DOMWINDOW == 77 (0x7f627556c400) [pid = 3347] [serial = 1109] [outer = 0x7f6275561800] 11:53:54 INFO - ++DOMWINDOW == 78 (0x7f627559d000) [pid = 3347] [serial = 1110] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 79 (0x7f6275561c00) [pid = 3347] [serial = 1111] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 80 (0x7f62755ac400) [pid = 3347] [serial = 1112] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 81 (0x7f62755abc00) [pid = 3347] [serial = 1113] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 82 (0x7f62755b1c00) [pid = 3347] [serial = 1114] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 83 (0x7f62755b2800) [pid = 3347] [serial = 1115] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 84 (0x7f627556c800) [pid = 3347] [serial = 1116] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 85 (0x7f62756e9c00) [pid = 3347] [serial = 1117] [outer = 0x7f6275561800] 11:53:55 INFO - ++DOMWINDOW == 86 (0x7f62754c8400) [pid = 3347] [serial = 1118] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 87 (0x7f62755b2400) [pid = 3347] [serial = 1119] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 88 (0x7f62756ee800) [pid = 3347] [serial = 1120] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 89 (0x7f62756ebc00) [pid = 3347] [serial = 1121] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 90 (0x7f62754c7400) [pid = 3347] [serial = 1122] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 91 (0x7f62754c9400) [pid = 3347] [serial = 1123] [outer = 0x7f6275561800] 11:53:56 INFO - --DOMWINDOW == 90 (0x7f62754c5800) [pid = 3347] [serial = 1042] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528+3n%2529%257B%2520z-index%253A%2520232%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528+3n%2529%257B%2520z-index%253A%2520232%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 89 (0x7f62754c6000) [pid = 3347] [serial = 1043] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25280n%2529%257B%2520z-index%253A%2520235%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25280n%2529%257B%2520z-index%253A%2520235%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 88 (0x7f62754cd400) [pid = 3347] [serial = 1044] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0n%2529%257B%2520z-index%253A%2520238%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0n%2529%257B%2520z-index%253A%2520238%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 87 (0x7f62754c8800) [pid = 3347] [serial = 1045] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528n%2529%257B%2520z-index%253A%2520241%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528n%2529%257B%2520z-index%253A%2520241%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 86 (0x7f6275566000) [pid = 3347] [serial = 1046] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528-n%2529%257B%2520z-index%253A%2520244%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528-n%2529%257B%2520z-index%253A%2520244%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 85 (0x7f62754d2000) [pid = 3347] [serial = 1047] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25282n+1%2529%257B%2520z-index%253A%2520247%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%25282n+1%2529%257B%2520z-index%253A%2520247%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 84 (0x7f627559c800) [pid = 3347] [serial = 1048] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n-1%2529%257B%2520z-index%253A%2520250%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n-1%2529%257B%2520z-index%253A%2520250%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 83 (0x7f6275fdd000) [pid = 3347] [serial = 1102] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/-2%2529%257B%2520z-index%253A%2520630%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/-2%2529%257B%2520z-index%253A%2520630%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 82 (0x7f62754cbc00) [pid = 3347] [serial = 1101] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-/**/n-2%2529%257B%2520z-index%253A%2520627%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-/**/n-2%2529%257B%2520z-index%253A%2520627%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 81 (0x7f627559e000) [pid = 3347] [serial = 1100] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n-2/**/%2529%257B%2520z-index%253A%2520624%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n-2/**/%2529%257B%2520z-index%253A%2520624%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 80 (0x7f6276107400) [pid = 3347] [serial = 1099] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n-/**/2%2529%257B%2520z-index%253A%2520621%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n-/**/2%2529%257B%2520z-index%253A%2520621%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 79 (0x7f6275fe4000) [pid = 3347] [serial = 1098] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/-2%2529%257B%2520z-index%253A%2520618%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/-2%2529%257B%2520z-index%253A%2520618%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 78 (0x7f6275599800) [pid = 3347] [serial = 1097] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/-2%2529%257B%2520z-index%253A%2520615%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/-2%2529%257B%2520z-index%253A%2520615%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 77 (0x7f6275c99000) [pid = 3347] [serial = 1096] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n-2%2529%257B%2520z-index%253A%2520612%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n-2%2529%257B%2520z-index%253A%2520612%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 76 (0x7f62755a0c00) [pid = 3347] [serial = 1088] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/+2%2529%257B%2520z-index%253A%2520580%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/+2%2529%257B%2520z-index%253A%2520580%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 75 (0x7f6275562000) [pid = 3347] [serial = 1095] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-2/**/%2529%257B%2520z-index%253A%2520609%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-2/**/%2529%257B%2520z-index%253A%2520609%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 74 (0x7f62754cd800) [pid = 3347] [serial = 1094] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-/**/2%2529%257B%2520z-index%253A%2520606%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-/**/2%2529%257B%2520z-index%253A%2520606%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 73 (0x7f6275fda800) [pid = 3347] [serial = 1093] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/-2%2529%257B%2520z-index%253A%2520603%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/-2%2529%257B%2520z-index%253A%2520603%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 72 (0x7f627559c000) [pid = 3347] [serial = 1092] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/-2%2529%257B%2520z-index%253A%2520600%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/-2%2529%257B%2520z-index%253A%2520600%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 71 (0x7f6275c8c000) [pid = 3347] [serial = 1091] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+/**/n-2%2529%257B%2520z-index%253A%2520597%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+/**/n-2%2529%257B%2520z-index%253A%2520597%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 70 (0x7f62756e9000) [pid = 3347] [serial = 1090] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n+2/**/%2529%257B%2520z-index%253A%2520586%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n+2/**/%2529%257B%2520z-index%253A%2520586%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 69 (0x7f6275fe3800) [pid = 3347] [serial = 1103] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/-2%2529%257B%2520z-index%253A%2520633%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/-2%2529%257B%2520z-index%253A%2520633%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 68 (0x7f6276107000) [pid = 3347] [serial = 1104] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-/**/2%2529%257B%2520z-index%253A%2520636%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-/**/2%2529%257B%2520z-index%253A%2520636%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 67 (0x7f6275fd8c00) [pid = 3347] [serial = 1105] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-2/**/%2529%257B%2520z-index%253A%2520639%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-2/**/%2529%257B%2520z-index%253A%2520639%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 66 (0x7f62754cec00) [pid = 3347] [serial = 1041] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528-3n%2529%257B%2520z-index%253A%2520229%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528-3n%2529%257B%2520z-index%253A%2520229%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 65 (0x7f62754cdc00) [pid = 3347] [serial = 1064] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n/**/+/**/2%2529%257B%2520z-index%253A%2520380%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n/**/+/**/2%2529%257B%2520z-index%253A%2520380%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 64 (0x7f62756eec00) [pid = 3347] [serial = 1065] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n-2%2529%257B%2520z-index%253A%2520383%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n-2%2529%257B%2520z-index%253A%2520383%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 63 (0x7f62756ed000) [pid = 3347] [serial = 1066] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n/**/-/**/2%2529%257B%2520z-index%253A%2520386%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n/**/-/**/2%2529%257B%2520z-index%253A%2520386%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 62 (0x7f62757ef000) [pid = 3347] [serial = 1067] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n+2%2529%257B%2520z-index%253A%2520453%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n+2%2529%257B%2520z-index%253A%2520453%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 61 (0x7f62756ecc00) [pid = 3347] [serial = 1068] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n/**/+/**/2%2529%257B%2520z-index%253A%2520456%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n/**/+/**/2%2529%257B%2520z-index%253A%2520456%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 60 (0x7f62756f4400) [pid = 3347] [serial = 1069] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n-2%2529%257B%2520z-index%253A%2520459%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n-2%2529%257B%2520z-index%253A%2520459%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 59 (0x7f62754ce400) [pid = 3347] [serial = 1070] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n/**/-/**/2%2529%257B%2520z-index%253A%2520462%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25282n/**/-/**/2%2529%257B%2520z-index%253A%2520462%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 58 (0x7f6275560800) [pid = 3347] [serial = 1071] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+/**/n+2%2529%257B%2520z-index%253A%2520529%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+/**/n+2%2529%257B%2520z-index%253A%2520529%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 57 (0x7f62757f6400) [pid = 3347] [serial = 1072] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/+2%2529%257B%2520z-index%253A%2520532%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/+2%2529%257B%2520z-index%253A%2520532%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 56 (0x7f62757f3c00) [pid = 3347] [serial = 1073] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/+2%2529%257B%2520z-index%253A%2520535%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n/**/+2%2529%257B%2520z-index%253A%2520535%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 55 (0x7f62754c7000) [pid = 3347] [serial = 1074] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+/**/2%2529%257B%2520z-index%253A%2520538%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+/**/2%2529%257B%2520z-index%253A%2520538%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 54 (0x7f62755ad000) [pid = 3347] [serial = 1075] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+2/**/%2529%257B%2520z-index%253A%2520541%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+2/**/%2529%257B%2520z-index%253A%2520541%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 53 (0x7f62757f6000) [pid = 3347] [serial = 1076] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n+2%2529%257B%2520z-index%253A%2520544%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n+2%2529%257B%2520z-index%253A%2520544%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 52 (0x7f6275c8c800) [pid = 3347] [serial = 1077] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/+2%2529%257B%2520z-index%253A%2520547%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/+2%2529%257B%2520z-index%253A%2520547%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 51 (0x7f6275c8f000) [pid = 3347] [serial = 1078] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/+2%2529%257B%2520z-index%253A%2520550%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n/**/+2%2529%257B%2520z-index%253A%2520550%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 50 (0x7f6275c8f400) [pid = 3347] [serial = 1079] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n+/**/2%2529%257B%2520z-index%253A%2520553%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n+/**/2%2529%257B%2520z-index%253A%2520553%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 49 (0x7f62757fc000) [pid = 3347] [serial = 1080] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n+2/**/%2529%257B%2520z-index%253A%2520556%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1n+2/**/%2529%257B%2520z-index%253A%2520556%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 48 (0x7f6275c8d000) [pid = 3347] [serial = 1081] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-/**/n+2%2529%257B%2520z-index%253A%2520559%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-/**/n+2%2529%257B%2520z-index%253A%2520559%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 47 (0x7f6275c8ec00) [pid = 3347] [serial = 1082] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/+2%2529%257B%2520z-index%253A%2520562%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/+2%2529%257B%2520z-index%253A%2520562%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 46 (0x7f62755ac800) [pid = 3347] [serial = 1049] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%25282n+0%2529%257B%2520z-index%253A%2520253%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%25282n+0%2529%257B%2520z-index%253A%2520253%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 45 (0x7f62755acc00) [pid = 3347] [serial = 1050] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%25282n-0%2529%257B%2520z-index%253A%2520256%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%25282n-0%2529%257B%2520z-index%253A%2520256%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 44 (0x7f62755b0800) [pid = 3347] [serial = 1051] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0n+0%2529%257B%2520z-index%253A%2520259%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-0n+0%2529%257B%2520z-index%253A%2520259%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 43 (0x7f62755b6000) [pid = 3347] [serial = 1052] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528n+1%2529%257B%2520z-index%253A%2520262%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-of-type%2528n+1%2529%257B%2520z-index%253A%2520262%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 42 (0x7f62754cb800) [pid = 3347] [serial = 1053] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528n-1%2529%257B%2520z-index%253A%2520265%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-child%2528n-1%2529%257B%2520z-index%253A%2520265%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 41 (0x7f62754cc800) [pid = 3347] [serial = 1054] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528-n+1%2529%257B%2520z-index%253A%2520268%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-last-of-type%2528-n+1%2529%257B%2520z-index%253A%2520268%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 40 (0x7f62756ea800) [pid = 3347] [serial = 1055] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-1%2529%257B%2520z-index%253A%2520271%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n-1%2529%257B%2520z-index%253A%2520271%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 39 (0x7f62756ea000) [pid = 3347] [serial = 1056] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2529%257B%2520z-index%253A%2520280%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2529%257B%2520z-index%253A%2520280%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 38 (0x7f62756ea400) [pid = 3347] [serial = 1057] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+2%2529%257B%2520z-index%253A%2520285%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n+2%2529%257B%2520z-index%253A%2520285%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 37 (0x7f62754c5c00) [pid = 3347] [serial = 1058] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-2%2529%257B%2520z-index%253A%2520288%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-2%2529%257B%2520z-index%253A%2520288%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 36 (0x7f62754c6c00) [pid = 3347] [serial = 1059] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520+%25202%2529%257B%2520z-index%253A%2520291%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520+%25202%2529%257B%2520z-index%253A%2520291%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 35 (0x7f627559e400) [pid = 3347] [serial = 1060] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520-%25202%2529%257B%2520z-index%253A%2520294%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520-%25202%2529%257B%2520z-index%253A%2520294%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 34 (0x7f62754d0400) [pid = 3347] [serial = 1061] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-100%2529%257B%2520z-index%253A%2520305%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n-100%2529%257B%2520z-index%253A%2520305%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 33 (0x7f62754d1000) [pid = 3347] [serial = 1062] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520-%2520100%2529%257B%2520z-index%253A%2520308%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+n%2520-%2520100%2529%257B%2520z-index%253A%2520308%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 32 (0x7f62754c8000) [pid = 3347] [serial = 1063] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n+2%2529%257B%2520z-index%253A%2520377%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528n+2%2529%257B%2520z-index%253A%2520377%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 31 (0x7f62755b2c00) [pid = 3347] [serial = 1089] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n+/**/2%2529%257B%2520z-index%253A%2520583%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n+/**/2%2529%257B%2520z-index%253A%2520583%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 30 (0x7f62754ca800) [pid = 3347] [serial = 1087] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/+2%2529%257B%2520z-index%253A%2520577%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/+2%2529%257B%2520z-index%253A%2520577%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 29 (0x7f62754c8c00) [pid = 3347] [serial = 1086] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1/**/n+2%2529%257B%2520z-index%253A%2520574%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1/**/n+2%2529%257B%2520z-index%253A%2520574%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 28 (0x7f6275c99800) [pid = 3347] [serial = 1085] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n+2/**/%2529%257B%2520z-index%253A%2520571%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n+2/**/%2529%257B%2520z-index%253A%2520571%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 27 (0x7f62755ae800) [pid = 3347] [serial = 1083] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/+2%2529%257B%2520z-index%253A%2520565%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n/**/+2%2529%257B%2520z-index%253A%2520565%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - --DOMWINDOW == 26 (0x7f62757efc00) [pid = 3347] [serial = 1084] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n+/**/2%2529%257B%2520z-index%253A%2520568%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-n+/**/2%2529%257B%2520z-index%253A%2520568%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:53:56 INFO - ++DOMWINDOW == 27 (0x7f62754c8800) [pid = 3347] [serial = 1124] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 28 (0x7f62754c6000) [pid = 3347] [serial = 1125] [outer = 0x7f6275561800] 11:53:56 INFO - ++DOMWINDOW == 29 (0x7f62754c7000) [pid = 3347] [serial = 1126] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 30 (0x7f62755b0800) [pid = 3347] [serial = 1127] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 31 (0x7f62757fa400) [pid = 3347] [serial = 1128] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 32 (0x7f6275c95400) [pid = 3347] [serial = 1129] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 33 (0x7f62755b7c00) [pid = 3347] [serial = 1130] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 34 (0x7f62756eb000) [pid = 3347] [serial = 1131] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 35 (0x7f62754c8000) [pid = 3347] [serial = 1132] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 36 (0x7f62755a0c00) [pid = 3347] [serial = 1133] [outer = 0x7f6275561800] 11:53:57 INFO - ++DOMWINDOW == 37 (0x7f6276103400) [pid = 3347] [serial = 1134] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 38 (0x7f6275fe1000) [pid = 3347] [serial = 1135] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 39 (0x7f627610a800) [pid = 3347] [serial = 1136] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 40 (0x7f62756ec400) [pid = 3347] [serial = 1137] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 41 (0x7f62763d7c00) [pid = 3347] [serial = 1138] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 42 (0x7f62756ef800) [pid = 3347] [serial = 1139] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 43 (0x7f62763dc000) [pid = 3347] [serial = 1140] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 44 (0x7f6276490400) [pid = 3347] [serial = 1141] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 45 (0x7f6276486000) [pid = 3347] [serial = 1142] [outer = 0x7f6275561800] 11:53:58 INFO - ++DOMWINDOW == 46 (0x7f6276486800) [pid = 3347] [serial = 1143] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 47 (0x7f62755ac800) [pid = 3347] [serial = 1144] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 48 (0x7f62755acc00) [pid = 3347] [serial = 1145] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 49 (0x7f6277104c00) [pid = 3347] [serial = 1146] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 50 (0x7f62771d6000) [pid = 3347] [serial = 1147] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 51 (0x7f6276f07c00) [pid = 3347] [serial = 1148] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 52 (0x7f6277104800) [pid = 3347] [serial = 1149] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 53 (0x7f62763dbc00) [pid = 3347] [serial = 1150] [outer = 0x7f6275561800] 11:53:59 INFO - ++DOMWINDOW == 54 (0x7f62772d6c00) [pid = 3347] [serial = 1151] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 55 (0x7f62772e1000) [pid = 3347] [serial = 1152] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 56 (0x7f62755ae400) [pid = 3347] [serial = 1153] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 57 (0x7f62771de800) [pid = 3347] [serial = 1154] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 58 (0x7f62754cac00) [pid = 3347] [serial = 1155] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 59 (0x7f62754ce000) [pid = 3347] [serial = 1156] [outer = 0x7f6275561800] 11:54:00 INFO - ++DOMWINDOW == 60 (0x7f62755ab400) [pid = 3347] [serial = 1157] [outer = 0x7f6275561800] 11:54:01 INFO - ++DOMWINDOW == 61 (0x7f62755ac000) [pid = 3347] [serial = 1158] [outer = 0x7f6275561800] 11:54:01 INFO - ++DOMWINDOW == 62 (0x7f62755b4400) [pid = 3347] [serial = 1159] [outer = 0x7f6275561800] 11:54:01 INFO - ++DOMWINDOW == 63 (0x7f62756f3400) [pid = 3347] [serial = 1160] [outer = 0x7f6275561800] 11:54:01 INFO - ++DOMWINDOW == 64 (0x7f62756f3000) [pid = 3347] [serial = 1161] [outer = 0x7f6275561800] 11:54:01 INFO - ++DOMWINDOW == 65 (0x7f62754cd400) [pid = 3347] [serial = 1162] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 66 (0x7f6275569000) [pid = 3347] [serial = 1163] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 67 (0x7f627559c400) [pid = 3347] [serial = 1164] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 68 (0x7f62755b1400) [pid = 3347] [serial = 1165] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 69 (0x7f62755b5c00) [pid = 3347] [serial = 1166] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 70 (0x7f62756ef000) [pid = 3347] [serial = 1167] [outer = 0x7f6275561800] 11:54:02 INFO - ++DOMWINDOW == 71 (0x7f6275599800) [pid = 3347] [serial = 1168] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 72 (0x7f62755b1000) [pid = 3347] [serial = 1169] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 73 (0x7f62757f5800) [pid = 3347] [serial = 1170] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 74 (0x7f6275c95c00) [pid = 3347] [serial = 1171] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 75 (0x7f6275fd9400) [pid = 3347] [serial = 1172] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 76 (0x7f6275fe4800) [pid = 3347] [serial = 1173] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 77 (0x7f6275562c00) [pid = 3347] [serial = 1174] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 78 (0x7f6275c90c00) [pid = 3347] [serial = 1175] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 79 (0x7f6276108000) [pid = 3347] [serial = 1176] [outer = 0x7f6275561800] 11:54:03 INFO - ++DOMWINDOW == 80 (0x7f6275566c00) [pid = 3347] [serial = 1177] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 81 (0x7f62757f6800) [pid = 3347] [serial = 1178] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 82 (0x7f62754c6c00) [pid = 3347] [serial = 1179] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 83 (0x7f62754c8c00) [pid = 3347] [serial = 1180] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 84 (0x7f62757f5400) [pid = 3347] [serial = 1181] [outer = 0x7f6275561800] 11:54:04 INFO - --DOMWINDOW == 83 (0x7f62755ae400) [pid = 3347] [serial = 1153] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-first-node%257B%2520z-index%253A%2520821%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-first-node%257B%2520z-index%253A%2520821%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 82 (0x7f6276f07c00) [pid = 3347] [serial = 1148] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25286%2529%257B%2520z-index%253A%2520806%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25286%2529%257B%2520z-index%253A%2520806%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 81 (0x7f62771d6000) [pid = 3347] [serial = 1147] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-child%25286%2529%257B%2520z-index%253A%2520803%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-child%25286%2529%257B%2520z-index%253A%2520803%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 80 (0x7f6277104c00) [pid = 3347] [serial = 1146] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25286%2529%257B%2520z-index%253A%2520800%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25286%2529%257B%2520z-index%253A%2520800%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 79 (0x7f62755acc00) [pid = 3347] [serial = 1145] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%25284n+1%2529%257B%2520z-index%253A%2520797%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%25284n+1%2529%257B%2520z-index%253A%2520797%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 78 (0x7f62755ac800) [pid = 3347] [serial = 1144] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25284n+1%2529%257B%2520z-index%253A%2520794%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25284n+1%2529%257B%2520z-index%253A%2520794%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 77 (0x7f6276486800) [pid = 3347] [serial = 1143] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-child%25284n+1%2529%257B%2520z-index%253A%2520791%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-child%25284n+1%2529%257B%2520z-index%253A%2520791%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 76 (0x7f6276486000) [pid = 3347] [serial = 1142] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25284n+1%2529%257B%2520z-index%253A%2520788%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25284n+1%2529%257B%2520z-index%253A%2520788%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 75 (0x7f6276490400) [pid = 3347] [serial = 1141] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-2n+3%2529%257B%2520z-index%253A%2520785%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-2n+3%2529%257B%2520z-index%253A%2520785%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 74 (0x7f62763dc000) [pid = 3347] [serial = 1140] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-1n+3%2529%257B%2520z-index%253A%2520782%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-1n+3%2529%257B%2520z-index%253A%2520782%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 73 (0x7f62756ef800) [pid = 3347] [serial = 1139] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-3%2529%257B%2520z-index%253A%2520779%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-3%2529%257B%2520z-index%253A%2520779%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 72 (0x7f62763d7c00) [pid = 3347] [serial = 1138] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n%2529%257B%2520z-index%253A%2520776%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n%2529%257B%2520z-index%253A%2520776%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 71 (0x7f62756ec400) [pid = 3347] [serial = 1137] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+3%2529%257B%2520z-index%253A%2520773%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+3%2529%257B%2520z-index%253A%2520773%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 70 (0x7f627610a800) [pid = 3347] [serial = 1136] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n+3%2529%257B%2520z-index%253A%2520770%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n+3%2529%257B%2520z-index%253A%2520770%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 69 (0x7f6275fe1000) [pid = 3347] [serial = 1135] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n-3%2529%257B%2520z-index%253A%2520767%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n-3%2529%257B%2520z-index%253A%2520767%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 68 (0x7f6276103400) [pid = 3347] [serial = 1134] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n%2529%257B%2520z-index%253A%2520764%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528n%2529%257B%2520z-index%253A%2520764%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 67 (0x7f62755a0c00) [pid = 3347] [serial = 1133] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-n-3%2529%257B%2520z-index%253A%2520761%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-n-3%2529%257B%2520z-index%253A%2520761%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 66 (0x7f62754c8000) [pid = 3347] [serial = 1132] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-n+3%2529%257B%2520z-index%253A%2520758%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-n+3%2529%257B%2520z-index%253A%2520758%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 65 (0x7f62756eb000) [pid = 3347] [serial = 1131] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-0%2529%257B%2520z-index%253A%2520755%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-0%2529%257B%2520z-index%253A%2520755%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 64 (0x7f62755b7c00) [pid = 3347] [serial = 1130] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+0%2529%257B%2520z-index%253A%2520752%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+0%2529%257B%2520z-index%253A%2520752%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 63 (0x7f62754d2800) [pid = 3347] [serial = 1106] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1/**/n-2%2529%257B%2520z-index%253A%2520642%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1/**/n-2%2529%257B%2520z-index%253A%2520642%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 62 (0x7f6275c95400) [pid = 3347] [serial = 1129] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528%25202n%2520+%25201%2520%2529%257B%2520z-index%253A%2520749%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528%25202n%2520+%25201%2520%2529%257B%2520z-index%253A%2520749%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 61 (0x7f62757fa400) [pid = 3347] [serial = 1128] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+1%2529%257B%2520z-index%253A%2520746%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n+1%2529%257B%2520z-index%253A%2520746%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 60 (0x7f62755b0800) [pid = 3347] [serial = 1127] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528%25202n%2520-%25201%2520%2529%257B%2520z-index%253A%2520743%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528%25202n%2520-%25201%2520%2529%257B%2520z-index%253A%2520743%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 59 (0x7f62754c7000) [pid = 3347] [serial = 1126] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-1%2529%257B%2520z-index%253A%2520740%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25282n-1%2529%257B%2520z-index%253A%2520740%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 58 (0x7f62754c6000) [pid = 3347] [serial = 1125] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528even%2529%257B%2520z-index%253A%2520737%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528even%2529%257B%2520z-index%253A%2520737%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 57 (0x7f62754c8800) [pid = 3347] [serial = 1124] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528odd%2529%257B%2520z-index%253A%2520734%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528odd%2529%257B%2520z-index%253A%2520734%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 56 (0x7f62754c9400) [pid = 3347] [serial = 1123] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25288%2529%257B%2520z-index%253A%2520731%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25288%2529%257B%2520z-index%253A%2520731%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 55 (0x7f62754c7400) [pid = 3347] [serial = 1122] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-0n+3%2529%257B%2520z-index%253A%2520728%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-0n+3%2529%257B%2520z-index%253A%2520728%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 54 (0x7f62756ebc00) [pid = 3347] [serial = 1121] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25280n+3%2529%257B%2520z-index%253A%2520725%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25280n+3%2529%257B%2520z-index%253A%2520725%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 53 (0x7f62756ee800) [pid = 3347] [serial = 1120] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25283%2529%257B%2520z-index%253A%2520722%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25283%2529%257B%2520z-index%253A%2520722%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 52 (0x7f62755b2400) [pid = 3347] [serial = 1119] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-3%2529%257B%2520z-index%253A%2520719%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%2528-3%2529%257B%2520z-index%253A%2520719%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 51 (0x7f62754c8400) [pid = 3347] [serial = 1118] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25280%2529%257B%2520z-index%253A%2520716%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-child%25280%2529%257B%2520z-index%253A%2520716%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 50 (0x7f62756e9c00) [pid = 3347] [serial = 1117] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25281/**/n-1%2529%257B%2520z-index%253A%2520689%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%25281/**/n-1%2529%257B%2520z-index%253A%2520689%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 49 (0x7f627556c800) [pid = 3347] [serial = 1116] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n-1%2529%257B%2520z-index%253A%2520686%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528+1/**/n-1%2529%257B%2520z-index%253A%2520686%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 48 (0x7f62755b2800) [pid = 3347] [serial = 1115] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n/**/%2520+/**/4%2520%2529%257B%2520z-index%253A%2520683%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n/**/%2520+/**/4%2520%2529%257B%2520z-index%253A%2520683%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 47 (0x7f62755b1c00) [pid = 3347] [serial = 1114] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n%2520/**/+/**/4%2520%2529%257B%2520z-index%253A%2520680%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n%2520/**/+/**/4%2520%2529%257B%2520z-index%253A%2520680%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 46 (0x7f62755abc00) [pid = 3347] [serial = 1113] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n/**/+/**/4%2520%2529%257B%2520z-index%253A%2520671%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520-/**/2/**/n/**/+/**/4%2520%2529%257B%2520z-index%253A%2520671%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 45 (0x7f62755ac400) [pid = 3347] [serial = 1112] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+/**/n%2520+%25201%2520%2529%257B%2520z-index%253A%2520668%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+/**/n%2520+%25201%2520%2529%257B%2520z-index%253A%2520668%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 44 (0x7f6275561c00) [pid = 3347] [serial = 1111] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+n%2520+%25201%2520%2529%257B%2520z-index%253A%2520665%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528%2520+n%2520+%25201%2520%2529%257B%2520z-index%253A%2520665%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 43 (0x7f627559d000) [pid = 3347] [serial = 1110] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n-2/**/%2529%257B%2520z-index%253A%2520654%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n-2/**/%2529%257B%2520z-index%253A%2520654%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 42 (0x7f627556c400) [pid = 3347] [serial = 1109] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n-/**/2%2529%257B%2520z-index%253A%2520651%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n-/**/2%2529%257B%2520z-index%253A%2520651%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 41 (0x7f6275565800) [pid = 3347] [serial = 1108] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/-2%2529%257B%2520z-index%253A%2520648%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/-2%2529%257B%2520z-index%253A%2520648%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 40 (0x7f62754ce800) [pid = 3347] [serial = 1107] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/-2%2529%257B%2520z-index%253A%2520645%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Anth-child%2528-1n/**/-2%2529%257B%2520z-index%253A%2520645%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 39 (0x7f62772e1000) [pid = 3347] [serial = 1152] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Aonly-child%257B%2520z-index%253A%2520818%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Aonly-child%257B%2520z-index%253A%2520818%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 38 (0x7f6277104800) [pid = 3347] [serial = 1149] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%25286%2529%257B%2520z-index%253A%2520809%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%25286%2529%257B%2520z-index%253A%2520809%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 37 (0x7f62763dbc00) [pid = 3347] [serial = 1150] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Afirst-child%257B%2520z-index%253A%2520812%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Afirst-child%257B%2520z-index%253A%2520812%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - --DOMWINDOW == 36 (0x7f62772d6c00) [pid = 3347] [serial = 1151] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Alast-child%257B%2520z-index%253A%2520815%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Alast-child%257B%2520z-index%253A%2520815%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:04 INFO - ++DOMWINDOW == 37 (0x7f62754ce800) [pid = 3347] [serial = 1182] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 38 (0x7f62754d2800) [pid = 3347] [serial = 1183] [outer = 0x7f6275561800] 11:54:04 INFO - ++DOMWINDOW == 39 (0x7f62754c7000) [pid = 3347] [serial = 1184] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 40 (0x7f62754c8000) [pid = 3347] [serial = 1185] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 41 (0x7f6276486c00) [pid = 3347] [serial = 1186] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 42 (0x7f627648e000) [pid = 3347] [serial = 1187] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 43 (0x7f6276f06400) [pid = 3347] [serial = 1188] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 44 (0x7f6276f06c00) [pid = 3347] [serial = 1189] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 45 (0x7f62754ccc00) [pid = 3347] [serial = 1190] [outer = 0x7f6275561800] 11:54:05 INFO - ++DOMWINDOW == 46 (0x7f6277107800) [pid = 3347] [serial = 1191] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 47 (0x7f6275fd6c00) [pid = 3347] [serial = 1192] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 48 (0x7f627710a000) [pid = 3347] [serial = 1193] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 49 (0x7f627710c000) [pid = 3347] [serial = 1194] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 50 (0x7f62755b7c00) [pid = 3347] [serial = 1195] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 51 (0x7f62756eb000) [pid = 3347] [serial = 1196] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 52 (0x7f62772d3800) [pid = 3347] [serial = 1197] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 53 (0x7f62771d5000) [pid = 3347] [serial = 1198] [outer = 0x7f6275561800] 11:54:06 INFO - ++DOMWINDOW == 54 (0x7f62771db000) [pid = 3347] [serial = 1199] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 55 (0x7f62772d2800) [pid = 3347] [serial = 1200] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 56 (0x7f62772d6800) [pid = 3347] [serial = 1201] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 57 (0x7f62771d4400) [pid = 3347] [serial = 1202] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 58 (0x7f627765a400) [pid = 3347] [serial = 1203] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 59 (0x7f62772dd000) [pid = 3347] [serial = 1204] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 60 (0x7f627710bc00) [pid = 3347] [serial = 1205] [outer = 0x7f6275561800] 11:54:07 INFO - ++DOMWINDOW == 61 (0x7f627774bc00) [pid = 3347] [serial = 1206] [outer = 0x7f6275561800] 11:54:08 INFO - ++DOMWINDOW == 62 (0x7f6278178000) [pid = 3347] [serial = 1207] [outer = 0x7f6275561800] 11:54:08 INFO - ++DOMWINDOW == 63 (0x7f627817a000) [pid = 3347] [serial = 1208] [outer = 0x7f6275561800] 11:54:08 INFO - ++DOMWINDOW == 64 (0x7f62754ce400) [pid = 3347] [serial = 1209] [outer = 0x7f6275561800] 11:54:08 INFO - ++DOMWINDOW == 65 (0x7f627559f000) [pid = 3347] [serial = 1210] [outer = 0x7f6275561800] 11:54:08 INFO - ++DOMWINDOW == 66 (0x7f62757f1000) [pid = 3347] [serial = 1211] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 67 (0x7f62757edc00) [pid = 3347] [serial = 1212] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 68 (0x7f62754c9400) [pid = 3347] [serial = 1213] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 69 (0x7f62754cc800) [pid = 3347] [serial = 1214] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 70 (0x7f6276102800) [pid = 3347] [serial = 1215] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 71 (0x7f62754cb800) [pid = 3347] [serial = 1216] [outer = 0x7f6275561800] 11:54:09 INFO - ++DOMWINDOW == 72 (0x7f62757efc00) [pid = 3347] [serial = 1217] [outer = 0x7f6275561800] 11:54:10 INFO - ++DOMWINDOW == 73 (0x7f62772e1c00) [pid = 3347] [serial = 1218] [outer = 0x7f6275561800] 11:54:10 INFO - ++DOMWINDOW == 74 (0x7f627826b000) [pid = 3347] [serial = 1219] [outer = 0x7f6275561800] 11:54:10 INFO - ++DOMWINDOW == 75 (0x7f627840a400) [pid = 3347] [serial = 1220] [outer = 0x7f6275561800] 11:54:10 INFO - ++DOMWINDOW == 76 (0x7f6278265800) [pid = 3347] [serial = 1221] [outer = 0x7f6275561800] 11:54:10 INFO - ++DOMWINDOW == 77 (0x7f62754d1000) [pid = 3347] [serial = 1222] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 78 (0x7f62754ca000) [pid = 3347] [serial = 1223] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 79 (0x7f6275561400) [pid = 3347] [serial = 1224] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 80 (0x7f62754d0000) [pid = 3347] [serial = 1225] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 81 (0x7f6275560800) [pid = 3347] [serial = 1226] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 82 (0x7f62755ae800) [pid = 3347] [serial = 1227] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 83 (0x7f627559dc00) [pid = 3347] [serial = 1228] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 84 (0x7f62755b4c00) [pid = 3347] [serial = 1229] [outer = 0x7f6275561800] 11:54:11 INFO - ++DOMWINDOW == 85 (0x7f62756ea000) [pid = 3347] [serial = 1230] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 86 (0x7f627559bc00) [pid = 3347] [serial = 1231] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 87 (0x7f62755acc00) [pid = 3347] [serial = 1232] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 88 (0x7f62756f1000) [pid = 3347] [serial = 1233] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 89 (0x7f62755b0000) [pid = 3347] [serial = 1234] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 90 (0x7f62754c6400) [pid = 3347] [serial = 1235] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 91 (0x7f62754c8800) [pid = 3347] [serial = 1236] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 92 (0x7f62756e9c00) [pid = 3347] [serial = 1237] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 93 (0x7f62757f4800) [pid = 3347] [serial = 1238] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 94 (0x7f62756f6c00) [pid = 3347] [serial = 1239] [outer = 0x7f6275561800] 11:54:12 INFO - ++DOMWINDOW == 95 (0x7f62757f0c00) [pid = 3347] [serial = 1240] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 96 (0x7f62757fac00) [pid = 3347] [serial = 1241] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 97 (0x7f62754c6000) [pid = 3347] [serial = 1242] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 98 (0x7f62754c5800) [pid = 3347] [serial = 1243] [outer = 0x7f6275561800] 11:54:13 INFO - --DOMWINDOW == 97 (0x7f627765a400) [pid = 3347] [serial = 1203] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528%257C*%2529%257B%2520z-index%253A%2520971%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528%257C*%2529%257B%2520z-index%253A%2520971%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 96 (0x7f62771d4400) [pid = 3347] [serial = 1202] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528html%257Ca%2529%257B%2520z-index%253A%2520968%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528html%257Ca%2529%257B%2520z-index%253A%2520968%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 95 (0x7f62772d6800) [pid = 3347] [serial = 1201] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528html%257C*%2529%257B%2520z-index%253A%2520965%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528html%257C*%2529%257B%2520z-index%253A%2520965%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 94 (0x7f62772d2800) [pid = 3347] [serial = 1200] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528%253Avisited%2529%257B%2520z-index%253A%2520962%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528%253Avisited%2529%257B%2520z-index%253A%2520962%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E%3Ca%20id%3D%27b%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 93 (0x7f62771db000) [pid = 3347] [serial = 1199] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528%253Alink%2529%257B%2520z-index%253A%2520959%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528%253Alink%2529%257B%2520z-index%253A%2520959%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E%3Ca%20id%3D%27b%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 92 (0x7f62771d5000) [pid = 3347] [serial = 1198] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%257Ca%2529%257B%2520z-index%253A%2520956%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%257Ca%2529%257B%2520z-index%253A%2520956%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 91 (0x7f62772d3800) [pid = 3347] [serial = 1197] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%257C*%2529%257B%2520z-index%253A%2520953%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%257C*%2529%257B%2520z-index%253A%2520953%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 90 (0x7f62756eb000) [pid = 3347] [serial = 1196] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528a%2529%257B%2520z-index%253A%2520950%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528a%2529%257B%2520z-index%253A%2520950%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 89 (0x7f62755b7c00) [pid = 3347] [serial = 1195] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%2529%257B%2520z-index%253A%2520947%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%253Anot%2528*%2529%257B%2520z-index%253A%2520947%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 88 (0x7f627710c000) [pid = 3347] [serial = 1194] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%257B%2520z-index%253A%2520944%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%257B%2520z-index%253A%2520944%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 87 (0x7f627710a000) [pid = 3347] [serial = 1193] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%257B%2520z-index%253A%2520941%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B*%257Ca%257B%2520z-index%253A%2520941%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 86 (0x7f6275fd6c00) [pid = 3347] [serial = 1192] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253Ba%257B%2520z-index%253A%2520938%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253Ba%257B%2520z-index%253A%2520938%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 85 (0x7f6277107800) [pid = 3347] [serial = 1191] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Ba%257B%2520z-index%253A%2520935%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Ba%257B%2520z-index%253A%2520935%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 84 (0x7f62754ccc00) [pid = 3347] [serial = 1190] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520932%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520932%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3C/div%3E%3Cdiv%20class%3D%22nomatch%22%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 83 (0x7f6276f06c00) [pid = 3347] [serial = 1189] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520929%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520929%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%3E%3Cdiv%20class%3D%22nomatch%22%3E%3C/div%3E%3C/div%3E%3Cdiv%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 82 (0x7f6276f06400) [pid = 3347] [serial = 1188] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520926%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520926%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%20class%3D%22nomatch%22%3E%3C/div%3E%3C/div%3E%3Cdiv%20class%3D%22nomatch%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 81 (0x7f627648e000) [pid = 3347] [serial = 1187] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520923%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.nomatch%257B%2520z-index%253A%2520923%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%20class%3D%22nomatch%22%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 80 (0x7f6276486c00) [pid = 3347] [serial = 1186] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520920%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520920%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 79 (0x7f62756f3400) [pid = 3347] [serial = 1160] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-first-node%257B%2520z-index%253A%2520842%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-first-node%257B%2520z-index%253A%2520842%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 78 (0x7f62755b4400) [pid = 3347] [serial = 1159] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-child%257B%2520z-index%253A%2520839%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-child%257B%2520z-index%253A%2520839%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 77 (0x7f62755ac000) [pid = 3347] [serial = 1158] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-child%257B%2520z-index%253A%2520836%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-child%257B%2520z-index%253A%2520836%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 76 (0x7f62755ab400) [pid = 3347] [serial = 1157] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Aonly-of-type%257B%2520z-index%253A%2520833%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Aonly-of-type%257B%2520z-index%253A%2520833%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 75 (0x7f62754ce000) [pid = 3347] [serial = 1156] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Alast-of-type%257B%2520z-index%253A%2520830%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Alast-of-type%257B%2520z-index%253A%2520830%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 74 (0x7f62754cac00) [pid = 3347] [serial = 1155] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Afirst-of-type%257B%2520z-index%253A%2520827%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253Afirst-of-type%257B%2520z-index%253A%2520827%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 73 (0x7f62754c8000) [pid = 3347] [serial = 1185] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520917%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520917%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22x%22%3E%3Cp%3Efiller%20filler%20%3Ci%3Efiller%3C/i%3E%20filler%3C/p%3E%3C/div%3E%3Cdiv%3E%3C/div%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%3E%3C/div%3E%3Cdiv%20class%3D%22x%22%3E%3Cp%3Efiller%20filler%20%3Ci%3Efiller%3C/i%3E%20filler%3C/p%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 72 (0x7f62754c7000) [pid = 3347] [serial = 1184] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520914%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520914%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3Cp%3Efiller%20filler%20%3Ci%3Efiller%3C/i%3E%20filler%3C/p%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 71 (0x7f62754d2800) [pid = 3347] [serial = 1183] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520911%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520911%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%20class%3D%22x%22%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 70 (0x7f62754ce800) [pid = 3347] [serial = 1182] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520908%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.a%2520%253E%2520.b%2520%257E%2520.match%257B%2520z-index%253A%2520908%2520%257D%27%3E%3Cbody%3E%3Cdiv%20class%3D%22a%22%3E%3Cdiv%20class%3D%22b%22%3E%3C/div%3E%3Cdiv%20class%3D%22match%22%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 69 (0x7f62757f5400) [pid = 3347] [serial = 1181] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523c%2520div%257B%2520z-index%253A%2520905%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523c%2520div%257B%2520z-index%253A%2520905%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 68 (0x7f62754c8c00) [pid = 3347] [serial = 1180] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%2523c%2520%253E%2520div%257B%2520z-index%253A%2520902%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%2523c%2520%253E%2520div%257B%2520z-index%253A%2520902%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 67 (0x7f62754c6c00) [pid = 3347] [serial = 1179] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523b%2520div%257B%2520z-index%253A%2520899%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523b%2520div%257B%2520z-index%253A%2520899%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 66 (0x7f62757f6800) [pid = 3347] [serial = 1178] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%2523b%2520%253E%2520div%257B%2520z-index%253A%2520896%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%2523b%2520%253E%2520div%257B%2520z-index%253A%2520896%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 65 (0x7f6275566c00) [pid = 3347] [serial = 1177] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520div%2520%253E%2520div%257B%2520z-index%253A%2520893%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520div%2520%253E%2520div%257B%2520z-index%253A%2520893%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 64 (0x7f6276108000) [pid = 3347] [serial = 1176] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523b%2520div%257B%2520z-index%253A%2520890%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520%2523b%2520div%257B%2520z-index%253A%2520890%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 63 (0x7f6275c90c00) [pid = 3347] [serial = 1175] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520div%2520div%257B%2520z-index%253A%2520887%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523a%2520%253E%2520div%2520div%257B%2520z-index%253A%2520887%2520%257D%27%3E%3Cbody%3E%3Cdiv%20id%3D%27a%27%3E%3Cdiv%20id%3D%27b%27%3E%3Cdiv%20id%3D%27c%27%3E%3Cdiv%20id%3D%27d%27%3E%3C/div%3E%3C/div%3E%3C/div%3E%3C/div%3E] 11:54:13 INFO - --DOMWINDOW == 62 (0x7f6275562c00) [pid = 3347] [serial = 1174] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%2528even%2529%257B%2520z-index%253A%2520884%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-last-of-type%2528even%2529%257B%2520z-index%253A%2520884%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3C/div%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3Cp%3E%3C/p%3E%3Caddress%3E%3C/address%3E%3C/div%3E%3Caddress%3E%3C/address%3E] 11:54:13 INFO - --DOMWINDOW == 61 (0x7f6275fe4800) [pid = 3347] [serial = 1173] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25282n-0%2529%257B%2520z-index%253A%2520881%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%25282n-0%2529%257B%2520z-index%253A%2520881%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3C/div%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3Cp%3E%3C/p%3E%3Caddress%3E%3C/address%3E%3C/div%3E%3Caddress%3E%3C/address%3E] 11:54:13 INFO - --DOMWINDOW == 60 (0x7f6275fd9400) [pid = 3347] [serial = 1172] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%2528odd%2529%257B%2520z-index%253A%2520878%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Anth-of-type%2528odd%2529%257B%2520z-index%253A%2520878%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3C/div%3E%3Cp%3E%3C/p%3E%3Cdiv%3E%3Cp%3E%3C/p%3E%3Caddress%3E%3C/address%3E%3C/div%3E%3Caddress%3E%3C/address%3E] 11:54:13 INFO - --DOMWINDOW == 59 (0x7f6275c95c00) [pid = 3347] [serial = 1171] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-of-type%257B%2520z-index%253A%2520875%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-of-type%257B%2520z-index%253A%2520875%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 58 (0x7f62757f5800) [pid = 3347] [serial = 1170] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-of-type%257B%2520z-index%253A%2520872%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-of-type%257B%2520z-index%253A%2520872%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 57 (0x7f62755b1000) [pid = 3347] [serial = 1169] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-of-type%257B%2520z-index%253A%2520869%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-of-type%257B%2520z-index%253A%2520869%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 56 (0x7f6275599800) [pid = 3347] [serial = 1168] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-of-type%257B%2520z-index%253A%2520866%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-of-type%257B%2520z-index%253A%2520866%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 55 (0x7f62756ef000) [pid = 3347] [serial = 1167] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-of-type%257B%2520z-index%253A%2520863%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-of-type%257B%2520z-index%253A%2520863%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 54 (0x7f62755b5c00) [pid = 3347] [serial = 1166] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-of-type%257B%2520z-index%253A%2520860%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Afirst-of-type%257B%2520z-index%253A%2520860%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 53 (0x7f62755b1400) [pid = 3347] [serial = 1165] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-child%257B%2520z-index%253A%2520857%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-child%257B%2520z-index%253A%2520857%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 52 (0x7f627559c400) [pid = 3347] [serial = 1164] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-child%257B%2520z-index%253A%2520854%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Aonly-child%257B%2520z-index%253A%2520854%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 51 (0x7f6275569000) [pid = 3347] [serial = 1163] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-last-node%257B%2520z-index%253A%2520851%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-last-node%257B%2520z-index%253A%2520851%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 50 (0x7f62754cd400) [pid = 3347] [serial = 1162] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-child%257B%2520z-index%253A%2520848%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-child%257B%2520z-index%253A%2520848%2520%257D%27%3E%3Cbody%3E%3C%21----%3E%20%3Cdiv%20id%3D%27p1%27%3E%20%3C%21----%3Ex%3Cp%20id%3D%27s1%27%3E%3C/p%3E%20%3C%21----%3E%3Cp%20id%3D%27s2%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E%3Cp%20id%3D%27p2%27%3E%20%3C%21----%3E%3Cspan%20id%3D%27s3%27%3E%3C/span%3E%20%3C%21----%3E%3Cspan%20id%3D%27s4%27%3E%3C/span%3E%20%3C%21----%3Ex%3C/p%3E%20%3C%21----%3E%3Cdiv%20id%3D%27p3%27%3E%20%3C%21----%3E%3Cp%20id%3D%27s5%27%3E%3C/p%3E%20%3C%21----%3E%3C/div%3E%20%3C%21----%3E] 11:54:13 INFO - --DOMWINDOW == 49 (0x7f62756f3000) [pid = 3347] [serial = 1161] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-child%257B%2520z-index%253A%2520845%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253Alast-child%257B%2520z-index%253A%2520845%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E%3Cp%3E%3C/p%3E] 11:54:13 INFO - --DOMWINDOW == 48 (0x7f627774bc00) [pid = 3347] [serial = 1206] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528%257Ca%2529%257B%2520z-index%253A%2520980%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528%257Ca%2529%257B%2520z-index%253A%2520980%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 47 (0x7f62772dd000) [pid = 3347] [serial = 1204] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528%257Ca%2529%257B%2520z-index%253A%2520974%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B*%257Ca%253Anot%2528%257Ca%2529%257B%2520z-index%253A%2520974%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - --DOMWINDOW == 46 (0x7f627710bc00) [pid = 3347] [serial = 1205] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528%257C*%2529%257B%2520z-index%253A%2520977%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528%257C*%2529%257B%2520z-index%253A%2520977%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:13 INFO - ++DOMWINDOW == 47 (0x7f62754c5c00) [pid = 3347] [serial = 1244] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 48 (0x7f62754c8000) [pid = 3347] [serial = 1245] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 49 (0x7f62754c8400) [pid = 3347] [serial = 1246] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 50 (0x7f627556e800) [pid = 3347] [serial = 1247] [outer = 0x7f6275561800] 11:54:13 INFO - ++DOMWINDOW == 51 (0x7f627559c400) [pid = 3347] [serial = 1248] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 52 (0x7f62755b3c00) [pid = 3347] [serial = 1249] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 53 (0x7f62754c7000) [pid = 3347] [serial = 1250] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 54 (0x7f62754c8c00) [pid = 3347] [serial = 1251] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 55 (0x7f62754c7400) [pid = 3347] [serial = 1252] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 56 (0x7f62754cd400) [pid = 3347] [serial = 1253] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 57 (0x7f627559d000) [pid = 3347] [serial = 1254] [outer = 0x7f6275561800] 11:54:14 INFO - ++DOMWINDOW == 58 (0x7f62757f5800) [pid = 3347] [serial = 1255] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 59 (0x7f62763d6800) [pid = 3347] [serial = 1256] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 60 (0x7f6275568000) [pid = 3347] [serial = 1257] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 61 (0x7f62757fc000) [pid = 3347] [serial = 1258] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 62 (0x7f62763db000) [pid = 3347] [serial = 1259] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 63 (0x7f62763dd800) [pid = 3347] [serial = 1260] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 64 (0x7f6276484400) [pid = 3347] [serial = 1261] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 65 (0x7f627648f000) [pid = 3347] [serial = 1262] [outer = 0x7f6275561800] 11:54:15 INFO - ++DOMWINDOW == 66 (0x7f6276489000) [pid = 3347] [serial = 1263] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 67 (0x7f6276f06800) [pid = 3347] [serial = 1264] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 68 (0x7f62763d6400) [pid = 3347] [serial = 1265] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 69 (0x7f62763d8800) [pid = 3347] [serial = 1266] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 70 (0x7f6275c97400) [pid = 3347] [serial = 1267] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 71 (0x7f6276108400) [pid = 3347] [serial = 1268] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 72 (0x7f6277104400) [pid = 3347] [serial = 1269] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 73 (0x7f6277104000) [pid = 3347] [serial = 1270] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 74 (0x7f6277104c00) [pid = 3347] [serial = 1271] [outer = 0x7f6275561800] 11:54:16 INFO - ++DOMWINDOW == 75 (0x7f62763d4800) [pid = 3347] [serial = 1272] [outer = 0x7f6275561800] 11:54:17 INFO - ++DOMWINDOW == 76 (0x7f62763dc400) [pid = 3347] [serial = 1273] [outer = 0x7f6275561800] 11:54:17 INFO - ++DOMWINDOW == 77 (0x7f62754cf400) [pid = 3347] [serial = 1274] [outer = 0x7f6275561800] 11:54:17 INFO - ++DOMWINDOW == 78 (0x7f62754d2000) [pid = 3347] [serial = 1275] [outer = 0x7f6275561800] 11:54:17 INFO - ++DOMWINDOW == 79 (0x7f627556f800) [pid = 3347] [serial = 1276] [outer = 0x7f6275561800] 11:54:17 INFO - MEMORY STAT | vsize 701MB | residentFast 142MB | heapAllocated 30MB 11:54:17 INFO - 1059 INFO TEST-OK | layout/style/test/test_selectors.html | took 46457ms 11:54:17 INFO - ++DOMWINDOW == 80 (0x7f62771e1c00) [pid = 3347] [serial = 1277] [outer = 0x7f6281591800] 11:54:18 INFO - 1060 INFO TEST-START | layout/style/test/test_selectors_on_anonymous_content.html 11:54:18 INFO - ++DOMWINDOW == 81 (0x7f62754ca400) [pid = 3347] [serial = 1278] [outer = 0x7f6281591800] 11:54:18 INFO - MEMORY STAT | vsize 702MB | residentFast 144MB | heapAllocated 32MB 11:54:18 INFO - --DOCSHELL 0x7f62754f1000 == 3 [pid = 3347] [id = 36] 11:54:18 INFO - 1061 INFO TEST-OK | layout/style/test/test_selectors_on_anonymous_content.html | took 671ms 11:54:18 INFO - ++DOMWINDOW == 82 (0x7f62754cdc00) [pid = 3347] [serial = 1279] [outer = 0x7f6281591800] 11:54:18 INFO - 1062 INFO TEST-START | layout/style/test/test_setPropertyWithNull.html 11:54:19 INFO - ++DOMWINDOW == 83 (0x7f627559d400) [pid = 3347] [serial = 1280] [outer = 0x7f6281591800] 11:54:19 INFO - MEMORY STAT | vsize 702MB | residentFast 143MB | heapAllocated 32MB 11:54:19 INFO - 1063 INFO TEST-OK | layout/style/test/test_setPropertyWithNull.html | took 419ms 11:54:19 INFO - ++DOMWINDOW == 84 (0x7f62772d7c00) [pid = 3347] [serial = 1281] [outer = 0x7f6281591800] 11:54:19 INFO - 1064 INFO TEST-START | layout/style/test/test_shorthand_property_getters.html 11:54:19 INFO - ++DOMWINDOW == 85 (0x7f62772dcc00) [pid = 3347] [serial = 1282] [outer = 0x7f6281591800] 11:54:19 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:54:20 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:54:20 INFO - MEMORY STAT | vsize 703MB | residentFast 144MB | heapAllocated 32MB 11:54:20 INFO - 1065 INFO TEST-OK | layout/style/test/test_shorthand_property_getters.html | took 880ms 11:54:20 INFO - ++DOMWINDOW == 86 (0x7f6277107400) [pid = 3347] [serial = 1283] [outer = 0x7f6281591800] 11:54:20 INFO - 1066 INFO TEST-START | layout/style/test/test_specified_value_serialization.html 11:54:20 INFO - ++DOMWINDOW == 87 (0x7f62754ce800) [pid = 3347] [serial = 1284] [outer = 0x7f6281591800] 11:54:21 INFO - MEMORY STAT | vsize 703MB | residentFast 141MB | heapAllocated 27MB 11:54:21 INFO - 1067 INFO TEST-OK | layout/style/test/test_specified_value_serialization.html | took 606ms 11:54:21 INFO - ++DOMWINDOW == 88 (0x7f62755a4400) [pid = 3347] [serial = 1285] [outer = 0x7f6281591800] 11:54:21 INFO - 1068 INFO TEST-START | layout/style/test/test_style_attribute_quirks.html 11:54:21 INFO - ++DOMWINDOW == 89 (0x7f62755a4c00) [pid = 3347] [serial = 1286] [outer = 0x7f6281591800] 11:54:21 INFO - MEMORY STAT | vsize 703MB | residentFast 142MB | heapAllocated 28MB 11:54:21 INFO - 1069 INFO TEST-OK | layout/style/test/test_style_attribute_quirks.html | took 332ms 11:54:21 INFO - ++DOMWINDOW == 90 (0x7f6275560400) [pid = 3347] [serial = 1287] [outer = 0x7f6281591800] 11:54:21 INFO - 1070 INFO TEST-START | layout/style/test/test_style_attribute_standards.html 11:54:21 INFO - ++DOMWINDOW == 91 (0x7f627559e400) [pid = 3347] [serial = 1288] [outer = 0x7f6281591800] 11:54:21 INFO - MEMORY STAT | vsize 703MB | residentFast 142MB | heapAllocated 28MB 11:54:21 INFO - 1071 INFO TEST-OK | layout/style/test/test_style_attribute_standards.html | took 280ms 11:54:21 INFO - ++DOMWINDOW == 92 (0x7f62756eec00) [pid = 3347] [serial = 1289] [outer = 0x7f6281591800] 11:54:22 INFO - 1072 INFO TEST-START | layout/style/test/test_style_struct_copy_constructors.html 11:54:22 INFO - ++DOMWINDOW == 93 (0x7f62756ef000) [pid = 3347] [serial = 1290] [outer = 0x7f6281591800] 11:54:23 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:54:23 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:54:23 INFO - MEMORY STAT | vsize 703MB | residentFast 150MB | heapAllocated 37MB 11:54:23 INFO - 1073 INFO TEST-OK | layout/style/test/test_style_struct_copy_constructors.html | took 1672ms 11:54:23 INFO - --DOMWINDOW == 92 (0x7f62771de800) [pid = 3347] [serial = 1154] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-last-node%257B%2520z-index%253A%2520824%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-last-node%257B%2520z-index%253A%2520824%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:23 INFO - --DOMWINDOW == 91 (0x7f6278178000) [pid = 3347] [serial = 1207] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528*%257C*%2529%257B%2520z-index%253A%2520983%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528*%257C*%2529%257B%2520z-index%253A%2520983%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 90 (0x7f627817a000) [pid = 3347] [serial = 1208] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528*%257Ca%2529%257B%2520z-index%253A%2520986%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520url%2528http%253A//www.mozilla.org/keymaster/gatekeeper/there.is.only.xul%2529%253B@namespace%2520html%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253Bhtml%257Ca%253Anot%2528*%257Ca%2529%257B%2520z-index%253A%2520986%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 89 (0x7f6275561400) [pid = 3347] [serial = 1224] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528LTr%2529%257B%2520z-index%253A%25201050%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528LTr%2529%257B%2520z-index%253A%25201050%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 88 (0x7f62754d0000) [pid = 3347] [serial = 1225] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528ltR%2529%257B%2520z-index%253A%25201053%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528ltR%2529%257B%2520z-index%253A%25201053%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 87 (0x7f6275560800) [pid = 3347] [serial = 1226] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528LTR%2529%257B%2520z-index%253A%25201056%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528LTR%2529%257B%2520z-index%253A%25201056%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 86 (0x7f62755ae800) [pid = 3347] [serial = 1227] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528RTl%2529%257B%2520z-index%253A%25201059%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528RTl%2529%257B%2520z-index%253A%25201059%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 85 (0x7f627559dc00) [pid = 3347] [serial = 1228] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528other%2529%257B%2520z-index%253A%25201062%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-dir%2528other%2529%257B%2520z-index%253A%25201062%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 84 (0x7f627559c400) [pid = 3347] [serial = 1248] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cspan%257B%2520z-index%253A%25201146%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cspan%257B%2520z-index%253A%25201146%2520%257D%27%3E%3Cbody%3E] 11:54:23 INFO - --DOMWINDOW == 83 (0x7f62755b3c00) [pid = 3347] [serial = 1249] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CsPaN%257B%2520z-index%253A%25201149%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CsPaN%257B%2520z-index%253A%25201149%2520%257D%27%3E%3Cbody%3E] 11:54:23 INFO - --DOMWINDOW == 82 (0x7f62754c7000) [pid = 3347] [serial = 1250] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CSpan%257B%2520z-index%253A%25201152%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CSpan%257B%2520z-index%253A%25201152%2520%257D%27%3E%3Cbody%3E] 11:54:23 INFO - --DOMWINDOW == 81 (0x7f62754c8c00) [pid = 3347] [serial = 1251] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CSPAN%257B%2520z-index%253A%25201155%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2CSPAN%257B%2520z-index%253A%25201155%2520%257D%27%3E%3Cbody%3E] 11:54:23 INFO - --DOMWINDOW == 80 (0x7f62754c7400) [pid = 3347] [serial = 1252] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520%255C32%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B%255C32%257Ca%257B%2520z-index%253A%25201166%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520%255C32%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B%255C32%257Ca%257B%2520z-index%253A%25201166%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 79 (0x7f62754cd400) [pid = 3347] [serial = 1253] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520-%255C32%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B-%255C32%257Ca%257B%2520z-index%253A%25201169%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520-%255C32%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B-%255C32%257Ca%257B%2520z-index%253A%25201169%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 78 (0x7f627559d000) [pid = 3347] [serial = 1254] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520%255C0002%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B%255C2%257Ca%257B%2520z-index%253A%25201172%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520%255C0002%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B%255C2%257Ca%257B%2520z-index%253A%25201172%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 77 (0x7f62757f5800) [pid = 3347] [serial = 1255] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520-%255C000002%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B-%255C2%257Ca%257B%2520z-index%253A%25201175%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C@namespace%2520-%255C000002%2520%2520url%2528http%253A//www.w3.org/1999/xhtml%2529%253B-%255C2%257Ca%257B%2520z-index%253A%25201175%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:23 INFO - --DOMWINDOW == 76 (0x7f62763d6800) [pid = 3347] [serial = 1256] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.%255C32%257B%2520z-index%253A%25201178%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.%255C32%257B%2520z-index%253A%25201178%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 75 (0x7f6275568000) [pid = 3347] [serial = 1257] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%253D%255C32%255D%257B%2520z-index%253A%25201181%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%253D%255C32%255D%257B%2520z-index%253A%25201181%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 74 (0x7f62757fc000) [pid = 3347] [serial = 1258] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.%255C2%257B%2520z-index%253A%25201184%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C.%255C2%257B%2520z-index%253A%25201184%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 73 (0x7f62763db000) [pid = 3347] [serial = 1259] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%253D%255C2%255D%257B%2520z-index%253A%25201187%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bclass%253D%255C2%255D%257B%2520z-index%253A%25201187%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 72 (0x7f62763dd800) [pid = 3347] [serial = 1260] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523%255C32%257B%2520z-index%253A%25201190%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523%255C32%257B%2520z-index%253A%25201190%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 71 (0x7f6276484400) [pid = 3347] [serial = 1261] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bid%253D%255C32%255D%257B%2520z-index%253A%25201193%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bid%253D%255C32%255D%257B%2520z-index%253A%25201193%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 70 (0x7f627648f000) [pid = 3347] [serial = 1262] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523%255C2%257B%2520z-index%253A%25201196%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%2523%255C2%257B%2520z-index%253A%25201196%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 69 (0x7f6276489000) [pid = 3347] [serial = 1263] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bid%253D%255C2%255D%257B%2520z-index%253A%25201199%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%255Bid%253D%255C2%255D%257B%2520z-index%253A%25201199%2520%257D%27%3E%3Cbody%3E%3Cspan%20class%3D%272%27%3E%3C/span%3E%3Cspan%20class%3D%27%26%23x2%3B%27%3E%3C/span%3E%3Cspan%20id%3D%272%27%3E%3C/span%3E%3Cspan%20id%3D%27%26%23x2%3B%27%3E%3C/span%3E] 11:54:23 INFO - --DOMWINDOW == 68 (0x7f62763d4800) [pid = 3347] [serial = 1272] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528%253Alink%252C%253Anot%2528a%2529%2529%257B%2520z-index%253A%25201280%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528%253Alink%252C%253Anot%2528a%2529%2529%257B%2520z-index%253A%25201280%2520%257D%27%3E%3Cbody%3E%3Cinput%20type%3D%27text%27%3E%3Ca%20href%3D%27http%3A//www.example.com/%27%3E%3C/a%3E%3Cdiv%3E%3C/div%3E%3Ca%20name%3D%27foo%27%3E] 11:54:23 INFO - --DOMWINDOW == 67 (0x7f6277104c00) [pid = 3347] [serial = 1271] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528a%252Cinput%2529%257B%2520z-index%253A%25201277%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528a%252Cinput%2529%257B%2520z-index%253A%25201277%2520%257D%27%3E%3Cbody%3E%3Cinput%20type%3D%27text%27%3E%3Ca%20href%3D%27http%3A//www.example.com/%27%3E%3C/a%3E%3Cdiv%3E%3C/div%3E%3Ca%20name%3D%27foo%27%3E] 11:54:23 INFO - ++DOMWINDOW == 68 (0x7f62754d0000) [pid = 3347] [serial = 1291] [outer = 0x7f6281591800] 11:54:23 INFO - 1074 INFO TEST-START | layout/style/test/test_supports_rules.html 11:54:24 INFO - ++DOMWINDOW == 69 (0x7f6275560800) [pid = 3347] [serial = 1292] [outer = 0x7f6281591800] 11:54:24 INFO - MEMORY STAT | vsize 703MB | residentFast 148MB | heapAllocated 36MB 11:54:24 INFO - 1075 INFO TEST-OK | layout/style/test/test_supports_rules.html | took 352ms 11:54:24 INFO - ++DOMWINDOW == 70 (0x7f627dd60400) [pid = 3347] [serial = 1293] [outer = 0x7f6281591800] 11:54:24 INFO - 1076 INFO TEST-START | layout/style/test/test_system_font_serialization.html 11:54:24 INFO - ++DOMWINDOW == 71 (0x7f62763d5c00) [pid = 3347] [serial = 1294] [outer = 0x7f6281591800] 11:54:24 INFO - MEMORY STAT | vsize 704MB | residentFast 147MB | heapAllocated 33MB 11:54:24 INFO - 1077 INFO TEST-OK | layout/style/test/test_system_font_serialization.html | took 334ms 11:54:24 INFO - ++DOMWINDOW == 72 (0x7f627dc0c000) [pid = 3347] [serial = 1295] [outer = 0x7f6281591800] 11:54:24 INFO - 1078 INFO TEST-START | layout/style/test/test_text_decoration_shorthands.html 11:54:25 INFO - ++DOMWINDOW == 73 (0x7f62756f0c00) [pid = 3347] [serial = 1296] [outer = 0x7f6281591800] 11:54:25 INFO - MEMORY STAT | vsize 704MB | residentFast 143MB | heapAllocated 34MB 11:54:25 INFO - 1079 INFO TEST-OK | layout/style/test/test_text_decoration_shorthands.html | took 434ms 11:54:25 INFO - ++DOMWINDOW == 74 (0x7f627dd63c00) [pid = 3347] [serial = 1297] [outer = 0x7f6281591800] 11:54:25 INFO - 1080 INFO TEST-START | layout/style/test/test_transitions.html 11:54:25 INFO - ++DOMWINDOW == 75 (0x7f62754cd800) [pid = 3347] [serial = 1298] [outer = 0x7f6281591800] 11:54:28 INFO - --DOCSHELL 0x7f62754f5000 == 2 [pid = 3347] [id = 37] 11:54:30 INFO - --DOMWINDOW == 74 (0x7f627dc0c000) [pid = 3347] [serial = 1295] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 73 (0x7f62763d5c00) [pid = 3347] [serial = 1294] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_system_font_serialization.html] 11:54:30 INFO - --DOMWINDOW == 72 (0x7f627dd60400) [pid = 3347] [serial = 1293] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 71 (0x7f6275560800) [pid = 3347] [serial = 1292] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_supports_rules.html] 11:54:30 INFO - --DOMWINDOW == 70 (0x7f62754d0000) [pid = 3347] [serial = 1291] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 69 (0x7f62756ef000) [pid = 3347] [serial = 1290] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_style_struct_copy_constructors.html] 11:54:30 INFO - --DOMWINDOW == 68 (0x7f62756eec00) [pid = 3347] [serial = 1289] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 67 (0x7f6275560400) [pid = 3347] [serial = 1287] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 66 (0x7f62755a4400) [pid = 3347] [serial = 1285] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 65 (0x7f62754ce800) [pid = 3347] [serial = 1284] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_specified_value_serialization.html] 11:54:30 INFO - --DOMWINDOW == 64 (0x7f6277107400) [pid = 3347] [serial = 1283] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 63 (0x7f6278265800) [pid = 3347] [serial = 1221] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528rTl%2529%257B%2520z-index%253A%25201041%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528rTl%2529%257B%2520z-index%253A%25201041%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 62 (0x7f62754d1000) [pid = 3347] [serial = 1222] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528LTR%2529%257B%2520z-index%253A%25201044%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528LTR%2529%257B%2520z-index%253A%25201044%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 61 (0x7f62754ca000) [pid = 3347] [serial = 1223] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528other%2529%257B%2520z-index%253A%25201047%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528other%2529%257B%2520z-index%253A%25201047%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 60 (0x7f62755b4c00) [pid = 3347] [serial = 1229] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme%257B%2520z-index%253A%25201081%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme%257B%2520z-index%253A%25201081%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 59 (0x7f62756ea000) [pid = 3347] [serial = 1230] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme-brighttext%257B%2520z-index%253A%25201084%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme-brighttext%257B%2520z-index%253A%25201084%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 58 (0x7f627559bc00) [pid = 3347] [serial = 1231] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme-darktext%257B%2520z-index%253A%25201087%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-lwtheme-darktext%257B%2520z-index%253A%25201087%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 57 (0x7f62755acc00) [pid = 3347] [serial = 1232] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2529%257B%2520z-index%253A%25201090%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2529%257B%2520z-index%253A%25201090%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 56 (0x7f62756f1000) [pid = 3347] [serial = 1233] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2529%257B%2520z-index%253A%25201093%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2529%257B%2520z-index%253A%25201093%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 55 (0x7f62755b0000) [pid = 3347] [serial = 1234] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520focus%2529%257B%2520z-index%253A%25201096%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520focus%2529%257B%2520z-index%253A%25201096%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 54 (0x7f62754c6400) [pid = 3347] [serial = 1235] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520%252C%2520focus%2529%257B%2520z-index%253A%25201099%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520%252C%2520focus%2529%257B%2520z-index%253A%25201099%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 53 (0x7f62754c8800) [pid = 3347] [serial = 1236] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2520%252Cfocus%2529%257B%2520z-index%253A%25201102%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2520%252Cfocus%2529%257B%2520z-index%253A%25201102%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 52 (0x7f62756e9c00) [pid = 3347] [serial = 1237] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%252C%2520focus%2529%257B%2520z-index%253A%25201105%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%252C%2520focus%2529%257B%2520z-index%253A%25201105%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 51 (0x7f62757f4800) [pid = 3347] [serial = 1238] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%252Cfocus%2529%257B%2520z-index%253A%25201108%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%252Cfocus%2529%257B%2520z-index%253A%25201108%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 50 (0x7f62756f6c00) [pid = 3347] [serial = 1239] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520%2520%2520%2520%2520focus%2529%257B%2520z-index%253A%25201111%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-tree-row%2528selected%2520%2520%2520%2520%2520focus%2529%257B%2520z-index%253A%25201111%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 49 (0x7f62757f0c00) [pid = 3347] [serial = 1240] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2520%2520%2520%2520%252C%2520%2520%2520focus%2529%257B%2520z-index%253A%25201114%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-row%2528selected%2520%2520%2520%2520%252C%2520%2520%2520focus%2529%257B%2520z-index%253A%25201114%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 48 (0x7f62757fac00) [pid = 3347] [serial = 1241] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-twisty%2528%2520%2520hover%2520open%2520%2520%2529%257B%2520z-index%253A%25201117%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A%253A-moz-tree-twisty%2528%2520%2520hover%2520open%2520%2520%2529%257B%2520z-index%253A%25201117%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 47 (0x7f62754c6000) [pid = 3347] [serial = 1242] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-window-inactive%257B%2520z-index%253A%25201126%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-window-inactive%257B%2520z-index%253A%25201126%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 46 (0x7f62754c5800) [pid = 3347] [serial = 1243] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520div%2520p%253A-moz-window-inactive%253Ahover%2520span%257B%2520z-index%253A%25201129%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520div%2520p%253A-moz-window-inactive%253Ahover%2520span%257B%2520z-index%253A%25201129%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 45 (0x7f62754c5c00) [pid = 3347] [serial = 1244] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-type-unsupported%257B%2520z-index%253A%25201132%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-type-unsupported%257B%2520z-index%253A%25201132%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 44 (0x7f62754c8000) [pid = 3347] [serial = 1245] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-disabled%257B%2520z-index%253A%25201135%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-disabled%257B%2520z-index%253A%25201135%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 43 (0x7f62754ce400) [pid = 3347] [serial = 1209] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528ltr%2529%257B%2520z-index%253A%2520989%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528ltr%2529%257B%2520z-index%253A%2520989%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 42 (0x7f627559f000) [pid = 3347] [serial = 1210] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528rtl%2529%257B%2520z-index%253A%2520992%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528rtl%2529%257B%2520z-index%253A%2520992%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 41 (0x7f62757f1000) [pid = 3347] [serial = 1211] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528rTl%2529%257B%2520z-index%253A%2520995%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528rTl%2529%257B%2520z-index%253A%2520995%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 40 (0x7f62757edc00) [pid = 3347] [serial = 1212] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528LTR%2529%257B%2520z-index%253A%2520998%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528LTR%2529%257B%2520z-index%253A%2520998%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 39 (0x7f62754c9400) [pid = 3347] [serial = 1213] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528other%2529%257B%2520z-index%253A%25201001%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-locale-dir%2528other%2529%257B%2520z-index%253A%25201001%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 38 (0x7f62754cc800) [pid = 3347] [serial = 1214] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528LTr%2529%257B%2520z-index%253A%25201004%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528LTr%2529%257B%2520z-index%253A%25201004%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:30 INFO - --DOMWINDOW == 37 (0x7f6276102800) [pid = 3347] [serial = 1215] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528ltR%2529%257B%2520z-index%253A%25201007%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528ltR%2529%257B%2520z-index%253A%25201007%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:30 INFO - --DOMWINDOW == 36 (0x7f62754cb800) [pid = 3347] [serial = 1216] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528LTR%2529%257B%2520z-index%253A%25201010%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528LTR%2529%257B%2520z-index%253A%25201010%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:30 INFO - --DOMWINDOW == 35 (0x7f62757efc00) [pid = 3347] [serial = 1217] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528RTl%2529%257B%2520z-index%253A%25201013%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528RTl%2529%257B%2520z-index%253A%25201013%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:30 INFO - --DOMWINDOW == 34 (0x7f62772e1c00) [pid = 3347] [serial = 1218] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528other%2529%257B%2520z-index%253A%25201016%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Ca%253A-moz-locale-dir%2528other%2529%257B%2520z-index%253A%25201016%2520%257D%27%3E%3Cbody%3E%3Ca%20id%3D%27a%27%20href%3D%27data%3Atext/plain%2Cthis_better_be_unvisited%27%3E%3C/a%3E] 11:54:30 INFO - --DOMWINDOW == 33 (0x7f627826b000) [pid = 3347] [serial = 1219] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528ltr%2529%257B%2520z-index%253A%25201035%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528ltr%2529%257B%2520z-index%253A%25201035%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 32 (0x7f627840a400) [pid = 3347] [serial = 1220] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528rtl%2529%257B%2520z-index%253A%25201038%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-dir%2528rtl%2529%257B%2520z-index%253A%25201038%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 31 (0x7f62754c8400) [pid = 3347] [serial = 1246] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-blocked%257B%2520z-index%253A%25201138%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-blocked%257B%2520z-index%253A%25201138%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 30 (0x7f627556e800) [pid = 3347] [serial = 1247] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-crashed%257B%2520z-index%253A%25201141%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-handler-crashed%257B%2520z-index%253A%25201141%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 29 (0x7f6275565000) [pid = 3347] [serial = 979] [outer = (nil)] [url = about:blank] 11:54:30 INFO - --DOMWINDOW == 28 (0x7f6275566400) [pid = 3347] [serial = 980] [outer = (nil)] [url = about:blank] 11:54:30 INFO - --DOMWINDOW == 27 (0x7f6276f06800) [pid = 3347] [serial = 1264] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252C%2520p%2529%257B%2520z-index%253A%25201254%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252C%2520p%2529%257B%2520z-index%253A%25201254%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 26 (0x7f62763d6400) [pid = 3347] [serial = 1265] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%2520div%2520%252C%2520p%2520%2520%2529%257B%2520z-index%253A%25201257%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%2520div%2520%252C%2520p%2520%2520%2529%257B%2520z-index%253A%25201257%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 25 (0x7f62763d8800) [pid = 3347] [serial = 1266] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252Cp%2529%257B%2520z-index%253A%25201260%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252Cp%2529%257B%2520z-index%253A%25201260%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 24 (0x7f6275c97400) [pid = 3347] [serial = 1267] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%2529%257B%2520z-index%253A%25201263%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%2529%257B%2520z-index%253A%25201263%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 23 (0x7f6276108400) [pid = 3347] [serial = 1268] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252Cp%252C%253Alink%252Cspan%253Afocus%2529%257B%2520z-index%253A%25201266%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528div%252Cp%252C%253Alink%252Cspan%253Afocus%2529%257B%2520z-index%253A%25201266%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 22 (0x7f6277104400) [pid = 3347] [serial = 1269] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%253Aactive%252C%253Afocus%2529%257B%2520z-index%253A%25201269%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%253Aactive%252C%253Afocus%2529%257B%2520z-index%253A%25201269%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 21 (0x7f6277104000) [pid = 3347] [serial = 1270] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%253Aactive%252C%253Alink%253Afocus%2529%257B%2520z-index%253A%25201272%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-any%2528%253Aactive%252C%253Alink%253Afocus%2529%257B%2520z-index%253A%25201272%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 20 (0x7f62763dc400) [pid = 3347] [serial = 1273] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528%255Bhref%255D%252Cinput%255Btype%255D%252Cinput%255Bname%255D%2529%257B%2520z-index%253A%25201283%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528%255Bhref%255D%252Cinput%255Btype%255D%252Cinput%255Bname%255D%2529%257B%2520z-index%253A%25201283%2520%257D%27%3E%3Cbody%3E%3Cinput%20type%3D%27text%27%3E%3Ca%20href%3D%27http%3A//www.example.com/%27%3E%3C/a%3E%3Cdiv%3E%3C/div%3E%3Ca%20name%3D%27foo%27%3E] 11:54:30 INFO - --DOMWINDOW == 19 (0x7f62754cf400) [pid = 3347] [serial = 1274] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528div%252Ca%2529%253A-moz-any%2528%255Btype%255D%252C%255Bhref%255D%252C%255Bname%255D%2529%257B%2520z-index%253A%25201286%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-any%2528div%252Ca%2529%253A-moz-any%2528%255Btype%255D%252C%255Bhref%255D%252C%255Bname%255D%2529%257B%2520z-index%253A%25201286%2520%257D%27%3E%3Cbody%3E%3Cinput%20type%3D%27text%27%3E%3Ca%20href%3D%27http%3A//www.example.com/%27%3E%3C/a%3E%3Cdiv%3E%3C/div%3E%3Ca%20name%3D%27foo%27%3E] 11:54:30 INFO - --DOMWINDOW == 18 (0x7f62754d2000) [pid = 3347] [serial = 1275] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-table-border-nonzero%257B%2520z-index%253A%25201289%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2C%253A-moz-table-border-nonzero%257B%2520z-index%253A%25201289%2520%257D%27%3E%3Cbody%3E%3Cp%3E%3C/p%3E%3Cp%20border%3D%272%27%3E%3C/p%3E%3Ctable%20border%3D%272%27%3E%3C/table%3E%3Ctable%20border%3E%3C/table%3E%3Ctable%3E%3C/table%3E%3Ctable%20frame%3D%27border%27%3E%3C/table%3E%3Ctable%20border%3D%270%27%3E%3C/table%3E%3Ctable%20border%3D%270pt%27%3E%3C/table%3E%3Ctable%20border%3D%273pt%27%3E%3C/table%3E] 11:54:30 INFO - --DOMWINDOW == 17 (0x7f627556f800) [pid = 3347] [serial = 1276] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-placeholder%257B%2520z-index%253A%25201318%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-placeholder%257B%2520z-index%253A%25201318%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 16 (0x7f62771e1c00) [pid = 3347] [serial = 1277] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 15 (0x7f62754ca400) [pid = 3347] [serial = 1278] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_selectors_on_anonymous_content.html] 11:54:30 INFO - --DOMWINDOW == 14 (0x7f62754cdc00) [pid = 3347] [serial = 1279] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 13 (0x7f62772d7c00) [pid = 3347] [serial = 1281] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 12 (0x7f62772dcc00) [pid = 3347] [serial = 1282] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_shorthand_property_getters.html] 11:54:30 INFO - --DOMWINDOW == 11 (0x7f627dd63c00) [pid = 3347] [serial = 1297] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:30 INFO - --DOMWINDOW == 10 (0x7f6275561800) [pid = 3347] [serial = 978] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-placeholder%257B%2520z-index%253A%25201318%2520%257D%27%3E%3Clink%20rel%3D%27stylesheet%27%20href%3D%27data%3Atext/css%2Cp%252C%2520%253A-moz-placeholder%257B%2520z-index%253A%25201318%2520%257D%27%3E%3Cp%3E%3C/p%3E] 11:54:30 INFO - --DOMWINDOW == 9 (0x7f62754c9c00) [pid = 3347] [serial = 977] [outer = (nil)] [url = about:blank] 11:54:30 INFO - --DOMWINDOW == 8 (0x7f627559e400) [pid = 3347] [serial = 1288] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_style_attribute_standards.html] 11:54:30 INFO - --DOMWINDOW == 7 (0x7f62755a4c00) [pid = 3347] [serial = 1286] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_style_attribute_quirks.html] 11:54:30 INFO - --DOMWINDOW == 6 (0x7f627559d400) [pid = 3347] [serial = 1280] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_setPropertyWithNull.html] 11:54:30 INFO - --DOMWINDOW == 5 (0x7f62756f0c00) [pid = 3347] [serial = 1296] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_text_decoration_shorthands.html] 11:54:34 INFO - MEMORY STAT | vsize 700MB | residentFast 115MB | heapAllocated 22MB 11:54:34 INFO - 1081 INFO TEST-OK | layout/style/test/test_transitions.html | took 9081ms 11:54:34 INFO - ++DOMWINDOW == 6 (0x7f62771e1c00) [pid = 3347] [serial = 1299] [outer = 0x7f6281591800] 11:54:34 INFO - 1082 INFO TEST-START | layout/style/test/test_transitions_and_reframes.html 11:54:35 INFO - ++DOMWINDOW == 7 (0x7f62754c6c00) [pid = 3347] [serial = 1300] [outer = 0x7f6281591800] 11:54:36 INFO - --DOMWINDOW == 6 (0x7f62754d1400) [pid = 3347] [serial = 976] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_selectors.html] 11:54:36 INFO - MEMORY STAT | vsize 700MB | residentFast 113MB | heapAllocated 20MB 11:54:36 INFO - 1083 INFO TEST-OK | layout/style/test/test_transitions_and_reframes.html | took 1714ms 11:54:36 INFO - ++DOMWINDOW == 7 (0x7f62754c5800) [pid = 3347] [serial = 1301] [outer = 0x7f6281591800] 11:54:36 INFO - 1084 INFO TEST-START | layout/style/test/test_transitions_and_restyles.html 11:54:36 INFO - ++DOMWINDOW == 8 (0x7f62755b3c00) [pid = 3347] [serial = 1302] [outer = 0x7f6281591800] 11:54:37 INFO - MEMORY STAT | vsize 700MB | residentFast 114MB | heapAllocated 20MB 11:54:37 INFO - 1085 INFO TEST-OK | layout/style/test/test_transitions_and_restyles.html | took 379ms 11:54:37 INFO - ++DOMWINDOW == 9 (0x7f62756eb400) [pid = 3347] [serial = 1303] [outer = 0x7f6281591800] 11:54:37 INFO - 1086 INFO TEST-START | layout/style/test/test_transitions_and_zoom.html 11:54:37 INFO - ++DOMWINDOW == 10 (0x7f62754cd400) [pid = 3347] [serial = 1304] [outer = 0x7f6281591800] 11:54:38 INFO - --DOMWINDOW == 9 (0x7f62754cd800) [pid = 3347] [serial = 1298] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions.html] 11:54:38 INFO - MEMORY STAT | vsize 701MB | residentFast 113MB | heapAllocated 20MB 11:54:38 INFO - 1087 INFO TEST-OK | layout/style/test/test_transitions_and_zoom.html | took 1586ms 11:54:38 INFO - ++DOMWINDOW == 10 (0x7f62756f0800) [pid = 3347] [serial = 1305] [outer = 0x7f6281591800] 11:54:39 INFO - 1088 INFO TEST-START | layout/style/test/test_transitions_bug537151.html 11:54:39 INFO - ++DOMWINDOW == 11 (0x7f62754cc800) [pid = 3347] [serial = 1306] [outer = 0x7f6281591800] 11:54:40 INFO - MEMORY STAT | vsize 697MB | residentFast 113MB | heapAllocated 21MB 11:54:40 INFO - 1089 INFO TEST-OK | layout/style/test/test_transitions_bug537151.html | took 992ms 11:54:40 INFO - ++DOMWINDOW == 12 (0x7f62756f6c00) [pid = 3347] [serial = 1307] [outer = 0x7f6281591800] 11:54:40 INFO - 1090 INFO TEST-START | layout/style/test/test_transitions_cancel_near_end.html 11:54:40 INFO - ++DOMWINDOW == 13 (0x7f62756f7c00) [pid = 3347] [serial = 1308] [outer = 0x7f6281591800] 11:54:42 INFO - MEMORY STAT | vsize 697MB | residentFast 115MB | heapAllocated 23MB 11:54:42 INFO - 1091 INFO TEST-OK | layout/style/test/test_transitions_cancel_near_end.html | took 2001ms 11:54:42 INFO - ++DOMWINDOW == 14 (0x7f6275c95800) [pid = 3347] [serial = 1309] [outer = 0x7f6281591800] 11:54:42 INFO - 1092 INFO TEST-START | layout/style/test/test_transitions_computed_value_combinations.html 11:54:42 INFO - ++DOMWINDOW == 15 (0x7f62754ce400) [pid = 3347] [serial = 1310] [outer = 0x7f6281591800] 11:54:44 INFO - MEMORY STAT | vsize 697MB | residentFast 118MB | heapAllocated 25MB 11:54:44 INFO - 1093 INFO TEST-OK | layout/style/test/test_transitions_computed_value_combinations.html | took 1902ms 11:54:44 INFO - ++DOMWINDOW == 16 (0x7f62803fb000) [pid = 3347] [serial = 1311] [outer = 0x7f6281591800] 11:54:44 INFO - 1094 INFO TEST-START | layout/style/test/test_transitions_computed_values.html 11:54:44 INFO - ++DOMWINDOW == 17 (0x7f62754c7000) [pid = 3347] [serial = 1312] [outer = 0x7f6281591800] 11:54:45 INFO - MEMORY STAT | vsize 697MB | residentFast 116MB | heapAllocated 22MB 11:54:45 INFO - 1095 INFO TEST-OK | layout/style/test/test_transitions_computed_values.html | took 569ms 11:54:45 INFO - ++DOMWINDOW == 18 (0x7f62755abc00) [pid = 3347] [serial = 1313] [outer = 0x7f6281591800] 11:54:45 INFO - 1096 INFO TEST-START | layout/style/test/test_transitions_dynamic_changes.html 11:54:45 INFO - ++DOMWINDOW == 19 (0x7f62755ac000) [pid = 3347] [serial = 1314] [outer = 0x7f6281591800] 11:54:45 INFO - MEMORY STAT | vsize 697MB | residentFast 116MB | heapAllocated 22MB 11:54:45 INFO - 1097 INFO TEST-OK | layout/style/test/test_transitions_dynamic_changes.html | took 544ms 11:54:45 INFO - ++DOMWINDOW == 20 (0x7f62756ef400) [pid = 3347] [serial = 1315] [outer = 0x7f6281591800] 11:54:45 INFO - 1098 INFO TEST-START | layout/style/test/test_transitions_events.html 11:54:46 INFO - ++DOMWINDOW == 21 (0x7f62756efc00) [pid = 3347] [serial = 1316] [outer = 0x7f6281591800] 11:54:47 INFO - --DOMWINDOW == 20 (0x7f62754c5800) [pid = 3347] [serial = 1301] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 19 (0x7f62756eb400) [pid = 3347] [serial = 1303] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 18 (0x7f62756f0800) [pid = 3347] [serial = 1305] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 17 (0x7f62756f6c00) [pid = 3347] [serial = 1307] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 16 (0x7f6275c95800) [pid = 3347] [serial = 1309] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 15 (0x7f62771e1c00) [pid = 3347] [serial = 1299] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:54:47 INFO - --DOMWINDOW == 14 (0x7f62754c6c00) [pid = 3347] [serial = 1300] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_and_reframes.html] 11:54:47 INFO - --DOMWINDOW == 13 (0x7f62755b3c00) [pid = 3347] [serial = 1302] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_and_restyles.html] 11:54:49 INFO - MEMORY STAT | vsize 697MB | residentFast 116MB | heapAllocated 23MB 11:54:49 INFO - 1099 INFO TEST-OK | layout/style/test/test_transitions_events.html | took 3967ms 11:54:49 INFO - ++DOMWINDOW == 14 (0x7f6275c8bc00) [pid = 3347] [serial = 1317] [outer = 0x7f6281591800] 11:54:50 INFO - 1100 INFO TEST-START | layout/style/test/test_transitions_per_property.html 11:54:50 INFO - ++DOMWINDOW == 15 (0x7f62756f6800) [pid = 3347] [serial = 1318] [outer = 0x7f6281591800] 11:55:36 INFO - --DOMWINDOW == 14 (0x7f62756f7c00) [pid = 3347] [serial = 1308] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_cancel_near_end.html] 11:55:36 INFO - --DOMWINDOW == 13 (0x7f62803fb000) [pid = 3347] [serial = 1311] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:36 INFO - --DOMWINDOW == 12 (0x7f62754cc800) [pid = 3347] [serial = 1306] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_bug537151.html] 11:55:36 INFO - --DOMWINDOW == 11 (0x7f62754cd400) [pid = 3347] [serial = 1304] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_and_zoom.html] 11:55:38 INFO - --DOMWINDOW == 10 (0x7f62754ce400) [pid = 3347] [serial = 1310] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_computed_value_combinations.html] 11:55:38 INFO - --DOMWINDOW == 9 (0x7f6275c8bc00) [pid = 3347] [serial = 1317] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:38 INFO - --DOMWINDOW == 8 (0x7f62756ef400) [pid = 3347] [serial = 1315] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:38 INFO - --DOMWINDOW == 7 (0x7f62755abc00) [pid = 3347] [serial = 1313] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:38 INFO - --DOMWINDOW == 6 (0x7f62754c7000) [pid = 3347] [serial = 1312] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_computed_values.html] 11:55:39 INFO - MEMORY STAT | vsize 698MB | residentFast 131MB | heapAllocated 28MB 11:55:39 INFO - 1101 INFO TEST-OK | layout/style/test/test_transitions_per_property.html | took 48993ms 11:55:40 INFO - ++DOMWINDOW == 7 (0x7f6276108000) [pid = 3347] [serial = 1319] [outer = 0x7f6281591800] 11:55:40 INFO - 1102 INFO TEST-START | layout/style/test/test_transitions_step_functions.html 11:55:40 INFO - ++DOMWINDOW == 8 (0x7f62755ae000) [pid = 3347] [serial = 1320] [outer = 0x7f6281591800] 11:55:40 INFO - MEMORY STAT | vsize 701MB | residentFast 132MB | heapAllocated 32MB 11:55:40 INFO - 1103 INFO TEST-OK | layout/style/test/test_transitions_step_functions.html | took 554ms 11:55:40 INFO - ++DOMWINDOW == 9 (0x7f62757f3000) [pid = 3347] [serial = 1321] [outer = 0x7f6281591800] 11:55:40 INFO - 1104 INFO TEST-START | layout/style/test/test_unclosed_parentheses.html 11:55:41 INFO - ++DOMWINDOW == 10 (0x7f6275c94800) [pid = 3347] [serial = 1322] [outer = 0x7f6281591800] 11:55:42 INFO - MEMORY STAT | vsize 701MB | residentFast 135MB | heapAllocated 34MB 11:55:42 INFO - 1105 INFO TEST-OK | layout/style/test/test_unclosed_parentheses.html | took 1382ms 11:55:42 INFO - ++DOMWINDOW == 11 (0x7f62754cb000) [pid = 3347] [serial = 1323] [outer = 0x7f6281591800] 11:55:42 INFO - 1106 INFO TEST-START | layout/style/test/test_unicode_range_loading.html 11:55:42 INFO - ++DOMWINDOW == 12 (0x7f62754cb800) [pid = 3347] [serial = 1324] [outer = 0x7f6281591800] 11:55:44 INFO - --DOMWINDOW == 11 (0x7f62756efc00) [pid = 3347] [serial = 1316] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_events.html] 11:55:44 INFO - --DOMWINDOW == 10 (0x7f62755ac000) [pid = 3347] [serial = 1314] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_dynamic_changes.html] 11:55:48 INFO - --DOMWINDOW == 9 (0x7f62754cb000) [pid = 3347] [serial = 1323] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:48 INFO - --DOMWINDOW == 8 (0x7f62757f3000) [pid = 3347] [serial = 1321] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:48 INFO - --DOMWINDOW == 7 (0x7f62755ae000) [pid = 3347] [serial = 1320] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_step_functions.html] 11:55:48 INFO - --DOMWINDOW == 6 (0x7f6276108000) [pid = 3347] [serial = 1319] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:55:48 INFO - --DOMWINDOW == 5 (0x7f6275c94800) [pid = 3347] [serial = 1322] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_unclosed_parentheses.html] 11:55:51 INFO - --DOMWINDOW == 4 (0x7f62756f6800) [pid = 3347] [serial = 1318] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_transitions_per_property.html] 11:55:52 INFO - MEMORY STAT | vsize 704MB | residentFast 127MB | heapAllocated 28MB 11:55:52 INFO - 1107 INFO TEST-OK | layout/style/test/test_unicode_range_loading.html | took 10080ms 11:55:52 INFO - ++DOMWINDOW == 5 (0x7f62755b2c00) [pid = 3347] [serial = 1325] [outer = 0x7f6281591800] 11:55:52 INFO - 1108 INFO TEST-START | layout/style/test/test_units_angle.html 11:55:52 INFO - ++DOMWINDOW == 6 (0x7f62754d0000) [pid = 3347] [serial = 1326] [outer = 0x7f6281591800] 11:55:53 INFO - MEMORY STAT | vsize 704MB | residentFast 127MB | heapAllocated 29MB 11:55:53 INFO - 1109 INFO TEST-OK | layout/style/test/test_units_angle.html | took 289ms 11:55:53 INFO - ++DOMWINDOW == 7 (0x7f627559c800) [pid = 3347] [serial = 1327] [outer = 0x7f6281591800] 11:55:53 INFO - 1110 INFO TEST-START | layout/style/test/test_units_frequency.html 11:55:53 INFO - ++DOMWINDOW == 8 (0x7f62756e8c00) [pid = 3347] [serial = 1328] [outer = 0x7f6281591800] 11:55:53 INFO - MEMORY STAT | vsize 704MB | residentFast 129MB | heapAllocated 29MB 11:55:53 INFO - 1111 INFO TEST-OK | layout/style/test/test_units_frequency.html | took 307ms 11:55:53 INFO - ++DOMWINDOW == 9 (0x7f62756f4400) [pid = 3347] [serial = 1329] [outer = 0x7f6281591800] 11:55:53 INFO - 1112 INFO TEST-START | layout/style/test/test_units_length.html 11:55:53 INFO - ++DOMWINDOW == 10 (0x7f62756f4800) [pid = 3347] [serial = 1330] [outer = 0x7f6281591800] 11:55:54 INFO - MEMORY STAT | vsize 704MB | residentFast 129MB | heapAllocated 30MB 11:55:54 INFO - 1113 INFO TEST-OK | layout/style/test/test_units_length.html | took 429ms 11:55:54 INFO - ++DOMWINDOW == 11 (0x7f62757f3000) [pid = 3347] [serial = 1331] [outer = 0x7f6281591800] 11:55:54 INFO - 1114 INFO TEST-START | layout/style/test/test_units_time.html 11:55:54 INFO - ++DOMWINDOW == 12 (0x7f62756f1000) [pid = 3347] [serial = 1332] [outer = 0x7f6281591800] 11:55:54 INFO - MEMORY STAT | vsize 704MB | residentFast 129MB | heapAllocated 30MB 11:55:54 INFO - 1115 INFO TEST-OK | layout/style/test/test_units_time.html | took 261ms 11:55:54 INFO - ++DOMWINDOW == 13 (0x7f62757f7400) [pid = 3347] [serial = 1333] [outer = 0x7f6281591800] 11:55:54 INFO - 1116 INFO TEST-START | layout/style/test/test_unprefixing_service.html 11:55:54 INFO - ++DOMWINDOW == 14 (0x7f62755b7000) [pid = 3347] [serial = 1334] [outer = 0x7f6281591800] 11:55:54 INFO - ++DOCSHELL 0x7f6278dd2800 == 3 [pid = 3347] [id = 38] 11:55:54 INFO - ++DOMWINDOW == 15 (0x7f62754cb000) [pid = 3347] [serial = 1335] [outer = (nil)] 11:55:54 INFO - ++DOMWINDOW == 16 (0x7f62757fb400) [pid = 3347] [serial = 1336] [outer = 0x7f62754cb000] 11:55:55 INFO - ++DOMWINDOW == 17 (0x7f6275c8dc00) [pid = 3347] [serial = 1337] [outer = 0x7f62754cb000] 11:55:56 INFO - ++DOMWINDOW == 18 (0x7f6275c8cc00) [pid = 3347] [serial = 1338] [outer = 0x7f62754cb000] 11:55:58 INFO - ++DOMWINDOW == 19 (0x7f6275c92800) [pid = 3347] [serial = 1339] [outer = 0x7f62754cb000] 11:56:00 INFO - ++DOMWINDOW == 20 (0x7f6275561000) [pid = 3347] [serial = 1340] [outer = 0x7f62754cb000] 11:56:01 INFO - ++DOMWINDOW == 21 (0x7f6276105400) [pid = 3347] [serial = 1341] [outer = 0x7f62754cb000] 11:56:02 INFO - --DOMWINDOW == 20 (0x7f62757fb400) [pid = 3347] [serial = 1336] [outer = (nil)] [url = about:blank] 11:56:02 INFO - --DOMWINDOW == 19 (0x7f62757f7400) [pid = 3347] [serial = 1333] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:02 INFO - --DOMWINDOW == 18 (0x7f62756f1000) [pid = 3347] [serial = 1332] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_units_time.html] 11:56:02 INFO - --DOMWINDOW == 17 (0x7f62757f3000) [pid = 3347] [serial = 1331] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:02 INFO - --DOMWINDOW == 16 (0x7f62756f4800) [pid = 3347] [serial = 1330] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_units_length.html] 11:56:02 INFO - --DOMWINDOW == 15 (0x7f62756f4400) [pid = 3347] [serial = 1329] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:02 INFO - --DOMWINDOW == 14 (0x7f62756e8c00) [pid = 3347] [serial = 1328] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_units_frequency.html] 11:56:02 INFO - --DOMWINDOW == 13 (0x7f627559c800) [pid = 3347] [serial = 1327] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:02 INFO - --DOMWINDOW == 12 (0x7f62754d0000) [pid = 3347] [serial = 1326] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_units_angle.html] 11:56:02 INFO - --DOMWINDOW == 11 (0x7f62755b2c00) [pid = 3347] [serial = 1325] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:02 INFO - ++DOMWINDOW == 12 (0x7f627559c800) [pid = 3347] [serial = 1342] [outer = 0x7f62754cb000] 11:56:03 INFO - MEMORY STAT | vsize 704MB | residentFast 134MB | heapAllocated 40MB 11:56:03 INFO - 1117 INFO TEST-OK | layout/style/test/test_unprefixing_service.html | took 8932ms 11:56:03 INFO - ++DOMWINDOW == 13 (0x7f627dd38800) [pid = 3347] [serial = 1343] [outer = 0x7f6281591800] 11:56:03 INFO - 1118 INFO TEST-START | layout/style/test/test_unprefixing_service_prefs.html 11:56:03 INFO - ++DOMWINDOW == 14 (0x7f627dd39000) [pid = 3347] [serial = 1344] [outer = 0x7f6281591800] 11:56:03 INFO - ++DOCSHELL 0x7f627e583000 == 4 [pid = 3347] [id = 39] 11:56:03 INFO - ++DOMWINDOW == 15 (0x7f627dd3c800) [pid = 3347] [serial = 1345] [outer = (nil)] 11:56:03 INFO - ++DOMWINDOW == 16 (0x7f627dd5b400) [pid = 3347] [serial = 1346] [outer = 0x7f627dd3c800] 11:56:04 INFO - ++DOMWINDOW == 17 (0x7f62756f0c00) [pid = 3347] [serial = 1347] [outer = 0x7f627dd3c800] 11:56:04 INFO - ++DOMWINDOW == 18 (0x7f62757fa400) [pid = 3347] [serial = 1348] [outer = 0x7f627dd3c800] 11:56:05 INFO - ++DOMWINDOW == 19 (0x7f627e0dcc00) [pid = 3347] [serial = 1349] [outer = 0x7f627dd3c800] 11:56:05 INFO - ++DOMWINDOW == 20 (0x7f627dd5b800) [pid = 3347] [serial = 1350] [outer = 0x7f627dd3c800] 11:56:06 INFO - ++DOMWINDOW == 21 (0x7f62756f2c00) [pid = 3347] [serial = 1351] [outer = 0x7f627dd3c800] 11:56:06 INFO - MEMORY STAT | vsize 705MB | residentFast 144MB | heapAllocated 47MB 11:56:06 INFO - 1119 INFO TEST-OK | layout/style/test/test_unprefixing_service_prefs.html | took 3242ms 11:56:07 INFO - ++DOMWINDOW == 22 (0x7f627dd38c00) [pid = 3347] [serial = 1352] [outer = 0x7f6281591800] 11:56:07 INFO - 1120 INFO TEST-START | layout/style/test/test_value_cloning.html 11:56:07 INFO - ++DOMWINDOW == 23 (0x7f62754c9800) [pid = 3347] [serial = 1353] [outer = 0x7f6281591800] 11:56:07 INFO - ++DOCSHELL 0x7f628050a000 == 5 [pid = 3347] [id = 40] 11:56:07 INFO - ++DOMWINDOW == 24 (0x7f62772df400) [pid = 3347] [serial = 1354] [outer = (nil)] 11:56:07 INFO - [Child 3347] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9245 11:56:07 INFO - ++DOMWINDOW == 25 (0x7f62756f5c00) [pid = 3347] [serial = 1355] [outer = 0x7f62772df400] 11:56:09 INFO - ++DOMWINDOW == 26 (0x7f62754c6400) [pid = 3347] [serial = 1356] [outer = 0x7f62772df400] 11:56:09 INFO - --DOCSHELL 0x7f6278dd2800 == 4 [pid = 3347] [id = 38] 11:56:09 INFO - --DOCSHELL 0x7f627e583000 == 3 [pid = 3347] [id = 39] 11:56:12 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:12 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:12 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:12 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:13 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:13 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:23 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:23 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:23 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:23 INFO - [Child 3347] WARNING: We shouldn't be backing up more than once! Someone must have set a break opportunity beyond the available width, even though there were better break opportunities before it: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsBlockFrame.cpp, line 3909 11:56:43 INFO - MEMORY STAT | vsize 961MB | residentFast 456MB | heapAllocated 357MB 11:56:44 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:56:44 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:56:44 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:56:44 INFO - 1121 INFO TEST-OK | layout/style/test/test_value_cloning.html | took 37362ms 11:56:45 INFO - ++DOMWINDOW == 27 (0x7f62755ae400) [pid = 3347] [serial = 1357] [outer = 0x7f6281591800] 11:56:45 INFO - 1122 INFO TEST-START | layout/style/test/test_value_computation.html 11:56:45 INFO - ++DOMWINDOW == 28 (0x7f6275c5f400) [pid = 3347] [serial = 1358] [outer = 0x7f6281591800] 11:56:45 INFO - ++DOCSHELL 0x7f6278dc4800 == 4 [pid = 3347] [id = 41] 11:56:45 INFO - ++DOMWINDOW == 29 (0x7f6275c61400) [pid = 3347] [serial = 1359] [outer = (nil)] 11:56:45 INFO - ++DOCSHELL 0x7f6278dc9000 == 5 [pid = 3347] [id = 42] 11:56:45 INFO - ++DOMWINDOW == 30 (0x7f6275f2fc00) [pid = 3347] [serial = 1360] [outer = (nil)] 11:56:45 INFO - ++DOMWINDOW == 31 (0x7f6275f2d800) [pid = 3347] [serial = 1361] [outer = 0x7f6275c61400] 11:56:45 INFO - ++DOMWINDOW == 32 (0x7f6275f32000) [pid = 3347] [serial = 1362] [outer = 0x7f6275f2fc00] 11:56:47 INFO - --DOMWINDOW == 31 (0x7f627dd3c800) [pid = 3347] [serial = 1345] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?4#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 30 (0x7f62754cb000) [pid = 3347] [serial = 1335] [outer = (nil)] [url = http://sub1.test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?5#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 29 (0x7f627dd38800) [pid = 3347] [serial = 1343] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:47 INFO - --DOMWINDOW == 28 (0x7f627dd5b400) [pid = 3347] [serial = 1346] [outer = (nil)] [url = about:blank] 11:56:47 INFO - --DOMWINDOW == 27 (0x7f627dd38c00) [pid = 3347] [serial = 1352] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:56:47 INFO - --DOMWINDOW == 26 (0x7f6275c92800) [pid = 3347] [serial = 1339] [outer = (nil)] [url = http://test2.example.org/tests/layout/style/test/unprefixing_service_iframe.html?2#expectEnabled] 11:56:47 INFO - --DOMWINDOW == 25 (0x7f6275c8cc00) [pid = 3347] [serial = 1338] [outer = (nil)] [url = http://sub1.test2.example.org/tests/layout/style/test/unprefixing_service_iframe.html?1#expectEnabled] 11:56:47 INFO - --DOMWINDOW == 24 (0x7f627559c800) [pid = 3347] [serial = 1342] [outer = (nil)] [url = http://sub1.test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?5#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 23 (0x7f6276105400) [pid = 3347] [serial = 1341] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/unprefixing_service_iframe.html?4#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 22 (0x7f6275561000) [pid = 3347] [serial = 1340] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?3#expectEnabled] 11:56:47 INFO - --DOMWINDOW == 21 (0x7f62757fa400) [pid = 3347] [serial = 1348] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?1#expectEnabled] 11:56:47 INFO - --DOMWINDOW == 20 (0x7f62756f0c00) [pid = 3347] [serial = 1347] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?0#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 19 (0x7f627dd5b800) [pid = 3347] [serial = 1350] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?3#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 18 (0x7f627e0dcc00) [pid = 3347] [serial = 1349] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?2#expectDisabled] 11:56:47 INFO - --DOMWINDOW == 17 (0x7f6275c8dc00) [pid = 3347] [serial = 1337] [outer = (nil)] [url = http://sub2.test2.example.org/tests/layout/style/test/unprefixing_service_iframe.html?0#expectEnabled] 11:56:47 INFO - --DOMWINDOW == 16 (0x7f62756f2c00) [pid = 3347] [serial = 1351] [outer = (nil)] [url = http://test1.example.org/tests/layout/style/test/unprefixing_service_iframe.html?4#expectDisabled] 11:56:48 INFO - [Child 3347] WARNING: XBL doc with no root element - this usually shouldn't happen: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/xbl/nsXBLService.cpp, line 333 11:56:49 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:56:51 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:56:55 INFO - --DOCSHELL 0x7f628050a000 == 4 [pid = 3347] [id = 40] 11:56:55 INFO - --DOMWINDOW == 15 (0x7f62755b7000) [pid = 3347] [serial = 1334] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_unprefixing_service.html] 11:56:55 INFO - --DOMWINDOW == 14 (0x7f62754cb800) [pid = 3347] [serial = 1324] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_unicode_range_loading.html] 11:56:55 INFO - --DOMWINDOW == 13 (0x7f627dd39000) [pid = 3347] [serial = 1344] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_unprefixing_service_prefs.html] 11:56:58 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:56:58 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:56:58 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:56:58 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:56:58 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:56:58 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:56:58 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:56:58 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:56:58 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:56:58 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:56:58 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:56:58 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:56:58 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:56:58 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:56:58 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:56:58 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:56:58 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:56:58 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:56:58 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:56:58 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:56:58 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:56:58 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:56:58 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:56:58 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:56:58 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:56:58 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:56:58 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:56:58 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:56:58 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:56:58 INFO - #35: ??? (???:???) 11:56:58 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:56:58 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:56:58 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:56:58 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:56:58 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:56:58 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:56:58 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:56:58 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:56:58 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:56:58 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:56:58 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:56:58 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:56:58 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:56:58 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:56:58 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:56:58 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:56:58 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:56:58 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:56:58 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:56:58 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:56:58 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:56:58 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:56:58 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:56:58 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:56:58 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:56:58 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:56:58 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:56:58 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:56:58 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:56:58 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:56:58 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:56:58 INFO - #35: ??? (???:???) 11:57:01 INFO - --DOMWINDOW == 12 (0x7f62754c6400) [pid = 3347] [serial = 1356] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%0A%3Clink%20rel%3D%27stylesheet%27%20type%3D%27text/css%27%20href%3D%27data%3Atext/css%2C%2523parent0%252C%2520%2523test0%2520%257B%2520%2520%257D%2523parent0%2520%257B%2520%257D%2523test0%2520%257B%2520-webkit-user-select%253A%2520-moz-none%257D%2523parent1%252C%2520%2523test1%2520%257B%2520%2520%257D%2523parent1%2520%257B%2520%257D%2523test1%2520%257B%2520-webkit-user-select%253A%2520-moz-all%257D%2523parent2%252C%2520%2523test2%2520%257B%2520%2520%257D%2523parent2%2520%257B%2520%257D%2523test2%2520%257B%2520-webkit-user-select%253A%2520tri-state%257D%2523parent3%252C%2520%2523test3%2520%257B%2520%2520%257D%2523parent3%2520%257B%2520%257D%2523test3%2520%257B%2520-webkit-user-select%253A%2520toggle%257D%2523parent4%252C%2520%2523test4%2520%257B%2520%2520%257D%2523parent4%2520%257B%2520%257D%2523test4%2520%257B%2520-webkit-user-select%253A%2520all%257D%2523parent5%252C%2520%2523test5%2520%257B%2520%2520%257D%2523parent5%2520%257B%2520%257D%2523tes] 11:57:01 INFO - --DOMWINDOW == 11 (0x7f62755ae400) [pid = 3347] [serial = 1357] [outer = (nil)] [url = http://mochi.test:8888/tests/SimpleTest/iframe-between-tests.html] 11:57:01 INFO - --DOMWINDOW == 10 (0x7f62772df400) [pid = 3347] [serial = 1354] [outer = (nil)] [url = data:text/html,%3C%21DOCTYPE%20HTML%3E%0A%3Clink%20rel%3D%27stylesheet%27%20type%3D%27text/css%27%20href%3D%27data%3Atext/css%2C%2523parent0%252C%2520%2523test0%2520%257B%2520%2520%257D%2523parent0%2520%257B%2520%257D%2523test0%2520%257B%2520-webkit-user-select%253A%2520-moz-none%257D%2523parent1%252C%2520%2523test1%2520%257B%2520%2520%257D%2523parent1%2520%257B%2520%257D%2523test1%2520%257B%2520-webkit-user-select%253A%2520-moz-all%257D%2523parent2%252C%2520%2523test2%2520%257B%2520%2520%257D%2523parent2%2520%257B%2520%257D%2523test2%2520%257B%2520-webkit-user-select%253A%2520tri-state%257D%2523parent3%252C%2520%2523test3%2520%257B%2520%2520%257D%2523parent3%2520%257B%2520%257D%2523test3%2520%257B%2520-webkit-user-select%253A%2520toggle%257D%2523parent4%252C%2520%2523test4%2520%257B%2520%2520%257D%2523parent4%2520%257B%2520%257D%2523test4%2520%257B%2520-webkit-user-select%253A%2520all%257D%2523parent5%252C%2520%2523test5%2520%257B%2520%2520%257D%2523parent5%2520%257B%2520%257D%2523tes] 11:57:01 INFO - --DOMWINDOW == 9 (0x7f62756f5c00) [pid = 3347] [serial = 1355] [outer = (nil)] [url = about:blank] 11:57:05 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:05 INFO - --DOMWINDOW == 8 (0x7f62754c9800) [pid = 3347] [serial = 1353] [outer = (nil)] [url = http://mochi.test:8888/tests/layout/style/test/test_value_cloning.html] 11:57:14 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:14 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:18 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:18 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:18 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:19 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:19 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:19 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:19 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:19 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:19 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:19 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:19 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:19 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:19 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:19 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:19 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:19 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:19 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:19 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:19 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:19 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:19 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:19 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:19 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:19 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:19 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:19 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:19 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:19 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:19 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:19 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:19 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:19 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:19 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:19 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:19 INFO - #39: ??? (???:???) 11:57:35 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:41 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:41 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:41 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:41 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:41 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:41 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:41 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:41 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:41 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:41 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:41 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:41 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:41 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:41 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:41 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:41 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:41 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:41 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:41 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:41 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:41 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:41 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:41 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:41 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:41 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:41 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:41 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:41 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:41 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:41 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:41 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:41 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:41 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:41 INFO - #39: ??? (???:???) 11:57:41 INFO - [Child 3347] ###!!! ASSERTION: bad inline size: 'metrics.ISize(lineWM) >= 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsLineLayout.cpp, line 1022 11:57:41 INFO - #01: nsBlockFrame::ReflowInlineFrame(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsIFrame*, LineReflowStatus*) [layout/generic/nsBlockFrame.cpp:4053] 11:57:41 INFO - #02: nsBlockFrame::DoReflowInlineFrames(nsBlockReflowState&, nsLineLayout&, nsLineList_iterator, nsFlowAreaRect&, int&, nsFloatManager::SavedState*, bool*, LineReflowStatus*, bool) [layout/generic/nsBlockFrame.cpp:3854] 11:57:41 INFO - #03: nsBlockFrame::ReflowInlineFrames(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3723] 11:57:41 INFO - #04: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2729] 11:57:41 INFO - #05: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #06: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #07: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:41 INFO - #08: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:41 INFO - #09: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:41 INFO - #10: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #11: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #12: nsBlockReflowContext::ReflowBlock(mozilla::LogicalRect const&, bool, nsCollapsingMargin&, int, bool, nsLineBox*, nsHTMLReflowState&, unsigned int&, nsBlockReflowState&) [layout/generic/nsBlockReflowContext.cpp:307] 11:57:41 INFO - #13: nsBlockFrame::ReflowBlockFrame(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:3372] 11:57:41 INFO - #14: nsBlockFrame::ReflowLine(nsBlockReflowState&, nsLineList_iterator, bool*) [layout/generic/nsBlockFrame.cpp:2724] 11:57:41 INFO - #15: nsBlockFrame::ReflowDirtyLines(nsBlockReflowState&) [layout/generic/nsColumnSetFrame.cpp:1169] 11:57:41 INFO - #16: nsBlockFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsBlockFrame.cpp:1180] 11:57:41 INFO - #17: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:41 INFO - #18: nsCanvasFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsCanvasFrame.cpp:591] 11:57:41 INFO - #19: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, mozilla::WritingMode const&, mozilla::LogicalPoint const&, nsSize const&, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:994] 11:57:41 INFO - #20: nsHTMLScrollFrame::ReflowScrolledFrame(ScrollReflowState*, bool, bool, nsHTMLReflowMetrics*, bool) [layout/generic/nsGfxScrollFrame.cpp:534] 11:57:41 INFO - #21: nsHTMLScrollFrame::ReflowContents(ScrollReflowState*, nsHTMLReflowMetrics const&) [layout/generic/nsGfxScrollFrame.cpp:664] 11:57:41 INFO - #22: nsHTMLScrollFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsGfxScrollFrame.cpp:882] 11:57:41 INFO - #23: nsContainerFrame::ReflowChild(nsIFrame*, nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, int, int, unsigned int, unsigned int&, nsOverflowContinuationTracker*) [layout/generic/nsContainerFrame.cpp:1036] 11:57:41 INFO - #24: ViewportFrame::Reflow(nsPresContext*, nsHTMLReflowMetrics&, nsHTMLReflowState const&, unsigned int&) [layout/generic/nsViewportFrame.cpp:311] 11:57:41 INFO - #25: PresShell::DoReflow(nsIFrame*, bool) [layout/generic/nsHTMLReflowMetrics.h:273] 11:57:41 INFO - #26: PresShell::ProcessReflowCommands(bool) [layout/base/nsPresShell.cpp:9040] 11:57:41 INFO - #27: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4023] 11:57:41 INFO - #28: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3864] 11:57:41 INFO - #29: nsDocument::FlushPendingNotifications(mozFlushType) [dom/base/nsDocument.cpp:8145] 11:57:41 INFO - #30: nsComputedDOMStyle::UpdateCurrentStyleSources(bool) [layout/style/nsComputedDOMStyle.cpp:642] 11:57:41 INFO - #31: nsComputedDOMStyle::GetPropertyCSSValue(nsAString_internal const&, mozilla::ErrorResult&) [layout/style/nsComputedDOMStyle.cpp:801] 11:57:41 INFO - #32: nsComputedDOMStyle::GetPropertyValue(nsAString_internal const&, nsAString_internal&) [mfbt/AlreadyAddRefed.h:116] 11:57:41 INFO - #33: mozilla::dom::CSSStyleDeclarationBinding::getPropertyValue [dom/bindings/ErrorResult.h:264] 11:57:41 INFO - #34: mozilla::dom::GenericBindingMethod(JSContext*, unsigned int, JS::Value*) [dom/bindings/BindingUtils.cpp:2720] 11:57:41 INFO - #35: js::CallJSNative(JSContext*, bool (*)(JSContext*, unsigned int, JS::Value*), JS::CallArgs const&) [js/src/jscntxtinlines.h:236] 11:57:41 INFO - #36: js::Invoke(JSContext*, JS::CallArgs const&, js::MaybeConstruct) [js/src/vm/Interpreter.cpp:460] 11:57:41 INFO - #37: js::Invoke(JSContext*, JS::Value const&, JS::Value const&, unsigned int, JS::Value const*, JS::MutableHandle) [js/src/vm/Interpreter.cpp:512] 11:57:41 INFO - #38: js::jit::InvokeFunction(JSContext*, JS::Handle, bool, unsigned int, JS::Value*, JS::MutableHandle) [js/public/RootingAPI.h:719] 11:57:41 INFO - #39: ??? (???:???) 11:57:55 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 11:57:56 INFO - MEMORY STAT | vsize 825MB | residentFast 201MB | heapAllocated 99MB 11:57:56 INFO - 1123 INFO TEST-OK | layout/style/test/test_value_computation.html | took 71258ms 11:57:57 INFO - ++DOMWINDOW == 9 (0x7f6275da3000) [pid = 3347] [serial = 1363] [outer = 0x7f6281591800] 11:57:57 INFO - 1124 INFO TEST-ERROR | layout/style/test/test_value_computation.html | 11:57:57 INFO - 1125 INFO TEST-START | layout/style/test/test_value_storage.html 11:57:57 INFO - ++DOMWINDOW == 10 (0x7f6275da3400) [pid = 3347] [serial = 1364] [outer = 0x7f6281591800] 11:57:57 INFO - --DOCSHELL 0x7f6278dc4800 == 3 [pid = 3347] [id = 41] 11:57:57 INFO - --DOCSHELL 0x7f6278dc9000 == 2 [pid = 3347] [id = 42] 11:58:06 INFO - [Child 3347] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 remoteFailed: [Failure instance: Traceback (failure with no frames): : Connection to the other side was lost in a non-clean fashion. ] [Failure instance: Traceback (failure with no frames): : Connection to the other side was lost in a non-clean fashion. ] ========= Finished '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' interrupted (results: 5, elapsed: 34 mins, 33 secs) (at 2015-12-31 12:01:11.455223) ========= ========= Skipped (results: not started, elapsed: not started) ========= ========= Skipped (results: not started, elapsed: not started) ========= ========= Skipped (results: not started, elapsed: not started) ========= ========= Total master_lag: 0.36 =========